diff --git a/docs/config.md b/docs/config.md index 55a048388a..daff3e3464 100644 --- a/docs/config.md +++ b/docs/config.md @@ -74,9 +74,11 @@ Supported keys include: | `artifacts.pipelinerun.format` | The format to store `PipelineRun` payloads in. | `in-toto`, `slsa/v1`| `in-toto` | | `artifacts.pipelinerun.storage` | The storage backend to store `PipelineRun` signatures in. Multiple backends can be specified with comma-separated list ("tekton,oci"). To disable the `PipelineRun` artifact input an empty string (""). | `tekton`, `oci`, `gcs`, `docdb`, `grafeas` | `tekton` | | `artifacts.pipelinerun.signer` | The signature backend to sign `PipelineRun` payloads with. | `x509`, `kms` | `x509` | +| `artifacts.pipelinerun.enable-deep-inspection` | This boolean option will configure whether Chains should inspect child taskruns in order to capture inputs/outputs within a pipelinerun. `"false"` means that Chains only checks pipeline level results, whereas `"true"` means Chains inspects both pipeline level and task level results. | `"true"`, `"false"` | `"false"` | -> NOTE: For grafeas storage backend, currently we only support Container Analysis. We will make grafeas server address configurabe within a short time. -> NOTE: `slsa/v1` is an alias of `in-toto` for backwards compatibility. +> NOTE: +> - For grafeas storage backend, currently we only support Container Analysis. We will make grafeas server address configurabe within a short time. +> - `slsa/v1` is an alias of `in-toto` for backwards compatibility. ### OCI Configuration diff --git a/go.mod b/go.mod index 5e9b2e0cfd..98293f669b 100644 --- a/go.mod +++ b/go.mod @@ -29,11 +29,11 @@ require ( github.com/tektoncd/pipeline v0.50.0 github.com/tektoncd/plumbing v0.0.0-20221102182345-5dbcfda657d7 go.uber.org/zap v1.24.0 - gocloud.dev v0.32.0 - gocloud.dev/docstore/mongodocstore v0.30.0 + gocloud.dev v0.33.0 + gocloud.dev/docstore/mongodocstore v0.33.0 gocloud.dev/pubsub/kafkapubsub v0.32.0 golang.org/x/crypto v0.11.0 - google.golang.org/grpc v1.56.2 + google.golang.org/grpc v1.57.0 google.golang.org/protobuf v1.31.0 k8s.io/api v0.27.3 k8s.io/apimachinery v0.27.3 @@ -46,11 +46,11 @@ require ( require ( 4d63.com/gocheckcompilerdirectives v1.2.1 // indirect 4d63.com/gochecknoglobals v0.2.1 // indirect - cloud.google.com/go v0.110.6 // indirect - cloud.google.com/go/compute v1.22.0 // indirect - cloud.google.com/go/firestore v1.11.0 // indirect + cloud.google.com/go v0.110.7 // indirect + cloud.google.com/go/compute v1.23.0 // indirect + cloud.google.com/go/firestore v1.12.0 // indirect cloud.google.com/go/iam v1.1.1 // indirect - cloud.google.com/go/kms v1.14.0 // indirect + cloud.google.com/go/kms v1.15.0 // indirect cloud.google.com/go/longrunning v0.5.1 // indirect contrib.go.opencensus.io/exporter/ocagent v0.7.1-0.20200907061046-05415f1de66d // indirect contrib.go.opencensus.io/exporter/prometheus v0.4.0 // indirect @@ -101,22 +101,22 @@ require ( github.com/asaskevich/govalidator v0.0.0-20230301143203-a9d515a09cc2 // indirect github.com/ashanbrown/forbidigo v1.5.3 // indirect github.com/ashanbrown/makezero v1.1.1 // indirect - github.com/aws/aws-sdk-go v1.44.303 // indirect - github.com/aws/aws-sdk-go-v2 v1.19.0 // indirect - github.com/aws/aws-sdk-go-v2/config v1.18.28 // indirect - github.com/aws/aws-sdk-go-v2/credentials v1.13.27 // indirect - github.com/aws/aws-sdk-go-v2/feature/ec2/imds v1.13.5 // indirect - github.com/aws/aws-sdk-go-v2/internal/configsources v1.1.35 // indirect - github.com/aws/aws-sdk-go-v2/internal/endpoints/v2 v2.4.29 // indirect - github.com/aws/aws-sdk-go-v2/internal/ini v1.3.36 // indirect + github.com/aws/aws-sdk-go v1.44.314 // indirect + github.com/aws/aws-sdk-go-v2 v1.20.0 // indirect + github.com/aws/aws-sdk-go-v2/config v1.18.32 // indirect + github.com/aws/aws-sdk-go-v2/credentials v1.13.31 // indirect + github.com/aws/aws-sdk-go-v2/feature/ec2/imds v1.13.7 // indirect + github.com/aws/aws-sdk-go-v2/internal/configsources v1.1.37 // indirect + github.com/aws/aws-sdk-go-v2/internal/endpoints/v2 v2.4.31 // indirect + github.com/aws/aws-sdk-go-v2/internal/ini v1.3.38 // indirect github.com/aws/aws-sdk-go-v2/service/ecr v1.18.11 // indirect github.com/aws/aws-sdk-go-v2/service/ecrpublic v1.16.2 // indirect - github.com/aws/aws-sdk-go-v2/service/internal/presigned-url v1.9.29 // indirect - github.com/aws/aws-sdk-go-v2/service/kms v1.23.1 // indirect - github.com/aws/aws-sdk-go-v2/service/sso v1.12.13 // indirect - github.com/aws/aws-sdk-go-v2/service/ssooidc v1.14.13 // indirect - github.com/aws/aws-sdk-go-v2/service/sts v1.19.3 // indirect - github.com/aws/smithy-go v1.13.5 // indirect + github.com/aws/aws-sdk-go-v2/service/internal/presigned-url v1.9.31 // indirect + github.com/aws/aws-sdk-go-v2/service/kms v1.24.1 // indirect + github.com/aws/aws-sdk-go-v2/service/sso v1.13.1 // indirect + github.com/aws/aws-sdk-go-v2/service/ssooidc v1.15.1 // indirect + github.com/aws/aws-sdk-go-v2/service/sts v1.21.1 // indirect + github.com/aws/smithy-go v1.14.0 // indirect github.com/awslabs/amazon-ecr-credential-helper/ecr-login v0.0.0-20230510185313-f5e39e5f34c7 // indirect github.com/benbjohnson/clock v1.3.0 // indirect github.com/beorn7/perks v1.0.1 // indirect @@ -388,7 +388,7 @@ require ( github.com/youmark/pkcs8 v0.0.0-20201027041543-1326539a0a0a // indirect github.com/zeebo/errs v1.3.0 // indirect gitlab.com/bosi/decorder v0.2.3 // indirect - go.mongodb.org/mongo-driver v1.11.7 // indirect + go.mongodb.org/mongo-driver v1.12.0 // indirect go.opencensus.io v0.24.0 // indirect go.opentelemetry.io/otel v1.16.0 // indirect go.opentelemetry.io/otel/metric v1.16.0 // indirect @@ -401,7 +401,7 @@ require ( golang.org/x/exp v0.0.0-20230510235704-dd950f8aeaea // indirect golang.org/x/exp/typeparams v0.0.0-20230224173230-c95f2b4c22f2 // indirect golang.org/x/mod v0.11.0 // indirect - golang.org/x/net v0.12.0 // indirect + golang.org/x/net v0.13.0 // indirect golang.org/x/oauth2 v0.10.0 // indirect golang.org/x/sync v0.3.0 // indirect golang.org/x/sys v0.10.0 // indirect @@ -411,11 +411,11 @@ require ( golang.org/x/tools v0.9.3 // indirect golang.org/x/xerrors v0.0.0-20220907171357-04be3eba64a2 // indirect gomodules.xyz/jsonpatch/v2 v2.2.0 // indirect - google.golang.org/api v0.132.0 // indirect + google.golang.org/api v0.134.0 // indirect google.golang.org/appengine v1.6.7 // indirect - google.golang.org/genproto v0.0.0-20230717213848-3f92550aa753 // indirect - google.golang.org/genproto/googleapis/api v0.0.0-20230717213848-3f92550aa753 // indirect - google.golang.org/genproto/googleapis/rpc v0.0.0-20230717213848-3f92550aa753 // indirect + google.golang.org/genproto v0.0.0-20230731193218-e0aa005b6bdf // indirect + google.golang.org/genproto/googleapis/api v0.0.0-20230731193218-e0aa005b6bdf // indirect + google.golang.org/genproto/googleapis/rpc v0.0.0-20230731193218-e0aa005b6bdf // indirect gopkg.in/inf.v0 v0.9.1 // indirect gopkg.in/ini.v1 v1.67.0 // indirect gopkg.in/square/go-jose.v2 v2.6.0 // indirect diff --git a/go.sum b/go.sum index c86a2ac16d..40e4627a8e 100644 --- a/go.sum +++ b/go.sum @@ -3,7 +3,6 @@ 4d63.com/gochecknoglobals v0.2.1 h1:1eiorGsgHOFOuoOiJDy2psSrQbRdIHrlge0IJIkUgDc= 4d63.com/gochecknoglobals v0.2.1/go.mod h1:KRE8wtJB3CXCsb1xy421JfTHIIbmT3U5ruxw2Qu8fSU= bazil.org/fuse v0.0.0-20160811212531-371fbbdaa898/go.mod h1:Xbm+BRKSBEpa4q4hTSxohYNQpsxXPbPry4JJWOB3LB8= -bazil.org/fuse v0.0.0-20200407214033-5883e5a4b512/go.mod h1:FbcW6z/2VytnFDhZfumh8Ss8zxHE6qpMP5sHTRe0EaM= cloud.google.com/go v0.26.0/go.mod h1:aQUYkXzVsufM+DwF1aE+0xfcU+56JwCaLick0ClmMTw= cloud.google.com/go v0.34.0/go.mod h1:aQUYkXzVsufM+DwF1aE+0xfcU+56JwCaLick0ClmMTw= cloud.google.com/go v0.38.0/go.mod h1:990N+gfupTy94rShfmMCWGDn0LpTmnzTp2qbd1dvSRU= @@ -35,525 +34,45 @@ cloud.google.com/go v0.93.3/go.mod h1:8utlLll2EF5XMAV15woO4lSbWQlk8rer9aLOfLh7+Y cloud.google.com/go v0.94.1/go.mod h1:qAlAugsXlC+JWO+Bke5vCtc9ONxjQT3drlTTnAplMW4= cloud.google.com/go v0.97.0/go.mod h1:GF7l59pYBVlXQIBLx3a761cZ41F9bBH3JUlihCt2Udc= cloud.google.com/go v0.99.0/go.mod h1:w0Xx2nLzqWJPuozYQX+hFfCSI8WioryfRDzkoI/Y2ZA= -cloud.google.com/go v0.100.1/go.mod h1:fs4QogzfH5n2pBXBP9vRiU+eCny7lD2vmFZy79Iuw1U= cloud.google.com/go v0.100.2/go.mod h1:4Xra9TjzAeYHrl5+oeLlzbM2k3mjVhZh4UqTZ//w99A= cloud.google.com/go v0.102.0/go.mod h1:oWcCzKlqJ5zgHQt9YsaeTY9KzIvjyy0ArmiBUgpQ+nc= cloud.google.com/go v0.102.1/go.mod h1:XZ77E9qnTEnrgEOvr4xzfdX5TRo7fB4T2F4O6+34hIU= -cloud.google.com/go v0.104.0/go.mod h1:OO6xxXdJyvuJPcEPBLN9BJPD+jep5G1+2U5B5gkRYtA= -cloud.google.com/go v0.105.0/go.mod h1:PrLgOJNe5nfE9UMxKxgXj4mD3voiP+YQ6gdt6KMFOKM= -cloud.google.com/go v0.107.0/go.mod h1:wpc2eNrD7hXUTy8EKS10jkxpZBjASrORK7goS+3YX2I= -cloud.google.com/go v0.110.0/go.mod h1:SJnCLqQ0FCFGSZMUNUf84MV3Aia54kn7pi8st7tMzaY= -cloud.google.com/go v0.110.2/go.mod h1:k04UEeEtb6ZBRTv3dZz4CeJC3jKGxyhl0sAiVVquxiw= -cloud.google.com/go v0.110.6 h1:8uYAkj3YHTP/1iwReuHPxLSbdcyc+dSBbzFMrVwDR6Q= -cloud.google.com/go v0.110.6/go.mod h1:+EYjdK8e5RME/VY/qLCAtuyALQ9q67dvuum8i+H5xsI= -cloud.google.com/go/accessapproval v1.4.0/go.mod h1:zybIuC3KpDOvotz59lFe5qxRZx6C75OtwbisN56xYB4= -cloud.google.com/go/accessapproval v1.5.0/go.mod h1:HFy3tuiGvMdcd/u+Cu5b9NkO1pEICJ46IR82PoUdplw= -cloud.google.com/go/accessapproval v1.6.0/go.mod h1:R0EiYnwV5fsRFiKZkPHr6mwyk2wxUJ30nL4j2pcFY2E= -cloud.google.com/go/accesscontextmanager v1.3.0/go.mod h1:TgCBehyr5gNMz7ZaH9xubp+CE8dkrszb4oK9CWyvD4o= -cloud.google.com/go/accesscontextmanager v1.4.0/go.mod h1:/Kjh7BBu/Gh83sv+K60vN9QE5NJcd80sU33vIe2IFPE= -cloud.google.com/go/accesscontextmanager v1.6.0/go.mod h1:8XCvZWfYw3K/ji0iVnp+6pu7huxoQTLmxAbVjbloTtM= -cloud.google.com/go/accesscontextmanager v1.7.0/go.mod h1:CEGLewx8dwa33aDAZQujl7Dx+uYhS0eay198wB/VumQ= -cloud.google.com/go/aiplatform v1.22.0/go.mod h1:ig5Nct50bZlzV6NvKaTwmplLLddFx0YReh9WfTO5jKw= -cloud.google.com/go/aiplatform v1.24.0/go.mod h1:67UUvRBKG6GTayHKV8DBv2RtR1t93YRu5B1P3x99mYY= -cloud.google.com/go/aiplatform v1.27.0/go.mod h1:Bvxqtl40l0WImSb04d0hXFU7gDOiq9jQmorivIiWcKg= -cloud.google.com/go/aiplatform v1.35.0/go.mod h1:7MFT/vCaOyZT/4IIFfxH4ErVg/4ku6lKv3w0+tFTgXQ= -cloud.google.com/go/aiplatform v1.36.1/go.mod h1:WTm12vJRPARNvJ+v6P52RDHCNe4AhvjcIZ/9/RRHy/k= -cloud.google.com/go/aiplatform v1.37.0/go.mod h1:IU2Cv29Lv9oCn/9LkFiiuKfwrRTq+QQMbW+hPCxJGZw= -cloud.google.com/go/analytics v0.11.0/go.mod h1:DjEWCu41bVbYcKyvlws9Er60YE4a//bK6mnhWvQeFNI= -cloud.google.com/go/analytics v0.12.0/go.mod h1:gkfj9h6XRf9+TS4bmuhPEShsh3hH8PAZzm/41OOhQd4= -cloud.google.com/go/analytics v0.17.0/go.mod h1:WXFa3WSym4IZ+JiKmavYdJwGG/CvpqiqczmL59bTD9M= -cloud.google.com/go/analytics v0.18.0/go.mod h1:ZkeHGQlcIPkw0R/GW+boWHhCOR43xz9RN/jn7WcqfIE= -cloud.google.com/go/analytics v0.19.0/go.mod h1:k8liqf5/HCnOUkbawNtrWWc+UAzyDlW89doe8TtoDsE= -cloud.google.com/go/apigateway v1.3.0/go.mod h1:89Z8Bhpmxu6AmUxuVRg/ECRGReEdiP3vQtk4Z1J9rJk= -cloud.google.com/go/apigateway v1.4.0/go.mod h1:pHVY9MKGaH9PQ3pJ4YLzoj6U5FUDeDFBllIz7WmzJoc= -cloud.google.com/go/apigateway v1.5.0/go.mod h1:GpnZR3Q4rR7LVu5951qfXPJCHquZt02jf7xQx7kpqN8= -cloud.google.com/go/apigeeconnect v1.3.0/go.mod h1:G/AwXFAKo0gIXkPTVfZDd2qA1TxBXJ3MgMRBQkIi9jc= -cloud.google.com/go/apigeeconnect v1.4.0/go.mod h1:kV4NwOKqjvt2JYR0AoIWo2QGfoRtn/pkS3QlHp0Ni04= -cloud.google.com/go/apigeeconnect v1.5.0/go.mod h1:KFaCqvBRU6idyhSNyn3vlHXc8VMDJdRmwDF6JyFRqZ8= -cloud.google.com/go/apigeeregistry v0.4.0/go.mod h1:EUG4PGcsZvxOXAdyEghIdXwAEi/4MEaoqLMLDMIwKXY= -cloud.google.com/go/apigeeregistry v0.5.0/go.mod h1:YR5+s0BVNZfVOUkMa5pAR2xGd0A473vA5M7j247o1wM= -cloud.google.com/go/apigeeregistry v0.6.0/go.mod h1:BFNzW7yQVLZ3yj0TKcwzb8n25CFBri51GVGOEUcgQsc= -cloud.google.com/go/apikeys v0.4.0/go.mod h1:XATS/yqZbaBK0HOssf+ALHp8jAlNHUgyfprvNcBIszU= -cloud.google.com/go/apikeys v0.5.0/go.mod h1:5aQfwY4D+ewMMWScd3hm2en3hCj+BROlyrt3ytS7KLI= -cloud.google.com/go/apikeys v0.6.0/go.mod h1:kbpXu5upyiAlGkKrJgQl8A0rKNNJ7dQ377pdroRSSi8= -cloud.google.com/go/appengine v1.4.0/go.mod h1:CS2NhuBuDXM9f+qscZ6V86m1MIIqPj3WC/UoEuR1Sno= -cloud.google.com/go/appengine v1.5.0/go.mod h1:TfasSozdkFI0zeoxW3PTBLiNqRmzraodCWatWI9Dmak= -cloud.google.com/go/appengine v1.6.0/go.mod h1:hg6i0J/BD2cKmDJbaFSYHFyZkgBEfQrDg/X0V5fJn84= -cloud.google.com/go/appengine v1.7.0/go.mod h1:eZqpbHFCqRGa2aCdope7eC0SWLV1j0neb/QnMJVWx6A= -cloud.google.com/go/appengine v1.7.1/go.mod h1:IHLToyb/3fKutRysUlFO0BPt5j7RiQ45nrzEJmKTo6E= -cloud.google.com/go/area120 v0.5.0/go.mod h1:DE/n4mp+iqVyvxHN41Vf1CR602GiHQjFPusMFW6bGR4= -cloud.google.com/go/area120 v0.6.0/go.mod h1:39yFJqWVgm0UZqWTOdqkLhjoC7uFfgXRC8g/ZegeAh0= -cloud.google.com/go/area120 v0.7.0/go.mod h1:a3+8EUD1SX5RUcCs3MY5YasiO1z6yLiNLRiFrykbynY= -cloud.google.com/go/area120 v0.7.1/go.mod h1:j84i4E1RboTWjKtZVWXPqvK5VHQFJRF2c1Nm69pWm9k= -cloud.google.com/go/artifactregistry v1.6.0/go.mod h1:IYt0oBPSAGYj/kprzsBjZ/4LnG/zOcHyFHjWPCi6SAQ= -cloud.google.com/go/artifactregistry v1.7.0/go.mod h1:mqTOFOnGZx8EtSqK/ZWcsm/4U8B77rbcLP6ruDU2Ixk= -cloud.google.com/go/artifactregistry v1.8.0/go.mod h1:w3GQXkJX8hiKN0v+at4b0qotwijQbYUqF2GWkZzAhC0= -cloud.google.com/go/artifactregistry v1.9.0/go.mod h1:2K2RqvA2CYvAeARHRkLDhMDJ3OXy26h3XW+3/Jh2uYc= -cloud.google.com/go/artifactregistry v1.11.1/go.mod h1:lLYghw+Itq9SONbCa1YWBoWs1nOucMH0pwXN1rOBZFI= -cloud.google.com/go/artifactregistry v1.11.2/go.mod h1:nLZns771ZGAwVLzTX/7Al6R9ehma4WUEhZGWV6CeQNQ= -cloud.google.com/go/artifactregistry v1.12.0/go.mod h1:o6P3MIvtzTOnmvGagO9v/rOjjA0HmhJ+/6KAXrmYDCI= -cloud.google.com/go/artifactregistry v1.13.0/go.mod h1:uy/LNfoOIivepGhooAUpL1i30Hgee3Cu0l4VTWHUC08= -cloud.google.com/go/asset v1.5.0/go.mod h1:5mfs8UvcM5wHhqtSv8J1CtxxaQq3AdBxxQi2jGW/K4o= -cloud.google.com/go/asset v1.7.0/go.mod h1:YbENsRK4+xTiL+Ofoj5Ckf+O17kJtgp3Y3nn4uzZz5s= -cloud.google.com/go/asset v1.8.0/go.mod h1:mUNGKhiqIdbr8X7KNayoYvyc4HbbFO9URsjbytpUaW0= -cloud.google.com/go/asset v1.9.0/go.mod h1:83MOE6jEJBMqFKadM9NLRcs80Gdw76qGuHn8m3h8oHQ= -cloud.google.com/go/asset v1.10.0/go.mod h1:pLz7uokL80qKhzKr4xXGvBQXnzHn5evJAEAtZiIb0wY= -cloud.google.com/go/asset v1.11.1/go.mod h1:fSwLhbRvC9p9CXQHJ3BgFeQNM4c9x10lqlrdEUYXlJo= -cloud.google.com/go/asset v1.12.0/go.mod h1:h9/sFOa4eDIyKmH6QMpm4eUK3pDojWnUhTgJlk762Hg= -cloud.google.com/go/asset v1.13.0/go.mod h1:WQAMyYek/b7NBpYq/K4KJWcRqzoalEsxz/t/dTk4THw= -cloud.google.com/go/assuredworkloads v1.5.0/go.mod h1:n8HOZ6pff6re5KYfBXcFvSViQjDwxFkAkmUFffJRbbY= -cloud.google.com/go/assuredworkloads v1.6.0/go.mod h1:yo2YOk37Yc89Rsd5QMVECvjaMKymF9OP+QXWlKXUkXw= -cloud.google.com/go/assuredworkloads v1.7.0/go.mod h1:z/736/oNmtGAyU47reJgGN+KVoYoxeLBoj4XkKYscNI= -cloud.google.com/go/assuredworkloads v1.8.0/go.mod h1:AsX2cqyNCOvEQC8RMPnoc0yEarXQk6WEKkxYfL6kGIo= -cloud.google.com/go/assuredworkloads v1.9.0/go.mod h1:kFuI1P78bplYtT77Tb1hi0FMxM0vVpRC7VVoJC3ZoT0= -cloud.google.com/go/assuredworkloads v1.10.0/go.mod h1:kwdUQuXcedVdsIaKgKTp9t0UJkE5+PAVNhdQm4ZVq2E= -cloud.google.com/go/automl v1.5.0/go.mod h1:34EjfoFGMZ5sgJ9EoLsRtdPSNZLcfflJR39VbVNS2M0= -cloud.google.com/go/automl v1.6.0/go.mod h1:ugf8a6Fx+zP0D59WLhqgTDsQI9w07o64uf/Is3Nh5p8= -cloud.google.com/go/automl v1.7.0/go.mod h1:RL9MYCCsJEOmt0Wf3z9uzG0a7adTT1fe+aObgSpkCt8= -cloud.google.com/go/automl v1.8.0/go.mod h1:xWx7G/aPEe/NP+qzYXktoBSDfjO+vnKMGgsApGJJquM= -cloud.google.com/go/automl v1.12.0/go.mod h1:tWDcHDp86aMIuHmyvjuKeeHEGq76lD7ZqfGLN6B0NuU= -cloud.google.com/go/baremetalsolution v0.3.0/go.mod h1:XOrocE+pvK1xFfleEnShBlNAXf+j5blPPxrhjKgnIFc= -cloud.google.com/go/baremetalsolution v0.4.0/go.mod h1:BymplhAadOO/eBa7KewQ0Ppg4A4Wplbn+PsFKRLo0uI= -cloud.google.com/go/baremetalsolution v0.5.0/go.mod h1:dXGxEkmR9BMwxhzBhV0AioD0ULBmuLZI8CdwalUxuss= -cloud.google.com/go/batch v0.3.0/go.mod h1:TR18ZoAekj1GuirsUsR1ZTKN3FC/4UDnScjT8NXImFE= -cloud.google.com/go/batch v0.4.0/go.mod h1:WZkHnP43R/QCGQsZ+0JyG4i79ranE2u8xvjq/9+STPE= -cloud.google.com/go/batch v0.7.0/go.mod h1:vLZN95s6teRUqRQ4s3RLDsH8PvboqBK+rn1oevL159g= -cloud.google.com/go/beyondcorp v0.2.0/go.mod h1:TB7Bd+EEtcw9PCPQhCJtJGjk/7TC6ckmnSFS+xwTfm4= -cloud.google.com/go/beyondcorp v0.3.0/go.mod h1:E5U5lcrcXMsCuoDNyGrpyTm/hn7ne941Jz2vmksAxW8= -cloud.google.com/go/beyondcorp v0.4.0/go.mod h1:3ApA0mbhHx6YImmuubf5pyW8srKnCEPON32/5hj+RmM= -cloud.google.com/go/beyondcorp v0.5.0/go.mod h1:uFqj9X+dSfrheVp7ssLTaRHd2EHqSL4QZmH4e8WXGGU= +cloud.google.com/go v0.110.7 h1:rJyC7nWRg2jWGZ4wSJ5nY65GTdYJkg0cd/uXb+ACI6o= +cloud.google.com/go v0.110.7/go.mod h1:+EYjdK8e5RME/VY/qLCAtuyALQ9q67dvuum8i+H5xsI= cloud.google.com/go/bigquery v1.0.1/go.mod h1:i/xbL2UlR5RvWAURpBYZTtm/cXjCha9lbfbpx4poX+o= cloud.google.com/go/bigquery v1.3.0/go.mod h1:PjpwJnslEMmckchkHFfq+HTD2DmtT67aNFKH1/VBDHE= cloud.google.com/go/bigquery v1.4.0/go.mod h1:S8dzgnTigyfTmLBfrtrhyYhwRxG72rYxvftPBK2Dvzc= cloud.google.com/go/bigquery v1.5.0/go.mod h1:snEHRnqQbz117VIFhE8bmtwIDY80NLUZUMb4Nv6dBIg= cloud.google.com/go/bigquery v1.7.0/go.mod h1://okPTzCYNXSlb24MZs83e2Do+h+VXtc4gLoIoXIAPc= cloud.google.com/go/bigquery v1.8.0/go.mod h1:J5hqkt3O0uAFnINi6JXValWIb1v0goeZM77hZzJN/fQ= -cloud.google.com/go/bigquery v1.42.0/go.mod h1:8dRTJxhtG+vwBKzE5OseQn/hiydoQN3EedCaOdYmxRA= -cloud.google.com/go/bigquery v1.43.0/go.mod h1:ZMQcXHsl+xmU1z36G2jNGZmKp9zNY5BUua5wDgmNCfw= -cloud.google.com/go/bigquery v1.44.0/go.mod h1:0Y33VqXTEsbamHJvJHdFmtqHvMIY28aK1+dFsvaChGc= -cloud.google.com/go/bigquery v1.47.0/go.mod h1:sA9XOgy0A8vQK9+MWhEQTY6Tix87M/ZurWFIxmF9I/E= -cloud.google.com/go/bigquery v1.48.0/go.mod h1:QAwSz+ipNgfL5jxiaK7weyOhzdoAy1zFm0Nf1fysJac= -cloud.google.com/go/bigquery v1.49.0/go.mod h1:Sv8hMmTFFYBlt/ftw2uN6dFdQPzBlREY9yBh7Oy7/4Q= -cloud.google.com/go/bigquery v1.50.0/go.mod h1:YrleYEh2pSEbgTBZYMJ5SuSr0ML3ypjRB1zgf7pvQLU= -cloud.google.com/go/billing v1.4.0/go.mod h1:g9IdKBEFlItS8bTtlrZdVLWSSdSyFUZKXNS02zKMOZY= -cloud.google.com/go/billing v1.5.0/go.mod h1:mztb1tBc3QekhjSgmpf/CV4LzWXLzCArwpLmP2Gm88s= -cloud.google.com/go/billing v1.6.0/go.mod h1:WoXzguj+BeHXPbKfNWkqVtDdzORazmCjraY+vrxcyvI= -cloud.google.com/go/billing v1.7.0/go.mod h1:q457N3Hbj9lYwwRbnlD7vUpyjq6u5U1RAOArInEiD5Y= -cloud.google.com/go/billing v1.12.0/go.mod h1:yKrZio/eu+okO/2McZEbch17O5CB5NpZhhXG6Z766ss= -cloud.google.com/go/billing v1.13.0/go.mod h1:7kB2W9Xf98hP9Sr12KfECgfGclsH3CQR0R08tnRlRbc= -cloud.google.com/go/binaryauthorization v1.1.0/go.mod h1:xwnoWu3Y84jbuHa0zd526MJYmtnVXn0syOjaJgy4+dM= -cloud.google.com/go/binaryauthorization v1.2.0/go.mod h1:86WKkJHtRcv5ViNABtYMhhNWRrD1Vpi//uKEy7aYEfI= -cloud.google.com/go/binaryauthorization v1.3.0/go.mod h1:lRZbKgjDIIQvzYQS1p99A7/U1JqvqeZg0wiI5tp6tg0= -cloud.google.com/go/binaryauthorization v1.4.0/go.mod h1:tsSPQrBd77VLplV70GUhBf/Zm3FsKmgSqgm4UmiDItk= -cloud.google.com/go/binaryauthorization v1.5.0/go.mod h1:OSe4OU1nN/VswXKRBmciKpo9LulY41gch5c68htf3/Q= -cloud.google.com/go/certificatemanager v1.3.0/go.mod h1:n6twGDvcUBFu9uBgt4eYvvf3sQ6My8jADcOVwHmzadg= -cloud.google.com/go/certificatemanager v1.4.0/go.mod h1:vowpercVFyqs8ABSmrdV+GiFf2H/ch3KyudYQEMM590= -cloud.google.com/go/certificatemanager v1.6.0/go.mod h1:3Hh64rCKjRAX8dXgRAyOcY5vQ/fE1sh8o+Mdd6KPgY8= -cloud.google.com/go/channel v1.8.0/go.mod h1:W5SwCXDJsq/rg3tn3oG0LOxpAo6IMxNa09ngphpSlnk= -cloud.google.com/go/channel v1.9.0/go.mod h1:jcu05W0my9Vx4mt3/rEHpfxc9eKi9XwsdDL8yBMbKUk= -cloud.google.com/go/channel v1.11.0/go.mod h1:IdtI0uWGqhEeatSB62VOoJ8FSUhJ9/+iGkJVqp74CGE= -cloud.google.com/go/channel v1.12.0/go.mod h1:VkxCGKASi4Cq7TbXxlaBezonAYpp1GCnKMY6tnMQnLU= -cloud.google.com/go/cloudbuild v1.3.0/go.mod h1:WequR4ULxlqvMsjDEEEFnOG5ZSRSgWOywXYDb1vPE6U= -cloud.google.com/go/cloudbuild v1.4.0/go.mod h1:5Qwa40LHiOXmz3386FrjrYM93rM/hdRr7b53sySrTqA= -cloud.google.com/go/cloudbuild v1.6.0/go.mod h1:UIbc/w9QCbH12xX+ezUsgblrWv+Cv4Tw83GiSMHOn9M= -cloud.google.com/go/cloudbuild v1.7.0/go.mod h1:zb5tWh2XI6lR9zQmsm1VRA+7OCuve5d8S+zJUul8KTg= -cloud.google.com/go/cloudbuild v1.9.0/go.mod h1:qK1d7s4QlO0VwfYn5YuClDGg2hfmLZEb4wQGAbIgL1s= -cloud.google.com/go/clouddms v1.3.0/go.mod h1:oK6XsCDdW4Ib3jCCBugx+gVjevp2TMXFtgxvPSee3OM= -cloud.google.com/go/clouddms v1.4.0/go.mod h1:Eh7sUGCC+aKry14O1NRljhjyrr0NFC0G2cjwX0cByRk= -cloud.google.com/go/clouddms v1.5.0/go.mod h1:QSxQnhikCLUw13iAbffF2CZxAER3xDGNHjsTAkQJcQA= -cloud.google.com/go/cloudtasks v1.5.0/go.mod h1:fD92REy1x5woxkKEkLdvavGnPJGEn8Uic9nWuLzqCpY= -cloud.google.com/go/cloudtasks v1.6.0/go.mod h1:C6Io+sxuke9/KNRkbQpihnW93SWDU3uXt92nu85HkYI= -cloud.google.com/go/cloudtasks v1.7.0/go.mod h1:ImsfdYWwlWNJbdgPIIGJWC+gemEGTBK/SunNQQNCAb4= -cloud.google.com/go/cloudtasks v1.8.0/go.mod h1:gQXUIwCSOI4yPVK7DgTVFiiP0ZW/eQkydWzwVMdHxrI= -cloud.google.com/go/cloudtasks v1.9.0/go.mod h1:w+EyLsVkLWHcOaqNEyvcKAsWp9p29dL6uL9Nst1cI7Y= -cloud.google.com/go/cloudtasks v1.10.0/go.mod h1:NDSoTLkZ3+vExFEWu2UJV1arUyzVDAiZtdWcsUyNwBs= cloud.google.com/go/compute v0.1.0/go.mod h1:GAesmwr110a34z04OlxYkATPBEfVhkymfTBXtfbBFow= cloud.google.com/go/compute v1.3.0/go.mod h1:cCZiE1NHEtai4wiufUhW8I8S1JKkAnhnQJWM7YD99wM= cloud.google.com/go/compute v1.5.0/go.mod h1:9SMHyhJlzhlkJqrPAc839t2BZFTSk6Jdj6mkzQJeu0M= cloud.google.com/go/compute v1.6.0/go.mod h1:T29tfhtVbq1wvAPo0E3+7vhgmkOYeXjhFvz/FMzPu0s= cloud.google.com/go/compute v1.6.1/go.mod h1:g85FgpzFvNULZ+S8AYq87axRKuf2Kh7deLqV/jJ3thU= cloud.google.com/go/compute v1.7.0/go.mod h1:435lt8av5oL9P3fv1OEzSbSUe+ybHXGMPQHHZWZxy9U= -cloud.google.com/go/compute v1.10.0/go.mod h1:ER5CLbMxl90o2jtNbGSbtfOpQKR0t15FOtRsugnLrlU= -cloud.google.com/go/compute v1.12.0/go.mod h1:e8yNOBcBONZU1vJKCvCoDw/4JQsA0dpM4x/6PIIOocU= -cloud.google.com/go/compute v1.12.1/go.mod h1:e8yNOBcBONZU1vJKCvCoDw/4JQsA0dpM4x/6PIIOocU= -cloud.google.com/go/compute v1.13.0/go.mod h1:5aPTS0cUNMIc1CE546K+Th6weJUNQErARyZtRXDJ8GE= -cloud.google.com/go/compute v1.14.0/go.mod h1:YfLtxrj9sU4Yxv+sXzZkyPjEyPBZfXHUvjxega5vAdo= -cloud.google.com/go/compute v1.15.1/go.mod h1:bjjoF/NtFUrkD/urWfdHaKuOPDR5nWIs63rR+SXhcpA= -cloud.google.com/go/compute v1.18.0/go.mod h1:1X7yHxec2Ga+Ss6jPyjxRxpu2uu7PLgsOVXvgU0yacs= -cloud.google.com/go/compute v1.19.0/go.mod h1:rikpw2y+UMidAe9tISo04EHNOIf42RLYF/q8Bs93scU= -cloud.google.com/go/compute v1.19.1/go.mod h1:6ylj3a05WF8leseCdIf77NK0g1ey+nj5IKd5/kvShxE= -cloud.google.com/go/compute v1.19.3/go.mod h1:qxvISKp/gYnXkSAD1ppcSOveRAmzxicEv/JlizULFrI= -cloud.google.com/go/compute v1.20.0/go.mod h1:kn5BhC++qUWR/AM3Dn21myV7QbgqejW04cAOrtppaQI= -cloud.google.com/go/compute v1.22.0 h1:cB8R6FtUtT1TYGl5R3xuxnW6OUIc/DrT2aiR16TTG7Y= -cloud.google.com/go/compute v1.22.0/go.mod h1:4tCnrn48xsqlwSAiLf1HXMQk8CONslYbdiEZc9FEIbM= -cloud.google.com/go/compute/metadata v0.1.0/go.mod h1:Z1VN+bulIf6bt4P/C37K4DyZYZEXYonfTBHHFPO/4UU= -cloud.google.com/go/compute/metadata v0.2.0/go.mod h1:zFmK7XCadkQkj6TtorcaGlCW1hT1fIilQDwofLpJ20k= -cloud.google.com/go/compute/metadata v0.2.1/go.mod h1:jgHgmJd2RKBGzXqF5LR2EZMGxBkeanZ9wwa75XHJgOM= +cloud.google.com/go/compute v1.23.0 h1:tP41Zoavr8ptEqaW6j+LQOnyBBhO7OkOMAGrgLopTwY= +cloud.google.com/go/compute v1.23.0/go.mod h1:4tCnrn48xsqlwSAiLf1HXMQk8CONslYbdiEZc9FEIbM= cloud.google.com/go/compute/metadata v0.2.3 h1:mg4jlk7mCAj6xXp9UJ4fjI9VUI5rubuGBW5aJ7UnBMY= cloud.google.com/go/compute/metadata v0.2.3/go.mod h1:VAV5nSsACxMJvgaAuX6Pk2AawlZn8kiOGuCv6gTkwuA= -cloud.google.com/go/contactcenterinsights v1.3.0/go.mod h1:Eu2oemoePuEFc/xKFPjbTuPSj0fYJcPls9TFlPNnHHY= -cloud.google.com/go/contactcenterinsights v1.4.0/go.mod h1:L2YzkGbPsv+vMQMCADxJoT9YiTTnSEd6fEvCeHTYVck= -cloud.google.com/go/contactcenterinsights v1.6.0/go.mod h1:IIDlT6CLcDoyv79kDv8iWxMSTZhLxSCofVV5W6YFM/w= -cloud.google.com/go/container v1.6.0/go.mod h1:Xazp7GjJSeUYo688S+6J5V+n/t+G5sKBTFkKNudGRxg= -cloud.google.com/go/container v1.7.0/go.mod h1:Dp5AHtmothHGX3DwwIHPgq45Y8KmNsgN3amoYfxVkLo= -cloud.google.com/go/container v1.13.1/go.mod h1:6wgbMPeQRw9rSnKBCAJXnds3Pzj03C4JHamr8asWKy4= -cloud.google.com/go/container v1.14.0/go.mod h1:3AoJMPhHfLDxLvrlVWaK57IXzaPnLaZq63WX59aQBfM= -cloud.google.com/go/container v1.15.0/go.mod h1:ft+9S0WGjAyjDggg5S06DXj+fHJICWg8L7isCQe9pQA= -cloud.google.com/go/containeranalysis v0.5.1/go.mod h1:1D92jd8gRR/c0fGMlymRgxWD3Qw9C1ff6/T7mLgVL8I= -cloud.google.com/go/containeranalysis v0.6.0/go.mod h1:HEJoiEIu+lEXM+k7+qLCci0h33lX3ZqoYFdmPcoO7s4= -cloud.google.com/go/containeranalysis v0.7.0/go.mod h1:9aUL+/vZ55P2CXfuZjS4UjQ9AgXoSw8Ts6lemfmxBxI= -cloud.google.com/go/containeranalysis v0.9.0/go.mod h1:orbOANbwk5Ejoom+s+DUCTTJ7IBdBQJDcSylAx/on9s= -cloud.google.com/go/datacatalog v1.3.0/go.mod h1:g9svFY6tuR+j+hrTw3J2dNcmI0dzmSiyOzm8kpLq0a0= -cloud.google.com/go/datacatalog v1.5.0/go.mod h1:M7GPLNQeLfWqeIm3iuiruhPzkt65+Bx8dAKvScX8jvs= -cloud.google.com/go/datacatalog v1.6.0/go.mod h1:+aEyF8JKg+uXcIdAmmaMUmZ3q1b/lKLtXCmXdnc0lbc= -cloud.google.com/go/datacatalog v1.7.0/go.mod h1:9mEl4AuDYWw81UGc41HonIHH7/sn52H0/tc8f8ZbZIE= -cloud.google.com/go/datacatalog v1.8.0/go.mod h1:KYuoVOv9BM8EYz/4eMFxrr4DUKhGIOXxZoKYF5wdISM= -cloud.google.com/go/datacatalog v1.8.1/go.mod h1:RJ58z4rMp3gvETA465Vg+ag8BGgBdnRPEMMSTr5Uv+M= -cloud.google.com/go/datacatalog v1.12.0/go.mod h1:CWae8rFkfp6LzLumKOnmVh4+Zle4A3NXLzVJ1d1mRm0= -cloud.google.com/go/datacatalog v1.13.0/go.mod h1:E4Rj9a5ZtAxcQJlEBTLgMTphfP11/lNaAshpoBgemX8= -cloud.google.com/go/dataflow v0.6.0/go.mod h1:9QwV89cGoxjjSR9/r7eFDqqjtvbKxAK2BaYU6PVk9UM= -cloud.google.com/go/dataflow v0.7.0/go.mod h1:PX526vb4ijFMesO1o202EaUmouZKBpjHsTlCtB4parQ= -cloud.google.com/go/dataflow v0.8.0/go.mod h1:Rcf5YgTKPtQyYz8bLYhFoIV/vP39eL7fWNcSOyFfLJE= -cloud.google.com/go/dataform v0.3.0/go.mod h1:cj8uNliRlHpa6L3yVhDOBrUXH+BPAO1+KFMQQNSThKo= -cloud.google.com/go/dataform v0.4.0/go.mod h1:fwV6Y4Ty2yIFL89huYlEkwUPtS7YZinZbzzj5S9FzCE= -cloud.google.com/go/dataform v0.5.0/go.mod h1:GFUYRe8IBa2hcomWplodVmUx/iTL0FrsauObOM3Ipr0= -cloud.google.com/go/dataform v0.6.0/go.mod h1:QPflImQy33e29VuapFdf19oPbE4aYTJxr31OAPV+ulA= -cloud.google.com/go/dataform v0.7.0/go.mod h1:7NulqnVozfHvWUBpMDfKMUESr+85aJsC/2O0o3jWPDE= -cloud.google.com/go/datafusion v1.4.0/go.mod h1:1Zb6VN+W6ALo85cXnM1IKiPw+yQMKMhB9TsTSRDo/38= -cloud.google.com/go/datafusion v1.5.0/go.mod h1:Kz+l1FGHB0J+4XF2fud96WMmRiq/wj8N9u007vyXZ2w= -cloud.google.com/go/datafusion v1.6.0/go.mod h1:WBsMF8F1RhSXvVM8rCV3AeyWVxcC2xY6vith3iw3S+8= -cloud.google.com/go/datalabeling v0.5.0/go.mod h1:TGcJ0G2NzcsXSE/97yWjIZO0bXj0KbVlINXMG9ud42I= -cloud.google.com/go/datalabeling v0.6.0/go.mod h1:WqdISuk/+WIGeMkpw/1q7bK/tFEZxsrFJOJdY2bXvTQ= -cloud.google.com/go/datalabeling v0.7.0/go.mod h1:WPQb1y08RJbmpM3ww0CSUAGweL0SxByuW2E+FU+wXcM= -cloud.google.com/go/dataplex v1.3.0/go.mod h1:hQuRtDg+fCiFgC8j0zV222HvzFQdRd+SVX8gdmFcZzA= -cloud.google.com/go/dataplex v1.4.0/go.mod h1:X51GfLXEMVJ6UN47ESVqvlsRplbLhcsAt0kZCCKsU0A= -cloud.google.com/go/dataplex v1.5.2/go.mod h1:cVMgQHsmfRoI5KFYq4JtIBEUbYwc3c7tXmIDhRmNNVQ= -cloud.google.com/go/dataplex v1.6.0/go.mod h1:bMsomC/aEJOSpHXdFKFGQ1b0TDPIeL28nJObeO1ppRs= -cloud.google.com/go/dataproc v1.7.0/go.mod h1:CKAlMjII9H90RXaMpSxQ8EU6dQx6iAYNPcYPOkSbi8s= -cloud.google.com/go/dataproc v1.8.0/go.mod h1:5OW+zNAH0pMpw14JVrPONsxMQYMBqJuzORhIBfBn9uI= -cloud.google.com/go/dataproc v1.12.0/go.mod h1:zrF3aX0uV3ikkMz6z4uBbIKyhRITnxvr4i3IjKsKrw4= -cloud.google.com/go/dataqna v0.5.0/go.mod h1:90Hyk596ft3zUQ8NkFfvICSIfHFh1Bc7C4cK3vbhkeo= -cloud.google.com/go/dataqna v0.6.0/go.mod h1:1lqNpM7rqNLVgWBJyk5NF6Uen2PHym0jtVJonplVsDA= -cloud.google.com/go/dataqna v0.7.0/go.mod h1:Lx9OcIIeqCrw1a6KdO3/5KMP1wAmTc0slZWwP12Qq3c= cloud.google.com/go/datastore v1.0.0/go.mod h1:LXYbyblFSglQ5pkeyhO+Qmw7ukd3C+pD7TKLgZqpHYE= cloud.google.com/go/datastore v1.1.0/go.mod h1:umbIZjpQpHh4hmRpGhH4tLFup+FVzqBi1b3c64qFpCk= -cloud.google.com/go/datastore v1.10.0/go.mod h1:PC5UzAmDEkAmkfaknstTYbNpgE49HAgW2J1gcgUfmdM= -cloud.google.com/go/datastore v1.11.0/go.mod h1:TvGxBIHCS50u8jzG+AW/ppf87v1of8nwzFNgEZU1D3c= -cloud.google.com/go/datastream v1.2.0/go.mod h1:i/uTP8/fZwgATHS/XFu0TcNUhuA0twZxxQ3EyCUQMwo= -cloud.google.com/go/datastream v1.3.0/go.mod h1:cqlOX8xlyYF/uxhiKn6Hbv6WjwPPuI9W2M9SAXwaLLQ= -cloud.google.com/go/datastream v1.4.0/go.mod h1:h9dpzScPhDTs5noEMQVWP8Wx8AFBRyS0s8KWPx/9r0g= -cloud.google.com/go/datastream v1.5.0/go.mod h1:6TZMMNPwjUqZHBKPQ1wwXpb0d5VDVPl2/XoS5yi88q4= -cloud.google.com/go/datastream v1.6.0/go.mod h1:6LQSuswqLa7S4rPAOZFVjHIG3wJIjZcZrw8JDEDJuIs= -cloud.google.com/go/datastream v1.7.0/go.mod h1:uxVRMm2elUSPuh65IbZpzJNMbuzkcvu5CjMqVIUHrww= -cloud.google.com/go/deploy v1.4.0/go.mod h1:5Xghikd4VrmMLNaF6FiRFDlHb59VM59YoDQnOUdsH/c= -cloud.google.com/go/deploy v1.5.0/go.mod h1:ffgdD0B89tToyW/U/D2eL0jN2+IEV/3EMuXHA0l4r+s= -cloud.google.com/go/deploy v1.6.0/go.mod h1:f9PTHehG/DjCom3QH0cntOVRm93uGBDt2vKzAPwpXQI= -cloud.google.com/go/deploy v1.8.0/go.mod h1:z3myEJnA/2wnB4sgjqdMfgxCA0EqC3RBTNcVPs93mtQ= -cloud.google.com/go/dialogflow v1.15.0/go.mod h1:HbHDWs33WOGJgn6rfzBW1Kv807BE3O1+xGbn59zZWI4= -cloud.google.com/go/dialogflow v1.16.1/go.mod h1:po6LlzGfK+smoSmTBnbkIZY2w8ffjz/RcGSS+sh1el0= -cloud.google.com/go/dialogflow v1.17.0/go.mod h1:YNP09C/kXA1aZdBgC/VtXX74G/TKn7XVCcVumTflA+8= -cloud.google.com/go/dialogflow v1.18.0/go.mod h1:trO7Zu5YdyEuR+BhSNOqJezyFQ3aUzz0njv7sMx/iek= -cloud.google.com/go/dialogflow v1.19.0/go.mod h1:JVmlG1TwykZDtxtTXujec4tQ+D8SBFMoosgy+6Gn0s0= -cloud.google.com/go/dialogflow v1.29.0/go.mod h1:b+2bzMe+k1s9V+F2jbJwpHPzrnIyHihAdRFMtn2WXuM= -cloud.google.com/go/dialogflow v1.31.0/go.mod h1:cuoUccuL1Z+HADhyIA7dci3N5zUssgpBJmCzI6fNRB4= -cloud.google.com/go/dialogflow v1.32.0/go.mod h1:jG9TRJl8CKrDhMEcvfcfFkkpp8ZhgPz3sBGmAUYJ2qE= -cloud.google.com/go/dlp v1.6.0/go.mod h1:9eyB2xIhpU0sVwUixfBubDoRwP+GjeUoxxeueZmqvmM= -cloud.google.com/go/dlp v1.7.0/go.mod h1:68ak9vCiMBjbasxeVD17hVPxDEck+ExiHavX8kiHG+Q= -cloud.google.com/go/dlp v1.9.0/go.mod h1:qdgmqgTyReTz5/YNSSuueR8pl7hO0o9bQ39ZhtgkWp4= -cloud.google.com/go/documentai v1.7.0/go.mod h1:lJvftZB5NRiFSX4moiye1SMxHx0Bc3x1+p9e/RfXYiU= -cloud.google.com/go/documentai v1.8.0/go.mod h1:xGHNEB7CtsnySCNrCFdCyyMz44RhFEEX2Q7UD0c5IhU= -cloud.google.com/go/documentai v1.9.0/go.mod h1:FS5485S8R00U10GhgBC0aNGrJxBP8ZVpEeJ7PQDZd6k= -cloud.google.com/go/documentai v1.10.0/go.mod h1:vod47hKQIPeCfN2QS/jULIvQTugbmdc0ZvxxfQY1bg4= -cloud.google.com/go/documentai v1.16.0/go.mod h1:o0o0DLTEZ+YnJZ+J4wNfTxmDVyrkzFvttBXXtYRMHkM= -cloud.google.com/go/documentai v1.18.0/go.mod h1:F6CK6iUH8J81FehpskRmhLq/3VlwQvb7TvwOceQ2tbs= -cloud.google.com/go/domains v0.6.0/go.mod h1:T9Rz3GasrpYk6mEGHh4rymIhjlnIuB4ofT1wTxDeT4Y= -cloud.google.com/go/domains v0.7.0/go.mod h1:PtZeqS1xjnXuRPKE/88Iru/LdfoRyEHYA9nFQf4UKpg= -cloud.google.com/go/domains v0.8.0/go.mod h1:M9i3MMDzGFXsydri9/vW+EWz9sWb4I6WyHqdlAk0idE= -cloud.google.com/go/edgecontainer v0.1.0/go.mod h1:WgkZ9tp10bFxqO8BLPqv2LlfmQF1X8lZqwW4r1BTajk= -cloud.google.com/go/edgecontainer v0.2.0/go.mod h1:RTmLijy+lGpQ7BXuTDa4C4ssxyXT34NIuHIgKuP4s5w= -cloud.google.com/go/edgecontainer v0.3.0/go.mod h1:FLDpP4nykgwwIfcLt6zInhprzw0lEi2P1fjO6Ie0qbc= -cloud.google.com/go/edgecontainer v1.0.0/go.mod h1:cttArqZpBB2q58W/upSG++ooo6EsblxDIolxa3jSjbY= -cloud.google.com/go/errorreporting v0.3.0/go.mod h1:xsP2yaAp+OAW4OIm60An2bbLpqIhKXdWR/tawvl7QzU= -cloud.google.com/go/essentialcontacts v1.3.0/go.mod h1:r+OnHa5jfj90qIfZDO/VztSFqbQan7HV75p8sA+mdGI= -cloud.google.com/go/essentialcontacts v1.4.0/go.mod h1:8tRldvHYsmnBCHdFpvU+GL75oWiBKl80BiqlFh9tp+8= -cloud.google.com/go/essentialcontacts v1.5.0/go.mod h1:ay29Z4zODTuwliK7SnX8E86aUF2CTzdNtvv42niCX0M= -cloud.google.com/go/eventarc v1.7.0/go.mod h1:6ctpF3zTnaQCxUjHUdcfgcA1A2T309+omHZth7gDfmc= -cloud.google.com/go/eventarc v1.8.0/go.mod h1:imbzxkyAU4ubfsaKYdQg04WS1NvncblHEup4kvF+4gw= -cloud.google.com/go/eventarc v1.10.0/go.mod h1:u3R35tmZ9HvswGRBnF48IlYgYeBcPUCjkr4BTdem2Kw= -cloud.google.com/go/eventarc v1.11.0/go.mod h1:PyUjsUKPWoRBCHeOxZd/lbOOjahV41icXyUY5kSTvVY= -cloud.google.com/go/filestore v1.3.0/go.mod h1:+qbvHGvXU1HaKX2nD0WEPo92TP/8AQuCVEBXNY9z0+w= -cloud.google.com/go/filestore v1.4.0/go.mod h1:PaG5oDfo9r224f8OYXURtAsY+Fbyq/bLYoINEK8XQAI= -cloud.google.com/go/filestore v1.5.0/go.mod h1:FqBXDWBp4YLHqRnVGveOkHDf8svj9r5+mUDLupOWEDs= -cloud.google.com/go/filestore v1.6.0/go.mod h1:di5unNuss/qfZTw2U9nhFqo8/ZDSc466dre85Kydllg= cloud.google.com/go/firestore v1.1.0/go.mod h1:ulACoGHTpvq5r8rxGJ4ddJZBZqakUQqClKRT5SZwBmk= -cloud.google.com/go/firestore v1.6.1/go.mod h1:asNXNOzBdyVQmEU+ggO8UPodTkEVFW5Qx+rwHnAz+EY= -cloud.google.com/go/firestore v1.9.0/go.mod h1:HMkjKHNTtRyZNiMzu7YAsLr9K3X2udY2AMwDaMEQiiE= -cloud.google.com/go/firestore v1.10.0/go.mod h1:eAeoQCV8F35Mcy4k8ZrQbcSYZOayIwoiU7ZJ6xzH1+o= -cloud.google.com/go/firestore v1.11.0 h1:PPgtwcYUOXV2jFe1bV3nda3RCrOa8cvBjTOn2MQVfW8= -cloud.google.com/go/firestore v1.11.0/go.mod h1:b38dKhgzlmNNGTNZZwe7ZRFEuRab1Hay3/DBsIGKKy4= -cloud.google.com/go/functions v1.6.0/go.mod h1:3H1UA3qiIPRWD7PeZKLvHZ9SaQhR26XIJcC0A5GbvAk= -cloud.google.com/go/functions v1.7.0/go.mod h1:+d+QBcWM+RsrgZfV9xo6KfA1GlzJfxcfZcRPEhDDfzg= -cloud.google.com/go/functions v1.8.0/go.mod h1:RTZ4/HsQjIqIYP9a9YPbU+QFoQsAlYgrwOXJWHn1POY= -cloud.google.com/go/functions v1.9.0/go.mod h1:Y+Dz8yGguzO3PpIjhLTbnqV1CWmgQ5UwtlpzoyquQ08= -cloud.google.com/go/functions v1.10.0/go.mod h1:0D3hEOe3DbEvCXtYOZHQZmD+SzYsi1YbI7dGvHfldXw= -cloud.google.com/go/functions v1.12.0/go.mod h1:AXWGrF3e2C/5ehvwYo/GH6O5s09tOPksiKhz+hH8WkA= -cloud.google.com/go/functions v1.13.0/go.mod h1:EU4O007sQm6Ef/PwRsI8N2umygGqPBS/IZQKBQBcJ3c= -cloud.google.com/go/gaming v1.5.0/go.mod h1:ol7rGcxP/qHTRQE/RO4bxkXq+Fix0j6D4LFPzYTIrDM= -cloud.google.com/go/gaming v1.6.0/go.mod h1:YMU1GEvA39Qt3zWGyAVA9bpYz/yAhTvaQ1t2sK4KPUA= -cloud.google.com/go/gaming v1.7.0/go.mod h1:LrB8U7MHdGgFG851iHAfqUdLcKBdQ55hzXy9xBJz0+w= -cloud.google.com/go/gaming v1.8.0/go.mod h1:xAqjS8b7jAVW0KFYeRUxngo9My3f33kFmua++Pi+ggM= -cloud.google.com/go/gaming v1.9.0/go.mod h1:Fc7kEmCObylSWLO334NcO+O9QMDyz+TKC4v1D7X+Bc0= -cloud.google.com/go/gkebackup v0.2.0/go.mod h1:XKvv/4LfG829/B8B7xRkk8zRrOEbKtEam6yNfuQNH60= -cloud.google.com/go/gkebackup v0.3.0/go.mod h1:n/E671i1aOQvUxT541aTkCwExO/bTer2HDlj4TsBRAo= -cloud.google.com/go/gkebackup v0.4.0/go.mod h1:byAyBGUwYGEEww7xsbnUTBHIYcOPy/PgUWUtOeRm9Vg= -cloud.google.com/go/gkeconnect v0.5.0/go.mod h1:c5lsNAg5EwAy7fkqX/+goqFsU1Da/jQFqArp+wGNr/o= -cloud.google.com/go/gkeconnect v0.6.0/go.mod h1:Mln67KyU/sHJEBY8kFZ0xTeyPtzbq9StAVvEULYK16A= -cloud.google.com/go/gkeconnect v0.7.0/go.mod h1:SNfmVqPkaEi3bF/B3CNZOAYPYdg7sU+obZ+QTky2Myw= -cloud.google.com/go/gkehub v0.9.0/go.mod h1:WYHN6WG8w9bXU0hqNxt8rm5uxnk8IH+lPY9J2TV7BK0= -cloud.google.com/go/gkehub v0.10.0/go.mod h1:UIPwxI0DsrpsVoWpLB0stwKCP+WFVG9+y977wO+hBH0= -cloud.google.com/go/gkehub v0.11.0/go.mod h1:JOWHlmN+GHyIbuWQPl47/C2RFhnFKH38jH9Ascu3n0E= -cloud.google.com/go/gkehub v0.12.0/go.mod h1:djiIwwzTTBrF5NaXCGv3mf7klpEMcST17VBTVVDcuaw= -cloud.google.com/go/gkemulticloud v0.3.0/go.mod h1:7orzy7O0S+5kq95e4Hpn7RysVA7dPs8W/GgfUtsPbrA= -cloud.google.com/go/gkemulticloud v0.4.0/go.mod h1:E9gxVBnseLWCk24ch+P9+B2CoDFJZTyIgLKSalC7tuI= -cloud.google.com/go/gkemulticloud v0.5.0/go.mod h1:W0JDkiyi3Tqh0TJr//y19wyb1yf8llHVto2Htf2Ja3Y= -cloud.google.com/go/grafeas v0.2.0/go.mod h1:KhxgtF2hb0P191HlY5besjYm6MqTSTj3LSI+M+ByZHc= -cloud.google.com/go/gsuiteaddons v1.3.0/go.mod h1:EUNK/J1lZEZO8yPtykKxLXI6JSVN2rg9bN8SXOa0bgM= -cloud.google.com/go/gsuiteaddons v1.4.0/go.mod h1:rZK5I8hht7u7HxFQcFei0+AtfS9uSushomRlg+3ua1o= -cloud.google.com/go/gsuiteaddons v1.5.0/go.mod h1:TFCClYLd64Eaa12sFVmUyG62tk4mdIsI7pAnSXRkcFo= -cloud.google.com/go/iam v0.1.0/go.mod h1:vcUNEa0pEm0qRVpmWepWaFMIAI8/hjB9mO8rNCJtF6c= +cloud.google.com/go/firestore v1.12.0 h1:aeEA/N7DW7+l2u5jtkO8I0qv0D95YwjggD8kUHrTHO4= +cloud.google.com/go/firestore v1.12.0/go.mod h1:b38dKhgzlmNNGTNZZwe7ZRFEuRab1Hay3/DBsIGKKy4= cloud.google.com/go/iam v0.3.0/go.mod h1:XzJPvDayI+9zsASAFO68Hk07u3z+f+JrT2xXNdp4bnY= cloud.google.com/go/iam v0.4.0/go.mod h1:cbaZxyScUhxl7ZAkNWiALgihfP75wS/fUsVNaa1r3vA= -cloud.google.com/go/iam v0.5.0/go.mod h1:wPU9Vt0P4UmCux7mqtRu6jcpPAb74cP1fh50J3QpkUc= -cloud.google.com/go/iam v0.6.0/go.mod h1:+1AH33ueBne5MzYccyMHtEKqLE4/kJOibtffMHDMFMc= -cloud.google.com/go/iam v0.7.0/go.mod h1:H5Br8wRaDGNc8XP3keLc4unfUUZeyH3Sfl9XpQEYOeg= -cloud.google.com/go/iam v0.8.0/go.mod h1:lga0/y3iH6CX7sYqypWJ33hf7kkfXJag67naqGESjkE= -cloud.google.com/go/iam v0.11.0/go.mod h1:9PiLDanza5D+oWFZiH1uG+RnRCfEGKoyl6yo4cgWZGY= -cloud.google.com/go/iam v0.12.0/go.mod h1:knyHGviacl11zrtZUoDuYpDgLjvr28sLQaG0YB2GYAY= -cloud.google.com/go/iam v0.13.0/go.mod h1:ljOg+rcNfzZ5d6f1nAUJ8ZIxOaZUVoS14bKCtaLZ/D0= -cloud.google.com/go/iam v1.0.1/go.mod h1:yR3tmSL8BcZB4bxByRv2jkSIahVmCtfKZwLYGBalRE8= -cloud.google.com/go/iam v1.1.0/go.mod h1:nxdHjaKfCr7fNYx/HJMM8LgiMugmveWlkatear5gVyk= cloud.google.com/go/iam v1.1.1 h1:lW7fzj15aVIXYHREOqjRBV9PsH0Z6u8Y46a1YGvQP4Y= cloud.google.com/go/iam v1.1.1/go.mod h1:A5avdyVL2tCppe4unb0951eI9jreack+RJ0/d+KUZOU= -cloud.google.com/go/iap v1.4.0/go.mod h1:RGFwRJdihTINIe4wZ2iCP0zF/qu18ZwyKxrhMhygBEc= -cloud.google.com/go/iap v1.5.0/go.mod h1:UH/CGgKd4KyohZL5Pt0jSKE4m3FR51qg6FKQ/z/Ix9A= -cloud.google.com/go/iap v1.6.0/go.mod h1:NSuvI9C/j7UdjGjIde7t7HBz+QTwBcapPE07+sSRcLk= -cloud.google.com/go/iap v1.7.0/go.mod h1:beqQx56T9O1G1yNPph+spKpNibDlYIiIixiqsQXxLIo= -cloud.google.com/go/iap v1.7.1/go.mod h1:WapEwPc7ZxGt2jFGB/C/bm+hP0Y6NXzOYGjpPnmMS74= -cloud.google.com/go/ids v1.1.0/go.mod h1:WIuwCaYVOzHIj2OhN9HAwvW+DBdmUAdcWlFxRl+KubM= -cloud.google.com/go/ids v1.2.0/go.mod h1:5WXvp4n25S0rA/mQWAg1YEEBBq6/s+7ml1RDCW1IrcY= -cloud.google.com/go/ids v1.3.0/go.mod h1:JBdTYwANikFKaDP6LtW5JAi4gubs57SVNQjemdt6xV4= -cloud.google.com/go/iot v1.3.0/go.mod h1:r7RGh2B61+B8oz0AGE+J72AhA0G7tdXItODWsaA2oLs= -cloud.google.com/go/iot v1.4.0/go.mod h1:dIDxPOn0UvNDUMD8Ger7FIaTuvMkj+aGk94RPP0iV+g= -cloud.google.com/go/iot v1.5.0/go.mod h1:mpz5259PDl3XJthEmh9+ap0affn/MqNSP4My77Qql9o= -cloud.google.com/go/iot v1.6.0/go.mod h1:IqdAsmE2cTYYNO1Fvjfzo9po179rAtJeVGUvkLN3rLE= -cloud.google.com/go/kms v1.4.0/go.mod h1:fajBHndQ+6ubNw6Ss2sSd+SWvjL26RNo/dr7uxsnnOA= -cloud.google.com/go/kms v1.5.0/go.mod h1:QJS2YY0eJGBg3mnDfuaCyLauWwBJiHRboYxJ++1xJNg= -cloud.google.com/go/kms v1.6.0/go.mod h1:Jjy850yySiasBUDi6KFUwUv2n1+o7QZFyuUJg6OgjA0= -cloud.google.com/go/kms v1.8.0/go.mod h1:4xFEhYFqvW+4VMELtZyxomGSYtSQKzM178ylFW4jMAg= -cloud.google.com/go/kms v1.9.0/go.mod h1:qb1tPTgfF9RQP8e1wq4cLFErVuTJv7UsSC915J8dh3w= -cloud.google.com/go/kms v1.10.0/go.mod h1:ng3KTUtQQU9bPX3+QGLsflZIHlkbn8amFAMY63m8d24= -cloud.google.com/go/kms v1.10.1/go.mod h1:rIWk/TryCkR59GMC3YtHtXeLzd634lBbKenvyySAyYI= -cloud.google.com/go/kms v1.10.2/go.mod h1:9mX3Q6pdroWzL20pbK6RaOdBbXBEhMNgK4Pfz2bweb4= -cloud.google.com/go/kms v1.12.0/go.mod h1:syfpIBSOqQ/ZqK48RLPkwUhFhvbsA1SyGAq/vPohd20= -cloud.google.com/go/kms v1.14.0 h1:B/F3X7OzZ2pFlKsJc0+5sbHV/k45+ITKIHH5l/HGUf4= -cloud.google.com/go/kms v1.14.0/go.mod h1:c9J991h5DTl+kg7gi3MYomh12YEENGrf48ee/N/2CDM= -cloud.google.com/go/language v1.4.0/go.mod h1:F9dRpNFQmJbkaop6g0JhSBXCNlO90e1KWx5iDdxbWic= -cloud.google.com/go/language v1.6.0/go.mod h1:6dJ8t3B+lUYfStgls25GusK04NLh3eDLQnWM3mdEbhI= -cloud.google.com/go/language v1.7.0/go.mod h1:DJ6dYN/W+SQOjF8e1hLQXMF21AkH2w9wiPzPCJa2MIE= -cloud.google.com/go/language v1.8.0/go.mod h1:qYPVHf7SPoNNiCL2Dr0FfEFNil1qi3pQEyygwpgVKB8= -cloud.google.com/go/language v1.9.0/go.mod h1:Ns15WooPM5Ad/5no/0n81yUetis74g3zrbeJBE+ptUY= -cloud.google.com/go/lifesciences v0.5.0/go.mod h1:3oIKy8ycWGPUyZDR/8RNnTOYevhaMLqh5vLUXs9zvT8= -cloud.google.com/go/lifesciences v0.6.0/go.mod h1:ddj6tSX/7BOnhxCSd3ZcETvtNr8NZ6t/iPhY2Tyfu08= -cloud.google.com/go/lifesciences v0.8.0/go.mod h1:lFxiEOMqII6XggGbOnKiyZ7IBwoIqA84ClvoezaA/bo= -cloud.google.com/go/logging v1.6.1/go.mod h1:5ZO0mHHbvm8gEmeEUHrmDlTDSu5imF6MUP9OfilNXBw= -cloud.google.com/go/logging v1.7.0/go.mod h1:3xjP2CjkM3ZkO73aj4ASA5wRPGGCRrPIAeNqVNkzY8M= -cloud.google.com/go/longrunning v0.1.1/go.mod h1:UUFxuDWkv22EuY93jjmDMFT5GPQKeFVJBIF6QlTqdsE= -cloud.google.com/go/longrunning v0.3.0/go.mod h1:qth9Y41RRSUE69rDcOn6DdK3HfQfsUI0YSmW3iIlLJc= -cloud.google.com/go/longrunning v0.4.1/go.mod h1:4iWDqhBZ70CvZ6BfETbvam3T8FMvLK+eFj0E6AaRQTo= -cloud.google.com/go/longrunning v0.4.2/go.mod h1:OHrnaYyLUV6oqwh0xiS7e5sLQhP1m0QU9R+WhGDMgIQ= -cloud.google.com/go/longrunning v0.5.0/go.mod h1:0JNuqRShmscVAhIACGtskSAWtqtOoPkwP0YF1oVEchc= +cloud.google.com/go/kms v1.15.0 h1:xYl5WEaSekKYN5gGRyhjvZKM22GVBBCzegGNVPy+aIs= +cloud.google.com/go/kms v1.15.0/go.mod h1:c9J991h5DTl+kg7gi3MYomh12YEENGrf48ee/N/2CDM= cloud.google.com/go/longrunning v0.5.1 h1:Fr7TXftcqTudoyRJa113hyaqlGdiBQkp0Gq7tErFDWI= cloud.google.com/go/longrunning v0.5.1/go.mod h1:spvimkwdz6SPWKEt/XBij79E9fiTkHSQl/fRUUQJYJc= -cloud.google.com/go/managedidentities v1.3.0/go.mod h1:UzlW3cBOiPrzucO5qWkNkh0w33KFtBJU281hacNvsdE= -cloud.google.com/go/managedidentities v1.4.0/go.mod h1:NWSBYbEMgqmbZsLIyKvxrYbtqOsxY1ZrGM+9RgDqInM= -cloud.google.com/go/managedidentities v1.5.0/go.mod h1:+dWcZ0JlUmpuxpIDfyP5pP5y0bLdRwOS4Lp7gMni/LA= -cloud.google.com/go/maps v0.1.0/go.mod h1:BQM97WGyfw9FWEmQMpZ5T6cpovXXSd1cGmFma94eubI= -cloud.google.com/go/maps v0.6.0/go.mod h1:o6DAMMfb+aINHz/p/jbcY+mYeXBoZoxTfdSQ8VAJaCw= -cloud.google.com/go/maps v0.7.0/go.mod h1:3GnvVl3cqeSvgMcpRlQidXsPYuDGQ8naBis7MVzpXsY= -cloud.google.com/go/mediatranslation v0.5.0/go.mod h1:jGPUhGTybqsPQn91pNXw0xVHfuJ3leR1wj37oU3y1f4= -cloud.google.com/go/mediatranslation v0.6.0/go.mod h1:hHdBCTYNigsBxshbznuIMFNe5QXEowAuNmmC7h8pu5w= -cloud.google.com/go/mediatranslation v0.7.0/go.mod h1:LCnB/gZr90ONOIQLgSXagp8XUW1ODs2UmUMvcgMfI2I= -cloud.google.com/go/memcache v1.4.0/go.mod h1:rTOfiGZtJX1AaFUrOgsMHX5kAzaTQ8azHiuDoTPzNsE= -cloud.google.com/go/memcache v1.5.0/go.mod h1:dk3fCK7dVo0cUU2c36jKb4VqKPS22BTkf81Xq617aWM= -cloud.google.com/go/memcache v1.6.0/go.mod h1:XS5xB0eQZdHtTuTF9Hf8eJkKtR3pVRCcvJwtm68T3rA= -cloud.google.com/go/memcache v1.7.0/go.mod h1:ywMKfjWhNtkQTxrWxCkCFkoPjLHPW6A7WOTVI8xy3LY= -cloud.google.com/go/memcache v1.9.0/go.mod h1:8oEyzXCu+zo9RzlEaEjHl4KkgjlNDaXbCQeQWlzNFJM= -cloud.google.com/go/metastore v1.5.0/go.mod h1:2ZNrDcQwghfdtCwJ33nM0+GrBGlVuh8rakL3vdPY3XY= -cloud.google.com/go/metastore v1.6.0/go.mod h1:6cyQTls8CWXzk45G55x57DVQ9gWg7RiH65+YgPsNh9s= -cloud.google.com/go/metastore v1.7.0/go.mod h1:s45D0B4IlsINu87/AsWiEVYbLaIMeUSoxlKKDqBGFS8= -cloud.google.com/go/metastore v1.8.0/go.mod h1:zHiMc4ZUpBiM7twCIFQmJ9JMEkDSyZS9U12uf7wHqSI= -cloud.google.com/go/metastore v1.10.0/go.mod h1:fPEnH3g4JJAk+gMRnrAnoqyv2lpUCqJPWOodSaf45Eo= -cloud.google.com/go/monitoring v1.1.0/go.mod h1:L81pzz7HKn14QCMaCs6NTQkdBnE87TElyanS95vIcl4= -cloud.google.com/go/monitoring v1.7.0/go.mod h1:HpYse6kkGo//7p6sT0wsIC6IBDET0RhIsnmlA53dvEk= -cloud.google.com/go/monitoring v1.8.0/go.mod h1:E7PtoMJ1kQXWxPjB6mv2fhC5/15jInuulFdYYtlcvT4= -cloud.google.com/go/monitoring v1.12.0/go.mod h1:yx8Jj2fZNEkL/GYZyTLS4ZtZEZN8WtDEiEqG4kLK50w= -cloud.google.com/go/monitoring v1.13.0/go.mod h1:k2yMBAB1H9JT/QETjNkgdCGD9bPF712XiLTVr+cBrpw= -cloud.google.com/go/monitoring v1.15.0/go.mod h1:/LPLNIY93ZtCpPKuO38kEYh+WhhiqIt8HYch2srelRM= -cloud.google.com/go/networkconnectivity v1.4.0/go.mod h1:nOl7YL8odKyAOtzNX73/M5/mGZgqqMeryi6UPZTk/rA= -cloud.google.com/go/networkconnectivity v1.5.0/go.mod h1:3GzqJx7uhtlM3kln0+x5wyFvuVH1pIBJjhCpjzSt75o= -cloud.google.com/go/networkconnectivity v1.6.0/go.mod h1:OJOoEXW+0LAxHh89nXd64uGG+FbQoeH8DtxCHVOMlaM= -cloud.google.com/go/networkconnectivity v1.7.0/go.mod h1:RMuSbkdbPwNMQjB5HBWD5MpTBnNm39iAVpC3TmsExt8= -cloud.google.com/go/networkconnectivity v1.10.0/go.mod h1:UP4O4sWXJG13AqrTdQCD9TnLGEbtNRqjuaaA7bNjF5E= -cloud.google.com/go/networkconnectivity v1.11.0/go.mod h1:iWmDD4QF16VCDLXUqvyspJjIEtBR/4zq5hwnY2X3scM= -cloud.google.com/go/networkmanagement v1.4.0/go.mod h1:Q9mdLLRn60AsOrPc8rs8iNV6OHXaGcDdsIQe1ohekq8= -cloud.google.com/go/networkmanagement v1.5.0/go.mod h1:ZnOeZ/evzUdUsnvRt792H0uYEnHQEMaz+REhhzJRcf4= -cloud.google.com/go/networkmanagement v1.6.0/go.mod h1:5pKPqyXjB/sgtvB5xqOemumoQNB7y95Q7S+4rjSOPYY= -cloud.google.com/go/networksecurity v0.5.0/go.mod h1:xS6fOCoqpVC5zx15Z/MqkfDwH4+m/61A3ODiDV1xmiQ= -cloud.google.com/go/networksecurity v0.6.0/go.mod h1:Q5fjhTr9WMI5mbpRYEbiexTzROf7ZbDzvzCrNl14nyU= -cloud.google.com/go/networksecurity v0.7.0/go.mod h1:mAnzoxx/8TBSyXEeESMy9OOYwo1v+gZ5eMRnsT5bC8k= -cloud.google.com/go/networksecurity v0.8.0/go.mod h1:B78DkqsxFG5zRSVuwYFRZ9Xz8IcQ5iECsNrPn74hKHU= -cloud.google.com/go/notebooks v1.2.0/go.mod h1:9+wtppMfVPUeJ8fIWPOq1UnATHISkGXGqTkxeieQ6UY= -cloud.google.com/go/notebooks v1.3.0/go.mod h1:bFR5lj07DtCPC7YAAJ//vHskFBxA5JzYlH68kXVdk34= -cloud.google.com/go/notebooks v1.4.0/go.mod h1:4QPMngcwmgb6uw7Po99B2xv5ufVoIQ7nOGDyL4P8AgA= -cloud.google.com/go/notebooks v1.5.0/go.mod h1:q8mwhnP9aR8Hpfnrc5iN5IBhrXUy8S2vuYs+kBJ/gu0= -cloud.google.com/go/notebooks v1.7.0/go.mod h1:PVlaDGfJgj1fl1S3dUwhFMXFgfYGhYQt2164xOMONmE= -cloud.google.com/go/notebooks v1.8.0/go.mod h1:Lq6dYKOYOWUCTvw5t2q1gp1lAp0zxAxRycayS0iJcqQ= -cloud.google.com/go/optimization v1.1.0/go.mod h1:5po+wfvX5AQlPznyVEZjGJTMr4+CAkJf2XSTQOOl9l4= -cloud.google.com/go/optimization v1.2.0/go.mod h1:Lr7SOHdRDENsh+WXVmQhQTrzdu9ybg0NecjHidBq6xs= -cloud.google.com/go/optimization v1.3.1/go.mod h1:IvUSefKiwd1a5p0RgHDbWCIbDFgKuEdB+fPPuP0IDLI= -cloud.google.com/go/orchestration v1.3.0/go.mod h1:Sj5tq/JpWiB//X/q3Ngwdl5K7B7Y0KZ7bfv0wL6fqVA= -cloud.google.com/go/orchestration v1.4.0/go.mod h1:6W5NLFWs2TlniBphAViZEVhrXRSMgUGDfW7vrWKvsBk= -cloud.google.com/go/orchestration v1.6.0/go.mod h1:M62Bevp7pkxStDfFfTuCOaXgaaqRAga1yKyoMtEoWPQ= -cloud.google.com/go/orgpolicy v1.4.0/go.mod h1:xrSLIV4RePWmP9P3tBl8S93lTmlAxjm06NSm2UTmKvE= -cloud.google.com/go/orgpolicy v1.5.0/go.mod h1:hZEc5q3wzwXJaKrsx5+Ewg0u1LxJ51nNFlext7Tanwc= -cloud.google.com/go/orgpolicy v1.10.0/go.mod h1:w1fo8b7rRqlXlIJbVhOMPrwVljyuW5mqssvBtU18ONc= -cloud.google.com/go/osconfig v1.7.0/go.mod h1:oVHeCeZELfJP7XLxcBGTMBvRO+1nQ5tFG9VQTmYS2Fs= -cloud.google.com/go/osconfig v1.8.0/go.mod h1:EQqZLu5w5XA7eKizepumcvWx+m8mJUhEwiPqWiZeEdg= -cloud.google.com/go/osconfig v1.9.0/go.mod h1:Yx+IeIZJ3bdWmzbQU4fxNl8xsZ4amB+dygAwFPlvnNo= -cloud.google.com/go/osconfig v1.10.0/go.mod h1:uMhCzqC5I8zfD9zDEAfvgVhDS8oIjySWh+l4WK6GnWw= -cloud.google.com/go/osconfig v1.11.0/go.mod h1:aDICxrur2ogRd9zY5ytBLV89KEgT2MKB2L/n6x1ooPw= -cloud.google.com/go/oslogin v1.4.0/go.mod h1:YdgMXWRaElXz/lDk1Na6Fh5orF7gvmJ0FGLIs9LId4E= -cloud.google.com/go/oslogin v1.5.0/go.mod h1:D260Qj11W2qx/HVF29zBg+0fd6YCSjSqLUkY/qEenQU= -cloud.google.com/go/oslogin v1.6.0/go.mod h1:zOJ1O3+dTU8WPlGEkFSh7qeHPPSoxrcMbbK1Nm2iX70= -cloud.google.com/go/oslogin v1.7.0/go.mod h1:e04SN0xO1UNJ1M5GP0vzVBFicIe4O53FOfcixIqTyXo= -cloud.google.com/go/oslogin v1.9.0/go.mod h1:HNavntnH8nzrn8JCTT5fj18FuJLFJc4NaZJtBnQtKFs= -cloud.google.com/go/phishingprotection v0.5.0/go.mod h1:Y3HZknsK9bc9dMi+oE8Bim0lczMU6hrX0UpADuMefr0= -cloud.google.com/go/phishingprotection v0.6.0/go.mod h1:9Y3LBLgy0kDTcYET8ZH3bq/7qni15yVUoAxiFxnlSUA= -cloud.google.com/go/phishingprotection v0.7.0/go.mod h1:8qJI4QKHoda/sb/7/YmMQ2omRLSLYSu9bU0EKCNI+Lk= -cloud.google.com/go/policytroubleshooter v1.3.0/go.mod h1:qy0+VwANja+kKrjlQuOzmlvscn4RNsAc0e15GGqfMxg= -cloud.google.com/go/policytroubleshooter v1.4.0/go.mod h1:DZT4BcRw3QoO8ota9xw/LKtPa8lKeCByYeKTIf/vxdE= -cloud.google.com/go/policytroubleshooter v1.5.0/go.mod h1:Rz1WfV+1oIpPdN2VvvuboLVRsB1Hclg3CKQ53j9l8vw= -cloud.google.com/go/policytroubleshooter v1.6.0/go.mod h1:zYqaPTsmfvpjm5ULxAyD/lINQxJ0DDsnWOP/GZ7xzBc= -cloud.google.com/go/privatecatalog v0.5.0/go.mod h1:XgosMUvvPyxDjAVNDYxJ7wBW8//hLDDYmnsNcMGq1K0= -cloud.google.com/go/privatecatalog v0.6.0/go.mod h1:i/fbkZR0hLN29eEWiiwue8Pb+GforiEIBnV9yrRUOKI= -cloud.google.com/go/privatecatalog v0.7.0/go.mod h1:2s5ssIFO69F5csTXcwBP7NPFTZvps26xGzvQ2PQaBYg= -cloud.google.com/go/privatecatalog v0.8.0/go.mod h1:nQ6pfaegeDAq/Q5lrfCQzQLhubPiZhSaNhIgfJlnIXs= cloud.google.com/go/pubsub v1.0.1/go.mod h1:R0Gpsv3s54REJCy4fxDixWD93lHJMoZTyQ2kNxGRt3I= cloud.google.com/go/pubsub v1.1.0/go.mod h1:EwwdRX2sKPjnvnqCa270oGRyludottCI76h+R3AArQw= cloud.google.com/go/pubsub v1.2.0/go.mod h1:jhfEVHT8odbXTkndysNHCcx0awwzvfOlguIAii9o8iA= cloud.google.com/go/pubsub v1.3.1/go.mod h1:i+ucay31+CNRpDW4Lu78I4xXG+O1r/MAHgjpRVR+TSU= -cloud.google.com/go/pubsub v1.26.0/go.mod h1:QgBH3U/jdJy/ftjPhTkyXNj543Tin1pRYcdcPRnFIRI= -cloud.google.com/go/pubsub v1.27.1/go.mod h1:hQN39ymbV9geqBnfQq6Xf63yNhUAhv9CZhzp5O6qsW0= -cloud.google.com/go/pubsub v1.28.0/go.mod h1:vuXFpwaVoIPQMGXqRyUQigu/AX1S3IWugR9xznmcXX8= -cloud.google.com/go/pubsub v1.30.0/go.mod h1:qWi1OPS0B+b5L+Sg6Gmc9zD1Y+HaM0MdUr7LsupY1P4= -cloud.google.com/go/pubsub v1.31.0/go.mod h1:dYmJ3K97NCQ/e4OwZ20rD4Ym3Bu8Gu9m/aJdWQjdcks= -cloud.google.com/go/pubsub v1.32.0 h1:JOEkgEYBuUTHSyHS4TcqOFuWr+vD6qO/imsFqShUCp4= -cloud.google.com/go/pubsublite v1.5.0/go.mod h1:xapqNQ1CuLfGi23Yda/9l4bBCKz/wC3KIJ5gKcxveZg= -cloud.google.com/go/pubsublite v1.6.0/go.mod h1:1eFCS0U11xlOuMFV/0iBqw3zP12kddMeCbj/F3FSj9k= -cloud.google.com/go/pubsublite v1.7.0/go.mod h1:8hVMwRXfDfvGm3fahVbtDbiLePT3gpoiJYJY+vxWxVM= -cloud.google.com/go/recaptchaenterprise v1.3.1/go.mod h1:OdD+q+y4XGeAlxRaMn1Y7/GveP6zmq76byL6tjPE7d4= -cloud.google.com/go/recaptchaenterprise/v2 v2.1.0/go.mod h1:w9yVqajwroDNTfGuhmOjPDN//rZGySaf6PtFVcSCa7o= -cloud.google.com/go/recaptchaenterprise/v2 v2.2.0/go.mod h1:/Zu5jisWGeERrd5HnlS3EUGb/D335f9k51B/FVil0jk= -cloud.google.com/go/recaptchaenterprise/v2 v2.3.0/go.mod h1:O9LwGCjrhGHBQET5CA7dd5NwwNQUErSgEDit1DLNTdo= -cloud.google.com/go/recaptchaenterprise/v2 v2.4.0/go.mod h1:Am3LHfOuBstrLrNCBrlI5sbwx9LBg3te2N6hGvHn2mE= -cloud.google.com/go/recaptchaenterprise/v2 v2.5.0/go.mod h1:O8LzcHXN3rz0j+LBC91jrwI3R+1ZSZEWrfL7XHgNo9U= -cloud.google.com/go/recaptchaenterprise/v2 v2.6.0/go.mod h1:RPauz9jeLtB3JVzg6nCbe12qNoaa8pXc4d/YukAmcnA= -cloud.google.com/go/recaptchaenterprise/v2 v2.7.0/go.mod h1:19wVj/fs5RtYtynAPJdDTb69oW0vNHYDBTbB4NvMD9c= -cloud.google.com/go/recommendationengine v0.5.0/go.mod h1:E5756pJcVFeVgaQv3WNpImkFP8a+RptV6dDLGPILjvg= -cloud.google.com/go/recommendationengine v0.6.0/go.mod h1:08mq2umu9oIqc7tDy8sx+MNJdLG0fUi3vaSVbztHgJ4= -cloud.google.com/go/recommendationengine v0.7.0/go.mod h1:1reUcE3GIu6MeBz/h5xZJqNLuuVjNg1lmWMPyjatzac= -cloud.google.com/go/recommender v1.5.0/go.mod h1:jdoeiBIVrJe9gQjwd759ecLJbxCDED4A6p+mqoqDvTg= -cloud.google.com/go/recommender v1.6.0/go.mod h1:+yETpm25mcoiECKh9DEScGzIRyDKpZ0cEhWGo+8bo+c= -cloud.google.com/go/recommender v1.7.0/go.mod h1:XLHs/W+T8olwlGOgfQenXBTbIseGclClff6lhFVe9Bs= -cloud.google.com/go/recommender v1.8.0/go.mod h1:PkjXrTT05BFKwxaUxQmtIlrtj0kph108r02ZZQ5FE70= -cloud.google.com/go/recommender v1.9.0/go.mod h1:PnSsnZY7q+VL1uax2JWkt/UegHssxjUVVCrX52CuEmQ= -cloud.google.com/go/redis v1.7.0/go.mod h1:V3x5Jq1jzUcg+UNsRvdmsfuFnit1cfe3Z/PGyq/lm4Y= -cloud.google.com/go/redis v1.8.0/go.mod h1:Fm2szCDavWzBk2cDKxrkmWBqoCiL1+Ctwq7EyqBCA/A= -cloud.google.com/go/redis v1.9.0/go.mod h1:HMYQuajvb2D0LvMgZmLDZW8V5aOC/WxstZHiy4g8OiA= -cloud.google.com/go/redis v1.10.0/go.mod h1:ThJf3mMBQtW18JzGgh41/Wld6vnDDc/F/F35UolRZPM= -cloud.google.com/go/redis v1.11.0/go.mod h1:/X6eicana+BWcUda5PpwZC48o37SiFVTFSs0fWAJ7uQ= -cloud.google.com/go/resourcemanager v1.3.0/go.mod h1:bAtrTjZQFJkiWTPDb1WBjzvc6/kifjj4QBYuKCCoqKA= -cloud.google.com/go/resourcemanager v1.4.0/go.mod h1:MwxuzkumyTX7/a3n37gmsT3py7LIXwrShilPh3P1tR0= -cloud.google.com/go/resourcemanager v1.5.0/go.mod h1:eQoXNAiAvCf5PXxWxXjhKQoTMaUSNrEfg+6qdf/wots= -cloud.google.com/go/resourcemanager v1.6.0/go.mod h1:YcpXGRs8fDzcUl1Xw8uOVmI8JEadvhRIkoXXUNVYcVo= -cloud.google.com/go/resourcemanager v1.7.0/go.mod h1:HlD3m6+bwhzj9XCouqmeiGuni95NTrExfhoSrkC/3EI= -cloud.google.com/go/resourcesettings v1.3.0/go.mod h1:lzew8VfESA5DQ8gdlHwMrqZs1S9V87v3oCnKCWoOuQU= -cloud.google.com/go/resourcesettings v1.4.0/go.mod h1:ldiH9IJpcrlC3VSuCGvjR5of/ezRrOxFtpJoJo5SmXg= -cloud.google.com/go/resourcesettings v1.5.0/go.mod h1:+xJF7QSG6undsQDfsCJyqWXyBwUoJLhetkRMDRnIoXA= -cloud.google.com/go/retail v1.8.0/go.mod h1:QblKS8waDmNUhghY2TI9O3JLlFk8jybHeV4BF19FrE4= -cloud.google.com/go/retail v1.9.0/go.mod h1:g6jb6mKuCS1QKnH/dpu7isX253absFl6iE92nHwlBUY= -cloud.google.com/go/retail v1.10.0/go.mod h1:2gDk9HsL4HMS4oZwz6daui2/jmKvqShXKQuB2RZ+cCc= -cloud.google.com/go/retail v1.11.0/go.mod h1:MBLk1NaWPmh6iVFSz9MeKG/Psyd7TAgm6y/9L2B4x9Y= -cloud.google.com/go/retail v1.12.0/go.mod h1:UMkelN/0Z8XvKymXFbD4EhFJlYKRx1FGhQkVPU5kF14= -cloud.google.com/go/run v0.2.0/go.mod h1:CNtKsTA1sDcnqqIFR3Pb5Tq0usWxJJvsWOCPldRU3Do= -cloud.google.com/go/run v0.3.0/go.mod h1:TuyY1+taHxTjrD0ZFk2iAR+xyOXEA0ztb7U3UNA0zBo= -cloud.google.com/go/run v0.8.0/go.mod h1:VniEnuBwqjigv0A7ONfQUaEItaiCRVujlMqerPPiktM= -cloud.google.com/go/run v0.9.0/go.mod h1:Wwu+/vvg8Y+JUApMwEDfVfhetv30hCG4ZwDR/IXl2Qg= -cloud.google.com/go/scheduler v1.4.0/go.mod h1:drcJBmxF3aqZJRhmkHQ9b3uSSpQoltBPGPxGAWROx6s= -cloud.google.com/go/scheduler v1.5.0/go.mod h1:ri073ym49NW3AfT6DZi21vLZrG07GXr5p3H1KxN5QlI= -cloud.google.com/go/scheduler v1.6.0/go.mod h1:SgeKVM7MIwPn3BqtcBntpLyrIJftQISRrYB5ZtT+KOk= -cloud.google.com/go/scheduler v1.7.0/go.mod h1:jyCiBqWW956uBjjPMMuX09n3x37mtyPJegEWKxRsn44= -cloud.google.com/go/scheduler v1.8.0/go.mod h1:TCET+Y5Gp1YgHT8py4nlg2Sew8nUHMqcpousDgXJVQc= -cloud.google.com/go/scheduler v1.9.0/go.mod h1:yexg5t+KSmqu+njTIh3b7oYPheFtBWGcbVUYF1GGMIc= -cloud.google.com/go/secretmanager v1.6.0/go.mod h1:awVa/OXF6IiyaU1wQ34inzQNc4ISIDIrId8qE5QGgKA= -cloud.google.com/go/secretmanager v1.8.0/go.mod h1:hnVgi/bN5MYHd3Gt0SPuTPPp5ENina1/LxM+2W9U9J4= -cloud.google.com/go/secretmanager v1.9.0/go.mod h1:b71qH2l1yHmWQHt9LC80akm86mX8AL6X1MA01dW8ht4= -cloud.google.com/go/secretmanager v1.10.0/go.mod h1:MfnrdvKMPNra9aZtQFvBcvRU54hbPD8/HayQdlUgJpU= -cloud.google.com/go/secretmanager v1.11.0/go.mod h1:qeQq0/jyJqrGeULu0GkRsVSPKTvf98AEqJnuEIQiJwA= -cloud.google.com/go/security v1.5.0/go.mod h1:lgxGdyOKKjHL4YG3/YwIL2zLqMFCKs0UbQwgyZmfJl4= -cloud.google.com/go/security v1.7.0/go.mod h1:mZklORHl6Bg7CNnnjLH//0UlAlaXqiG7Lb9PsPXLfD0= -cloud.google.com/go/security v1.8.0/go.mod h1:hAQOwgmaHhztFhiQ41CjDODdWP0+AE1B3sX4OFlq+GU= -cloud.google.com/go/security v1.9.0/go.mod h1:6Ta1bO8LXI89nZnmnsZGp9lVoVWXqsVbIq/t9dzI+2Q= -cloud.google.com/go/security v1.10.0/go.mod h1:QtOMZByJVlibUT2h9afNDWRZ1G96gVywH8T5GUSb9IA= -cloud.google.com/go/security v1.12.0/go.mod h1:rV6EhrpbNHrrxqlvW0BWAIawFWq3X90SduMJdFwtLB8= -cloud.google.com/go/security v1.13.0/go.mod h1:Q1Nvxl1PAgmeW0y3HTt54JYIvUdtcpYKVfIB8AOMZ+0= -cloud.google.com/go/securitycenter v1.13.0/go.mod h1:cv5qNAqjY84FCN6Y9z28WlkKXyWsgLO832YiWwkCWcU= -cloud.google.com/go/securitycenter v1.14.0/go.mod h1:gZLAhtyKv85n52XYWt6RmeBdydyxfPeTrpToDPw4Auc= -cloud.google.com/go/securitycenter v1.15.0/go.mod h1:PeKJ0t8MoFmmXLXWm41JidyzI3PJjd8sXWaVqg43WWk= -cloud.google.com/go/securitycenter v1.16.0/go.mod h1:Q9GMaLQFUD+5ZTabrbujNWLtSLZIZF7SAR0wWECrjdk= -cloud.google.com/go/securitycenter v1.18.1/go.mod h1:0/25gAzCM/9OL9vVx4ChPeM/+DlfGQJDwBy/UC8AKK0= -cloud.google.com/go/securitycenter v1.19.0/go.mod h1:LVLmSg8ZkkyaNy4u7HCIshAngSQ8EcIRREP3xBnyfag= -cloud.google.com/go/servicecontrol v1.4.0/go.mod h1:o0hUSJ1TXJAmi/7fLJAedOovnujSEvjKCAFNXPQ1RaU= -cloud.google.com/go/servicecontrol v1.5.0/go.mod h1:qM0CnXHhyqKVuiZnGKrIurvVImCs8gmqWsDoqe9sU1s= -cloud.google.com/go/servicecontrol v1.10.0/go.mod h1:pQvyvSRh7YzUF2efw7H87V92mxU8FnFDawMClGCNuAA= -cloud.google.com/go/servicecontrol v1.11.0/go.mod h1:kFmTzYzTUIuZs0ycVqRHNaNhgR+UMUpw9n02l/pY+mc= -cloud.google.com/go/servicecontrol v1.11.1/go.mod h1:aSnNNlwEFBY+PWGQ2DoM0JJ/QUXqV5/ZD9DOLB7SnUk= -cloud.google.com/go/servicedirectory v1.4.0/go.mod h1:gH1MUaZCgtP7qQiI+F+A+OpeKF/HQWgtAddhTbhL2bs= -cloud.google.com/go/servicedirectory v1.5.0/go.mod h1:QMKFL0NUySbpZJ1UZs3oFAmdvVxhhxB6eJ/Vlp73dfg= -cloud.google.com/go/servicedirectory v1.6.0/go.mod h1:pUlbnWsLH9c13yGkxCmfumWEPjsRs1RlmJ4pqiNjVL4= -cloud.google.com/go/servicedirectory v1.7.0/go.mod h1:5p/U5oyvgYGYejufvxhgwjL8UVXjkuw7q5XcG10wx1U= -cloud.google.com/go/servicedirectory v1.8.0/go.mod h1:srXodfhY1GFIPvltunswqXpVxFPpZjf8nkKQT7XcXaY= -cloud.google.com/go/servicedirectory v1.9.0/go.mod h1:29je5JjiygNYlmsGz8k6o+OZ8vd4f//bQLtvzkPPT/s= -cloud.google.com/go/servicemanagement v1.4.0/go.mod h1:d8t8MDbezI7Z2R1O/wu8oTggo3BI2GKYbdG4y/SJTco= -cloud.google.com/go/servicemanagement v1.5.0/go.mod h1:XGaCRe57kfqu4+lRxaFEAuqmjzF0r+gWHjWqKqBvKFo= -cloud.google.com/go/servicemanagement v1.6.0/go.mod h1:aWns7EeeCOtGEX4OvZUWCCJONRZeFKiptqKf1D0l/Jc= -cloud.google.com/go/servicemanagement v1.8.0/go.mod h1:MSS2TDlIEQD/fzsSGfCdJItQveu9NXnUniTrq/L8LK4= -cloud.google.com/go/serviceusage v1.3.0/go.mod h1:Hya1cozXM4SeSKTAgGXgj97GlqUvF5JaoXacR1JTP/E= -cloud.google.com/go/serviceusage v1.4.0/go.mod h1:SB4yxXSaYVuUBYUml6qklyONXNLt83U0Rb+CXyhjEeU= -cloud.google.com/go/serviceusage v1.5.0/go.mod h1:w8U1JvqUqwJNPEOTQjrMHkw3IaIFLoLsPLvsE3xueec= -cloud.google.com/go/serviceusage v1.6.0/go.mod h1:R5wwQcbOWsyuOfbP9tGdAnCAc6B9DRwPG1xtWMDeuPA= -cloud.google.com/go/shell v1.3.0/go.mod h1:VZ9HmRjZBsjLGXusm7K5Q5lzzByZmJHf1d0IWHEN5X4= -cloud.google.com/go/shell v1.4.0/go.mod h1:HDxPzZf3GkDdhExzD/gs8Grqk+dmYcEjGShZgYa9URw= -cloud.google.com/go/shell v1.6.0/go.mod h1:oHO8QACS90luWgxP3N9iZVuEiSF84zNyLytb+qE2f9A= -cloud.google.com/go/spanner v1.41.0/go.mod h1:MLYDBJR/dY4Wt7ZaMIQ7rXOTLjYrmxLE/5ve9vFfWos= -cloud.google.com/go/spanner v1.44.0/go.mod h1:G8XIgYdOK+Fbcpbs7p2fiprDw4CaZX63whnSMLVBxjk= -cloud.google.com/go/spanner v1.45.0/go.mod h1:FIws5LowYz8YAE1J8fOS7DJup8ff7xJeetWEo5REA2M= -cloud.google.com/go/speech v1.6.0/go.mod h1:79tcr4FHCimOp56lwC01xnt/WPJZc4v3gzyT7FoBkCM= -cloud.google.com/go/speech v1.7.0/go.mod h1:KptqL+BAQIhMsj1kOP2la5DSEEerPDuOP/2mmkhHhZQ= -cloud.google.com/go/speech v1.8.0/go.mod h1:9bYIl1/tjsAnMgKGHKmBZzXKEkGgtU+MpdDPTE9f7y0= -cloud.google.com/go/speech v1.9.0/go.mod h1:xQ0jTcmnRFFM2RfX/U+rk6FQNUF6DQlydUSyoooSpco= -cloud.google.com/go/speech v1.14.1/go.mod h1:gEosVRPJ9waG7zqqnsHpYTOoAS4KouMRLDFMekpJ0J0= -cloud.google.com/go/speech v1.15.0/go.mod h1:y6oH7GhqCaZANH7+Oe0BhgIogsNInLlz542tg3VqeYI= +cloud.google.com/go/pubsub v1.33.0 h1:6SPCPvWav64tj0sVX/+npCBKhUi/UjJehy9op/V3p2g= cloud.google.com/go/storage v1.0.0/go.mod h1:IhtSnM/ZTZV8YYJWCY8RULGVqBDmpoyjwiyrjsg+URw= cloud.google.com/go/storage v1.5.0/go.mod h1:tpKbwo567HUNpVclU5sGELwQWBDZ8gh0ZeosJ0Rtdos= cloud.google.com/go/storage v1.6.0/go.mod h1:N7U0C8pVQ/+NIKOBQyamJIeKQKkZ+mxpohlUTyfDhBk= @@ -561,99 +80,20 @@ cloud.google.com/go/storage v1.8.0/go.mod h1:Wv1Oy7z6Yz3DshWRJFhqM/UCfaWIRTdp0RX cloud.google.com/go/storage v1.10.0/go.mod h1:FLPqc6j+Ki4BU591ie1oL6qBQGu2Bl/tZ9ullr3+Kg0= cloud.google.com/go/storage v1.14.0/go.mod h1:GrKmX003DSIwi9o29oFT7YDnHYwZoctc3fOKtUw0Xmo= cloud.google.com/go/storage v1.22.1/go.mod h1:S8N1cAStu7BOeFfE8KAQzmyyLkK8p/vmRq6kuBTW58Y= -cloud.google.com/go/storage v1.23.0/go.mod h1:vOEEDNFnciUMhBeT6hsJIn3ieU5cFRmzeLgDvXzfIXc= -cloud.google.com/go/storage v1.27.0/go.mod h1:x9DOL8TK/ygDUMieqwfhdpQryTeEkhGKMi80i/iqR2s= -cloud.google.com/go/storage v1.28.1/go.mod h1:Qnisd4CqDdo6BGs2AD5LLnEsmSQ80wQ5ogcBBKhU86Y= -cloud.google.com/go/storage v1.29.0/go.mod h1:4puEjyTKnku6gfKoTfNOU/W+a9JyuVNxjpS5GBrB8h4= -cloud.google.com/go/storage v1.30.1/go.mod h1:NfxhC0UJE1aXSx7CIIbCf7y9HKT7BiccwkR7+P7gN8E= cloud.google.com/go/storage v1.31.0 h1:+S3LjjEN2zZ+L5hOwj4+1OkGCsLVe0NzpXKQ1pSdTCI= cloud.google.com/go/storage v1.31.0/go.mod h1:81ams1PrhW16L4kF7qg+4mTq7SRs5HsbDTM0bWvrwJ0= -cloud.google.com/go/storagetransfer v1.5.0/go.mod h1:dxNzUopWy7RQevYFHewchb29POFv3/AaBgnhqzqiK0w= -cloud.google.com/go/storagetransfer v1.6.0/go.mod h1:y77xm4CQV/ZhFZH75PLEXY0ROiS7Gh6pSKrM8dJyg6I= -cloud.google.com/go/storagetransfer v1.7.0/go.mod h1:8Giuj1QNb1kfLAiWM1bN6dHzfdlDAVC9rv9abHot2W4= -cloud.google.com/go/storagetransfer v1.8.0/go.mod h1:JpegsHHU1eXg7lMHkvf+KE5XDJ7EQu0GwNJbbVGanEw= -cloud.google.com/go/talent v1.1.0/go.mod h1:Vl4pt9jiHKvOgF9KoZo6Kob9oV4lwd/ZD5Cto54zDRw= -cloud.google.com/go/talent v1.2.0/go.mod h1:MoNF9bhFQbiJ6eFD3uSsg0uBALw4n4gaCaEjBw9zo8g= -cloud.google.com/go/talent v1.3.0/go.mod h1:CmcxwJ/PKfRgd1pBjQgU6W3YBwiewmUzQYH5HHmSCmM= -cloud.google.com/go/talent v1.4.0/go.mod h1:ezFtAgVuRf8jRsvyE6EwmbTK5LKciD4KVnHuDEFmOOA= -cloud.google.com/go/talent v1.5.0/go.mod h1:G+ODMj9bsasAEJkQSzO2uHQWXHHXUomArjWQQYkqK6c= -cloud.google.com/go/texttospeech v1.4.0/go.mod h1:FX8HQHA6sEpJ7rCMSfXuzBcysDAuWusNNNvN9FELDd8= -cloud.google.com/go/texttospeech v1.5.0/go.mod h1:oKPLhR4n4ZdQqWKURdwxMy0uiTS1xU161C8W57Wkea4= -cloud.google.com/go/texttospeech v1.6.0/go.mod h1:YmwmFT8pj1aBblQOI3TfKmwibnsfvhIBzPXcW4EBovc= -cloud.google.com/go/tpu v1.3.0/go.mod h1:aJIManG0o20tfDQlRIej44FcwGGl/cD0oiRyMKG19IQ= -cloud.google.com/go/tpu v1.4.0/go.mod h1:mjZaX8p0VBgllCzF6wcU2ovUXN9TONFLd7iz227X2Xg= -cloud.google.com/go/tpu v1.5.0/go.mod h1:8zVo1rYDFuW2l4yZVY0R0fb/v44xLh3llq7RuV61fPM= -cloud.google.com/go/trace v1.0.0/go.mod h1:4iErSByzxkyHWzzlAj63/Gmjz0NH1ASqhJguHpGcr6A= -cloud.google.com/go/trace v1.3.0/go.mod h1:FFUE83d9Ca57C+K8rDl/Ih8LwOzWIV1krKgxg6N0G28= -cloud.google.com/go/trace v1.4.0/go.mod h1:UG0v8UBqzusp+z63o7FK74SdFE+AXpCLdFb1rshXG+Y= -cloud.google.com/go/trace v1.8.0/go.mod h1:zH7vcsbAhklH8hWFig58HvxcxyQbaIqMarMg9hn5ECA= -cloud.google.com/go/trace v1.9.0/go.mod h1:lOQqpE5IaWY0Ixg7/r2SjixMuc6lfTFeO4QGM4dQWOk= -cloud.google.com/go/trace v1.10.0/go.mod h1:X3g0Th7+AIjj4rUVhv9JpMv7jpsRIJ9et+wYjCHYbQs= -cloud.google.com/go/translate v1.3.0/go.mod h1:gzMUwRjvOqj5i69y/LYLd8RrNQk+hOmIXTi9+nb3Djs= -cloud.google.com/go/translate v1.4.0/go.mod h1:06Dn/ppvLD6WvA5Rhdp029IX2Mi3Mn7fpMRLPvXT5Wg= -cloud.google.com/go/translate v1.5.0/go.mod h1:29YDSYveqqpA1CQFD7NQuP49xymq17RXNaUDdc0mNu0= -cloud.google.com/go/translate v1.6.0/go.mod h1:lMGRudH1pu7I3n3PETiOB2507gf3HnfLV8qlkHZEyos= -cloud.google.com/go/translate v1.7.0/go.mod h1:lMGRudH1pu7I3n3PETiOB2507gf3HnfLV8qlkHZEyos= -cloud.google.com/go/video v1.8.0/go.mod h1:sTzKFc0bUSByE8Yoh8X0mn8bMymItVGPfTuUBUyRgxk= -cloud.google.com/go/video v1.9.0/go.mod h1:0RhNKFRF5v92f8dQt0yhaHrEuH95m068JYOvLZYnJSw= -cloud.google.com/go/video v1.12.0/go.mod h1:MLQew95eTuaNDEGriQdcYn0dTwf9oWiA4uYebxM5kdg= -cloud.google.com/go/video v1.13.0/go.mod h1:ulzkYlYgCp15N2AokzKjy7MQ9ejuynOJdf1tR5lGthk= -cloud.google.com/go/video v1.14.0/go.mod h1:SkgaXwT+lIIAKqWAJfktHT/RbgjSuY6DobxEp0C5yTQ= -cloud.google.com/go/video v1.15.0/go.mod h1:SkgaXwT+lIIAKqWAJfktHT/RbgjSuY6DobxEp0C5yTQ= -cloud.google.com/go/videointelligence v1.6.0/go.mod h1:w0DIDlVRKtwPCn/C4iwZIJdvC69yInhW0cfi+p546uU= -cloud.google.com/go/videointelligence v1.7.0/go.mod h1:k8pI/1wAhjznARtVT9U1llUaFNPh7muw8QyOUpavru4= -cloud.google.com/go/videointelligence v1.8.0/go.mod h1:dIcCn4gVDdS7yte/w+koiXn5dWVplOZkE+xwG9FgK+M= -cloud.google.com/go/videointelligence v1.9.0/go.mod h1:29lVRMPDYHikk3v8EdPSaL8Ku+eMzDljjuvRs105XoU= -cloud.google.com/go/videointelligence v1.10.0/go.mod h1:LHZngX1liVtUhZvi2uNS0VQuOzNi2TkY1OakiuoUOjU= -cloud.google.com/go/vision v1.2.0/go.mod h1:SmNwgObm5DpFBme2xpyOyasvBc1aPdjvMk2bBk0tKD0= -cloud.google.com/go/vision/v2 v2.2.0/go.mod h1:uCdV4PpN1S0jyCyq8sIM42v2Y6zOLkZs+4R9LrGYwFo= -cloud.google.com/go/vision/v2 v2.3.0/go.mod h1:UO61abBx9QRMFkNBbf1D8B1LXdS2cGiiCRx0vSpZoUo= -cloud.google.com/go/vision/v2 v2.4.0/go.mod h1:VtI579ll9RpVTrdKdkMzckdnwMyX2JILb+MhPqRbPsY= -cloud.google.com/go/vision/v2 v2.5.0/go.mod h1:MmaezXOOE+IWa+cS7OhRRLK2cNv1ZL98zhqFFZaaH2E= -cloud.google.com/go/vision/v2 v2.6.0/go.mod h1:158Hes0MvOS9Z/bDMSFpjwsUrZ5fPrdwuyyvKSGAGMY= -cloud.google.com/go/vision/v2 v2.7.0/go.mod h1:H89VysHy21avemp6xcf9b9JvZHVehWbET0uT/bcuY/0= -cloud.google.com/go/vmmigration v1.2.0/go.mod h1:IRf0o7myyWFSmVR1ItrBSFLFD/rJkfDCUTO4vLlJvsE= -cloud.google.com/go/vmmigration v1.3.0/go.mod h1:oGJ6ZgGPQOFdjHuocGcLqX4lc98YQ7Ygq8YQwHh9A7g= -cloud.google.com/go/vmmigration v1.5.0/go.mod h1:E4YQ8q7/4W9gobHjQg4JJSgXXSgY21nA5r8swQV+Xxc= -cloud.google.com/go/vmmigration v1.6.0/go.mod h1:bopQ/g4z+8qXzichC7GW1w2MjbErL54rk3/C843CjfY= -cloud.google.com/go/vmwareengine v0.1.0/go.mod h1:RsdNEf/8UDvKllXhMz5J40XxDrNJNN4sagiox+OI208= -cloud.google.com/go/vmwareengine v0.2.2/go.mod h1:sKdctNJxb3KLZkE/6Oui94iw/xs9PRNC2wnNLXsHvH8= -cloud.google.com/go/vmwareengine v0.3.0/go.mod h1:wvoyMvNWdIzxMYSpH/R7y2h5h3WFkx6d+1TIsP39WGY= -cloud.google.com/go/vpcaccess v1.4.0/go.mod h1:aQHVbTWDYUR1EbTApSVvMq1EnT57ppDmQzZ3imqIk4w= -cloud.google.com/go/vpcaccess v1.5.0/go.mod h1:drmg4HLk9NkZpGfCmZ3Tz0Bwnm2+DKqViEpeEpOq0m8= -cloud.google.com/go/vpcaccess v1.6.0/go.mod h1:wX2ILaNhe7TlVa4vC5xce1bCnqE3AeH27RV31lnmZes= -cloud.google.com/go/webrisk v1.4.0/go.mod h1:Hn8X6Zr+ziE2aNd8SliSDWpEnSS1u4R9+xXZmFiHmGE= -cloud.google.com/go/webrisk v1.5.0/go.mod h1:iPG6fr52Tv7sGk0H6qUFzmL3HHZev1htXuWDEEsqMTg= -cloud.google.com/go/webrisk v1.6.0/go.mod h1:65sW9V9rOosnc9ZY7A7jsy1zoHS5W9IAXv6dGqhMQMc= -cloud.google.com/go/webrisk v1.7.0/go.mod h1:mVMHgEYH0r337nmt1JyLthzMr6YxwN1aAIEc2fTcq7A= -cloud.google.com/go/webrisk v1.8.0/go.mod h1:oJPDuamzHXgUc+b8SiHRcVInZQuybnvEW72PqTc7sSg= -cloud.google.com/go/websecurityscanner v1.3.0/go.mod h1:uImdKm2wyeXQevQJXeh8Uun/Ym1VqworNDlBXQevGMo= -cloud.google.com/go/websecurityscanner v1.4.0/go.mod h1:ebit/Fp0a+FWu5j4JOmJEV8S8CzdTkAS77oDsiSqYWQ= -cloud.google.com/go/websecurityscanner v1.5.0/go.mod h1:Y6xdCPy81yi0SQnDY1xdNTNpfY1oAgXUlcfN3B3eSng= -cloud.google.com/go/workflows v1.6.0/go.mod h1:6t9F5h/unJz41YqfBmqSASJSXccBLtD1Vwf+KmJENM0= -cloud.google.com/go/workflows v1.7.0/go.mod h1:JhSrZuVZWuiDfKEFxU0/F1PQjmpnpcoISEXH2bcHC3M= -cloud.google.com/go/workflows v1.8.0/go.mod h1:ysGhmEajwZxGn1OhGOGKsTXc5PyxOc0vfKf5Af+to4M= -cloud.google.com/go/workflows v1.9.0/go.mod h1:ZGkj1aFIOd9c8Gerkjjq7OW7I5+l6cSvT3ujaO/WwSA= -cloud.google.com/go/workflows v1.10.0/go.mod h1:fZ8LmRmZQWacon9UCX1r/g/DfAXx5VcPALq2CxzdePw= -code.cloudfoundry.org/clock v0.0.0-20180518195852-02e53af36e6c/go.mod h1:QD9Lzhd/ux6eNQVUDVRJX/RKTigpewimNYBi7ivZKY8= code.gitea.io/sdk/gitea v0.15.1 h1:WJreC7YYuxbn0UDaPuWIe/mtiNKTvLN8MLkaw71yx/M= -contrib.go.opencensus.io/exporter/aws v0.0.0-20230502192102-15967c811cec/go.mod h1:uu1P0UCM/6RbsMrgPa98ll8ZcHM858i/AD06a9aLRCA= contrib.go.opencensus.io/exporter/ocagent v0.7.1-0.20200907061046-05415f1de66d h1:LblfooH1lKOpp1hIhukktmSAxFkqMPFk9KR6iZ0MJNI= contrib.go.opencensus.io/exporter/ocagent v0.7.1-0.20200907061046-05415f1de66d/go.mod h1:IshRmMJBhDfFj5Y67nVhMYTTIze91RUeT73ipWKs/GY= contrib.go.opencensus.io/exporter/prometheus v0.4.0 h1:0QfIkj9z/iVZgK31D9H9ohjjIDApI2GOPScCKwxedbs= contrib.go.opencensus.io/exporter/prometheus v0.4.0/go.mod h1:o7cosnyfuPVK0tB8q0QmaQNhGnptITnPQB+z1+qeFB0= -contrib.go.opencensus.io/exporter/stackdriver v0.13.14/go.mod h1:5pSSGY0Bhuk7waTHuDf4aQ8D2DrhgETRo9fy6k3Xlzc= -contrib.go.opencensus.io/integrations/ocsql v0.1.7/go.mod h1:8DsSdjz3F+APR+0z0WkU1aRorQCFfRxvqjUUPMbF3fE= dmitri.shuralyov.com/gpu/mtl v0.0.0-20190408044501-666a987793e9/go.mod h1:H6x//7gZCb22OMCxBHrMx7a5I7Hp++hsVxbQ4BYO7hU= filippo.io/edwards25519 v1.0.0 h1:0wAIcmJUqRdI8IJ/3eGi5/HwXZWPujYXXlkrQogz0Ek= filippo.io/edwards25519 v1.0.0/go.mod h1:N1IkdkCkiLB6tki+MYJoSx2JTY9NUlxZE7eHn5EwJns= -gioui.org v0.0.0-20210308172011-57750fc8a0a6/go.mod h1:RSH6KIUZ0p2xy5zHDxgAM4zumjgTw83q2ge/PI+yyw8= -git.sr.ht/~sbinet/gg v0.3.1/go.mod h1:KGYtlADtqsqANL9ueOFkWymvzUvLMQllU5Ixo+8v3pc= github.com/4meepo/tagalign v1.2.2 h1:kQeUTkFTaBRtd/7jm8OKJl9iHk0gAO+TDFPHGSna0aw= github.com/4meepo/tagalign v1.2.2/go.mod h1:Q9c1rYMZJc9dPRkbQPpcBNCLEmY2njbAsXhQOZFE2dE= github.com/Abirdcfly/dupword v0.0.11 h1:z6v8rMETchZXUIuHxYNmlUAuKuB21PeaSymTed16wgU= github.com/Abirdcfly/dupword v0.0.11/go.mod h1:wH8mVGuf3CP5fsBTkfWwwwKTjDnVVCxtU8d8rgeVYXA= -github.com/AdaLogics/go-fuzz-headers v0.0.0-20210715213245-6c3934b029d8/go.mod h1:CzsSbkDixRphAF5hS6wbMKq0eI6ccJRb7/A0M6JBnwg= github.com/AdamKorcz/go-fuzz-headers-1 v0.0.0-20230618160516-e936619f9f18 h1:rd389Q26LMy03gG4anandGFC2LW/xvjga5GezeeaxQk= github.com/AliyunContainerService/ack-ram-tool/pkg/credentials/alibabacloudsdkgo/helper v0.2.0 h1:8+4G8JaejP8Xa6W46PzJEwisNgBXMvFcz78N6zG/ARw= github.com/AliyunContainerService/ack-ram-tool/pkg/credentials/alibabacloudsdkgo/helper v0.2.0/go.mod h1:GgeIE+1be8Ivm7Sh4RgwI42aTtC9qrcj+Y9Y6CjJhJs= @@ -661,59 +101,29 @@ github.com/Antonboom/errname v0.1.10 h1:RZ7cYo/GuZqjr1nuJLNe8ZH+a+Jd9DaZzttWzak9 github.com/Antonboom/errname v0.1.10/go.mod h1:xLeiCIrvVNpUtsN0wxAh05bNIZpqE22/qDMnTBTttiA= github.com/Antonboom/nilnil v0.1.5 h1:X2JAdEVcbPaOom2TUa1FxZ3uyuUlex0XMLGYMemu6l0= github.com/Antonboom/nilnil v0.1.5/go.mod h1:I24toVuBKhfP5teihGWctrRiPbRKHwZIFOvc6v3HZXk= -github.com/Azure/azure-amqp-common-go/v3 v3.2.3/go.mod h1:7rPmbSfszeovxGfc5fSAXE4ehlXQZHpMja2OtxC2Tas= github.com/Azure/azure-sdk-for-go v16.2.1+incompatible/go.mod h1:9XXNKU+eRnpl9moKnB4QOLf1HestfXbmab5FXxiDBjc= -github.com/Azure/azure-sdk-for-go v63.0.0+incompatible/go.mod h1:9XXNKU+eRnpl9moKnB4QOLf1HestfXbmab5FXxiDBjc= -github.com/Azure/azure-sdk-for-go v65.0.0+incompatible/go.mod h1:9XXNKU+eRnpl9moKnB4QOLf1HestfXbmab5FXxiDBjc= -github.com/Azure/azure-sdk-for-go v66.0.0+incompatible/go.mod h1:9XXNKU+eRnpl9moKnB4QOLf1HestfXbmab5FXxiDBjc= github.com/Azure/azure-sdk-for-go v68.0.0+incompatible h1:fcYLmCpyNYRnvJbPerq7U0hS+6+I79yEDJBqVNcqUzU= github.com/Azure/azure-sdk-for-go v68.0.0+incompatible/go.mod h1:9XXNKU+eRnpl9moKnB4QOLf1HestfXbmab5FXxiDBjc= -github.com/Azure/azure-sdk-for-go/sdk/azcore v1.0.0/go.mod h1:uGG2W01BaETf0Ozp+QxxKJdMBNRWPdstHG0Fmdwn1/U= -github.com/Azure/azure-sdk-for-go/sdk/azcore v1.1.2/go.mod h1:uGG2W01BaETf0Ozp+QxxKJdMBNRWPdstHG0Fmdwn1/U= -github.com/Azure/azure-sdk-for-go/sdk/azcore v1.3.0/go.mod h1:tZoQYdDZNOiIjdSn0dVWVfl0NEPGOJqVLzSrcFk4Is0= -github.com/Azure/azure-sdk-for-go/sdk/azcore v1.4.0/go.mod h1:ON4tFdPTwRcgWEaVDrN3584Ef+b7GgSJaXxe5fW9t4M= -github.com/Azure/azure-sdk-for-go/sdk/azcore v1.6.0/go.mod h1:bjGvMhVMb+EEm3VRNQawDMUyMMjo+S5ewNjflkep/0Q= -github.com/Azure/azure-sdk-for-go/sdk/azcore v1.6.1/go.mod h1:bjGvMhVMb+EEm3VRNQawDMUyMMjo+S5ewNjflkep/0Q= github.com/Azure/azure-sdk-for-go/sdk/azcore v1.7.0 h1:8q4SaHjFsClSvuVne0ID/5Ka8u3fcIHyqkLjcFpNRHQ= github.com/Azure/azure-sdk-for-go/sdk/azcore v1.7.0/go.mod h1:bjGvMhVMb+EEm3VRNQawDMUyMMjo+S5ewNjflkep/0Q= -github.com/Azure/azure-sdk-for-go/sdk/azidentity v1.0.0/go.mod h1:+6sju8gk8FRmSajX3Oz4G5Gm7P+mbqE9FVaXXFYTkCM= -github.com/Azure/azure-sdk-for-go/sdk/azidentity v1.1.0/go.mod h1:bhXu1AjYL+wutSL/kpSq6s7733q2Rb0yuot9Zgfqa/0= -github.com/Azure/azure-sdk-for-go/sdk/azidentity v1.2.1/go.mod h1:gLa1CL2RNE4s7M3yopJ/p0iq5DdY6Yv5ZUt9MTRZOQM= github.com/Azure/azure-sdk-for-go/sdk/azidentity v1.3.0 h1:vcYCAze6p19qBW7MhZybIsqD8sMV8js0NyQM8JDnVtg= github.com/Azure/azure-sdk-for-go/sdk/azidentity v1.3.0/go.mod h1:OQeznEEkTZ9OrhHJoDD8ZDq51FHgXjqtP9z6bEwBq9U= -github.com/Azure/azure-sdk-for-go/sdk/internal v1.0.0/go.mod h1:eWRD7oawr1Mu1sLCawqVc0CUiF43ia3qQMxLscsKQ9w= -github.com/Azure/azure-sdk-for-go/sdk/internal v1.1.1/go.mod h1:eWRD7oawr1Mu1sLCawqVc0CUiF43ia3qQMxLscsKQ9w= -github.com/Azure/azure-sdk-for-go/sdk/internal v1.1.2/go.mod h1:eWRD7oawr1Mu1sLCawqVc0CUiF43ia3qQMxLscsKQ9w= -github.com/Azure/azure-sdk-for-go/sdk/internal v1.2.0/go.mod h1:eWRD7oawr1Mu1sLCawqVc0CUiF43ia3qQMxLscsKQ9w= github.com/Azure/azure-sdk-for-go/sdk/internal v1.3.0 h1:sXr+ck84g/ZlZUOZiNELInmMgOsuGwdjjVkEIde0OtY= github.com/Azure/azure-sdk-for-go/sdk/internal v1.3.0/go.mod h1:okt5dMMTOFjX/aovMlrjvvXoPMBVSPzk9185BT0+eZM= -github.com/Azure/azure-sdk-for-go/sdk/keyvault/azkeys v0.10.0/go.mod h1:Pu5Zksi2KrU7LPbZbNINx6fuVrUp/ffvpxdDj+i8LeE= -github.com/Azure/azure-sdk-for-go/sdk/keyvault/internal v0.7.1/go.mod h1:9V2j0jn9jDEkCkv8w/bKTNppX/d0FVA1ud77xCIP4KA= -github.com/Azure/azure-sdk-for-go/sdk/messaging/azservicebus v1.4.0/go.mod h1:pXDkeh10bAqElvd+S5Ppncj+DCKvJGXNa8rRT2R7rIw= github.com/Azure/azure-sdk-for-go/sdk/security/keyvault/azkeys v0.12.0 h1:4Kynh6Hn2ekyIsBgNQJb3dn1+/MyvzfUJebti2emB/A= github.com/Azure/azure-sdk-for-go/sdk/security/keyvault/azkeys v0.12.0/go.mod h1:Q28U+75mpCaSCDowNEmhIo/rmgdkqmkmzI7N6TGR4UY= github.com/Azure/azure-sdk-for-go/sdk/security/keyvault/internal v0.8.0 h1:T028gtTPiYt/RMUfs8nVsAL7FDQrfLlrm/NnRG/zcC4= github.com/Azure/azure-sdk-for-go/sdk/security/keyvault/internal v0.8.0/go.mod h1:cw4zVQgBby0Z5f2v0itn6se2dDP17nTjbZFXW5uPyHA= -github.com/Azure/azure-sdk-for-go/sdk/storage/azblob v1.0.0/go.mod h1:2e8rMJtl2+2j+HXbTBwnyGpm5Nou7KhvSfxOq8JpTag= -github.com/Azure/go-amqp v0.17.0/go.mod h1:9YJ3RhxRT1gquYnzpZO1vcYMMpAdJT+QEg6fwmw9Zlg= -github.com/Azure/go-amqp v1.0.0/go.mod h1:+bg0x3ce5+Q3ahCEXnCsGG3ETpDQe3MEVnOuT2ywPwc= -github.com/Azure/go-amqp v1.0.1/go.mod h1:+bg0x3ce5+Q3ahCEXnCsGG3ETpDQe3MEVnOuT2ywPwc= github.com/Azure/go-ansiterm v0.0.0-20170929234023-d6e3b3328b78/go.mod h1:LmzpDX56iTiv29bbRTIsUNlaFfuhWRQBWjQdVyAevI8= -github.com/Azure/go-ansiterm v0.0.0-20210608223527-2377c96fe795/go.mod h1:LmzpDX56iTiv29bbRTIsUNlaFfuhWRQBWjQdVyAevI8= -github.com/Azure/go-ansiterm v0.0.0-20210617225240-d185dfc1b5a1/go.mod h1:xomTg63KZ2rFqZQzSB4Vz2SUXa1BpHTVz9L5PTmPC4E= github.com/Azure/go-autorest v10.8.1+incompatible/go.mod h1:r+4oMnoxhatjLLJ6zxSWATqVooLgysK6ZNox3g/xq24= github.com/Azure/go-autorest v14.2.0+incompatible h1:V5VMDjClD3GiElqLWO7mz2MxNAK/vTfRHdAubSIPRgs= github.com/Azure/go-autorest v14.2.0+incompatible/go.mod h1:r+4oMnoxhatjLLJ6zxSWATqVooLgysK6ZNox3g/xq24= github.com/Azure/go-autorest/autorest v0.11.1/go.mod h1:JFgpikqFJ/MleTTxwepExTKnFUKKszPS8UavbQYUMuw= -github.com/Azure/go-autorest/autorest v0.11.18/go.mod h1:dSiJPy22c3u0OtOKDNttNgqpNFY/GeWa7GH/Pz56QRA= github.com/Azure/go-autorest/autorest v0.11.24/go.mod h1:G6kyRlFnTuSbEYkQGawPfsCswgme4iYf6rfSKUDzbCc= -github.com/Azure/go-autorest/autorest v0.11.25/go.mod h1:7l8ybrIdUmGqZMTD0sRtAr8NvbHjfofbf8RSP2q7w7U= -github.com/Azure/go-autorest/autorest v0.11.28/go.mod h1:MrkzG3Y3AH668QyF9KRk5neJnGgmhQ6krbhR8Q5eMvA= github.com/Azure/go-autorest/autorest v0.11.29 h1:I4+HL/JDvErx2LjyzaVxllw2lRDB5/BT2Bm4g20iqYw= github.com/Azure/go-autorest/autorest v0.11.29/go.mod h1:ZtEzC4Jy2JDrZLxvWs8LrBWEBycl1hbT1eknI8MtfAs= github.com/Azure/go-autorest/autorest/adal v0.9.0/go.mod h1:/c022QCutn2P7uY+/oQWWNcK9YU+MH96NgK+jErpbcg= github.com/Azure/go-autorest/autorest/adal v0.9.5/go.mod h1:B7KF7jKIeC9Mct5spmyCB/A8CG/sEz1vwIRGv/bbw7A= -github.com/Azure/go-autorest/autorest/adal v0.9.13/go.mod h1:W/MM4U6nLxnIskrw4UwWzlHfGjwUS50aOsc/I3yuU8M= github.com/Azure/go-autorest/autorest/adal v0.9.18/go.mod h1:XVVeme+LZwABT8K5Lc3hA4nAe8LDBVle26gTrguhhPQ= github.com/Azure/go-autorest/autorest/adal v0.9.22/go.mod h1:XuAbAEUv2Tta//+voMI038TrJBqjKam0me7qR+L8Cmk= github.com/Azure/go-autorest/autorest/adal v0.9.23 h1:Yepx8CvFxwNKpH6ja7RZ+sKX+DWYNldbLiALMC3BTz8= @@ -729,16 +139,11 @@ github.com/Azure/go-autorest/autorest/mocks v0.4.0/go.mod h1:LTp+uSrOhSkaKrUy935 github.com/Azure/go-autorest/autorest/mocks v0.4.1/go.mod h1:LTp+uSrOhSkaKrUy935gNZuuIPPVsHlr9DSOxSayd+k= github.com/Azure/go-autorest/autorest/mocks v0.4.2 h1:PGN4EDXnuQbojHbU0UWoNvmu9AGVwYHG9/fkDYhtAfw= github.com/Azure/go-autorest/autorest/mocks v0.4.2/go.mod h1:Vy7OitM9Kei0i1Oj+LvyAWMXJHeKH1MVlzFugfVrmyU= -github.com/Azure/go-autorest/autorest/to v0.4.0/go.mod h1:fE8iZBn7LQR7zH/9XU2NcPR4o9jEImooCeWJcYV/zLE= -github.com/Azure/go-autorest/autorest/validation v0.3.1/go.mod h1:yhLgjC0Wda5DYXl6JAsWyUe4KVNffhoDhG0zVzUMo3E= github.com/Azure/go-autorest/logger v0.2.0/go.mod h1:T9E3cAhj2VqvPOtCYAvby9aBXkZmbF5NWuPV8+WeEW8= github.com/Azure/go-autorest/logger v0.2.1 h1:IG7i4p/mDa2Ce4TRyAO8IHnVhAVF3RFU+ZtXWSmf4Tg= github.com/Azure/go-autorest/logger v0.2.1/go.mod h1:T9E3cAhj2VqvPOtCYAvby9aBXkZmbF5NWuPV8+WeEW8= github.com/Azure/go-autorest/tracing v0.6.0 h1:TYi4+3m5t6K48TGI9AUdb+IzbnSxvnvUMfuitfgcfuo= github.com/Azure/go-autorest/tracing v0.6.0/go.mod h1:+vhtPC754Xsa23ID7GlGsrdKBpUA79WCAKPPZVC2DeU= -github.com/AzureAD/microsoft-authentication-library-for-go v0.4.0/go.mod h1:Vt9sXTKwMyGcOxSmLDMnGPgqsUg7m8pe215qMLrDXw4= -github.com/AzureAD/microsoft-authentication-library-for-go v0.5.1/go.mod h1:Vt9sXTKwMyGcOxSmLDMnGPgqsUg7m8pe215qMLrDXw4= -github.com/AzureAD/microsoft-authentication-library-for-go v0.8.1/go.mod h1:4qFor3D/HDsvBME35Xy9rwW9DecL+M2sNw1ybjPtwA0= github.com/AzureAD/microsoft-authentication-library-for-go v1.0.0 h1:OBhqkivkhkMqLPymWEppkm7vgPQY2XsHoEkaMQ0AdZY= github.com/AzureAD/microsoft-authentication-library-for-go v1.0.0/go.mod h1:kgDmCTgBzIEPFElEF+FK0SdjAor06dRq2Go927dnQ6o= github.com/BurntSushi/toml v0.3.1/go.mod h1:xHWCNGjB5oqiDr8zfno3MHue2Ht5sIBksp03qcyfWMU= @@ -746,19 +151,12 @@ github.com/BurntSushi/toml v1.2.1/go.mod h1:CxXYINrC8qIiEnFrOxCa7Jy5BFHlXnUU2pbi github.com/BurntSushi/toml v1.3.2 h1:o7IhLm0Msx3BaB+n3Ag7L8EVlByGnpq14C4YWiu/gL8= github.com/BurntSushi/toml v1.3.2/go.mod h1:CxXYINrC8qIiEnFrOxCa7Jy5BFHlXnUU2pbicEuybxQ= github.com/BurntSushi/xgb v0.0.0-20160522181843-27f122750802/go.mod h1:IVnqGOEym/WlBOVXweHU+Q+/VP0lqqI8lqeDx9IjBqo= -github.com/DataDog/datadog-go v3.2.0+incompatible/go.mod h1:LButxg5PwREeZtORoXG3tL4fMGNddJ+vMq1mwgfaqoQ= github.com/Djarvur/go-err113 v0.0.0-20210108212216-aea10b59be24 h1:sHglBQTwgx+rWPdisA5ynNEsoARbiCBOyGcJM4/OzsM= github.com/Djarvur/go-err113 v0.0.0-20210108212216-aea10b59be24/go.mod h1:4UJr5HIiMZrwgkSPdsjy2uOQExX/WEILpIrO9UPGuXs= github.com/GaijinEntertainment/go-exhaustruct/v2 v2.3.0 h1:+r1rSv4gvYn0wmRjC8X7IAzX8QezqtFV9m0MUHFJgts= github.com/GaijinEntertainment/go-exhaustruct/v2 v2.3.0/go.mod h1:b3g59n2Y+T5xmcxJL+UEG2f8cQploZm1mR/v6BW0mU0= -github.com/GoogleCloudPlatform/cloudsql-proxy v1.33.7/go.mod h1:JBp/RvKNOoIkR5BdMSXswBksHcPZ/41sbBV+GhSjgMY= -github.com/HdrHistogram/hdrhistogram-go v1.1.0/go.mod h1:yDgFjdqOqDEKOvasDdhWNXYg9BVp4O+o5f6V/ehm6Oo= -github.com/HdrHistogram/hdrhistogram-go v1.1.2/go.mod h1:yDgFjdqOqDEKOvasDdhWNXYg9BVp4O+o5f6V/ehm6Oo= -github.com/JohnCGriffin/overflow v0.0.0-20211019200055-46fa312c352c/go.mod h1:X0CRv0ky0k6m906ixxpzmDRLvX58TFUKS2eePweuyxk= -github.com/Knetic/govaluate v3.0.1-0.20171022003610-9aa49832a739+incompatible/go.mod h1:r7JcOSlj0wfOMncg0iLm8Leh48TZaKVeNIfJntJ2wa0= github.com/Masterminds/semver v1.5.0 h1:H65muMkzWKEuNDnfl9d70GUjFniHKHRbFPGBuZ3QEww= github.com/Masterminds/semver v1.5.0/go.mod h1:MB6lktGJrhw8PrUyiEoblNEGEQ+RzHPF078ddwwvV3Y= -github.com/Masterminds/semver/v3 v3.1.1/go.mod h1:VPu/7SZ7ePZ3QOrcuXROw5FAcLl4a0cBrbBpGY/8hQs= github.com/Microsoft/go-winio v0.4.11/go.mod h1:VhR8bwka0BXejwEJY73c50VrPtXAaKcyvVC4A4RozmA= github.com/Microsoft/go-winio v0.4.14/go.mod h1:qXqCSQ3Xa7+6tgxaGTIe4Kpcdsi+P8jBhyzoq1bpyYA= github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5/go.mod h1:tTuCMEN+UleMWgg9dVx4Hu52b1bJo+59jBh3ajtinzw= @@ -768,9 +166,7 @@ github.com/Microsoft/go-winio v0.4.17-0.20210211115548-6eac466e5fa3/go.mod h1:JP github.com/Microsoft/go-winio v0.4.17-0.20210324224401-5516f17a5958/go.mod h1:JPGBdM1cNvN/6ISo+n8V5iA4v8pBzdOpzfwIujj1a84= github.com/Microsoft/go-winio v0.4.17/go.mod h1:JPGBdM1cNvN/6ISo+n8V5iA4v8pBzdOpzfwIujj1a84= github.com/Microsoft/go-winio v0.5.0/go.mod h1:JPGBdM1cNvN/6ISo+n8V5iA4v8pBzdOpzfwIujj1a84= -github.com/Microsoft/go-winio v0.5.1/go.mod h1:JPGBdM1cNvN/6ISo+n8V5iA4v8pBzdOpzfwIujj1a84= github.com/Microsoft/go-winio v0.5.2/go.mod h1:WpS1mjBmmwHBEWmogvA2mj8546UReBk4v8QkMxJ6pZY= -github.com/Microsoft/go-winio v0.6.0/go.mod h1:cTAf44im0RAYeL23bpB+fzCyDH2MJiz2BO69KH/soAE= github.com/Microsoft/go-winio v0.6.1 h1:9/kr64B9VUZrLm5YYwbGtUJnMgqWVOdUAXu6Migciow= github.com/Microsoft/go-winio v0.6.1/go.mod h1:LRdKpFKfdobln8UmuiYcKPot9D2v6svN5+sAH+4kjUM= github.com/Microsoft/hcsshim v0.8.6/go.mod h1:Op3hHsoHPAvb6lceZHDtd9OkTew38wNoXnJs8iY7rUg= @@ -780,54 +176,34 @@ github.com/Microsoft/hcsshim v0.8.9/go.mod h1:5692vkUqntj1idxauYlpoINNKeqCiG6Sg3 github.com/Microsoft/hcsshim v0.8.14/go.mod h1:NtVKoYxQuTLx6gEq0L96c9Ju4JbRJ4nY2ow3VK6a9Lg= github.com/Microsoft/hcsshim v0.8.15/go.mod h1:x38A4YbHbdxJtc0sF6oIz+RG0npwSCAvn69iY6URG00= github.com/Microsoft/hcsshim v0.8.16/go.mod h1:o5/SZqmR7x9JNKsW3pu+nqHm0MF8vbA+VxGOoXdC600= -github.com/Microsoft/hcsshim v0.8.20/go.mod h1:+w2gRZ5ReXQhFOrvSQeNfhrYB/dg3oDwTOcER2fw4I4= -github.com/Microsoft/hcsshim v0.8.21/go.mod h1:+w2gRZ5ReXQhFOrvSQeNfhrYB/dg3oDwTOcER2fw4I4= -github.com/Microsoft/hcsshim v0.8.23/go.mod h1:4zegtUJth7lAvFyc6cH2gGQ5B3OFQim01nnU2M8jKDg= -github.com/Microsoft/hcsshim v0.9.2/go.mod h1:7pLA8lDk46WKDWlVsENo92gC0XFa8rbKfyFRBqxEbCc= github.com/Microsoft/hcsshim/test v0.0.0-20201218223536-d3e5debf77da/go.mod h1:5hlzMzRKMLyo42nCZ9oml8AdTlq/0cvIaBv6tK1RehU= github.com/Microsoft/hcsshim/test v0.0.0-20210227013316-43a75bb4edd3/go.mod h1:mw7qgWloBUl75W/gVH3cQszUg1+gUITj7D6NY7ywVnY= github.com/NYTimes/gziphandler v0.0.0-20170623195520-56545f4a5d46/go.mod h1:3wb06e3pkSAbeQ52E9H9iFoQsEEwGN64994WTCIhntQ= -github.com/NYTimes/gziphandler v1.1.1/go.mod h1:n/CVRwUEOgIxrgPvAQhUUr9oeUtvrhMomdKFjzJNB0c= github.com/OneOfOne/xxhash v1.2.2/go.mod h1:HSdplMjZKSmBqAxg5vPj2TmRDmfkzw+cTzAElWljhcU= github.com/OpenPeeDeeP/depguard/v2 v2.1.0 h1:aQl70G173h/GZYhWf36aE5H0KaujXfVMnn/f1kSDVYY= github.com/OpenPeeDeeP/depguard/v2 v2.1.0/go.mod h1:PUBgk35fX4i7JDmwzlJwJ+GMe6NfO1723wmJMgPThNQ= github.com/ProtonMail/go-crypto v0.0.0-20230518184743-7afd39499903 h1:ZK3C5DtzV2nVAQTx5S5jQvMeDqWtD1By5mOoyY/xJek= github.com/ProtonMail/go-crypto v0.0.0-20230518184743-7afd39499903/go.mod h1:8TI4H3IbrackdNgv+92dI+rhpCaLqM0IfpgCgenFvRE= -github.com/PuerkitoBio/purell v1.0.0/go.mod h1:c11w/QuzBsJSee3cPx9rAFu61PvFxuPbtSwDGJws/X0= github.com/PuerkitoBio/purell v1.1.1/go.mod h1:c11w/QuzBsJSee3cPx9rAFu61PvFxuPbtSwDGJws/X0= -github.com/PuerkitoBio/urlesc v0.0.0-20160726150825-5bd2802263f2/go.mod h1:uGdkoq3SwY9Y+13GIhn11/XLaGBb4BfwItxLd5jeuXE= github.com/PuerkitoBio/urlesc v0.0.0-20170810143723-de5bf2ad4578/go.mod h1:uGdkoq3SwY9Y+13GIhn11/XLaGBb4BfwItxLd5jeuXE= github.com/Shopify/logrus-bugsnag v0.0.0-20171204204709-577dee27f20d/go.mod h1:HI8ITrYtUY+O+ZhtlqUnD8+KwNPOyugEhfP9fdUIaEQ= -github.com/Shopify/sarama v1.19.0/go.mod h1:FVkBWblsNy7DGZRfXLU0O9RCGt5g3g3yEuWXgklEdEo= github.com/Shopify/sarama v1.30.0/go.mod h1:zujlQQx1kzHsh4jfV1USnptCQrHAEZ2Hk8fTKCulPVs= github.com/Shopify/sarama v1.38.1 h1:lqqPUPQZ7zPqYlWpTh+LQ9bhYNu2xJL6k1SJN4WVe2A= github.com/Shopify/sarama v1.38.1/go.mod h1:iwv9a67Ha8VNa+TifujYoWGxWnu2kNVAQdSdZ4X2o5g= -github.com/Shopify/toxiproxy v2.1.4+incompatible h1:TKdv8HiTLgE5wdJuEML90aBgNWsokNbMijUGhmcoBJc= -github.com/Shopify/toxiproxy v2.1.4+incompatible/go.mod h1:OXgGpZ6Cli1/URJOF1DMxUHB2q5Ap20/P/eIdh4G0pI= github.com/Shopify/toxiproxy/v2 v2.1.6-0.20210914104332-15ea381dcdae/go.mod h1:/cvHQkZ1fst0EmZnA5dFtiQdWCNCFYzb+uE2vqVgvx0= github.com/Shopify/toxiproxy/v2 v2.5.0 h1:i4LPT+qrSlKNtQf5QliVjdP08GyAH8+BUIc9gT0eahc= github.com/ThalesIgnite/crypto11 v1.2.5 h1:1IiIIEqYmBvUYFeMnHqRft4bwf/O36jryEUpY+9ef8E= github.com/ThalesIgnite/crypto11 v1.2.5/go.mod h1:ILDKtnCKiQ7zRoNxcp36Y1ZR8LBPmR2E23+wTQe/MlE= -github.com/VividCortex/gohistogram v1.0.0/go.mod h1:Pf5mBqqDxYaXu3hDrrU+w6nw50o/4+TcAqDqk/vUH7g= github.com/acomagu/bufpipe v1.0.4 h1:e3H4WUzM3npvo5uv95QuJM3cQspFNtFBzvJ2oNjKIDQ= -github.com/afex/hystrix-go v0.0.0-20180502004556-fa1af6a1f4f5/go.mod h1:SkGFH1ia65gfNATL8TAiHDNxPzPdmEL5uirI2Uyuz6c= -github.com/ajstarks/deck v0.0.0-20200831202436-30c9fc6549a9/go.mod h1:JynElWSGnm/4RlzPXRlREEwqTHAN3T56Bv2ITsFT3gY= -github.com/ajstarks/deck/generate v0.0.0-20210309230005-c3f852c02e19/go.mod h1:T13YZdzov6OU0A1+RfKZiZN9ca6VeKdBdyDV+BY97Tk= -github.com/ajstarks/svgo v0.0.0-20180226025133-644b8db467af/go.mod h1:K08gAheRH3/J6wwsYMMT4xOr94bZjxIelGM0+d/wbFw= -github.com/ajstarks/svgo v0.0.0-20211024235047-1546f124cd8b/go.mod h1:1KcenG0jGWcpt8ov532z81sp/kMMUG485J2InIOyADM= github.com/alcortesm/tgz v0.0.0-20161220082320-9c5fe88206d7 h1:uSoVVbwJiQipAclBbw+8quDsfcvFjOpI5iCf4p/cqCs= github.com/alcortesm/tgz v0.0.0-20161220082320-9c5fe88206d7/go.mod h1:6zEj6s6u/ghQa61ZWa/C2Aw3RkjiTBOix7dkqa1VLIs= -github.com/alecthomas/kingpin/v2 v2.3.1/go.mod h1:oYL5vtsvEHZGHxU7DMp32Dvx+qL+ptGn6lWaot2vCNE= -github.com/alecthomas/kingpin/v2 v2.3.2/go.mod h1:0gyi0zQnjuFk8xrkNKamJoyUo382HRL7ATRpFZCw6tE= github.com/alecthomas/template v0.0.0-20160405071501-a0175ee3bccc/go.mod h1:LOuyumcjzFXgccqObfd/Ljyb9UuFJ6TxHnclSeseNhc= github.com/alecthomas/template v0.0.0-20190718012654-fb15b899a751/go.mod h1:LOuyumcjzFXgccqObfd/Ljyb9UuFJ6TxHnclSeseNhc= github.com/alecthomas/units v0.0.0-20151022065526-2efee857e7cf/go.mod h1:ybxpYRFXyAe+OPACYpWeL0wqObRcbAqCMya13uyzqw0= github.com/alecthomas/units v0.0.0-20190717042225-c3de453c63f4/go.mod h1:ybxpYRFXyAe+OPACYpWeL0wqObRcbAqCMya13uyzqw0= github.com/alecthomas/units v0.0.0-20190924025748-f65c72e2690d/go.mod h1:rBZYJk541a8SKzHPHnH3zbiI+7dagKZ0cgpgrD7Fyho= -github.com/alecthomas/units v0.0.0-20211218093645-b94a6e3cc137/go.mod h1:OMCwj8VM1Kc9e19TLln2VL61YJF0x1XFtfdL4JdbSyE= github.com/alessio/shellescape v1.4.1 h1:V7yhSDDn8LP4lc4jS8pFkt0zCnzVJlG5JXy9BVKJUX0= github.com/alexflint/go-filemutex v0.0.0-20171022225611-72bdc8eae2ae/go.mod h1:CgnQgUtFrFz9mxFNtED3jI5tLDjKlOM+oUF/sTk6ps0= -github.com/alexflint/go-filemutex v1.1.0/go.mod h1:7P4iRhttt/nUvUOrYIhcpMzv2G6CY9UnI16Z+UJqRyk= github.com/alexkohler/nakedret/v2 v2.0.2 h1:qnXuZNvv3/AxkAb22q/sEsEpcA99YxLFACDtEw9TPxE= github.com/alexkohler/nakedret/v2 v2.0.2/go.mod h1:2b8Gkk0GsOrqQv/gPWjNLDSKwG8I5moSXG1K4VIBcTQ= github.com/alexkohler/prealloc v1.0.0 h1:Hbq0/3fJPQhNkN0dR95AVrr6R7tou91y0uHG5pOcUuw= @@ -872,27 +248,17 @@ github.com/alingse/asasalint v0.0.11/go.mod h1:nCaoMhw7a9kSJObvQyVzNTPBDbNpdocqr github.com/aliyun/credentials-go v1.1.2/go.mod h1:ozcZaMR5kLM7pwtCMEpVmQ242suV6qTJya2bDq4X1Tw= github.com/aliyun/credentials-go v1.2.3 h1:Vmodnr52Rz1mcbwn0kzMhLRKb6soizewuKXdfZiNemU= github.com/aliyun/credentials-go v1.2.3/go.mod h1:/KowD1cfGSLrLsH28Jr8W+xwoId0ywIy5lNzDz6O1vw= -github.com/andybalholm/brotli v1.0.4/go.mod h1:fO7iG3H7G2nSZ7m0zPUDn85XEX2GTukHGRSepvi9Eig= github.com/anmitsu/go-shlex v0.0.0-20161002113705-648efa622239/go.mod h1:2FmKhYUyUczH0OGQWaF5ceTx0UBShxjsH6f8oGKYe2c= github.com/anmitsu/go-shlex v0.0.0-20200514113438-38f4b401e2be h1:9AeTilPcZAjCFIImctFaOjnTIavg87rW78vTPkQqLI8= github.com/antihax/optional v1.0.0/go.mod h1:uupD/76wgC+ih3iEmQUL+0Ugr19nfwCT1kdvxnR2qWY= -github.com/apache/arrow/go/v10 v10.0.1/go.mod h1:YvhnlEePVnBS4+0z3fhPfUy7W1Ikj0Ih0vcRo/gZ1M0= -github.com/apache/arrow/go/v11 v11.0.0/go.mod h1:Eg5OsL5H+e299f7u5ssuXsuHQVEGC4xei5aX110hRiI= -github.com/apache/thrift v0.16.0/go.mod h1:PHK3hniurgQaNMZYaCLEqXKsYK8upmhPbmdP2FXSqgU= github.com/armon/circbuf v0.0.0-20150827004946-bbbad097214e/go.mod h1:3U/XgcO3hCbHZ8TKRvWD2dDTCfh9M9ya+I9JpbB7O8o= github.com/armon/consul-api v0.0.0-20180202201655-eb2c6b5be1b6/go.mod h1:grANhF5doyWs3UAsr3K4I6qtAmlQcZDesFNEHPZAzj8= github.com/armon/go-metrics v0.0.0-20180917152333-f0300d1749da/go.mod h1:Q73ZrmVTwzkszR9V5SSuryQ31EELlFMUz1kKyl939pY= -github.com/armon/go-metrics v0.3.3/go.mod h1:4O98XIr/9W0sxpJ8UaYkvjk10Iff7SnFrb4QAOwNTFc= -github.com/armon/go-metrics v0.3.9/go.mod h1:4O98XIr/9W0sxpJ8UaYkvjk10Iff7SnFrb4QAOwNTFc= -github.com/armon/go-metrics v0.3.10/go.mod h1:4O98XIr/9W0sxpJ8UaYkvjk10Iff7SnFrb4QAOwNTFc= -github.com/armon/go-metrics v0.4.1/go.mod h1:E6amYzXo6aW1tqzoZGT755KkbgrJsSdpwZ+3JqfkOG4= github.com/armon/go-radix v0.0.0-20180808171621-7fddfc383310/go.mod h1:ufUuZ+zHj4x4TnLV4JWEpy2hxWSpsRywHrMgIH9cCH8= -github.com/armon/go-radix v1.0.0/go.mod h1:ufUuZ+zHj4x4TnLV4JWEpy2hxWSpsRywHrMgIH9cCH8= github.com/armon/go-socks5 v0.0.0-20160902184237-e75332964ef5 h1:0CwZNZbxp69SHPdPJAN/hZIm0C4OItdklCFmMRWYpio= github.com/armon/go-socks5 v0.0.0-20160902184237-e75332964ef5/go.mod h1:wHh0iHkYZB8zMSxRWpUBQtwG5a7fFgvEO+odwuTv2gs= github.com/asaskevich/govalidator v0.0.0-20190424111038-f61b66f89f4a/go.mod h1:lB+ZfQJz7igIIfQNfa7Ml4HSf2uFQQRzpGGRXenZAgY= github.com/asaskevich/govalidator v0.0.0-20200907205600-7a23bdc65eef/go.mod h1:WaHUgvxTVq04UNunO+XhnAqY/wQc+bxr74GqbsZ/Jqw= -github.com/asaskevich/govalidator v0.0.0-20210307081110-f21760c49a8d/go.mod h1:WaHUgvxTVq04UNunO+XhnAqY/wQc+bxr74GqbsZ/Jqw= github.com/asaskevich/govalidator v0.0.0-20230301143203-a9d515a09cc2 h1:DklsrG3dyBCFEj5IhUbnKptjxatkF07cF2ak3yi77so= github.com/asaskevich/govalidator v0.0.0-20230301143203-a9d515a09cc2/go.mod h1:WaHUgvxTVq04UNunO+XhnAqY/wQc+bxr74GqbsZ/Jqw= github.com/ashanbrown/forbidigo v1.5.3 h1:jfg+fkm/snMx+V9FBwsl1d340BV/99kZGv5jN9hBoXk= @@ -900,87 +266,52 @@ github.com/ashanbrown/forbidigo v1.5.3/go.mod h1:Y8j9jy9ZYAEHXdu723cUlraTqbzjKF1 github.com/ashanbrown/makezero v1.1.1 h1:iCQ87C0V0vSyO+M9E/FZYbu65auqH0lnsOkf5FcB28s= github.com/ashanbrown/makezero v1.1.1/go.mod h1:i1bJLCRSCHOcOa9Y6MyF2FTfMZMFdHvxKHxgO5Z1axI= github.com/aws/aws-sdk-go v1.15.11/go.mod h1:mFuSZ37Z9YOHbQEwBWztmVzqXrEkub65tZoCYDt7FT0= -github.com/aws/aws-sdk-go v1.15.27/go.mod h1:mFuSZ37Z9YOHbQEwBWztmVzqXrEkub65tZoCYDt7FT0= -github.com/aws/aws-sdk-go v1.38.35/go.mod h1:hcU610XS61/+aQV88ixoOzUoG7v3b31pl2zKMmprdro= -github.com/aws/aws-sdk-go v1.40.45/go.mod h1:585smgzpB/KqRA+K3y/NL/oYRqQvpNJYvLm+LY1U59Q= -github.com/aws/aws-sdk-go v1.43.11/go.mod h1:y4AeaBuwd2Lk+GepC1E9v0qOiTws0MIWAX4oIKwKHZo= -github.com/aws/aws-sdk-go v1.43.31/go.mod h1:y4AeaBuwd2Lk+GepC1E9v0qOiTws0MIWAX4oIKwKHZo= -github.com/aws/aws-sdk-go v1.44.156/go.mod h1:aVsgQcEevwlmQ7qHE9I3h+dtQgpqhFB+i8Phjh7fkwI= -github.com/aws/aws-sdk-go v1.44.245/go.mod h1:aVsgQcEevwlmQ7qHE9I3h+dtQgpqhFB+i8Phjh7fkwI= -github.com/aws/aws-sdk-go v1.44.284/go.mod h1:aVsgQcEevwlmQ7qHE9I3h+dtQgpqhFB+i8Phjh7fkwI= -github.com/aws/aws-sdk-go v1.44.303 h1:GybJmj22u3KVMghsqYZoicS3NpiWiNaPE1+5bhvkxIs= -github.com/aws/aws-sdk-go v1.44.303/go.mod h1:aVsgQcEevwlmQ7qHE9I3h+dtQgpqhFB+i8Phjh7fkwI= -github.com/aws/aws-sdk-go-v2 v1.9.1/go.mod h1:cK/D0BBs0b/oWPIcX/Z/obahJK1TT7IPVjy53i/mX/4= +github.com/aws/aws-sdk-go v1.44.314 h1:d/5Jyk/Fb+PBd/4nzQg0JuC2W4A0knrDIzBgK/ggAow= +github.com/aws/aws-sdk-go v1.44.314/go.mod h1:aVsgQcEevwlmQ7qHE9I3h+dtQgpqhFB+i8Phjh7fkwI= github.com/aws/aws-sdk-go-v2 v1.18.0/go.mod h1:uzbQtefpm44goOPmdKyAlXSNcwlRgF3ePWVW6EtJvvw= -github.com/aws/aws-sdk-go-v2 v1.18.1/go.mod h1:uzbQtefpm44goOPmdKyAlXSNcwlRgF3ePWVW6EtJvvw= -github.com/aws/aws-sdk-go-v2 v1.19.0 h1:klAT+y3pGFBU/qVf1uzwttpBbiuozJYWzNLHioyDJ+k= -github.com/aws/aws-sdk-go-v2 v1.19.0/go.mod h1:uzbQtefpm44goOPmdKyAlXSNcwlRgF3ePWVW6EtJvvw= -github.com/aws/aws-sdk-go-v2/aws/protocol/eventstream v1.4.10/go.mod h1:VeTZetY5KRJLuD/7fkQXMU6Mw7H5m/KP2J5Iy9osMno= +github.com/aws/aws-sdk-go-v2 v1.20.0 h1:INUDpYLt4oiPOJl0XwZDK2OVAVf0Rzo+MGVTv9f+gy8= +github.com/aws/aws-sdk-go-v2 v1.20.0/go.mod h1:uWOr0m0jDsiWw8nnXiqZ+YG6LdvAlGYDLLf2NmHZoy4= github.com/aws/aws-sdk-go-v2/config v1.18.25/go.mod h1:dZnYpD5wTW/dQF0rRNLVypB396zWCcPiBIvdvSWHEg4= -github.com/aws/aws-sdk-go-v2/config v1.18.27/go.mod h1:0My+YgmkGxeqjXZb5BYme5pc4drjTnM+x1GJ3zv42Nw= -github.com/aws/aws-sdk-go-v2/config v1.18.28 h1:TINEaKyh1Td64tqFvn09iYpKiWjmHYrG1fa91q2gnqw= -github.com/aws/aws-sdk-go-v2/config v1.18.28/go.mod h1:nIL+4/8JdAuNHEjn/gPEXqtnS02Q3NXB/9Z7o5xE4+A= +github.com/aws/aws-sdk-go-v2/config v1.18.32 h1:tqEOvkbTxwEV7hToRcJ1xZRjcATqwDVsWbAscgRKyNI= +github.com/aws/aws-sdk-go-v2/config v1.18.32/go.mod h1:U3ZF0fQRRA4gnbn9GGvOWLoT2EzzZfAWeKwnVrm1rDc= github.com/aws/aws-sdk-go-v2/credentials v1.13.24/go.mod h1:jYPYi99wUOPIFi0rhiOvXeSEReVOzBqFNOX5bXYoG2o= -github.com/aws/aws-sdk-go-v2/credentials v1.13.26/go.mod h1:GoXt2YC8jHUBbA4jr+W3JiemnIbkXOfxSXcisUsZ3os= -github.com/aws/aws-sdk-go-v2/credentials v1.13.27 h1:dz0yr/yR1jweAnsCx+BmjerUILVPQ6FS5AwF/OyG1kA= -github.com/aws/aws-sdk-go-v2/credentials v1.13.27/go.mod h1:syOqAek45ZXZp29HlnRS/BNgMIW6uiRmeuQsz4Qh2UE= +github.com/aws/aws-sdk-go-v2/credentials v1.13.31 h1:vJyON3lG7R8VOErpJJBclBADiWTwzcwdkQpTKx8D2sk= +github.com/aws/aws-sdk-go-v2/credentials v1.13.31/go.mod h1:T4sESjBtY2lNxLgkIASmeP57b5j7hTQqCbqG0tWnxC4= github.com/aws/aws-sdk-go-v2/feature/ec2/imds v1.13.3/go.mod h1:4Q0UFP0YJf0NrsEuEYHpM9fTSEVnD16Z3uyEF7J9JGM= -github.com/aws/aws-sdk-go-v2/feature/ec2/imds v1.13.4/go.mod h1:E1hLXN/BL2e6YizK1zFlYd8vsfi2GTjbjBazinMmeaM= -github.com/aws/aws-sdk-go-v2/feature/ec2/imds v1.13.5 h1:kP3Me6Fy3vdi+9uHd7YLr6ewPxRL+PU6y15urfTaamU= -github.com/aws/aws-sdk-go-v2/feature/ec2/imds v1.13.5/go.mod h1:Gj7tm95r+QsDoN2Fhuz/3npQvcZbkEf5mL70n3Xfluc= -github.com/aws/aws-sdk-go-v2/feature/s3/manager v1.11.70/go.mod h1:9yI5NXzqy2yOiMytv6QLZHvlyHLwYxO9iIq+bZIbrFg= +github.com/aws/aws-sdk-go-v2/feature/ec2/imds v1.13.7 h1:X3H6+SU21x+76LRglk21dFRgMTJMa5QcpW+SqUf5BBg= +github.com/aws/aws-sdk-go-v2/feature/ec2/imds v1.13.7/go.mod h1:3we0V09SwcJBzNlnyovrR2wWJhWmVdqAsmVs4uronv8= github.com/aws/aws-sdk-go-v2/internal/configsources v1.1.33/go.mod h1:7i0PF1ME/2eUPFcjkVIwq+DOygHEoK92t5cDqNgYbIw= -github.com/aws/aws-sdk-go-v2/internal/configsources v1.1.34/go.mod h1:wZpTEecJe0Btj3IYnDx/VlUzor9wm3fJHyvLpQF0VwY= -github.com/aws/aws-sdk-go-v2/internal/configsources v1.1.35 h1:hMUCiE3Zi5AHrRNGf5j985u0WyqI6r2NULhUfo0N/No= -github.com/aws/aws-sdk-go-v2/internal/configsources v1.1.35/go.mod h1:ipR5PvpSPqIqL5Mi82BxLnfMkHVbmco8kUwO2xrCi0M= +github.com/aws/aws-sdk-go-v2/internal/configsources v1.1.37 h1:zr/gxAZkMcvP71ZhQOcvdm8ReLjFgIXnIn0fw5AM7mo= +github.com/aws/aws-sdk-go-v2/internal/configsources v1.1.37/go.mod h1:Pdn4j43v49Kk6+82spO3Tu5gSeQXRsxo56ePPQAvFiA= github.com/aws/aws-sdk-go-v2/internal/endpoints/v2 v2.4.27/go.mod h1:UrHnn3QV/d0pBZ6QBAEQcqFLf8FAzLmoUfPVIueOvoM= -github.com/aws/aws-sdk-go-v2/internal/endpoints/v2 v2.4.28/go.mod h1:7VRpKQQedkfIEXb4k52I7swUnZP0wohVajJMRn3vsUw= -github.com/aws/aws-sdk-go-v2/internal/endpoints/v2 v2.4.29 h1:yOpYx+FTBdpk/g+sBU6Cb1H0U/TLEcYYp66mYqsPpcc= -github.com/aws/aws-sdk-go-v2/internal/endpoints/v2 v2.4.29/go.mod h1:M/eUABlDbw2uVrdAn+UsI6M727qp2fxkp8K0ejcBDUY= +github.com/aws/aws-sdk-go-v2/internal/endpoints/v2 v2.4.31 h1:0HCMIkAkVY9KMgueD8tf4bRTUanzEYvhw7KkPXIMpO0= +github.com/aws/aws-sdk-go-v2/internal/endpoints/v2 v2.4.31/go.mod h1:fTJDMe8LOFYtqiFFFeHA+SVMAwqLhoq0kcInYoLa9Js= github.com/aws/aws-sdk-go-v2/internal/ini v1.3.34/go.mod h1:Etz2dj6UHYuw+Xw830KfzCfWGMzqvUTCjUj5b76GVDc= -github.com/aws/aws-sdk-go-v2/internal/ini v1.3.35/go.mod h1:0Eg1YjxE0Bhn56lx+SHJwCzhW+2JGtizsrx+lCqrfm0= -github.com/aws/aws-sdk-go-v2/internal/ini v1.3.36 h1:8r5m1BoAWkn0TDC34lUculryf7nUF25EgIMdjvGCkgo= -github.com/aws/aws-sdk-go-v2/internal/ini v1.3.36/go.mod h1:Rmw2M1hMVTwiUhjwMoIBFWFJMhvJbct06sSidxInkhY= -github.com/aws/aws-sdk-go-v2/internal/v4a v1.0.26/go.mod h1:MtYiox5gvyB+OyP0Mr0Sm/yzbEAIPL9eijj/ouHAPw0= -github.com/aws/aws-sdk-go-v2/service/cloudwatch v1.8.1/go.mod h1:CM+19rL1+4dFWnOQKwDc7H1KwXTz+h61oUSHyhV0b3o= +github.com/aws/aws-sdk-go-v2/internal/ini v1.3.38 h1:+i1DOFrW3YZ3apE45tCal9+aDKK6kNEbW6Ib7e1nFxE= +github.com/aws/aws-sdk-go-v2/internal/ini v1.3.38/go.mod h1:1/jLp0OgOaWIetycOmycW+vYTYgTZFPttJQRgsI1PoU= github.com/aws/aws-sdk-go-v2/service/ecr v1.18.11 h1:wlTgmb/sCmVRJrN5De3CiHj4v/bTCgL5+qpdEd0CPtw= github.com/aws/aws-sdk-go-v2/service/ecr v1.18.11/go.mod h1:Ce1q2jlNm8BVpjLaOnwnm5v2RClAbK6txwPljFzyW6c= github.com/aws/aws-sdk-go-v2/service/ecrpublic v1.16.2 h1:yflJrGmi1pXtP9lOpOeaNZyc0vXnJTuP2sor3nJcGGo= github.com/aws/aws-sdk-go-v2/service/ecrpublic v1.16.2/go.mod h1:uHtRE7aqXNmpeYL+7Ec7LacH5zC9+w2T5MBOeEKDdu0= -github.com/aws/aws-sdk-go-v2/service/internal/accept-encoding v1.9.11/go.mod h1:iV4q2hsqtNECrfmlXyord9u4zyuFEJX9eLgLpSPzWA8= -github.com/aws/aws-sdk-go-v2/service/internal/checksum v1.1.29/go.mod h1:z7EjRjVwZ6pWcWdI2H64dKttvzaP99jRIj5hphW0M5U= github.com/aws/aws-sdk-go-v2/service/internal/presigned-url v1.9.27/go.mod h1:EOwBD4J4S5qYszS5/3DpkejfuK+Z5/1uzICfPaZLtqw= -github.com/aws/aws-sdk-go-v2/service/internal/presigned-url v1.9.28/go.mod h1:jj7znCIg05jXlaGBlFMGP8+7UN3VtCkRBG2spnmRQkU= -github.com/aws/aws-sdk-go-v2/service/internal/presigned-url v1.9.29 h1:IiDolu/eLmuB18DRZibj77n1hHQT7z12jnGO7Ze3pLc= -github.com/aws/aws-sdk-go-v2/service/internal/presigned-url v1.9.29/go.mod h1:fDbkK4o7fpPXWn8YAPmTieAMuB9mk/VgvW64uaUqxd4= -github.com/aws/aws-sdk-go-v2/service/internal/s3shared v1.14.3/go.mod h1:f1QyiAsvIv4B49DmCqrhlXqyaR+0IxMmyX+1P+AnzOM= -github.com/aws/aws-sdk-go-v2/service/kms v1.22.2/go.mod h1:aNfh11Smy55o65PB3MyKbkM8BFyFUcZmj1k+4g8eNfg= -github.com/aws/aws-sdk-go-v2/service/kms v1.23.1 h1:u9A03kEyjBCt44Tg3NMtWJL2SnIvMpipDIoQYtXYzMA= -github.com/aws/aws-sdk-go-v2/service/kms v1.23.1/go.mod h1:BuDl6WtqaDJbd9c29q/EFHrZjuWlrJN7oMNy5Yd5n7Q= -github.com/aws/aws-sdk-go-v2/service/s3 v1.35.0/go.mod h1:aVbf0sko/TsLWHx30c/uVu7c62+0EAJ3vbxaJga0xCw= -github.com/aws/aws-sdk-go-v2/service/secretsmanager v1.19.10/go.mod h1:ezn6mzIRqTPdAbDpm03dx4y9g6rvGRb2q33wS76dCxw= -github.com/aws/aws-sdk-go-v2/service/sns v1.20.13/go.mod h1:rWrvp9i8y/lX94lS7Kn/0iu9RY6vXzeKRqS/knVX8/c= -github.com/aws/aws-sdk-go-v2/service/sqs v1.23.2/go.mod h1:TaV67b6JMD1988x/uMDop/JnMFK6v5d4Ru+sDmFg+ww= -github.com/aws/aws-sdk-go-v2/service/ssm v1.36.6/go.mod h1:NdyMyZH/FzmCaybTrVMBD0nTCGrs1G4cOPKHFywx9Ns= +github.com/aws/aws-sdk-go-v2/service/internal/presigned-url v1.9.31 h1:auGDJ0aLZahF5SPvkJ6WcUuX7iQ7kyl2MamV7Tm8QBk= +github.com/aws/aws-sdk-go-v2/service/internal/presigned-url v1.9.31/go.mod h1:3+lloe3sZuBQw1aBc5MyndvodzQlyqCZ7x1QPDHaWP4= +github.com/aws/aws-sdk-go-v2/service/kms v1.24.1 h1:zDmx9yZjSYDaeakQVN16qfsLxhBeAxgclioB0+rOCDM= +github.com/aws/aws-sdk-go-v2/service/kms v1.24.1/go.mod h1:yrlimpsAJc9fXj3jHC7Ig2Zb4iMAoSJ/VVzChf22dZk= github.com/aws/aws-sdk-go-v2/service/sso v1.12.10/go.mod h1:ouy2P4z6sJN70fR3ka3wD3Ro3KezSxU6eKGQI2+2fjI= -github.com/aws/aws-sdk-go-v2/service/sso v1.12.12/go.mod h1:HuCOxYsF21eKrerARYO6HapNeh9GBNq7fius2AcwodY= -github.com/aws/aws-sdk-go-v2/service/sso v1.12.13 h1:sWDv7cMITPcZ21QdreULwxOOAmE05JjEsT6fCDtDA9k= -github.com/aws/aws-sdk-go-v2/service/sso v1.12.13/go.mod h1:DfX0sWuT46KpcqbMhJ9QWtxAIP1VozkDWf8VAkByjYY= +github.com/aws/aws-sdk-go-v2/service/sso v1.13.1 h1:DSNpSbfEgFXRV+IfEcKE5kTbqxm+MeF5WgyeRlsLnHY= +github.com/aws/aws-sdk-go-v2/service/sso v1.13.1/go.mod h1:TC9BubuFMVScIU+TLKamO6VZiYTkYoEHqlSQwAe2omw= github.com/aws/aws-sdk-go-v2/service/ssooidc v1.14.10/go.mod h1:AFvkxc8xfBe8XA+5St5XIHHrQQtkxqrRincx4hmMHOk= -github.com/aws/aws-sdk-go-v2/service/ssooidc v1.14.12/go.mod h1:E4VrHCPzmVB/KFXtqBGKb3c8zpbNBgKe3fisDNLAW5w= -github.com/aws/aws-sdk-go-v2/service/ssooidc v1.14.13 h1:BFubHS/xN5bjl818QaroN6mQdjneYQ+AOx44KNXlyH4= -github.com/aws/aws-sdk-go-v2/service/ssooidc v1.14.13/go.mod h1:BzqsVVFduubEmzrVtUFQQIQdFqvUItF8XUq2EnS8Wog= +github.com/aws/aws-sdk-go-v2/service/ssooidc v1.15.1 h1:hd0SKLMdOL/Sl6Z0np1PX9LeH2gqNtBe0MhTedA8MGI= +github.com/aws/aws-sdk-go-v2/service/ssooidc v1.15.1/go.mod h1:XO/VcyoQ8nKyKfFW/3DMsRQXsfh/052tHTWmg3xBXRg= github.com/aws/aws-sdk-go-v2/service/sts v1.19.0/go.mod h1:BgQOMsg8av8jset59jelyPW7NoZcZXLVpDsXunGDrk8= -github.com/aws/aws-sdk-go-v2/service/sts v1.19.2/go.mod h1:dp0yLPsLBOi++WTxzCjA/oZqi6NPIhoR+uF7GeMU9eg= -github.com/aws/aws-sdk-go-v2/service/sts v1.19.3 h1:e5mnydVdCVWxP+5rPAGi2PYxC7u2OZgH1ypC114H04U= -github.com/aws/aws-sdk-go-v2/service/sts v1.19.3/go.mod h1:yVGZA1CPkmUhBdA039jXNJJG7/6t+G+EBWmFq23xqnY= -github.com/aws/smithy-go v1.8.0/go.mod h1:SObp3lf9smib00L/v3U2eAKG8FyQ7iLrJnQiAmR5n+E= -github.com/aws/smithy-go v1.13.5 h1:hgz0X/DX0dGqTYpGALqXJoRKRj5oQ7150i5FdTePzO8= +github.com/aws/aws-sdk-go-v2/service/sts v1.21.1 h1:pAOJj+80tC8sPVgSDHzMYD6KLWsaLQ1kZw31PTeORbs= +github.com/aws/aws-sdk-go-v2/service/sts v1.21.1/go.mod h1:G8SbvL0rFk4WOJroU8tKBczhsbhj2p/YY7qeJezJ3CI= github.com/aws/smithy-go v1.13.5/go.mod h1:Tg+OJXh4MB2R/uN61Ko2f6hTZwB/ZYGOtib8J3gBHzA= +github.com/aws/smithy-go v1.14.0 h1:+X90sB94fizKjDmwb4vyl2cTTPXTE5E2G/1mjByb0io= +github.com/aws/smithy-go v1.14.0/go.mod h1:Tg+OJXh4MB2R/uN61Ko2f6hTZwB/ZYGOtib8J3gBHzA= github.com/awslabs/amazon-ecr-credential-helper/ecr-login v0.0.0-20230510185313-f5e39e5f34c7 h1:G5IT+PEpFY0CDb3oITDP9tkmLrHkVD8Ny+elUmBqVYI= github.com/awslabs/amazon-ecr-credential-helper/ecr-login v0.0.0-20230510185313-f5e39e5f34c7/go.mod h1:VVALgT1UESBh91dY0GprHnT1Z7mKd96VDk8qVy+bmu0= -github.com/benbjohnson/clock v1.0.3/go.mod h1:bGMdMPoPVvcYyt1gHDf4J2KE153Yf9BuiUKYMaxlTDM= -github.com/benbjohnson/clock v1.1.0/go.mod h1:J11/hYXuz8f4ySSvYwY0FKfm+ezbsZBKZxNJlLklBHA= github.com/benbjohnson/clock v1.3.0 h1:ip6w0uFQkncKQ979AypyG0ER7mqUSBdKLOgAle/AT8A= github.com/benbjohnson/clock v1.3.0/go.mod h1:J11/hYXuz8f4ySSvYwY0FKfm+ezbsZBKZxNJlLklBHA= github.com/beorn7/perks v0.0.0-20160804104726-4c0e84591b9a/go.mod h1:Dwedo/Wpr24TaqPxmxbtue+5NUziq4I4S80YR8gNf3Q= @@ -990,8 +321,6 @@ github.com/beorn7/perks v1.0.1 h1:VlbKKnNfV8bJzeqoa4cOKqO6bYr3WgKZxO8Z16+hsOM= github.com/beorn7/perks v1.0.1/go.mod h1:G2ZrVWU2WbWT9wwq4/hrbKbnv/1ERSJQ0ibhJ6rlkpw= github.com/bgentry/speakeasy v0.1.0/go.mod h1:+zsyZBPWlz7T6j88CTgSN5bM796AkVf0kBD4zp0CCIs= github.com/bitly/go-simplejson v0.5.0/go.mod h1:cXHtHw4XUPsvGaxgjIAn8PhEWG9NfngEKAMDJEczWVA= -github.com/bits-and-blooms/bitset v1.2.0/go.mod h1:gIdJ4wp64HaoK2YrL1Q5/N7Y16edYb8uY+O0FJTyyDA= -github.com/bketelsen/crypt v0.0.3-0.20200106085610-5cbc8cc4026c/go.mod h1:MKsuJmJgSg28kpZDP6UIiPt0e0Oz0kqKNGyRaWEPv84= github.com/bketelsen/crypt v0.0.4/go.mod h1:aI6NrJ0pMGgvZKL1iVgXLnfIFJtfV+bKCoqOes/6LfM= github.com/bkielbasa/cyclop v1.2.1 h1:AeF71HZDob1P2/pRm1so9cd1alZnrpyc4q2uP2l0gJY= github.com/bkielbasa/cyclop v1.2.1/go.mod h1:K/dT/M0FPAiYjBgQGau7tz+3TMh4FWAEqlMhzFWCrgM= @@ -1010,8 +339,6 @@ github.com/bmatcuk/doublestar/v4 v4.0.2/go.mod h1:xBQ8jztBU6kakFMg+8WGxn0c6z1fTS github.com/bmizerany/assert v0.0.0-20160611221934-b7ed37b82869/go.mod h1:Ekp36dRnpXw/yCqJaO+ZrUyxD+3VXMFFr56k5XYrpB4= github.com/bombsimon/wsl/v3 v3.4.0 h1:RkSxjT3tmlptwfgEgTgU+KYKLI35p/tviNXNXiL2aNU= github.com/bombsimon/wsl/v3 v3.4.0/go.mod h1:KkIB+TXkqy6MvK9BDZVbZxKNYsE1/oLRJbIFtf14qqo= -github.com/boombuler/barcode v1.0.0/go.mod h1:paBWMcWSl3LHKBqUq+rly7CNSldXjb2rDl3JlRe0mD8= -github.com/boombuler/barcode v1.0.1/go.mod h1:paBWMcWSl3LHKBqUq+rly7CNSldXjb2rDl3JlRe0mD8= github.com/breml/bidichk v0.2.4 h1:i3yedFWWQ7YzjdZJHnPo9d/xURinSq3OM+gyM43K4/8= github.com/breml/bidichk v0.2.4/go.mod h1:7Zk0kRFt1LIZxtQdl9W9JwGAcLTTkOs+tN7wuEYGJ3s= github.com/breml/errchkjson v0.3.1 h1:hlIeXuspTyt8Y/UmP5qy1JocGNR00KQHgfaNtRAjoxQ= @@ -1029,18 +356,11 @@ github.com/butuzov/ireturn v0.2.0/go.mod h1:Wh6Zl3IMtTpaIKbmwzqi6olnM9ptYQxxVacM github.com/butuzov/mirror v1.1.0 h1:ZqX54gBVMXu78QLoiqdwpl2mgmoOJTk7s4p4o+0avZI= github.com/butuzov/mirror v1.1.0/go.mod h1:8Q0BdQU6rC6WILDiBM60DBfvV78OLJmMmixe7GF45AE= github.com/bwesterb/go-ristretto v1.2.0/go.mod h1:fUIoIZaG73pV5biE2Blr2xEzDoMj7NFEuV9ekS419A0= -github.com/casbin/casbin/v2 v2.37.0/go.mod h1:vByNa/Fchek0KZUgG5wEsl7iFsiviAYKRtgrQfcJqHg= github.com/cenkalti/backoff/v3 v3.2.2 h1:cfUAAO3yvKMYKPrvhDuHSwQnhZNk/RMHKdZqKTxfm6M= github.com/cenkalti/backoff/v3 v3.2.2/go.mod h1:cIeZDE3IrqwwJl6VUwCN6trj1oXrTS4rc0ij+ULvLYs= -github.com/cenkalti/backoff/v4 v4.1.1/go.mod h1:scbssz8iZGpm3xbr14ovlUdkxfGXNInqkPWOWmG2CLw= -github.com/cenkalti/backoff/v4 v4.1.2/go.mod h1:scbssz8iZGpm3xbr14ovlUdkxfGXNInqkPWOWmG2CLw= -github.com/cenkalti/backoff/v4 v4.2.0/go.mod h1:Y3VNntkOUPxTVeUxJ/G5vcM//AlwfmyYozVcomhLiZE= github.com/census-instrumentation/opencensus-proto v0.2.1/go.mod h1:f6KPmirojxKA12rnyqOA5BBL4O983OfeGPqjHWSTneU= -github.com/census-instrumentation/opencensus-proto v0.3.0/go.mod h1:f6KPmirojxKA12rnyqOA5BBL4O983OfeGPqjHWSTneU= github.com/census-instrumentation/opencensus-proto v0.4.1 h1:iKLQ0xPNFxR/2hzXZMrBo8f1j86j5WHzznCCQxV/b8g= github.com/census-instrumentation/opencensus-proto v0.4.1/go.mod h1:4T9NM4+4Vw91VeyqjLS6ao50K5bOcLKN6Q42XnYaRYw= -github.com/certifi/gocertifi v0.0.0-20191021191039-0944d244cd40/go.mod h1:sGbDF6GwGcLpkNXPUTkMRoywsNa/ol15pxFe6ERfguA= -github.com/certifi/gocertifi v0.0.0-20200922220541-2c3bb06c6054/go.mod h1:sGbDF6GwGcLpkNXPUTkMRoywsNa/ol15pxFe6ERfguA= github.com/cespare/xxhash v1.1.0/go.mod h1:XrSqR1VqqWfGrhpAt58auRo0WTKS1nRRg3ghfAqPWnc= github.com/cespare/xxhash/v2 v2.1.1/go.mod h1:VGX0DQ3Q6kWi7AoAeZDth3/j3BFtOZR5XLFGgcrjCOs= github.com/cespare/xxhash/v2 v2.1.2/go.mod h1:VGX0DQ3Q6kWi7AoAeZDth3/j3BFtOZR5XLFGgcrjCOs= @@ -1051,25 +371,15 @@ github.com/charithe/durationcheck v0.0.10/go.mod h1:bCWXb7gYRysD1CU3C+u4ceO49LoG github.com/chavacava/garif v0.0.0-20230227094218-b8c73b2037b8 h1:W9o46d2kbNL06lq7UNDPV0zYLzkrde/bjIqO02eoll0= github.com/chavacava/garif v0.0.0-20230227094218-b8c73b2037b8/go.mod h1:gakxgyXaaPkxvLw1XQxNGK4I37ys9iBRzNUx/B7pUCo= github.com/checkpoint-restore/go-criu/v4 v4.1.0/go.mod h1:xUQBLp4RLc5zJtWY++yjOoMoB5lihDt7fai+75m+rGw= -github.com/checkpoint-restore/go-criu/v5 v5.0.0/go.mod h1:cfwC0EG7HMUenopBsUf9d89JlCLQIfgVcNsNN0t6T2M= -github.com/checkpoint-restore/go-criu/v5 v5.3.0/go.mod h1:E/eQpaFtUKGOOSEBZgmKAcn+zUUwWxqcaKZlF54wK8E= github.com/chrismellard/docker-credential-acr-env v0.0.0-20230304212654-82a0ddb27589 h1:krfRl01rzPzxSxyLyrChD+U+MzsBXbm0OwYYB67uF+4= github.com/chrismellard/docker-credential-acr-env v0.0.0-20230304212654-82a0ddb27589/go.mod h1:OuDyvmLnMCwa2ep4Jkm6nyA0ocJuZlGyk2gGseVzERM= github.com/chzyer/logex v1.1.10/go.mod h1:+Ywpsq7O8HXn0nuIou7OrIPyXbp3wmkHB+jjWRnGsAI= -github.com/chzyer/logex v1.2.1/go.mod h1:JLbx6lG2kDbNRFnfkgvh4eRJRPX1QCoOIWomwysCBrQ= github.com/chzyer/readline v0.0.0-20180603132655-2972be24d48e/go.mod h1:nSuG5e5PlCu98SY8svDHJxuZscDgtXS6KTTbou5AhLI= -github.com/chzyer/readline v1.5.1/go.mod h1:Eh+b79XXUwfKfcPLepksvw2tcLE/Ct21YObkaSkeBlk= github.com/chzyer/test v0.0.0-20180213035817-a1ea475d72b1/go.mod h1:Q3SI9o4m/ZMnBNeIyt5eFwwo7qiLfzFZmjNmxjkiQlU= -github.com/chzyer/test v1.0.0/go.mod h1:2JlltgoNkt4TW/z9V/IzDdFaMTM2JPIi26O1pF38GC8= github.com/cilium/ebpf v0.0.0-20200110133405-4032b1d8aae3/go.mod h1:MA5e5Lr8slmEg9bt0VpxxWqJlO4iwu3FBdHUzV7wQVg= github.com/cilium/ebpf v0.0.0-20200702112145-1c8d4c9ef775/go.mod h1:7cR51M8ViRLIdUjrmSXlK9pkrsDlLHbO8jiB8X8JnOc= github.com/cilium/ebpf v0.2.0/go.mod h1:To2CFviqOWL/M0gIMsvSMlqe7em/l1ALkX1PyjrX2Qs= github.com/cilium/ebpf v0.4.0/go.mod h1:4tRaxcgiL706VnOzHOdBlY8IEAIdxINsQBcU4xJJXRs= -github.com/cilium/ebpf v0.6.2/go.mod h1:4tRaxcgiL706VnOzHOdBlY8IEAIdxINsQBcU4xJJXRs= -github.com/cilium/ebpf v0.7.0/go.mod h1:/oI2+1shJiTGAMgl6/RgJr36Eo1jzrRcAWbcXO2usCA= -github.com/circonus-labs/circonus-gometrics v2.3.1+incompatible/go.mod h1:nmEj6Dob7S7YxXgwXpfOuvO54S+tGdZdw9fuRZt25Ag= -github.com/circonus-labs/circonusllhist v0.1.3/go.mod h1:kMXHVDlOchFAehlya5ePtbp5jckzBHf4XRpQvBOLI+I= -github.com/clbanning/mxj v1.8.4/go.mod h1:BVjHeAH+rl9rs6f+QIpeRl0tfu10SXn1pUSa5PVGJng= github.com/clbanning/mxj/v2 v2.5.6 h1:Jm4VaCI/+Ug5Q57IzEoZbwx4iQFA6wkXv72juUSeK+g= github.com/clbanning/mxj/v2 v2.5.6/go.mod h1:hNiWqW14h+kc+MdF9C6/YoRfjEJoR3ou6tn/Qo+ve2s= github.com/client9/misspell v0.3.4/go.mod h1:qj6jICC3Q7zFZvVWo7KLAzC3yx5G7kyvSDkc90ppPyw= @@ -1082,22 +392,12 @@ github.com/cncf/udpa/go v0.0.0-20191209042840-269d4d468f6f/go.mod h1:M8M6+tZqaGX github.com/cncf/udpa/go v0.0.0-20200629203442-efcf912fb354/go.mod h1:WmhPx2Nbnhtbo57+VJT5O0JRkEi1Wbu0z5j0R8u5Hbk= github.com/cncf/udpa/go v0.0.0-20201120205902-5459f2c99403/go.mod h1:WmhPx2Nbnhtbo57+VJT5O0JRkEi1Wbu0z5j0R8u5Hbk= github.com/cncf/udpa/go v0.0.0-20210930031921-04548b0d99d4/go.mod h1:6pvJx4me5XPnfI9Z40ddWsdw2W/uZgQLFXToKeRcDiI= -github.com/cncf/udpa/go v0.0.0-20220112060539-c52dc94e7fbe/go.mod h1:6pvJx4me5XPnfI9Z40ddWsdw2W/uZgQLFXToKeRcDiI= github.com/cncf/xds/go v0.0.0-20210312221358-fbca930ec8ed/go.mod h1:eXthEFrGJvWHgFFCl3hGmgk+/aYT6PnTQLykKQRLhEs= github.com/cncf/xds/go v0.0.0-20210805033703-aa0b78936158/go.mod h1:eXthEFrGJvWHgFFCl3hGmgk+/aYT6PnTQLykKQRLhEs= github.com/cncf/xds/go v0.0.0-20210922020428-25de7278fc84/go.mod h1:eXthEFrGJvWHgFFCl3hGmgk+/aYT6PnTQLykKQRLhEs= github.com/cncf/xds/go v0.0.0-20211001041855-01bcc9b48dfe/go.mod h1:eXthEFrGJvWHgFFCl3hGmgk+/aYT6PnTQLykKQRLhEs= github.com/cncf/xds/go v0.0.0-20211011173535-cb28da3451f1/go.mod h1:eXthEFrGJvWHgFFCl3hGmgk+/aYT6PnTQLykKQRLhEs= -github.com/cncf/xds/go v0.0.0-20220314180256-7f1daf1720fc/go.mod h1:eXthEFrGJvWHgFFCl3hGmgk+/aYT6PnTQLykKQRLhEs= -github.com/cncf/xds/go v0.0.0-20230105202645-06c439db220b/go.mod h1:eXthEFrGJvWHgFFCl3hGmgk+/aYT6PnTQLykKQRLhEs= -github.com/cncf/xds/go v0.0.0-20230112175826-46e39c7b9b43/go.mod h1:eXthEFrGJvWHgFFCl3hGmgk+/aYT6PnTQLykKQRLhEs= -github.com/cncf/xds/go v0.0.0-20230310173818-32f1caf87195/go.mod h1:eXthEFrGJvWHgFFCl3hGmgk+/aYT6PnTQLykKQRLhEs= -github.com/cncf/xds/go v0.0.0-20230607035331-e9ce68804cb4/go.mod h1:eXthEFrGJvWHgFFCl3hGmgk+/aYT6PnTQLykKQRLhEs= -github.com/cockroachdb/apd v1.1.0/go.mod h1:8Sl8LxpKi29FqWXR16WEFZRNSz3SoPzUzeMeY4+DwBQ= github.com/cockroachdb/datadriven v0.0.0-20190809214429-80d97fb3cbaa/go.mod h1:zn76sxSg3SzpJ0PPJaLDCu+Bu0Lg3sKTORVIj19EIF8= -github.com/cockroachdb/datadriven v0.0.0-20200714090401-bf6692d28da5/go.mod h1:h6jFvWxBdQXxjopDMZyH2UVceIRfR84bdzbkoKrsWNo= -github.com/cockroachdb/errors v1.2.4/go.mod h1:rQD95gz6FARkaKkQXUksEje/d9a6wBJoCr5oaCLELYA= -github.com/cockroachdb/logtags v0.0.0-20190617123548-eb05cc24525f/go.mod h1:i/u985jwjWRlyHXQbwatDASoW0RMlZ/3i9yJHE2xLkI= github.com/codahale/rfc6979 v0.0.0-20141003034818-6a90f24967eb h1:EDmT6Q9Zs+SbUoc7Ik9EfrFqcylYqgPZ9ANSbTAntnE= github.com/common-nighthawk/go-figure v0.0.0-20210622060536-734e95fb86be h1:J5BL2kskAlV9ckgEsNQXscjIaLiOYiZ75d4e94E6dcQ= github.com/common-nighthawk/go-figure v0.0.0-20210622060536-734e95fb86be/go.mod h1:mk5IQ+Y0ZeO87b858TlA645sVcEcbiX6YqP98kt+7+w= @@ -1115,13 +415,11 @@ github.com/containerd/cgroups v0.0.0-20200710171044-318312a37340/go.mod h1:s5q4S github.com/containerd/cgroups v0.0.0-20200824123100-0b889c03f102/go.mod h1:s5q4SojHctfxANBDvMeIaIovkq29IP48TKAxnhYRxvo= github.com/containerd/cgroups v0.0.0-20210114181951-8a68de567b68/go.mod h1:ZJeTFisyysqgcCdecO57Dj79RfL0LNeGiFUqLYQRYLE= github.com/containerd/cgroups v1.0.1/go.mod h1:0SJrPIenamHDcZhEcJMNBB85rHcUsw4f25ZfBiPYRkU= -github.com/containerd/cgroups v1.0.3/go.mod h1:/ofk34relqNjSGyqPrmEULrO4Sc8LJhvJmWbUCUKqj8= github.com/containerd/console v0.0.0-20180822173158-c12b1e7919c1/go.mod h1:Tj/on1eG8kiEhd0+fhSDzsPAFESxzBBvdyEgyryXffw= github.com/containerd/console v0.0.0-20181022165439-0650fd9eeb50/go.mod h1:Tj/on1eG8kiEhd0+fhSDzsPAFESxzBBvdyEgyryXffw= github.com/containerd/console v0.0.0-20191206165004-02ecf6a7291e/go.mod h1:8Pf4gM6VEbTNRIT26AyyU7hxdQU3MvAvxVI0sc00XBE= github.com/containerd/console v1.0.1/go.mod h1:XUsP6YE/mKtz6bxc+I8UiKKTP04qjQL4qcS3XoQ5xkw= github.com/containerd/console v1.0.2/go.mod h1:ytZPjGgY2oeTkAONYafi2kSj0aYggsf8acV1PGKCbzQ= -github.com/containerd/console v1.0.3/go.mod h1:7LqA/THxQ86k76b8c/EMSiaJ3h1eZkMkXar0TQ1gf3U= github.com/containerd/containerd v1.2.10/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA= github.com/containerd/containerd v1.3.0-beta.2.0.20190828155532-0293cbd26c69/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA= github.com/containerd/containerd v1.3.0/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA= @@ -1130,16 +428,11 @@ github.com/containerd/containerd v1.3.2/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMX github.com/containerd/containerd v1.4.0-beta.2.0.20200729163537-40b22ef07410/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA= github.com/containerd/containerd v1.4.1/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA= github.com/containerd/containerd v1.4.3/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA= -github.com/containerd/containerd v1.4.9/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA= github.com/containerd/containerd v1.5.0-beta.1/go.mod h1:5HfvG1V2FsKesEGQ17k5/T7V960Tmcumvqn8Mc+pCYQ= github.com/containerd/containerd v1.5.0-beta.3/go.mod h1:/wr9AVtEM7x9c+n0+stptlo/uBBoBORwEx6ardVcmKU= github.com/containerd/containerd v1.5.0-beta.4/go.mod h1:GmdgZd2zA2GYIBZ0w09ZvgqEq8EfBp/m3lcVZIvPHhI= github.com/containerd/containerd v1.5.0-rc.0/go.mod h1:V/IXoMqNGgBlabz3tHD2TWDoTJseu1FGOKuoA4nNb2s= -github.com/containerd/containerd v1.5.1/go.mod h1:0DOxVqwDy2iZvrZp2JUx/E+hS0UNTVn7dJnIOwtYR4g= github.com/containerd/containerd v1.5.2/go.mod h1:0DOxVqwDy2iZvrZp2JUx/E+hS0UNTVn7dJnIOwtYR4g= -github.com/containerd/containerd v1.5.7/go.mod h1:gyvv6+ugqY25TiXxcZC3L5yOeYgEw0QMhscqVp1AR9c= -github.com/containerd/containerd v1.5.8/go.mod h1:YdFSv5bTFLpG2HIYmfqDpSYYTDX+mc5qtSuYx1YUb/s= -github.com/containerd/containerd v1.6.1/go.mod h1:1nJz5xCZPusx6jJU8Frfct988y0NpumIq9ODB0kLtoE= github.com/containerd/containerd v1.6.19 h1:F0qgQPrG0P2JPgwpxWxYavrVeXAG0ezUIB9Z/4FTUAU= github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y= github.com/containerd/continuity v0.0.0-20190815185530-f2a389ac0a02/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y= @@ -1148,7 +441,6 @@ github.com/containerd/continuity v0.0.0-20200710164510-efbc4488d8fe/go.mod h1:cE github.com/containerd/continuity v0.0.0-20201208142359-180525291bb7/go.mod h1:kR3BEg7bDFaEddKm54WSmrol1fKWDU1nKYkgrcgZT7Y= github.com/containerd/continuity v0.0.0-20210208174643-50096c924a4e/go.mod h1:EXlVlkqNba9rJe3j7w3Xa924itAMLgZH4UD/Q4PExuQ= github.com/containerd/continuity v0.1.0/go.mod h1:ICJu0PwR54nI0yPEnJ6jcS+J7CZAUXrLh8lPo2knzsM= -github.com/containerd/continuity v0.2.2/go.mod h1:pWygW9u7LtS1o4N/Tn0FoCFDIXZ7rxcMX7HX1Dmibvk= github.com/containerd/fifo v0.0.0-20180307165137-3d5202aec260/go.mod h1:ODA38xgv3Kuk8dQz2ZQXpnv/UZZUHUCL7pnLehbXgQI= github.com/containerd/fifo v0.0.0-20190226154929-a9fb20d87448/go.mod h1:ODA38xgv3Kuk8dQz2ZQXpnv/UZZUHUCL7pnLehbXgQI= github.com/containerd/fifo v0.0.0-20200410184934-f15a3290365b/go.mod h1:jPQ2IAeZRCYxpS/Cm1495vGFww6ecHmMk1YJH2Q5ln0= @@ -1157,8 +449,6 @@ github.com/containerd/fifo v0.0.0-20210316144830-115abcc95a1d/go.mod h1:ocF/ME1S github.com/containerd/fifo v1.0.0/go.mod h1:ocF/ME1SX5b1AOlWi9r677YJmCPSwwWnQ9O123vzpE4= github.com/containerd/go-cni v1.0.1/go.mod h1:+vUpYxKvAF72G9i1WoDOiPGRtQpqsNW/ZHtSlv++smU= github.com/containerd/go-cni v1.0.2/go.mod h1:nrNABBHzu0ZwCug9Ije8hL2xBCYh/pjfMb1aZGrrohk= -github.com/containerd/go-cni v1.1.0/go.mod h1:Rflh2EJ/++BA2/vY5ao3K6WJRR/bZKsX123aPk+kUtA= -github.com/containerd/go-cni v1.1.3/go.mod h1:Rflh2EJ/++BA2/vY5ao3K6WJRR/bZKsX123aPk+kUtA= github.com/containerd/go-runc v0.0.0-20180907222934-5a6d9f37cfa3/go.mod h1:IV7qH3hrUgRmyYrtgEeGWJfWbgcHL9CSRruz2Vqcph0= github.com/containerd/go-runc v0.0.0-20190911050354-e029b79d8cda/go.mod h1:IV7qH3hrUgRmyYrtgEeGWJfWbgcHL9CSRruz2Vqcph0= github.com/containerd/go-runc v0.0.0-20200220073739-7016d3ce2328/go.mod h1:PpyHrqVs8FTi9vpyHwPwiNEGaACDxT/N/pLcvMSRA9g= @@ -1168,11 +458,9 @@ github.com/containerd/imgcrypt v1.0.1/go.mod h1:mdd8cEPW7TPgNG4FpuP3sGBiQ7Yi/zak github.com/containerd/imgcrypt v1.0.4-0.20210301171431-0ae5c75f59ba/go.mod h1:6TNsg0ctmizkrOgXRNQjAPFWpMYRWuiB6dSF4Pfa5SA= github.com/containerd/imgcrypt v1.1.1-0.20210312161619-7ed62a527887/go.mod h1:5AZJNI6sLHJljKuI9IHnw1pWqo/F0nGDOuR9zgTs7ow= github.com/containerd/imgcrypt v1.1.1/go.mod h1:xpLnwiQmEUJPvQoAapeb2SNCxz7Xr6PJrXQb0Dpc4ms= -github.com/containerd/imgcrypt v1.1.3/go.mod h1:/TPA1GIDXMzbj01yd8pIbQiLdQxed5ue1wb8bP7PQu4= github.com/containerd/nri v0.0.0-20201007170849-eb1350a75164/go.mod h1:+2wGSDGFYfE5+So4M5syatU0N0f0LbWpuqyMi4/BE8c= github.com/containerd/nri v0.0.0-20210316161719-dbaa18c31c14/go.mod h1:lmxnXF6oMkbqs39FiCt1s0R2HSMhcLel9vNL3m4AaeY= github.com/containerd/nri v0.1.0/go.mod h1:lmxnXF6oMkbqs39FiCt1s0R2HSMhcLel9vNL3m4AaeY= -github.com/containerd/stargz-snapshotter/estargz v0.4.1/go.mod h1:x7Q9dg9QYb4+ELgxmo4gBUeJB0tl5dqH1Sdz0nJU1QM= github.com/containerd/stargz-snapshotter/estargz v0.7.0/go.mod h1:83VWDqHnurTKliEB0YvWMiCfLDwv4Cjj1X9Vk98GJZw= github.com/containerd/stargz-snapshotter/estargz v0.14.3 h1:OqlDCK3ZVUO6C3B/5FSkDwbkEETK84kQgEeFwDC+62k= github.com/containerd/stargz-snapshotter/estargz v0.14.3/go.mod h1:KY//uOCIkSuNAHhJogcZtrNHdKrA99/FCCRjE3HD36o= @@ -1181,7 +469,6 @@ github.com/containerd/ttrpc v0.0.0-20190828172938-92c8520ef9f8/go.mod h1:PvCDdDG github.com/containerd/ttrpc v0.0.0-20191028202541-4f1b8fe65a5c/go.mod h1:LPm1u0xBw8r8NOKoOdNMeVHSawSsltak+Ihv+etqsE8= github.com/containerd/ttrpc v1.0.1/go.mod h1:UAxOpgT9ziI0gJrmKvgcZivgxOp8iFPSk8httJEt98Y= github.com/containerd/ttrpc v1.0.2/go.mod h1:UAxOpgT9ziI0gJrmKvgcZivgxOp8iFPSk8httJEt98Y= -github.com/containerd/ttrpc v1.1.0/go.mod h1:XX4ZTnoOId4HklF4edwc4DcqskFZuvXB1Evzy5KFQpQ= github.com/containerd/typeurl v0.0.0-20180627222232-a93fcdb778cd/go.mod h1:Cm3kwCdlkCfMSHURc+r6fwoGH6/F1hH3S4sg0rLFWPc= github.com/containerd/typeurl v0.0.0-20190911142611-5eb25027c9fd/go.mod h1:GeKYzf2pQcqv7tJ0AoCuuhtnqhva5LNU3U+OyKxxJpk= github.com/containerd/typeurl v1.0.1/go.mod h1:TB1hUtrpaiO88KEK56ijojHS1+NeF0izUACaJW2mdXg= @@ -1194,21 +481,16 @@ github.com/containerd/zfs v1.0.0/go.mod h1:m+m51S1DvAP6r3FcmYCp54bQ34pyOwTieQDNR github.com/containernetworking/cni v0.7.1/go.mod h1:LGwApLUm2FpoOfxTDEeq8T9ipbpZ61X79hmU3w8FmsY= github.com/containernetworking/cni v0.8.0/go.mod h1:LGwApLUm2FpoOfxTDEeq8T9ipbpZ61X79hmU3w8FmsY= github.com/containernetworking/cni v0.8.1/go.mod h1:LGwApLUm2FpoOfxTDEeq8T9ipbpZ61X79hmU3w8FmsY= -github.com/containernetworking/cni v1.0.1/go.mod h1:AKuhXbN5EzmD4yTNtfSsX3tPcmtrBI6QcRV0NiNt15Y= github.com/containernetworking/plugins v0.8.6/go.mod h1:qnw5mN19D8fIwkqW7oHHYDHVlzhJpcY6TQxn/fUyDDM= github.com/containernetworking/plugins v0.9.1/go.mod h1:xP/idU2ldlzN6m4p5LmGiwRDjeJr6FLK6vuiUwoH7P8= -github.com/containernetworking/plugins v1.0.1/go.mod h1:QHCfGpaTwYTbbH+nZXKVTxNBDZcxSOplJT5ico8/FLE= github.com/containers/ocicrypt v1.0.1/go.mod h1:MeJDzk1RJHv89LjsH0Sp5KTY3ZYkjXO/C+bKAeWFIrc= github.com/containers/ocicrypt v1.1.0/go.mod h1:b8AOe0YR67uU8OqfVNcznfFpAzu3rdgUV4GP9qXPfu4= github.com/containers/ocicrypt v1.1.1/go.mod h1:Dm55fwWm1YZAjYRaJ94z2mfZikIyIN4B0oB3dj3jFxY= -github.com/containers/ocicrypt v1.1.2/go.mod h1:Dm55fwWm1YZAjYRaJ94z2mfZikIyIN4B0oB3dj3jFxY= github.com/coreos/bbolt v1.3.2/go.mod h1:iRUV2dpdMOn7Bo10OQBFzIJO9kkE559Wcmn+qkEiiKk= github.com/coreos/etcd v3.3.10+incompatible/go.mod h1:uF7uidLiAD3TWHmW31ZFd/JWoc32PjwdhPthX9715RE= -github.com/coreos/etcd v3.3.13+incompatible/go.mod h1:uF7uidLiAD3TWHmW31ZFd/JWoc32PjwdhPthX9715RE= github.com/coreos/go-etcd v2.0.0+incompatible/go.mod h1:Jez6KQU2B/sWsbdaef3ED8NzMklzPG4d5KIOhIy30Tk= github.com/coreos/go-iptables v0.4.5/go.mod h1:/mVI274lEDI2ns62jHCDnCyBF9Iwsmekav8Dbxlm1MU= github.com/coreos/go-iptables v0.5.0/go.mod h1:/mVI274lEDI2ns62jHCDnCyBF9Iwsmekav8Dbxlm1MU= -github.com/coreos/go-iptables v0.6.0/go.mod h1:Qe8Bv2Xik5FyTXwgIbLAnv2sWSBmvWdFETJConOQ//Q= github.com/coreos/go-oidc v2.1.0+incompatible/go.mod h1:CgnwVTmzoESiwO9qyAFEMiHoZ1nMCKZlZ9V6mm3/LKc= github.com/coreos/go-oidc/v3 v3.6.0 h1:AKVxfYw1Gmkn/w96z0DbT/B/xFnzTd3MkZvWLjF4n/o= github.com/coreos/go-oidc/v3 v3.6.0/go.mod h1:ZpHUsHBucTUj6WOkrP4E20UPynbLZzhTQ1XKCXkxyPc= @@ -1217,12 +499,9 @@ github.com/coreos/go-semver v0.3.0/go.mod h1:nnelYz7RCh+5ahJtPPxZlU+153eP4D4r3Ee github.com/coreos/go-systemd v0.0.0-20161114122254-48702e0da86b/go.mod h1:F5haX7vjVVG0kc13fIWeqUViNPyEJxv/OmvnBo0Yme4= github.com/coreos/go-systemd v0.0.0-20180511133405-39ca1b05acc7/go.mod h1:F5haX7vjVVG0kc13fIWeqUViNPyEJxv/OmvnBo0Yme4= github.com/coreos/go-systemd v0.0.0-20190321100706-95778dfbb74e/go.mod h1:F5haX7vjVVG0kc13fIWeqUViNPyEJxv/OmvnBo0Yme4= -github.com/coreos/go-systemd v0.0.0-20190719114852-fd7a80b32e1f/go.mod h1:F5haX7vjVVG0kc13fIWeqUViNPyEJxv/OmvnBo0Yme4= github.com/coreos/go-systemd/v22 v22.0.0/go.mod h1:xO0FLkIi5MaZafQlIrOotqXZ90ih+1atmu1JpKERPPk= github.com/coreos/go-systemd/v22 v22.1.0/go.mod h1:xO0FLkIi5MaZafQlIrOotqXZ90ih+1atmu1JpKERPPk= github.com/coreos/go-systemd/v22 v22.3.2/go.mod h1:Y58oyj3AT4RCenI/lSvhwexgC+NSVTIJ3seZv2GcEnc= -github.com/coreos/go-systemd/v22 v22.4.0/go.mod h1:Y58oyj3AT4RCenI/lSvhwexgC+NSVTIJ3seZv2GcEnc= -github.com/coreos/go-systemd/v22 v22.5.0/go.mod h1:Y58oyj3AT4RCenI/lSvhwexgC+NSVTIJ3seZv2GcEnc= github.com/coreos/pkg v0.0.0-20160727233714-3ac0863d7acf/go.mod h1:E3G3o1h8I7cfcXa63jLwjI0eiQQMgzzUDFVpN/nH/eA= github.com/coreos/pkg v0.0.0-20180928190104-399ea9e2e55f/go.mod h1:E3G3o1h8I7cfcXa63jLwjI0eiQQMgzzUDFVpN/nH/eA= github.com/cpuguy83/go-md2man v1.0.10/go.mod h1:SmD6nW6nTyfqj6ABTjUi3V3JVMnlJmwcJI5acqYI6dE= @@ -1231,13 +510,11 @@ github.com/cpuguy83/go-md2man/v2 v2.0.0/go.mod h1:maD7wRr/U5Z6m/iR4s+kqSMx2CaBsr github.com/cpuguy83/go-md2man/v2 v2.0.2/go.mod h1:tgQtvFlXSQOSOSIRvRPT7W67SCa46tRHOmNcaadrF8o= github.com/creack/pty v1.1.7/go.mod h1:lj5s0c3V2DBrqTV7llrYr5NG6My20zk30Fl46Y7DoTY= github.com/creack/pty v1.1.9/go.mod h1:oKZEueFk5CKHvIhNR5MUki03XCEU+Q6VDXinZuGJ33E= -github.com/creack/pty v1.1.11/go.mod h1:oKZEueFk5CKHvIhNR5MUki03XCEU+Q6VDXinZuGJ33E= github.com/curioswitch/go-reassign v0.2.0 h1:G9UZyOcpk/d7Gd6mqYgd8XYWFMw/znxwGDUstnC9DIo= github.com/curioswitch/go-reassign v0.2.0/go.mod h1:x6OpXuWvgfQaMGks2BZybTngWjT84hqJfKoO8Tt/Roc= github.com/cyberphone/json-canonicalization v0.0.0-20220623050100-57a0ce2678a7 h1:vU+EP9ZuFUCYE0NYLwTSob+3LNEJATzNfP/DC7SWGWI= github.com/cyberphone/json-canonicalization v0.0.0-20220623050100-57a0ce2678a7/go.mod h1:uzvlm1mxhHkdfqitSA92i7Se+S9ksOn3a3qmv/kyOCw= github.com/cyphar/filepath-securejoin v0.2.2/go.mod h1:FpkQEhXnPnOthhzymB7CGsFk2G9VLXONKD9G7QGMM+4= -github.com/cyphar/filepath-securejoin v0.2.3/go.mod h1:aPGpWjXOXUn2NCNjFvBE6aRxGGx79pTxQpKOJNYHHl4= github.com/d2g/dhcp4 v0.0.0-20170904100407-a1d1b6c41b1c/go.mod h1:Ct2BUK8SB0YC1SMSibvLzxjeJLnrYEVLULFNiHY9YfQ= github.com/d2g/dhcp4client v1.0.0/go.mod h1:j0hNfjhrt2SxUOw55nL0ATM/z4Yt3t2Kd1mW34z5W5s= github.com/d2g/dhcp4server v0.0.0-20181031114812-7d4a0a7f59a5/go.mod h1:Eo87+Kg/IX2hfWJfwxMzLyuSZyxSoAug2nGa1G2QAi8= @@ -1251,16 +528,11 @@ github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38= github.com/denis-tingaikin/go-header v0.4.3 h1:tEaZKAlqql6SKCY++utLmkPLd6K8IBM20Ha7UVm+mtU= github.com/denis-tingaikin/go-header v0.4.3/go.mod h1:0wOCWuN71D5qIgE2nz9KrKmuYBAC2Mra5RassOIQ2/c= -github.com/dennwc/varint v1.0.0/go.mod h1:hnItb35rvZvJrbTALZtY/iQfDs48JKRG1RPpgziApxA= github.com/denverdino/aliyungo v0.0.0-20190125010748-a747050bb1ba/go.mod h1:dV8lFg6daOBZbT6/BDGIz6Y3WFGn8juu6G+CQ6LHtl0= github.com/depcheck-test/depcheck-test v0.0.0-20220607135614-199033aaa936 h1:foGzavPWwtoyBvjWyKJYDYsyzy+23iBV7NKTwdk+LRY= -github.com/devigned/tab v0.1.1/go.mod h1:XG9mPq0dFghrYvoBF3xdRrJzSTX1b7IQrvaL9mzjeJY= github.com/dgrijalva/jwt-go v0.0.0-20170104182250-a601269ab70c/go.mod h1:E3ru+11k8xSBh+hMPgOLZmtrrCbhqsmaPHjLKYnJCaQ= github.com/dgrijalva/jwt-go v3.2.0+incompatible/go.mod h1:E3ru+11k8xSBh+hMPgOLZmtrrCbhqsmaPHjLKYnJCaQ= github.com/dgryski/go-sip13 v0.0.0-20181026042036-e10d5fee7954/go.mod h1:vAd38F8PWV+bWy6jNmig1y/TA+kYO4g3RSRF0IAv0no= -github.com/dgryski/go-sip13 v0.0.0-20200911182023-62edffca9245/go.mod h1:vAd38F8PWV+bWy6jNmig1y/TA+kYO4g3RSRF0IAv0no= -github.com/digitalocean/godo v1.78.0/go.mod h1:GBmu8MkjZmNARE7IXRPmkbbnocNN8+uBm0xbEVw2LCs= -github.com/digitalocean/godo v1.98.0/go.mod h1:NRpFznZFvhHjBoqZAaOD3khVzsJ3EibzKqFL4R60dmA= github.com/digitorus/pkcs7 v0.0.0-20221019075359-21b8b40e6bb4/go.mod h1:SKVExuS+vpu2l9IoOc0RwqE7NYnb0JlcFHFnEJkVDzc= github.com/digitorus/pkcs7 v0.0.0-20221212123742-001c36b64ec3 h1:rjCXeRWazGsbcBlExMcAW8H1LGdgJ9r619y7+aeKgds= github.com/digitorus/pkcs7 v0.0.0-20221212123742-001c36b64ec3/go.mod h1:SKVExuS+vpu2l9IoOc0RwqE7NYnb0JlcFHFnEJkVDzc= @@ -1269,23 +541,16 @@ github.com/digitorus/timestamp v0.0.0-20221019182153-ef3b63b79b31/go.mod h1:6V2N github.com/dimchansky/utfbom v1.1.1 h1:vV6w1AhK4VMnhBno/TPVCoK9U/LP0PkLCS9tbxHdi/U= github.com/dimchansky/utfbom v1.1.1/go.mod h1:SxdoEBH5qIqFocHMyGOXVAybYJdr71b1Q/j0mACtrfE= github.com/dnaeon/go-vcr v1.0.1/go.mod h1:aBB1+wY4s93YsC3HHjMBMrwTj2R9FHDzUr9KyGc8n1E= -github.com/dnaeon/go-vcr v1.1.0/go.mod h1:M7tiix8f0r6mKKJ3Yq/kqU1OYf3MnfmBWVbPx/yU9ko= github.com/dnaeon/go-vcr v1.2.0 h1:zHCHvJYTMh1N7xnV7zf1m1GPBF9Ad0Jk/whtQ1663qI= -github.com/dnaeon/go-vcr v1.2.0/go.mod h1:R4UdLID7HZT3taECzJs4YgbbH6PIGXB6W/sc5OLb6RQ= -github.com/docker/cli v0.0.0-20191017083524-a8ff7f821017/go.mod h1:JLrzqnKDaYBop7H2jaqPtU4hHvMKP+vjCwu2uszcLI8= github.com/docker/cli v20.10.7+incompatible/go.mod h1:JLrzqnKDaYBop7H2jaqPtU4hHvMKP+vjCwu2uszcLI8= github.com/docker/cli v24.0.0+incompatible h1:0+1VshNwBQzQAx9lOl+OYCTCEAD8fKs/qeXMx3O0wqM= github.com/docker/cli v24.0.0+incompatible/go.mod h1:JLrzqnKDaYBop7H2jaqPtU4hHvMKP+vjCwu2uszcLI8= github.com/docker/distribution v0.0.0-20190905152932-14b96e55d84c/go.mod h1:0+TTO4EOBfRPhZXAeF1Vu+W3hHZ8eLp8PgKVZlcvtFY= github.com/docker/distribution v2.7.1-0.20190205005809-0d3efadf0154+incompatible/go.mod h1:J2gT2udsDAN96Uj4KfcMRqY0/ypR+oyYUYmja8H+y+w= github.com/docker/distribution v2.7.1+incompatible/go.mod h1:J2gT2udsDAN96Uj4KfcMRqY0/ypR+oyYUYmja8H+y+w= -github.com/docker/distribution v2.8.1+incompatible/go.mod h1:J2gT2udsDAN96Uj4KfcMRqY0/ypR+oyYUYmja8H+y+w= github.com/docker/distribution v2.8.2+incompatible h1:T3de5rq0dB1j30rp0sA2rER+m322EBzniBPB6ZIzuh8= github.com/docker/distribution v2.8.2+incompatible/go.mod h1:J2gT2udsDAN96Uj4KfcMRqY0/ypR+oyYUYmja8H+y+w= -github.com/docker/docker v1.4.2-0.20190924003213-a8608b5b67c7/go.mod h1:eEKB0N0r5NX/I1kEveEz05bcu8tLC/8azJZsviup8Sk= github.com/docker/docker v20.10.7+incompatible/go.mod h1:eEKB0N0r5NX/I1kEveEz05bcu8tLC/8azJZsviup8Sk= -github.com/docker/docker v20.10.14+incompatible/go.mod h1:eEKB0N0r5NX/I1kEveEz05bcu8tLC/8azJZsviup8Sk= -github.com/docker/docker v23.0.4+incompatible/go.mod h1:eEKB0N0r5NX/I1kEveEz05bcu8tLC/8azJZsviup8Sk= github.com/docker/docker v24.0.0+incompatible h1:z4bf8HvONXX9Tde5lGBMQ7yCJgNahmJumdrStZAbeY4= github.com/docker/docker v24.0.0+incompatible/go.mod h1:eEKB0N0r5NX/I1kEveEz05bcu8tLC/8azJZsviup8Sk= github.com/docker/docker-credential-helpers v0.6.3/go.mod h1:WRaJzqw3CTB9bk10avuGsjVBZsD05qeibJ1/TYlvc0Y= @@ -1297,13 +562,11 @@ github.com/docker/go-events v0.0.0-20190806004212-e31b211e4f1c/go.mod h1:Uw6Uezg github.com/docker/go-metrics v0.0.0-20180209012529-399ea8c73916/go.mod h1:/u0gXw0Gay3ceNrsHubL3BtdOL2fHf93USgMTe0W5dI= github.com/docker/go-metrics v0.0.1/go.mod h1:cG1hvH2utMXtqgqqYE9plW6lDxS3/5ayHzueweSI3Vw= github.com/docker/go-units v0.4.0/go.mod h1:fgPhTUdO+D/Jk86RDLlptpiXQzgHJF7gydDDbaIK4Dk= -github.com/docker/go-units v0.5.0/go.mod h1:fgPhTUdO+D/Jk86RDLlptpiXQzgHJF7gydDDbaIK4Dk= github.com/docker/libtrust v0.0.0-20150114040149-fa567046d9b1/go.mod h1:cyGadeNEkKy96OOhEzfZl+yxihPEzKnqJwvfuSUqbZE= github.com/docker/spdystream v0.0.0-20160310174837-449fdfce4d96/go.mod h1:Qh8CwZgvJUkLughtfhJv5dyTYa91l1fOUCrgjqmcifM= github.com/docopt/docopt-go v0.0.0-20180111231733-ee0de3bc6815/go.mod h1:WwZ+bS3ebgob9U8Nd0kOddGdZWjyMGR8Wziv+TBNwSE= github.com/dustin/go-humanize v0.0.0-20171111073723-bb3d318650d4/go.mod h1:HtrtbFcZ19U5GC7JDqmcUSB87Iq5E25KnS6fMYU6eOk= github.com/dustin/go-humanize v1.0.0/go.mod h1:HtrtbFcZ19U5GC7JDqmcUSB87Iq5E25KnS6fMYU6eOk= -github.com/eapache/go-resiliency v1.1.0/go.mod h1:kFI+JgMyC7bLPUVY133qvEBtVayf5mFgVsvEsIPBvNs= github.com/eapache/go-resiliency v1.2.0/go.mod h1:kFI+JgMyC7bLPUVY133qvEBtVayf5mFgVsvEsIPBvNs= github.com/eapache/go-resiliency v1.3.0 h1:RRL0nge+cWGlxXbUzJ7yMcq6w2XBEr19dCN6HECGaT0= github.com/eapache/go-resiliency v1.3.0/go.mod h1:5yPzW0MIvSe0JDsv0v+DvcjEv2FyD6iZYSs1ZI+iQho= @@ -1312,14 +575,9 @@ github.com/eapache/go-xerial-snappy v0.0.0-20230111030713-bf00bc1b83b6 h1:8yY/I9 github.com/eapache/go-xerial-snappy v0.0.0-20230111030713-bf00bc1b83b6/go.mod h1:YvSRo5mw33fLEx1+DlK6L2VV43tJt5Eyel9n9XBcR+0= github.com/eapache/queue v1.1.0 h1:YOEu7KNc61ntiQlcEeUIoDTJ2o8mQznoNvUhiigpIqc= github.com/eapache/queue v1.1.0/go.mod h1:6eCeP0CKFpHLu8blIFXhExK/dRa7WDZfr6jVFPTqq+I= -github.com/edsrzf/mmap-go v1.0.0/go.mod h1:YO35OhQPt3KJa3ryjFM5Bs14WD66h8eGKpfaBNrHW5M= -github.com/edsrzf/mmap-go v1.1.0/go.mod h1:19H/e8pUPLicwkyNgOykDXkJ9F0MHE+Z52B8EIth78Q= github.com/elazarl/goproxy v0.0.0-20180725130230-947c36da3153/go.mod h1:/Zj4wYkgs4iZTTu3o/KG3Itv/qCCa8VVMlb3i9OVuzc= github.com/emicklei/go-restful v0.0.0-20170410110728-ff4f55a20633/go.mod h1:otzb+WCGbkyDHkqmQmT5YD2WR4BBwUdeQoFo8l/7tVs= github.com/emicklei/go-restful v2.9.5+incompatible/go.mod h1:otzb+WCGbkyDHkqmQmT5YD2WR4BBwUdeQoFo8l/7tVs= -github.com/emicklei/go-restful/v3 v3.8.0/go.mod h1:6n3XBCmQQb25CM2LCACGz8ukIrRry+4bhvbpWn3mrbc= -github.com/emicklei/go-restful/v3 v3.9.0/go.mod h1:6n3XBCmQQb25CM2LCACGz8ukIrRry+4bhvbpWn3mrbc= -github.com/emicklei/go-restful/v3 v3.10.1/go.mod h1:6n3XBCmQQb25CM2LCACGz8ukIrRry+4bhvbpWn3mrbc= github.com/emicklei/go-restful/v3 v3.10.2 h1:hIovbnmBTLjHXkqEBUz3HGpXZdM7ZrE9fJIZIqlJLqE= github.com/emicklei/go-restful/v3 v3.10.2/go.mod h1:6n3XBCmQQb25CM2LCACGz8ukIrRry+4bhvbpWn3mrbc= github.com/emirpasic/gods v1.12.0/go.mod h1:YfzfFFoVP/catgzJb4IKIqXjX78Ha8FMSDh3ymbK86o= @@ -1333,23 +591,14 @@ github.com/envoyproxy/go-control-plane v0.9.9-0.20201210154907-fd9021fe5dad/go.m github.com/envoyproxy/go-control-plane v0.9.9-0.20210217033140-668b12f5399d/go.mod h1:cXg6YxExXjJnVBQHBLXeUAgxn2UodCpnH306RInaBQk= github.com/envoyproxy/go-control-plane v0.9.9-0.20210512163311-63b5d3c536b0/go.mod h1:hliV/p42l8fGbc6Y9bQ70uLwIvmJyVE5k4iMKlh8wCQ= github.com/envoyproxy/go-control-plane v0.9.10-0.20210907150352-cf90f659a021/go.mod h1:AFq3mo9L8Lqqiid3OhADV3RfLJnjiw63cSpi+fDTRC0= -github.com/envoyproxy/go-control-plane v0.10.1/go.mod h1:AY7fTTXNdv/aJ2O5jwpxAPOWUZ7hQAEvzN5Pf27BkQQ= github.com/envoyproxy/go-control-plane v0.10.2-0.20220325020618-49ff273808a1/go.mod h1:KJwIaB5Mv44NWtYuAOFCVOjcI94vtpEz2JU/D2v6IjE= -github.com/envoyproxy/go-control-plane v0.10.3/go.mod h1:fJJn/j26vwOu972OllsvAgJJM//w9BV6Fxbg2LuVd34= -github.com/envoyproxy/go-control-plane v0.11.0/go.mod h1:VnHyVMpzcLvCFt9yUz1UnCwHLhwx1WguiVDV7pTG/tI= -github.com/envoyproxy/go-control-plane v0.11.1-0.20230524094728-9239064ad72f/go.mod h1:sfYdkwUW4BA3PbKjySwjJy+O4Pu0h62rlqCMHNk+K+Q= github.com/envoyproxy/protoc-gen-validate v0.1.0/go.mod h1:iSmxcyjqTsJpI2R4NaDN7+kN2VEUnK/pcBlmesArF7c= -github.com/envoyproxy/protoc-gen-validate v0.6.7/go.mod h1:dyJXwwfPK2VSqiB9Klm1J6romD608Ba7Hij42vrOBCo= -github.com/envoyproxy/protoc-gen-validate v0.9.1/go.mod h1:OKNgG7TCp5pF4d6XftA0++PMirau2/yoOwVac3AbF2w= -github.com/envoyproxy/protoc-gen-validate v0.10.0/go.mod h1:DRjgyB0I43LtJapqN6NiRwroiAU2PaFuvk/vjgh61ss= -github.com/envoyproxy/protoc-gen-validate v0.10.1/go.mod h1:DRjgyB0I43LtJapqN6NiRwroiAU2PaFuvk/vjgh61ss= github.com/esimonov/ifshort v1.0.4 h1:6SID4yGWfRae/M7hkVDVVyppy8q/v9OuxNdmjLQStBA= github.com/esimonov/ifshort v1.0.4/go.mod h1:Pe8zjlRrJ80+q2CxHLfEOfTwxCZ4O+MuhcHcfgNWTk0= github.com/ettle/strcase v0.1.1 h1:htFueZyVeE1XNnMEfbqp5r67qAN/4r6ya1ysq8Q+Zcw= github.com/ettle/strcase v0.1.1/go.mod h1:hzDLsPC7/lwKyBOywSHEP89nt2pDgdy+No1NBA9o9VY= github.com/evanphx/json-patch v0.5.2/go.mod h1:ZWS5hhDbVDyob71nXKNL0+PWn6ToqBHMikGIFbs31qQ= github.com/evanphx/json-patch v4.9.0+incompatible/go.mod h1:50XU6AFN0ol/bzJsmQLiYLvXMP4fmwYFNcr97nuDLSk= -github.com/evanphx/json-patch v4.11.0+incompatible/go.mod h1:50XU6AFN0ol/bzJsmQLiYLvXMP4fmwYFNcr97nuDLSk= github.com/evanphx/json-patch v4.12.0+incompatible h1:4onqiflcdA9EOZ4RxV643DvftH5pOlLGNtQ5lPWQu84= github.com/evanphx/json-patch v4.12.0+incompatible/go.mod h1:50XU6AFN0ol/bzJsmQLiYLvXMP4fmwYFNcr97nuDLSk= github.com/evanphx/json-patch/v5 v5.6.0 h1:b91NhWfaz02IuVxO9faSllyAtNXHMPkC5J8sJCLunww= @@ -1358,36 +607,21 @@ github.com/facebookgo/clock v0.0.0-20150410010913-600d898af40a h1:yDWHCSQ40h88yi github.com/facebookgo/limitgroup v0.0.0-20150612190941-6abd8d71ec01 h1:IeaD1VDVBPlx3viJT9Md8if8IxxJnO+x0JCGb054heg= github.com/facebookgo/muster v0.0.0-20150708232844-fd3d7953fd52 h1:a4DFiKFJiDRGFD1qIcqGLX/WlUMD9dyLSLDt+9QZgt8= github.com/fatih/color v1.7.0/go.mod h1:Zm6kSWBoL9eyXnKyktHP6abPY2pDugNf5KwzbycvMj4= -github.com/fatih/color v1.9.0/go.mod h1:eQcE1qtQxscV5RaZvpXrrb8Drkc3/DdQ+uUYCNjL+zU= -github.com/fatih/color v1.10.0/go.mod h1:ELkj/draVOlAH/xkhN6mQ50Qd0MPOk5AAr3maGEBuJM= -github.com/fatih/color v1.12.0/go.mod h1:ELkj/draVOlAH/xkhN6mQ50Qd0MPOk5AAr3maGEBuJM= -github.com/fatih/color v1.13.0/go.mod h1:kLAiJbzzSOZDVNGyDpeOxJ47H46qBXwg5ILebYFFOfk= -github.com/fatih/color v1.14.1/go.mod h1:2oHN61fhTpgcxD3TSWCgKDiH1+x4OiDVVGH8WlgGZGg= github.com/fatih/color v1.15.0 h1:kOqh6YHBtK8aywxGerMG2Eq3H6Qgoqeo13Bk2Mv/nBs= github.com/fatih/color v1.15.0/go.mod h1:0h5ZqXfHYED7Bhv2ZJamyIOUej9KtShiJESRwBDUSsw= github.com/fatih/structtag v1.2.0 h1:/OdNE99OxoI/PqaW/SuSK9uxxT3f/tcSZgon/ssNSx4= github.com/fatih/structtag v1.2.0/go.mod h1:mBJUNpUnHmRKrKlQQlmCrh5PuhftFbNv8Ys4/aAZl94= -github.com/felixge/httpsnoop v1.0.1/go.mod h1:m8KPJKqk1gH5J9DgRY2ASl2lWCfGKXixSwevea8zH2U= -github.com/felixge/httpsnoop v1.0.2/go.mod h1:m8KPJKqk1gH5J9DgRY2ASl2lWCfGKXixSwevea8zH2U= -github.com/felixge/httpsnoop v1.0.3/go.mod h1:m8KPJKqk1gH5J9DgRY2ASl2lWCfGKXixSwevea8zH2U= github.com/firefart/nonamedreturns v1.0.4 h1:abzI1p7mAEPYuR4A+VLKn4eNDOycjYo2phmY9sfv40Y= github.com/firefart/nonamedreturns v1.0.4/go.mod h1:TDhe/tjI1BXo48CmYbUduTV7BdIga8MAO/xbKdcVsGI= github.com/flowstack/go-jsonschema v0.1.1/go.mod h1:yL7fNggx1o8rm9RlgXv7hTBWxdBM0rVwpMwimd3F3N0= github.com/flynn/go-shlex v0.0.0-20150515145356-3f9db97f8568/go.mod h1:xEzjJPgXI435gkrCt3MPfRiAkVrwSbHsst4LCFVfpJc= -github.com/fogleman/gg v1.2.1-0.20190220221249-0403632d5b90/go.mod h1:R/bRT+9gY/C5z7JzPU0zXsXHKM4/ayA+zqcVNZzPa1k= -github.com/fogleman/gg v1.3.0/go.mod h1:R/bRT+9gY/C5z7JzPU0zXsXHKM4/ayA+zqcVNZzPa1k= github.com/form3tech-oss/jwt-go v3.2.2+incompatible/go.mod h1:pbq4aXjuKjdthFRnoDwaVPLA+WlJuPGy+QneDUgJi2k= -github.com/form3tech-oss/jwt-go v3.2.3+incompatible/go.mod h1:pbq4aXjuKjdthFRnoDwaVPLA+WlJuPGy+QneDUgJi2k= github.com/fortytw2/leaktest v1.3.0 h1:u8491cBMTQ8ft8aeV+adlcytMZylmA5nnwwkRZjI8vw= github.com/fortytw2/leaktest v1.3.0/go.mod h1:jDsjWgpAGjm2CA7WthBh/CdZYEPF31XHquHwclZch5g= -github.com/franela/goblin v0.0.0-20210519012713-85d372ac71e2/go.mod h1:VzmDKDJVZI3aJmnRI9VjAn9nJ8qPPsN1fqzr9dqInIo= -github.com/franela/goreq v0.0.0-20171204163338-bcd34c9993f8/go.mod h1:ZhphrRTfi2rbfLwlschooIH4+wKKDR4Pdxhh+TRoA20= github.com/frankban/quicktest v1.11.3/go.mod h1:wRf/ReqHper53s+kmmSZizM8NamnL3IM0I9ntUbOk+k= -github.com/frankban/quicktest v1.14.3/go.mod h1:mgiwOwqx65TmIk1wJ6Q7wvnVMocbUorkibMOrVTHZps= github.com/frankban/quicktest v1.14.4 h1:g2rn0vABPOOXmZUj+vbmUp0lPoXEMuhTpIluN0XL9UY= github.com/fsnotify/fsnotify v1.4.7/go.mod h1:jwhsz4b93w/PPRr/qN1Yymfu8t87LnFCMoQvtojpjFo= github.com/fsnotify/fsnotify v1.4.9/go.mod h1:znqG4EE+3YCdAaPaxE2ZRY/06pZUdp0tY4IgpuI1SZQ= -github.com/fsnotify/fsnotify v1.5.1/go.mod h1:T3375wBYaZdLLcVNkcVbzGHY7f1l/uK5T5Ai1i3InKU= github.com/fsnotify/fsnotify v1.5.4/go.mod h1:OVB6XrOHzAwXMpEM7uPOzcehqUV2UqJxmVXmkdnm1bU= github.com/fsnotify/fsnotify v1.6.0 h1:n+5WquG0fcWoWp6xPWfHdbskMCQaFnG6PfBrh1Ky4HY= github.com/fsnotify/fsnotify v1.6.0/go.mod h1:sl3t1tCWJFWoRz9R8WJCbQihKKwmorjAbSClcnxKAGw= @@ -1397,24 +631,14 @@ github.com/fzipp/gocyclo v0.6.0/go.mod h1:rXPyn8fnlpa0R2csP/31uerbiVBugk5whMdlya github.com/gabriel-vasile/mimetype v1.4.2 h1:w5qFW6JKBz9Y393Y4q372O9A7cUSequkh1Q7OhCmWKU= github.com/gabriel-vasile/mimetype v1.4.2/go.mod h1:zApsH/mKG4w07erKIaJPFiX0Tsq9BFQgN3qGY5GnNgA= github.com/garyburd/redigo v0.0.0-20150301180006-535138d7bcd7/go.mod h1:NR3MbYisc3/PwhQ00EMzDiPmrwpPxAn5GI05/YaO1SY= -github.com/getkin/kin-openapi v0.76.0/go.mod h1:660oXbgy5JFMKreazJaQTw7o+X00qeSyhcnluiMv+Xg= -github.com/getsentry/raven-go v0.2.0/go.mod h1:KungGk8q33+aIAZUIVWZDr2OfAEBsO49PX4NzFV5kcQ= github.com/ghodss/yaml v0.0.0-20150909031657-73d445a93680/go.mod h1:4dBDuWmgqj2HViK6kFavaiC9ZROes6MMH2rRYeMEF04= github.com/ghodss/yaml v1.0.0/go.mod h1:4dBDuWmgqj2HViK6kFavaiC9ZROes6MMH2rRYeMEF04= -github.com/gin-contrib/sse v0.1.0/go.mod h1:RHrZQHXnP2xjPF+u1gW/2HnVO7nvIa9PG3Gm+fLHvGI= -github.com/gin-gonic/gin v1.6.3/go.mod h1:75u5sXoLsGZoRN5Sgbi1eraJ4GU3++wFwWzhwvtwp4M= -github.com/gin-gonic/gin v1.7.7/go.mod h1:axIBovoeJpVj8S3BwE0uPMTeReE4+AfFtqpqaZ1qq1U= github.com/gliderlabs/ssh v0.2.2/go.mod h1:U7qILu1NlMHj9FlMhZLlkCdDnU1DBEAqr0aevW3Awn0= github.com/gliderlabs/ssh v0.3.5 h1:OcaySEmAQJgyYcArR+gGGTHCyE7nvhEMTlYY+Dp8CpY= github.com/go-chi/chi v4.1.2+incompatible h1:fGFk2Gmi/YKXk0OmGfBh0WgmN3XB8lVnEyNz34tQRec= github.com/go-chi/chi v4.1.2+incompatible/go.mod h1:eB3wogJHnLi3x/kFX2A+IbTBlXxmMeXJVKy9tTv1XzQ= github.com/go-critic/go-critic v0.8.1 h1:16omCF1gN3gTzt4j4J6fKI/HnRojhEp+Eks6EuKw3vw= github.com/go-critic/go-critic v0.8.1/go.mod h1:kpzXl09SIJX1cr9TB/g/sAG+eFEl7ZS9f9cqvZtyNl0= -github.com/go-fonts/dejavu v0.1.0/go.mod h1:4Wt4I4OU2Nq9asgDCteaAaWZOV24E+0/Pwo0gppep4g= -github.com/go-fonts/latin-modern v0.2.0/go.mod h1:rQVLdDMK+mK1xscDwsqM5J8U2jrRa3T0ecnM9pNujks= -github.com/go-fonts/liberation v0.1.1/go.mod h1:K6qoJYypsmfVjWg8KOVDQhLc8UDgIK2HYqyqAO9z7GY= -github.com/go-fonts/liberation v0.2.0/go.mod h1:K6qoJYypsmfVjWg8KOVDQhLc8UDgIK2HYqyqAO9z7GY= -github.com/go-fonts/stix v0.1.0/go.mod h1:w/c1f0ldAUlJmLBvlbkvVXLAD+tAMqobIIQpmnUIzUY= github.com/go-git/gcfg v1.5.0 h1:Q5ViNfGF8zFgyJWPqYwA7qGFoMTEiBmdlkcfRmpIMa4= github.com/go-git/go-billy/v5 v5.4.1 h1:Uwp5tDRkPr+l/TnbHOQzp+tmJfLceOlbVucgpTz8ix4= github.com/go-git/go-git/v5 v5.6.1 h1:q4ZRqQl4pR/ZJHc1L5CFjGA1a10u76aV1iC+nh+bHsk= @@ -1426,29 +650,20 @@ github.com/go-jose/go-jose/v3 v3.0.0 h1:s6rrhirfEP/CGIoc6p+PZAeogN2SxKav6Wp7+dyM github.com/go-jose/go-jose/v3 v3.0.0/go.mod h1:RNkWWRld676jZEYoV3+XK8L2ZnNSvIsxFMht0mSX+u8= github.com/go-kit/kit v0.8.0/go.mod h1:xBxKIO96dXMWWy0MnWVtmwkA9/13aqxPnvrjFYMA2as= github.com/go-kit/kit v0.9.0/go.mod h1:xBxKIO96dXMWWy0MnWVtmwkA9/13aqxPnvrjFYMA2as= -github.com/go-kit/kit v0.12.0/go.mod h1:lHd+EkCZPIwYItmGDDRdhinkzX2A1sj+M9biaEaizzs= github.com/go-kit/log v0.1.0/go.mod h1:zbhenjAZHb184qTLMA9ZjW7ThYL0H2mk7Q6pNt4vbaY= -github.com/go-kit/log v0.2.0/go.mod h1:NwTd00d/i8cPZ3xOwwiv2PO5MOcx78fFErGNcVmBjv0= github.com/go-kit/log v0.2.1 h1:MRVx0/zhvdseW+Gza6N9rVzU/IVzaeE1SFI4raAhmBU= github.com/go-kit/log v0.2.1/go.mod h1:NwTd00d/i8cPZ3xOwwiv2PO5MOcx78fFErGNcVmBjv0= -github.com/go-latex/latex v0.0.0-20210118124228-b3d85cf34e07/go.mod h1:CO1AlKB2CSIqUrmQPqA0gdRIlnLEY0gK5JGjh37zN5U= -github.com/go-latex/latex v0.0.0-20210823091927-c0d11ff05a81/go.mod h1:SX0U8uGpxhq9o2S/CELCSUxEWWAuoCUcVCQWv7G2OCk= github.com/go-logfmt/logfmt v0.3.0/go.mod h1:Qt1PoO58o5twSAckw1HlFXLmHsOX5/0LbT9GBnD5lWE= github.com/go-logfmt/logfmt v0.4.0/go.mod h1:3RMwSq7FuexP4Kalkev3ejPJsZTpXXBr9+V4qmtdjCk= github.com/go-logfmt/logfmt v0.5.0/go.mod h1:wCYkCAKZfumFQihp8CzCvQ3paCTfi41vtzG1KdI/P7A= -github.com/go-logfmt/logfmt v0.5.1/go.mod h1:WYhtIu8zTZfxdn5+rREduYbwxfcBr/Vr6KEVveWlfTs= github.com/go-logfmt/logfmt v0.6.0 h1:wGYYu3uicYdqXVgoYbvnkrPVXkuLM1p1ifugDMEdRi4= github.com/go-logfmt/logfmt v0.6.0/go.mod h1:WYhtIu8zTZfxdn5+rREduYbwxfcBr/Vr6KEVveWlfTs= github.com/go-logr/logr v0.1.0/go.mod h1:ixOQHD9gLJUVQQ2ZOR7zLEifBX6tGkNJF4QyIY7sIas= github.com/go-logr/logr v0.2.0/go.mod h1:z6/tIYblkpsD+a4lm/fGIIU9mZ+XfAiaFtq7xTgseGU= -github.com/go-logr/logr v0.4.0/go.mod h1:z6/tIYblkpsD+a4lm/fGIIU9mZ+XfAiaFtq7xTgseGU= github.com/go-logr/logr v1.2.0/go.mod h1:jdQByPbusPIv2/zmleS9BjJVeZ6kBagPoEUsqbVz/1A= -github.com/go-logr/logr v1.2.1/go.mod h1:jdQByPbusPIv2/zmleS9BjJVeZ6kBagPoEUsqbVz/1A= github.com/go-logr/logr v1.2.2/go.mod h1:jdQByPbusPIv2/zmleS9BjJVeZ6kBagPoEUsqbVz/1A= -github.com/go-logr/logr v1.2.3/go.mod h1:jdQByPbusPIv2/zmleS9BjJVeZ6kBagPoEUsqbVz/1A= github.com/go-logr/logr v1.2.4 h1:g01GSCwiDw2xSZfjJ2/T9M+S6pFdcNtFYsp+Y43HYDQ= github.com/go-logr/logr v1.2.4/go.mod h1:jdQByPbusPIv2/zmleS9BjJVeZ6kBagPoEUsqbVz/1A= -github.com/go-logr/stdr v1.2.0/go.mod h1:YkVgnZu1ZjjL7xTxrfm/LLZBfkhTqSR1ydtm6jTKKwI= github.com/go-logr/stdr v1.2.2 h1:hSWxHoqTgW2S2qGc0LTAI563KZ5YKYRhT3MFKZMbjag= github.com/go-logr/stdr v1.2.2/go.mod h1:mMo/vtBO5dYbehREoey6XUKy/eSumjCCveDpRre4VKE= github.com/go-openapi/analysis v0.21.2/go.mod h1:HZwRk4RRisyG8vx2Oe6aqeSQcoxRp47Xkp3+K6q+LdY= @@ -1457,78 +672,52 @@ github.com/go-openapi/analysis v0.21.4/go.mod h1:4zQ35W4neeZTqh3ol0rv/O8JBbka9Qy github.com/go-openapi/errors v0.19.8/go.mod h1:cM//ZKUKyO06HSwqAelJ5NsEMMcpa6VpXe8DOa1Mi1M= github.com/go-openapi/errors v0.19.9/go.mod h1:cM//ZKUKyO06HSwqAelJ5NsEMMcpa6VpXe8DOa1Mi1M= github.com/go-openapi/errors v0.20.2/go.mod h1:cM//ZKUKyO06HSwqAelJ5NsEMMcpa6VpXe8DOa1Mi1M= -github.com/go-openapi/errors v0.20.3/go.mod h1:Z3FlZ4I8jEGxjUK+bugx3on2mIAk4txuAOhlsB1FSgk= github.com/go-openapi/errors v0.20.4 h1:unTcVm6PispJsMECE3zWgvG4xTiKda1LIR5rCRWLG6M= github.com/go-openapi/errors v0.20.4/go.mod h1:Z3FlZ4I8jEGxjUK+bugx3on2mIAk4txuAOhlsB1FSgk= -github.com/go-openapi/jsonpointer v0.0.0-20160704185906-46af16f9f7b1/go.mod h1:+35s3my2LFTysnkMfxsJBAMHj/DoqoB9knIWoYG/Vk0= github.com/go-openapi/jsonpointer v0.19.2/go.mod h1:3akKfEdA7DF1sugOqz1dVQHBcuDBPKZGEoHC/NkiQRg= github.com/go-openapi/jsonpointer v0.19.3/go.mod h1:Pl9vOtqEWErmShwVjC8pYs9cog34VGT37dQOVbmoatg= github.com/go-openapi/jsonpointer v0.19.5/go.mod h1:Pl9vOtqEWErmShwVjC8pYs9cog34VGT37dQOVbmoatg= github.com/go-openapi/jsonpointer v0.19.6 h1:eCs3fxoIi3Wh6vtgmLTOjdhSpiqphQ+DaPn38N2ZdrE= github.com/go-openapi/jsonpointer v0.19.6/go.mod h1:osyAmYz/mB/C3I+WsTTSgw1ONzaLJoLCyoi6/zppojs= -github.com/go-openapi/jsonreference v0.0.0-20160704190145-13c6e3589ad9/go.mod h1:W3Z9FmVs9qj+KR4zFKmDPGiLdk1D9Rlm7cyMvf57TTg= github.com/go-openapi/jsonreference v0.19.2/go.mod h1:jMjeRr2HHw6nAVajTXJ4eiUwohSTlpa0o73RUL1owJc= github.com/go-openapi/jsonreference v0.19.3/go.mod h1:rjx6GuL8TTa9VaixXglHmQmIL98+wF9xc8zWvFonSJ8= -github.com/go-openapi/jsonreference v0.19.5/go.mod h1:RdybgQwPxbL4UEjuAruzK1x3nE69AqPYEJeo/TWfEeg= github.com/go-openapi/jsonreference v0.19.6/go.mod h1:diGHMEHg2IqXZGKxqyvWdfWU/aim5Dprw5bqpKkTvns= github.com/go-openapi/jsonreference v0.20.0/go.mod h1:Ag74Ico3lPc+zR+qjn4XBUmXymS4zJbYVCZmcgkasdo= -github.com/go-openapi/jsonreference v0.20.1/go.mod h1:Bl1zwGIM8/wsvqjsOQLJ/SH+En5Ap4rVB5KVcIDZG2k= github.com/go-openapi/jsonreference v0.20.2 h1:3sVjiK66+uXK/6oQ8xgcRKcFgQ5KXa2KvnJRumpMGbE= github.com/go-openapi/jsonreference v0.20.2/go.mod h1:Bl1zwGIM8/wsvqjsOQLJ/SH+En5Ap4rVB5KVcIDZG2k= github.com/go-openapi/loads v0.21.1/go.mod h1:/DtAMXXneXFjbQMGEtbamCZb+4x7eGwkvZCvBmwUG+g= github.com/go-openapi/loads v0.21.2 h1:r2a/xFIYeZ4Qd2TnGpWDIQNcP80dIaZgf704za8enro= github.com/go-openapi/loads v0.21.2/go.mod h1:Jq58Os6SSGz0rzh62ptiu8Z31I+OTHqmULx5e/gJbNw= -github.com/go-openapi/runtime v0.23.1/go.mod h1:AKurw9fNre+h3ELZfk6ILsfvPN+bvvlaU/M9q/r9hpk= -github.com/go-openapi/runtime v0.25.0/go.mod h1:Ux6fikcHXyyob6LNWxtE96hWwjBPYF0DXgVFuMTneOs= github.com/go-openapi/runtime v0.26.0 h1:HYOFtG00FM1UvqrcxbEJg/SwvDRvYLQKGhw2zaQjTcc= github.com/go-openapi/runtime v0.26.0/go.mod h1:QgRGeZwrUcSHdeh4Ka9Glvo0ug1LC5WyE+EV88plZrQ= -github.com/go-openapi/spec v0.0.0-20160808142527-6aced65f8501/go.mod h1:J8+jY1nAiCcj+friV/PDoE1/3eeccG9LYBs0tYvLOWc= github.com/go-openapi/spec v0.19.3/go.mod h1:FpwSN1ksY1eteniUU7X0N/BgJ7a4WvBFVA8Lj9mJglo= github.com/go-openapi/spec v0.20.4/go.mod h1:faYFR1CvsJZ0mNsmsphTMSoRrNV3TEDoAM7FOEWeq8I= github.com/go-openapi/spec v0.20.6/go.mod h1:2OpW+JddWPrpXSCIX8eOx7lZ5iyuWj3RYR6VaaBKcWA= -github.com/go-openapi/spec v0.20.7/go.mod h1:2OpW+JddWPrpXSCIX8eOx7lZ5iyuWj3RYR6VaaBKcWA= -github.com/go-openapi/spec v0.20.8/go.mod h1:2OpW+JddWPrpXSCIX8eOx7lZ5iyuWj3RYR6VaaBKcWA= github.com/go-openapi/spec v0.20.9 h1:xnlYNQAwKd2VQRRfwTEI0DcK+2cbuvI/0c7jx3gA8/8= github.com/go-openapi/spec v0.20.9/go.mod h1:2OpW+JddWPrpXSCIX8eOx7lZ5iyuWj3RYR6VaaBKcWA= github.com/go-openapi/strfmt v0.21.0/go.mod h1:ZRQ409bWMj+SOgXofQAGTIo2Ebu72Gs+WaRADcS5iNg= github.com/go-openapi/strfmt v0.21.1/go.mod h1:I/XVKeLc5+MM5oPNN7P6urMOpuLXEcNrCX/rPGuWb0k= -github.com/go-openapi/strfmt v0.21.2/go.mod h1:I/XVKeLc5+MM5oPNN7P6urMOpuLXEcNrCX/rPGuWb0k= github.com/go-openapi/strfmt v0.21.3/go.mod h1:k+RzNO0Da+k3FrrynSNN8F7n/peCmQQqbbXjtDfvmGg= github.com/go-openapi/strfmt v0.21.7 h1:rspiXgNWgeUzhjo1YU01do6qsahtJNByjLVbPLNHb8k= github.com/go-openapi/strfmt v0.21.7/go.mod h1:adeGTkxE44sPyLk0JV235VQAO/ZXUr8KAzYjclFs3ew= -github.com/go-openapi/swag v0.0.0-20160704191624-1d0bd113de87/go.mod h1:DXUve3Dpr1UfpPtxFw+EFuQ41HhCWZfha5jSVRG7C7I= github.com/go-openapi/swag v0.19.2/go.mod h1:POnQmlKehdgb5mhVOsnJFsivZCEZ/vjK9gh66Z9tfKk= github.com/go-openapi/swag v0.19.5/go.mod h1:POnQmlKehdgb5mhVOsnJFsivZCEZ/vjK9gh66Z9tfKk= -github.com/go-openapi/swag v0.19.14/go.mod h1:QYRuS/SOXUCsnplDa677K7+DxSOj6IPNl/eQntq43wQ= github.com/go-openapi/swag v0.19.15/go.mod h1:QYRuS/SOXUCsnplDa677K7+DxSOj6IPNl/eQntq43wQ= github.com/go-openapi/swag v0.21.1/go.mod h1:QYRuS/SOXUCsnplDa677K7+DxSOj6IPNl/eQntq43wQ= github.com/go-openapi/swag v0.22.3/go.mod h1:UzaqsxGiab7freDnrUUra0MwWfN/q7tE4j+VcZ0yl14= github.com/go-openapi/swag v0.22.4 h1:QLMzNJnMGPRNDCbySlcj1x01tzU8/9LTTL9hZZZogBU= github.com/go-openapi/swag v0.22.4/go.mod h1:UzaqsxGiab7freDnrUUra0MwWfN/q7tE4j+VcZ0yl14= -github.com/go-openapi/validate v0.21.0/go.mod h1:rjnrwK57VJ7A8xqfpAOEKRH8yQSGUriMu5/zuPSQ1hg= -github.com/go-openapi/validate v0.22.0/go.mod h1:rjnrwK57VJ7A8xqfpAOEKRH8yQSGUriMu5/zuPSQ1hg= github.com/go-openapi/validate v0.22.1 h1:G+c2ub6q47kfX1sOBLwIQwzBVt8qmOAARyo/9Fqs9NU= github.com/go-openapi/validate v0.22.1/go.mod h1:rjnrwK57VJ7A8xqfpAOEKRH8yQSGUriMu5/zuPSQ1hg= -github.com/go-pdf/fpdf v0.5.0/go.mod h1:HzcnA+A23uwogo0tp9yU+l3V+KXhiESpt1PMayhOh5M= -github.com/go-pdf/fpdf v0.6.0/go.mod h1:HzcnA+A23uwogo0tp9yU+l3V+KXhiESpt1PMayhOh5M= -github.com/go-playground/assert/v2 v2.0.1/go.mod h1:VDjEfimB/XKnb+ZQfWdccd7VUvScMdVu0Titje2rxJ4= github.com/go-playground/assert/v2 v2.2.0 h1:JvknZsQTYeFEAhQwI4qEt9cyV5ONwRHC+lYKSsYSR8s= -github.com/go-playground/locales v0.13.0/go.mod h1:taPMhCMXrRLJO55olJkUXHZBHCxTMfnGwq/HNwmWNS8= github.com/go-playground/locales v0.14.1 h1:EWaQ/wswjilfKLTECiXz7Rh+3BjFhfDFKv/oXslEjJA= github.com/go-playground/locales v0.14.1/go.mod h1:hxrqLVvrK65+Rwrd5Fc6F2O76J/NuW9t0sjnWqG1slY= -github.com/go-playground/universal-translator v0.17.0/go.mod h1:UkSxE5sNxxRwHyU+Scu5vgOQjsIJAF8j9muTVoKLVtA= github.com/go-playground/universal-translator v0.18.1 h1:Bcnm0ZwsGyWbCzImXv+pAJnYK9S473LQFuzCbDbfSFY= github.com/go-playground/universal-translator v0.18.1/go.mod h1:xekY+UJKNuX9WP91TpwSH2VMlDf28Uj24BCp08ZFTUY= -github.com/go-playground/validator/v10 v10.2.0/go.mod h1:uOYAAleCW8F/7oMFd6aG0GOhaH6EGOAJShg8Id5JGkI= -github.com/go-playground/validator/v10 v10.4.1/go.mod h1:nlOn6nFhuKACm19sB/8EGNn9GlaMV7XkbRSipzJ0Ii4= github.com/go-playground/validator/v10 v10.14.1 h1:9c50NUPC30zyuKprjL3vNZ0m5oG+jU0zvx4AqHGnv4k= github.com/go-playground/validator/v10 v10.14.1/go.mod h1:9iXMNT7sEkjXb0I+enO7QXmzG6QCsPWY4zveKFVRSyU= -github.com/go-resty/resty/v2 v2.1.1-0.20191201195748-d7b97669fe48/go.mod h1:dZGr0i9PLlaaTD4H/hoZIDjQ+r6xq8mgbRzHZf7f2J8= -github.com/go-resty/resty/v2 v2.7.0/go.mod h1:9PWDzw47qPphMRFfhsyk0NnSgvluHcljSMVIq3w7q0I= github.com/go-rod/rod v0.113.3 h1:oLiKZW721CCMwA5g7977cWfcAKQ+FuosP47Zf1QiDrA= -github.com/go-sql-driver/mysql v1.7.1/go.mod h1:OXbVy3sEdcQ2Doequ6Z5BW6fXNQTmx+9S1MCJN5yJMI= github.com/go-stack/stack v1.8.0/go.mod h1:v0f6uXyyMGvRgIKkXu+yp6POWl0qKG85gN/melR3HDY= -github.com/go-stack/stack v1.8.1/go.mod h1:dcoOX6HbPZSZptuspn9bctJ+N/CnF5gGygcUP3XYfe4= github.com/go-task/slim-sprig v0.0.0-20210107165309-348f09dbbbc0/go.mod h1:fyg7847qk6SyHyPtNmDHnmrv/HOrqktSC+C9fM+CJOE= github.com/go-task/slim-sprig v0.0.0-20230315185526-52ccab3ef572 h1:tfuBGBXKqDEevZMzYi5KSi8KkcZtzBcTgAUUtapy0OI= github.com/go-test/deep v1.1.0 h1:WOcxcdHcvdgThNXjw0t76K42FXTU7HpNQWHpA2HHNlg= @@ -1551,8 +740,6 @@ github.com/go-toolsmith/typep v1.1.0 h1:fIRYDyF+JywLfqzyhdiHzRop/GQDxxNhLGQ6gFUN github.com/go-toolsmith/typep v1.1.0/go.mod h1:fVIw+7zjdsMxDA3ITWnH1yOiw1rnTQKCsF/sk2H/qig= github.com/go-xmlfmt/xmlfmt v1.1.2 h1:Nea7b4icn8s57fTx1M5AI4qQT5HEM3rVUO8MuE6g80U= github.com/go-xmlfmt/xmlfmt v1.1.2/go.mod h1:aUCEOzzezBEjDBbFBoSiya/gduyIiWYRP6CnSFIV8AM= -github.com/go-zookeeper/zk v1.0.2/go.mod h1:nOB03cncLtlp4t+UAkGSV+9beXP/akpekBwL+UX1Qcw= -github.com/go-zookeeper/zk v1.0.3/go.mod h1:nOB03cncLtlp4t+UAkGSV+9beXP/akpekBwL+UX1Qcw= github.com/gobuffalo/attrs v0.0.0-20190224210810-a9411de4debd/go.mod h1:4duuawTqi2wkkpB4ePgWMaai6/Kc6WEz83bhFwpHzj0= github.com/gobuffalo/depgen v0.0.0-20190329151759-d478694a28d3/go.mod h1:3STtPUQYuzV0gBVOY3vy6CfMm/ljR4pABfrTeHNLHUY= github.com/gobuffalo/depgen v0.1.0/go.mod h1:+ifsuy7fhi15RWncXQQKjWS9JPkdah5sZvtHc2RXGlg= @@ -1579,11 +766,6 @@ github.com/gobuffalo/packr/v2 v2.2.0/go.mod h1:CaAwI0GPIAv+5wKLtv8Afwl+Cm78K/I/V github.com/gobuffalo/syncx v0.0.0-20190224160051-33c29581e754/go.mod h1:HhnNqWY95UYwwW3uSASeV7vtgYkT2t16hJgV3AEPUpw= github.com/gobwas/glob v0.2.3 h1:A4xDbljILXROh+kObIiy5kIaPYD8e96x1tgBhUI5J+Y= github.com/gobwas/glob v0.2.3/go.mod h1:d3Ez4x06l9bZtSvzIay5+Yzi0fmZzPgnTbPcKjJAkT8= -github.com/gobwas/httphead v0.0.0-20180130184737-2c6c146eadee/go.mod h1:L0fX3K22YWvt/FAX9NnzrNzcI4wNYi9Yku4O0LKYflo= -github.com/gobwas/pool v0.2.0/go.mod h1:q8bcK0KcYlCgd9e7WYLm9LpyS+YeLd8JVDW6WezmKEw= -github.com/gobwas/ws v1.0.2/go.mod h1:szmBTxLgaFppYjEmNtny/v3w89xOydFnnZMcgRRu/EM= -github.com/goccy/go-json v0.9.11/go.mod h1:6MelG93GURQebXPDq3khkgXZkazVtN9CRI+MGFi0w8I= -github.com/goccy/go-yaml v1.9.5/go.mod h1:U/jl18uSupI5rdI2jmuCswEA2htH9eXfferR3KfscvA= github.com/goccy/kpoward v0.1.0 h1:UcrLMG9rq7NwrMiUc0h+qUyIlvqPzqLiPb+zQEqH8cE= github.com/godbus/dbus v0.0.0-20151105175453-c7fdd8b5cd55/go.mod h1:/YcGZj5zSblfDWMMoOzV4fas9FZnQYTkDnsGvmh2Grw= github.com/godbus/dbus v0.0.0-20180201030542-885f9cc04c9c/go.mod h1:/YcGZj5zSblfDWMMoOzV4fas9FZnQYTkDnsGvmh2Grw= @@ -1591,14 +773,9 @@ github.com/godbus/dbus v0.0.0-20190422162347-ade71ed3457e h1:BWhy2j3IXJhjCbC68Fp github.com/godbus/dbus v0.0.0-20190422162347-ade71ed3457e/go.mod h1:bBOAhwG1umN6/6ZUMtDFBMQR8jRg9O75tm9K00oMsK4= github.com/godbus/dbus/v5 v5.0.3/go.mod h1:xhWf0FNVPg57R7Z0UbKHbJfkEywrmjJnf7w5xrFpKfA= github.com/godbus/dbus/v5 v5.0.4/go.mod h1:xhWf0FNVPg57R7Z0UbKHbJfkEywrmjJnf7w5xrFpKfA= -github.com/godbus/dbus/v5 v5.0.6/go.mod h1:xhWf0FNVPg57R7Z0UbKHbJfkEywrmjJnf7w5xrFpKfA= github.com/godbus/dbus/v5 v5.1.0 h1:4KLkAxT3aOY8Li4FRJe/KvhoNFFxo0m6fNuFUO8QJUk= github.com/gofrs/flock v0.8.1 h1:+gYjHKf32LDeiEEFhQaotPbLuUXjY5ZqxKgXy7n59aw= github.com/gofrs/flock v0.8.1/go.mod h1:F1TvTiK9OcQqauNUHlbJvyl9Qa1QvF/gOUDKA14jxHU= -github.com/gofrs/uuid v3.3.0+incompatible/go.mod h1:b2aQJv3Z4Fp6yNu3cdSllBxTCLRxnplIgP/c0N/04lM= -github.com/gofrs/uuid v4.0.0+incompatible/go.mod h1:b2aQJv3Z4Fp6yNu3cdSllBxTCLRxnplIgP/c0N/04lM= -github.com/gofrs/uuid v4.2.0+incompatible/go.mod h1:b2aQJv3Z4Fp6yNu3cdSllBxTCLRxnplIgP/c0N/04lM= -github.com/gofrs/uuid v4.3.1+incompatible/go.mod h1:b2aQJv3Z4Fp6yNu3cdSllBxTCLRxnplIgP/c0N/04lM= github.com/gogo/googleapis v1.2.0/go.mod h1:Njal3psf3qN6dwBtQfUmBZh2ybovJ0tlu3o/AC7HYjU= github.com/gogo/googleapis v1.4.0/go.mod h1:5YRNX2z1oM5gXdAkurHa942MDgEJyk02w4OecKY87+c= github.com/gogo/protobuf v1.1.1/go.mod h1:r8qH/GZQm5c6nD/R0oafs1akxWv10x8SbQlK7atdtwQ= @@ -1608,17 +785,10 @@ github.com/gogo/protobuf v1.3.0/go.mod h1:SlYgWuQ5SjCEi6WLHjHCa1yvBfUnHcTbrrZtXP github.com/gogo/protobuf v1.3.1/go.mod h1:SlYgWuQ5SjCEi6WLHjHCa1yvBfUnHcTbrrZtXPKa29o= github.com/gogo/protobuf v1.3.2 h1:Ov1cvc58UF3b5XjBnZv7+opcTcQFZebYjWzi34vdm4Q= github.com/gogo/protobuf v1.3.2/go.mod h1:P1XiOD3dCwIKUDQYPy72D8LYyHL2YPYrpS2s69NZV8Q= -github.com/golang-jwt/jwt v3.2.1+incompatible/go.mod h1:8pz2t5EyA70fFQQSrl6XZXzqecmYZeUEB8OUGHkxJ+I= -github.com/golang-jwt/jwt v3.2.2+incompatible/go.mod h1:8pz2t5EyA70fFQQSrl6XZXzqecmYZeUEB8OUGHkxJ+I= github.com/golang-jwt/jwt/v4 v4.0.0/go.mod h1:/xlHOz8bRuivTWchD4jCa+NbatV+wEUSzwAxVc6locg= github.com/golang-jwt/jwt/v4 v4.2.0/go.mod h1:/xlHOz8bRuivTWchD4jCa+NbatV+wEUSzwAxVc6locg= -github.com/golang-jwt/jwt/v4 v4.4.2/go.mod h1:m21LjoU+eqJr34lmDMbreY2eSTRJ1cv77w39/MY0Ch0= -github.com/golang-jwt/jwt/v4 v4.4.3/go.mod h1:m21LjoU+eqJr34lmDMbreY2eSTRJ1cv77w39/MY0Ch0= github.com/golang-jwt/jwt/v4 v4.5.0 h1:7cYmW1XlMY7h7ii7UhUyChSgS5wUJEnm9uZVTGqOWzg= github.com/golang-jwt/jwt/v4 v4.5.0/go.mod h1:m21LjoU+eqJr34lmDMbreY2eSTRJ1cv77w39/MY0Ch0= -github.com/golang-sql/civil v0.0.0-20190719163853-cb61b32ac6fe/go.mod h1:8vg3r2VgvsThLBIFL93Qb5yWzgyZWhEmBwUJWevAkK0= -github.com/golang-sql/sqlexp v0.1.0/go.mod h1:J4ad9Vo8ZCWQ2GMrC4UCQy1JpCbwU9m3EOqtpKwwwHI= -github.com/golang/freetype v0.0.0-20170609003504-e2365dfdc4a0/go.mod h1:E/TSTwGwJL78qG/PmXZO1EjYhfJinVAhrmmHX6Z8B9k= github.com/golang/groupcache v0.0.0-20160516000752-02826c3e7903/go.mod h1:cIg4eruTrX1D+g88fzRXU5OdNfaM+9IcxsU14FzY7Hc= github.com/golang/groupcache v0.0.0-20190129154638-5b532d6fd5ef/go.mod h1:cIg4eruTrX1D+g88fzRXU5OdNfaM+9IcxsU14FzY7Hc= github.com/golang/groupcache v0.0.0-20190702054246-869f871628b6/go.mod h1:cIg4eruTrX1D+g88fzRXU5OdNfaM+9IcxsU14FzY7Hc= @@ -1654,7 +824,6 @@ github.com/golang/protobuf v1.5.1/go.mod h1:DopwsBzvsk0Fs44TXzsVbJyPhcCPeIwnvohx github.com/golang/protobuf v1.5.2/go.mod h1:XVQd3VNwM+JqD3oG2Ue2ip4fOMUkwXdXDdiuN0vRsmY= github.com/golang/protobuf v1.5.3 h1:KhyjKVUg7Usr/dYsdSqoFveMYd5ko72D+zANwlG1mmg= github.com/golang/protobuf v1.5.3/go.mod h1:XVQd3VNwM+JqD3oG2Ue2ip4fOMUkwXdXDdiuN0vRsmY= -github.com/golang/snappy v0.0.0-20180518054509-2e65f85255db/go.mod h1:/XxbfmMg8lxefKM7IXC3fBNl/7bRcc72aCRzEWrmP2Q= github.com/golang/snappy v0.0.1/go.mod h1:/XxbfmMg8lxefKM7IXC3fBNl/7bRcc72aCRzEWrmP2Q= github.com/golang/snappy v0.0.3/go.mod h1:/XxbfmMg8lxefKM7IXC3fBNl/7bRcc72aCRzEWrmP2Q= github.com/golang/snappy v0.0.4 h1:yAGX7huGHXlcLOEtBnF4w7FQwA26wojNCwOYAEhLjQM= @@ -1683,11 +852,8 @@ github.com/google/addlicense v1.1.1 h1:jpVf9qPbU8rz5MxKo7d+RMcNHkqxi4YJi/laauX4a github.com/google/addlicense v1.1.1/go.mod h1:Sm/DHu7Jk+T5miFHHehdIjbi4M5+dJDRS3Cq0rncIxA= github.com/google/btree v0.0.0-20180813153112-4030bb1f1f0c/go.mod h1:lNA+9X1NB3Zf8V7Ke586lFgjr2dZNuvo3lPJSGZ5JPQ= github.com/google/btree v1.0.0/go.mod h1:lNA+9X1NB3Zf8V7Ke586lFgjr2dZNuvo3lPJSGZ5JPQ= -github.com/google/btree v1.0.1/go.mod h1:xXMiIv4Fb/0kKde4SpL7qlzvu5cMJDRkFDxJfI9uaxA= github.com/google/certificate-transparency-go v1.1.6 h1:SW5K3sr7ptST/pIvNkSVWMiJqemRmkjJPPT0jzXdOOY= github.com/google/certificate-transparency-go v1.1.6/go.mod h1:0OJjOsOk+wj6aYQgP7FU0ioQ0AJUmnWPFMqTjQeazPQ= -github.com/google/flatbuffers v2.0.8+incompatible/go.mod h1:1AeVuKshWv4vARoZatz6mlQ0JxURH0Kv5+zNeJKJCa8= -github.com/google/gnostic v0.5.7-v3refs/go.mod h1:73MKFl6jIHelAJNaBGFzt3SPtZULs9dYrGFt8OiIsHQ= github.com/google/gnostic v0.6.9 h1:ZK/5VhkoX835RikCHpSUJV9a+S3e1zLh59YnyWeBW+0= github.com/google/gnostic v0.6.9/go.mod h1:Nm8234We1lq6iB9OmlgNv3nH91XLLVZHCDayfA3xq+E= github.com/google/go-cmp v0.2.0/go.mod h1:oXzfMopK8JAjlY9xF4vHSVASa0yLyX7SntLO5aqRK0M= @@ -1706,7 +872,6 @@ github.com/google/go-cmp v0.5.7/go.mod h1:n+brtR0CgQNWTVd5ZUFpTBC8YFBDLK/h/bpaJ8 github.com/google/go-cmp v0.5.8/go.mod h1:17dUlkBOakJ0+DkrSSNjCkIjxS6bF9zb3elmeNGIjoY= github.com/google/go-cmp v0.5.9 h1:O2Tfq5qg4qc4AmwVlvv0oLiVAGB7enBSJ2x2DqQFi38= github.com/google/go-cmp v0.5.9/go.mod h1:17dUlkBOakJ0+DkrSSNjCkIjxS6bF9zb3elmeNGIjoY= -github.com/google/go-containerregistry v0.5.1/go.mod h1:Ct15B4yir3PLOP5jsy0GNeYVaIZs/MK/Jz5any1wFW0= github.com/google/go-containerregistry v0.6.0/go.mod h1:euCCtNbZ6tKqi1E72vwDj2xZcN5ttKpZLfa/wSo5iLw= github.com/google/go-containerregistry v0.15.2 h1:MMkSh+tjSdnmJZO7ljvEqV1DjfekB6VUEAZgy3a+TQE= github.com/google/go-containerregistry v0.15.2/go.mod h1:wWK+LnOv4jXMM23IT/F1wdYftGWGr47Is8CG+pmHK1Q= @@ -1719,15 +884,11 @@ github.com/google/go-github/v50 v50.2.0/go.mod h1:VBY8FB6yPIjrtKhozXv4FQupxKLS6H github.com/google/go-licenses v0.0.0-20200602185517-f29a4c695c3d/go.mod h1:g1VOUGKZYIqe8lDq2mL7plhAWXqrEaGUs7eIjthN1sk= github.com/google/go-licenses v1.6.0 h1:MM+VCXf0slYkpWO0mECvdYDVCxZXIQNal5wqUIXEZ/A= github.com/google/go-licenses v1.6.0/go.mod h1:Z8jgz2isEhdenOqd/00pq7I4y4k1xVVQJv415otjclo= -github.com/google/go-pkcs11 v0.2.0/go.mod h1:6eQoGcuNJpa7jnd5pMGdkSaQpNDYvPlXWMcjXXThLlY= -github.com/google/go-querystring v1.0.0/go.mod h1:odCYkC5MyYFN7vkCjXpyrEuKhc/BUO6wN/zVPAxq5ck= github.com/google/go-querystring v1.1.0 h1:AnCroh3fv4ZBgVIf1Iwtovgjaw/GiKJo8M8yD/fhyJ8= github.com/google/go-querystring v1.1.0/go.mod h1:Kcdr2DB4koayq7X8pmAG4sNG59So17icRSOU623lUBU= github.com/google/go-replayers/grpcreplay v1.1.0 h1:S5+I3zYyZ+GQz68OfbURDdt/+cSMqCK1wrvNx7WBzTE= -github.com/google/go-replayers/grpcreplay v1.1.0/go.mod h1:qzAvJ8/wi57zq7gWqaE6AwLM6miiXUQwP1S+I9icmhk= github.com/google/go-replayers/httpreplay v1.1.1/go.mod h1:gN9GeLIs7l6NUoVaSSnv2RiqK1NiwAmD0MrKeC9IIks= github.com/google/go-replayers/httpreplay v1.2.0 h1:VM1wEyyjaoU53BwrOnaf9VhAyQQEEioJvFYxYcLRKzk= -github.com/google/go-replayers/httpreplay v1.2.0/go.mod h1:WahEFFZZ7a1P4VM1qEeHy+tME4bwyqPcwWbNlUI1Mcg= github.com/google/gofuzz v1.0.0/go.mod h1:dBl0BpW6vV/+mYPU4Po3pmUjxk6FQPldtuIdl/M65Eg= github.com/google/gofuzz v1.1.0/go.mod h1:dBl0BpW6vV/+mYPU4Po3pmUjxk6FQPldtuIdl/M65Eg= github.com/google/gofuzz v1.2.0 h1:xRy4A+RhZaiKjJ1bPfwQ8sedCA+YS2YcCHW6ec7JMi0= @@ -1735,9 +896,8 @@ github.com/google/gofuzz v1.2.0/go.mod h1:dBl0BpW6vV/+mYPU4Po3pmUjxk6FQPldtuIdl/ github.com/google/licenseclassifier v0.0.0-20190926221455-842c0d70d702/go.mod h1:qsqn2hxC+vURpyBRygGUuinTO42MFRLcsmQ/P8v94+M= github.com/google/licenseclassifier v0.0.0-20210722185704-3043a050f148 h1:TJsAqW6zLRMDTyGmc9TPosfn9OyVlHs8Hrn3pY6ONSY= github.com/google/licenseclassifier v0.0.0-20210722185704-3043a050f148/go.mod h1:rq9F0RSpNKlrefnf6ZYMHKUnEJBCNzf6AcCXMYBeYvE= +github.com/google/martian v2.1.0+incompatible h1:/CP5g8u/VJHijgedC/Legn3BAbAaWPgecwXBIDzw5no= github.com/google/martian v2.1.0+incompatible/go.mod h1:9I4somxYTbIHy5NJKHRl3wXiIaQGbYVAs8BPL6v8lEs= -github.com/google/martian v2.1.1-0.20190517191504-25dcb96d9e51+incompatible h1:xmapqc1AyLoB+ddYT6r04bD9lIjlOqGaREovi0SzFaE= -github.com/google/martian v2.1.1-0.20190517191504-25dcb96d9e51+incompatible/go.mod h1:9I4somxYTbIHy5NJKHRl3wXiIaQGbYVAs8BPL6v8lEs= github.com/google/martian/v3 v3.0.0/go.mod h1:y5Zk1BBys9G+gd6Jrk0W3cC1+ELVxBWuIGO+w/tUAp0= github.com/google/martian/v3 v3.1.0/go.mod h1:y5Zk1BBys9G+gd6Jrk0W3cC1+ELVxBWuIGO+w/tUAp0= github.com/google/martian/v3 v3.2.1/go.mod h1:oBOf6HBosgwRXnUGWUB05QECsc6uvmMiJ3+6W4l/CUk= @@ -1759,13 +919,9 @@ github.com/google/pprof v0.0.0-20210407192527-94a9f03dee38/go.mod h1:kpwsk12EmLe github.com/google/pprof v0.0.0-20210506205249-923b5ab0fc1a/go.mod h1:kpwsk12EmLew5upagYY7GY0pfYCcupk39gWOCRROcvE= github.com/google/pprof v0.0.0-20210601050228-01bbb1931b22/go.mod h1:kpwsk12EmLew5upagYY7GY0pfYCcupk39gWOCRROcvE= github.com/google/pprof v0.0.0-20210609004039-a478d1d731e9/go.mod h1:kpwsk12EmLew5upagYY7GY0pfYCcupk39gWOCRROcvE= +github.com/google/pprof v0.0.0-20210720184732-4bb14d4b1be1 h1:K6RDEckDVWvDI9JAJYCmNdQXq6neHJOYx3V6jnqNEec= github.com/google/pprof v0.0.0-20210720184732-4bb14d4b1be1/go.mod h1:kpwsk12EmLew5upagYY7GY0pfYCcupk39gWOCRROcvE= -github.com/google/pprof v0.0.0-20220318212150-b2ab0324ddda/go.mod h1:KgnwoLYCZ8IQu3XUZ8Nc/bM9CCZFOyjUNOSygVozoDg= -github.com/google/pprof v0.0.0-20230406165453-00490a63f317 h1:hFhpt7CTmR3DX+b4R19ydQFtofxT0Sv3QsKNMVQYTMQ= -github.com/google/pprof v0.0.0-20230406165453-00490a63f317/go.mod h1:79YE0hCXdHag9sBkw2o+N/YnZtTkXi0UT9Nnixa5eYk= github.com/google/renameio v0.1.0/go.mod h1:KWCgfxg9yswjAJkECMjeO8J8rahYeXnNhOm40UhjYkI= -github.com/google/s2a-go v0.1.0/go.mod h1:OJpEgntRZo8ugHpF9hkoLJbS5dSI20XZeXJ9JVywLlM= -github.com/google/s2a-go v0.1.3/go.mod h1:Ej+mSEMGRnqRzjc7VtF+jdBwYG5fuJfiZ8ELkjEwM0A= github.com/google/s2a-go v0.1.4 h1:1kZ/sQM3srePvKs3tXAvQzo66XfcReoqFpIpIccE7Oc= github.com/google/s2a-go v0.1.4/go.mod h1:Ej+mSEMGRnqRzjc7VtF+jdBwYG5fuJfiZ8ELkjEwM0A= github.com/google/subcommands v1.0.1/go.mod h1:ZjhPrFU+Olkh9WazFPsl27BQ4UPiG37m3yTrtFlrHVk= @@ -1780,10 +936,6 @@ github.com/google/wire v0.5.0 h1:I7ELFeVBr3yfPIcc8+MWvrjk+3VjbcSzoXm3JVa+jD8= github.com/google/wire v0.5.0/go.mod h1:ngWDr9Qvq3yZA10YrxfyGELY/AFWGVpy9c1LTRi1EoU= github.com/googleapis/enterprise-certificate-proxy v0.0.0-20220520183353-fd19c99a87aa/go.mod h1:17drOmN3MwGY7t0e+Ei9b45FFGA3fBs3x36SsCg1hq8= github.com/googleapis/enterprise-certificate-proxy v0.1.0/go.mod h1:17drOmN3MwGY7t0e+Ei9b45FFGA3fBs3x36SsCg1hq8= -github.com/googleapis/enterprise-certificate-proxy v0.2.0/go.mod h1:8C0jb7/mgJe/9KK8Lm7X9ctZC2t60YyIpYEI16jx0Qg= -github.com/googleapis/enterprise-certificate-proxy v0.2.1/go.mod h1:AwSRAtLfXpU5Nm3pW+v7rGDHp09LsPtGY9MduiEsR9k= -github.com/googleapis/enterprise-certificate-proxy v0.2.3/go.mod h1:AwSRAtLfXpU5Nm3pW+v7rGDHp09LsPtGY9MduiEsR9k= -github.com/googleapis/enterprise-certificate-proxy v0.2.4/go.mod h1:AwSRAtLfXpU5Nm3pW+v7rGDHp09LsPtGY9MduiEsR9k= github.com/googleapis/enterprise-certificate-proxy v0.2.5 h1:UR4rDjcgpgEnqpIEvkiqTYKBCKLNmlge2eVjoZfySzM= github.com/googleapis/enterprise-certificate-proxy v0.2.5/go.mod h1:RxW0N9901Cko1VOCW3SXCpWP+mlIEkk2tP7jnHy9a3w= github.com/googleapis/gax-go/v2 v2.0.4/go.mod h1:0Wqv26UfaUD9n4G6kQubkQ+KchISgw+vpHVxEJEs9eg= @@ -1793,30 +945,16 @@ github.com/googleapis/gax-go/v2 v2.1.1/go.mod h1:hddJymUZASv3XPyGkUpKj8pPO47Rmb0 github.com/googleapis/gax-go/v2 v2.2.0/go.mod h1:as02EH8zWkzwUoLbBaFeQ+arQaj/OthfcblKl4IGNaM= github.com/googleapis/gax-go/v2 v2.3.0/go.mod h1:b8LNqSzNabLiUpXKkY7HAR5jr6bIT99EXz9pXxye9YM= github.com/googleapis/gax-go/v2 v2.4.0/go.mod h1:XOTVJ59hdnfJLIP/dh8n5CGryZR2LxK9wbMD5+iXC6c= -github.com/googleapis/gax-go/v2 v2.5.1/go.mod h1:h6B0KMMFNtI2ddbGJn3T3ZbwkeT6yqEF02fYlzkUCyo= -github.com/googleapis/gax-go/v2 v2.6.0/go.mod h1:1mjbznJAPHFpesgE5ucqfYEscaz5kMdcIDwU/6+DDoY= -github.com/googleapis/gax-go/v2 v2.7.0/go.mod h1:TEop28CZZQ2y+c0VxMUmu1lV+fQx57QpBWsYpwqHJx8= -github.com/googleapis/gax-go/v2 v2.7.1/go.mod h1:4orTrqY6hXxxaUL4LHIPl6lGo8vAE38/qKbhSAKP6QI= -github.com/googleapis/gax-go/v2 v2.8.0/go.mod h1:4orTrqY6hXxxaUL4LHIPl6lGo8vAE38/qKbhSAKP6QI= -github.com/googleapis/gax-go/v2 v2.9.1/go.mod h1:4FG3gMrVZlyMp5itSYKMU9z/lBE7+SbnUOvzH2HqbEY= -github.com/googleapis/gax-go/v2 v2.10.0/go.mod h1:4UOEnMCrxsSqQ940WnTiD6qJ63le2ev3xfyagutxiPw= -github.com/googleapis/gax-go/v2 v2.11.0/go.mod h1:DxmR61SGKkGLa2xigwuZIQpkCI2S5iydzRfb3peWZJI= github.com/googleapis/gax-go/v2 v2.12.0 h1:A+gCJKdRfqXkr+BIRGtZLibNXf0m1f9E4HG56etFpas= github.com/googleapis/gax-go/v2 v2.12.0/go.mod h1:y+aIqrI5eb1YGMVJfuV3185Ts/D7qKpsEkdD5+I6QGU= github.com/googleapis/gnostic v0.4.1/go.mod h1:LRhVm6pbyptWbWbuZ38d1eyptfvIytN3ir6b65WBswg= -github.com/googleapis/gnostic v0.5.1/go.mod h1:6U4PtQXGIEt/Z3h5MAT7FNofLnw9vXk2cUuW7uA/OeU= -github.com/googleapis/gnostic v0.5.5/go.mod h1:7+EbHbldMins07ALC74bsA81Ovc97DwqyJO1AENw9kA= github.com/googleapis/go-type-adapters v1.0.0/go.mod h1:zHW75FOG2aur7gAO2B+MLby+cLsWGBF62rFAi7WjWO4= github.com/googleapis/google-cloud-go-testing v0.0.0-20200911160855-bcd43fbb19e8/go.mod h1:dvDLG8qkwmyD9a/MJJN3XJcT3xFxOKAvTZGvuZmac9g= -github.com/gophercloud/gophercloud v0.24.0/go.mod h1:Q8fZtyi5zZxPS/j9aj3sSxtvj41AdQMDwyo1myduD5c= -github.com/gophercloud/gophercloud v1.3.0/go.mod h1:aAVqcocTSXh2vYFZ1JTvx4EQmfgzxRcNupUfxZbBNDM= github.com/gopherjs/gopherjs v0.0.0-20181017120253-0766667cb4d1/go.mod h1:wJfORRmW1u3UXTncJ5qlYoELFm8eSnnEO6hX4iZ3EWY= github.com/gopherjs/gopherjs v0.0.0-20200217142428-fce0ec30dd00/go.mod h1:wJfORRmW1u3UXTncJ5qlYoELFm8eSnnEO6hX4iZ3EWY= github.com/gordonklaus/ineffassign v0.0.0-20230610083614-0e73809eb601 h1:mrEEilTAUmaAORhssPPkxj84TsHrPMLBGW2Z4SoTxm8= github.com/gordonklaus/ineffassign v0.0.0-20230610083614-0e73809eb601/go.mod h1:Qcp2HIAYhR7mNUVSIxZww3Guk4it82ghYcEXIAk+QT0= -github.com/gorilla/context v1.1.1/go.mod h1:kBGZzfjB9CEq2AlWe17Uuf7NDRt0dE0s8S51q0aT7Yg= github.com/gorilla/handlers v0.0.0-20150720190736-60c7bfde3e33/go.mod h1:Qkdc/uu4tH4g6mTK6auzZ766c4CA0Ng8+o/OAirnOIQ= -github.com/gorilla/mux v1.6.2/go.mod h1:1lud6UwP+6orDFRuTfBEV8e9/aOM/c4fVVCaMa2zaAs= github.com/gorilla/mux v1.7.2/go.mod h1:1lud6UwP+6orDFRuTfBEV8e9/aOM/c4fVVCaMa2zaAs= github.com/gorilla/mux v1.7.3/go.mod h1:1lud6UwP+6orDFRuTfBEV8e9/aOM/c4fVVCaMa2zaAs= github.com/gorilla/mux v1.8.0/go.mod h1:DVbg23sWSpFRCP0SfiEN6jmj59UnW/n46BH5rLB71So= @@ -1824,9 +962,7 @@ github.com/gorilla/securecookie v1.1.1/go.mod h1:ra0sb63/xPlUeL+yeDciTfxMRAA+MP+ github.com/gorilla/sessions v1.2.1/go.mod h1:dk2InVEVJ0sfLlnXv9EAgkf6ecYs/i80K/zI+bUmuGM= github.com/gorilla/websocket v0.0.0-20170926233335-4201258b820c/go.mod h1:E7qHFY5m1UJ88s3WnNqhKjPHQ0heANvMoAMk2YaljkQ= github.com/gorilla/websocket v1.4.0/go.mod h1:E7qHFY5m1UJ88s3WnNqhKjPHQ0heANvMoAMk2YaljkQ= -github.com/gorilla/websocket v1.4.1/go.mod h1:YR8l580nyteQvAITg2hZ9XVh4b55+EU/adAjf1fMHhE= github.com/gorilla/websocket v1.4.2/go.mod h1:YR8l580nyteQvAITg2hZ9XVh4b55+EU/adAjf1fMHhE= -github.com/gorilla/websocket v1.5.0/go.mod h1:YR8l580nyteQvAITg2hZ9XVh4b55+EU/adAjf1fMHhE= github.com/gostaticanalysis/analysisutil v0.7.1 h1:ZMCjoue3DtDWQ5WyU16YbjbQEQ3VuzwxALrpYd+HeKk= github.com/gostaticanalysis/analysisutil v0.7.1/go.mod h1:v21E3hY37WKMGSnbsw2S/ojApNWb6C1//mXO48CXbVc= github.com/gostaticanalysis/comment v1.4.1/go.mod h1:ih6ZxzTHLdadaiSnF5WY3dxUoXfXAlTaRzuaNDlSado= @@ -1838,59 +974,35 @@ github.com/gostaticanalysis/nilerr v0.1.1 h1:ThE+hJP0fEp4zWLkWHWcRyI2Od0p7DlgYG3 github.com/gostaticanalysis/nilerr v0.1.1/go.mod h1:wZYb6YI5YAxxq0i1+VJbY0s2YONW0HU0GPE3+5PWN4A= github.com/gostaticanalysis/testutil v0.3.1-0.20210208050101-bfb5c8eec0e4/go.mod h1:D+FIZ+7OahH3ePw/izIEeH5I06eKs1IKI4Xr64/Am3M= github.com/gostaticanalysis/testutil v0.4.0 h1:nhdCmubdmDF6VEatUNjgUZBJKWRqugoISdUv3PPQgHY= -github.com/grafana/regexp v0.0.0-20220304095617-2e8d9baf4ac2/go.mod h1:M5qHK+eWfAv8VR/265dIuEpL3fNfeC21tXXp9itM24A= -github.com/grafana/regexp v0.0.0-20221122212121-6b5c0a4cb7fd/go.mod h1:M5qHK+eWfAv8VR/265dIuEpL3fNfeC21tXXp9itM24A= github.com/grafeas/grafeas v0.2.2 h1:dhn3M/RkBVrEP+gCowny1qoG1Opfa09SwPL1BGT6k0U= github.com/grafeas/grafeas v0.2.2/go.mod h1:O+UvNYn4LhdKR59XrxRDWwr2bbheR1KRRNdD8mJpxs4= github.com/gregjones/httpcache v0.0.0-20180305231024-9cad4c3443a7/go.mod h1:FecbI9+v66THATjSRHfNgh1IVFe/9kFxbXtjV0ctIMA= github.com/grpc-ecosystem/go-grpc-middleware v1.0.0/go.mod h1:FiyG127CGDf3tlThmgyCl78X/SZQqEOJBCDaAfeWzPs= github.com/grpc-ecosystem/go-grpc-middleware v1.0.1-0.20190118093823-f849b5445de4/go.mod h1:FiyG127CGDf3tlThmgyCl78X/SZQqEOJBCDaAfeWzPs= -github.com/grpc-ecosystem/go-grpc-middleware v1.3.0/go.mod h1:z0ButlSOZa5vEBq9m2m2hlwIgKw+rp3sdCBRoJY+30Y= github.com/grpc-ecosystem/go-grpc-prometheus v1.2.0/go.mod h1:8NvIoxWQoOIhqOTXgfV/d3M/q6VIi02HzZEHgUlZvzk= github.com/grpc-ecosystem/grpc-gateway v1.9.0/go.mod h1:vNeuVxBJEsws4ogUvrchl83t/GYV9WGTSLVdBhOQFDY= github.com/grpc-ecosystem/grpc-gateway v1.9.5/go.mod h1:vNeuVxBJEsws4ogUvrchl83t/GYV9WGTSLVdBhOQFDY= github.com/grpc-ecosystem/grpc-gateway v1.14.6/go.mod h1:zdiPV4Yse/1gnckTHtghG4GkDEdKCRJduHpTxT3/jcw= github.com/grpc-ecosystem/grpc-gateway v1.16.0/go.mod h1:BDjrQk3hbvj6Nolgz8mAMFbcEtjT1g+wF4CSlocrBnw= -github.com/grpc-ecosystem/grpc-gateway/v2 v2.7.0/go.mod h1:hgWBS7lorOAVIJEQMi4ZsPv9hVvWI6+ch50m39Pf2Ks= -github.com/grpc-ecosystem/grpc-gateway/v2 v2.11.3/go.mod h1:o//XUCC/F+yRGJoPO/VU0GSB0f8Nhgmxx0VIRUvaC0w= github.com/grpc-ecosystem/grpc-gateway/v2 v2.15.2 h1:gDLXvp5S9izjldquuoAhDzccbskOL6tDC5jMSyx3zxE= github.com/grpc-ecosystem/grpc-gateway/v2 v2.15.2/go.mod h1:7pdNwVWBBHGiCxa9lAszqCJMbfTISJ7oMftp8+UGV08= -github.com/hanwen/go-fuse/v2 v2.3.0/go.mod h1:xKwi1cF7nXAOBCXujD5ie0ZKsxc8GGSA1rlMJc+8IJs= github.com/hashicorp/consul/api v1.1.0/go.mod h1:VmuI/Lkw1nC05EYQWNKwWGbkg+FbDBtguAZLlVdkD9Q= -github.com/hashicorp/consul/api v1.10.1/go.mod h1:XjsvQN+RJGWI2TWy1/kqaE16HrR2J/FWgkYjdZQsX9M= -github.com/hashicorp/consul/api v1.12.0/go.mod h1:6pVBMo0ebnYdt2S3H87XhekM/HHrUoTD2XXb/VrZVy0= -github.com/hashicorp/consul/api v1.20.0/go.mod h1:nR64eD44KQ59Of/ECwt2vUmIK2DKsDzAwTmwmLl8Wpo= github.com/hashicorp/consul/sdk v0.1.1/go.mod h1:VKf9jXwCTEY1QZP2MOLRhb5i/I/ssyNV1vwHyQBF0x8= -github.com/hashicorp/consul/sdk v0.8.0/go.mod h1:GBvyrGALthsZObzUGsfgHZQDXjg4lOjagTIwIR1vPms= -github.com/hashicorp/consul/sdk v0.13.1/go.mod h1:SW/mM4LbKfqmMvcFu8v+eiQQ7oitXEFeiBe9StxERb0= -github.com/hashicorp/cronexpr v1.1.1/go.mod h1:P4wA0KBl9C5q2hABiMO7cp6jcIg96CDh1Efb3g1PWA4= github.com/hashicorp/errwrap v0.0.0-20141028054710-7554cd9344ce/go.mod h1:YH+1FKiLXxHSkmPseP+kNlulaMuP3n2brvKWEqk/Jc4= github.com/hashicorp/errwrap v1.0.0/go.mod h1:YH+1FKiLXxHSkmPseP+kNlulaMuP3n2brvKWEqk/Jc4= github.com/hashicorp/errwrap v1.1.0 h1:OxrOeh75EUXMY8TBjag2fzXGZ40LB6IKw45YeGUDY2I= github.com/hashicorp/errwrap v1.1.0/go.mod h1:YH+1FKiLXxHSkmPseP+kNlulaMuP3n2brvKWEqk/Jc4= -github.com/hashicorp/go-cleanhttp v0.5.0/go.mod h1:JpRdi6/HCYpAwUzNwuwqhbovhLtngrth3wmdIIUrZ80= github.com/hashicorp/go-cleanhttp v0.5.1/go.mod h1:JpRdi6/HCYpAwUzNwuwqhbovhLtngrth3wmdIIUrZ80= github.com/hashicorp/go-cleanhttp v0.5.2 h1:035FKYIWjmULyFRBKPs8TBQoi0x6d9G4xc9neXJWAZQ= github.com/hashicorp/go-cleanhttp v0.5.2/go.mod h1:kO/YDlP8L1346E6Sodw+PrpBSV4/SoxCXGY6BqNFT48= github.com/hashicorp/go-hclog v0.9.2/go.mod h1:5CU+agLiy3J7N7QjHK5d05KxGsuXiQLrjA0H7acj2lQ= -github.com/hashicorp/go-hclog v0.12.0/go.mod h1:whpDNt7SSdeAju8AWKIWsul05p54N/39EeqMAyrmvFQ= -github.com/hashicorp/go-hclog v0.12.2/go.mod h1:whpDNt7SSdeAju8AWKIWsul05p54N/39EeqMAyrmvFQ= -github.com/hashicorp/go-hclog v0.16.2/go.mod h1:whpDNt7SSdeAju8AWKIWsul05p54N/39EeqMAyrmvFQ= -github.com/hashicorp/go-hclog v1.2.0/go.mod h1:whpDNt7SSdeAju8AWKIWsul05p54N/39EeqMAyrmvFQ= -github.com/hashicorp/go-hclog v1.4.0 h1:ctuWFGrhFha8BnnzxqeRGidlEcQkDyL5u8J8t5eA11I= -github.com/hashicorp/go-hclog v1.4.0/go.mod h1:W4Qnvbt70Wk/zYJryRzDRU/4r0kIg0PVHBcfoyhpF5M= +github.com/hashicorp/go-hclog v1.2.0 h1:La19f8d7WIlm4ogzNHB0JGqs5AUDAZ2UfCY4sJXcJdM= github.com/hashicorp/go-immutable-radix v1.0.0/go.mod h1:0y9vanUI8NX6FsYoO3zeMjhV/C5i9g4Q3DwcSNZ4P60= -github.com/hashicorp/go-immutable-radix v1.2.0/go.mod h1:0y9vanUI8NX6FsYoO3zeMjhV/C5i9g4Q3DwcSNZ4P60= -github.com/hashicorp/go-immutable-radix v1.3.1/go.mod h1:0y9vanUI8NX6FsYoO3zeMjhV/C5i9g4Q3DwcSNZ4P60= github.com/hashicorp/go-msgpack v0.5.3/go.mod h1:ahLV/dePpqEmjfWmKiqvPkv/twdG7iPBM1vqhUKIvfM= github.com/hashicorp/go-multierror v0.0.0-20161216184304-ed905158d874/go.mod h1:JMRHfdO9jKNzS/+BTlxCjKNQHg/jZAft8U7LloJvN7I= github.com/hashicorp/go-multierror v1.0.0/go.mod h1:dHtQlpGsu+cZNNAkkCN/P3hoUDHhCYQXV3UM06sGGrk= -github.com/hashicorp/go-multierror v1.1.0/go.mod h1:spPvp8C1qA32ftKqdAHm4hHTbPw+vmowP0z+KUhOZdA= github.com/hashicorp/go-multierror v1.1.1 h1:H5DkEtf6CXdFp0N0Em5UCwQpXMWke8IA0+lD48awMYo= github.com/hashicorp/go-multierror v1.1.1/go.mod h1:iw975J/qwKPdAO1clOe2L8331t/9/fmwbPZ6JB6eMoM= -github.com/hashicorp/go-retryablehttp v0.5.3/go.mod h1:9B5zBasrRhHXnJnui7y6sL7es7NDiJgTc6Er0maI1Xs= -github.com/hashicorp/go-retryablehttp v0.7.1/go.mod h1:vAew36LZh98gCBJNLH42IQ1ER/9wtLZZ8meHqQvEYWY= -github.com/hashicorp/go-retryablehttp v0.7.2/go.mod h1:Jy/gPYAdjqffZ/yFGCFV2doI5wjtH1ewM9u8iYVjtX8= github.com/hashicorp/go-retryablehttp v0.7.4 h1:ZQgVdpTdAL7WpMIwLzCfbalOcSUdkDZnpUv3/+BxzFA= github.com/hashicorp/go-retryablehttp v0.7.4/go.mod h1:Jy/gPYAdjqffZ/yFGCFV2doI5wjtH1ewM9u8iYVjtX8= github.com/hashicorp/go-rootcerts v1.0.0/go.mod h1:K6zTfqpRlCUIjkwsN4Z+hiSfzSTQa6eBIzfwKfwNnHU= @@ -1916,49 +1028,28 @@ github.com/hashicorp/go-version v1.6.0/go.mod h1:fltr4n8CU8Ke44wwGCBoEymUuxUHl09 github.com/hashicorp/go.net v0.0.1/go.mod h1:hjKkEWcCURg++eb33jQU7oqQcI9XDCnUzHA0oac0k90= github.com/hashicorp/golang-lru v0.5.0/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8= github.com/hashicorp/golang-lru v0.5.1/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8= -github.com/hashicorp/golang-lru v0.5.4/go.mod h1:iADmTwqILo4mZ8BN3D2Q6+9jd8WM5uGBxy+E8yxSoD4= github.com/hashicorp/golang-lru v0.6.0 h1:uL2shRDx7RTrOrTCUZEGP/wJUFiUI8QT6E7z5o8jga4= github.com/hashicorp/golang-lru v0.6.0/go.mod h1:iADmTwqILo4mZ8BN3D2Q6+9jd8WM5uGBxy+E8yxSoD4= github.com/hashicorp/hcl v1.0.0 h1:0Anlzjpi4vEasTeNFn2mLJgTSwt0+6sfsiTG8qcWGx4= github.com/hashicorp/hcl v1.0.0/go.mod h1:E5yfLk+7swimpb2L/Alb/PJmXilQ/rhwaUYs4T20WEQ= github.com/hashicorp/logutils v1.0.0/go.mod h1:QIAnNjmIWmVIIkWDTG1z5v++HQmx9WQRO+LraFDTW64= github.com/hashicorp/mdns v1.0.0/go.mod h1:tL+uN++7HEJ6SQLQ2/p+z2pH24WQKWjBPkE0mNTz8vQ= -github.com/hashicorp/mdns v1.0.1/go.mod h1:4gW7WsVCke5TE7EPeYliwHlRUyBtfCwuFwuMg2DmyNY= -github.com/hashicorp/mdns v1.0.4/go.mod h1:mtBihi+LeNXGtG8L9dX59gAEa12BDtBQSp4v/YAJqrc= github.com/hashicorp/memberlist v0.1.3/go.mod h1:ajVTdAv/9Im8oMAAj5G31PhhMCZJV2pPBoIllUwCN7I= -github.com/hashicorp/memberlist v0.2.2/go.mod h1:MS2lj3INKhZjWNqd3N0m3J+Jxf3DAOnAH9VT3Sh9MUE= -github.com/hashicorp/memberlist v0.3.0/go.mod h1:MS2lj3INKhZjWNqd3N0m3J+Jxf3DAOnAH9VT3Sh9MUE= -github.com/hashicorp/memberlist v0.3.1/go.mod h1:MS2lj3INKhZjWNqd3N0m3J+Jxf3DAOnAH9VT3Sh9MUE= -github.com/hashicorp/memberlist v0.5.0/go.mod h1:yvyXLpo0QaGE59Y7hDTsTzDD25JYBZ4mHgHUZ8lrOI0= -github.com/hashicorp/nomad/api v0.0.0-20230418003350-3067191c5197/go.mod h1:2TCrNvonL09r7EiQ6M2rNt+Cmjbn1QbzchFoTWJFpj4= github.com/hashicorp/serf v0.8.2/go.mod h1:6hOLApaqBFA1NXqRQAsxw9QxuDEvNxSQRwA/JwenrHc= -github.com/hashicorp/serf v0.9.5/go.mod h1:UWDWwZeL5cuWDJdl0C6wrvrUwEqtQ4ZKBKKENpqIUyk= -github.com/hashicorp/serf v0.9.6/go.mod h1:TXZNMjZQijwlDvp+r0b63xZ45H7JmCmgg4gpTwn9UV4= -github.com/hashicorp/serf v0.9.7/go.mod h1:TXZNMjZQijwlDvp+r0b63xZ45H7JmCmgg4gpTwn9UV4= -github.com/hashicorp/serf v0.10.1/go.mod h1:yL2t6BqATOLGc5HF7qbFkTfXoPIY0WZdWHfEvMqbG+4= github.com/hashicorp/vault/api v1.9.2 h1:YjkZLJ7K3inKgMZ0wzCU9OHqc+UqMQyXsPXnf3Cl2as= github.com/hashicorp/vault/api v1.9.2/go.mod h1:jo5Y/ET+hNyz+JnKDt8XLAdKs+AM0G5W0Vp1IrFI8N8= -github.com/hetznercloud/hcloud-go v1.33.1/go.mod h1:XX/TQub3ge0yWR2yHWmnDVIrB+MQbda1pHxkUmDlUME= -github.com/hetznercloud/hcloud-go v1.42.0/go.mod h1:YADL8AbmQYH0Eo+1lkuyoc8LutT0UeMvaKP47nNUb+Y= github.com/hexops/gotextdiff v1.0.3 h1:gitA9+qJrrTCsiCl7+kh75nPqQt1cx4ZkudSTLoUqJM= github.com/hexops/gotextdiff v1.0.3/go.mod h1:pSWU5MAI3yDq+fZBTazCSJysOMbxWL1BSow5/V2vxeg= github.com/honeycombio/beeline-go v1.10.0 h1:cUDe555oqvw8oD76BQJ8alk7FP0JZ/M/zXpNvOEDLDc= github.com/honeycombio/libhoney-go v1.16.0 h1:kPpqoz6vbOzgp7jC6SR7SkNj7rua7rgxvznI6M3KdHc= github.com/howeyc/gopass v0.0.0-20210920133722-c8aef6fb66ef h1:A9HsByNhogrvm9cWb28sjiS3i7tcKCkflWFEkHfuAgM= github.com/hpcloud/tail v1.0.0/go.mod h1:ab1qPbhIpdTxEkNHXyeSf5vhxWSCs/tWer42PpOxQnU= -github.com/hudl/fargo v1.4.0/go.mod h1:9Ai6uvFy5fQNq6VPKtg+Ceq1+eTY4nKUlR2JElEOcDo= -github.com/iancoleman/strcase v0.2.0/go.mod h1:iwCmte+B7n89clKwxIoIXy/HfoL7AsD47ZCWhYzw7ho= github.com/ianlancetaylor/demangle v0.0.0-20181102032728-5e5cf60278f6/go.mod h1:aSSvb/t6k1mPoxDqO4vJh6VOCGPwU4O0C2/Eqndh1Sc= github.com/ianlancetaylor/demangle v0.0.0-20200824232613-28f6c0f3b639/go.mod h1:aSSvb/t6k1mPoxDqO4vJh6VOCGPwU4O0C2/Eqndh1Sc= -github.com/ianlancetaylor/demangle v0.0.0-20210905161508-09a460cdf81d/go.mod h1:aYm2/VgdVmcIU8iMfdMvDMsRAQjcfZSKFby6HOFvi/w= -github.com/ianlancetaylor/demangle v0.0.0-20220517205856-0058ec4f073c/go.mod h1:aYm2/VgdVmcIU8iMfdMvDMsRAQjcfZSKFby6HOFvi/w= github.com/imdario/mergo v0.3.5/go.mod h1:2EnlNZ0deacrJVfApfmtdGgDfMuh/nq6Ok1EcJh5FfA= -github.com/imdario/mergo v0.3.6/go.mod h1:2EnlNZ0deacrJVfApfmtdGgDfMuh/nq6Ok1EcJh5FfA= github.com/imdario/mergo v0.3.8/go.mod h1:2EnlNZ0deacrJVfApfmtdGgDfMuh/nq6Ok1EcJh5FfA= github.com/imdario/mergo v0.3.10/go.mod h1:jmQim1M+e3UYxmgPu/WyfjB3N3VflVyUjjjwH0dnCYA= github.com/imdario/mergo v0.3.11/go.mod h1:jmQim1M+e3UYxmgPu/WyfjB3N3VflVyUjjjwH0dnCYA= -github.com/imdario/mergo v0.3.12/go.mod h1:jmQim1M+e3UYxmgPu/WyfjB3N3VflVyUjjjwH0dnCYA= -github.com/imdario/mergo v0.3.13/go.mod h1:4lJ1jqUDcsbIECGy0RUJAXNIhg+6ocWgb1ALK2O4oXg= github.com/imdario/mergo v0.3.15 h1:M8XP7IuFNsqUx6VPK2P9OSmsYsI/YFaGil0uD21V3dM= github.com/imdario/mergo v0.3.15/go.mod h1:WBLT9ZmE3lPoWsEzCh9LPo3TiwVN+ZKEjmz+hD27ysY= github.com/in-toto/in-toto-golang v0.9.0 h1:tHny7ac4KgtsfrG6ybU8gVOZux2H8jN05AXJ9EBM1XU= @@ -1967,51 +1058,7 @@ github.com/inconshreveable/mousetrap v1.0.0/go.mod h1:PxqpIevigyE2G7u3NXJIT2ANyt github.com/inconshreveable/mousetrap v1.0.1/go.mod h1:vpF70FUmC8bwa3OWnCshd2FqLfsEA9PFc4w1p2J65bw= github.com/inconshreveable/mousetrap v1.1.0 h1:wN+x4NVGpMsO7ErUn/mUI3vEoE6Jt13X2s0bqwp9tc8= github.com/inconshreveable/mousetrap v1.1.0/go.mod h1:vpF70FUmC8bwa3OWnCshd2FqLfsEA9PFc4w1p2J65bw= -github.com/influxdata/influxdb1-client v0.0.0-20200827194710-b269163b24ab/go.mod h1:qj24IKcXYK6Iy9ceXlo3Tc+vtHo9lIhSX5JddghvEPo= -github.com/intel/goresctrl v0.2.0/go.mod h1:+CZdzouYFn5EsxgqAQTEzMfwKwuc0fVdMrT9FCCAVRQ= -github.com/ionos-cloud/sdk-go/v6 v6.1.6/go.mod h1:EzEgRIDxBELvfoa/uBN0kOQaqovLjUWEB7iW4/Q+t4k= github.com/j-keck/arping v0.0.0-20160618110441-2cf9dc699c56/go.mod h1:ymszkNOg6tORTn+6F6j+Jc8TOr5osrynvN6ivFWZ2GA= -github.com/j-keck/arping v1.0.2/go.mod h1:aJbELhR92bSk7tp79AWM/ftfc90EfEi2bQJrbBFOsPw= -github.com/jackc/chunkreader v1.0.0/go.mod h1:RT6O25fNZIuasFJRyZ4R/Y2BbhasbmZXF9QQ7T3kePo= -github.com/jackc/chunkreader/v2 v2.0.0/go.mod h1:odVSm741yZoC3dpHEUXIqA9tQRhFrgOHwnPIn9lDKlk= -github.com/jackc/chunkreader/v2 v2.0.1/go.mod h1:odVSm741yZoC3dpHEUXIqA9tQRhFrgOHwnPIn9lDKlk= -github.com/jackc/pgconn v0.0.0-20190420214824-7e0022ef6ba3/go.mod h1:jkELnwuX+w9qN5YIfX0fl88Ehu4XC3keFuOJJk9pcnA= -github.com/jackc/pgconn v0.0.0-20190824142844-760dd75542eb/go.mod h1:lLjNuW/+OfW9/pnVKPazfWOgNfH2aPem8YQ7ilXGvJE= -github.com/jackc/pgconn v0.0.0-20190831204454-2fabfa3c18b7/go.mod h1:ZJKsE/KZfsUgOEh9hBm+xYTstcNHg7UPMVJqRfQxq4s= -github.com/jackc/pgconn v1.8.0/go.mod h1:1C2Pb36bGIP9QHGBYCjnyhqu7Rv3sGshaQUvmfGIB/o= -github.com/jackc/pgconn v1.9.0/go.mod h1:YctiPyvzfU11JFxoXokUOOKQXQmDMoJL9vJzHH8/2JY= -github.com/jackc/pgconn v1.9.1-0.20210724152538-d89c8390a530/go.mod h1:4z2w8XhRbP1hYxkpTuBjTS3ne3J48K83+u0zoyvg2pI= -github.com/jackc/pgconn v1.14.0/go.mod h1:9mBNlny0UvkgJdCDvdVHYSjI+8tD2rnKK69Wz8ti++E= -github.com/jackc/pgio v1.0.0/go.mod h1:oP+2QK2wFfUWgr+gxjoBH9KGBb31Eio69xUb0w5bYf8= -github.com/jackc/pgmock v0.0.0-20190831213851-13a1b77aafa2/go.mod h1:fGZlG77KXmcq05nJLRkk0+p82V8B8Dw8KN2/V9c/OAE= -github.com/jackc/pgmock v0.0.0-20201204152224-4fe30f7445fd/go.mod h1:hrBW0Enj2AZTNpt/7Y5rr2xe/9Mn757Wtb2xeBzPv2c= -github.com/jackc/pgmock v0.0.0-20210724152146-4ad1a8207f65/go.mod h1:5R2h2EEX+qri8jOWMbJCtaPWkrrNc7OHwsp2TCqp7ak= -github.com/jackc/pgpassfile v1.0.0/go.mod h1:CEx0iS5ambNFdcRtxPj5JhEz+xB6uRky5eyVu/W2HEg= -github.com/jackc/pgproto3 v1.1.0/go.mod h1:eR5FA3leWg7p9aeAqi37XOTgTIbkABlvcPB3E5rlc78= -github.com/jackc/pgproto3/v2 v2.0.0-alpha1.0.20190420180111-c116219b62db/go.mod h1:bhq50y+xrl9n5mRYyCBFKkpRVTLYJVWeCc+mEAI3yXA= -github.com/jackc/pgproto3/v2 v2.0.0-alpha1.0.20190609003834-432c2951c711/go.mod h1:uH0AWtUmuShn0bcesswc4aBTWGvw0cAxIJp+6OB//Wg= -github.com/jackc/pgproto3/v2 v2.0.0-rc3/go.mod h1:ryONWYqW6dqSg1Lw6vXNMXoBJhpzvWKnT95C46ckYeM= -github.com/jackc/pgproto3/v2 v2.0.0-rc3.0.20190831210041-4c03ce451f29/go.mod h1:ryONWYqW6dqSg1Lw6vXNMXoBJhpzvWKnT95C46ckYeM= -github.com/jackc/pgproto3/v2 v2.0.6/go.mod h1:WfJCnwN3HIg9Ish/j3sgWXnAfK8A9Y0bwXYU5xKaEdA= -github.com/jackc/pgproto3/v2 v2.1.1/go.mod h1:WfJCnwN3HIg9Ish/j3sgWXnAfK8A9Y0bwXYU5xKaEdA= -github.com/jackc/pgproto3/v2 v2.3.2/go.mod h1:WfJCnwN3HIg9Ish/j3sgWXnAfK8A9Y0bwXYU5xKaEdA= -github.com/jackc/pgservicefile v0.0.0-20200714003250-2b9c44734f2b/go.mod h1:vsD4gTJCa9TptPL8sPkXrLZ+hDuNrZCnj29CQpr4X1E= -github.com/jackc/pgservicefile v0.0.0-20221227161230-091c0ba34f0a/go.mod h1:5TJZWKEWniPve33vlWYSoGYefn3gLQRzjfDlhSJ9ZKM= -github.com/jackc/pgtype v0.0.0-20190421001408-4ed0de4755e0/go.mod h1:hdSHsc1V01CGwFsrv11mJRHWJ6aifDLfdV3aVjFF0zg= -github.com/jackc/pgtype v0.0.0-20190824184912-ab885b375b90/go.mod h1:KcahbBH1nCMSo2DXpzsoWOAfFkdEtEJpPbVLq8eE+mc= -github.com/jackc/pgtype v0.0.0-20190828014616-a8802b16cc59/go.mod h1:MWlu30kVJrUS8lot6TQqcg7mtthZ9T0EoIBFiJcmcyw= -github.com/jackc/pgtype v1.8.1-0.20210724151600-32e20a603178/go.mod h1:C516IlIV9NKqfsMCXTdChteoXmwgUceqaLfjg2e3NlM= -github.com/jackc/pgtype v1.14.0/go.mod h1:LUMuVrfsFfdKGLw+AFFVv6KtHOFMwRgDDzBt76IqCA4= -github.com/jackc/pgx/v4 v4.0.0-20190420224344-cc3461e65d96/go.mod h1:mdxmSJJuR08CZQyj1PVQBHy9XOp5p8/SHH6a0psbY9Y= -github.com/jackc/pgx/v4 v4.0.0-20190421002000-1b8f0016e912/go.mod h1:no/Y67Jkk/9WuGR0JG/JseM9irFbnEPbuWV2EELPNuM= -github.com/jackc/pgx/v4 v4.0.0-pre1.0.20190824185557-6972a5742186/go.mod h1:X+GQnOEnf1dqHGpw7JmHqHc1NxDoalibchSk9/RWuDc= -github.com/jackc/pgx/v4 v4.12.1-0.20210724153913-640aa07df17c/go.mod h1:1QD0+tgSXP7iUjYm9C1NxKhny7lq6ee99u/z+IHFcgs= -github.com/jackc/pgx/v4 v4.18.1/go.mod h1:FydWkUyadDmdNH/mHnGob881GawxeEm7TcMCzkb+qQE= -github.com/jackc/puddle v0.0.0-20190413234325-e4ced69a3a2b/go.mod h1:m4B5Dj62Y0fbyuIc15OsIqK0+JU8nkqQjsgx7dvjSWk= -github.com/jackc/puddle v0.0.0-20190608224051-11cab39313c9/go.mod h1:m4B5Dj62Y0fbyuIc15OsIqK0+JU8nkqQjsgx7dvjSWk= -github.com/jackc/puddle v1.1.3/go.mod h1:m4B5Dj62Y0fbyuIc15OsIqK0+JU8nkqQjsgx7dvjSWk= -github.com/jackc/puddle v1.3.0/go.mod h1:m4B5Dj62Y0fbyuIc15OsIqK0+JU8nkqQjsgx7dvjSWk= -github.com/jarcoal/httpmock v1.3.0/go.mod h1:3yb8rc4BI7TCBhFY8ng0gjuLKJNquuDNiPaZjnENuYg= github.com/jbenet/go-context v0.0.0-20150711004518-d14ea06fba99 h1:BQSFePA1RWJOlocH6Fxy8MmwDt+yVQYULKfN0RoTN8A= github.com/jbenet/go-context v0.0.0-20150711004518-d14ea06fba99/go.mod h1:1lJo3i6rXxKeerYnT8Nvf0QmHCRC1n8sfWVwXF2Frvo= github.com/jcmturner/aescts/v2 v2.0.0 h1:9YKLH6ey7H4eDBXW8khjYslgyqG2xZikXP0EQFKrle8= @@ -2036,7 +1083,6 @@ github.com/jellydator/ttlcache/v3 v3.0.1 h1:cHgCSMS7TdQcoprXnWUptJZzyFsqs18Lt8VV github.com/jellydator/ttlcache/v3 v3.0.1/go.mod h1:WwTaEmcXQ3MTjOm4bsZoDFiCu/hMvNWLO1w67RXz6h4= github.com/jenkins-x/go-scm v1.13.13 h1:QEUDWwaLMMGuf8b82SUR8AZpXETEu9U5J7eC4fU7HSM= github.com/jessevdk/go-flags v1.4.0/go.mod h1:4FA24M0QyGHXBuZZK/XkWh8h0e1EYbRYJSGM75WSRxI= -github.com/jessevdk/go-flags v1.5.0/go.mod h1:Fw0T6WPc1dYxT4mKEZRfG5kJhaTDP9pj1c2EWnYs/m4= github.com/jgautheron/goconst v1.5.1 h1:HxVbL1MhydKs8R8n/HE5NPvzfaYmQJA3o879lE4+WcM= github.com/jgautheron/goconst v1.5.1/go.mod h1:aAosetZ5zaeC/2EfMeRswtxUFBpe2Hr7HzkgX4fanO4= github.com/jingyugao/rowserrcheck v1.1.1 h1:zibz55j/MJtLsjP1OF4bSdgXxwL1b+Vn7Tjzq7gFzUs= @@ -2050,16 +1096,13 @@ github.com/jmespath/go-jmespath v0.4.0/go.mod h1:T8mJZnbsbmF+m6zOOFylbeCJqk5+pHW github.com/jmespath/go-jmespath/internal/testify v1.5.1 h1:shLQSRRSCCPj3f2gpwzGwWFoC7ycTf1rcQZHOlsJ6N8= github.com/jmespath/go-jmespath/internal/testify v1.5.1/go.mod h1:L3OGu8Wl2/fWfCI6z80xFu9LTZmf1ZRjMHUOPmWr69U= github.com/jmhodges/clock v0.0.0-20160418191101-880ee4c33548 h1:dYTbLf4m0a5u0KLmPfB6mgxbcV7588bOCx79hxa5Sr4= -github.com/joefitzgerald/rainbow-reporter v0.1.0/go.mod h1:481CNgqmVHQZzdIbN52CupLJyoVwB10FQ/IQlF1pdL8= github.com/joho/godotenv v1.3.0/go.mod h1:7hK45KPybAkOC6peb+G5yklZfMxEjkZhHbwpqxOKXbg= github.com/jonboulle/clockwork v0.1.0/go.mod h1:Ii8DK3G1RaLaWxj9trq07+26W01tbo22gdxWY5EU2bo= -github.com/jonboulle/clockwork v0.2.2/go.mod h1:Pkfl5aHPm1nk2H9h0bjmnJD/BcgbGXUBGnn1kMkgxc8= github.com/josharian/intern v1.0.0 h1:vlS4z54oSdjm0bgjRigI+G1HpF+tI+9rE5LLzOg8HmY= github.com/josharian/intern v1.0.0/go.mod h1:5DoeVV0s6jJacbCEi61lwdGj/aVlrQvzHFFd8Hwg//Y= github.com/jpillora/backoff v1.0.0/go.mod h1:J/6gKK9jxlEcS3zixgDgUAsiuZ7yrSoa/FX5e0EB2j4= github.com/json-iterator/go v1.1.6/go.mod h1:+SdeFBvtyEkXs7REEP0seUULqWtbJapLOCVDaaPEHmU= github.com/json-iterator/go v1.1.7/go.mod h1:KdQUCv79m/52Kvf8AW2vK1V8akMuk1QjK/uOdHXbAo4= -github.com/json-iterator/go v1.1.9/go.mod h1:KdQUCv79m/52Kvf8AW2vK1V8akMuk1QjK/uOdHXbAo4= github.com/json-iterator/go v1.1.10/go.mod h1:KdQUCv79m/52Kvf8AW2vK1V8akMuk1QjK/uOdHXbAo4= github.com/json-iterator/go v1.1.11/go.mod h1:KdQUCv79m/52Kvf8AW2vK1V8akMuk1QjK/uOdHXbAo4= github.com/json-iterator/go v1.1.12 h1:PV8peI4a0ysnczrg+LtxykD8LfKY9ML6u2jnxaEnrnM= @@ -2071,11 +1114,8 @@ github.com/julienschmidt/httprouter v1.2.0/go.mod h1:SYymIcj16QtmaHHD7aYtjjsJG7V github.com/julienschmidt/httprouter v1.3.0/go.mod h1:JR6WtHb+2LUe8TCKY3cZOxFyyO8IZAc4RVcycCCAKdM= github.com/julz/importas v0.1.0 h1:F78HnrsjY3cR7j0etXy5+TU1Zuy7Xt08X/1aJnH5xXY= github.com/julz/importas v0.1.0/go.mod h1:oSFU2R4XK/P7kNBrnL/FEQlDGN1/6WoxXEjSSXO0DV0= -github.com/jung-kurt/gofpdf v1.0.0/go.mod h1:7Id9E/uU8ce6rXgefFLlgrJj/GYY22cpxn+r32jIOes= -github.com/jung-kurt/gofpdf v1.0.3-0.20190309125859-24315acbbda5/go.mod h1:7Id9E/uU8ce6rXgefFLlgrJj/GYY22cpxn+r32jIOes= github.com/karrick/godirwalk v1.8.0/go.mod h1:H5KPZjojv4lE+QYImBI8xVtrBRgYrIVsaRPx4tDPEn4= github.com/karrick/godirwalk v1.10.3/go.mod h1:RoGL9dQei4vP9ilrpETWE8CLOZ1kiN0LhBygSwrAsHA= -github.com/kballard/go-shellquote v0.0.0-20180428030007-95032a82bc51/go.mod h1:CzGEWj7cYgsdH8dAjBGEr58BoE7ScuLd+fwFZ44+/x8= github.com/kelseyhightower/envconfig v1.4.0 h1:Im6hONhd3pLkfDFsbRgu68RDNkGF1r3dvMUtDTo2cv8= github.com/kelseyhightower/envconfig v1.4.0/go.mod h1:cccZRl6mQpaq41TPp5QxidR+Sa3axMbJDNb//FQX6Gg= github.com/kevinburke/ssh_config v0.0.0-20190725054713-01f96b0aa0cd/go.mod h1:CT57kijsi8u/K/BOFA39wgDQJ9CxiF4nAY/ojJ6r6mM= @@ -2090,21 +1130,13 @@ github.com/kisielk/gotool v1.0.0 h1:AV2c/EiW3KqPNT9ZKl07ehoAGi4C5/01Cfbblndcapg= github.com/kisielk/gotool v1.0.0/go.mod h1:XhKaO+MFFWcvkIS/tQcRk01m1F5IRFswLeQ+oQHNcck= github.com/kkHAIKE/contextcheck v1.1.4 h1:B6zAaLhOEEcjvUgIYEqystmnFk1Oemn8bvJhbt0GMb8= github.com/kkHAIKE/contextcheck v1.1.4/go.mod h1:1+i/gWqokIa+dm31mqGLZhZJ7Uh44DJGZVmr6QRBNJg= -github.com/klauspost/asmfmt v1.3.2/go.mod h1:AG8TuvYojzulgDAMCnYn50l/5QV3Bs/tp6j0HLHbNSE= -github.com/klauspost/compress v1.10.3/go.mod h1:aoV0uJVorq1K+umq18yTdKaF57EivdYsUV+/s2qKfXs= github.com/klauspost/compress v1.11.3/go.mod h1:aoV0uJVorq1K+umq18yTdKaF57EivdYsUV+/s2qKfXs= github.com/klauspost/compress v1.11.13/go.mod h1:aoV0uJVorq1K+umq18yTdKaF57EivdYsUV+/s2qKfXs= github.com/klauspost/compress v1.12.3/go.mod h1:8dP1Hq4DHOhN9w426knH3Rhby4rFm6D8eO+e+Dq5Gzg= github.com/klauspost/compress v1.13.0/go.mod h1:8dP1Hq4DHOhN9w426knH3Rhby4rFm6D8eO+e+Dq5Gzg= -github.com/klauspost/compress v1.13.4/go.mod h1:8dP1Hq4DHOhN9w426knH3Rhby4rFm6D8eO+e+Dq5Gzg= github.com/klauspost/compress v1.13.6/go.mod h1:/3/Vjq9QcHkK5uEr5lBEmyoZ1iFhe47etQ6QUkpK6sk= -github.com/klauspost/compress v1.15.9/go.mod h1:PhcZ0MbTNciWF3rruxRgKxI5NkcHHrHUDtV4Yw2GlzU= -github.com/klauspost/compress v1.16.6/go.mod h1:ntbaceVETuRiXiv4DpjP66DpAtAGkEQskQzEyD//IeE= github.com/klauspost/compress v1.16.7 h1:2mk3MPGNzKyxErAw8YaohYh69+pa4sIQSC0fPGCFR9I= github.com/klauspost/compress v1.16.7/go.mod h1:ntbaceVETuRiXiv4DpjP66DpAtAGkEQskQzEyD//IeE= -github.com/klauspost/cpuid/v2 v2.0.9/go.mod h1:FInQzS24/EEf25PyTYn52gqo7WaD8xa0213Md/qVLRg= -github.com/kolo/xmlrpc v0.0.0-20201022064351-38db28db192b/go.mod h1:pcaDhQK0/NJZEvtCO0qQPPropqV0sJOJ6YW7X+9kRwM= -github.com/kolo/xmlrpc v0.0.0-20220921171641-a4b6fa1dd06b/go.mod h1:pcaDhQK0/NJZEvtCO0qQPPropqV0sJOJ6YW7X+9kRwM= github.com/konsorten/go-windows-terminal-sequences v1.0.1/go.mod h1:T0+1ngSBFLxvqU3pZ+m/2kptfBszLMUkC4ZK/EgS/cQ= github.com/konsorten/go-windows-terminal-sequences v1.0.2/go.mod h1:T0+1ngSBFLxvqU3pZ+m/2kptfBszLMUkC4ZK/EgS/cQ= github.com/konsorten/go-windows-terminal-sequences v1.0.3/go.mod h1:T0+1ngSBFLxvqU3pZ+m/2kptfBszLMUkC4ZK/EgS/cQ= @@ -2113,9 +1145,7 @@ github.com/kr/logfmt v0.0.0-20140226030751-b84e30acd515/go.mod h1:+0opPa2QZZtGFB github.com/kr/pretty v0.1.0/go.mod h1:dAy3ld7l9f0ibDNOQOHHMYYIIbhfbHSm3C4ZsoJORNo= github.com/kr/pretty v0.2.0/go.mod h1:ipq/a2n7PKx3OHsz4KJII5eveXtPO4qwEXGdVfWzfnI= github.com/kr/pretty v0.2.1/go.mod h1:ipq/a2n7PKx3OHsz4KJII5eveXtPO4qwEXGdVfWzfnI= -github.com/kr/pretty v0.3.0/go.mod h1:640gp4NfQd8pI5XOwp5fnNeVWj67G7CFk/SaSQn7NBk= github.com/kr/pretty v0.3.1 h1:flRD4NNwYAUpkphVc1HcthR4KEIFJ65n8Mw5qdRn3LE= -github.com/kr/pretty v0.3.1/go.mod h1:hoEshYVHaxMs3cyo3Yncou5ZscifuDolrwPKZanG3xk= github.com/kr/pty v1.1.1/go.mod h1:pFQYn66WHrOpPYNljwOMqo10TkYh1fy3cYio2l3bCsQ= github.com/kr/pty v1.1.5/go.mod h1:9r2w37qlBe7rQ6e1fg1S/9xpWHSnaqNdHD3WcMdbPDA= github.com/kr/pty v1.1.8/go.mod h1:O1sed60cT9XZ5uDucP5qwvh+TE3NnUj51EiZO/lmSfw= @@ -2126,7 +1156,6 @@ github.com/kulti/thelper v0.6.3 h1:ElhKf+AlItIu+xGnI990no4cE2+XaSu1ULymV2Yulxs= github.com/kulti/thelper v0.6.3/go.mod h1:DsqKShOvP40epevkFrvIwkCMNYxMeTNjdWL4dqWHZ6I= github.com/kunwardeep/paralleltest v1.0.7 h1:2uCk94js0+nVNQoHZNLBkAR1DQJrVzw6T0RMzJn55dQ= github.com/kunwardeep/paralleltest v1.0.7/go.mod h1:2C7s65hONVqY7Q5Efj5aLzRCNLjw2h4eMc9EcypGjcY= -github.com/kylelemons/godebug v0.0.0-20170820004349-d65d576e9348/go.mod h1:B69LEHPfb2qLo0BaaOLcbitczOKLWTsrBG9LczfCD4k= github.com/kylelemons/godebug v1.1.0 h1:RPNrshWIDI6G2gRW9EHilWtl7Z6Sb1BR0xunSBf0SNc= github.com/kylelemons/godebug v1.1.0/go.mod h1:9/0rRGxNHcop5bhtWyNeEfOS8JIWk580+fNqagV/RAw= github.com/kyoh86/exportloopref v0.1.11 h1:1Z0bcmTypkL3Q4k+IDHMWTcnCliEZcaPiIe0/ymEyhQ= @@ -2135,33 +1164,18 @@ github.com/ldez/gomoddirectives v0.2.3 h1:y7MBaisZVDYmKvt9/l1mjNCiSA1BVn34U0ObUc github.com/ldez/gomoddirectives v0.2.3/go.mod h1:cpgBogWITnCfRq2qGoDkKMEVSaarhdBr6g8G04uz6d0= github.com/ldez/tagliatelle v0.5.0 h1:epgfuYt9v0CG3fms0pEgIMNPuFf/LpPIfjk4kyqSioo= github.com/ldez/tagliatelle v0.5.0/go.mod h1:rj1HmWiL1MiKQuOONhd09iySTEkUuE/8+5jtPYz9xa4= -github.com/leodido/go-urn v1.2.0/go.mod h1:+8+nEpDfqqsY+g338gtMEUOtuK+4dEMhiQEgxpxOKII= github.com/leodido/go-urn v1.2.4 h1:XlAE/cm/ms7TE/VMVoduSpNBoyc2dOxHs5MZSwAN63Q= github.com/leodido/go-urn v1.2.4/go.mod h1:7ZrI8mTSeBSHl/UaRyKQW1qZeMgak41ANeCNaVckg+4= github.com/leonklingele/grouper v1.1.1 h1:suWXRU57D4/Enn6pXR0QVqqWWrnJ9Osrz+5rjt8ivzU= github.com/leonklingele/grouper v1.1.1/go.mod h1:uk3I3uDfi9B6PeUjsCKi6ndcf63Uy7snXgR4yDYQVDY= github.com/letsencrypt/boulder v0.0.0-20221109233200-85aa52084eaf h1:ndns1qx/5dL43g16EQkPV/i8+b3l5bYQwLeoSBe7tS8= github.com/letsencrypt/boulder v0.0.0-20221109233200-85aa52084eaf/go.mod h1:aGkAgvWY/IUcVFfuly53REpfv5edu25oij+qHRFaraA= -github.com/lib/pq v1.0.0/go.mod h1:5WUZQaWbwv1U+lTReE5YruASi9Al49XbQIvNi/34Woo= -github.com/lib/pq v1.1.0/go.mod h1:5WUZQaWbwv1U+lTReE5YruASi9Al49XbQIvNi/34Woo= -github.com/lib/pq v1.2.0/go.mod h1:5WUZQaWbwv1U+lTReE5YruASi9Al49XbQIvNi/34Woo= -github.com/lib/pq v1.10.2/go.mod h1:AlVN5x4E4T544tWzH6hKfbfQvm3HdbOxrmggDNAPY9o= -github.com/lib/pq v1.10.9/go.mod h1:AlVN5x4E4T544tWzH6hKfbfQvm3HdbOxrmggDNAPY9o= -github.com/linode/linodego v1.4.0/go.mod h1:PVsRxSlOiJyvG4/scTszpmZDTdgS+to3X6eS8pRrWI8= -github.com/linode/linodego v1.16.1/go.mod h1:aESRAbpLY9R6IA1WGAWHikRI9DU9Lhesapv1MhKmPHM= -github.com/linuxkit/virtsock v0.0.0-20201010232012-f8cee7dfc7a3/go.mod h1:3r6x7q95whyfWQpmGZTu3gk3v2YkMi05HEzl7Tf7YEo= github.com/lufeee/execinquery v1.2.1 h1:hf0Ems4SHcUGBxpGN7Jz78z1ppVkP/837ZlETPCEtOM= github.com/lufeee/execinquery v1.2.1/go.mod h1:EC7DrEKView09ocscGHC+apXMIaorh4xqSxS/dy8SbM= -github.com/lyft/protoc-gen-star v0.6.0/go.mod h1:TGAoBVkt8w7MPG72TrKIu85MIdXwDuzJYeZuUPFPNwA= -github.com/lyft/protoc-gen-star v0.6.1/go.mod h1:TGAoBVkt8w7MPG72TrKIu85MIdXwDuzJYeZuUPFPNwA= -github.com/lyft/protoc-gen-star/v2 v2.0.1/go.mod h1:RcCdONR2ScXaYnQC5tUzxzlpA3WVYF7/opLeUgcQs/o= github.com/magiconair/properties v1.8.0/go.mod h1:PppfXfuXeibc/6YijjN8zIbojt8czPbwD3XqdrwzmxQ= -github.com/magiconair/properties v1.8.1/go.mod h1:PppfXfuXeibc/6YijjN8zIbojt8czPbwD3XqdrwzmxQ= github.com/magiconair/properties v1.8.5/go.mod h1:y3VJvCyxH9uVvJTWEGAELF3aiYNyPKd5NZ3oSwXrF60= -github.com/magiconair/properties v1.8.6/go.mod h1:y3VJvCyxH9uVvJTWEGAELF3aiYNyPKd5NZ3oSwXrF60= github.com/magiconair/properties v1.8.7 h1:IeQXZAiQcpL9mgcAe1Nu6cX9LLw6ExEHKjN0VQdvPDY= github.com/magiconair/properties v1.8.7/go.mod h1:Dhd985XPs7jluiymwWYZ0G4Z61jb3vdS329zhj2hYo0= -github.com/mailru/easyjson v0.0.0-20160728113105-d5b7844b561a/go.mod h1:C1wdFJiN94OJF2b5HbByQZoLdCWB1Yqtg26g4irojpc= github.com/mailru/easyjson v0.0.0-20190614124828-94de47d64c63/go.mod h1:C1wdFJiN94OJF2b5HbByQZoLdCWB1Yqtg26g4irojpc= github.com/mailru/easyjson v0.0.0-20190626092158-b2ccc519800e/go.mod h1:C1wdFJiN94OJF2b5HbByQZoLdCWB1Yqtg26g4irojpc= github.com/mailru/easyjson v0.7.0/go.mod h1:KAzv3t3aY1NaHWoQz1+4F1ccyAH66Jk7yos7ldAVICs= @@ -2180,23 +1194,10 @@ github.com/matoous/godox v0.0.0-20230222163458-006bad1f9d26/go.mod h1:1BELzlh859 github.com/matryer/is v1.4.0 h1:sosSmIWwkYITGrxZ25ULNDeKiMNzFSr4V/eqBQP0PeE= github.com/matryer/is v1.4.0/go.mod h1:8I/i5uYgLzgsgEloJE1U6xx5HkBQpAZvepWuujKwMRU= github.com/mattn/go-colorable v0.0.9/go.mod h1:9vuHe8Xs5qXnSaW/c/ABM9alt+Vo+STaOChaDxuIBZU= -github.com/mattn/go-colorable v0.1.1/go.mod h1:FuOcm+DKB9mbwrcAfNl7/TZVBZ6rcnceauSikq3lYCQ= -github.com/mattn/go-colorable v0.1.4/go.mod h1:U0ppj6V5qS13XJ6of8GYAs25YV2eR4EVcfRqFIhoBtE= -github.com/mattn/go-colorable v0.1.6/go.mod h1:u6P/XSegPjTcexA+o6vUJrdnUu04hMope9wVRipJSqc= -github.com/mattn/go-colorable v0.1.8/go.mod h1:u6P/XSegPjTcexA+o6vUJrdnUu04hMope9wVRipJSqc= -github.com/mattn/go-colorable v0.1.9/go.mod h1:u6P/XSegPjTcexA+o6vUJrdnUu04hMope9wVRipJSqc= -github.com/mattn/go-colorable v0.1.12/go.mod h1:u5H1YNBxpqRaxsYJYSkiCWKzEfiAb1Gb520KVy5xxl4= github.com/mattn/go-colorable v0.1.13 h1:fFA4WZxdEF4tXPZVKMLwD8oUnCTTo08duU7wxecdEvA= github.com/mattn/go-colorable v0.1.13/go.mod h1:7S9/ev0klgBDR4GtXTXX8a3vIGJpMovkB8vQcUbaXHg= github.com/mattn/go-isatty v0.0.3/go.mod h1:M+lRXTBqGeGNdLjl/ufCoiOlB5xdOkqRJdNxMWT7Zi4= github.com/mattn/go-isatty v0.0.4/go.mod h1:M+lRXTBqGeGNdLjl/ufCoiOlB5xdOkqRJdNxMWT7Zi4= -github.com/mattn/go-isatty v0.0.5/go.mod h1:Iq45c/XA43vh69/j3iqttzPXn0bhXyGjM0Hdxcsrc5s= -github.com/mattn/go-isatty v0.0.7/go.mod h1:Iq45c/XA43vh69/j3iqttzPXn0bhXyGjM0Hdxcsrc5s= -github.com/mattn/go-isatty v0.0.8/go.mod h1:Iq45c/XA43vh69/j3iqttzPXn0bhXyGjM0Hdxcsrc5s= -github.com/mattn/go-isatty v0.0.10/go.mod h1:qgIWMr58cqv1PHHyhnkY9lrL7etaEgOFcMEpPG5Rm84= -github.com/mattn/go-isatty v0.0.11/go.mod h1:PhnuNfih5lzO57/f3n+odYbM4JtupLOxQOAqxQCu2WE= -github.com/mattn/go-isatty v0.0.12/go.mod h1:cbi8OIDigv2wuxKPP5vlRcQ1OAZbq2CE4Kysco4FUpU= -github.com/mattn/go-isatty v0.0.14/go.mod h1:7GGIvUiUoEMVVmxf/4nioHXj79iQHKdU27kJ6hsGG94= github.com/mattn/go-isatty v0.0.16/go.mod h1:kYGgaQfpe5nmfYZH+SKPsOc2e4SrIfOl2e/yFXSvRLM= github.com/mattn/go-isatty v0.0.17 h1:BTarxUcIeDqL27Mc+vyvdWYSL28zpIhv3RoTdsLMPng= github.com/mattn/go-isatty v0.0.17/go.mod h1:kYGgaQfpe5nmfYZH+SKPsOc2e4SrIfOl2e/yFXSvRLM= @@ -2205,45 +1206,26 @@ github.com/mattn/go-runewidth v0.0.9/go.mod h1:H031xJmbD/WCDINGzjvQ9THkh0rPKHF+m github.com/mattn/go-runewidth v0.0.13 h1:lTGmDsbAYt5DmK6OnoV7EuIF1wEIFAcxld6ypU4OSgU= github.com/mattn/go-runewidth v0.0.13/go.mod h1:Jdepj2loyihRzMpdS35Xk/zdY8IAYHsh153qUoGf23w= github.com/mattn/go-shellwords v1.0.3/go.mod h1:3xCvwCdWdlDJUrvuMn7Wuy9eWs4pE8vqg+NOMyg4B2o= -github.com/mattn/go-shellwords v1.0.6/go.mod h1:3xCvwCdWdlDJUrvuMn7Wuy9eWs4pE8vqg+NOMyg4B2o= -github.com/mattn/go-shellwords v1.0.12/go.mod h1:EZzvwXDESEeg03EKmM+RmDnNOPKG4lLtQsUlTZDWQ8Y= -github.com/mattn/go-sqlite3 v1.14.14/go.mod h1:NyWgC/yNuGj7Q9rpYnZvas74GogHl5/Z4A/KQRfk6bU= github.com/matttproud/golang_protobuf_extensions v1.0.1/go.mod h1:D8He9yQNgCq6Z5Ld7szi9bcBfOoFv/3dc6xSMkL2PC0= github.com/matttproud/golang_protobuf_extensions v1.0.2-0.20181231171920-c182affec369/go.mod h1:BSXmuO+STAnVfrANrmjBb36TMTDstsz7MSK+HVaYKv4= -github.com/matttproud/golang_protobuf_extensions v1.0.2/go.mod h1:BSXmuO+STAnVfrANrmjBb36TMTDstsz7MSK+HVaYKv4= github.com/matttproud/golang_protobuf_extensions v1.0.4 h1:mmDVorXM7PCGKw94cs5zkfA9PSy5pEvNWRP0ET0TIVo= github.com/matttproud/golang_protobuf_extensions v1.0.4/go.mod h1:BSXmuO+STAnVfrANrmjBb36TMTDstsz7MSK+HVaYKv4= -github.com/maxatome/go-testdeep v1.12.0/go.mod h1:lPZc/HAcJMP92l7yI6TRz1aZN5URwUBUAfUNvrclaNM= -github.com/maxbrunsfeld/counterfeiter/v6 v6.2.2/go.mod h1:eD9eIE7cdwcMi9rYluz88Jz2VyhSmden33/aXg4oVIY= github.com/mbilski/exhaustivestruct v1.2.0 h1:wCBmUnSYufAHO6J4AVWY6ff+oxWxsVFrwgOdMUQePUo= github.com/mbilski/exhaustivestruct v1.2.0/go.mod h1:OeTBVxQWoEmB2J2JCHmXWPJ0aksxSUOUy+nvtVEfzXc= github.com/mgechev/revive v1.3.2 h1:Wb8NQKBaALBJ3xrrj4zpwJwqwNA6nDpyJSEQWcCka6U= github.com/mgechev/revive v1.3.2/go.mod h1:UCLtc7o5vg5aXCwdUTU1kEBQ1v+YXPAkYDIDXbrs5I0= -github.com/microsoft/ApplicationInsights-Go v0.4.4/go.mod h1:fKRUseBqkw6bDiXTs3ESTiU/4YTIHsQS4W3fP2ieF4U= -github.com/microsoft/go-mssqldb v0.21.0/go.mod h1:+4wZTUnz/SV6nffv+RRRB/ss8jPng5Sho2SmM1l2ts4= github.com/miekg/dns v1.0.14/go.mod h1:W1PPwlIAgtquWBMBEV9nkV9Cazfe8ScdGz/Lj7v3Nrg= -github.com/miekg/dns v1.1.26/go.mod h1:bPDLeHnStXmXAq1m/Ch/hvfNHr14JKNPMBo3VZKjuso= -github.com/miekg/dns v1.1.41/go.mod h1:p6aan82bvRIyn+zDIv9xYNUpwa73JcSh9BKwknJysuI= -github.com/miekg/dns v1.1.43/go.mod h1:+evo5L0630/F6ca/Z9+GAqzhjGyn8/c+TBaOyfEl0V4= -github.com/miekg/dns v1.1.48/go.mod h1:e3IlAVfNqAllflbibAZEWOXOQ+Ynzk/dDozDxY7XnME= -github.com/miekg/dns v1.1.53/go.mod h1:uInx36IzPl7FYnDcMeVWxj9byh7DutNykX4G9Sj60FY= github.com/miekg/pkcs11 v1.0.3-0.20190429190417-a667d056470f/go.mod h1:XsNlhZGX73bx86s2hdc/FuaLm2CPZJemRLMA+WTFxgs= github.com/miekg/pkcs11 v1.0.3/go.mod h1:XsNlhZGX73bx86s2hdc/FuaLm2CPZJemRLMA+WTFxgs= github.com/miekg/pkcs11 v1.1.1 h1:Ugu9pdy6vAYku5DEpVWVFPYnzV+bxB+iRdbuFSu7TvU= github.com/miekg/pkcs11 v1.1.1/go.mod h1:XsNlhZGX73bx86s2hdc/FuaLm2CPZJemRLMA+WTFxgs= -github.com/minio/asm2plan9s v0.0.0-20200509001527-cdd76441f9d8/go.mod h1:mC1jAcsrzbxHt8iiaC+zU4b1ylILSosueou12R++wfY= -github.com/minio/c2goasm v0.0.0-20190812172519-36a3d3bbc4f3/go.mod h1:RagcQ7I8IeTMnF8JTXieKnO4Z6JCsikNEzj0DwauVzE= -github.com/minio/highwayhash v1.0.1/go.mod h1:BQskDq+xkJ12lmlUUi7U0M5Swg3EWR+dLTk+kldvVxY= -github.com/minio/highwayhash v1.0.2/go.mod h1:BQskDq+xkJ12lmlUUi7U0M5Swg3EWR+dLTk+kldvVxY= github.com/mistifyio/go-zfs v2.1.2-0.20190413222219-f784269be439+incompatible/go.mod h1:8AuVvqP/mXw1px98n46wfvcGfQ4ci2FwoAjKYxuo3Z4= github.com/mitchellh/cli v1.0.0/go.mod h1:hNIlj7HEI86fIcpObd7a0FcrxTWetlwJDGcceTlRvqc= -github.com/mitchellh/cli v1.1.0/go.mod h1:xcISNoH86gajksDmfB23e/pu+B+GeFRMYmoHXxx3xhI= github.com/mitchellh/copystructure v1.2.0 h1:vpKXTN4ewci03Vljg/q9QvCGUDttBOGBIa15WveJJGw= github.com/mitchellh/go-homedir v1.0.0/go.mod h1:SfyaCUpYCn1Vlf4IUYiD9fPX4A5wJrkLzIz1N1q0pr0= github.com/mitchellh/go-homedir v1.1.0 h1:lukF9ziXFxDFPkA1vsr5zpc1XuPDn/wFntq5mG+4E0Y= github.com/mitchellh/go-homedir v1.1.0/go.mod h1:SfyaCUpYCn1Vlf4IUYiD9fPX4A5wJrkLzIz1N1q0pr0= github.com/mitchellh/go-testing-interface v1.0.0/go.mod h1:kRemZodwjscx+RGhAo8eIhFbs2+BFgRtFPeD/KE+zxI= -github.com/mitchellh/go-testing-interface v1.14.1/go.mod h1:gfgS7OtZj6MA4U1UrDRp04twqAjfvlZyCfX3sDjEym8= github.com/mitchellh/go-wordwrap v1.0.0/go.mod h1:ZXFpozHsX6DPmq2I0TCekCxypsnAUbP2oI0UX1GXzOo= github.com/mitchellh/gox v0.4.0/go.mod h1:Sd9lOJ0+aimLBi73mGofS1ycjY8lL3uZM3JPS42BGNg= github.com/mitchellh/iochan v1.0.0/go.mod h1:JwYml1nuB7xOzsp52dPpHFffvOCDupsG0QubkSMEySY= @@ -2251,25 +1233,16 @@ github.com/mitchellh/mapstructure v0.0.0-20160808181253-ca63d7c062ee/go.mod h1:F github.com/mitchellh/mapstructure v1.1.2/go.mod h1:FVVH3fgwuzCH5S8UJGiWEs2h04kUh9fWfEaFds41c1Y= github.com/mitchellh/mapstructure v1.3.3/go.mod h1:bFUtVrKA4DC2yAKiSyO/QUcy7e+RRV2QTWOzhPopBRo= github.com/mitchellh/mapstructure v1.4.1/go.mod h1:bFUtVrKA4DC2yAKiSyO/QUcy7e+RRV2QTWOzhPopBRo= -github.com/mitchellh/mapstructure v1.4.2/go.mod h1:bFUtVrKA4DC2yAKiSyO/QUcy7e+RRV2QTWOzhPopBRo= -github.com/mitchellh/mapstructure v1.4.3/go.mod h1:bFUtVrKA4DC2yAKiSyO/QUcy7e+RRV2QTWOzhPopBRo= github.com/mitchellh/mapstructure v1.5.0 h1:jeMsZIYE/09sWLaz43PL7Gy6RuMjD2eJVyuac5Z2hdY= github.com/mitchellh/mapstructure v1.5.0/go.mod h1:bFUtVrKA4DC2yAKiSyO/QUcy7e+RRV2QTWOzhPopBRo= github.com/mitchellh/osext v0.0.0-20151018003038-5e2d6d41470f/go.mod h1:OkQIRizQZAeMln+1tSwduZz7+Af5oFlKirV/MSYes2A= github.com/mitchellh/reflectwalk v1.0.2 h1:G2LzWKi524PWgd3mLHV8Y5k7s6XUvT0Gef6zxSIeXaQ= github.com/moby/locker v1.0.1/go.mod h1:S7SDdo5zpBK84bzzVlKr2V0hz+7x9hWbYC/kq7oQppc= github.com/moby/spdystream v0.2.0 h1:cjW1zVyyoiM0T7b6UoySUFqzXMoqRckQtXwGPiBhOM8= -github.com/moby/spdystream v0.2.0/go.mod h1:f7i0iNDQJ059oMTcWxx8MA/zKFIuD/lY+0GqbN2Wy8c= github.com/moby/sys/mountinfo v0.4.0/go.mod h1:rEr8tzG/lsIZHBtN/JjGG+LMYx9eXgW2JI+6q0qou+A= github.com/moby/sys/mountinfo v0.4.1/go.mod h1:rEr8tzG/lsIZHBtN/JjGG+LMYx9eXgW2JI+6q0qou+A= -github.com/moby/sys/mountinfo v0.5.0/go.mod h1:3bMD3Rg+zkqx8MRYPi7Pyb0Ie97QEBmdxbhnCLlSvSU= -github.com/moby/sys/mountinfo v0.6.2/go.mod h1:IJb6JQeOklcdMU9F5xQ8ZALD+CUr5VlGpwtX+VE0rpI= -github.com/moby/sys/signal v0.6.0/go.mod h1:GQ6ObYZfqacOwTtlXvcmh9A26dVRul/hbOZn88Kg8Tg= github.com/moby/sys/symlink v0.1.0/go.mod h1:GGDODQmbFOjFsXvfLVn3+ZRxkch54RkSiGqsZeMYowQ= -github.com/moby/sys/symlink v0.2.0/go.mod h1:7uZVF2dqJjG/NsClqul95CqKOBRQyYSNnJ6BMgR/gFs= github.com/moby/term v0.0.0-20200312100748-672ec06f55cd/go.mod h1:DdlQx2hp0Ss5/fLikoLlEeIYiATotOjgB//nb973jeo= -github.com/moby/term v0.0.0-20210610120745-9d4ed1856297/go.mod h1:vgPCkQMyxTZ7IDy8SXRufE172gr8+K/JE/7hHFxHW3A= -github.com/moby/term v0.0.0-20210619224110-3f7ff695adc6/go.mod h1:E2VnQOmVuvZB6UYnnDB0qG5Nq/1tD9acaOpo6xmt0Kw= github.com/modern-go/concurrent v0.0.0-20180228061459-e0a39a4cb421/go.mod h1:6dJC0mAP4ikYIbvyc7fijjWJddQyLn8Ig3JB5CqoB9Q= github.com/modern-go/concurrent v0.0.0-20180306012644-bacd9c7ef1dd h1:TRLaZ9cD/w8PVh93nsPXa1VrQ6jlwL5oN8l14QlcNfg= github.com/modern-go/concurrent v0.0.0-20180306012644-bacd9c7ef1dd/go.mod h1:6dJC0mAP4ikYIbvyc7fijjWJddQyLn8Ig3JB5CqoB9Q= @@ -2277,10 +1250,7 @@ github.com/modern-go/reflect2 v0.0.0-20180701023420-4b7aa43c6742/go.mod h1:bx2lN github.com/modern-go/reflect2 v1.0.1/go.mod h1:bx2lNnkwVCuqBIxFjflWJWanXIb3RllmbCylyMrvgv0= github.com/modern-go/reflect2 v1.0.2 h1:xBagoLtFs94CBntxluKeaWgTMpvLxC4ur3nMaC9Gz0M= github.com/modern-go/reflect2 v1.0.2/go.mod h1:yWuevngMOJpCy52FWWMvUC8ws7m/LJsjYzDa0/r8luk= -github.com/modocache/gover v0.0.0-20171022184752-b58185e213c5/go.mod h1:caMODM3PzxT8aQXRPkAt8xlV/e7d7w8GM5g0fa5F0D8= github.com/montanaflynn/stats v0.0.0-20171201202039-1bf9dbcd8cbe/go.mod h1:wL8QJuTMNUDYhXwkmfOly8iTdp5TEcJFWZD2D7SIkUc= -github.com/montanaflynn/stats v0.6.6/go.mod h1:etXPPgVO6n31NxCd9KQUMvCM+ve0ruNzt6R8Bnaayow= -github.com/montanaflynn/stats v0.7.0/go.mod h1:etXPPgVO6n31NxCd9KQUMvCM+ve0ruNzt6R8Bnaayow= github.com/montanaflynn/stats v0.7.1 h1:etflOAAHORrCC44V+aR6Ftzort912ZU+YLiSTuV8eaE= github.com/montanaflynn/stats v0.7.1/go.mod h1:etXPPgVO6n31NxCd9KQUMvCM+ve0ruNzt6R8Bnaayow= github.com/moricho/tparallel v0.3.1 h1:fQKD4U1wRMAYNngDonW5XupoB/ZGJHdpzrWqgyg9krA= @@ -2297,13 +1267,6 @@ github.com/mwitkow/go-conntrack v0.0.0-20190716064945-2f068394615f/go.mod h1:qRW github.com/mxk/go-flowrate v0.0.0-20140419014527-cca7078d478f/go.mod h1:ZdcZmHo+o7JKHSa8/e818NopupXU1YMK5fe1lsApnBw= github.com/nakabonne/nestif v0.3.1 h1:wm28nZjhQY5HyYPx+weN3Q65k6ilSBxDb8v5S81B81U= github.com/nakabonne/nestif v0.3.1/go.mod h1:9EtoZochLn5iUprVDmDjqGKPofoUEBL8U4Ngq6aY7OE= -github.com/nats-io/jwt v1.2.2/go.mod h1:/xX356yQA6LuXI9xWW7mZNpxgF2mBmGecH+Fj34sP5Q= -github.com/nats-io/jwt/v2 v2.0.3/go.mod h1:VRP+deawSXyhNjXmxPCHskrR6Mq50BqpEI5SEcNiGlY= -github.com/nats-io/nats-server/v2 v2.5.0/go.mod h1:Kj86UtrXAL6LwYRA6H4RqzkHhK0Vcv2ZnKD5WbQ1t3g= -github.com/nats-io/nats.go v1.12.1/go.mod h1:BPko4oXsySz4aSWeFgOHLZs3G4Jq4ZAyE6/zMCxRT6w= -github.com/nats-io/nkeys v0.2.0/go.mod h1:XdZpAbhgyyODYqjTawOnIOI7VlbKSarI9Gfy1tqEu/s= -github.com/nats-io/nkeys v0.3.0/go.mod h1:gvUNGjVcM2IPr5rCsRsC6Wb3Hr2CQAm08dsxtV6A5y4= -github.com/nats-io/nuid v1.0.1/go.mod h1:19wcPz3Ph3q0Jbyiqsd0kePYG7A95tJPxeL+1OSON2c= github.com/nbutton23/zxcvbn-go v0.0.0-20210217022336-fa2cb2858354 h1:4kuARK6Y6FxaNu/BnU2OAaLF86eTVhP2hjTB6iMvItA= github.com/nbutton23/zxcvbn-go v0.0.0-20210217022336-fa2cb2858354/go.mod h1:KSVJerMDfblTH7p5MZaTt+8zaT2iEk3AkVb9PQdZuE8= github.com/ncw/swift v1.0.47/go.mod h1:23YIA4yWVnGwv2dQlN4bB7egfYX6YLn0Yo/S6zZO/ZM= @@ -2319,7 +1282,6 @@ github.com/nunnatsa/ginkgolinter v0.12.1/go.mod h1:AK8Ab1PypVrcGUusuKD8RDcl2KgsI github.com/nxadm/tail v1.4.4/go.mod h1:kenIhsEOeOJmVchQTgglprH7qJGnHDVpk1VPCcaMI8A= github.com/nxadm/tail v1.4.8 h1:nPr65rt6Y5JFSKQO7qToXr7pePgD6Gwiw05lkbyAQTE= github.com/nxadm/tail v1.4.8/go.mod h1:+ncqLTQzXmGhMZNUePPaPqPvBxHAIsmXswZKocGu+AU= -github.com/oklog/run v1.1.0/go.mod h1:sVPdnTZT1zYwAJeCMu2Th4T21pA3FPOQRfWjQlk7DVU= github.com/oklog/ulid v1.3.1 h1:EGfNDEx6MqHz8B3uNV6QAib1UR2Lm97sHi3ocA6ESJ4= github.com/oklog/ulid v1.3.1/go.mod h1:CirwcVhetQ6Lv90oh/F+FBtV6XMibvdAFo93nm5qn4U= github.com/olekukonko/tablewriter v0.0.0-20170122224234-a0225b3f23b5/go.mod h1:vsDQFd/mU46D+Z4whnwzcISnGGzXWMclvtLoiIKAKIo= @@ -2328,45 +1290,25 @@ github.com/olekukonko/tablewriter v0.0.5/go.mod h1:hPp6KlRPjbx+hW8ykQs1w3UBbZlj6 github.com/onsi/ginkgo v0.0.0-20151202141238-7f8ab55aaf3b/go.mod h1:lLunBs/Ym6LB5Z9jYTR76FiuTmxDTDusOGeTQH+WWjE= github.com/onsi/ginkgo v0.0.0-20170829012221-11459a886d9c/go.mod h1:lLunBs/Ym6LB5Z9jYTR76FiuTmxDTDusOGeTQH+WWjE= github.com/onsi/ginkgo v1.6.0/go.mod h1:lLunBs/Ym6LB5Z9jYTR76FiuTmxDTDusOGeTQH+WWjE= -github.com/onsi/ginkgo v1.7.0/go.mod h1:lLunBs/Ym6LB5Z9jYTR76FiuTmxDTDusOGeTQH+WWjE= -github.com/onsi/ginkgo v1.8.0/go.mod h1:lLunBs/Ym6LB5Z9jYTR76FiuTmxDTDusOGeTQH+WWjE= github.com/onsi/ginkgo v1.10.1/go.mod h1:lLunBs/Ym6LB5Z9jYTR76FiuTmxDTDusOGeTQH+WWjE= github.com/onsi/ginkgo v1.10.3/go.mod h1:lLunBs/Ym6LB5Z9jYTR76FiuTmxDTDusOGeTQH+WWjE= github.com/onsi/ginkgo v1.11.0/go.mod h1:lLunBs/Ym6LB5Z9jYTR76FiuTmxDTDusOGeTQH+WWjE= -github.com/onsi/ginkgo v1.12.0/go.mod h1:oUhWkIvk5aDxtKvDDuw8gItl8pKl42LzjC9KZE0HfGg= github.com/onsi/ginkgo v1.12.1/go.mod h1:zj2OWP4+oCPe1qIXoGWkgMRwljMUYCdkwsT2108oapk= -github.com/onsi/ginkgo v1.13.0/go.mod h1:+REjRxOmWfHCjfv9TTWB1jD1Frx4XydAD3zm1lskyM0= -github.com/onsi/ginkgo v1.14.0/go.mod h1:iSB4RoI2tjJc9BBv4NKIKWKya62Rps+oPG/Lv9klQyY= -github.com/onsi/ginkgo v1.16.2/go.mod h1:CObGmKUOKaSC0RjmoAK7tKyn4Azo5P2IWuoMnvwxz1E= github.com/onsi/ginkgo v1.16.4/go.mod h1:dX+/inL/fNMqNlz0e9LfyB9TswhZpCVdJM/Z6Vvnwo0= github.com/onsi/ginkgo v1.16.5 h1:8xi0RTUf59SOSfEtZMvwTvXYMzG4gV23XVHOZiXNtnE= github.com/onsi/ginkgo v1.16.5/go.mod h1:+E8gABHa3K6zRBolWtd+ROzc/U5bkGt0FwiG042wbpU= github.com/onsi/ginkgo/v2 v2.1.3/go.mod h1:vw5CSIxN1JObi/U8gcbwft7ZxR2dgaR70JSE3/PpL4c= -github.com/onsi/ginkgo/v2 v2.1.4/go.mod h1:um6tUpWM/cxCK3/FK8BXqEiUMUwRgSM4JXG47RKZmLU= -github.com/onsi/ginkgo/v2 v2.1.6/go.mod h1:MEH45j8TBi6u9BMogfbp0stKC5cdGjumZj5Y7AG4VIk= -github.com/onsi/ginkgo/v2 v2.3.0/go.mod h1:Eew0uilEqZmIEZr8JrvYlvOM7Rr6xzTmMV8AyFNU9d0= -github.com/onsi/ginkgo/v2 v2.4.0/go.mod h1:iHkDK1fKGcBoEHT5W7YBq4RFWaQulw+caOMkAt4OrFo= github.com/onsi/ginkgo/v2 v2.9.4 h1:xR7vG4IXt5RWx6FfIjyAtsoMAtnc3C/rFXBBd2AjZwE= github.com/onsi/gomega v0.0.0-20151007035656-2152b45fa28a/go.mod h1:C1qb7wdrVGGVU+Z6iS04AVkA3Q65CEZX59MT0QO5uiA= github.com/onsi/gomega v0.0.0-20170829124025-dcabb60a477c/go.mod h1:C1qb7wdrVGGVU+Z6iS04AVkA3Q65CEZX59MT0QO5uiA= -github.com/onsi/gomega v1.4.3/go.mod h1:ex+gbHU/CVuBBDIJjb2X0qEXbFg53c61hWP/1CpauHY= -github.com/onsi/gomega v1.5.0/go.mod h1:ex+gbHU/CVuBBDIJjb2X0qEXbFg53c61hWP/1CpauHY= github.com/onsi/gomega v1.7.0/go.mod h1:ex+gbHU/CVuBBDIJjb2X0qEXbFg53c61hWP/1CpauHY= github.com/onsi/gomega v1.7.1/go.mod h1:XdKZgCCFLUoM/7CFJVPcG8C1xQ1AJ0vpAezJrB7JYyY= -github.com/onsi/gomega v1.9.0/go.mod h1:Ho0h+IUsWyvy1OpqCwxlQ/21gkhVunqlU8fDGcoTdcA= github.com/onsi/gomega v1.10.1/go.mod h1:iN09h71vgCQne3DLsj+A5owkum+a2tYe+TOCB1ybHNo= github.com/onsi/gomega v1.10.3/go.mod h1:V9xEwhxec5O8UDM77eCW8vLymOMltsqPVYWrpDsH8xc= -github.com/onsi/gomega v1.13.0/go.mod h1:lRk9szgn8TxENtWd0Tp4c3wjlRfMTMH27I+3Je41yGY= -github.com/onsi/gomega v1.15.0/go.mod h1:cIuvLEne0aoVhAgh/O6ac0Op8WWw9H6eYCriF+tEHG0= github.com/onsi/gomega v1.16.0/go.mod h1:HnhC7FXeEQY45zxNK3PPoIUhzk/80Xly9PcubAlGdZY= github.com/onsi/gomega v1.17.0/go.mod h1:HnhC7FXeEQY45zxNK3PPoIUhzk/80Xly9PcubAlGdZY= github.com/onsi/gomega v1.19.0/go.mod h1:LY+I3pBVzYsTBU1AnDwOSxaYi9WoWiqgwooUqq9yPro= -github.com/onsi/gomega v1.20.1/go.mod h1:DtrZpjmvpn2mPm4YWQa0/ALMDj9v4YxLgojwPeREyVo= -github.com/onsi/gomega v1.21.1/go.mod h1:iYAIXgPSaDHak0LCMA+AWBpIKBr8WZicMxnE8luStNc= -github.com/onsi/gomega v1.22.1/go.mod h1:x6n7VNe4hw0vkyYUM4mjIXx3JbLiPaBPNgB7PRQ1tuM= -github.com/onsi/gomega v1.23.0/go.mod h1:Z/NWtiqwBrwUt4/2loMmHL63EDLnYHmVbuBpDr2vQAg= github.com/onsi/gomega v1.27.6 h1:ENqfyGeS5AX/rlXDd/ETokDz93u0YufY1Pgxuy/PvWE= -github.com/op/go-logging v0.0.0-20160315200505-970db520ece7/go.mod h1:HzydrMdWErDVzsI23lYNej1Htcns9BCg93Dk0bBINWk= github.com/opencontainers/go-digest v0.0.0-20170106003457-a6d0ee40d420/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s= github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s= github.com/opencontainers/go-digest v1.0.0-rc1/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s= @@ -2375,8 +1317,6 @@ github.com/opencontainers/go-digest v1.0.0 h1:apOUWs51W5PlhuyGyz9FCeeBIOUDA/6nW8 github.com/opencontainers/go-digest v1.0.0/go.mod h1:0JzlMkj0TRzQZfJkVvzbP0HBR3IKzErnv2BNG4W4MAM= github.com/opencontainers/image-spec v1.0.0/go.mod h1:BtxoFyWECRxE4U/7sNtV5W15zMzWCbyJoFRP3s7yZA0= github.com/opencontainers/image-spec v1.0.1/go.mod h1:BtxoFyWECRxE4U/7sNtV5W15zMzWCbyJoFRP3s7yZA0= -github.com/opencontainers/image-spec v1.0.2-0.20211117181255-693428a734f5/go.mod h1:BtxoFyWECRxE4U/7sNtV5W15zMzWCbyJoFRP3s7yZA0= -github.com/opencontainers/image-spec v1.0.2/go.mod h1:BtxoFyWECRxE4U/7sNtV5W15zMzWCbyJoFRP3s7yZA0= github.com/opencontainers/image-spec v1.1.0-rc4 h1:oOxKUJWnFC4YGHCCMNql1x4YaDfYBTS5Y4x/Cgeo1E0= github.com/opencontainers/image-spec v1.1.0-rc4/go.mod h1:X4pATf0uXsnn3g5aiGIsVnJBR4mxhKzfwmvK/B2NTm8= github.com/opencontainers/runc v0.0.0-20190115041553-12f6a991201f/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U= @@ -2384,23 +1324,16 @@ github.com/opencontainers/runc v0.1.1/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59P github.com/opencontainers/runc v1.0.0-rc8.0.20190926000215-3e425f80a8c9/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U= github.com/opencontainers/runc v1.0.0-rc9/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U= github.com/opencontainers/runc v1.0.0-rc93/go.mod h1:3NOsor4w32B2tC0Zbl8Knk4Wg84SM2ImC1fxBuqJ/H0= -github.com/opencontainers/runc v1.0.2/go.mod h1:aTaHFFwQXuA71CiyxOdFFIorAoemI04suvGRQFzWTD0= -github.com/opencontainers/runc v1.1.0/go.mod h1:Tj1hFw6eFWp/o33uxGf5yF2BX5yz2Z6iptFpuvbbKqc= github.com/opencontainers/runtime-spec v0.1.2-0.20190507144316-5b71a03e2700/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0= github.com/opencontainers/runtime-spec v1.0.1/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0= github.com/opencontainers/runtime-spec v1.0.2-0.20190207185410-29686dbc5559/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0= github.com/opencontainers/runtime-spec v1.0.2/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0= github.com/opencontainers/runtime-spec v1.0.3-0.20200929063507-e6143ca7d51d/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0= -github.com/opencontainers/runtime-spec v1.0.3-0.20210326190908-1c3f411f0417/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0= github.com/opencontainers/runtime-tools v0.0.0-20181011054405-1d69bd0f9c39/go.mod h1:r3f7wjNzSs2extwzU3Y+6pKfobzPh+kKFJ3ofN+3nfs= github.com/opencontainers/selinux v1.6.0/go.mod h1:VVGKuOLlE7v4PJyT6h7mNWvq1rzqiriPsEqVhc+svHE= github.com/opencontainers/selinux v1.8.0/go.mod h1:RScLhm78qiWa2gbVCcGkC7tCGdgk3ogry1nUQF8Evvo= -github.com/opencontainers/selinux v1.8.2/go.mod h1:MUIHuUEvKB1wtJjQdOyYRgOnLD2xAPP8dBsCoU0KuF8= -github.com/opencontainers/selinux v1.10.0/go.mod h1:2i0OySw99QjzBBQByd1Gr9gSjvuho1lHsJxIJ3gGbJI= -github.com/opentracing/opentracing-go v1.1.0/go.mod h1:UkNAQd3GIcIGf0SeVgPpRdFStlNbqXla1AfSYxPUl2o= github.com/opentracing/opentracing-go v1.2.0 h1:uEJPy/1a5RIPAJ0Ov+OIO8OxWu77jEv+1B0VhjKrZUs= github.com/opentracing/opentracing-go v1.2.0/go.mod h1:GxEUsuufX4nBwe+T+Wl9TAgYrxe9dPLANfrWvHYVTgc= -github.com/openzipkin/zipkin-go v0.2.5/go.mod h1:KpXfKdgRDnnhsxw4pNIH9Md5lyFqKUa4YDFlwRYAMyE= github.com/openzipkin/zipkin-go v0.3.0 h1:XtuXmOLIXLjiU2XduuWREDT0LOKtSgos/g7i7RYyoZQ= github.com/openzipkin/zipkin-go v0.3.0/go.mod h1:4c3sLeE8xjNqehmF5RpAFLPLJxXscc0R4l6Zg0P1tTQ= github.com/otiai10/copy v1.2.0/go.mod h1:rrF5dJ5F0t/EWSYODDu4j9/vEeYHMkc8jt0zJChqQWw= @@ -2411,9 +1344,7 @@ github.com/otiai10/curr v1.0.0/go.mod h1:LskTG5wDwr8Rs+nNQ+1LlxRjAtTZZjtJW4rMXl6 github.com/otiai10/mint v1.3.0/go.mod h1:F5AjcsTsWUqX+Na9fpHb52P8pcRX2CI6A3ctIT91xUo= github.com/otiai10/mint v1.3.1/go.mod h1:/yxELlJQ0ufhjUwhshSj+wFjZ78CnZ48/1wtmBH1OTc= github.com/otiai10/mint v1.3.2/go.mod h1:/yxELlJQ0ufhjUwhshSj+wFjZ78CnZ48/1wtmBH1OTc= -github.com/ovh/go-ovh v1.4.1/go.mod h1:6bL6pPyUT7tBfI0pqOegJgRjgjuO+mOo+MyXd1EEC0M= github.com/pascaldekloe/goe v0.0.0-20180627143212-57f6aae5913c/go.mod h1:lzWF7FIEvWOWxwDKqyGYQf6ZUaNfKdP144TG7ZOy1lc= -github.com/pascaldekloe/goe v0.1.0/go.mod h1:lzWF7FIEvWOWxwDKqyGYQf6ZUaNfKdP144TG7ZOy1lc= github.com/pborman/uuid v1.2.1 h1:+ZZIw58t/ozdjRaXh/3awHfmWRbzYxJoAdNJxe/3pvw= github.com/pborman/uuid v1.2.1/go.mod h1:X/NO0urCmaxf9VXbdlT7C2Yzkj2IKimNn4k+gtPdI/k= github.com/pelletier/go-buffruneio v0.2.0/go.mod h1:JkE26KsDizTr40EUHkXVtNPvgGtbSNq5BcowyYOWdKo= @@ -2421,31 +1352,20 @@ github.com/pelletier/go-toml v1.2.0/go.mod h1:5z9KED0ma1S8pY6P1sdut58dfprrGBbd/9 github.com/pelletier/go-toml v1.7.0/go.mod h1:vwGMzjaWMwyfHwgIBhI2YUM4fB6nL6lVAvS1LBMMhTE= github.com/pelletier/go-toml v1.8.1/go.mod h1:T2/BmBdy8dvIRq1a/8aqjN41wvWlN4lrapLU/GW4pbc= github.com/pelletier/go-toml v1.9.3/go.mod h1:u1nR/EPcESfeI/szUZKdtJ0xRNbUoANCkoOuaOx1Y+c= -github.com/pelletier/go-toml v1.9.5/go.mod h1:u1nR/EPcESfeI/szUZKdtJ0xRNbUoANCkoOuaOx1Y+c= -github.com/pelletier/go-toml/v2 v2.0.5/go.mod h1:OMHamSCAODeSsVrwwvcJOaoN0LIUIaFVNZzmWyNfXas= github.com/pelletier/go-toml/v2 v2.0.8 h1:0ctb6s9mE31h0/lhu+J6OPmVeDxJn+kYnJc2jZR9tGQ= github.com/pelletier/go-toml/v2 v2.0.8/go.mod h1:vuYfssBdrU2XDZ9bYydBu6t+6a6PYNcZljzZR9VXg+4= -github.com/performancecopilot/speed/v4 v4.0.0/go.mod h1:qxrSyuDGrTOWfV+uKRFhfxw6h/4HXRGUiZiufxo49BM= github.com/peterbourgon/diskv v2.0.1+incompatible/go.mod h1:uqqh8zWWbv1HBMNONnaR/tNboyR3/BZd58JJSHlUSCU= -github.com/phpdave11/gofpdf v1.4.2/go.mod h1:zpO6xFn9yxo3YLyMvW8HcKWVdbNqgIfOOp2dXMnm1mY= -github.com/phpdave11/gofpdi v1.0.12/go.mod h1:vBmVV0Do6hSBHC8uKUQ71JGW+ZGQq74llk/7bXwjDoI= -github.com/phpdave11/gofpdi v1.0.13/go.mod h1:vBmVV0Do6hSBHC8uKUQ71JGW+ZGQq74llk/7bXwjDoI= -github.com/pierrec/lz4 v1.0.2-0.20190131084431-473cd7ce01a1/go.mod h1:3/3N9NVKO0jef7pBehbT1qWhCMrIgbYNnFAZCqQ5LRc= github.com/pierrec/lz4 v2.6.1+incompatible/go.mod h1:pdkljMzZIN41W+lC3N2tnIh5sFi+IEE17M5jbnwPHcY= -github.com/pierrec/lz4/v4 v4.1.15/go.mod h1:gZWDp/Ze/IJXGXf23ltt2EXimqmTUXEy0GFuRQyBid4= github.com/pierrec/lz4/v4 v4.1.18 h1:xaKrnTkyoqfh1YItXl56+6KJNVYWlEEPuAQW9xsplYQ= github.com/pierrec/lz4/v4 v4.1.18/go.mod h1:gZWDp/Ze/IJXGXf23ltt2EXimqmTUXEy0GFuRQyBid4= github.com/pjbgf/sha1cd v0.3.0 h1:4D5XXmUUBUl/xQ6IjCkEAbqXskkq/4O7LmGn0AqMDs4= -github.com/pkg/browser v0.0.0-20210115035449-ce105d075bb4/go.mod h1:N6UoU20jOqggOuDwUaBQpluzLNDqif3kq9z2wpdYEfQ= github.com/pkg/browser v0.0.0-20210911075715-681adbf594b8 h1:KoWmjvw+nsYOo29YJK9vDA65RGE3NrOnUtO7a+RF9HU= github.com/pkg/browser v0.0.0-20210911075715-681adbf594b8/go.mod h1:HKlIX3XHQyzLZPlr7++PzdhaXEj94dEiJgZDTsxEqUI= -github.com/pkg/diff v0.0.0-20210226163009-20ebb0f2a09e/go.mod h1:pJLUxLENpZxwdsKMEsNbx1VGcRFpLqf3715MtcvvzbA= github.com/pkg/errors v0.8.0/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0= github.com/pkg/errors v0.8.1-0.20171018195549-f15c970de5b7/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0= github.com/pkg/errors v0.8.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0= github.com/pkg/errors v0.9.1 h1:FEBLx1zS214owpjy7qsBeixbURkuhQAwrK5UwLGTwt4= github.com/pkg/errors v0.9.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0= -github.com/pkg/profile v1.2.1/go.mod h1:hJw3o1OdXxsrSjjVksARp5W95eeEaEfptyVZyv6JUPA= github.com/pkg/sftp v1.10.1/go.mod h1:lYOWFsE0bwd1+KfKJaKeuokY15vzFx25BLbzYYoAxZI= github.com/pkg/sftp v1.13.1/go.mod h1:3HaPG6Dq1ILlpPZRO0HVMrsydcdLt6HRDccSgb87qRg= github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM= @@ -2453,25 +1373,16 @@ github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZN github.com/polyfloyd/go-errorlint v1.4.2 h1:CU+O4181IxFDdPH6t/HT7IiDj1I7zxNi1RIUxYwn8d0= github.com/polyfloyd/go-errorlint v1.4.2/go.mod h1:k6fU/+fQe38ednoZS51T7gSIGQW1y94d6TkSr35OzH8= github.com/posener/complete v1.1.1/go.mod h1:em0nMJCgc9GFtwrmVmEMR/ZL6WyhyjMBndrE9hABlRI= -github.com/posener/complete v1.2.3/go.mod h1:WZIdtGGp+qx0sLrYKtIRAruyNpv6hFCicSgv7Sy7s/s= github.com/pquerna/cachecontrol v0.0.0-20171018203845-0dec1b30a021/go.mod h1:prYjPmNq4d1NPVmpShWobRqXY3q7Vp+80DqgxxUrUIA= github.com/prashantv/gostub v1.1.0 h1:BTyx3RfQjRHnUWaGF9oQos79AlQ5k8WNktv7VGvVH4g= -github.com/prashantv/gostub v1.1.0/go.mod h1:A5zLQHz7ieHGG7is6LLXLz7I8+3LZzsrV0P1IAHhP5U= -github.com/prometheus/alertmanager v0.24.0/go.mod h1:r6fy/D7FRuZh5YbnX6J3MBY0eI4Pb5yPYS7/bPSXXqI= -github.com/prometheus/alertmanager v0.25.0/go.mod h1:MEZ3rFVHqKZsw7IcNS/m4AWZeXThmJhumpiWR4eHU/w= github.com/prometheus/client_golang v0.0.0-20180209125602-c332b6f63c06/go.mod h1:7SWBe2y4D6OKWSNQJUaRYU/AaXPKyh/dDVn+NZz0KFw= github.com/prometheus/client_golang v0.9.1/go.mod h1:7SWBe2y4D6OKWSNQJUaRYU/AaXPKyh/dDVn+NZz0KFw= github.com/prometheus/client_golang v0.9.3/go.mod h1:/TN21ttK/J9q6uSwhBd54HahCDft0ttaMvbicHlPoso= github.com/prometheus/client_golang v1.0.0/go.mod h1:db9x61etRT2tGnBNRi70OPL5FsnadC4Ky3P0J6CfImo= github.com/prometheus/client_golang v1.1.0/go.mod h1:I1FGZT9+L76gKKOs5djB6ezCbFQP1xR9D75/vuwEF3g= -github.com/prometheus/client_golang v1.4.0/go.mod h1:e9GMxYsXl05ICDXkRhurwBS4Q3OK1iX/F2sw+iXX5zU= github.com/prometheus/client_golang v1.7.1/go.mod h1:PY5Wy2awLA44sXw4AOSfFBetzPP4j5+D6mVACh+pe2M= github.com/prometheus/client_golang v1.11.0/go.mod h1:Z6t4BnS23TR94PD6BsDNk8yVqroYurpAkEiz0P2BEV0= -github.com/prometheus/client_golang v1.11.1/go.mod h1:Z6t4BnS23TR94PD6BsDNk8yVqroYurpAkEiz0P2BEV0= github.com/prometheus/client_golang v1.12.1/go.mod h1:3Z9XVyYiZYEO+YQWt3RD2R3jrbd179Rt297l4aS6nDY= -github.com/prometheus/client_golang v1.13.0/go.mod h1:vTeo+zgvILHsnnj/39Ou/1fPN5nJFOEMgftOUOmlvYQ= -github.com/prometheus/client_golang v1.14.0/go.mod h1:8vpkKitgIVNcqrRBWh1C4TIUQgYNtG/XQE4E/Zae36Y= -github.com/prometheus/client_golang v1.15.0/go.mod h1:e9yaBhRPU2pPNsZwE+JdQl0KEt1N9XgF6zxWmaC0xOk= github.com/prometheus/client_golang v1.16.0 h1:yk/hx9hDbrGHovbci4BY+pRMfSuuat626eFsHb7tmT8= github.com/prometheus/client_golang v1.16.0/go.mod h1:Zsulrv/L9oM40tJ7T815tM89lFEugiJ9HzIqaAx4LKc= github.com/prometheus/client_model v0.0.0-20171117100541-99fa1f4be8e5/go.mod h1:MbSGuTsp3dbXC40dX6PRTWyKYBIrTGTE9sqQNg2J8bo= @@ -2479,7 +1390,6 @@ github.com/prometheus/client_model v0.0.0-20180712105110-5c3871d89910/go.mod h1: github.com/prometheus/client_model v0.0.0-20190129233127-fd36f4220a90/go.mod h1:xMI15A0UPsDsEKsMN9yxemIoYk6Tm2C1GtYGdfGttqA= github.com/prometheus/client_model v0.0.0-20190812154241-14fe0d1b01d4/go.mod h1:xMI15A0UPsDsEKsMN9yxemIoYk6Tm2C1GtYGdfGttqA= github.com/prometheus/client_model v0.2.0/go.mod h1:xMI15A0UPsDsEKsMN9yxemIoYk6Tm2C1GtYGdfGttqA= -github.com/prometheus/client_model v0.3.0/go.mod h1:LDGWKZIo7rky3hgvBe+caln+Dr3dPggB5dvjtD7w9+w= github.com/prometheus/client_model v0.4.0 h1:5lQXD3cAg1OXBf4Wq03gTrXHeaV0TQvGfUooCfx1yqY= github.com/prometheus/client_model v0.4.0/go.mod h1:oMQmHW1/JoDwqLtg57MGgP/Fb1CJEYF2imWWhWtMkYU= github.com/prometheus/common v0.0.0-20180110214958-89604d197083/go.mod h1:daVV7qP5qjZbuso7PdcryaAu0sAZbrN9i7WWcTMWvro= @@ -2487,25 +1397,12 @@ github.com/prometheus/common v0.0.0-20181113130724-41aa239b4cce/go.mod h1:daVV7q github.com/prometheus/common v0.4.0/go.mod h1:TNfzLD0ON7rHzMJeJkieUDPYmFC7Snx/y86RQel1bk4= github.com/prometheus/common v0.4.1/go.mod h1:TNfzLD0ON7rHzMJeJkieUDPYmFC7Snx/y86RQel1bk4= github.com/prometheus/common v0.6.0/go.mod h1:eBmuwkDJBwy6iBfxCBob6t6dR6ENT/y+J+Zk0j9GMYc= -github.com/prometheus/common v0.9.1/go.mod h1:yhUN8i9wzaXS3w1O07YhxHEBxD+W35wd8bs7vj7HSQ4= github.com/prometheus/common v0.10.0/go.mod h1:Tlit/dnDKsSWFlCLTWaA1cyBgKHSMdTB80sz/V91rCo= github.com/prometheus/common v0.26.0/go.mod h1:M7rCNAaPfAosfx8veZJCuw84e35h3Cfd9VFqTh1DIvc= github.com/prometheus/common v0.28.0/go.mod h1:vu+V0TpY+O6vW9J44gczi3Ap/oXXR10b+M/gUGO4Hls= -github.com/prometheus/common v0.29.0/go.mod h1:vu+V0TpY+O6vW9J44gczi3Ap/oXXR10b+M/gUGO4Hls= -github.com/prometheus/common v0.30.0/go.mod h1:vu+V0TpY+O6vW9J44gczi3Ap/oXXR10b+M/gUGO4Hls= github.com/prometheus/common v0.32.1/go.mod h1:vu+V0TpY+O6vW9J44gczi3Ap/oXXR10b+M/gUGO4Hls= -github.com/prometheus/common v0.34.0/go.mod h1:gB3sOl7P0TvJabZpLY5uQMpUqRCPPCyRLCZYc7JZTNE= -github.com/prometheus/common v0.37.0/go.mod h1:phzohg0JFMnBEFGxTDbfu3QyL5GI8gTQJFhYO5B3mfA= -github.com/prometheus/common v0.38.0/go.mod h1:MBXfmBQZrK5XpbCkjofnXs96LD2QQ7fEq4C0xjC/yec= -github.com/prometheus/common v0.41.0/go.mod h1:xBwqVerjNdUDjgODMpudtOMwlOwf2SaTr1yjz4b7Zbc= github.com/prometheus/common v0.42.0 h1:EKsfXEYo4JpWMHH5cg+KOUWeuJSov1Id8zGR8eeI1YM= github.com/prometheus/common v0.42.0/go.mod h1:xBwqVerjNdUDjgODMpudtOMwlOwf2SaTr1yjz4b7Zbc= -github.com/prometheus/common/assets v0.1.0/go.mod h1:D17UVUE12bHbim7HzwUvtqm6gwBEaDQ0F+hIGbFbccI= -github.com/prometheus/common/assets v0.2.0/go.mod h1:D17UVUE12bHbim7HzwUvtqm6gwBEaDQ0F+hIGbFbccI= -github.com/prometheus/common/sigv4 v0.1.0/go.mod h1:2Jkxxk9yYvCkE5G1sQT7GuEXm57JrvHu9k5YwTjsNtI= -github.com/prometheus/exporter-toolkit v0.7.1/go.mod h1:ZUBIj498ePooX9t/2xtDjeQYwvRpiPP2lh5u4iblj2g= -github.com/prometheus/exporter-toolkit v0.8.2/go.mod h1:00shzmJL7KxcsabLWcONwpyNEuWhREOnFqZW7vadFS0= -github.com/prometheus/exporter-toolkit v0.9.1/go.mod h1:iFlTmFISCix0vyuyBmm0UqOUCTao9+RsAsKJP3YM9ec= github.com/prometheus/procfs v0.0.0-20180125133057-cb4147076ac7/go.mod h1:c3At6R/oaqEKCNdg8wHV1ftS6bRYblBhIjjI8uT2IGk= github.com/prometheus/procfs v0.0.0-20181005140218-185b4288413d/go.mod h1:c3At6R/oaqEKCNdg8wHV1ftS6bRYblBhIjjI8uT2IGk= github.com/prometheus/procfs v0.0.0-20190507164030-5867b95ac084/go.mod h1:TjEm7ze935MbeOT/UhFTIMYKhuLP4wbCsTZCD3I8kEA= @@ -2518,12 +1415,8 @@ github.com/prometheus/procfs v0.1.3/go.mod h1:lV6e/gmhEcM9IjHGsFOCxxuZ+z1YqCvr4O github.com/prometheus/procfs v0.2.0/go.mod h1:lV6e/gmhEcM9IjHGsFOCxxuZ+z1YqCvr4OA4YeYWdaU= github.com/prometheus/procfs v0.6.0/go.mod h1:cz+aTbrPOrUb4q7XlbU9ygM+/jj0fzG6c1xBZuNvfVA= github.com/prometheus/procfs v0.7.3/go.mod h1:cz+aTbrPOrUb4q7XlbU9ygM+/jj0fzG6c1xBZuNvfVA= -github.com/prometheus/procfs v0.8.0/go.mod h1:z7EfXMXOkbkqb9IINtpCn86r/to3BnA0uaxHdg830/4= -github.com/prometheus/procfs v0.9.0/go.mod h1:+pB4zwohETzFnmlpe6yd2lSc+0/46IYZRB/chUwxUZY= github.com/prometheus/procfs v0.10.1 h1:kYK1Va/YMlutzCGazswoHKo//tZVlFpKYh+PymziUAg= github.com/prometheus/procfs v0.10.1/go.mod h1:nwNm2aOCAYw8uTR/9bWRREkZFxAUcWzPHWJq+XBB/FM= -github.com/prometheus/prometheus v0.35.0/go.mod h1:7HaLx5kEPKJ0GDgbODG0fZgXbQ8K/XjZNJXQmbmgQlY= -github.com/prometheus/prometheus v0.44.0/go.mod h1:aPsmIK3py5XammeTguyqTmuqzX/jeCdyOWWobLHNKQg= github.com/prometheus/statsd_exporter v0.21.0 h1:hA05Q5RFeIjgwKIYEdFd59xu5Wwaznf33yKI+pyX6T8= github.com/prometheus/statsd_exporter v0.21.0/go.mod h1:rbT83sZq2V+p73lHhPZfMc3MLCHmSHelCh9hSGYNLTQ= github.com/prometheus/tsdb v0.7.1/go.mod h1:qhTCs0VvXwvX/y3TZrWD7rabWM+ijKTux40TwIPHuXU= @@ -2536,11 +1429,8 @@ github.com/quasilyte/regex/syntax v0.0.0-20210819130434-b3f0c404a727/go.mod h1:r github.com/quasilyte/stdinfo v0.0.0-20220114132959-f7386bf02567 h1:M8mH9eK4OUR4lu7Gd+PU1fV2/qnDNfzT635KRSObncs= github.com/quasilyte/stdinfo v0.0.0-20220114132959-f7386bf02567/go.mod h1:DWNGW8A4Y+GyBgPuaQJuWiy0XYftx4Xm/y5Jqk9I6VQ= github.com/rabbitmq/amqp091-go v1.1.0/go.mod h1:ogQDLSOACsLPsIq0NpbtiifNZi2YOz0VTJ0kHRghqbM= -github.com/rakyll/embedmd v0.0.0-20171029212350-c8060a0752a2/go.mod h1:7jOTMgqac46PZcF54q6l2hkLEG8op93fZu61KmxWDV4= -github.com/rcrowley/go-metrics v0.0.0-20181016184325-3113b8401b8a/go.mod h1:bCqnVzQkZxMG4s8nGwiZ5l3QUCyqpo9Y+/ZMZ9VjZe4= github.com/rcrowley/go-metrics v0.0.0-20201227073835-cf1acfcdf475 h1:N/ElC8H3+5XpJzTSTfLsJV/mx9Q9g7kxmchpfZyxgzM= github.com/rcrowley/go-metrics v0.0.0-20201227073835-cf1acfcdf475/go.mod h1:bCqnVzQkZxMG4s8nGwiZ5l3QUCyqpo9Y+/ZMZ9VjZe4= -github.com/remyoudompheng/bigfft v0.0.0-20200410134404-eec4a21b6bb0/go.mod h1:qqbHyh8v60DhA7CoWK5oRCqLrMHRGoxYCSS9EjAz6Eo= github.com/rivo/uniseg v0.2.0 h1:S1pD9weZBuJdFmowNwbpi7BJ8TNftyUImj/0WQi72jY= github.com/rivo/uniseg v0.2.0/go.mod h1:J6wj4VEh+S6ZtnVlnTBMWIodfgj8LQOQFoIToxlJtxc= github.com/rogpeppe/fastuuid v0.0.0-20150106093220-6724a57986af/go.mod h1:XWv6SoW27p1b0cqNHllgS5HIMJraePCO15w5zCzIWYg= @@ -2548,19 +1438,10 @@ github.com/rogpeppe/fastuuid v1.2.0/go.mod h1:jVj6XXZzXRy/MSR5jhDC/2q6DgLz+nrA6L github.com/rogpeppe/go-internal v1.1.0/go.mod h1:M8bDsm7K2OlrFYOpmOWEs/qY81heoFRclV5y23lUDJ4= github.com/rogpeppe/go-internal v1.2.2/go.mod h1:M8bDsm7K2OlrFYOpmOWEs/qY81heoFRclV5y23lUDJ4= github.com/rogpeppe/go-internal v1.3.0/go.mod h1:M8bDsm7K2OlrFYOpmOWEs/qY81heoFRclV5y23lUDJ4= -github.com/rogpeppe/go-internal v1.6.1/go.mod h1:xXDCJY+GAPziupqXw64V24skbSoqbTEfhy4qGm1nDQc= -github.com/rogpeppe/go-internal v1.9.0/go.mod h1:WtVeX8xhTBvf0smdhujwtBcq4Qrzq/fJaraNFVN+nFs= github.com/rogpeppe/go-internal v1.10.0 h1:TMyTOH3F/DB16zRVcYyreMH6GnZZrwQVAoYjRBZyWFQ= -github.com/rogpeppe/go-internal v1.10.0/go.mod h1:UQnix2H7Ngw/k4C5ijL5+65zddjncjaFoBhdsK/akog= -github.com/rs/cors v1.8.2/go.mod h1:XyqrcTp5zjWr1wsJ8PIRZssZ8b/WMcMf71DJnit4EMU= -github.com/rs/xid v1.2.1/go.mod h1:+uKXf+4Djp6Md1KODXJxgGQPKngRmWyn10oCKFzNHOQ= -github.com/rs/zerolog v1.13.0/go.mod h1:YbFCdg8HfsridGWAh22vktObvhZbQsZXe4/zB0OKkWU= -github.com/rs/zerolog v1.15.0/go.mod h1:xYTKnLHcpfU2225ny5qZjxnj9NvkumZYjJHlAThCjNc= github.com/russross/blackfriday v1.5.2/go.mod h1:JO/DiYxRf+HjHt06OyowR9PTA263kcR/rfWxYHBV53g= github.com/russross/blackfriday/v2 v2.0.1/go.mod h1:+Rmxgy9KzJVeS9/2gXHxylqXiyQDYRxCVz55jmeOWTM= github.com/russross/blackfriday/v2 v2.1.0/go.mod h1:+Rmxgy9KzJVeS9/2gXHxylqXiyQDYRxCVz55jmeOWTM= -github.com/ruudk/golang-pdf417 v0.0.0-20181029194003-1af4ab5afa58/go.mod h1:6lfFZQK844Gfx8o5WFuvpxWRwnSoipWe/p622j1v06w= -github.com/ruudk/golang-pdf417 v0.0.0-20201230142125-a7e3863a1245/go.mod h1:pQAZKsJ8yyVxGRWYNEm9oFB8ieLgKFnamEyDmSA0BRk= github.com/ryancurrah/gomodguard v1.3.0 h1:q15RT/pd6UggBXVBuLps8BXRvl5GPBcwVA7BJHMLuTw= github.com/ryancurrah/gomodguard v1.3.0/go.mod h1:ggBxb3luypPEzqVtq33ee7YSN35V28XeGnid8dnni50= github.com/ryanrolds/sqlclosecheck v0.4.0 h1:i8SX60Rppc1wRuyQjMciLqIzV3xnoHB7/tXbr6RGYNI= @@ -2570,8 +1451,6 @@ github.com/ryanuber/columnize v2.1.0+incompatible/go.mod h1:sm1tb6uqfes/u+d4ooFo github.com/ryanuber/go-glob v1.0.0 h1:iQh3xXAumdQ+4Ufa5b25cRpC5TYKlno6hsv6Cb3pkBk= github.com/ryanuber/go-glob v1.0.0/go.mod h1:807d1WSdnB0XRJzKNil9Om6lcp/3a0v4qIHxIXzX/Yc= github.com/safchain/ethtool v0.0.0-20190326074333-42ed695e3de8/go.mod h1:Z0q5wiBQGYcxhMZ6gUqHn6pYNLypFAvaL3UvgZLR0U4= -github.com/safchain/ethtool v0.0.0-20210803160452-9aa261dae9b1/go.mod h1:Z0q5wiBQGYcxhMZ6gUqHn6pYNLypFAvaL3UvgZLR0U4= -github.com/sagikazarmark/crypt v0.6.0/go.mod h1:U8+INwJo3nBv1m6A/8OBXAq7Jnpspk5AxSgDyEQcea8= github.com/sanposhiho/wastedassign/v2 v2.0.7 h1:J+6nrY4VW+gC9xFzUc+XjPD3g3wF3je/NsJFwFK7Uxc= github.com/sanposhiho/wastedassign/v2 v2.0.7/go.mod h1:KyZ0MWTwxxBmfwn33zh3k1dmsbF2ud9pAAGfoLfjhtI= github.com/sashamelentyev/interfacebloat v1.1.0 h1:xdRdJp0irL086OyW1H/RTZTr1h/tMEOsumirXcOJqAw= @@ -2582,13 +1461,8 @@ github.com/sassoftware/relic v7.2.1+incompatible h1:Pwyh1F3I0r4clFJXkSI8bOyJINGq github.com/sassoftware/relic v7.2.1+incompatible/go.mod h1:CWfAxv73/iLZ17rbyhIEq3K9hs5w6FpNMdUT//qR+zk= github.com/sassoftware/relic/v7 v7.5.5 h1:2ZUM6ovo3STCAp0hZnO9nQY9lOB8OyfneeYIi4YUxMU= github.com/satori/go.uuid v1.2.0/go.mod h1:dA0hQrYB0VpLJoorglMZABFdXlWrHn1NEOzdhQKdks0= -github.com/scaleway/scaleway-sdk-go v1.0.0-beta.9/go.mod h1:fCa7OJZ/9DRTnOKmxvT6pn+LPWUptQAmHF/SBJUGEcg= -github.com/scaleway/scaleway-sdk-go v1.0.0-beta.15/go.mod h1:fCa7OJZ/9DRTnOKmxvT6pn+LPWUptQAmHF/SBJUGEcg= -github.com/sclevine/agouti v3.0.0+incompatible/go.mod h1:b4WX9W9L1sfQKXeJf1mUTLZKJ48R1S7H23Ji7oFO5Bw= -github.com/sclevine/spec v1.2.0/go.mod h1:W4J29eT/Kzv7/b9IWLB055Z+qvVC9vt0Arko24q7p+U= github.com/sean-/seed v0.0.0-20170313163322-e2103e2c3529/go.mod h1:DxrIzT+xaE7yg65j358z/aeFdxmN0P9QXhEzd20vsDc= github.com/seccomp/libseccomp-golang v0.9.1/go.mod h1:GbW5+tmTXfcxTToHLXlScSlAvWlF4P2Ca7zGrPiEpWo= -github.com/seccomp/libseccomp-golang v0.9.2-0.20210429002308-3879420cc921/go.mod h1:JA8cRccbGaA1s33RQf7Y1+q9gHmZX1yB/z9WDN1C6fg= github.com/secure-systems-lab/go-securesystemslib v0.6.0 h1:T65atpAVCJQK14UA57LMdZGpHi4QYSH/9FZyNGqMYIA= github.com/secure-systems-lab/go-securesystemslib v0.6.0/go.mod h1:8Mtpo9JKks/qhPG4HGZ2LGMvrPbzuxwfz/f/zLfEWkk= github.com/securego/gosec/v2 v2.16.0 h1:Pi0JKoasQQ3NnoRao/ww/N/XdynIB9NRYYZT5CyOs5U= @@ -2603,16 +1477,11 @@ github.com/shazow/go-diff v0.0.0-20160112020656-b6b7b6733b8c h1:W65qqJCIOVP4jpqP github.com/shazow/go-diff v0.0.0-20160112020656-b6b7b6733b8c/go.mod h1:/PevMnwAxekIXwN8qQyfc5gl2NlkB3CQlkizAbOkeBs= github.com/shibumi/go-pathspec v1.3.0 h1:QUyMZhFo0Md5B8zV8x2tesohbb5kfbpTi9rBnKh5dkI= github.com/shibumi/go-pathspec v1.3.0/go.mod h1:Xutfslp817l2I1cZvgcfeMQJG5QnU2lh5tVaaMCl3jE= -github.com/shoenig/test v0.6.3/go.mod h1:byHiCGXqrVaflBLAMq/srcZIHynQPQgeyvkvXnjqq0k= -github.com/shopspring/decimal v0.0.0-20180709203117-cd690d0c9e24/go.mod h1:M+9NzErvs504Cn4c5DxATwIqPbtswREoFCre64PpcG4= -github.com/shopspring/decimal v1.2.0/go.mod h1:DKyhrW/HYNuLGql+MJL6WCR6knT2jwCFRcu2hWCYk4o= github.com/shurcooL/githubv4 v0.0.0-20190718010115-4ba037080260 h1:xKXiRdBUtMVp64NaxACcyX4kvfmHJ9KrLU+JvyB1mdM= github.com/shurcooL/go v0.0.0-20180423040247-9e1955d9fb6e/go.mod h1:TDJrrUr11Vxrven61rcy3hJMUqaf/CLWYhHNPmT14Lk= github.com/shurcooL/go-goon v0.0.0-20170922171312-37c2f522c041/go.mod h1:N5mDOmsrJOB+vfqUK+7DmDyjhSLIIBnXo9lvZJj3MWQ= github.com/shurcooL/graphql v0.0.0-20181231061246-d48a9a75455f h1:tygelZueB1EtXkPI6mQ4o9DQ0+FKW41hTbunoXZCTqk= -github.com/shurcooL/httpfs v0.0.0-20190707220628-8d4bc4ba7749/go.mod h1:ZY1cvUeJuFPAdZ/B6v7RHavJWZn2YPVFQ1OSXhCGOkg= github.com/shurcooL/sanitized_anchor_name v1.0.0/go.mod h1:1NzhyTcUVG4SuEtjjoZeVRXNmyL/1OwPU0+IJeTBvfc= -github.com/shurcooL/vfsgen v0.0.0-20200824052919-0d455de96546/go.mod h1:TrYk7fJVaAttu97ZZKrO9UbRa8izdowaMIZcxYMbVaw= github.com/sigstore/cosign/v2 v2.1.1 h1:HOI6pWaEie0wLituDWWaqC5U9MaXablKNf6QroVhj6k= github.com/sigstore/cosign/v2 v2.1.1/go.mod h1:S9KGmdQ/Dd29TdgUwGCNeXR7scJWZwREh4A9Za2PRPY= github.com/sigstore/fulcio v1.3.1 h1:0ntW9VbQbt2JytoSs8BOGB84A65eeyvGSavWteYp29Y= @@ -2658,31 +1527,24 @@ github.com/smartystreets/assertions v1.1.0/go.mod h1:tcbTF8ujkAEcZ8TElKY+i30BzYl github.com/smartystreets/goconvey v0.0.0-20190330032615-68dc04aab96a/go.mod h1:syvi0/a8iFYH4r/RixwvyeAJjdLS9QV7WQ/tjFTllLA= github.com/smartystreets/goconvey v1.6.4/go.mod h1:syvi0/a8iFYH4r/RixwvyeAJjdLS9QV7WQ/tjFTllLA= github.com/soheilhy/cmux v0.1.4/go.mod h1:IM3LyeVVIOuxMH7sFAkER9+bJ4dT7Ms6E4xg4kGIyLM= -github.com/soheilhy/cmux v0.1.5/go.mod h1:T7TcVDs9LWfQgPlPsdngu6I6QIoyIFZDDC6sNE1GqG0= github.com/sonatard/noctx v0.0.2 h1:L7Dz4De2zDQhW8S0t+KUjY0MAQJd6SgVwhzNIc4ok00= github.com/sonatard/noctx v0.0.2/go.mod h1:kzFz+CzWSjQ2OzIm46uJZoXuBpa2+0y3T36U18dWqIo= -github.com/sony/gobreaker v0.4.1/go.mod h1:ZKptC7FHNvhBz7dN2LGjPVBz2sZJmc0/PkyDJOjmxWY= github.com/sourcegraph/go-diff v0.7.0 h1:9uLlrd5T46OXs5qpp8L/MTltk0zikUGi0sNNyCpA8G0= github.com/sourcegraph/go-diff v0.7.0/go.mod h1:iBszgVvyxdc8SFZ7gm69go2KDdt3ag071iBaWPF6cjs= github.com/spaolacci/murmur3 v0.0.0-20180118202830-f09979ecbc72/go.mod h1:JwIasOWyU6f++ZhiEuf87xNszmSA2myDM2Kzu9HwQUA= github.com/spf13/afero v1.1.2/go.mod h1:j4pytiNVoe2o6bmDsKpLACNPDBIoEAkihy7loJ1B0CQ= github.com/spf13/afero v1.2.2/go.mod h1:9ZxEEn6pIJ8Rxe320qSDBk6AsU0r9pR7Q4OcevTdifk= -github.com/spf13/afero v1.3.3/go.mod h1:5KUK8ByomD5Ti5Artl0RtHeI5pTF7MIDuXL3yY520V4= github.com/spf13/afero v1.6.0/go.mod h1:Ai8FlHk4v/PARR026UzYexafAt9roJ7LcLMAmO6Z93I= -github.com/spf13/afero v1.8.2/go.mod h1:CtAatgMJh6bJEIs48Ay/FOnkljP3WeGUG0MC1RfAqwo= -github.com/spf13/afero v1.9.2/go.mod h1:iUV7ddyEEZPO5gA3zD4fJt6iStLlL+Lg4m2cihcDf8Y= github.com/spf13/afero v1.9.5 h1:stMpOSZFs//0Lv29HduCmli3GUfpFoF3Y1Q/aXj/wVM= github.com/spf13/afero v1.9.5/go.mod h1:UBogFpq8E9Hx+xc5CNTTEpTnuHVmXDwZcZcE1eb/UhQ= github.com/spf13/cast v1.3.0/go.mod h1:Qx5cxh0v+4UWYiBimWS+eyWzqEqokIECu5etghLkUJE= github.com/spf13/cast v1.3.1/go.mod h1:Qx5cxh0v+4UWYiBimWS+eyWzqEqokIECu5etghLkUJE= -github.com/spf13/cast v1.5.0/go.mod h1:SpXXQ5YoyJw6s3/6cMTQuxvgRl3PCJiyaX9p6b155UU= github.com/spf13/cast v1.5.1 h1:R+kOtfhWQE6TVQzY+4D7wJLBgkdVasCEFxSUBYBYIlA= github.com/spf13/cast v1.5.1/go.mod h1:b9PdjNptOpzXr7Rq1q9gJML/2cdGQAo69NKzQ10KN48= github.com/spf13/cobra v0.0.2-0.20171109065643-2da4a54c5cee/go.mod h1:1l0Ry5zgKvJasoi3XT1TypsSe7PqH0Sj9dhYf7v3XqQ= github.com/spf13/cobra v0.0.3/go.mod h1:1l0Ry5zgKvJasoi3XT1TypsSe7PqH0Sj9dhYf7v3XqQ= github.com/spf13/cobra v0.0.5/go.mod h1:3K3wKZymM7VvHMDS9+Akkh4K60UwM26emMESw8tLCHU= github.com/spf13/cobra v1.0.0/go.mod h1:/6GTrnGXV9HjY+aR4k0oJ5tcvakLuG6EuKReYlHNrgE= -github.com/spf13/cobra v1.1.3/go.mod h1:pGADOWyqRD/YMrPZigI/zbliZ2wVD/23d+is3pSWzOo= github.com/spf13/cobra v1.2.1/go.mod h1:ExllRjgxM/piMAM+3tAZvg8fsklGAf3tPfi+i8t68Nk= github.com/spf13/cobra v1.6.0/go.mod h1:IOw/AERYS7UzyrGinqmz6HLUo219MORXGxhbaJUqzrY= github.com/spf13/cobra v1.7.0 h1:hyqWnYt1ZQShIddO5kBpj3vu05/++x6tJ6dg8EC572I= @@ -2698,9 +1560,7 @@ github.com/spf13/pflag v1.0.5 h1:iy+VFUOCP1a+8yFto/drg2CJ5u0yRoB7fZw3DKv/JXA= github.com/spf13/pflag v1.0.5/go.mod h1:McXfInJRrz4CZXVZOBLb0bTZqETkiAhM9Iw0y3An2Bg= github.com/spf13/viper v1.3.2/go.mod h1:ZiWeW+zYFKm7srdB9IoDzzZXaJaI5eL9QjNiN/DMA2s= github.com/spf13/viper v1.4.0/go.mod h1:PTJ7Z/lr49W6bUbkmS1V3by4uWynFiR9p7+dSq/yZzE= -github.com/spf13/viper v1.7.0/go.mod h1:8WkrPz2fc9jxqZNCJI/76HCieCp4Q8HaLFoCha5qpdg= github.com/spf13/viper v1.8.1/go.mod h1:o0Pch8wJ9BVSWGQMbra6iw0oQ5oktSIBaujf1rJH9Ns= -github.com/spf13/viper v1.13.0/go.mod h1:Icm2xNL3/8uyh/wFuB1jI7TiTNKp8632Nwegu+zgdYw= github.com/spf13/viper v1.16.0 h1:rGGH0XDZhdUOryiDWjmIvUSWpbNqisK8Wk0Vyefw8hc= github.com/spf13/viper v1.16.0/go.mod h1:yg78JgCJcbrQOvV9YLXgkLaZqUidkY9K+Dd1FofRzQg= github.com/spiffe/go-spiffe/v2 v2.1.6 h1:4SdizuQieFyL9eNU+SPiCArH4kynzaKOOj0VvM8R7Xo= @@ -2714,9 +1574,6 @@ github.com/stbenjam/no-sprintf-host-port v0.1.1 h1:tYugd/yrm1O0dV+ThCbaKZh195Dfm github.com/stbenjam/no-sprintf-host-port v0.1.1/go.mod h1:TLhvtIvONRzdmkFiio4O8LHsN9N74I+PhRquPsxpL0I= github.com/stefanberger/go-pkcs11uri v0.0.0-20201008174630-78d3cae3a980/go.mod h1:AO3tvPzVZ/ayst6UlUKUv6rcPQInYe3IknH3jYhAKu8= github.com/stoewer/go-strcase v1.2.0/go.mod h1:IBiWB2sKIp3wVVQ3Y035++gc+knqhUQag1KpM8ahLw8= -github.com/streadway/amqp v0.0.0-20190404075320-75d898a42a94/go.mod h1:AZpEONHx3DKn8O/DFsRAY58/XVQiIPMTMB1SddzLXVw= -github.com/streadway/amqp v1.0.0/go.mod h1:AZpEONHx3DKn8O/DFsRAY58/XVQiIPMTMB1SddzLXVw= -github.com/streadway/handy v0.0.0-20200128134331-0f66f006fb2e/go.mod h1:qNTQ5P5JnDBl6z3cMAg/SywNDC5ABu5ApDIw6lUbRmI= github.com/stretchr/objx v0.0.0-20180129172003-8a3f7159479f/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME= github.com/stretchr/objx v0.1.0/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME= github.com/stretchr/objx v0.1.1/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME= @@ -2734,7 +1591,6 @@ github.com/stretchr/testify v1.6.1/go.mod h1:6Fq8oRcR53rry900zMqJjRRixrwX3KX962/ github.com/stretchr/testify v1.7.0/go.mod h1:6Fq8oRcR53rry900zMqJjRRixrwX3KX962/h/Wwjteg= github.com/stretchr/testify v1.7.1/go.mod h1:6Fq8oRcR53rry900zMqJjRRixrwX3KX962/h/Wwjteg= github.com/stretchr/testify v1.7.2/go.mod h1:R6va5+xMeoiuVRoj+gSkQ7d3FALtqAAGI1FQKckRals= -github.com/stretchr/testify v1.7.5/go.mod h1:yNjHg4UonilssWZ8iaSj1OCr/vHnekPRkoO+kdMU+MU= github.com/stretchr/testify v1.8.0/go.mod h1:yNjHg4UonilssWZ8iaSj1OCr/vHnekPRkoO+kdMU+MU= github.com/stretchr/testify v1.8.1/go.mod h1:w2LPCIKwWwSfY2zedu0+kehJoqGctiVI29o6fzry7u4= github.com/stretchr/testify v1.8.2/go.mod h1:w2LPCIKwWwSfY2zedu0+kehJoqGctiVI29o6fzry7u4= @@ -2742,7 +1598,6 @@ github.com/stretchr/testify v1.8.3/go.mod h1:sz/lmYIOXD/1dqDmKjjqLyZ2RngseejIcXl github.com/stretchr/testify v1.8.4 h1:CcVxjf3Q8PM0mHUKJCdn+eZZtm5yQwehR5yeSVQQcUk= github.com/stretchr/testify v1.8.4/go.mod h1:sz/lmYIOXD/1dqDmKjjqLyZ2RngseejIcXlSw2iwfAo= github.com/subosito/gotenv v1.2.0/go.mod h1:N0PQaV/YGNqwC0u51sEeR/aUtSLEXKX9iv69rRypqCw= -github.com/subosito/gotenv v1.4.1/go.mod h1:ayKnFf/c6rvx/2iiLrJUk1e6plDbT3edrFNGqEflhK0= github.com/subosito/gotenv v1.4.2 h1:X1TuBLAMDFbaTAChgCBLu3DU3UPyELpnF2jjJ2cz/S8= github.com/subosito/gotenv v1.4.2/go.mod h1:ayKnFf/c6rvx/2iiLrJUk1e6plDbT3edrFNGqEflhK0= github.com/syndtr/gocapability v0.0.0-20170704070218-db04d3cc01c8/go.mod h1:hkRG7XYTFWNJGYcbNJQlaLq0fg1yr4J4t/NcTQtrfww= @@ -2755,7 +1610,6 @@ github.com/t-yuki/gocover-cobertura v0.0.0-20180217150009-aaee18c8195c/go.mod h1 github.com/tchap/go-patricia v2.2.6+incompatible/go.mod h1:bmLyhP68RS6kStMGxByiQ23RP/odRBOTVjwp2cDyi6I= github.com/tdakkota/asciicheck v0.2.0 h1:o8jvnUANo0qXtnslk2d3nMKTFNlOnJjRrNcj0j9qkHM= github.com/tdakkota/asciicheck v0.2.0/go.mod h1:Qb7Y9EgjCLJGup51gDHFzbI08/gbGhL/UVhYIPWG2rg= -github.com/tedsuo/ifrit v0.0.0-20180802180643-bea94bb476cc/go.mod h1:eyZnKCc955uh98WQvzOm0dgAeLnf2O0Rz0LPoC5ze+0= github.com/tektoncd/pipeline v0.50.0 h1:bH04XChFOYCwr7Gm6f2NiDkieHUiGohKCGsLe0fxYf0= github.com/tektoncd/pipeline v0.50.0/go.mod h1:OjhCfhPQbVvK6GUmIseL2ipjaQ8ILcUerMk4P4sCcHA= github.com/tektoncd/plumbing v0.0.0-20221102182345-5dbcfda657d7 h1:YsjQ83UBIIq4k/s2PzQ6pqe4tpPtm1hia3oyNBDDrDU= @@ -2771,7 +1625,6 @@ github.com/thales-e-security/pool v0.0.2/go.mod h1:qtpMm2+thHtqhLzTwgDBj/OuNnMpu github.com/theupdateframework/go-tuf v0.5.2 h1:habfDzTmpbzBLIFGWa2ZpVhYvFBoK0C1onC3a4zuPRA= github.com/theupdateframework/go-tuf v0.5.2/go.mod h1:SyMV5kg5n4uEclsyxXJZI2UxPFJNDc4Y+r7wv+MlvTA= github.com/tidwall/pretty v1.0.0/go.mod h1:XNkn88O1ChpSDQmQeStsy+sBenx6DDtFZJxhVysOjyk= -github.com/tidwall/pretty v1.2.0 h1:RWIZEg2iJ8/g6fDDYzMpobmaoGh5OLl4AXtGUGPcqCs= github.com/timakin/bodyclose v0.0.0-20230421092635-574207250966 h1:quvGphlmUVU+nhpFa4gg4yJyTRJ13reZMDHrKwYw53M= github.com/timakin/bodyclose v0.0.0-20230421092635-574207250966/go.mod h1:27bSVNWSBOHm+qRp1T9qzaIpsWEP6TbUnei/43HK+PQ= github.com/timonwong/loggercheck v0.9.4 h1:HKKhqrjcVj8sxL7K77beXh0adEm6DLjV/QOGeMXEVi4= @@ -2782,19 +1635,14 @@ github.com/tjfoc/gmsm v1.3.2 h1:7JVkAn5bvUJ7HtU08iW6UiD+UTmJTIToHCfeFzkcCxM= github.com/tjfoc/gmsm v1.3.2/go.mod h1:HaUcFuY0auTiaHB9MHFGCPx5IaLhTUd2atbCFBQXn9w= github.com/tmc/grpc-websocket-proxy v0.0.0-20170815181823-89b8d40f7ca8/go.mod h1:ncp9v5uamzpCO7NfCPTXjqaC+bZgJeR0sMTm6dMHP7U= github.com/tmc/grpc-websocket-proxy v0.0.0-20190109142713-0ad062ec5ee5/go.mod h1:ncp9v5uamzpCO7NfCPTXjqaC+bZgJeR0sMTm6dMHP7U= -github.com/tmc/grpc-websocket-proxy v0.0.0-20201229170055-e5319fda7802/go.mod h1:ncp9v5uamzpCO7NfCPTXjqaC+bZgJeR0sMTm6dMHP7U= github.com/tomarrell/wrapcheck/v2 v2.8.1 h1:HxSqDSN0sAt0yJYsrcYVoEeyM4aI9yAm3KQpIXDJRhQ= github.com/tomarrell/wrapcheck/v2 v2.8.1/go.mod h1:/n2Q3NZ4XFT50ho6Hbxg+RV1uyo2Uow/Vdm9NQcl5SE= github.com/tommy-muehle/go-mnd/v2 v2.5.1 h1:NowYhSdyE/1zwK9QCLeRb6USWdoif80Ie+v+yU8u1Zw= github.com/tommy-muehle/go-mnd/v2 v2.5.1/go.mod h1:WsUAkMJMYww6l/ufffCD3m+P7LEvr8TnZn9lwVDlgzw= github.com/transparency-dev/merkle v0.0.2 h1:Q9nBoQcZcgPamMkGn7ghV8XiTZ/kRxn1yCG81+twTK4= github.com/transparency-dev/merkle v0.0.2/go.mod h1:pqSy+OXefQ1EDUVmAJ8MUhHB9TXGuzVAT58PqBoHz1A= -github.com/tv42/httpunix v0.0.0-20150427012821-b75d8614f926/go.mod h1:9ESjWnEqriFuLhtthL60Sar/7RFoluCcXsuvEwTV5KM= -github.com/tv42/httpunix v0.0.0-20191220191345-2ba4b9c3382c/go.mod h1:hzIxponao9Kjc7aWznkXaL4U4TWaDSs8zcsY4Ka08nM= github.com/ugorji/go v1.1.4/go.mod h1:uQMGLiO92mf5W77hV/PUCpI3pbzQx3CRekS0kk+RGrc= -github.com/ugorji/go v1.1.7/go.mod h1:kZn38zHttfInRq0xu/PH0az30d+z6vm202qpg1oXVMw= github.com/ugorji/go/codec v0.0.0-20181204163529-d75b2dcb6bc8/go.mod h1:VFNgLljTbGfSG7qAOspJ7OScBnGdDN/yBr0sguwnwf0= -github.com/ugorji/go/codec v1.1.7/go.mod h1:Ax+UKWsSmolVDwsd+7N3ZtXu+yMGCf907BLYF3GoBXY= github.com/ultraware/funlen v0.0.3 h1:5ylVWm8wsNwH5aWo9438pwvsK0QiqVuUrt9bn7S/iLA= github.com/ultraware/funlen v0.0.3/go.mod h1:Dp4UiAus7Wdb9KUZsYWZEWiRzGuM2kXM1lPbfaF6xhA= github.com/ultraware/whitespace v0.0.5 h1:hh+/cpIcopyMYbZNVov9iSxvJU3OYQg78Sfaqzi/CzI= @@ -2813,14 +1661,11 @@ github.com/vbatts/tar-split v0.11.3/go.mod h1:9QlHN18E+fEH7RdG+QAJJcuya3rqT7eXST github.com/vishvananda/netlink v0.0.0-20181108222139-023a6dafdcdf/go.mod h1:+SR5DhBJrl6ZM7CoCKvpw5BKroDKQ+PJqOg65H/2ktk= github.com/vishvananda/netlink v1.1.0/go.mod h1:cTgwzPIzzgDAYoQrMm0EdrjRUBkTqKYppBueQtXaqoE= github.com/vishvananda/netlink v1.1.1-0.20201029203352-d40f9887b852/go.mod h1:twkDnbuQxJYemMlGd4JFIcuhgX83tXhKS2B/PRMpOho= -github.com/vishvananda/netlink v1.1.1-0.20210330154013-f5de75959ad5/go.mod h1:twkDnbuQxJYemMlGd4JFIcuhgX83tXhKS2B/PRMpOho= github.com/vishvananda/netns v0.0.0-20180720170159-13995c7128cc/go.mod h1:ZjcWmFBXmLKZu9Nxj3WKYEafiSqer2rnvPr0en9UNpI= github.com/vishvananda/netns v0.0.0-20191106174202-0a2b9b5464df/go.mod h1:JP3t17pCcGlemwknint6hfoeCVQrEMVwxRLRjXpq+BU= github.com/vishvananda/netns v0.0.0-20200728191858-db3c7e526aae/go.mod h1:DD4vA1DwXk04H54A1oHXtwZmA0grkVMdPxx/VGLCah0= -github.com/vishvananda/netns v0.0.0-20210104183010-2eb08e3e575f/go.mod h1:DD4vA1DwXk04H54A1oHXtwZmA0grkVMdPxx/VGLCah0= github.com/vmihailenco/msgpack/v5 v5.3.5 h1:5gO0H1iULLWGhs2H5tbAHIZTV8/cYafcFOr9znI5mJU= github.com/vmihailenco/tagparser/v2 v2.0.0 h1:y09buUbR+b5aycVFQs/g70pqKVZNBmxwAhO7/IwNM9g= -github.com/vultr/govultr/v2 v2.17.2/go.mod h1:ZFOKGWmgjytfyjeyAdhQlSWwTjh2ig+X49cAp50dzXI= github.com/willf/bitset v1.1.11-0.20200630133818-d5bec3311243/go.mod h1:RjeCKbqT1RxIR/KWY6phxZiaY1IyutSBfGjNPySAYV4= github.com/willf/bitset v1.1.11/go.mod h1:83CECat5yLh5zVOf4P1ErAgKA5UDvKtgyUABdr3+MjI= github.com/xanzy/go-gitlab v0.86.0 h1:jR8V9cK9jXRQDb46KOB20NCF3ksY09luaG0IfXE6p7w= @@ -2844,10 +1689,7 @@ github.com/xeipuuv/gojsonschema v0.0.0-20180618132009-1d523034197f/go.mod h1:5yf github.com/xeipuuv/gojsonschema v1.2.0/go.mod h1:anYRn/JVcOK2ZgGU+IjEV4nwlhoK5sQluxsYJ78Id3Y= github.com/xen0n/gosmopolitan v1.2.1 h1:3pttnTuFumELBRSh+KQs1zcz4fN6Zy7aB0xlnQSn1Iw= github.com/xen0n/gosmopolitan v1.2.1/go.mod h1:JsHq/Brs1o050OOdmzHeOr0N7OtlnKRAGAsElF8xBQA= -github.com/xhit/go-str2duration v1.2.0/go.mod h1:3cPSlfZlUHVlneIVfePFWcJZsuwf+P1v2SRTV4cUmp4= -github.com/xhit/go-str2duration/v2 v2.1.0/go.mod h1:ohY8p+0f07DiV6Em5LKB0s2YpLtXVyJfNt1+BlmyAsU= github.com/xiang90/probing v0.0.0-20190116061207-43a291ad63a2/go.mod h1:UETIi67q53MR2AWcXfiuqkDkRtnGDLqkBTpCHuJHxtU= -github.com/xlab/treeprint v1.1.0/go.mod h1:gj5Gd3gPdKtR1ikdDK6fnFLdmIS0X30kTTuNd/WEJu0= github.com/xordataexchange/crypt v0.0.3-0.20170626215501-b2862e3d0a77/go.mod h1:aYKd//L2LvnjZzWKhF00oedf4jCCReLcmhLdhm1A27Q= github.com/yagipy/maintidx v1.0.0 h1:h5NvIsCz+nRDapQ0exNv4aJ0yXSI0420omVANTv3GJM= github.com/yagipy/maintidx v1.0.0/go.mod h1:0qNf/I/CCZXSMhsRsrEPDZ+DkekpKLXAJfsTACwgXLk= @@ -2875,40 +1717,24 @@ github.com/yvasiyarov/go-metrics v0.0.0-20140926110328-57bccd1ccd43/go.mod h1:aX github.com/yvasiyarov/gorelic v0.0.0-20141212073537-a9bba5b9ab50/go.mod h1:NUSPSUX/bi6SeDMUh6brw0nXpxHnc96TguQh0+r/ssA= github.com/yvasiyarov/newrelic_platform_go v0.0.0-20140908184405-b21fdbd4370f/go.mod h1:GlGEuHIJweS1mbCqG+7vt2nvWLzLLnRHbXz5JKd/Qbg= github.com/zalando/go-keyring v0.2.2 h1:f0xmpYiSrHtSNAVgwip93Cg8tuF45HJM6rHq/A5RI/4= -github.com/zeebo/assert v1.3.0/go.mod h1:Pq9JiuJQpG8JLJdtkwrJESF0Foym2/D9XMU5ciN/wJ0= github.com/zeebo/errs v1.3.0 h1:hmiaKqgYZzcVgRL1Vkc1Mn2914BbzB0IBxs+ebeutGs= github.com/zeebo/errs v1.3.0/go.mod h1:sgbWHsvVuTPHcqJJGQ1WhI5KbWlHYz+2+2C/LSEtCw4= -github.com/zeebo/xxh3 v1.0.2/go.mod h1:5NWz9Sef7zIDm2JHfFlcQvNekmcEl9ekUZQQKCYaDcA= -github.com/zenazn/goji v0.9.0/go.mod h1:7S9M489iMyHBNxwZnk9/EHS098H4/F6TATF2mIxtB1Q= gitlab.com/bosi/decorder v0.2.3 h1:gX4/RgK16ijY8V+BRQHAySfQAb354T7/xQpDB2n10P0= gitlab.com/bosi/decorder v0.2.3/go.mod h1:9K1RB5+VPNQYtXtTDAzd2OEftsZb1oV0IrJrzChSdGE= go-simpler.org/assert v0.5.0 h1:+5L/lajuQtzmbtEfh69sr5cRf2/xZzyJhFjoOz/PPqs= go.etcd.io/bbolt v1.3.2/go.mod h1:IbVyRI1SCnLcuJnV2u8VeU0CEYM7e686BmAb1XKL+uU= go.etcd.io/bbolt v1.3.3/go.mod h1:IbVyRI1SCnLcuJnV2u8VeU0CEYM7e686BmAb1XKL+uU= go.etcd.io/bbolt v1.3.5/go.mod h1:G5EMThwa9y8QZGBClrRx5EY+Yw9kAhnjy3bSjsnlVTQ= -go.etcd.io/bbolt v1.3.6/go.mod h1:qXsaaIqmgQH0T+OPdb99Bf+PKfBBQVAdyD6TY9G8XM4= go.etcd.io/etcd v0.5.0-alpha.5.0.20200910180754-dd1b699fc489/go.mod h1:yVHk9ub3CSBatqGNg7GRmsnfLWtoW60w4eDYfh7vHDg= go.etcd.io/etcd/api/v3 v3.5.0/go.mod h1:cbVKeC6lCfl7j/8jBhAK6aIYO9XOjdptoxU/nLQcPvs= -go.etcd.io/etcd/api/v3 v3.5.4/go.mod h1:5GB2vv4A4AOn3yk7MftYGHkUfGtDHnEraIjym4dYz5A= go.etcd.io/etcd/client/pkg/v3 v3.5.0/go.mod h1:IJHfcCEKxYu1Os13ZdwCwIUTUVGYTSAM3YSwc9/Ac1g= -go.etcd.io/etcd/client/pkg/v3 v3.5.4/go.mod h1:IJHfcCEKxYu1Os13ZdwCwIUTUVGYTSAM3YSwc9/Ac1g= go.etcd.io/etcd/client/v2 v2.305.0/go.mod h1:h9puh54ZTgAKtEbut2oe9P4L/oqKCVB6xsXlzd7alYQ= -go.etcd.io/etcd/client/v2 v2.305.4/go.mod h1:Ud+VUwIi9/uQHOMA+4ekToJ12lTxlv0zB/+DHwTGEbU= -go.etcd.io/etcd/client/v3 v3.5.0/go.mod h1:AIKXXVX/DQXtfTEqBryiLTUXwON+GuvO6Z7lLS/oTh0= -go.etcd.io/etcd/client/v3 v3.5.4/go.mod h1:ZaRkVgBZC+L+dLCjTcF1hRXpgZXQPOvnA/Ak/gq3kiY= -go.etcd.io/etcd/pkg/v3 v3.5.0/go.mod h1:UzJGatBQ1lXChBkQF0AuAtkRQMYnHubxAEYIrC3MSsE= -go.etcd.io/etcd/raft/v3 v3.5.0/go.mod h1:UFOHSIvO/nKwd4lhkwabrTD3cqW5yVyYYf/KlD00Szc= -go.etcd.io/etcd/server/v3 v3.5.0/go.mod h1:3Ah5ruV+M+7RZr0+Y/5mNLwC+eQlni+mQmOVdCRJoS4= go.mongodb.org/mongo-driver v1.7.3/go.mod h1:NqaYOwnXWr5Pm7AOpO5QFxKJ503nbMse/R79oO62zWg= go.mongodb.org/mongo-driver v1.7.5/go.mod h1:VXEWRZ6URJIkUq2SCAyapmhH0ZLRBP+FT4xhp5Zvxng= -go.mongodb.org/mongo-driver v1.8.3/go.mod h1:0sQWfOeY63QTntERDJJ/0SuKK0T1uVSgKCuAROlKEPY= go.mongodb.org/mongo-driver v1.10.0/go.mod h1:wsihk0Kdgv8Kqu1Anit4sfK+22vSFbUrAVEYRhCXrA8= -go.mongodb.org/mongo-driver v1.11.0/go.mod h1:s7p5vEtfbeR1gYi6pnj3c3/urpbLv2T5Sfd6Rp2HBB8= -go.mongodb.org/mongo-driver v1.11.3/go.mod h1:PTSz5yu21bkT/wXpkS7WR5f0ddqw5quethTUn9WM+2g= -go.mongodb.org/mongo-driver v1.11.7 h1:LIwYxASDLGUg/8wOhgOOZhX8tQa/9tgZPgzZoVqJvcs= -go.mongodb.org/mongo-driver v1.11.7/go.mod h1:G9TgswdsWjX4tmDA5zfs2+6AEPpYJwqblyjsfuh8oXY= +go.mongodb.org/mongo-driver v1.12.0 h1:aPx33jmn/rQuJXPQLZQ8NtfPQG8CaqgLThFtqRb0PiE= +go.mongodb.org/mongo-driver v1.12.0/go.mod h1:AZkxhPnFJUoH7kZlFkVKucV20K387miPfm7oimrSmK0= go.mozilla.org/pkcs7 v0.0.0-20200128120323-432b2356ecb1/go.mod h1:SNgMg+EgDFwmvSmLRTNKC5fegJjB7v23qTQ0XLGUNHk= -go.opencensus.io v0.15.0/go.mod h1:UffZAU+4sDEINUGP/B7UfBBkq4fqLu9zXAX7ke6CHW0= go.opencensus.io v0.21.0/go.mod h1:mSImk1erAIZhrmZN+AvHh14ztQfjbGwt4TtuofqLduU= go.opencensus.io v0.22.0/go.mod h1:+kGneAE2xo2IficOXnaByMWTGM9T73dGwxeWcUqIpI8= go.opencensus.io v0.22.2/go.mod h1:yxeiOL68Rb0Xd1ddK5vPZ/oVn4vY4Ynel7k9FzqtOIw= @@ -2918,102 +1744,38 @@ go.opencensus.io v0.22.5/go.mod h1:5pWMHQbX5EPX2/62yrJeAkowc+lfs/XD7Uxpq3pI6kk= go.opencensus.io v0.23.0/go.mod h1:XItmlyltB5F7CS4xOC1DcqMoFqwtC6OG2xF7mCv7P7E= go.opencensus.io v0.24.0 h1:y73uSU6J157QMP2kn2r30vwW1A2W2WFwSCGnAVxeaD0= go.opencensus.io v0.24.0/go.mod h1:vNK8G9p7aAivkbmorf4v+7Hgx+Zs0yY+0fOtgBfjQKo= -go.opentelemetry.io/contrib v0.20.0/go.mod h1:G/EtFaa6qaN7+LxqfIAT3GiZa7Wv5DTBUzl5H4LY0Kc= -go.opentelemetry.io/contrib/instrumentation/google.golang.org/grpc/otelgrpc v0.20.0/go.mod h1:oVGt1LRbBOBq1A5BQLlUg9UaU/54aiHw8cgjV3aWZ/E= -go.opentelemetry.io/contrib/instrumentation/google.golang.org/grpc/otelgrpc v0.28.0/go.mod h1:vEhqr0m4eTc+DWxfsXoXue2GBgV2uUwVznkGIHW/e5w= -go.opentelemetry.io/contrib/instrumentation/net/http/otelhttp v0.20.0/go.mod h1:2AboqHi0CiIZU0qwhtUfCYD1GeUzvvIXWNkhDt7ZMG4= -go.opentelemetry.io/contrib/instrumentation/net/http/otelhttp v0.31.0/go.mod h1:PFmBsWbldL1kiWZk9+0LBZz2brhByaGsvp6pRICMlPE= -go.opentelemetry.io/contrib/instrumentation/net/http/otelhttp v0.40.0/go.mod h1:pcQ3MM3SWvrA71U4GDqv9UFDJ3HQsW7y5ZO3tDTlUdI= -go.opentelemetry.io/otel v0.20.0/go.mod h1:Y3ugLH2oa81t5QO+Lty+zXf8zC9L26ax4Nzoxm/dooo= -go.opentelemetry.io/otel v1.3.0/go.mod h1:PWIKzi6JCp7sM0k9yZ43VX+T345uNbAkDKwHVjb2PTs= -go.opentelemetry.io/otel v1.6.0/go.mod h1:bfJD2DZVw0LBxghOTlgnlI0CV3hLDu9XF/QKOUXMTQQ= -go.opentelemetry.io/otel v1.6.1/go.mod h1:blzUabWHkX6LJewxvadmzafgh/wnvBSDBdOuwkAtrWQ= -go.opentelemetry.io/otel v1.11.1/go.mod h1:1nNhXBbWSD0nsL38H6btgnFN2k4i0sNLHNNMZMSbUGE= -go.opentelemetry.io/otel v1.14.0/go.mod h1:o4buv+dJzx8rohcUeRmWUZhqupFvzWis188WlggnNeU= go.opentelemetry.io/otel v1.16.0 h1:Z7GVAX/UkAXPKsy94IU+i6thsQS4nb7LviLpnaNeW8s= go.opentelemetry.io/otel v1.16.0/go.mod h1:vl0h9NUa1D5s1nv3A5vZOYWn8av4K8Ml6JDeHrT/bx4= -go.opentelemetry.io/otel/exporters/otlp v0.20.0/go.mod h1:YIieizyaN77rtLJra0buKiNBOm9XQfkPEKBeuhoMwAM= -go.opentelemetry.io/otel/exporters/otlp/internal/retry v1.3.0/go.mod h1:VpP4/RMn8bv8gNo9uK7/IMY4mtWLELsS+JIP0inH0h4= -go.opentelemetry.io/otel/exporters/otlp/internal/retry v1.6.1/go.mod h1:NEu79Xo32iVb+0gVNV8PMd7GoWqnyDXRlj04yFjqz40= -go.opentelemetry.io/otel/exporters/otlp/internal/retry v1.14.0/go.mod h1:UFG7EBMRdXyFstOwH028U0sVf+AvukSGhF0g8+dmNG8= -go.opentelemetry.io/otel/exporters/otlp/otlptrace v1.3.0/go.mod h1:hO1KLR7jcKaDDKDkvI9dP/FIhpmna5lkqPUQdEjFAM8= -go.opentelemetry.io/otel/exporters/otlp/otlptrace v1.6.1/go.mod h1:YJ/JbY5ag/tSQFXzH3mtDmHqzF3aFn3DI/aB1n7pt4w= -go.opentelemetry.io/otel/exporters/otlp/otlptrace v1.14.0/go.mod h1:HrbCVv40OOLTABmOn1ZWty6CHXkU8DK/Urc43tHug70= -go.opentelemetry.io/otel/exporters/otlp/otlptrace/otlptracegrpc v1.3.0/go.mod h1:keUU7UfnwWTWpJ+FWnyqmogPa82nuU5VUANFq49hlMY= -go.opentelemetry.io/otel/exporters/otlp/otlptrace/otlptracegrpc v1.6.1/go.mod h1:UJJXJj0rltNIemDMwkOJyggsvyMG9QHfJeFH0HS5JjM= -go.opentelemetry.io/otel/exporters/otlp/otlptrace/otlptracegrpc v1.14.0/go.mod h1:5w41DY6S9gZrbjuq6Y+753e96WfPha5IcsOSZTtullM= -go.opentelemetry.io/otel/exporters/otlp/otlptrace/otlptracehttp v1.3.0/go.mod h1:QNX1aly8ehqqX1LEa6YniTU7VY9I6R3X/oPxhGdTceE= -go.opentelemetry.io/otel/exporters/otlp/otlptrace/otlptracehttp v1.6.1/go.mod h1:DAKwdo06hFLc0U88O10x4xnb5sc7dDRDqRuiN+io8JE= -go.opentelemetry.io/otel/exporters/otlp/otlptrace/otlptracehttp v1.14.0/go.mod h1:+N7zNjIJv4K+DeX67XXET0P+eIciESgaFDBqh+ZJFS4= -go.opentelemetry.io/otel/metric v0.20.0/go.mod h1:598I5tYlH1vzBjn+BTuhzTCSb/9debfNp6R3s7Pr1eU= -go.opentelemetry.io/otel/metric v0.28.0/go.mod h1:TrzsfQAmQaB1PDcdhBauLMk7nyyg9hm+GoQq/ekE9Iw= -go.opentelemetry.io/otel/metric v0.37.0/go.mod h1:DmdaHfGt54iV6UKxsV9slj2bBRJcKC1B1uvDLIioc1s= go.opentelemetry.io/otel/metric v1.16.0 h1:RbrpwVG1Hfv85LgnZ7+txXioPDoh6EdbZHo26Q3hqOo= go.opentelemetry.io/otel/metric v1.16.0/go.mod h1:QE47cpOmkwipPiefDwo2wDzwJrlfxxNYodqc4xnGCo4= -go.opentelemetry.io/otel/oteltest v0.20.0/go.mod h1:L7bgKf9ZB7qCwT9Up7i9/pn0PWIa9FqQ2IQ8LoxiGnw= -go.opentelemetry.io/otel/sdk v0.20.0/go.mod h1:g/IcepuwNsoiX5Byy2nNV0ySUF1em498m7hBWC279Yc= -go.opentelemetry.io/otel/sdk v1.3.0/go.mod h1:rIo4suHNhQwBIPg9axF8V9CA72Wz2mKF1teNrup8yzs= -go.opentelemetry.io/otel/sdk v1.6.1/go.mod h1:IVYrddmFZ+eJqu2k38qD3WezFR2pymCzm8tdxyh3R4E= -go.opentelemetry.io/otel/sdk v1.11.1/go.mod h1:/l3FE4SupHJ12TduVjUkZtlfFqDCQJlOlithYrdktys= -go.opentelemetry.io/otel/sdk v1.14.0/go.mod h1:bwIC5TjrNG6QDCHNWvW4HLHtUQ4I+VQDsnjhvyZCALM= go.opentelemetry.io/otel/sdk v1.16.0 h1:Z1Ok1YsijYL0CSJpHt4cS3wDDh7p572grzNrBMiMWgE= -go.opentelemetry.io/otel/sdk/export/metric v0.20.0/go.mod h1:h7RBNMsDJ5pmI1zExLi+bJK+Dr8NQCh0qGhm1KDnNlE= -go.opentelemetry.io/otel/sdk/metric v0.20.0/go.mod h1:knxiS8Xd4E/N+ZqKmUPf3gTTZ4/0TjTXukfxjzSTpHE= -go.opentelemetry.io/otel/trace v0.20.0/go.mod h1:6GjCW8zgDjwGHGa6GkyeB8+/5vjT16gUEi0Nf1iBdgw= -go.opentelemetry.io/otel/trace v1.3.0/go.mod h1:c/VDhno8888bvQYmbYLqe41/Ldmr/KKunbvWM4/fEjk= -go.opentelemetry.io/otel/trace v1.6.0/go.mod h1:qs7BrU5cZ8dXQHBGxHMOxwME/27YH2qEp4/+tZLLwJE= -go.opentelemetry.io/otel/trace v1.6.1/go.mod h1:RkFRM1m0puWIq10oxImnGEduNBzxiN7TXluRBtE+5j0= -go.opentelemetry.io/otel/trace v1.11.1/go.mod h1:f/Q9G7vzk5u91PhbmKbg1Qn0rzH1LJ4vbPHFGkTPtOk= -go.opentelemetry.io/otel/trace v1.14.0/go.mod h1:8avnQLK+CG77yNLUae4ea2JDQ6iT+gozhnZjy/rw9G8= go.opentelemetry.io/otel/trace v1.16.0 h1:8JRpaObFoW0pxuVPapkgH8UhHQj+bJW8jJsCZEu5MQs= go.opentelemetry.io/otel/trace v1.16.0/go.mod h1:Yt9vYq1SdNz3xdjZZK7wcXv1qv2pwLkqr2QVwea0ef0= go.opentelemetry.io/proto/otlp v0.7.0/go.mod h1:PqfVotwruBrMGOCsRd/89rSnXhoiJIqeYNgFYFoEGnI= -go.opentelemetry.io/proto/otlp v0.11.0/go.mod h1:QpEjXPrNQzrFDZgoTo49dgHR9RYRSrg3NAKnUGl9YpQ= -go.opentelemetry.io/proto/otlp v0.12.1/go.mod h1:H7XAot3MsfNsj7EXtrA2q5xSNQ10UqI405h3+duxN4U= -go.opentelemetry.io/proto/otlp v0.15.0/go.mod h1:H7XAot3MsfNsj7EXtrA2q5xSNQ10UqI405h3+duxN4U= -go.opentelemetry.io/proto/otlp v0.19.0/go.mod h1:H7XAot3MsfNsj7EXtrA2q5xSNQ10UqI405h3+duxN4U= go.step.sm/crypto v0.32.2 h1:EhJpFRNgU3RaNEO3WZ62Kn2gF9NWNglNG4DvSPeuiTs= go.step.sm/crypto v0.32.2/go.mod h1:JwarCq+Sn6N8IbRSKfSJfjUNKfO8c4N1mcNxYXuxXzc= go.tmz.dev/musttag v0.7.0 h1:QfytzjTWGXZmChoX0L++7uQN+yRCPfyFm+whsM+lfGc= go.tmz.dev/musttag v0.7.0/go.mod h1:oTFPvgOkJmp5kYL02S8+jrH0eLrBIl57rzWeA26zDEM= go.uber.org/atomic v1.3.2/go.mod h1:gD2HeocX3+yG+ygLZcrzQJaqmWj9AIm7n08wl/qW/PE= go.uber.org/atomic v1.4.0/go.mod h1:gD2HeocX3+yG+ygLZcrzQJaqmWj9AIm7n08wl/qW/PE= -go.uber.org/atomic v1.5.0/go.mod h1:sABNBOSYdrvTF6hTgEIbc7YasKWGhgEQZyfxyTvoXHQ= -go.uber.org/atomic v1.6.0/go.mod h1:sABNBOSYdrvTF6hTgEIbc7YasKWGhgEQZyfxyTvoXHQ= go.uber.org/atomic v1.7.0/go.mod h1:fEN4uk6kAWBTFdckzkM89CLk9XfWZrxpCo0nPH17wJc= -go.uber.org/atomic v1.9.0/go.mod h1:fEN4uk6kAWBTFdckzkM89CLk9XfWZrxpCo0nPH17wJc= -go.uber.org/atomic v1.10.0/go.mod h1:LUxbIzbOniOlMKjJjyPfpl4v+PKK2cNJn91OQbhoJI0= go.uber.org/atomic v1.11.0 h1:ZvwS0R+56ePWxUNi+Atn9dWONBPp/AUETXlHW0DxSjE= go.uber.org/atomic v1.11.0/go.mod h1:LUxbIzbOniOlMKjJjyPfpl4v+PKK2cNJn91OQbhoJI0= -go.uber.org/automaxprocs v1.5.1/go.mod h1:BF4eumQw0P9GtnuxxovUd06vwm1o18oMzFtK66vU6XU= go.uber.org/automaxprocs v1.5.2 h1:2LxUOGiR3O6tw8ui5sZa2LAaHnsviZdVOUZw4fvbnME= go.uber.org/automaxprocs v1.5.2/go.mod h1:eRbA25aqJrxAbsLO0xy5jVwPt7FQnRgjW+efnwa1WM0= -go.uber.org/goleak v1.1.10/go.mod h1:8a7PlsEVH3e/a/GLqe5IIrQx6GzcnRmZEufDUTk4A7A= -go.uber.org/goleak v1.1.11-0.20210813005559-691160354723/go.mod h1:cwTWslyiVhfpKIDGSZEM2HlOvcqm+tG4zioyIeLoqMQ= -go.uber.org/goleak v1.1.11/go.mod h1:cwTWslyiVhfpKIDGSZEM2HlOvcqm+tG4zioyIeLoqMQ= -go.uber.org/goleak v1.1.12/go.mod h1:cwTWslyiVhfpKIDGSZEM2HlOvcqm+tG4zioyIeLoqMQ= go.uber.org/goleak v1.2.1 h1:NBol2c7O1ZokfZ0LEU9K6Whx/KnwvepVetCUhtKja4A= -go.uber.org/goleak v1.2.1/go.mod h1:qlT2yGI9QafXHhZZLxlSuNsMw3FFLxBr+tBRlmO1xH4= go.uber.org/multierr v1.1.0/go.mod h1:wR5kodmAFQ0UK8QlbwjlSNy0Z68gJhDJUG5sjR94q/0= -go.uber.org/multierr v1.3.0/go.mod h1:VgVr7evmIr6uPjLBxg28wmKNXyqE9akIJ5XnfpiKl+4= -go.uber.org/multierr v1.5.0/go.mod h1:FeouvMocqHpRaaGuG9EjoKcStLC43Zu/fmqdUMPcKYU= go.uber.org/multierr v1.6.0/go.mod h1:cdWPpRnG4AhwMwsgIHip0KRBQjJy5kYEpYjJxpXp9iU= -go.uber.org/multierr v1.7.0/go.mod h1:7EAYxJLBy9rStEaz58O2t4Uvip6FSURkq8/ppBp95ak= go.uber.org/multierr v1.11.0 h1:blXXJkSxSSfBVBlC76pxqeO+LN3aDfLQo+309xJstO0= go.uber.org/multierr v1.11.0/go.mod h1:20+QtiLqy0Nd6FdQB9TLXag12DsQkrbs3htMFfDN80Y= -go.uber.org/tools v0.0.0-20190618225709-2cfd321de3ee/go.mod h1:vJERXedbb3MVM5f9Ejo0C68/HhF8uaILCdgjnY+goOA= -go.uber.org/zap v1.9.1/go.mod h1:vwi/ZaCAaUcBkycHslxD9B2zi4UTXhF60s6SWpuDF0Q= go.uber.org/zap v1.10.0/go.mod h1:vwi/ZaCAaUcBkycHslxD9B2zi4UTXhF60s6SWpuDF0Q= -go.uber.org/zap v1.13.0/go.mod h1:zwrFLgMcdUuIBviXEYEH1YKNaOBnKXsx2IPda5bBwHM= go.uber.org/zap v1.17.0/go.mod h1:MXVU+bhUf/A7Xi2HNOnopQOrmycQ5Ih87HtOu4q5SSo= -go.uber.org/zap v1.19.1/go.mod h1:j3DNczoxDZroyBnOT1L/Q79cfUMGZxlv/9dzN7SM1rI= go.uber.org/zap v1.24.0 h1:FiJd5l1UOLj0wCgbSE0rwwXHzEdAZS6hiiSnxJN/D60= go.uber.org/zap v1.24.0/go.mod h1:2kMP+WWQ8aoFoedH3T2sq6iJ2yDWpHbP0f6MQbS9Gkg= -gocloud.dev v0.30.0/go.mod h1:w+GlGVg/Jy9JV0Xc9eSXzUZeVEmSWW49W0syFK1+T9U= -gocloud.dev v0.32.0 h1:jHf8WSkByuAuXcvFt04OiiQH+N0zaRtxI6iEph8Bq8Y= -gocloud.dev v0.32.0/go.mod h1:m/x/N9cRjDF5MD0i5TLFbKbqkGffl/qayXA9FcMT5Oc= -gocloud.dev/docstore/mongodocstore v0.30.0 h1:3YeflF1O8jD+egDUzwEcZTfNL0LLhzMDP+PvVWl9ueA= -gocloud.dev/docstore/mongodocstore v0.30.0/go.mod h1:s7lilLIYKxYu7g2O8ipDlNIpp+OzemAofNKAVaXD+Dc= +gocloud.dev v0.33.0 h1:ET5z49jm1+eUhY5BkuGk2d7czfgGeXKd4vtg1Jcg9OQ= +gocloud.dev v0.33.0/go.mod h1:z6W8qorjrfM09H8t1MDk8KLPj3Xi26aFBzDKAHWIgLU= +gocloud.dev/docstore/mongodocstore v0.33.0 h1:cM6vEyyBq8O5TgerGDtHj1ZDsvqyWrrvyMCEfWFsteA= +gocloud.dev/docstore/mongodocstore v0.33.0/go.mod h1:P5kPTTQIYM5sDACG1jt/H7T1Pf+Ms5UrGBBYQck4Kr4= gocloud.dev/pubsub/kafkapubsub v0.32.0 h1:XWdb9Z9Lsmp6ByGpMkyGPM84J+VHXYysv7mfGiH6NPI= gocloud.dev/pubsub/kafkapubsub v0.32.0/go.mod h1:7LkR7ouvEVsz+z1gwE6JYxjaNu/rMceFjblfa4zI8f0= golang.org/x/crypto v0.0.0-20171113213409-9f005a07e0d3/go.mod h1:6SG95UA2DQfeDnfUPMdvaQW0Q7yPrPDi9nlGo2tz2b4= @@ -3023,7 +1785,6 @@ golang.org/x/crypto v0.0.0-20181029021203-45a5f77698d3/go.mod h1:6SG95UA2DQfeDnf golang.org/x/crypto v0.0.0-20181203042331-505ab145d0a9/go.mod h1:6SG95UA2DQfeDnfUPMdvaQW0Q7yPrPDi9nlGo2tz2b4= golang.org/x/crypto v0.0.0-20190219172222-a4c6cb3142f2/go.mod h1:6SG95UA2DQfeDnfUPMdvaQW0Q7yPrPDi9nlGo2tz2b4= golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2/go.mod h1:djNgcEr1/C05ACkg1iLfiJU5Ep61QUkGW8qpdssI0+w= -golang.org/x/crypto v0.0.0-20190411191339-88737f569e3a/go.mod h1:WFFai1msRO1wXaEeE5yQxYXgSfI8pQAWXbQop6sCtWE= golang.org/x/crypto v0.0.0-20190422162423-af44ce270edf/go.mod h1:WFFai1msRO1wXaEeE5yQxYXgSfI8pQAWXbQop6sCtWE= golang.org/x/crypto v0.0.0-20190510104115-cbcb75029529/go.mod h1:yigFU9vqHzYiE8UmvKecakEJjdnWj3jj499lnFckfCI= golang.org/x/crypto v0.0.0-20190605123033-f99c8df09eb5/go.mod h1:yigFU9vqHzYiE8UmvKecakEJjdnWj3jj499lnFckfCI= @@ -3031,82 +1792,46 @@ golang.org/x/crypto v0.0.0-20190611184440-5c40567a22f8/go.mod h1:yigFU9vqHzYiE8U golang.org/x/crypto v0.0.0-20190701094942-4def268fd1a4/go.mod h1:yigFU9vqHzYiE8UmvKecakEJjdnWj3jj499lnFckfCI= golang.org/x/crypto v0.0.0-20190820162420-60c769a6c586/go.mod h1:yigFU9vqHzYiE8UmvKecakEJjdnWj3jj499lnFckfCI= golang.org/x/crypto v0.0.0-20190911031432-227b76d455e7/go.mod h1:yigFU9vqHzYiE8UmvKecakEJjdnWj3jj499lnFckfCI= -golang.org/x/crypto v0.0.0-20190923035154-9ee001bba392/go.mod h1:/lpIB1dKB+9EgE3H3cr1v9wB50oz8l4C4h62xy7jSTY= golang.org/x/crypto v0.0.0-20191011191535-87dc89f01550/go.mod h1:yigFU9vqHzYiE8UmvKecakEJjdnWj3jj499lnFckfCI= golang.org/x/crypto v0.0.0-20191117063200-497ca9f6d64f/go.mod h1:LzIPMQfyMNhhGPhUkYOs5KpL4U8rLKemX1yGLhDgUto= golang.org/x/crypto v0.0.0-20191219195013-becbf705a915/go.mod h1:LzIPMQfyMNhhGPhUkYOs5KpL4U8rLKemX1yGLhDgUto= golang.org/x/crypto v0.0.0-20200302210943-78000ba7a073/go.mod h1:LzIPMQfyMNhhGPhUkYOs5KpL4U8rLKemX1yGLhDgUto= -golang.org/x/crypto v0.0.0-20200323165209-0ec3e9974c59/go.mod h1:LzIPMQfyMNhhGPhUkYOs5KpL4U8rLKemX1yGLhDgUto= golang.org/x/crypto v0.0.0-20200510223506-06a226fb4e37/go.mod h1:LzIPMQfyMNhhGPhUkYOs5KpL4U8rLKemX1yGLhDgUto= golang.org/x/crypto v0.0.0-20200622213623-75b288015ac9/go.mod h1:LzIPMQfyMNhhGPhUkYOs5KpL4U8rLKemX1yGLhDgUto= golang.org/x/crypto v0.0.0-20200728195943-123391ffb6de/go.mod h1:LzIPMQfyMNhhGPhUkYOs5KpL4U8rLKemX1yGLhDgUto= golang.org/x/crypto v0.0.0-20201002170205-7f63de1d35b0/go.mod h1:LzIPMQfyMNhhGPhUkYOs5KpL4U8rLKemX1yGLhDgUto= golang.org/x/crypto v0.0.0-20201112155050-0c6587e931a9/go.mod h1:LzIPMQfyMNhhGPhUkYOs5KpL4U8rLKemX1yGLhDgUto= -golang.org/x/crypto v0.0.0-20201203163018-be400aefbc4c/go.mod h1:jdWPYTVW3xRLrWPugEBEK3UY2ZEsg3UU495nc5E+M+I= -golang.org/x/crypto v0.0.0-20201216223049-8b5274cf687f/go.mod h1:jdWPYTVW3xRLrWPugEBEK3UY2ZEsg3UU495nc5E+M+I= -golang.org/x/crypto v0.0.0-20210220033148-5ea612d1eb83/go.mod h1:jdWPYTVW3xRLrWPugEBEK3UY2ZEsg3UU495nc5E+M+I= -golang.org/x/crypto v0.0.0-20210314154223-e6e6c4f2bb5b/go.mod h1:T9bdIzuCu7OtxOm1hfPfRQxPLYneinmdGuTeoZ9dtd4= golang.org/x/crypto v0.0.0-20210322153248-0c34fe9e7dc2/go.mod h1:T9bdIzuCu7OtxOm1hfPfRQxPLYneinmdGuTeoZ9dtd4= golang.org/x/crypto v0.0.0-20210421170649-83a5a9bb288b/go.mod h1:T9bdIzuCu7OtxOm1hfPfRQxPLYneinmdGuTeoZ9dtd4= -golang.org/x/crypto v0.0.0-20210616213533-5ff15b29337e/go.mod h1:GvvjBRRGRdwPK5ydBHafDWAxML/pGHZbMvKqRZ5+Abc= -golang.org/x/crypto v0.0.0-20210711020723-a769d52b0f97/go.mod h1:GvvjBRRGRdwPK5ydBHafDWAxML/pGHZbMvKqRZ5+Abc= -golang.org/x/crypto v0.0.0-20210817164053-32db794688a5/go.mod h1:GvvjBRRGRdwPK5ydBHafDWAxML/pGHZbMvKqRZ5+Abc= -golang.org/x/crypto v0.0.0-20210915214749-c084706c2272/go.mod h1:GvvjBRRGRdwPK5ydBHafDWAxML/pGHZbMvKqRZ5+Abc= golang.org/x/crypto v0.0.0-20210920023735-84f357641f63/go.mod h1:GvvjBRRGRdwPK5ydBHafDWAxML/pGHZbMvKqRZ5+Abc= golang.org/x/crypto v0.0.0-20210921155107-089bfa567519/go.mod h1:GvvjBRRGRdwPK5ydBHafDWAxML/pGHZbMvKqRZ5+Abc= -golang.org/x/crypto v0.0.0-20211108221036-ceb1ce70b4fa/go.mod h1:GvvjBRRGRdwPK5ydBHafDWAxML/pGHZbMvKqRZ5+Abc= -golang.org/x/crypto v0.0.0-20211202192323-5770296d904e/go.mod h1:IxCIyHEi3zRg3s0A5j5BB6A9Jmi73HwBIUl50j+osU4= golang.org/x/crypto v0.0.0-20211215153901-e495a2d5b3d3/go.mod h1:IxCIyHEi3zRg3s0A5j5BB6A9Jmi73HwBIUl50j+osU4= golang.org/x/crypto v0.0.0-20220314234659-1baeb1ce4c0b/go.mod h1:IxCIyHEi3zRg3s0A5j5BB6A9Jmi73HwBIUl50j+osU4= -golang.org/x/crypto v0.0.0-20220411220226-7b82a4e95df4/go.mod h1:IxCIyHEi3zRg3s0A5j5BB6A9Jmi73HwBIUl50j+osU4= -golang.org/x/crypto v0.0.0-20220511200225-c6db032c6c88/go.mod h1:IxCIyHEi3zRg3s0A5j5BB6A9Jmi73HwBIUl50j+osU4= golang.org/x/crypto v0.0.0-20220622213112-05595931fe9d/go.mod h1:IxCIyHEi3zRg3s0A5j5BB6A9Jmi73HwBIUl50j+osU4= golang.org/x/crypto v0.0.0-20220722155217-630584e8d5aa/go.mod h1:IxCIyHEi3zRg3s0A5j5BB6A9Jmi73HwBIUl50j+osU4= -golang.org/x/crypto v0.0.0-20220829220503-c86fa9a7ed90/go.mod h1:IxCIyHEi3zRg3s0A5j5BB6A9Jmi73HwBIUl50j+osU4= -golang.org/x/crypto v0.0.0-20221012134737-56aed061732a/go.mod h1:IxCIyHEi3zRg3s0A5j5BB6A9Jmi73HwBIUl50j+osU4= golang.org/x/crypto v0.1.0/go.mod h1:RecgLatLF4+eUMCP1PoPZQb+cVrJcOPbHkTkbkB9sbw= golang.org/x/crypto v0.6.0/go.mod h1:OFC/31mSvZgRz0V1QTNCzfAI1aIRzbiufJtkMIlEp58= golang.org/x/crypto v0.7.0/go.mod h1:pYwdfH91IfpZVANVyUOhSIPZaFoJGxTFbZhFTx+dXZU= -golang.org/x/crypto v0.9.0/go.mod h1:yrmDGqONDYtNj3tH8X9dzUun2m2lzPa9ngI6/RUPGR0= -golang.org/x/crypto v0.10.0/go.mod h1:o4eNf7Ede1fv+hwOwZsTHl9EsPFO6q6ZvYR8vYfY45I= golang.org/x/crypto v0.11.0 h1:6Ewdq3tDic1mg5xRO4milcWCfMVQhI4NkqWWvqejpuA= golang.org/x/crypto v0.11.0/go.mod h1:xgJhtzW8F9jGdVFWZESrid1U1bjeNy4zgy5cRr/CIio= -golang.org/x/exp v0.0.0-20180321215751-8460e604b9de/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA= -golang.org/x/exp v0.0.0-20180807140117-3d87b88a115f/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA= golang.org/x/exp v0.0.0-20190121172915-509febef88a4/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA= -golang.org/x/exp v0.0.0-20190125153040-c74c464bbbf2/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA= golang.org/x/exp v0.0.0-20190306152737-a1d7652674e8/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA= golang.org/x/exp v0.0.0-20190510132918-efd6b22b2522/go.mod h1:ZjyILWgesfNpC6sMxTJOJm9Kp84zZh5NQWvqDGG3Qr8= golang.org/x/exp v0.0.0-20190829153037-c13cbed26979/go.mod h1:86+5VVa7VpoJ4kLfm080zCjGlMRFzhUhsZKEZO7MGek= -golang.org/x/exp v0.0.0-20191002040644-a1355ae1e2c3/go.mod h1:NOZ3BPKG0ec/BKJQgnvsSFpcKLM5xXVWnvZS97DWHgE= golang.org/x/exp v0.0.0-20191030013958-a1ab85dbe136/go.mod h1:JXzH8nQsPlswgeRAPE3MuO9GYsAcnJvJ4vnMwN/5qkY= golang.org/x/exp v0.0.0-20191129062945-2f5052295587/go.mod h1:2RIsYlXP63K8oxa1u096TMicItID8zy7Y6sNkU49FU4= golang.org/x/exp v0.0.0-20191227195350-da58074b4299/go.mod h1:2RIsYlXP63K8oxa1u096TMicItID8zy7Y6sNkU49FU4= golang.org/x/exp v0.0.0-20200119233911-0405dc783f0a/go.mod h1:2RIsYlXP63K8oxa1u096TMicItID8zy7Y6sNkU49FU4= golang.org/x/exp v0.0.0-20200207192155-f17229e696bd/go.mod h1:J/WKrq2StrnmMY6+EHIKF9dgMWnmCNThgcyBT1FY9mM= golang.org/x/exp v0.0.0-20200224162631-6cc2880d07d6/go.mod h1:3jZMyOhIsHpP37uCMkUooju7aAi5cS1Q23tOzKc+0MU= -golang.org/x/exp v0.0.0-20220827204233-334a2380cb91/go.mod h1:cyybsKvd6eL0RnXn6p/Grxp8F5bW7iYuBgsNCOHpMYE= -golang.org/x/exp v0.0.0-20230108222341-4b8118a2686a/go.mod h1:CxIveKay+FTh1D0yPZemJVgC/95VzuuOLq5Qi4xnoYc= -golang.org/x/exp v0.0.0-20230321023759-10a507213a29/go.mod h1:CxIveKay+FTh1D0yPZemJVgC/95VzuuOLq5Qi4xnoYc= golang.org/x/exp v0.0.0-20230510235704-dd950f8aeaea h1:vLCWI/yYrdEHyN2JzIzPO3aaQJHQdp89IZBA/+azVC4= golang.org/x/exp v0.0.0-20230510235704-dd950f8aeaea/go.mod h1:V1LtkGg67GoY2N1AnLN78QLrzxkLyJw7RJb1gzOOz9w= golang.org/x/exp/typeparams v0.0.0-20220428152302-39d4317da171/go.mod h1:AbB0pIl9nAr9wVwH+Z2ZpaocVmF5I4GyWCDIsVjR0bk= golang.org/x/exp/typeparams v0.0.0-20230203172020-98cc5a0785f9/go.mod h1:AbB0pIl9nAr9wVwH+Z2ZpaocVmF5I4GyWCDIsVjR0bk= golang.org/x/exp/typeparams v0.0.0-20230224173230-c95f2b4c22f2 h1:J74nGeMgeFnYQJN59eFwh06jX/V8g0lB7LWpjSLxtgU= golang.org/x/exp/typeparams v0.0.0-20230224173230-c95f2b4c22f2/go.mod h1:AbB0pIl9nAr9wVwH+Z2ZpaocVmF5I4GyWCDIsVjR0bk= -golang.org/x/image v0.0.0-20180708004352-c73c2afc3b81/go.mod h1:ux5Hcp/YLpHSI86hEcLt0YII63i6oz57MZXIpbrjZUs= golang.org/x/image v0.0.0-20190227222117-0694c2d4d067/go.mod h1:kZ7UVZpmo3dzQBMxlp+ypCbDeSB+sBbTgSJuh5dn5js= golang.org/x/image v0.0.0-20190802002840-cff245a6509b/go.mod h1:FeLwcggjj3mMvU+oOTbSwawSJRM1uh48EjtB4UJZlP0= -golang.org/x/image v0.0.0-20190910094157-69e4b8554b2a/go.mod h1:FeLwcggjj3mMvU+oOTbSwawSJRM1uh48EjtB4UJZlP0= -golang.org/x/image v0.0.0-20200119044424-58c23975cae1/go.mod h1:FeLwcggjj3mMvU+oOTbSwawSJRM1uh48EjtB4UJZlP0= -golang.org/x/image v0.0.0-20200430140353-33d19683fad8/go.mod h1:FeLwcggjj3mMvU+oOTbSwawSJRM1uh48EjtB4UJZlP0= -golang.org/x/image v0.0.0-20200618115811-c13761719519/go.mod h1:FeLwcggjj3mMvU+oOTbSwawSJRM1uh48EjtB4UJZlP0= -golang.org/x/image v0.0.0-20201208152932-35266b937fa6/go.mod h1:FeLwcggjj3mMvU+oOTbSwawSJRM1uh48EjtB4UJZlP0= -golang.org/x/image v0.0.0-20210216034530-4410531fe030/go.mod h1:FeLwcggjj3mMvU+oOTbSwawSJRM1uh48EjtB4UJZlP0= -golang.org/x/image v0.0.0-20210607152325-775e3b0c77b9/go.mod h1:023OzeP/+EPmXeapQh35lcL3II3LrY8Ic+EFFKVhULM= -golang.org/x/image v0.0.0-20210628002857-a66eb6448b8d/go.mod h1:023OzeP/+EPmXeapQh35lcL3II3LrY8Ic+EFFKVhULM= -golang.org/x/image v0.0.0-20211028202545-6944b10bf410/go.mod h1:023OzeP/+EPmXeapQh35lcL3II3LrY8Ic+EFFKVhULM= -golang.org/x/image v0.0.0-20220302094943-723b81ca9867/go.mod h1:023OzeP/+EPmXeapQh35lcL3II3LrY8Ic+EFFKVhULM= golang.org/x/lint v0.0.0-20181026193005-c67002cb31c3/go.mod h1:UVdnD1Gm6xHRNCYTkRU2/jEulfH38KcIWyp/GAMgvoE= golang.org/x/lint v0.0.0-20190227174305-5b3e6a55c961/go.mod h1:wehouNa3lNwaWXcvxsM5YxQ5yQlVC4a0KAMCusXpPoU= golang.org/x/lint v0.0.0-20190301231843-5614ed5bae6f/go.mod h1:UVdnD1Gm6xHRNCYTkRU2/jEulfH38KcIWyp/GAMgvoE= @@ -3130,15 +1855,12 @@ golang.org/x/mod v0.3.0/go.mod h1:s0Qsj1ACt9ePp/hMypM3fl4fZqREWJwdYDEqhRiZZUA= golang.org/x/mod v0.4.0/go.mod h1:s0Qsj1ACt9ePp/hMypM3fl4fZqREWJwdYDEqhRiZZUA= golang.org/x/mod v0.4.1/go.mod h1:s0Qsj1ACt9ePp/hMypM3fl4fZqREWJwdYDEqhRiZZUA= golang.org/x/mod v0.4.2/go.mod h1:s0Qsj1ACt9ePp/hMypM3fl4fZqREWJwdYDEqhRiZZUA= -golang.org/x/mod v0.5.0/go.mod h1:5OXOZSfqPIIbmVBIIKWRFfZjPR0E5r58TLhUjH0a2Ro= golang.org/x/mod v0.5.1/go.mod h1:5OXOZSfqPIIbmVBIIKWRFfZjPR0E5r58TLhUjH0a2Ro= golang.org/x/mod v0.6.0-dev.0.20220106191415-9b9b3d81d5e3/go.mod h1:3p9vT2HGsQu2K1YbXdKPJLVgG5VJdoTa1poYQBtP1AY= golang.org/x/mod v0.6.0-dev.0.20220419223038-86c51ed26bb4/go.mod h1:jJ57K6gSWd91VN4djpZkiMVwK6gcyfeH4XE8wZrZaV4= golang.org/x/mod v0.6.0/go.mod h1:4mET923SAdbXp2ki8ey+zGs1SLqsuM2Y0uvdZR/fUNI= golang.org/x/mod v0.7.0/go.mod h1:iBbtSCu2XBx23ZKBPSOrRkjjQPZFPuis4dIYUhu/chs= golang.org/x/mod v0.8.0/go.mod h1:iBbtSCu2XBx23ZKBPSOrRkjjQPZFPuis4dIYUhu/chs= -golang.org/x/mod v0.9.0/go.mod h1:iBbtSCu2XBx23ZKBPSOrRkjjQPZFPuis4dIYUhu/chs= -golang.org/x/mod v0.10.0/go.mod h1:iBbtSCu2XBx23ZKBPSOrRkjjQPZFPuis4dIYUhu/chs= golang.org/x/mod v0.11.0 h1:bUO06HqtnRcc/7l71XBe4WcqTZ+3AH1J59zWDDwLKgU= golang.org/x/mod v0.11.0/go.mod h1:iBbtSCu2XBx23ZKBPSOrRkjjQPZFPuis4dIYUhu/chs= golang.org/x/net v0.0.0-20180724234803-3673e40ba225/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= @@ -3164,7 +1886,6 @@ golang.org/x/net v0.0.0-20190628185345-da137c7871d7/go.mod h1:z5CRVTTTmAJ677TzLL golang.org/x/net v0.0.0-20190724013045-ca1201d0de80/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= golang.org/x/net v0.0.0-20190813141303-74dc4d7220e7/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= golang.org/x/net v0.0.0-20190827160401-ba9fcec4b297/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= -golang.org/x/net v0.0.0-20190923162816-aa69164e4478/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= golang.org/x/net v0.0.0-20191002035440-2ec189313ef0/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= golang.org/x/net v0.0.0-20191004110552-13f9640d40b9/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= golang.org/x/net v0.0.0-20191119073136-fc4aabc6c914/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= @@ -3184,62 +1905,39 @@ golang.org/x/net v0.0.0-20200625001655-4c5254603344/go.mod h1:/O7V0waA8r7cgGh81R golang.org/x/net v0.0.0-20200707034311-ab3426394381/go.mod h1:/O7V0waA8r7cgGh81Ro3o1hOxt32SMVPicZroKQ2sZA= golang.org/x/net v0.0.0-20200822124328-c89045814202/go.mod h1:/O7V0waA8r7cgGh81Ro3o1hOxt32SMVPicZroKQ2sZA= golang.org/x/net v0.0.0-20201006153459-a7d1128ccaa0/go.mod h1:sp8m0HH+o8qH0wwXwYZr8TS3Oi6o0r6Gce1SSxlDquU= -golang.org/x/net v0.0.0-20201010224723-4f7140c49acb/go.mod h1:sp8m0HH+o8qH0wwXwYZr8TS3Oi6o0r6Gce1SSxlDquU= golang.org/x/net v0.0.0-20201021035429-f5854403a974/go.mod h1:sp8m0HH+o8qH0wwXwYZr8TS3Oi6o0r6Gce1SSxlDquU= golang.org/x/net v0.0.0-20201031054903-ff519b6c9102/go.mod h1:sp8m0HH+o8qH0wwXwYZr8TS3Oi6o0r6Gce1SSxlDquU= golang.org/x/net v0.0.0-20201110031124-69a78807bb2b/go.mod h1:sp8m0HH+o8qH0wwXwYZr8TS3Oi6o0r6Gce1SSxlDquU= -golang.org/x/net v0.0.0-20201202161906-c7110b5ffcbb/go.mod h1:sp8m0HH+o8qH0wwXwYZr8TS3Oi6o0r6Gce1SSxlDquU= golang.org/x/net v0.0.0-20201209123823-ac852fbbde11/go.mod h1:m0MpNAwzfU5UDzcl9v0D8zg8gWTRqZa9RBIspLL5mdg= golang.org/x/net v0.0.0-20201224014010-6772e930b67b/go.mod h1:m0MpNAwzfU5UDzcl9v0D8zg8gWTRqZa9RBIspLL5mdg= golang.org/x/net v0.0.0-20210119194325-5f4716e94777/go.mod h1:m0MpNAwzfU5UDzcl9v0D8zg8gWTRqZa9RBIspLL5mdg= golang.org/x/net v0.0.0-20210226172049-e18ecbb05110/go.mod h1:m0MpNAwzfU5UDzcl9v0D8zg8gWTRqZa9RBIspLL5mdg= golang.org/x/net v0.0.0-20210316092652-d523dce5a7f4/go.mod h1:RBQZq4jEuRlivfhVLdyRGr576XBO4/greRjx4P4O3yc= golang.org/x/net v0.0.0-20210405180319-a5a99cb37ef4/go.mod h1:p54w0d4576C0XHj96bSt6lcn1PtDYWL6XObtHCRCNQM= -golang.org/x/net v0.0.0-20210410081132-afb366fc7cd1/go.mod h1:9tjilg8BloeKEkVJvy7fQ90B1CfIiPueXVOjqfkSzI8= golang.org/x/net v0.0.0-20210421230115-4e50805a0758/go.mod h1:72T/g9IO56b78aLF+1Kcs5dz7/ng1VjMUvfKvpfy+jM= golang.org/x/net v0.0.0-20210428140749-89ef3d95e781/go.mod h1:OJAsFXCWl8Ukc7SiCT/9KSuxbyM7479/AVlXFRxuMCk= golang.org/x/net v0.0.0-20210503060351-7fd8e65b6420/go.mod h1:9nx3DQGgdP8bBQD5qxJ1jj9UTztislL4KSBs9R2vV5Y= -golang.org/x/net v0.0.0-20210520170846-37e1c6afe023/go.mod h1:9nx3DQGgdP8bBQD5qxJ1jj9UTztislL4KSBs9R2vV5Y= golang.org/x/net v0.0.0-20210525063256-abc453219eb5/go.mod h1:9nx3DQGgdP8bBQD5qxJ1jj9UTztislL4KSBs9R2vV5Y= -golang.org/x/net v0.0.0-20210614182718-04defd469f4e/go.mod h1:9nx3DQGgdP8bBQD5qxJ1jj9UTztislL4KSBs9R2vV5Y= -golang.org/x/net v0.0.0-20210726213435-c6fcb2dbf985/go.mod h1:9nx3DQGgdP8bBQD5qxJ1jj9UTztislL4KSBs9R2vV5Y= golang.org/x/net v0.0.0-20210805182204-aaa1db679c0d/go.mod h1:9nx3DQGgdP8bBQD5qxJ1jj9UTztislL4KSBs9R2vV5Y= -golang.org/x/net v0.0.0-20210813160813-60bc85c4be6d/go.mod h1:9nx3DQGgdP8bBQD5qxJ1jj9UTztislL4KSBs9R2vV5Y= -golang.org/x/net v0.0.0-20210825183410-e898025ed96a/go.mod h1:9nx3DQGgdP8bBQD5qxJ1jj9UTztislL4KSBs9R2vV5Y= golang.org/x/net v0.0.0-20210917221730-978cfadd31cf/go.mod h1:9nx3DQGgdP8bBQD5qxJ1jj9UTztislL4KSBs9R2vV5Y= golang.org/x/net v0.0.0-20211015210444-4f30a5c0130f/go.mod h1:9nx3DQGgdP8bBQD5qxJ1jj9UTztislL4KSBs9R2vV5Y= -golang.org/x/net v0.0.0-20211029224645-99673261e6eb/go.mod h1:9nx3DQGgdP8bBQD5qxJ1jj9UTztislL4KSBs9R2vV5Y= golang.org/x/net v0.0.0-20211112202133-69e39bad7dc2/go.mod h1:9nx3DQGgdP8bBQD5qxJ1jj9UTztislL4KSBs9R2vV5Y= -golang.org/x/net v0.0.0-20211209124913-491a49abca63/go.mod h1:9nx3DQGgdP8bBQD5qxJ1jj9UTztislL4KSBs9R2vV5Y= -golang.org/x/net v0.0.0-20211216030914-fe4d6282115f/go.mod h1:9nx3DQGgdP8bBQD5qxJ1jj9UTztislL4KSBs9R2vV5Y= golang.org/x/net v0.0.0-20220127200216-cd36cc0744dd/go.mod h1:CfG3xpIq0wQ8r1q4Su4UZFWDARRcnwPjda9FqA0JpMk= golang.org/x/net v0.0.0-20220225172249-27dd8689420f/go.mod h1:CfG3xpIq0wQ8r1q4Su4UZFWDARRcnwPjda9FqA0JpMk= golang.org/x/net v0.0.0-20220325170049-de3da57026de/go.mod h1:CfG3xpIq0wQ8r1q4Su4UZFWDARRcnwPjda9FqA0JpMk= golang.org/x/net v0.0.0-20220412020605-290c469a71a5/go.mod h1:CfG3xpIq0wQ8r1q4Su4UZFWDARRcnwPjda9FqA0JpMk= golang.org/x/net v0.0.0-20220425223048-2871e0cb64e4/go.mod h1:CfG3xpIq0wQ8r1q4Su4UZFWDARRcnwPjda9FqA0JpMk= -golang.org/x/net v0.0.0-20220520000938-2e3eb7b945c2/go.mod h1:CfG3xpIq0wQ8r1q4Su4UZFWDARRcnwPjda9FqA0JpMk= golang.org/x/net v0.0.0-20220607020251-c690dde0001d/go.mod h1:XRhObCWvk6IyKnWLug+ECip1KBveYUHfp+8e9klMJ9c= -golang.org/x/net v0.0.0-20220617184016-355a448f1bc9/go.mod h1:XRhObCWvk6IyKnWLug+ECip1KBveYUHfp+8e9klMJ9c= golang.org/x/net v0.0.0-20220624214902-1bab6f366d9e/go.mod h1:XRhObCWvk6IyKnWLug+ECip1KBveYUHfp+8e9klMJ9c= golang.org/x/net v0.0.0-20220722155237-a158d28d115b/go.mod h1:XRhObCWvk6IyKnWLug+ECip1KBveYUHfp+8e9klMJ9c= -golang.org/x/net v0.0.0-20220805013720-a33c5aa5df48/go.mod h1:YDH+HFinaLZZlnHAfSS6ZXJJ9M9t4Dl22yv3iI2vPwk= -golang.org/x/net v0.0.0-20220909164309-bea034e7d591/go.mod h1:YDH+HFinaLZZlnHAfSS6ZXJJ9M9t4Dl22yv3iI2vPwk= -golang.org/x/net v0.0.0-20220921155015-db77216a4ee9/go.mod h1:YDH+HFinaLZZlnHAfSS6ZXJJ9M9t4Dl22yv3iI2vPwk= -golang.org/x/net v0.0.0-20221012135044-0b7e1fb9d458/go.mod h1:YDH+HFinaLZZlnHAfSS6ZXJJ9M9t4Dl22yv3iI2vPwk= -golang.org/x/net v0.0.0-20221014081412-f15817d10f9b/go.mod h1:YDH+HFinaLZZlnHAfSS6ZXJJ9M9t4Dl22yv3iI2vPwk= golang.org/x/net v0.1.0/go.mod h1:Cx3nUiGt4eDBEyega/BKRp+/AlGL8hYe7U9odMt2Cco= golang.org/x/net v0.2.0/go.mod h1:KqCZLdyyvdV855qA2rE3GC2aiw5xGR5TEjj8smXukLY= -golang.org/x/net v0.3.0/go.mod h1:MBQ8lrhLObU/6UmLb4fmbmk5OcyYmqtbGd/9yIeKjEE= -golang.org/x/net v0.4.0/go.mod h1:MBQ8lrhLObU/6UmLb4fmbmk5OcyYmqtbGd/9yIeKjEE= golang.org/x/net v0.5.0/go.mod h1:DivGGAXEgPSlEBzxGzZI+ZLohi+xUj054jfeKui00ws= golang.org/x/net v0.6.0/go.mod h1:2Tu9+aMcznHK/AK1HMvgo6xiTLG5rD5rZLDS+rp2Bjs= golang.org/x/net v0.7.0/go.mod h1:2Tu9+aMcznHK/AK1HMvgo6xiTLG5rD5rZLDS+rp2Bjs= golang.org/x/net v0.8.0/go.mod h1:QVkue5JL9kW//ek3r6jTKnTFis1tRmNAW2P1shuFdJc= -golang.org/x/net v0.9.0/go.mod h1:d48xBJpPfHeWQsugry2m+kC02ZBRGRgulfHnEXEuWns= -golang.org/x/net v0.10.0/go.mod h1:0qNGK6F8kojg2nk9dLZ2mShWaEBan6FAoqfSigmmuDg= -golang.org/x/net v0.11.0/go.mod h1:2L/ixqYpgIVXmeoSA/4Lu7BzTG4KIyPIryS4IsOd1oQ= -golang.org/x/net v0.12.0 h1:cfawfvKITfUsFCeJIHJrbSxpeu/E81khclypR0GVT50= -golang.org/x/net v0.12.0/go.mod h1:zEVYFnQC7m/vmpQFELhcD1EWkZlX69l4oqgmer6hfKA= +golang.org/x/net v0.13.0 h1:Nvo8UFsZ8X3BhAC9699Z1j7XQ3rsZnUUm7jfBEk1ueY= +golang.org/x/net v0.13.0/go.mod h1:zEVYFnQC7m/vmpQFELhcD1EWkZlX69l4oqgmer6hfKA= golang.org/x/oauth2 v0.0.0-20180821212333-d2e6202438be/go.mod h1:N/0e6XlmueqKjAGxoOufVs8QHGRruUQn6yWY3a++T0U= golang.org/x/oauth2 v0.0.0-20190226205417-e64efc72b421/go.mod h1:gOpvHmFTYa4IltrdGE7lF6nIHvwfUNPOp7c8zoXwtLw= golang.org/x/oauth2 v0.0.0-20190604053449-0f29369cfe45/go.mod h1:gOpvHmFTYa4IltrdGE7lF6nIHvwfUNPOp7c8zoXwtLw= @@ -3257,24 +1955,12 @@ golang.org/x/oauth2 v0.0.0-20210514164344-f6687ab2804c/go.mod h1:KelEdhl1UZF7XfJ golang.org/x/oauth2 v0.0.0-20210628180205-a41e5a781914/go.mod h1:KelEdhl1UZF7XfJ4dDtk6s++YSgaE7mD/BuKKDLBl4A= golang.org/x/oauth2 v0.0.0-20210805134026-6f1e6394065a/go.mod h1:KelEdhl1UZF7XfJ4dDtk6s++YSgaE7mD/BuKKDLBl4A= golang.org/x/oauth2 v0.0.0-20210819190943-2bc19b11175f/go.mod h1:KelEdhl1UZF7XfJ4dDtk6s++YSgaE7mD/BuKKDLBl4A= -golang.org/x/oauth2 v0.0.0-20211005180243-6b3c2da341f1/go.mod h1:KelEdhl1UZF7XfJ4dDtk6s++YSgaE7mD/BuKKDLBl4A= golang.org/x/oauth2 v0.0.0-20211104180415-d3ed0bb246c8/go.mod h1:KelEdhl1UZF7XfJ4dDtk6s++YSgaE7mD/BuKKDLBl4A= golang.org/x/oauth2 v0.0.0-20220223155221-ee480838109b/go.mod h1:DAh4E804XQdzx2j+YRIaUnCqCV2RuMz24cGBJ5QYIrc= golang.org/x/oauth2 v0.0.0-20220309155454-6242fa91716a/go.mod h1:DAh4E804XQdzx2j+YRIaUnCqCV2RuMz24cGBJ5QYIrc= golang.org/x/oauth2 v0.0.0-20220411215720-9780585627b5/go.mod h1:DAh4E804XQdzx2j+YRIaUnCqCV2RuMz24cGBJ5QYIrc= golang.org/x/oauth2 v0.0.0-20220608161450-d0670ef3b1eb/go.mod h1:jaDAt6Dkxork7LmZnYtzbRWj0W47D86a3TGe0YHBvmE= golang.org/x/oauth2 v0.0.0-20220622183110-fd043fe589d2/go.mod h1:jaDAt6Dkxork7LmZnYtzbRWj0W47D86a3TGe0YHBvmE= -golang.org/x/oauth2 v0.0.0-20220722155238-128564f6959c/go.mod h1:h4gKUeWbJ4rQPri7E0u6Gs4e9Ri2zaLxzw5DI5XGrYg= -golang.org/x/oauth2 v0.0.0-20220822191816-0ebed06d0094/go.mod h1:h4gKUeWbJ4rQPri7E0u6Gs4e9Ri2zaLxzw5DI5XGrYg= -golang.org/x/oauth2 v0.0.0-20220909003341-f21342109be1/go.mod h1:h4gKUeWbJ4rQPri7E0u6Gs4e9Ri2zaLxzw5DI5XGrYg= -golang.org/x/oauth2 v0.0.0-20221006150949-b44042a4b9c1/go.mod h1:h4gKUeWbJ4rQPri7E0u6Gs4e9Ri2zaLxzw5DI5XGrYg= -golang.org/x/oauth2 v0.0.0-20221014153046-6fdb5e3db783/go.mod h1:h4gKUeWbJ4rQPri7E0u6Gs4e9Ri2zaLxzw5DI5XGrYg= -golang.org/x/oauth2 v0.4.0/go.mod h1:RznEsdpjGAINPTOF0UH/t+xJ75L18YO3Ho6Pyn+uRec= -golang.org/x/oauth2 v0.5.0/go.mod h1:9/XBHVqLaWO3/BRHs5jbpYCnOZVjj5V0ndyaAM7KB4I= -golang.org/x/oauth2 v0.6.0/go.mod h1:ycmewcwgD4Rpr3eZJLSB4Kyyljb3qDh40vJ8STE5HKw= -golang.org/x/oauth2 v0.7.0/go.mod h1:hPLQkd9LyjfXTiRohC/41GhcFqxisoUQ99sCUOHO9x4= -golang.org/x/oauth2 v0.8.0/go.mod h1:yr7u4HXZRm1R1kBWqr/xKNqewf0plRYoB7sla+BCIXE= -golang.org/x/oauth2 v0.9.0/go.mod h1:qYgFZaFiu6Wg24azG8bdV52QJXJGbZzIIsRCdVKzbLw= golang.org/x/oauth2 v0.10.0 h1:zHCpF2Khkwy4mMB4bv0U37YtJdTGW8jI0glAApi0Kh8= golang.org/x/oauth2 v0.10.0/go.mod h1:kTpgurOux7LqtuxjuyZa4Gj2gdezIt/jQtGnNFfypQI= golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= @@ -3289,13 +1975,9 @@ golang.org/x/sync v0.0.0-20200625203802-6e8e738ad208/go.mod h1:RxMgew5VJxzue5/jJ golang.org/x/sync v0.0.0-20201020160332-67f06af15bc9/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= golang.org/x/sync v0.0.0-20201207232520-09787c993a3a/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= golang.org/x/sync v0.0.0-20210220032951-036812b2e83c/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= -golang.org/x/sync v0.0.0-20220513210516-0976fa681c29/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= golang.org/x/sync v0.0.0-20220601150217-0de741cfad7f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= golang.org/x/sync v0.0.0-20220722155255-886fb9371eb4/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= -golang.org/x/sync v0.0.0-20220819030929-7fc1605a5dde/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= -golang.org/x/sync v0.0.0-20220929204114-8fcdb60fdcc0/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= golang.org/x/sync v0.1.0/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= -golang.org/x/sync v0.2.0/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= golang.org/x/sync v0.3.0 h1:ftCYgMx6zT/asHUrPw8BLLscYtGznsLAnjq5RH9P66E= golang.org/x/sync v0.3.0/go.mod h1:FU7BRWz2tNW+3quACPkgCx/L+uEAv1htQ0V83Z9Rj+Y= golang.org/x/sys v0.0.0-20180823144017-11551d06cbcc/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= @@ -3306,10 +1988,8 @@ golang.org/x/sys v0.0.0-20181026203630-95b1ffbd15a5/go.mod h1:STP8DvDyc/dI5b8T5h golang.org/x/sys v0.0.0-20181107165924-66b7b1311ac8/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20181116152217-5ac8a444bdc5/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20181205085412-a5c9d58dba9a/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= -golang.org/x/sys v0.0.0-20190130150945-aca44879d564/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20190221075227-b4e8571b14e0/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= -golang.org/x/sys v0.0.0-20190222072716-a9d3bda3a223/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20190312061237-fead79001313/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20190403152447-81d4e9dc473e/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20190412213103-97732733099d/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= @@ -3325,19 +2005,14 @@ golang.org/x/sys v0.0.0-20190606165138-5da285871e9c/go.mod h1:h1NjWce9XRLGQEsW7w golang.org/x/sys v0.0.0-20190606203320-7fc4e5ec1444/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20190616124812-15dcb6c0061f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20190624142023-c5567b49c5d0/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= -golang.org/x/sys v0.0.0-20190626221950-04f50cda93cb/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20190726091711-fc99dfbffb4e/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20190801041406-cbf593c0f2f3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20190812073006-9eafafc0a87e/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= -golang.org/x/sys v0.0.0-20190813064441-fde4db37ae7a/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20190826190057-c7b8b68b1456/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20190904154756-749cb33beabd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= -golang.org/x/sys v0.0.0-20190922100055-0a153f010e69/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= -golang.org/x/sys v0.0.0-20190924154521-2837fb4f24fe/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20191001151750-bb3f8db39f24/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20191005200804-aed5e4c7ecf9/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= -golang.org/x/sys v0.0.0-20191008105621-543471e840be/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20191022100944-742c48ecaeb7/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20191026070338-33540a1f6037/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20191115151921-52ab43148777/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= @@ -3348,7 +2023,6 @@ golang.org/x/sys v0.0.0-20191210023423-ac6580df4449/go.mod h1:h1NjWce9XRLGQEsW7w golang.org/x/sys v0.0.0-20191228213918-04cbcbbfeed8/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20200106162015-b016eb3dc98e/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20200113162924-86b910548bc1/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= -golang.org/x/sys v0.0.0-20200116001909-b77594299b42/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20200120151820-655fe14d7479/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20200122134326-e047566fdf82/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20200124204421-9fbb57f87de9/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= @@ -3363,7 +2037,6 @@ golang.org/x/sys v0.0.0-20200501052902-10377860bb8e/go.mod h1:h1NjWce9XRLGQEsW7w golang.org/x/sys v0.0.0-20200509044756-6aff5f38e54f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20200511232937-7e40ca221e25/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20200515095857-1151b9dac4a9/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= -golang.org/x/sys v0.0.0-20200519105757-fe76b779f299/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20200523222454-059865788121/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20200615200032-f1bc736245b1/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20200622214017-ed371f2e16b4/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= @@ -3371,12 +2044,10 @@ golang.org/x/sys v0.0.0-20200625212154-ddb9806d33ae/go.mod h1:h1NjWce9XRLGQEsW7w golang.org/x/sys v0.0.0-20200728102440-3e129f6d46b1/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20200803210538-64077c9b5642/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20200817155316-9781c653f443/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= -golang.org/x/sys v0.0.0-20200831180312-196b9ba8737a/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20200905004654-be1d3432aa8f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20200909081042-eff7692f9009/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20200916030750-2334cc1a136f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20200922070232-aee5d888a860/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= -golang.org/x/sys v0.0.0-20200923182605-d9f96fdee20d/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20200930185726-fdedc70b468f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20201112073958-5cba982894dd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20201117170446-d9b008d0a637/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= @@ -3389,8 +2060,6 @@ golang.org/x/sys v0.0.0-20210119212857-b64e53b001e4/go.mod h1:h1NjWce9XRLGQEsW7w golang.org/x/sys v0.0.0-20210124154548-22da62e12c0c/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20210220050731-9a76102bfb43/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20210225134936-a50acf3fe073/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= -golang.org/x/sys v0.0.0-20210303074136-134d130e1a04/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= -golang.org/x/sys v0.0.0-20210304124612-50617c2ba197/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20210305230114-8fe3ee5dd75b/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20210315160823-c6e025ad8005/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20210320140829-1e4c9ba3b0c4/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= @@ -3400,7 +2069,6 @@ golang.org/x/sys v0.0.0-20210403161142-5e06dd20ab57/go.mod h1:h1NjWce9XRLGQEsW7w golang.org/x/sys v0.0.0-20210420072515-93ed5bcd2bfe/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20210423082822-04245dca01da/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20210423185535-09eb48e85fd7/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= -golang.org/x/sys v0.0.0-20210426230700-d19ff857e887/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20210503080704-8803ae5d1324/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20210510120138-977fb7262007/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/sys v0.0.0-20210514084401-e8d321eab015/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= @@ -3411,75 +2079,47 @@ golang.org/x/sys v0.0.0-20210616045830-e2b7044e8c71/go.mod h1:oPkhp1MJrh7nUepCBc golang.org/x/sys v0.0.0-20210616094352-59db8d763f22/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/sys v0.0.0-20210630005230-0f9fa26af87c/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/sys v0.0.0-20210806184541-e5e7981a1069/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= -golang.org/x/sys v0.0.0-20210809222454-d867a43fc93e/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= -golang.org/x/sys v0.0.0-20210816183151-1e6c022a8912/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/sys v0.0.0-20210819135213-f52c844e1c1c/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/sys v0.0.0-20210823070655-63515b42dcdf/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= -golang.org/x/sys v0.0.0-20210831042530-f4d43177bf5e/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= -golang.org/x/sys v0.0.0-20210903071746-97244b99971b/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= -golang.org/x/sys v0.0.0-20210906170528-6f6e22806c34/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/sys v0.0.0-20210908233432-aa78b53d3365/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= -golang.org/x/sys v0.0.0-20210917161153-d61c044b1678/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= -golang.org/x/sys v0.0.0-20210927094055-39ccf1dd6fa6/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/sys v0.0.0-20211007075335-d3039528d8ac/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/sys v0.0.0-20211019181941-9d821ace8654/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= -golang.org/x/sys v0.0.0-20211025201205-69cdffdb9359/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/sys v0.0.0-20211105183446-c75c47738b0c/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= -golang.org/x/sys v0.0.0-20211116061358-0a5406a5449c/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/sys v0.0.0-20211124211545-fe61309f8881/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/sys v0.0.0-20211210111614-af8b64212486/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/sys v0.0.0-20211216021012-1d35b9e2eb4e/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/sys v0.0.0-20220114195835-da31bd327af9/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/sys v0.0.0-20220128215802-99c3d69c2c27/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/sys v0.0.0-20220209214540-3681064d5158/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= -golang.org/x/sys v0.0.0-20220224120231-95c6836cb0e7/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/sys v0.0.0-20220227234510-4e6760a101f9/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= -golang.org/x/sys v0.0.0-20220310020820-b874c991c1a5/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= -golang.org/x/sys v0.0.0-20220319134239-a9b59b0215f8/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/sys v0.0.0-20220328115105-d36c6a25d886/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/sys v0.0.0-20220412211240-33da011f77ad/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= -golang.org/x/sys v0.0.0-20220422013727-9388b58f7150/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/sys v0.0.0-20220502124256-b6088ccd6cba/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/sys v0.0.0-20220503163025-988cb79eb6c6/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/sys v0.0.0-20220520151302-bc2c85ada10a/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/sys v0.0.0-20220610221304-9f5ed59c137d/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= -golang.org/x/sys v0.0.0-20220615213510-4f61da869c0c/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/sys v0.0.0-20220624220833-87e55d714810/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/sys v0.0.0-20220702020025-31831981b65f/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/sys v0.0.0-20220715151400-c0bba94af5f8/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/sys v0.0.0-20220722155257-8c9f86f7a55f/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= -golang.org/x/sys v0.0.0-20220728004956-3c1f35247d10/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/sys v0.0.0-20220811171246-fbc7d0a398ab/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/sys v0.0.0-20220825204002-c680a09ffe64/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= -golang.org/x/sys v0.0.0-20220829200755-d48e67d00261/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/sys v0.0.0-20220906165534-d0df966e6959/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/sys v0.0.0-20220908164124-27713097b956/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= -golang.org/x/sys v0.0.0-20220919091848-fb04ddd9f9c8/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/sys v0.1.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/sys v0.2.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= -golang.org/x/sys v0.3.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/sys v0.4.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/sys v0.5.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/sys v0.6.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= -golang.org/x/sys v0.7.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= -golang.org/x/sys v0.8.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= -golang.org/x/sys v0.9.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/sys v0.10.0 h1:SqMFp9UcQJZa+pmYuAKjd9xq1f0j5rLcDIk0mj4qAsA= golang.org/x/sys v0.10.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= -golang.org/x/term v0.0.0-20201117132131-f5c789dd3221/go.mod h1:Nr5EML6q2oocZ2LXRh80K7BxOlk5/8JxuGnuhpl+muw= golang.org/x/term v0.0.0-20201126162022-7de9c90e9dd1/go.mod h1:bj7SfCRtBDWHUb9snDiAeCFNEtKQo2Wmx5Cou7ajbmo= -golang.org/x/term v0.0.0-20210220032956-6a3ed077a48d/go.mod h1:bj7SfCRtBDWHUb9snDiAeCFNEtKQo2Wmx5Cou7ajbmo= -golang.org/x/term v0.0.0-20210615171337-6886f2dfbf5b/go.mod h1:jbD1KX2456YbFQfuXm/mYQcufACuNUgVhRMnK/tPxf8= golang.org/x/term v0.0.0-20210927222741-03fcf44c2211/go.mod h1:jbD1KX2456YbFQfuXm/mYQcufACuNUgVhRMnK/tPxf8= golang.org/x/term v0.1.0/go.mod h1:jbD1KX2456YbFQfuXm/mYQcufACuNUgVhRMnK/tPxf8= golang.org/x/term v0.2.0/go.mod h1:TVmDHMZPmdnySmBfhjOoOdhjzdE1h4u1VwSiw2l1Nuc= -golang.org/x/term v0.3.0/go.mod h1:q750SLmJuPmVoN1blW3UFBPREJfb1KmY3vwxfr+nFDA= golang.org/x/term v0.4.0/go.mod h1:9P2UbLfCdcvo3p/nzKvsmas4TnlujnuoV9hGgYzW1lQ= golang.org/x/term v0.5.0/go.mod h1:jMB1sMXY+tzblOD4FWmEbocvup2/aLOaQEp7JmGp78k= golang.org/x/term v0.6.0/go.mod h1:m6U89DPEgQRMq3DNkDClhWw02AUbt2daBVO4cn4Hv9U= -golang.org/x/term v0.7.0/go.mod h1:P32HKFT3hSsZrRxla30E9HqToFYAQPCMs/zFMBUFqPY= -golang.org/x/term v0.8.0/go.mod h1:xPskH00ivmX89bAKVGSKKtLOWNx2+17Eiy94tnKShWo= -golang.org/x/term v0.9.0/go.mod h1:M6DEAAIenWoTxdKrOltXcmDY3rSplQUkrvaDU5FcQyo= golang.org/x/term v0.10.0 h1:3R7pNqamzBraeqj/Tj8qt1aQ2HpmlC+Cx/qL/7hn4/c= golang.org/x/term v0.10.0/go.mod h1:lpqdcUyK/oCiQxvxVrppt5ggO2KCZ5QblwqPnfZ6d5o= golang.org/x/text v0.0.0-20170915032832-14c0d48ead0c/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ= @@ -3493,35 +2133,22 @@ golang.org/x/text v0.3.6/go.mod h1:5Zoc/QRtKVWzQhOtBMvqHzDpF6irO9z98xDceosuGiQ= golang.org/x/text v0.3.7/go.mod h1:u+2+/6zg+i71rQMx5EYifcz6MCKuco9NR6JIITiCfzQ= golang.org/x/text v0.3.8/go.mod h1:E6s5w1FMmriuDzIBO73fBruAKo1PCIq6d2Q6DHfQ8WQ= golang.org/x/text v0.4.0/go.mod h1:mrYo+phRRbMaCq/xk9113O4dZlRixOauAjOtrjsXDZ8= -golang.org/x/text v0.5.0/go.mod h1:mrYo+phRRbMaCq/xk9113O4dZlRixOauAjOtrjsXDZ8= golang.org/x/text v0.6.0/go.mod h1:mrYo+phRRbMaCq/xk9113O4dZlRixOauAjOtrjsXDZ8= golang.org/x/text v0.7.0/go.mod h1:mrYo+phRRbMaCq/xk9113O4dZlRixOauAjOtrjsXDZ8= golang.org/x/text v0.8.0/go.mod h1:e1OnstbJyHTd6l/uOt8jFFHp6TRDWZR/bV3emEE/zU8= -golang.org/x/text v0.9.0/go.mod h1:e1OnstbJyHTd6l/uOt8jFFHp6TRDWZR/bV3emEE/zU8= -golang.org/x/text v0.10.0/go.mod h1:TvPlkZtksWOMsz7fbANvkp4WM8x/WCo/om8BMLbz+aE= golang.org/x/text v0.11.0 h1:LAntKIrcmeSKERyiOh0XMV39LXS8IE9UL2yP7+f5ij4= golang.org/x/text v0.11.0/go.mod h1:TvPlkZtksWOMsz7fbANvkp4WM8x/WCo/om8BMLbz+aE= golang.org/x/time v0.0.0-20180412165947-fbb02b2291d2/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ= golang.org/x/time v0.0.0-20181108054448-85acf8d2951c/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ= golang.org/x/time v0.0.0-20190308202827-9d24e82272b4/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ= golang.org/x/time v0.0.0-20191024005414-555d28b269f0/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ= -golang.org/x/time v0.0.0-20200416051211-89c76fbcd5d1/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ= golang.org/x/time v0.0.0-20200630173020-3af7569d3a1e/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ= -golang.org/x/time v0.0.0-20210220033141-f8bda1e9f3ba/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ= -golang.org/x/time v0.0.0-20210723032227-1f47c861a9ac/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ= -golang.org/x/time v0.0.0-20220210224613-90d013bbcef8/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ= -golang.org/x/time v0.0.0-20220224211638-0e9765cccd65/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ= -golang.org/x/time v0.0.0-20220922220347-f3bd1da661af/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ= -golang.org/x/time v0.1.0/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ= golang.org/x/time v0.3.0 h1:rg5rLMjNzMS1RkNLzCG38eapWhnYLFYXDXj2gOlr8j4= golang.org/x/time v0.3.0/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ= golang.org/x/tools v0.0.0-20180221164845-07fd8470d635/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= -golang.org/x/tools v0.0.0-20180525024113-a5b4c53f6e8b/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= golang.org/x/tools v0.0.0-20180917221912-90fa682c2a6e/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= -golang.org/x/tools v0.0.0-20181011042414-1f849cf54d09/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= golang.org/x/tools v0.0.0-20181030221726-6c7e314b6563/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= golang.org/x/tools v0.0.0-20190114222345-bf090417da8b/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= -golang.org/x/tools v0.0.0-20190206041539-40960b6deb8e/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= golang.org/x/tools v0.0.0-20190226205152-f727befe758c/go.mod h1:9Yl7xja0Znq3iFh3HoIrodX9oNMXvdceNzlUR8zjMvY= golang.org/x/tools v0.0.0-20190311212946-11955173bddd/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs= golang.org/x/tools v0.0.0-20190312151545-0bb0c0a6e846/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs= @@ -3533,7 +2160,6 @@ golang.org/x/tools v0.0.0-20190416151739-9c9e1878f421/go.mod h1:LCzVGOaR6xXOjkQ3 golang.org/x/tools v0.0.0-20190420181800-aa740d480789/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs= golang.org/x/tools v0.0.0-20190422233926-fe54fb35175b/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs= golang.org/x/tools v0.0.0-20190425150028-36563e24a262/go.mod h1:RgjU9mgBXZiqYHBnxXauZ1Gv1EHHAz9KjViQ78xBX0Q= -golang.org/x/tools v0.0.0-20190425163242-31fd60d6bfdc/go.mod h1:RgjU9mgBXZiqYHBnxXauZ1Gv1EHHAz9KjViQ78xBX0Q= golang.org/x/tools v0.0.0-20190506145303-2d16b83fe98c/go.mod h1:RgjU9mgBXZiqYHBnxXauZ1Gv1EHHAz9KjViQ78xBX0Q= golang.org/x/tools v0.0.0-20190524140312-2c0ae7006135/go.mod h1:RgjU9mgBXZiqYHBnxXauZ1Gv1EHHAz9KjViQ78xBX0Q= golang.org/x/tools v0.0.0-20190531172133-b3315ee88b7d/go.mod h1:/rFqwRUd4F7ZHNgwSSTFct+R/Kf4OFW1sUzUTQQTgfc= @@ -3542,17 +2168,11 @@ golang.org/x/tools v0.0.0-20190614205625-5aca471b1d59/go.mod h1:/rFqwRUd4F7ZHNgw golang.org/x/tools v0.0.0-20190621195816-6e04913cbbac/go.mod h1:/rFqwRUd4F7ZHNgwSSTFct+R/Kf4OFW1sUzUTQQTgfc= golang.org/x/tools v0.0.0-20190624222133-a101b041ded4/go.mod h1:/rFqwRUd4F7ZHNgwSSTFct+R/Kf4OFW1sUzUTQQTgfc= golang.org/x/tools v0.0.0-20190628153133-6cdbf07be9d0/go.mod h1:/rFqwRUd4F7ZHNgwSSTFct+R/Kf4OFW1sUzUTQQTgfc= -golang.org/x/tools v0.0.0-20190706070813-72ffa07ba3db/go.mod h1:jcCCGcm9btYwXyDqrUWc6MKQKKGJCWEQ3AfLSRIbEuI= golang.org/x/tools v0.0.0-20190729092621-ff9f1409240a/go.mod h1:jcCCGcm9btYwXyDqrUWc6MKQKKGJCWEQ3AfLSRIbEuI= golang.org/x/tools v0.0.0-20190816200558-6889da9d5479/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo= -golang.org/x/tools v0.0.0-20190823170909-c4a336ef6a2f/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo= -golang.org/x/tools v0.0.0-20190907020128-2ca718005c18/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo= golang.org/x/tools v0.0.0-20190910044552-dd2b5c81c578/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo= golang.org/x/tools v0.0.0-20190911174233-4f2ddba30aff/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo= -golang.org/x/tools v0.0.0-20190927191325-030b2cf1153e/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo= golang.org/x/tools v0.0.0-20191012152004-8de300cfc20a/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo= -golang.org/x/tools v0.0.0-20191029041327-9cc4af7d6b2c/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo= -golang.org/x/tools v0.0.0-20191029190741-b9c20aec41a5/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo= golang.org/x/tools v0.0.0-20191108193012-7d206e10da11/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo= golang.org/x/tools v0.0.0-20191112195655-aa38f8e97acc/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo= golang.org/x/tools v0.0.0-20191113191852-77e3bb0ad9e7/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo= @@ -3563,7 +2183,6 @@ golang.org/x/tools v0.0.0-20191125144606-a911d9008d1f/go.mod h1:b+2E5dAYhXwXZwtn golang.org/x/tools v0.0.0-20191130070609-6e064ea0cf2d/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo= golang.org/x/tools v0.0.0-20191216173652-a0e659d51361/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28= golang.org/x/tools v0.0.0-20191227053925-7b8e75db28f4/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28= -golang.org/x/tools v0.0.0-20200103221440-774c71fcf114/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28= golang.org/x/tools v0.0.0-20200117161641-43d50277825c/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28= golang.org/x/tools v0.0.0-20200122220014-bf1340f18c4a/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28= golang.org/x/tools v0.0.0-20200130002326-2f3ba24bd6e7/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28= @@ -3582,7 +2201,6 @@ golang.org/x/tools v0.0.0-20200505023115-26f46d2f7ef8/go.mod h1:EkVYQZoAsY45+roY golang.org/x/tools v0.0.0-20200509030707-2212a7e161a5/go.mod h1:EkVYQZoAsY45+roYkvgYkIh4xh/qjgUK9TdY2XT94GE= golang.org/x/tools v0.0.0-20200512131952-2bc93b1c0c88/go.mod h1:EkVYQZoAsY45+roYkvgYkIh4xh/qjgUK9TdY2XT94GE= golang.org/x/tools v0.0.0-20200515010526-7d3b6ebf133d/go.mod h1:EkVYQZoAsY45+roYkvgYkIh4xh/qjgUK9TdY2XT94GE= -golang.org/x/tools v0.0.0-20200616133436-c1934b75d054/go.mod h1:EkVYQZoAsY45+roYkvgYkIh4xh/qjgUK9TdY2XT94GE= golang.org/x/tools v0.0.0-20200618134242-20370b0cb4b2/go.mod h1:EkVYQZoAsY45+roYkvgYkIh4xh/qjgUK9TdY2XT94GE= golang.org/x/tools v0.0.0-20200619180055-7c47624df98f/go.mod h1:EkVYQZoAsY45+roYkvgYkIh4xh/qjgUK9TdY2XT94GE= golang.org/x/tools v0.0.0-20200724022722-7017fd6b1305/go.mod h1:njjCfa9FT2d7l9Bc6FUM5FLjQPp3cFF28FI3qnDFljA= @@ -3591,11 +2209,9 @@ golang.org/x/tools v0.0.0-20200804011535-6c149bb5ef0d/go.mod h1:njjCfa9FT2d7l9Bc golang.org/x/tools v0.0.0-20200820010801-b793a1359eac/go.mod h1:njjCfa9FT2d7l9Bc6FUM5FLjQPp3cFF28FI3qnDFljA= golang.org/x/tools v0.0.0-20200825202427-b303f430e36d/go.mod h1:njjCfa9FT2d7l9Bc6FUM5FLjQPp3cFF28FI3qnDFljA= golang.org/x/tools v0.0.0-20200904185747-39188db58858/go.mod h1:Cj7w3i3Rnn0Xh82ur9kSqwfTHTeVxaDqrfMjpcNT6bE= -golang.org/x/tools v0.0.0-20200916195026-c9a70fc28ce3/go.mod h1:z6u4i615ZeAfBE4XtMziQW1fSVJXACjjbWkB/mvPzlU= golang.org/x/tools v0.0.0-20201001104356-43ebab892c4c/go.mod h1:z6u4i615ZeAfBE4XtMziQW1fSVJXACjjbWkB/mvPzlU= golang.org/x/tools v0.0.0-20201023174141-c8cfbd0f21e6/go.mod h1:emZCQorbCU4vsT4fOWvOPXz4eW1wZW4PmDk9uLelYpA= golang.org/x/tools v0.0.0-20201110124207-079ba7bd75cd/go.mod h1:emZCQorbCU4vsT4fOWvOPXz4eW1wZW4PmDk9uLelYpA= -golang.org/x/tools v0.0.0-20201124115921-2c860bdd6e78/go.mod h1:emZCQorbCU4vsT4fOWvOPXz4eW1wZW4PmDk9uLelYpA= golang.org/x/tools v0.0.0-20201201161351-ac6f37ff4c2a/go.mod h1:emZCQorbCU4vsT4fOWvOPXz4eW1wZW4PmDk9uLelYpA= golang.org/x/tools v0.0.0-20201208233053-a543418bbed2/go.mod h1:emZCQorbCU4vsT4fOWvOPXz4eW1wZW4PmDk9uLelYpA= golang.org/x/tools v0.0.0-20201224043029-2b0845dc783e/go.mod h1:emZCQorbCU4vsT4fOWvOPXz4eW1wZW4PmDk9uLelYpA= @@ -3610,22 +2226,16 @@ golang.org/x/tools v0.1.2/go.mod h1:o0xws9oXOQQZyjljx8fwUC0k7L1pTE6eaCbjGeHmOkk= golang.org/x/tools v0.1.3/go.mod h1:o0xws9oXOQQZyjljx8fwUC0k7L1pTE6eaCbjGeHmOkk= golang.org/x/tools v0.1.4/go.mod h1:o0xws9oXOQQZyjljx8fwUC0k7L1pTE6eaCbjGeHmOkk= golang.org/x/tools v0.1.5/go.mod h1:o0xws9oXOQQZyjljx8fwUC0k7L1pTE6eaCbjGeHmOkk= -golang.org/x/tools v0.1.6-0.20210726203631-07bc1bf47fb2/go.mod h1:o0xws9oXOQQZyjljx8fwUC0k7L1pTE6eaCbjGeHmOkk= golang.org/x/tools v0.1.9/go.mod h1:nABZi5QlRsZVlzPpHl034qft6wpY4eDcsTt5AaioBiU= golang.org/x/tools v0.1.10/go.mod h1:Uh6Zz+xoGYZom868N8YTex3t7RhtHDBrE8Gzo9bV56E= golang.org/x/tools v0.1.11/go.mod h1:SgwaegtQh8clINPpECJMqnxLv9I09HLqnW3RMqW0CA4= golang.org/x/tools v0.1.12/go.mod h1:hNGJHUnrk76NpqgfD5Aqm5Crs+Hm0VOH/i9J2+nxYbc= golang.org/x/tools v0.2.0/go.mod h1:y4OqIKeOV/fWJetJ8bXPU1sEVniLMIyDAZWeHdV+NTA= golang.org/x/tools v0.3.0/go.mod h1:/rWhSS2+zyEVwoJf8YAX6L2f0ntZ7Kn/mGgAWcipA5k= -golang.org/x/tools v0.4.0/go.mod h1:UE5sM2OK9E/d67R0ANs2xJizIymRP5gJU295PvKXxjQ= golang.org/x/tools v0.5.0/go.mod h1:N+Kgy78s5I24c24dU8OfWNEotWjutIs8SnJvn5IDq+k= golang.org/x/tools v0.6.0/go.mod h1:Xwgl3UAJ/d3gWutnCtw505GrjyAbvKui8lOU390QaIU= -golang.org/x/tools v0.7.0/go.mod h1:4pg6aUX35JBAogB10C9AtvVL+qowtN4pT3CGSQex14s= -golang.org/x/tools v0.8.0/go.mod h1:JxBZ99ISMI5ViVkT1tr6tdNmXeTrcpVSD3vZ1RsRdN4= golang.org/x/tools v0.9.3 h1:Gn1I8+64MsuTb/HpH+LmQtNas23LhUVr3rYZ0eKuaMM= golang.org/x/tools v0.9.3/go.mod h1:owI94Op576fPu3cIGQeHs3joujW/2Oc6MtlxbF5dfNc= -golang.org/x/xerrors v0.0.0-20190410155217-1f06c39b4373/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0= -golang.org/x/xerrors v0.0.0-20190513163551-3ee3066db522/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0= golang.org/x/xerrors v0.0.0-20190717185122-a985d3407aa7/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0= golang.org/x/xerrors v0.0.0-20191011141410-1b5146add898/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0= golang.org/x/xerrors v0.0.0-20191204190536-9bdfabe68543/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0= @@ -3637,14 +2247,6 @@ golang.org/x/xerrors v0.0.0-20220907171357-04be3eba64a2 h1:H2TDz8ibqkAF6YGhCdN3j golang.org/x/xerrors v0.0.0-20220907171357-04be3eba64a2/go.mod h1:K8+ghG5WaK9qNqU5K3HdILfMLy1f3aNYFI/wnl100a8= gomodules.xyz/jsonpatch/v2 v2.2.0 h1:4pT439QV83L+G9FkcCriY6EkpcK6r6bK+A5FBUMI7qY= gomodules.xyz/jsonpatch/v2 v2.2.0/go.mod h1:WXp+iVDkoLQqPudfQ9GBlwB2eZ5DKOnjQZCYdOS8GPY= -gonum.org/v1/gonum v0.0.0-20180816165407-929014505bf4/go.mod h1:Y+Yx5eoAFn32cQvJDxZx5Dpnq+c3wtXuadVZAcxbbBo= -gonum.org/v1/gonum v0.8.2/go.mod h1:oe/vMfY3deqTw+1EZJhuvEW2iwGF1bW9wwu7XCu0+v0= -gonum.org/v1/gonum v0.9.3/go.mod h1:TZumC3NeyVQskjXqmyWt4S3bINhy7B4eYwW69EbyX+0= -gonum.org/v1/gonum v0.11.0/go.mod h1:fSG4YDCxxUZQJ7rKsQrj0gMOg00Il0Z96/qMA4bVQhA= -gonum.org/v1/netlib v0.0.0-20190313105609-8cb42192e0e0/go.mod h1:wa6Ws7BG/ESfp6dHfk7C6KdzKA7wR7u/rKwOGE66zvw= -gonum.org/v1/plot v0.0.0-20190515093506-e2840ee46a6b/go.mod h1:Wt8AAjI+ypCyYX3nZBvf6cAIx93T+c/OS2HFAYskSZc= -gonum.org/v1/plot v0.9.0/go.mod h1:3Pcqqmp6RHvJI72kgb8fThyUnav364FOsdDo2aGW5lY= -gonum.org/v1/plot v0.10.1/go.mod h1:VZW5OlhkL1mysU9vaqNHnsy86inf6Ot+jB3r+BczCEo= google.golang.org/api v0.0.0-20160322025152-9bf6e6e569ff/go.mod h1:4mhQ8q/RsB7i+udVvVy5NUi08OU8ZlA0gRVgrF7VFY0= google.golang.org/api v0.4.0/go.mod h1:8k5glujaEP+g9n7WNsDg8QP6cUVNI86fCNMcbazEtwE= google.golang.org/api v0.7.0/go.mod h1:WtwebWUNSVBH/HAw79HIFXZNqEvBhG+Ra+ax0hx3E3M= @@ -3678,8 +2280,6 @@ google.golang.org/api v0.54.0/go.mod h1:7C4bFFOvVDGXjfDTAsgGwDgAxRDeQ4X8NvUedIt6 google.golang.org/api v0.55.0/go.mod h1:38yMfeP1kfjsl8isn0tliTjIb1rJXcQi4UXlbqivdVE= google.golang.org/api v0.56.0/go.mod h1:38yMfeP1kfjsl8isn0tliTjIb1rJXcQi4UXlbqivdVE= google.golang.org/api v0.57.0/go.mod h1:dVPlbZyBo2/OjBpmvNdpn2GRm6rPy75jyU7bmhdrMgI= -google.golang.org/api v0.58.0/go.mod h1:cAbP2FsxoGVNwtgNAmmn3y5G1TWAiVYRmg4yku3lv+E= -google.golang.org/api v0.59.0/go.mod h1:sT2boj7M9YJxZzgeZqXogmhfmRWDtPzT31xkieUbuZU= google.golang.org/api v0.61.0/go.mod h1:xQRti5UdCmoCEqFxcz93fTl338AVqDgyaDRuOZ3hg9I= google.golang.org/api v0.63.0/go.mod h1:gs4ij2ffTRXwuzzgJl/56BdwJaA194ijkfn++9tDuPo= google.golang.org/api v0.67.0/go.mod h1:ShHKP8E60yPsKNw/w8w+VYaj9H6buA5UqDp8dhbQZ6g= @@ -3687,37 +2287,12 @@ google.golang.org/api v0.70.0/go.mod h1:Bs4ZM2HGifEvXwd50TtW70ovgJffJYw2oRCOFU/S google.golang.org/api v0.71.0/go.mod h1:4PyU6e6JogV1f9eA4voyrTY2batOLdgZ5qZ5HOCc4j8= google.golang.org/api v0.74.0/go.mod h1:ZpfMZOVRMywNyvJFeqL9HRWBgAuRfSjJFpe9QtRRyDs= google.golang.org/api v0.75.0/go.mod h1:pU9QmyHLnzlpar1Mjt4IbapUCy8J+6HD6GeELN69ljA= -google.golang.org/api v0.77.0/go.mod h1:pU9QmyHLnzlpar1Mjt4IbapUCy8J+6HD6GeELN69ljA= google.golang.org/api v0.78.0/go.mod h1:1Sg78yoMLOhlQTeF+ARBoytAcH1NNyyl390YMy6rKmw= google.golang.org/api v0.80.0/go.mod h1:xY3nI94gbvBrE0J6NHXhxOmW97HG7Khjkku6AFB3Hyg= -google.golang.org/api v0.81.0/go.mod h1:FA6Mb/bZxj706H2j+j2d6mHEEaHBmbbWnkfvmorOCko= google.golang.org/api v0.84.0/go.mod h1:NTsGnUFJMYROtiquksZHBWtHfeMC7iYthki7Eq3pa8o= -google.golang.org/api v0.85.0/go.mod h1:AqZf8Ep9uZ2pyTvgL+x0D3Zt0eoT9b5E8fmzfu6FO2g= -google.golang.org/api v0.90.0/go.mod h1:+Sem1dnrKlrXMR/X0bPnMWyluQe4RsNoYfmNLhOIkzw= google.golang.org/api v0.93.0/go.mod h1:+Sem1dnrKlrXMR/X0bPnMWyluQe4RsNoYfmNLhOIkzw= -google.golang.org/api v0.95.0/go.mod h1:eADj+UBuxkh5zlrSntJghuNeg8HwQ1w5lTKkuqaETEI= -google.golang.org/api v0.96.0/go.mod h1:w7wJQLTM+wvQpNf5JyEcBoxK0RH7EDrh/L4qfsuJ13s= -google.golang.org/api v0.97.0/go.mod h1:w7wJQLTM+wvQpNf5JyEcBoxK0RH7EDrh/L4qfsuJ13s= -google.golang.org/api v0.98.0/go.mod h1:w7wJQLTM+wvQpNf5JyEcBoxK0RH7EDrh/L4qfsuJ13s= -google.golang.org/api v0.99.0/go.mod h1:1YOf74vkVndF7pG6hIHuINsM7eWwpVTAfNMNiL91A08= -google.golang.org/api v0.100.0/go.mod h1:ZE3Z2+ZOr87Rx7dqFsdRQkRBk36kDtp/h+QpHbB7a70= -google.golang.org/api v0.102.0/go.mod h1:3VFl6/fzoA+qNuS1N1/VfXY4LjoXN/wzeIp7TweWwGo= -google.golang.org/api v0.103.0/go.mod h1:hGtW6nK1AC+d9si/UBhw8Xli+QMOf6xyNAyJw4qU9w0= -google.golang.org/api v0.106.0/go.mod h1:2Ts0XTHNVWxypznxWOYUeI4g3WdP9Pk2Qk58+a/O9MY= -google.golang.org/api v0.107.0/go.mod h1:2Ts0XTHNVWxypznxWOYUeI4g3WdP9Pk2Qk58+a/O9MY= -google.golang.org/api v0.108.0/go.mod h1:2Ts0XTHNVWxypznxWOYUeI4g3WdP9Pk2Qk58+a/O9MY= -google.golang.org/api v0.110.0/go.mod h1:7FC4Vvx1Mooxh8C5HWjzZHcavuS2f6pmJpZx60ca7iI= -google.golang.org/api v0.111.0/go.mod h1:qtFHvU9mhgTJegR31csQ+rwxyUTHOKFqCKWp1J0fdw0= -google.golang.org/api v0.114.0/go.mod h1:ifYI2ZsFK6/uGddGfAD5BMxlnkBqCmqHSDUVi45N5Yg= -google.golang.org/api v0.118.0/go.mod h1:76TtD3vkgmZ66zZzp72bUUklpmQmKlhh6sYtIjYK+5E= -google.golang.org/api v0.122.0/go.mod h1:gcitW0lvnyWjSp9nKxAbdHKIZ6vF4aajGueeslZOyms= -google.golang.org/api v0.123.0/go.mod h1:gcitW0lvnyWjSp9nKxAbdHKIZ6vF4aajGueeslZOyms= -google.golang.org/api v0.124.0/go.mod h1:xu2HQurE5gi/3t1aFCvhPD781p0a3p11sdunTJ2BlP4= -google.golang.org/api v0.125.0/go.mod h1:mBwVAtz+87bEN6CbA1GtZPDOqY2R5ONPqJeIlvyo4Aw= -google.golang.org/api v0.126.0/go.mod h1:mBwVAtz+87bEN6CbA1GtZPDOqY2R5ONPqJeIlvyo4Aw= -google.golang.org/api v0.128.0/go.mod h1:Y611qgqaE92On/7g65MQgxYul3c0rEB894kniWLY750= -google.golang.org/api v0.132.0 h1:8t2/+qZ26kAOGSmOiHwVycqVaDg7q3JDILrNi/Z6rvc= -google.golang.org/api v0.132.0/go.mod h1:AeTBC6GpJnJSRJjktDcPX0QwtS8pGYZOV6MSuSCusw0= +google.golang.org/api v0.134.0 h1:ktL4Goua+UBgoP1eL1/60LwZJqa1sIzkLmvoR3hR6Gw= +google.golang.org/api v0.134.0/go.mod h1:sjRL3UnjTx5UqNQS9EWr9N8p7xbHpy1k0XGRLCf3Spk= google.golang.org/appengine v1.1.0/go.mod h1:EbEs0AVv82hx2wNQdGPgUI5lhzA/G0D9YwlJXL52JkM= google.golang.org/appengine v1.4.0/go.mod h1:xpcJRLb0r/rnEns0DIKYYv+WjYCduHsrkT7/EB5XEv4= google.golang.org/appengine v1.5.0/go.mod h1:xpcJRLb0r/rnEns0DIKYYv+WjYCduHsrkT7/EB5XEv4= @@ -3750,7 +2325,6 @@ google.golang.org/genproto v0.0.0-20200228133532-8c2c7df3a383/go.mod h1:55QSHmfG google.golang.org/genproto v0.0.0-20200305110556-506484158171/go.mod h1:55QSHmfGQM9UVYDPBsyGGes0y52j32PQ3BqQfXhyH3c= google.golang.org/genproto v0.0.0-20200312145019-da6875a35672/go.mod h1:55QSHmfGQM9UVYDPBsyGGes0y52j32PQ3BqQfXhyH3c= google.golang.org/genproto v0.0.0-20200331122359-1ee6d9798940/go.mod h1:55QSHmfGQM9UVYDPBsyGGes0y52j32PQ3BqQfXhyH3c= -google.golang.org/genproto v0.0.0-20200423170343-7949de9c1215/go.mod h1:55QSHmfGQM9UVYDPBsyGGes0y52j32PQ3BqQfXhyH3c= google.golang.org/genproto v0.0.0-20200430143042-b979b6f78d84/go.mod h1:55QSHmfGQM9UVYDPBsyGGes0y52j32PQ3BqQfXhyH3c= google.golang.org/genproto v0.0.0-20200511104702-f5ebc3bea380/go.mod h1:55QSHmfGQM9UVYDPBsyGGes0y52j32PQ3BqQfXhyH3c= google.golang.org/genproto v0.0.0-20200513103714-09dca8ec2884/go.mod h1:55QSHmfGQM9UVYDPBsyGGes0y52j32PQ3BqQfXhyH3c= @@ -3762,7 +2336,6 @@ google.golang.org/genproto v0.0.0-20200729003335-053ba62fc06f/go.mod h1:FWY/as6D google.golang.org/genproto v0.0.0-20200804131852-c06518451d9c/go.mod h1:FWY/as6DDZQgahTzZj3fqbO1CbirC29ZNUFHwi0/+no= google.golang.org/genproto v0.0.0-20200825200019-8632dd797987/go.mod h1:FWY/as6DDZQgahTzZj3fqbO1CbirC29ZNUFHwi0/+no= google.golang.org/genproto v0.0.0-20200904004341-0bd0a958aa1d/go.mod h1:FWY/as6DDZQgahTzZj3fqbO1CbirC29ZNUFHwi0/+no= -google.golang.org/genproto v0.0.0-20201019141844-1ed22bb0c154/go.mod h1:FWY/as6DDZQgahTzZj3fqbO1CbirC29ZNUFHwi0/+no= google.golang.org/genproto v0.0.0-20201109203340-2640f1f9cdfb/go.mod h1:FWY/as6DDZQgahTzZj3fqbO1CbirC29ZNUFHwi0/+no= google.golang.org/genproto v0.0.0-20201110150050-8816d57aaa9a/go.mod h1:FWY/as6DDZQgahTzZj3fqbO1CbirC29ZNUFHwi0/+no= google.golang.org/genproto v0.0.0-20201201144952-b05cb90ed32e/go.mod h1:FWY/as6DDZQgahTzZj3fqbO1CbirC29ZNUFHwi0/+no= @@ -3793,12 +2366,7 @@ google.golang.org/genproto v0.0.0-20210828152312-66f60bf46e71/go.mod h1:eFjDcFEc google.golang.org/genproto v0.0.0-20210831024726-fe130286e0e2/go.mod h1:eFjDcFEctNawg4eG61bRv87N7iHBWyVhJu7u1kqDUXY= google.golang.org/genproto v0.0.0-20210903162649-d08c68adba83/go.mod h1:eFjDcFEctNawg4eG61bRv87N7iHBWyVhJu7u1kqDUXY= google.golang.org/genproto v0.0.0-20210909211513-a8c4777a87af/go.mod h1:eFjDcFEctNawg4eG61bRv87N7iHBWyVhJu7u1kqDUXY= -google.golang.org/genproto v0.0.0-20210917145530-b395a37504d4/go.mod h1:eFjDcFEctNawg4eG61bRv87N7iHBWyVhJu7u1kqDUXY= -google.golang.org/genproto v0.0.0-20210921142501-181ce0d877f6/go.mod h1:5CzLGKJ67TSI2B9POpiiyGha0AjJvZIUgRMt1dSmuhc= google.golang.org/genproto v0.0.0-20210924002016-3dee208752a0/go.mod h1:5CzLGKJ67TSI2B9POpiiyGha0AjJvZIUgRMt1dSmuhc= -google.golang.org/genproto v0.0.0-20211008145708-270636b82663/go.mod h1:5CzLGKJ67TSI2B9POpiiyGha0AjJvZIUgRMt1dSmuhc= -google.golang.org/genproto v0.0.0-20211018162055-cf77aa76bad2/go.mod h1:5CzLGKJ67TSI2B9POpiiyGha0AjJvZIUgRMt1dSmuhc= -google.golang.org/genproto v0.0.0-20211028162531-8db9c33dc351/go.mod h1:5CzLGKJ67TSI2B9POpiiyGha0AjJvZIUgRMt1dSmuhc= google.golang.org/genproto v0.0.0-20211118181313-81c1377c94b1/go.mod h1:5CzLGKJ67TSI2B9POpiiyGha0AjJvZIUgRMt1dSmuhc= google.golang.org/genproto v0.0.0-20211206160659-862468c7d6e0/go.mod h1:5CzLGKJ67TSI2B9POpiiyGha0AjJvZIUgRMt1dSmuhc= google.golang.org/genproto v0.0.0-20211208223120-3a66f561d7aa/go.mod h1:5CzLGKJ67TSI2B9POpiiyGha0AjJvZIUgRMt1dSmuhc= @@ -3811,87 +2379,25 @@ google.golang.org/genproto v0.0.0-20220222213610-43724f9ea8cf/go.mod h1:kGP+zUP2 google.golang.org/genproto v0.0.0-20220304144024-325a89244dc8/go.mod h1:kGP+zUP2Ddo0ayMi4YuN7C3WZyJvGLZRh8Z5wnAqvEI= google.golang.org/genproto v0.0.0-20220310185008-1973136f34c6/go.mod h1:kGP+zUP2Ddo0ayMi4YuN7C3WZyJvGLZRh8Z5wnAqvEI= google.golang.org/genproto v0.0.0-20220324131243-acbaeb5b85eb/go.mod h1:hAL49I2IFola2sVEjAn7MEwsja0xp51I0tlGAf9hz4E= -google.golang.org/genproto v0.0.0-20220329172620-7be39ac1afc7/go.mod h1:8w6bsBMX6yCPbAVTeqQHvzxW0EIFigd5lZyahWgyfDo= google.golang.org/genproto v0.0.0-20220407144326-9054f6ed7bac/go.mod h1:8w6bsBMX6yCPbAVTeqQHvzxW0EIFigd5lZyahWgyfDo= google.golang.org/genproto v0.0.0-20220413183235-5e96e2839df9/go.mod h1:8w6bsBMX6yCPbAVTeqQHvzxW0EIFigd5lZyahWgyfDo= google.golang.org/genproto v0.0.0-20220414192740-2d67ff6cf2b4/go.mod h1:8w6bsBMX6yCPbAVTeqQHvzxW0EIFigd5lZyahWgyfDo= google.golang.org/genproto v0.0.0-20220421151946-72621c1f0bd3/go.mod h1:8w6bsBMX6yCPbAVTeqQHvzxW0EIFigd5lZyahWgyfDo= google.golang.org/genproto v0.0.0-20220429170224-98d788798c3e/go.mod h1:8w6bsBMX6yCPbAVTeqQHvzxW0EIFigd5lZyahWgyfDo= -google.golang.org/genproto v0.0.0-20220502173005-c8bf987b8c21/go.mod h1:RAyBrSAP7Fh3Nc84ghnVLDPuV51xc9agzmm4Ph6i0Q4= google.golang.org/genproto v0.0.0-20220505152158-f39f71e6c8f3/go.mod h1:RAyBrSAP7Fh3Nc84ghnVLDPuV51xc9agzmm4Ph6i0Q4= google.golang.org/genproto v0.0.0-20220518221133-4f43b3371335/go.mod h1:RAyBrSAP7Fh3Nc84ghnVLDPuV51xc9agzmm4Ph6i0Q4= -google.golang.org/genproto v0.0.0-20220519153652-3a47de7e79bd/go.mod h1:RAyBrSAP7Fh3Nc84ghnVLDPuV51xc9agzmm4Ph6i0Q4= google.golang.org/genproto v0.0.0-20220523171625-347a074981d8/go.mod h1:RAyBrSAP7Fh3Nc84ghnVLDPuV51xc9agzmm4Ph6i0Q4= google.golang.org/genproto v0.0.0-20220608133413-ed9918b62aac/go.mod h1:KEWEmljWE5zPzLBa/oHl6DaEt9LmfH6WtH1OHIvleBA= google.golang.org/genproto v0.0.0-20220616135557-88e70c0c3a90/go.mod h1:KEWEmljWE5zPzLBa/oHl6DaEt9LmfH6WtH1OHIvleBA= google.golang.org/genproto v0.0.0-20220617124728-180714bec0ad/go.mod h1:KEWEmljWE5zPzLBa/oHl6DaEt9LmfH6WtH1OHIvleBA= google.golang.org/genproto v0.0.0-20220624142145-8cd45d7dbd1f/go.mod h1:KEWEmljWE5zPzLBa/oHl6DaEt9LmfH6WtH1OHIvleBA= -google.golang.org/genproto v0.0.0-20220628213854-d9e0b6570c03/go.mod h1:KEWEmljWE5zPzLBa/oHl6DaEt9LmfH6WtH1OHIvleBA= -google.golang.org/genproto v0.0.0-20220722212130-b98a9ff5e252/go.mod h1:GkXuJDJ6aQ7lnJcRF+SJVgFdQhypqgl3LB1C9vabdRE= -google.golang.org/genproto v0.0.0-20220801145646-83ce21fca29f/go.mod h1:iHe1svFLAZg9VWz891+QbRMwUv9O/1Ww+/mngYeThbc= google.golang.org/genproto v0.0.0-20220815135757-37a418bb8959/go.mod h1:dbqgFATTzChvnt+ujMdZwITVAJHFtfyN1qUhDqEiIlk= -google.golang.org/genproto v0.0.0-20220817144833-d7fd3f11b9b1/go.mod h1:dbqgFATTzChvnt+ujMdZwITVAJHFtfyN1qUhDqEiIlk= -google.golang.org/genproto v0.0.0-20220822174746-9e6da59bd2fc/go.mod h1:dbqgFATTzChvnt+ujMdZwITVAJHFtfyN1qUhDqEiIlk= -google.golang.org/genproto v0.0.0-20220829144015-23454907ede3/go.mod h1:dbqgFATTzChvnt+ujMdZwITVAJHFtfyN1qUhDqEiIlk= -google.golang.org/genproto v0.0.0-20220829175752-36a9c930ecbf/go.mod h1:dbqgFATTzChvnt+ujMdZwITVAJHFtfyN1qUhDqEiIlk= -google.golang.org/genproto v0.0.0-20220913154956-18f8339a66a5/go.mod h1:0Nb8Qy+Sk5eDzHnzlStwW3itdNaWoZA5XeSG+R3JHSo= -google.golang.org/genproto v0.0.0-20220914142337-ca0e39ece12f/go.mod h1:0Nb8Qy+Sk5eDzHnzlStwW3itdNaWoZA5XeSG+R3JHSo= -google.golang.org/genproto v0.0.0-20220915135415-7fd63a7952de/go.mod h1:0Nb8Qy+Sk5eDzHnzlStwW3itdNaWoZA5XeSG+R3JHSo= -google.golang.org/genproto v0.0.0-20220916172020-2692e8806bfa/go.mod h1:0Nb8Qy+Sk5eDzHnzlStwW3itdNaWoZA5XeSG+R3JHSo= -google.golang.org/genproto v0.0.0-20220919141832-68c03719ef51/go.mod h1:0Nb8Qy+Sk5eDzHnzlStwW3itdNaWoZA5XeSG+R3JHSo= -google.golang.org/genproto v0.0.0-20220920201722-2b89144ce006/go.mod h1:ht8XFiar2npT/g4vkk7O0WYS1sHOHbdujxbEp7CJWbw= -google.golang.org/genproto v0.0.0-20220926165614-551eb538f295/go.mod h1:woMGP53BroOrRY3xTxlbr8Y3eB/nzAvvFM83q7kG2OI= -google.golang.org/genproto v0.0.0-20220926220553-6981cbe3cfce/go.mod h1:woMGP53BroOrRY3xTxlbr8Y3eB/nzAvvFM83q7kG2OI= -google.golang.org/genproto v0.0.0-20221010155953-15ba04fc1c0e/go.mod h1:3526vdqwhZAwq4wsRUaVG555sVgsNmIjRtO7t/JH29U= -google.golang.org/genproto v0.0.0-20221014173430-6e2ab493f96b/go.mod h1:1vXfmgAz9N9Jx0QA82PqRVauvCz1SGSz739p0f183jM= -google.golang.org/genproto v0.0.0-20221014213838-99cd37c6964a/go.mod h1:1vXfmgAz9N9Jx0QA82PqRVauvCz1SGSz739p0f183jM= -google.golang.org/genproto v0.0.0-20221024153911-1573dae28c9c/go.mod h1:9qHF0xnpdSfF6knlcsnpzUu5y+rpwgbvsyGAZPBMg4s= -google.golang.org/genproto v0.0.0-20221024183307-1bc688fe9f3e/go.mod h1:9qHF0xnpdSfF6knlcsnpzUu5y+rpwgbvsyGAZPBMg4s= -google.golang.org/genproto v0.0.0-20221027153422-115e99e71e1c/go.mod h1:CGI5F/G+E5bKwmfYo09AXuVN4dD894kIKUFmVbP2/Fo= -google.golang.org/genproto v0.0.0-20221109142239-94d6d90a7d66/go.mod h1:rZS5c/ZVYMaOGBfO68GWtjOw/eLaZM1X6iVtgjZ+EWg= -google.golang.org/genproto v0.0.0-20221114212237-e4508ebdbee1/go.mod h1:rZS5c/ZVYMaOGBfO68GWtjOw/eLaZM1X6iVtgjZ+EWg= -google.golang.org/genproto v0.0.0-20221117204609-8f9c96812029/go.mod h1:rZS5c/ZVYMaOGBfO68GWtjOw/eLaZM1X6iVtgjZ+EWg= -google.golang.org/genproto v0.0.0-20221118155620-16455021b5e6/go.mod h1:rZS5c/ZVYMaOGBfO68GWtjOw/eLaZM1X6iVtgjZ+EWg= -google.golang.org/genproto v0.0.0-20221201164419-0e50fba7f41c/go.mod h1:rZS5c/ZVYMaOGBfO68GWtjOw/eLaZM1X6iVtgjZ+EWg= -google.golang.org/genproto v0.0.0-20221201204527-e3fa12d562f3/go.mod h1:rZS5c/ZVYMaOGBfO68GWtjOw/eLaZM1X6iVtgjZ+EWg= -google.golang.org/genproto v0.0.0-20221202195650-67e5cbc046fd/go.mod h1:cTsE614GARnxrLsqKREzmNYJACSWWpAWdNMwnD7c2BE= -google.golang.org/genproto v0.0.0-20221227171554-f9683d7f8bef/go.mod h1:RGgjbofJ8xD9Sq1VVhDM1Vok1vRONV+rg+CjzG4SZKM= -google.golang.org/genproto v0.0.0-20230110181048-76db0878b65f/go.mod h1:RGgjbofJ8xD9Sq1VVhDM1Vok1vRONV+rg+CjzG4SZKM= -google.golang.org/genproto v0.0.0-20230112194545-e10362b5ecf9/go.mod h1:RGgjbofJ8xD9Sq1VVhDM1Vok1vRONV+rg+CjzG4SZKM= -google.golang.org/genproto v0.0.0-20230113154510-dbe35b8444a5/go.mod h1:RGgjbofJ8xD9Sq1VVhDM1Vok1vRONV+rg+CjzG4SZKM= -google.golang.org/genproto v0.0.0-20230123190316-2c411cf9d197/go.mod h1:RGgjbofJ8xD9Sq1VVhDM1Vok1vRONV+rg+CjzG4SZKM= -google.golang.org/genproto v0.0.0-20230124163310-31e0e69b6fc2/go.mod h1:RGgjbofJ8xD9Sq1VVhDM1Vok1vRONV+rg+CjzG4SZKM= -google.golang.org/genproto v0.0.0-20230125152338-dcaf20b6aeaa/go.mod h1:RGgjbofJ8xD9Sq1VVhDM1Vok1vRONV+rg+CjzG4SZKM= -google.golang.org/genproto v0.0.0-20230127162408-596548ed4efa/go.mod h1:RGgjbofJ8xD9Sq1VVhDM1Vok1vRONV+rg+CjzG4SZKM= -google.golang.org/genproto v0.0.0-20230209215440-0dfe4f8abfcc/go.mod h1:RGgjbofJ8xD9Sq1VVhDM1Vok1vRONV+rg+CjzG4SZKM= -google.golang.org/genproto v0.0.0-20230216225411-c8e22ba71e44/go.mod h1:8B0gmkoRebU8ukX6HP+4wrVQUY1+6PkQ44BSyIlflHA= -google.golang.org/genproto v0.0.0-20230222225845-10f96fb3dbec/go.mod h1:3Dl5ZL0q0isWJt+FVcfpQyirqemEuLAK/iFvg1UP1Hw= -google.golang.org/genproto v0.0.0-20230223222841-637eb2293923/go.mod h1:3Dl5ZL0q0isWJt+FVcfpQyirqemEuLAK/iFvg1UP1Hw= -google.golang.org/genproto v0.0.0-20230303212802-e74f57abe488/go.mod h1:TvhZT5f700eVlTNwND1xoEZQeWTB2RY/65kplwl/bFA= -google.golang.org/genproto v0.0.0-20230306155012-7f2fa6fef1f4/go.mod h1:NWraEVixdDnqcqQ30jipen1STv2r/n24Wb7twVTGR4s= -google.golang.org/genproto v0.0.0-20230320184635-7606e756e683/go.mod h1:NWraEVixdDnqcqQ30jipen1STv2r/n24Wb7twVTGR4s= -google.golang.org/genproto v0.0.0-20230323212658-478b75c54725/go.mod h1:UUQDJDOlWu4KYeJZffbWgBkS1YFobzKbLVfK69pe0Ak= -google.golang.org/genproto v0.0.0-20230330154414-c0448cd141ea/go.mod h1:UUQDJDOlWu4KYeJZffbWgBkS1YFobzKbLVfK69pe0Ak= -google.golang.org/genproto v0.0.0-20230331144136-dcfb400f0633/go.mod h1:UUQDJDOlWu4KYeJZffbWgBkS1YFobzKbLVfK69pe0Ak= -google.golang.org/genproto v0.0.0-20230403163135-c38d8f061ccd/go.mod h1:UUQDJDOlWu4KYeJZffbWgBkS1YFobzKbLVfK69pe0Ak= -google.golang.org/genproto v0.0.0-20230410155749-daa745c078e1/go.mod h1:nKE/iIaLqn2bQwXBg8f1g2Ylh6r5MN5CmZvuzZCgsCU= -google.golang.org/genproto v0.0.0-20230525234025-438c736192d0/go.mod h1:9ExIQyXL5hZrHzQceCwuSYwZZ5QZBazOcprJ5rgs3lY= -google.golang.org/genproto v0.0.0-20230530153820-e85fd2cbaebc/go.mod h1:xZnkP7mREFX5MORlOPEzLMr+90PPZQ2QWzrVTWfAq64= -google.golang.org/genproto v0.0.0-20230717213848-3f92550aa753 h1:+VoAg+OKmWaommL56xmZSE2sUK8A7m6SUO7X89F2tbw= -google.golang.org/genproto v0.0.0-20230717213848-3f92550aa753/go.mod h1:iqkVr8IRpZ53gx1dEnWlCUIEwDWqWARWrbzpasaTNYM= -google.golang.org/genproto/googleapis/api v0.0.0-20230525234020-1aefcd67740a/go.mod h1:ts19tUU+Z0ZShN1y3aPyq2+O3d5FUNNgT6FtOzmrNn8= -google.golang.org/genproto/googleapis/api v0.0.0-20230525234035-dd9d682886f9/go.mod h1:vHYtlOoi6TsQ3Uk2yxR7NI5z8uoV+3pZtR4jmHIkRig= -google.golang.org/genproto/googleapis/api v0.0.0-20230526203410-71b5a4ffd15e/go.mod h1:vHYtlOoi6TsQ3Uk2yxR7NI5z8uoV+3pZtR4jmHIkRig= -google.golang.org/genproto/googleapis/api v0.0.0-20230530153820-e85fd2cbaebc/go.mod h1:vHYtlOoi6TsQ3Uk2yxR7NI5z8uoV+3pZtR4jmHIkRig= -google.golang.org/genproto/googleapis/api v0.0.0-20230717213848-3f92550aa753 h1:lCbbUxUDD+DiXx9Q6F/ttL0aAu7N2pz8XnmMm8ZW4NE= -google.golang.org/genproto/googleapis/api v0.0.0-20230717213848-3f92550aa753/go.mod h1:rsr7RhLuwsDKL7RmgDDCUc6yaGr1iqceVb5Wv6f6YvQ= -google.golang.org/genproto/googleapis/bytestream v0.0.0-20230530153820-e85fd2cbaebc/go.mod h1:ylj+BE99M198VPbBh6A8d9n3w8fChvyLK3wwBOjXBFA= -google.golang.org/genproto/googleapis/rpc v0.0.0-20230525234015-3fc162c6f38a/go.mod h1:xURIpW9ES5+/GZhnV6beoEtxQrnkRGIfP5VQG2tCBLc= -google.golang.org/genproto/googleapis/rpc v0.0.0-20230525234030-28d5490b6b19/go.mod h1:66JfowdXAEgad5O9NnYcsNPLCPZJD++2L9X0PCMODrA= -google.golang.org/genproto/googleapis/rpc v0.0.0-20230526203410-71b5a4ffd15e/go.mod h1:66JfowdXAEgad5O9NnYcsNPLCPZJD++2L9X0PCMODrA= -google.golang.org/genproto/googleapis/rpc v0.0.0-20230530153820-e85fd2cbaebc/go.mod h1:66JfowdXAEgad5O9NnYcsNPLCPZJD++2L9X0PCMODrA= -google.golang.org/genproto/googleapis/rpc v0.0.0-20230717213848-3f92550aa753 h1:XUODHrpzJEUeWmVo/jfNTLj0YyVveOo28oE6vkFbkO4= -google.golang.org/genproto/googleapis/rpc v0.0.0-20230717213848-3f92550aa753/go.mod h1:TUfxEVdsvPg18p6AslUXFoLdpED4oBnGwyqk3dV1XzM= +google.golang.org/genproto v0.0.0-20230731193218-e0aa005b6bdf h1:v5Cf4E9+6tawYrs/grq1q1hFpGtzlGFzgWHqwt6NFiU= +google.golang.org/genproto v0.0.0-20230731193218-e0aa005b6bdf/go.mod h1:oH/ZOT02u4kWEp7oYBGYFFkCdKS/uYR9Z7+0/xuuFp8= +google.golang.org/genproto/googleapis/api v0.0.0-20230731193218-e0aa005b6bdf h1:xkVZ5FdZJF4U82Q/JS+DcZA83s/GRVL+QrFMlexk9Yo= +google.golang.org/genproto/googleapis/api v0.0.0-20230731193218-e0aa005b6bdf/go.mod h1:5DZzOUPCLYL3mNkQ0ms0F3EuUNZ7py1Bqeq6sxzI7/Q= +google.golang.org/genproto/googleapis/rpc v0.0.0-20230731193218-e0aa005b6bdf h1:guOdSPaeFgN+jEJwTo1dQ71hdBm+yKSCCKuTRkJzcVo= +google.golang.org/genproto/googleapis/rpc v0.0.0-20230731193218-e0aa005b6bdf/go.mod h1:zBEcrKX2ZOcEkHWxBPAIvYUWOKKMIhYcmNiUIu2ji3I= google.golang.org/grpc v0.0.0-20160317175043-d3ddb4469d5a/go.mod h1:yo6s7OP7yaDglbqo1J04qKzAhqBH6lvTonzMVmEdcZw= google.golang.org/grpc v1.19.0/go.mod h1:mqu4LbDTu4XGKhr4mRzUsmM4RtVoemTSY81AxZiDr8c= google.golang.org/grpc v1.20.1/go.mod h1:10oTOabMzJvdu6/UiuZezV6QK5dSlG84ov/aaiqXj38= @@ -3923,26 +2429,14 @@ google.golang.org/grpc v1.39.1/go.mod h1:PImNr+rS9TWYb2O4/emRugxiyHZ5JyHW5F+RPnD google.golang.org/grpc v1.40.0/go.mod h1:ogyxbiOoUXAkP+4+xa6PZSE9DZgIHtSpzjDTB9KAK34= google.golang.org/grpc v1.40.1/go.mod h1:ogyxbiOoUXAkP+4+xa6PZSE9DZgIHtSpzjDTB9KAK34= google.golang.org/grpc v1.41.0/go.mod h1:U3l9uK9J0sini8mHphKoXyaqDA/8VyGnDee1zzIUK6k= -google.golang.org/grpc v1.42.0/go.mod h1:k+4IHHFw41K8+bbowsex27ge2rCb65oeWqe4jJ590SU= -google.golang.org/grpc v1.43.0/go.mod h1:k+4IHHFw41K8+bbowsex27ge2rCb65oeWqe4jJ590SU= google.golang.org/grpc v1.44.0/go.mod h1:k+4IHHFw41K8+bbowsex27ge2rCb65oeWqe4jJ590SU= google.golang.org/grpc v1.45.0/go.mod h1:lN7owxKUQEqMfSyQikvvk5tf/6zMPsrK+ONuO11+0rQ= google.golang.org/grpc v1.46.0/go.mod h1:vN9eftEi1UMyUsIF80+uQXhHjbXYbm0uXoFCACuMGWk= google.golang.org/grpc v1.46.2/go.mod h1:vN9eftEi1UMyUsIF80+uQXhHjbXYbm0uXoFCACuMGWk= google.golang.org/grpc v1.47.0/go.mod h1:vN9eftEi1UMyUsIF80+uQXhHjbXYbm0uXoFCACuMGWk= google.golang.org/grpc v1.48.0/go.mod h1:vN9eftEi1UMyUsIF80+uQXhHjbXYbm0uXoFCACuMGWk= -google.golang.org/grpc v1.49.0/go.mod h1:ZgQEeidpAuNRZ8iRrlBKXZQP1ghovWIVhdJRyCDK+GI= -google.golang.org/grpc v1.50.0/go.mod h1:ZgQEeidpAuNRZ8iRrlBKXZQP1ghovWIVhdJRyCDK+GI= -google.golang.org/grpc v1.50.1/go.mod h1:ZgQEeidpAuNRZ8iRrlBKXZQP1ghovWIVhdJRyCDK+GI= -google.golang.org/grpc v1.51.0/go.mod h1:wgNDFcnuBGmxLKI/qn4T+m5BtEBYXJPvibbUPsAIPww= -google.golang.org/grpc v1.52.0/go.mod h1:pu6fVzoFb+NBYNAvQL08ic+lvB2IojljRYuun5vorUY= -google.golang.org/grpc v1.52.3/go.mod h1:pu6fVzoFb+NBYNAvQL08ic+lvB2IojljRYuun5vorUY= -google.golang.org/grpc v1.53.0/go.mod h1:OnIrk0ipVdj4N5d9IUoFUx72/VlD7+jUsHwZgwSMQpw= -google.golang.org/grpc v1.54.0/go.mod h1:PUSEXI6iWghWaB6lXM4knEgpJNu2qUcKfDtNci3EC2g= -google.golang.org/grpc v1.55.0/go.mod h1:iYEXKGkEBhg1PjZQvoYEVPTDkHo1/bjTnfwTeGONTY8= -google.golang.org/grpc v1.56.0/go.mod h1:I9bI3vqKfayGqPUAwGdOSu7kt6oIJLixfffKrpXqQ9s= -google.golang.org/grpc v1.56.2 h1:fVRFRnXvU+x6C4IlHZewvJOVHoOv1TUuQyoRsYnB4bI= -google.golang.org/grpc v1.56.2/go.mod h1:I9bI3vqKfayGqPUAwGdOSu7kt6oIJLixfffKrpXqQ9s= +google.golang.org/grpc v1.57.0 h1:kfzNeI/klCGD2YPMUlaGNT3pxvYfga7smW3Vth8Zsiw= +google.golang.org/grpc v1.57.0/go.mod h1:Sd+9RMTACXwmub0zcNY2c4arhtrbBYD1AUHI/dt16Mo= google.golang.org/grpc/cmd/protoc-gen-go-grpc v1.1.0/go.mod h1:6Kw0yEErY5E/yWrBtf03jp27GLLJujG4z/JK95pnjjw= google.golang.org/protobuf v0.0.0-20200109180630-ec00e32a8dfd/go.mod h1:DFci5gLYBciE7Vtevhsrf46CRTquxDuWsQurQQe4oz8= google.golang.org/protobuf v0.0.0-20200221191635-4d8936d0db64/go.mod h1:kwYJMbMJ01Woi6D6+Kah6886xMZcty6N08ah7+eCXa0= @@ -3959,8 +2453,6 @@ google.golang.org/protobuf v1.26.0/go.mod h1:9q0QmTI4eRPtz6boOQmLYwt+qCgq0jsYwAQ google.golang.org/protobuf v1.27.1/go.mod h1:9q0QmTI4eRPtz6boOQmLYwt+qCgq0jsYwAQnmE0givc= google.golang.org/protobuf v1.28.0/go.mod h1:HV8QOd/L58Z+nl8r43ehVNZIU/HEI6OcFqwMG9pJV4I= google.golang.org/protobuf v1.28.1/go.mod h1:HV8QOd/L58Z+nl8r43ehVNZIU/HEI6OcFqwMG9pJV4I= -google.golang.org/protobuf v1.29.1/go.mod h1:HV8QOd/L58Z+nl8r43ehVNZIU/HEI6OcFqwMG9pJV4I= -google.golang.org/protobuf v1.30.0/go.mod h1:HV8QOd/L58Z+nl8r43ehVNZIU/HEI6OcFqwMG9pJV4I= google.golang.org/protobuf v1.31.0 h1:g0LDEJHgrBl9N9r17Ru3sqWhkIx2NB67okBHPwC7hs8= google.golang.org/protobuf v1.31.0/go.mod h1:HV8QOd/L58Z+nl8r43ehVNZIU/HEI6OcFqwMG9pJV4I= gopkg.in/airbrake/gobrake.v2 v2.0.9/go.mod h1:/h5ZAUhDkGaJfjzjKLSjv6zCL6O0LLBxU4K+aSYdM/U= @@ -3976,19 +2468,14 @@ gopkg.in/check.v1 v1.0.0-20201130134442-10cb98267c6c/go.mod h1:JHkPIbrfpd72SG/EV gopkg.in/cheggaaa/pb.v1 v1.0.25/go.mod h1:V/YB90LKu/1FcN3WVnfiiE5oMCibMjukxqG/qStrOgw= gopkg.in/errgo.v2 v2.1.0/go.mod h1:hNsd1EY+bozCKY1Ytp96fpM3vjJbqLJn88ws8XvfDNI= gopkg.in/fsnotify.v1 v1.4.7/go.mod h1:Tz8NjZHkW78fSQdbUxIjBTcgA1z1m8ZHf0WmKUhAMys= -gopkg.in/gcfg.v1 v1.2.3/go.mod h1:yesOnuUOFQAhST5vPY4nbZsb/huCgGGXlipJsBn0b3o= gopkg.in/gemnasium/logrus-airbrake-hook.v2 v2.1.2/go.mod h1:Xk6kEKp8OKb+X14hQBKWaSkCsqBpgog8nAV2xsGOxlo= -gopkg.in/inconshreveable/log15.v2 v2.0.0-20180818164646-67afb5ed74ec/go.mod h1:aPpfJ7XW+gOuirDoZ8gHhLh3kZ1B08FtV2bbmy7Jv3s= gopkg.in/inf.v0 v0.9.1 h1:73M5CoZyi3ZLMOyDlQh031Cx6N9NDJ2Vvfl76EDAgDc= gopkg.in/inf.v0 v0.9.1/go.mod h1:cWUDdTG/fYaXco+Dcufb5Vnc6Gp2YChqWtbxRZE0mXw= -gopkg.in/ini.v1 v1.51.0/go.mod h1:pNLf8WUiyNEtQjuu5G5vTm06TEv9tsIgeAvK8hOrP4k= gopkg.in/ini.v1 v1.56.0/go.mod h1:pNLf8WUiyNEtQjuu5G5vTm06TEv9tsIgeAvK8hOrP4k= gopkg.in/ini.v1 v1.62.0/go.mod h1:pNLf8WUiyNEtQjuu5G5vTm06TEv9tsIgeAvK8hOrP4k= -gopkg.in/ini.v1 v1.66.6/go.mod h1:pNLf8WUiyNEtQjuu5G5vTm06TEv9tsIgeAvK8hOrP4k= gopkg.in/ini.v1 v1.67.0 h1:Dgnx+6+nfE+IfzjUEISNeydPJh9AXNNsWbGP9KzCsOA= gopkg.in/ini.v1 v1.67.0/go.mod h1:pNLf8WUiyNEtQjuu5G5vTm06TEv9tsIgeAvK8hOrP4k= gopkg.in/natefinch/lumberjack.v2 v2.0.0/go.mod h1:l0ndWWf7gzL7RNwBG7wST/UCcT4T24xpD6X8LsfU/+k= -gopkg.in/natefinch/npipe.v2 v2.0.0-20160621034901-c1b8fa8bdcce/go.mod h1:5AcXVHNjg+BDxry382+8OKon8SEWiKktQR07RKPsv1c= gopkg.in/resty.v1 v1.12.0/go.mod h1:mDo4pnntr5jdWRML875a/NmxYqAlA73dVijT2AXvQQo= gopkg.in/square/go-jose.v2 v2.2.2/go.mod h1:M9dMgbHiYLoDGQrXy7OpJDJWiKiU//h+vD76mk0e1AI= gopkg.in/square/go-jose.v2 v2.3.1/go.mod h1:M9dMgbHiYLoDGQrXy7OpJDJWiKiU//h+vD76mk0e1AI= @@ -4001,8 +2488,6 @@ gopkg.in/src-d/go-git-fixtures.v3 v3.5.0 h1:ivZFOIltbce2Mo8IjzUHAFoq/IylO9WHhNOA gopkg.in/src-d/go-git-fixtures.v3 v3.5.0/go.mod h1:dLBcvytrw/TYZsNTWCnkNF2DSIlzWYqTe3rJR56Ac7g= gopkg.in/src-d/go-git.v4 v4.13.1 h1:SRtFyV8Kxc0UP7aCHcijOMQGPxHSmMOPrzulQWolkYE= gopkg.in/src-d/go-git.v4 v4.13.1/go.mod h1:nx5NYcxdKxq5fpltdHnPa2Exj4Sx0EclMWZQbYDu2z8= -gopkg.in/telebot.v3 v3.0.0/go.mod h1:7rExV8/0mDDNu9epSrDm/8j22KLaActH1Tbee6YjzWg= -gopkg.in/telebot.v3 v3.1.2/go.mod h1:GJKwwWqp9nSkIVN51eRKU78aB5f5OnQuWdwiIZfPbko= gopkg.in/tomb.v1 v1.0.0-20141024135613-dd632973f1e7 h1:uRGJdciOHaEIrze2W8Q3AKkepLTh2hOroT7a+7czfdQ= gopkg.in/tomb.v1 v1.0.0-20141024135613-dd632973f1e7/go.mod h1:dt/ZhP58zS4L8KSrWDmTeBkI65Dw0HsyUHuEVlX15mw= gopkg.in/warnings.v0 v0.1.2 h1:wFXVbFY8DY5/xOe1ECiWdKCzZlxgshcYVNkBHstARME= @@ -4021,7 +2506,6 @@ gopkg.in/yaml.v3 v3.0.0-20200313102051-9f266ea9e77c/go.mod h1:K4uyk7z7BCEPqu6E+C gopkg.in/yaml.v3 v3.0.0-20200605160147-a5ece683394c/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM= gopkg.in/yaml.v3 v3.0.0-20200615113413-eeeca48fe776/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM= gopkg.in/yaml.v3 v3.0.0-20210107192922-496545a6307b/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM= -gopkg.in/yaml.v3 v3.0.0/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM= gopkg.in/yaml.v3 v3.0.1 h1:fxVm/GzAzEWqLHuvctI91KS9hhNmmWOoWu0XTYJS7CA= gopkg.in/yaml.v3 v3.0.1/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM= gotest.tools v2.2.0+incompatible h1:VsBPFP1AI068pPrMxtb/S8Zkgf9xEmTLJjfM+P5UIEo= @@ -4036,15 +2520,11 @@ honnef.co/go/tools v0.0.0-20190523083050-ea95bdfd59fc/go.mod h1:rf3lG4BRIbNafJWh honnef.co/go/tools v0.0.1-2019.2.3/go.mod h1:a3bituU0lyd329TUQxRnasdCoJDkEUEAqEt0JzvZhAg= honnef.co/go/tools v0.0.1-2020.1.3/go.mod h1:X/FiERA/W4tHapMX5mGpAtMSVEeEUOyHaw9vFzvIQ3k= honnef.co/go/tools v0.0.1-2020.1.4/go.mod h1:X/FiERA/W4tHapMX5mGpAtMSVEeEUOyHaw9vFzvIQ3k= -honnef.co/go/tools v0.1.3/go.mod h1:NgwopIslSNH47DimFoV78dnkksY2EFtX0ajyb3K/las= honnef.co/go/tools v0.4.3 h1:o/n5/K5gXqk8Gozvs2cnL0F2S1/g1vcGCAx2vETjITw= honnef.co/go/tools v0.4.3/go.mod h1:36ZgoUOrqOk1GxwHhyryEkq8FQWkUO2xGuSMhUCcdvA= k8s.io/api v0.20.1/go.mod h1:KqwcCVogGxQY3nBlRpwt+wpAMF/KjaCc7RpywacvqUo= k8s.io/api v0.20.4/go.mod h1:++lNL1AJMkDymriNniQsWRkMDzRaX2Y/POTUi8yvqYQ= k8s.io/api v0.20.6/go.mod h1:X9e8Qag6JV/bL5G6bU8sdVRltWKmdHsFUGS3eVndqE8= -k8s.io/api v0.22.5/go.mod h1:mEhXyLaSD1qTOf40rRiKXkc+2iCem09rWLlFwhCEiAs= -k8s.io/api v0.23.5/go.mod h1:Na4XuKng8PXJ2JsploYYrivXrINeTaycCGcYgF91Xm8= -k8s.io/api v0.26.2/go.mod h1:1kjMQsFE+QHPfskEcVNgL3+Hp88B80uj0QtSOlj8itU= k8s.io/api v0.27.3 h1:yR6oQXXnUEBWEWcvPWS0jQL575KoAboQPfJAuKNrw5Y= k8s.io/api v0.27.3/go.mod h1:C4BNvZnQOF7JA/0Xed2S+aUyJSfTGkGFxLXz9MnpIpg= k8s.io/apiextensions-apiserver v0.25.4 h1:7hu9pF+xikxQuQZ7/30z/qxIPZc2J1lFElPtr7f+B6U= @@ -4052,108 +2532,43 @@ k8s.io/apiextensions-apiserver v0.25.4/go.mod h1:bkSGki5YBoZWdn5pWtNIdGvDrrsRWlm k8s.io/apimachinery v0.20.1/go.mod h1:WlLqWAHZGg07AeltaI0MV5uk1Omp8xaN0JGLY6gkRpU= k8s.io/apimachinery v0.20.4/go.mod h1:WlLqWAHZGg07AeltaI0MV5uk1Omp8xaN0JGLY6gkRpU= k8s.io/apimachinery v0.20.6/go.mod h1:ejZXtW1Ra6V1O5H8xPBGz+T3+4gfkTCeExAHKU57MAc= -k8s.io/apimachinery v0.22.1/go.mod h1:O3oNtNadZdeOMxHFVxOreoznohCpy0z6mocxbZr7oJ0= -k8s.io/apimachinery v0.22.5/go.mod h1:xziclGKwuuJ2RM5/rSFQSYAj0zdbci3DH8kj+WvyN0U= -k8s.io/apimachinery v0.23.5/go.mod h1:BEuFMMBaIbcOqVIJqNZJXGFTP4W6AycEpb5+m/97hrM= -k8s.io/apimachinery v0.26.2/go.mod h1:ats7nN1LExKHvJ9TmwootT00Yz05MuYqPXEXaVeOy5I= k8s.io/apimachinery v0.27.3 h1:Ubye8oBufD04l9QnNtW05idcOe9Z3GQN8+7PqmuVcUM= k8s.io/apimachinery v0.27.3/go.mod h1:XNfZ6xklnMCOGGFNqXG7bUrQCoR04dh/E7FprV6pb+E= k8s.io/apiserver v0.20.1/go.mod h1:ro5QHeQkgMS7ZGpvf4tSMx6bBOgPfE+f52KwvXfScaU= k8s.io/apiserver v0.20.4/go.mod h1:Mc80thBKOyy7tbvFtB4kJv1kbdD0eIH8k8vianJcbFM= k8s.io/apiserver v0.20.6/go.mod h1:QIJXNt6i6JB+0YQRNcS0hdRHJlMhflFmsBDeSgT1r8Q= -k8s.io/apiserver v0.22.5/go.mod h1:s2WbtgZAkTKt679sYtSudEQrTGWUSQAPe6MupLnlmaQ= k8s.io/client-go v0.20.1/go.mod h1:/zcHdt1TeWSd5HoUe6elJmHSQ6uLLgp4bIJHVEuy+/Y= k8s.io/client-go v0.20.4/go.mod h1:LiMv25ND1gLUdBeYxBIwKpkSC5IsozMMmOOeSJboP+k= k8s.io/client-go v0.20.6/go.mod h1:nNQMnOvEUEsOzRRFIIkdmYOjAZrC8bgq0ExboWSU1I0= -k8s.io/client-go v0.22.5/go.mod h1:cs6yf/61q2T1SdQL5Rdcjg9J1ElXSwbjSrW2vFImM4Y= -k8s.io/client-go v0.23.5/go.mod h1:flkeinTO1CirYgzMPRWxUCnV0G4Fbu2vLhYCObnt/r4= -k8s.io/client-go v0.26.2/go.mod h1:u5EjOuSyBa09yqqyY7m3abZeovO/7D/WehVVlZ2qcqU= k8s.io/client-go v0.27.3 h1:7dnEGHZEJld3lYwxvLl7WoehK6lAq7GvgjxpA3nv1E8= k8s.io/client-go v0.27.3/go.mod h1:2MBEKuTo6V1lbKy3z1euEGnhPfGZLKTS9tiJ2xodM48= -k8s.io/code-generator v0.19.7/go.mod h1:lwEq3YnLYb/7uVXLorOJfxg+cUu2oihFhHZ0n9NIla0= k8s.io/code-generator v0.25.9 h1:lgyAV9AIRYNxZxgLRXqsCAtqJLHvakot41CjEqD5W0w= k8s.io/code-generator v0.25.9/go.mod h1:DHfpdhSUrwqF0f4oLqCtF8gYbqlndNetjBEz45nWzJI= k8s.io/component-base v0.20.1/go.mod h1:guxkoJnNoh8LNrbtiQOlyp2Y2XFCZQmrcg2n/DeYNLk= k8s.io/component-base v0.20.4/go.mod h1:t4p9EdiagbVCJKrQ1RsA5/V4rFQNDfRlevJajlGwgjI= k8s.io/component-base v0.20.6/go.mod h1:6f1MPBAeI+mvuts3sIdtpjljHWBQ2cIy38oBIWMYnrM= -k8s.io/component-base v0.22.5/go.mod h1:VK3I+TjuF9eaa+Ln67dKxhGar5ynVbwnGrUiNF4MqCI= k8s.io/cri-api v0.17.3/go.mod h1:X1sbHmuXhwaHs9xxYffLqJogVsnI+f6cPRcgPel7ywM= k8s.io/cri-api v0.20.1/go.mod h1:2JRbKt+BFLTjtrILYVqQK5jqhI+XNdF6UiGMgczeBCI= k8s.io/cri-api v0.20.4/go.mod h1:2JRbKt+BFLTjtrILYVqQK5jqhI+XNdF6UiGMgczeBCI= k8s.io/cri-api v0.20.6/go.mod h1:ew44AjNXwyn1s0U4xCKGodU7J1HzBeZ1MpGrpa5r8Yc= -k8s.io/cri-api v0.23.1/go.mod h1:REJE3PSU0h/LOV1APBrupxrEJqnoxZC8KWzkBUHwrK4= k8s.io/gengo v0.0.0-20200413195148-3a45101e95ac/go.mod h1:ezvh/TsK7cY6rbqRK0oQQ8IAqLxYwwyPxAX1Pzy0ii0= -k8s.io/gengo v0.0.0-20200428234225-8167cfdcfc14/go.mod h1:ezvh/TsK7cY6rbqRK0oQQ8IAqLxYwwyPxAX1Pzy0ii0= -k8s.io/gengo v0.0.0-20201113003025-83324d819ded/go.mod h1:FiNAH4ZV3gBg2Kwh89tzAEV2be7d5xI0vBa/VySYy3E= -k8s.io/gengo v0.0.0-20210813121822-485abfe95c7c/go.mod h1:FiNAH4ZV3gBg2Kwh89tzAEV2be7d5xI0vBa/VySYy3E= k8s.io/gengo v0.0.0-20221011193443-fad74ee6edd9 h1:iu3o/SxaHVI7tKPtkGzD3M9IzrE21j+CUKH98NQJ8Ms= k8s.io/gengo v0.0.0-20221011193443-fad74ee6edd9/go.mod h1:FiNAH4ZV3gBg2Kwh89tzAEV2be7d5xI0vBa/VySYy3E= -k8s.io/klog v1.0.0/go.mod h1:4Bi6QPql/J/LkTDqv7R/cd3hPo4k2DG6Ptcz060Ez5I= k8s.io/klog/v2 v2.0.0/go.mod h1:PBfzABfn139FHAV07az/IF9Wp1bkk3vpT2XSJ76fSDE= k8s.io/klog/v2 v2.2.0/go.mod h1:Od+F08eJP+W3HUb4pSrPpgp9DGU4GzlpG/TmITuYh/Y= k8s.io/klog/v2 v2.4.0/go.mod h1:Od+F08eJP+W3HUb4pSrPpgp9DGU4GzlpG/TmITuYh/Y= -k8s.io/klog/v2 v2.9.0/go.mod h1:hy9LJ/NvuK+iVyP4Ehqva4HxZG/oXyIS3n3Jmire4Ec= -k8s.io/klog/v2 v2.30.0/go.mod h1:y1WjHnz7Dj687irZUWR/WLkLc5N1YHtjLdmgWjndZn0= -k8s.io/klog/v2 v2.40.1/go.mod h1:y1WjHnz7Dj687irZUWR/WLkLc5N1YHtjLdmgWjndZn0= k8s.io/klog/v2 v2.80.1/go.mod h1:y1WjHnz7Dj687irZUWR/WLkLc5N1YHtjLdmgWjndZn0= -k8s.io/klog/v2 v2.90.1/go.mod h1:y1WjHnz7Dj687irZUWR/WLkLc5N1YHtjLdmgWjndZn0= k8s.io/klog/v2 v2.100.1 h1:7WCHKK6K8fNhTqfBhISHQ97KrnJNFZMcQvKp7gP/tmg= k8s.io/klog/v2 v2.100.1/go.mod h1:y1WjHnz7Dj687irZUWR/WLkLc5N1YHtjLdmgWjndZn0= -k8s.io/kube-openapi v0.0.0-20200805222855-6aeccd4b50c6/go.mod h1:UuqjUnNftUyPE5H64/qeyjQoUZhGpeFDVdxjTeEVN2o= k8s.io/kube-openapi v0.0.0-20201113171705-d219536bb9fd/go.mod h1:WOJ3KddDSol4tAGcJo0Tvi+dK12EcqSLqcWsryKMpfM= -k8s.io/kube-openapi v0.0.0-20210421082810-95288971da7e/go.mod h1:vHXdDvt9+2spS2Rx9ql3I8tycm3H9FDfdUoIuKCefvw= -k8s.io/kube-openapi v0.0.0-20211109043538-20434351676c/go.mod h1:vHXdDvt9+2spS2Rx9ql3I8tycm3H9FDfdUoIuKCefvw= -k8s.io/kube-openapi v0.0.0-20211115234752-e816edb12b65/go.mod h1:sX9MT8g7NVZM5lVL/j8QyCCJe8YSMW30QvGZWaCIDIk= -k8s.io/kube-openapi v0.0.0-20221012153701-172d655c2280/go.mod h1:+Axhij7bCpeqhklhUTe3xmOn6bWxolyZEeyaFpjGtl4= -k8s.io/kube-openapi v0.0.0-20230303024457-afdc3dddf62d/go.mod h1:y5VtZWM9sHHc2ZodIH/6SHzXj+TPU5USoA8lcIeKEKY= k8s.io/kube-openapi v0.0.0-20230515203736-54b630e78af5 h1:azYPdzztXxPSa8wb+hksEKayiz0o+PPisO/d+QhWnoo= k8s.io/kube-openapi v0.0.0-20230515203736-54b630e78af5/go.mod h1:kzo02I3kQ4BTtEfVLaPbjvCkX97YqGve33wzlb3fofQ= k8s.io/kubernetes v1.13.0/go.mod h1:ocZa8+6APFNC2tX1DZASIbocyYT5jHzqFVsY5aoB7Jk= k8s.io/utils v0.0.0-20201110183641-67b214c5f920/go.mod h1:jPW/WVKK9YHAvNhRxK0md/EJ228hCsBRufyofKtW8HA= -k8s.io/utils v0.0.0-20210802155522-efc7438f0176/go.mod h1:jPW/WVKK9YHAvNhRxK0md/EJ228hCsBRufyofKtW8HA= -k8s.io/utils v0.0.0-20210819203725-bdf08cb9a70a/go.mod h1:jPW/WVKK9YHAvNhRxK0md/EJ228hCsBRufyofKtW8HA= -k8s.io/utils v0.0.0-20210930125809-cb0fa318a74b/go.mod h1:jPW/WVKK9YHAvNhRxK0md/EJ228hCsBRufyofKtW8HA= -k8s.io/utils v0.0.0-20211116205334-6203023598ed/go.mod h1:jPW/WVKK9YHAvNhRxK0md/EJ228hCsBRufyofKtW8HA= -k8s.io/utils v0.0.0-20221107191617-1a15be271d1d/go.mod h1:OLgZIPagt7ERELqWJFomSt595RzquPNLL48iOWgYOg0= -k8s.io/utils v0.0.0-20230308161112-d77c459e9343/go.mod h1:OLgZIPagt7ERELqWJFomSt595RzquPNLL48iOWgYOg0= k8s.io/utils v0.0.0-20230505201702-9f6742963106 h1:EObNQ3TW2D+WptiYXlApGNLVy0zm/JIBVY9i+M4wpAU= k8s.io/utils v0.0.0-20230505201702-9f6742963106/go.mod h1:OLgZIPagt7ERELqWJFomSt595RzquPNLL48iOWgYOg0= knative.dev/pkg v0.0.0-20230518105712-dfb4bf04635d h1:jGvqcYwyh7O1V2PZfd0poheaOOvy6x0z+KQxHXOgskc= knative.dev/pkg v0.0.0-20230518105712-dfb4bf04635d/go.mod h1:WLTHHHc/dhrDmhx03nm5F8AeqpNx3RQGggMI2N0/oks= -lukechampine.com/uint128 v1.1.1/go.mod h1:c4eWIwlEGaxC/+H1VguhU4PHXNWDCDMUlWdIWl2j1gk= -lukechampine.com/uint128 v1.2.0/go.mod h1:c4eWIwlEGaxC/+H1VguhU4PHXNWDCDMUlWdIWl2j1gk= -modernc.org/cc/v3 v3.36.0/go.mod h1:NFUHyPn4ekoC/JHeZFfZurN6ixxawE1BnVonP/oahEI= -modernc.org/cc/v3 v3.36.2/go.mod h1:NFUHyPn4ekoC/JHeZFfZurN6ixxawE1BnVonP/oahEI= -modernc.org/cc/v3 v3.36.3/go.mod h1:NFUHyPn4ekoC/JHeZFfZurN6ixxawE1BnVonP/oahEI= -modernc.org/ccgo/v3 v3.0.0-20220428102840-41399a37e894/go.mod h1:eI31LL8EwEBKPpNpA4bU1/i+sKOwOrQy8D87zWUcRZc= -modernc.org/ccgo/v3 v3.0.0-20220430103911-bc99d88307be/go.mod h1:bwdAnOoaIt8Ax9YdWGjxWsdkPcZyRPHqrOvJxaKAKGw= -modernc.org/ccgo/v3 v3.16.4/go.mod h1:tGtX0gE9Jn7hdZFeU88slbTh1UtCYKusWOoCJuvkWsQ= -modernc.org/ccgo/v3 v3.16.6/go.mod h1:tGtX0gE9Jn7hdZFeU88slbTh1UtCYKusWOoCJuvkWsQ= -modernc.org/ccgo/v3 v3.16.8/go.mod h1:zNjwkizS+fIFDrDjIAgBSCLkWbJuHF+ar3QRn+Z9aws= -modernc.org/ccgo/v3 v3.16.9/go.mod h1:zNMzC9A9xeNUepy6KuZBbugn3c0Mc9TeiJO4lgvkJDo= -modernc.org/ccorpus v1.11.6/go.mod h1:2gEUTrWqdpH2pXsmTM1ZkjeSrUWDpjMu2T6m29L/ErQ= -modernc.org/httpfs v1.0.6/go.mod h1:7dosgurJGp0sPaRanU53W4xZYKh14wfzX420oZADeHM= -modernc.org/libc v0.0.0-20220428101251-2d5f3daf273b/go.mod h1:p7Mg4+koNjc8jkqwcoFBJx7tXkpj00G77X7A72jXPXA= -modernc.org/libc v1.16.0/go.mod h1:N4LD6DBE9cf+Dzf9buBlzVJndKr/iJHG97vGLHYnb5A= -modernc.org/libc v1.16.1/go.mod h1:JjJE0eu4yeK7tab2n4S1w8tlWd9MxXLRzheaRnAKymU= -modernc.org/libc v1.16.17/go.mod h1:hYIV5VZczAmGZAnG15Vdngn5HSF5cSkbvfz2B7GRuVU= -modernc.org/libc v1.16.19/go.mod h1:p7Mg4+koNjc8jkqwcoFBJx7tXkpj00G77X7A72jXPXA= -modernc.org/libc v1.17.0/go.mod h1:XsgLldpP4aWlPlsjqKRdHPqCxCjISdHfM/yeWC5GyW0= -modernc.org/libc v1.17.1/go.mod h1:FZ23b+8LjxZs7XtFMbSzL/EhPxNbfZbErxEHc7cbD9s= -modernc.org/mathutil v1.2.2/go.mod h1:mZW8CKdRPY1v87qxC/wUdX5O1qDzXMP5TH3wjfpga6E= -modernc.org/mathutil v1.4.1/go.mod h1:mZW8CKdRPY1v87qxC/wUdX5O1qDzXMP5TH3wjfpga6E= -modernc.org/mathutil v1.5.0/go.mod h1:mZW8CKdRPY1v87qxC/wUdX5O1qDzXMP5TH3wjfpga6E= -modernc.org/memory v1.1.1/go.mod h1:/0wo5ibyrQiaoUoH7f9D8dnglAmILJ5/cxZlRECf+Nw= -modernc.org/memory v1.2.0/go.mod h1:/0wo5ibyrQiaoUoH7f9D8dnglAmILJ5/cxZlRECf+Nw= -modernc.org/memory v1.2.1/go.mod h1:PkUhL0Mugw21sHPeskwZW4D6VscE/GQJOnIpCnW6pSU= -modernc.org/opt v0.1.1/go.mod h1:WdSiB5evDcignE70guQKxYUl14mgWtbClRi5wmkkTX0= -modernc.org/opt v0.1.3/go.mod h1:WdSiB5evDcignE70guQKxYUl14mgWtbClRi5wmkkTX0= -modernc.org/sqlite v1.18.1/go.mod h1:6ho+Gow7oX5V+OiOQ6Tr4xeqbx13UZ6t+Fw9IRUG4d4= -modernc.org/strutil v1.1.1/go.mod h1:DE+MQQ/hjKBZS2zNInV5hhcipt5rLPWkmpbGeW5mmdw= -modernc.org/strutil v1.1.3/go.mod h1:MEHNA7PdEnEwLvspRMtWTNnp2nnyvMfkimT1NKNAGbw= -modernc.org/tcl v1.13.1/go.mod h1:XOLfOwzhkljL4itZkK6T72ckMgvj0BDsnKNdZVUOecw= -modernc.org/token v1.0.0/go.mod h1:UGzOrNV1mAFSEB63lOFHIpNRUVMvYTc6yu1SMY/XTDM= -modernc.org/z v1.5.1/go.mod h1:eWFB510QWW5Th9YGZT81s+LwvaAs3Q2yr4sP0rmLkv8= mvdan.cc/gofumpt v0.5.0 h1:0EQ+Z56k8tXjj/6TQD25BFNKQXpCvT0rnansIc7Ug5E= mvdan.cc/gofumpt v0.5.0/go.mod h1:HBeVDtMKRZpXyxFciAirzdKklDlGu8aAy1wEbH5Y9js= mvdan.cc/interfacer v0.0.0-20180901003855-c20040233aed h1:WX1yoOaKQfddO/mLzdV4wptyWgoH/6hwLs7QHTixo0I= @@ -4162,25 +2577,17 @@ mvdan.cc/lint v0.0.0-20170908181259-adc824a0674b h1:DxJ5nJdkhDlLok9K6qO+5290kphD mvdan.cc/lint v0.0.0-20170908181259-adc824a0674b/go.mod h1:2odslEg/xrtNQqCYg2/jCoyKnw3vv5biOc3JnIcYfL4= mvdan.cc/unparam v0.0.0-20221223090309-7455f1af531d h1:3rvTIIM22r9pvXk+q3swxUQAQOxksVMGK7sml4nG57w= mvdan.cc/unparam v0.0.0-20221223090309-7455f1af531d/go.mod h1:IeHQjmn6TOD+e4Z3RFiZMMsLVL+A96Nvptar8Fj71is= -nhooyr.io/websocket v1.8.7/go.mod h1:B70DZP8IakI65RVQ51MsWP/8jndNma26DVA/nFSCgW0= rsc.io/binaryregexp v0.2.0/go.mod h1:qTv7/COck+e2FymRvadv62gMdZztPaShugOCi3I+8D8= -rsc.io/pdf v0.1.1/go.mod h1:n8OzWcQ6Sp37PL01nO98y4iUCRdTGarVfzxY20ICaU4= rsc.io/quote/v3 v3.1.0/go.mod h1:yEA65RcK8LyAZtP9Kv3t0HmxON59tX3rD+tICJqUlj0= rsc.io/sampler v1.3.0/go.mod h1:T1hPZKmBbMNahiBKFy5HrXp6adAjACjK9JXDnKaTXpA= sigs.k8s.io/apiserver-network-proxy/konnectivity-client v0.0.14/go.mod h1:LEScyzhFmoF5pso/YSeBstl57mOzx9xlU9n85RGrDQg= sigs.k8s.io/apiserver-network-proxy/konnectivity-client v0.0.15/go.mod h1:LEScyzhFmoF5pso/YSeBstl57mOzx9xlU9n85RGrDQg= -sigs.k8s.io/apiserver-network-proxy/konnectivity-client v0.0.22/go.mod h1:LEScyzhFmoF5pso/YSeBstl57mOzx9xlU9n85RGrDQg= -sigs.k8s.io/json v0.0.0-20211020170558-c049b76a60c6/go.mod h1:p4QtZmO4uMYipTQNzagwnNoseA6OxSUutVw05NhYDRs= -sigs.k8s.io/json v0.0.0-20220713155537-f223a00ba0e2/go.mod h1:B8JuhiUyNFVKdsE8h686QcCxMaH6HrOAZj4vswFpcB0= sigs.k8s.io/json v0.0.0-20221116044647-bc3834ca7abd h1:EDPBXCAspyGV4jQlpZSudPeMmr1bNJefnuqLsRAsHZo= sigs.k8s.io/json v0.0.0-20221116044647-bc3834ca7abd/go.mod h1:B8JuhiUyNFVKdsE8h686QcCxMaH6HrOAZj4vswFpcB0= sigs.k8s.io/release-utils v0.7.4 h1:17LmJrydpUloTCtaoWj95uKlcrUp4h2A9Sa+ZL+lV9w= sigs.k8s.io/release-utils v0.7.4/go.mod h1:JEt2QPHItd5Pg2UKLAU8PEaSlF4bUjCZimpxFDgymVU= -sigs.k8s.io/structured-merge-diff/v4 v4.0.1/go.mod h1:bJZC9H9iH24zzfZ/41RGcq60oK1F7G282QMXDPYydCw= sigs.k8s.io/structured-merge-diff/v4 v4.0.2/go.mod h1:bJZC9H9iH24zzfZ/41RGcq60oK1F7G282QMXDPYydCw= sigs.k8s.io/structured-merge-diff/v4 v4.0.3/go.mod h1:bJZC9H9iH24zzfZ/41RGcq60oK1F7G282QMXDPYydCw= -sigs.k8s.io/structured-merge-diff/v4 v4.1.2/go.mod h1:j/nl6xW8vLS49O8YvXW1ocPhZawJtm+Yrr7PPRQ0Vg4= -sigs.k8s.io/structured-merge-diff/v4 v4.2.1/go.mod h1:j/nl6xW8vLS49O8YvXW1ocPhZawJtm+Yrr7PPRQ0Vg4= sigs.k8s.io/structured-merge-diff/v4 v4.2.3 h1:PRbqxJClWWYMNV1dhaG4NsibJbArud9kFxnAMREiWFE= sigs.k8s.io/structured-merge-diff/v4 v4.2.3/go.mod h1:qjx8mGObPmV2aSZepjQjbmb2ihdVs8cGKBraizNC69E= sigs.k8s.io/yaml v1.1.0/go.mod h1:UJmg0vDUVViEyp3mgSv9WPwZCDxu4rQW1olrI1uml+o= diff --git a/pkg/chains/formats/slsa/extract/extract.go b/pkg/chains/formats/slsa/extract/extract.go index e01fefcb1e..7e74aef2d5 100644 --- a/pkg/chains/formats/slsa/extract/extract.go +++ b/pkg/chains/formats/slsa/extract/extract.go @@ -27,6 +27,7 @@ import ( "github.com/in-toto/in-toto-golang/in_toto/slsa_provenance/common" "github.com/tektoncd/chains/internal/backport" "github.com/tektoncd/chains/pkg/artifacts" + "github.com/tektoncd/chains/pkg/chains/formats/slsa/internal/slsaconfig" "github.com/tektoncd/chains/pkg/chains/objects" "github.com/tektoncd/pipeline/pkg/apis/pipeline/v1beta1" "knative.dev/pkg/logging" @@ -39,7 +40,102 @@ import ( // - have suffix `IMAGE_URL` & `IMAGE_DIGEST` or `ARTIFACT_URI` & `ARTIFACT_DIGEST` pair. // - the `*_DIGEST` field must be in the format of ":" where the algorithm must be "sha256" and actual sha must be valid per https://github.com/opencontainers/image-spec/blob/main/descriptor.md#sha-256. // - the `*_URL` or `*_URI` fields cannot be empty. -func SubjectDigests(ctx context.Context, obj objects.TektonObject) []intoto.Subject { +// +//nolint:all +func SubjectDigests(ctx context.Context, obj objects.TektonObject, slsaconfig *slsaconfig.SlsaConfig) []intoto.Subject { + var subjects []intoto.Subject + + switch obj.GetObject().(type) { + case *v1beta1.PipelineRun: + subjects = subjectsFromPipelineRun(ctx, obj, slsaconfig) + case *v1beta1.TaskRun: + subjects = subjectsFromTektonObject(ctx, obj) + } + + sort.Slice(subjects, func(i, j int) bool { + return subjects[i].Name <= subjects[j].Name + }) + + return subjects +} + +func subjectsFromPipelineRun(ctx context.Context, obj objects.TektonObject, slsaconfig *slsaconfig.SlsaConfig) []intoto.Subject { + prSubjects := subjectsFromTektonObject(ctx, obj) + + // If deep inspection is not enabled, just return subjects observed on the pipelinerun level + if !slsaconfig.DeepInspectionEnabled { + return prSubjects + } + + logger := logging.FromContext(ctx) + // If deep inspection is enabled, collect subjects from child taskruns + var result []intoto.Subject + + pro := obj.(*objects.PipelineRunObject) + + pSpec := pro.Status.PipelineSpec + if pSpec != nil { + pipelineTasks := append(pSpec.Tasks, pSpec.Finally...) + for _, t := range pipelineTasks { + tr := pro.GetTaskRunFromTask(t.Name) + // Ignore Tasks that did not execute during the PipelineRun. + if tr == nil || tr.Status.CompletionTime == nil { + logger.Infof("taskrun status not found for task %s", t.Name) + continue + } + + trSubjects := subjectsFromTektonObject(ctx, objects.NewTaskRunObject(tr)) + for _, s := range trSubjects { + result = addSubject(result, s) + } + } + } + + // also add subjects observed from pipelinerun level with duplication removed + for _, s := range prSubjects { + result = addSubject(result, s) + } + + return result +} + +// addSubject adds a new subject item to the original slice. +func addSubject(original []intoto.Subject, item intoto.Subject) []intoto.Subject { + + for i, s := range original { + // if there is an equivalent entry in the original slice, merge item's DigestSet + // into the existing entry's DigestSet. + if subjectEqual(s, item) { + mergeMaps(original[i].Digest, item.Digest) + return original + } + } + + original = append(original, item) + return original +} + +// two subjects are equal if and only if they have same name and have at least +// one common algorithm and hex value. +func subjectEqual(x, y intoto.Subject) bool { + if x.Name != y.Name { + return false + } + for algo, hex := range x.Digest { + if y.Digest[algo] == hex { + return true + } + } + return false +} + +func mergeMaps(m1 map[string]string, m2 map[string]string) { + for k, v := range m2 { + m1[k] = v + } +} + +func subjectsFromTektonObject(ctx context.Context, obj objects.TektonObject) []intoto.Subject { logger := logging.FromContext(ctx) var subjects []intoto.Subject @@ -121,9 +217,7 @@ func SubjectDigests(ctx context.Context, obj objects.TektonObject) []intoto.Subj }) } } - sort.Slice(subjects, func(i, j int) bool { - return subjects[i].Name <= subjects[j].Name - }) + return subjects } @@ -131,9 +225,9 @@ func SubjectDigests(ctx context.Context, obj objects.TektonObject) []intoto.Subj // - It first extracts intoto subjects from run object results and converts the subjects // to a slice of string URIs in the format of "NAME" + "@" + "ALGORITHM" + ":" + "DIGEST". // - If no subjects could be extracted from results, then an empty slice is returned. -func RetrieveAllArtifactURIs(ctx context.Context, obj objects.TektonObject) []string { +func RetrieveAllArtifactURIs(ctx context.Context, obj objects.TektonObject, deepInspectionEnabled bool) []string { result := []string{} - subjects := SubjectDigests(ctx, obj) + subjects := SubjectDigests(ctx, obj, &slsaconfig.SlsaConfig{DeepInspectionEnabled: deepInspectionEnabled}) for _, s := range subjects { for algo, digest := range s.Digest { diff --git a/pkg/chains/formats/slsa/extract/extract_test.go b/pkg/chains/formats/slsa/extract/extract_test.go index 0b5a576a5e..1f1d58e898 100644 --- a/pkg/chains/formats/slsa/extract/extract_test.go +++ b/pkg/chains/formats/slsa/extract/extract_test.go @@ -19,13 +19,16 @@ package extract_test import ( "fmt" "testing" + "time" "github.com/google/go-cmp/cmp" "github.com/google/go-cmp/cmp/cmpopts" intoto "github.com/in-toto/in-toto-golang/in_toto" "github.com/tektoncd/chains/pkg/chains/formats/slsa/extract" + "github.com/tektoncd/chains/pkg/chains/formats/slsa/internal/slsaconfig" "github.com/tektoncd/chains/pkg/chains/objects" "github.com/tektoncd/pipeline/pkg/apis/pipeline/v1beta1" + metav1 "k8s.io/apimachinery/pkg/apis/meta/v1" logtesting "knative.dev/pkg/logging/testing" ) @@ -102,16 +105,15 @@ func TestSubjectDigestsAndRetrieveAllArtifactURIs(t *testing.T) { // test both taskrun object and pipelinerun object runObjects := []objects.TektonObject{ createTaskRunObjectWithResults(tc.results), - createPipelineRunObjectWithResults(tc.results), + createProWithPipelineResults(tc.results), } - for _, o := range runObjects { - gotSubjects := extract.SubjectDigests(ctx, o) + gotSubjects := extract.SubjectDigests(ctx, o, &slsaconfig.SlsaConfig{DeepInspectionEnabled: false}) if diff := cmp.Diff(tc.wantSubjects, gotSubjects, cmpopts.SortSlices(func(x, y intoto.Subject) bool { return x.Name < y.Name })); diff != "" { - t.Errorf("Wrong subjects extracted, diff=%s", diff) + t.Errorf("Wrong subjects extracted, diff=%s, %s", diff, gotSubjects) } - gotURIs := extract.RetrieveAllArtifactURIs(ctx, o) + gotURIs := extract.RetrieveAllArtifactURIs(ctx, o, false) if diff := cmp.Diff(tc.wantFullURLs, gotURIs, cmpopts.SortSlices(func(x, y string) bool { return x < y })); diff != "" { t.Errorf("Wrong URIs extracted, diff=%s", diff) } @@ -121,6 +123,153 @@ func TestSubjectDigestsAndRetrieveAllArtifactURIs(t *testing.T) { } } +func TestPipelineRunObserveModeForSubjects(t *testing.T) { + var tests = []struct { + name string + pro objects.TektonObject + deepInspectionEnabled bool + wantSubjects []intoto.Subject + wantFullURLs []string + }{ + { + name: "deep inspection disabled", + pro: createProWithPipelineResults(map[string]string{artifactURL1: "sha256:" + artifactDigest1}), + deepInspectionEnabled: false, + wantSubjects: []intoto.Subject{ + { + Name: artifactURL1, + Digest: map[string]string{ + "sha256": artifactDigest1, + }, + }, + }, + wantFullURLs: []string{fmt.Sprintf("%s@sha256:%s", artifactURL1, artifactDigest1)}, + }, + { + name: "deep inspection enabled: no duplication", + pro: createProWithTaskRunResults(nil, []artifact{{uri: artifactURL2, digest: "sha256:" + artifactDigest2}}), + deepInspectionEnabled: true, + wantSubjects: []intoto.Subject{ + { + Name: artifactURL2, + Digest: map[string]string{ + "sha256": artifactDigest2, + }, + }, + }, + wantFullURLs: []string{fmt.Sprintf("%s@sha256:%s", artifactURL2, artifactDigest2)}, + }, + { + name: "deep inspection enabled: 2 tasks have same uri with different sha256 digests", + pro: createProWithTaskRunResults(nil, []artifact{ + {uri: artifactURL2, digest: "sha256:" + artifactDigest1}, + {uri: artifactURL2, digest: "sha256:" + artifactDigest2}, + }), + deepInspectionEnabled: true, + wantSubjects: []intoto.Subject{ + { + Name: artifactURL2, + Digest: map[string]string{ + "sha256": artifactDigest2, + }, + }, + { + Name: artifactURL2, + Digest: map[string]string{ + "sha256": artifactDigest1, + }, + }, + }, + wantFullURLs: []string{ + fmt.Sprintf("%s@sha256:%s", artifactURL2, artifactDigest1), + fmt.Sprintf("%s@sha256:%s", artifactURL2, artifactDigest2), + }, + }, + { + name: "deep inspection enabled: 2 taskruns have same uri with same sha256 digests", + pro: createProWithTaskRunResults(nil, []artifact{ + {uri: artifactURL2, digest: "sha256:" + artifactDigest2}, + {uri: artifactURL2, digest: "sha256:" + artifactDigest2}, + }), + deepInspectionEnabled: true, + wantSubjects: []intoto.Subject{ + { + Name: artifactURL2, + Digest: map[string]string{ + "sha256": artifactDigest2, + }, + }, + }, + wantFullURLs: []string{ + fmt.Sprintf("%s@sha256:%s", artifactURL2, artifactDigest2), + }, + }, + { + name: "deep inspection enabled: pipelinerun and taskrun have duplicated results", + pro: createProWithTaskRunResults( + createProWithPipelineResults(map[string]string{artifactURL1: "sha256:" + artifactDigest1}).(*objects.PipelineRunObject), + []artifact{ + {uri: artifactURL1, digest: "sha256:" + artifactDigest1}, + }), + deepInspectionEnabled: true, + wantSubjects: []intoto.Subject{ + { + Name: artifactURL1, + Digest: map[string]string{ + "sha256": artifactDigest1, + }, + }, + }, + wantFullURLs: []string{ + fmt.Sprintf("%s@sha256:%s", artifactURL1, artifactDigest1), + }, + }, + { + name: "deep inspection enabled: pipelinerun and taskrun have different results", + pro: createProWithTaskRunResults( + createProWithPipelineResults(map[string]string{artifactURL1: "sha256:" + artifactDigest1}).(*objects.PipelineRunObject), + []artifact{ + {uri: artifactURL2, digest: "sha256:" + artifactDigest2}, + }), + deepInspectionEnabled: true, + wantSubjects: []intoto.Subject{ + { + Name: artifactURL1, + Digest: map[string]string{ + "sha256": artifactDigest1, + }, + }, + { + Name: artifactURL2, + Digest: map[string]string{ + "sha256": artifactDigest2, + }, + }, + }, + wantFullURLs: []string{ + fmt.Sprintf("%s@sha256:%s", artifactURL1, artifactDigest1), + fmt.Sprintf("%s@sha256:%s", artifactURL2, artifactDigest2), + }, + }, + } + + for _, tc := range tests { + t.Run(tc.name, func(t *testing.T) { + ctx := logtesting.TestContextWithLogger(t) + + gotSubjects := extract.SubjectDigests(ctx, tc.pro, &slsaconfig.SlsaConfig{DeepInspectionEnabled: tc.deepInspectionEnabled}) + if diff := cmp.Diff(tc.wantSubjects, gotSubjects, cmpopts.SortSlices(func(x, y intoto.Subject) bool { return x.Name < y.Name })); diff != "" { + t.Errorf("Wrong subjects extracted, diff=%s, %s", diff, gotSubjects) + } + + gotURIs := extract.RetrieveAllArtifactURIs(ctx, tc.pro, tc.deepInspectionEnabled) + if diff := cmp.Diff(tc.wantFullURLs, gotURIs, cmpopts.SortSlices(func(x, y string) bool { return x < y })); diff != "" { + t.Errorf("Wrong URIs extracted, diff=%s", diff) + } + }) + } +} + func createTaskRunObjectWithResults(results map[string]string) objects.TektonObject { trResults := []v1beta1.TaskRunResult{} prefix := 0 @@ -143,7 +292,7 @@ func createTaskRunObjectWithResults(results map[string]string) objects.TektonObj ) } -func createPipelineRunObjectWithResults(results map[string]string) objects.TektonObject { +func createProWithPipelineResults(results map[string]string) objects.TektonObject { prResults := []v1beta1.PipelineRunResult{} prefix := 0 for url, digest := range results { @@ -164,3 +313,52 @@ func createPipelineRunObjectWithResults(results map[string]string) objects.Tekto }, ) } + +type artifact struct { + uri string + digest string +} + +// create a child taskrun for each result +// +//nolint:all +func createProWithTaskRunResults(pro *objects.PipelineRunObject, results []artifact) objects.TektonObject { + if pro == nil { + pro = objects.NewPipelineRunObject(&v1beta1.PipelineRun{ + Status: v1beta1.PipelineRunStatus{ + PipelineRunStatusFields: v1beta1.PipelineRunStatusFields{ + PipelineSpec: &v1beta1.PipelineSpec{}, + }, + }, + }) + } + + if pro.Status.PipelineSpec == nil { + pro.Status.PipelineSpec = &v1beta1.PipelineSpec{} + } + + // create child taskruns with results and pipelinetask + prefix := 0 + for _, r := range results { + // simulate child taskruns + pipelineTaskName := fmt.Sprintf("task-%d", prefix) + tr := &v1beta1.TaskRun{ + ObjectMeta: metav1.ObjectMeta{Labels: map[string]string{objects.PipelineTaskLabel: pipelineTaskName}}, + Status: v1beta1.TaskRunStatus{ + TaskRunStatusFields: v1beta1.TaskRunStatusFields{ + CompletionTime: &metav1.Time{Time: time.Date(1995, time.December, 24, 6, 12, 12, 24, time.UTC)}, + TaskRunResults: []v1beta1.TaskRunResult{ + {Name: fmt.Sprintf("%v_IMAGE_DIGEST", prefix), Value: *v1beta1.NewStructuredValues(r.digest)}, + {Name: fmt.Sprintf("%v_IMAGE_URL", prefix), Value: *v1beta1.NewStructuredValues(r.uri)}, + }, + }, + }, + } + + pro.AppendTaskRun(tr) + pro.Status.PipelineSpec.Tasks = append(pro.Status.PipelineSpec.Tasks, v1beta1.PipelineTask{Name: pipelineTaskName}) + prefix++ + } + + return pro +} diff --git a/pkg/chains/formats/slsa/internal/slsaconfig/slsaconfig.go b/pkg/chains/formats/slsa/internal/slsaconfig/slsaconfig.go index 64388806c9..343cbf5bb7 100644 --- a/pkg/chains/formats/slsa/internal/slsaconfig/slsaconfig.go +++ b/pkg/chains/formats/slsa/internal/slsaconfig/slsaconfig.go @@ -18,4 +18,6 @@ package slsaconfig type SlsaConfig struct { // BuilderID is the URI of the trusted build platform. BuilderID string + // DeepInspectionEnabled configures whether to dive into child taskruns in a pipelinerun + DeepInspectionEnabled bool } diff --git a/pkg/chains/formats/slsa/testdata/taskrun-multiple-subjects.json b/pkg/chains/formats/slsa/testdata/taskrun-multiple-subjects.json index d7716372c8..32ddbc30e5 100644 --- a/pkg/chains/formats/slsa/testdata/taskrun-multiple-subjects.json +++ b/pkg/chains/formats/slsa/testdata/taskrun-multiple-subjects.json @@ -28,7 +28,7 @@ "taskResults": [ { "name": "IMAGES", - "value": "gcr.io/myimage@sha256:d4b63d3e24d6eef04a6dc0795cf8a73470688803d97c52cffa3c8d4efd3397b6,gcr.io/myimage@sha256:daa1a56e13c85cf164e7d9e595006649e3a04c47fe4a8261320e18a0bf3b0367" + "value": "gcr.io/myimage1@sha256:d4b63d3e24d6eef04a6dc0795cf8a73470688803d97c52cffa3c8d4efd3397b6,gcr.io/myimage2@sha256:daa1a56e13c85cf164e7d9e595006649e3a04c47fe4a8261320e18a0bf3b0367" } ], "taskSpec": { diff --git a/pkg/chains/formats/slsa/testdata/v2alpha2/taskrun-multiple-subjects.json b/pkg/chains/formats/slsa/testdata/v2alpha2/taskrun-multiple-subjects.json index d7716372c8..32ddbc30e5 100644 --- a/pkg/chains/formats/slsa/testdata/v2alpha2/taskrun-multiple-subjects.json +++ b/pkg/chains/formats/slsa/testdata/v2alpha2/taskrun-multiple-subjects.json @@ -28,7 +28,7 @@ "taskResults": [ { "name": "IMAGES", - "value": "gcr.io/myimage@sha256:d4b63d3e24d6eef04a6dc0795cf8a73470688803d97c52cffa3c8d4efd3397b6,gcr.io/myimage@sha256:daa1a56e13c85cf164e7d9e595006649e3a04c47fe4a8261320e18a0bf3b0367" + "value": "gcr.io/myimage1@sha256:d4b63d3e24d6eef04a6dc0795cf8a73470688803d97c52cffa3c8d4efd3397b6,gcr.io/myimage2@sha256:daa1a56e13c85cf164e7d9e595006649e3a04c47fe4a8261320e18a0bf3b0367" } ], "taskSpec": { diff --git a/pkg/chains/formats/slsa/v1/intotoite6.go b/pkg/chains/formats/slsa/v1/intotoite6.go index 0b5ff609ea..3849879753 100644 --- a/pkg/chains/formats/slsa/v1/intotoite6.go +++ b/pkg/chains/formats/slsa/v1/intotoite6.go @@ -53,7 +53,8 @@ func NewFormatter(ctx context.Context, cfg config.Config) (formats.Payloader, er builderID: cfg.Builder.ID, sbomMaxBytes: cfg.Artifacts.SBOM.MaxBytes, slsaConfig: &slsaconfig.SlsaConfig{ - BuilderID: cfg.Builder.ID, + BuilderID: cfg.Builder.ID, + DeepInspectionEnabled: cfg.Artifacts.PipelineRuns.DeepInspectionEnabled, }, }, nil } diff --git a/pkg/chains/formats/slsa/v1/intotoite6_test.go b/pkg/chains/formats/slsa/v1/intotoite6_test.go index a8249a7d77..cb7dd89ea4 100644 --- a/pkg/chains/formats/slsa/v1/intotoite6_test.go +++ b/pkg/chains/formats/slsa/v1/intotoite6_test.go @@ -683,12 +683,12 @@ func TestMultipleSubjects(t *testing.T) { PredicateType: slsa.PredicateSLSAProvenance, Subject: []in_toto.Subject{ { - Name: "gcr.io/myimage", + Name: "gcr.io/myimage1", Digest: common.DigestSet{ "sha256": "d4b63d3e24d6eef04a6dc0795cf8a73470688803d97c52cffa3c8d4efd3397b6", }, }, { - Name: "gcr.io/myimage", + Name: "gcr.io/myimage2", Digest: common.DigestSet{ "sha256": "daa1a56e13c85cf164e7d9e595006649e3a04c47fe4a8261320e18a0bf3b0367", }, diff --git a/pkg/chains/formats/slsa/v1/pipelinerun/pipelinerun.go b/pkg/chains/formats/slsa/v1/pipelinerun/pipelinerun.go index c1781fb209..984450e8f9 100644 --- a/pkg/chains/formats/slsa/v1/pipelinerun/pipelinerun.go +++ b/pkg/chains/formats/slsa/v1/pipelinerun/pipelinerun.go @@ -48,7 +48,7 @@ type TaskAttestation struct { } func GenerateAttestation(ctx context.Context, pro *objects.PipelineRunObject, slsaConfig *slsaconfig.SlsaConfig) (interface{}, error) { - subjects := extract.SubjectDigests(ctx, pro) + subjects := extract.SubjectDigests(ctx, pro, slsaConfig) mat, err := material.PipelineMaterials(ctx, pro) if err != nil { diff --git a/pkg/chains/formats/slsa/v1/pipelinerun/provenance_test.go b/pkg/chains/formats/slsa/v1/pipelinerun/provenance_test.go index 1f1ee34c6c..1674e0dd5a 100644 --- a/pkg/chains/formats/slsa/v1/pipelinerun/provenance_test.go +++ b/pkg/chains/formats/slsa/v1/pipelinerun/provenance_test.go @@ -26,6 +26,7 @@ import ( "github.com/tektoncd/chains/pkg/artifacts" "github.com/tektoncd/chains/pkg/chains/formats/slsa/attest" "github.com/tektoncd/chains/pkg/chains/formats/slsa/extract" + "github.com/tektoncd/chains/pkg/chains/formats/slsa/internal/slsaconfig" "github.com/tektoncd/chains/pkg/chains/objects" "github.com/tektoncd/chains/pkg/internal/objectloader" "github.com/tektoncd/pipeline/pkg/apis/pipeline/v1beta1" @@ -480,7 +481,7 @@ func TestSubjectDigests(t *testing.T) { } ctx := logtesting.TestContextWithLogger(t) - gotSubjects := extract.SubjectDigests(ctx, pro) + gotSubjects := extract.SubjectDigests(ctx, pro, &slsaconfig.SlsaConfig{DeepInspectionEnabled: false}) opts := append(ignore, cmpopts.SortSlices(func(x, y intoto.Subject) bool { return x.Name < y.Name })) if diff := cmp.Diff(gotSubjects, wantSubjects, opts...); diff != "" { t.Errorf("Differences in subjects: -want +got: %s", diff) diff --git a/pkg/chains/formats/slsa/v1/taskrun/provenance_test.go b/pkg/chains/formats/slsa/v1/taskrun/provenance_test.go index 0b0d47ab06..8d87becb0f 100644 --- a/pkg/chains/formats/slsa/v1/taskrun/provenance_test.go +++ b/pkg/chains/formats/slsa/v1/taskrun/provenance_test.go @@ -333,7 +333,7 @@ func TestGetSubjectDigests(t *testing.T) { } ctx := logtesting.TestContextWithLogger(t) tro := objects.NewTaskRunObject(tr) - got := extract.SubjectDigests(ctx, tro) + got := extract.SubjectDigests(ctx, tro, nil) if !reflect.DeepEqual(expected, got) { if d := cmp.Diff(expected, got); d != "" { t.Log(d) diff --git a/pkg/chains/formats/slsa/v1/taskrun/taskrun.go b/pkg/chains/formats/slsa/v1/taskrun/taskrun.go index 99fb9773d1..b5e4509142 100644 --- a/pkg/chains/formats/slsa/v1/taskrun/taskrun.go +++ b/pkg/chains/formats/slsa/v1/taskrun/taskrun.go @@ -28,7 +28,7 @@ import ( ) func GenerateAttestation(ctx context.Context, tro *objects.TaskRunObject, slsaConfig *slsaconfig.SlsaConfig) (interface{}, error) { - subjects := extract.SubjectDigests(ctx, tro) + subjects := extract.SubjectDigests(ctx, tro, slsaConfig) mat, err := material.TaskMaterials(ctx, tro) if err != nil { diff --git a/pkg/chains/formats/slsa/v2alpha1/slsav2_test.go b/pkg/chains/formats/slsa/v2alpha1/slsav2_test.go index 5448f6b261..ea772f2656 100644 --- a/pkg/chains/formats/slsa/v2alpha1/slsav2_test.go +++ b/pkg/chains/formats/slsa/v2alpha1/slsav2_test.go @@ -293,12 +293,12 @@ func TestMultipleSubjects(t *testing.T) { PredicateType: slsa.PredicateSLSAProvenance, Subject: []in_toto.Subject{ { - Name: "gcr.io/myimage", + Name: "gcr.io/myimage1", Digest: common.DigestSet{ "sha256": "d4b63d3e24d6eef04a6dc0795cf8a73470688803d97c52cffa3c8d4efd3397b6", }, }, { - Name: "gcr.io/myimage", + Name: "gcr.io/myimage2", Digest: common.DigestSet{ "sha256": "daa1a56e13c85cf164e7d9e595006649e3a04c47fe4a8261320e18a0bf3b0367", }, @@ -353,7 +353,7 @@ func TestMultipleSubjects(t *testing.T) { Name: "IMAGES", Value: v1beta1.ParamValue{ Type: "string", - StringVal: "gcr.io/myimage@sha256:d4b63d3e24d6eef04a6dc0795cf8a73470688803d97c52cffa3c8d4efd3397b6,gcr.io/myimage@sha256:daa1a56e13c85cf164e7d9e595006649e3a04c47fe4a8261320e18a0bf3b0367", + StringVal: "gcr.io/myimage1@sha256:d4b63d3e24d6eef04a6dc0795cf8a73470688803d97c52cffa3c8d4efd3397b6,gcr.io/myimage2@sha256:daa1a56e13c85cf164e7d9e595006649e3a04c47fe4a8261320e18a0bf3b0367", }, }, }, diff --git a/pkg/chains/formats/slsa/v2alpha1/taskrun/taskrun.go b/pkg/chains/formats/slsa/v2alpha1/taskrun/taskrun.go index f7ca35cc3a..f9c01dbc1a 100644 --- a/pkg/chains/formats/slsa/v2alpha1/taskrun/taskrun.go +++ b/pkg/chains/formats/slsa/v2alpha1/taskrun/taskrun.go @@ -38,7 +38,7 @@ type BuildConfig struct { } func GenerateAttestation(ctx context.Context, builderID string, payloadType config.PayloadType, tro *objects.TaskRunObject) (interface{}, error) { - subjects := extract.SubjectDigests(ctx, tro) + subjects := extract.SubjectDigests(ctx, tro, nil) mat, err := material.TaskMaterials(ctx, tro) if err != nil { return nil, err diff --git a/pkg/chains/formats/slsa/v2alpha1/taskrun/taskrun_test.go b/pkg/chains/formats/slsa/v2alpha1/taskrun/taskrun_test.go index 9e515bff15..ccfcbb5070 100644 --- a/pkg/chains/formats/slsa/v2alpha1/taskrun/taskrun_test.go +++ b/pkg/chains/formats/slsa/v2alpha1/taskrun/taskrun_test.go @@ -358,7 +358,7 @@ func TestGetSubjectDigests(t *testing.T) { } tro := objects.NewTaskRunObject(tr) ctx := logtesting.TestContextWithLogger(t) - got := extract.SubjectDigests(ctx, tro) + got := extract.SubjectDigests(ctx, tro, nil) if !reflect.DeepEqual(expected, got) { if d := cmp.Diff(expected, got); d != "" { t.Log(d) diff --git a/pkg/chains/formats/slsa/v2alpha2/internal/pipelinerun/pipelinerun.go b/pkg/chains/formats/slsa/v2alpha2/internal/pipelinerun/pipelinerun.go index cc33e3475c..f9f334a44e 100644 --- a/pkg/chains/formats/slsa/v2alpha2/internal/pipelinerun/pipelinerun.go +++ b/pkg/chains/formats/slsa/v2alpha2/internal/pipelinerun/pipelinerun.go @@ -46,7 +46,7 @@ func GenerateAttestation(ctx context.Context, pro *objects.PipelineRunObject, sl StatementHeader: intoto.StatementHeader{ Type: intoto.StatementInTotoV01, PredicateType: slsa.PredicateSLSAProvenance, - Subject: extract.SubjectDigests(ctx, pro), + Subject: extract.SubjectDigests(ctx, pro, slsaconfig), }, Predicate: slsa.ProvenancePredicate{ BuildDefinition: slsa.ProvenanceBuildDefinition{ diff --git a/pkg/chains/formats/slsa/v2alpha2/internal/pipelinerun/pipelinerun_test.go b/pkg/chains/formats/slsa/v2alpha2/internal/pipelinerun/pipelinerun_test.go index 29e3e17f7d..d13a5d30ef 100644 --- a/pkg/chains/formats/slsa/v2alpha2/internal/pipelinerun/pipelinerun_test.go +++ b/pkg/chains/formats/slsa/v2alpha2/internal/pipelinerun/pipelinerun_test.go @@ -351,7 +351,8 @@ func TestGenerateAttestation(t *testing.T) { } got, err := GenerateAttestation(ctx, pr, &slsaconfig.SlsaConfig{ - BuilderID: "test_builder-1", + BuilderID: "test_builder-1", + DeepInspectionEnabled: false, }) if err != nil { diff --git a/pkg/chains/formats/slsa/v2alpha2/internal/taskrun/taskrun.go b/pkg/chains/formats/slsa/v2alpha2/internal/taskrun/taskrun.go index 7c82db346f..fc1b88a512 100644 --- a/pkg/chains/formats/slsa/v2alpha2/internal/taskrun/taskrun.go +++ b/pkg/chains/formats/slsa/v2alpha2/internal/taskrun/taskrun.go @@ -22,7 +22,6 @@ import ( slsa "github.com/in-toto/in-toto-golang/in_toto/slsa_provenance/v1" "github.com/tektoncd/chains/pkg/chains/formats/slsa/extract" "github.com/tektoncd/chains/pkg/chains/formats/slsa/internal/slsaconfig" - "github.com/tektoncd/chains/pkg/chains/formats/slsa/v2alpha2/internal/pipelinerun" resolveddependencies "github.com/tektoncd/chains/pkg/chains/formats/slsa/v2alpha2/internal/resolved_dependencies" "github.com/tektoncd/chains/pkg/chains/objects" ) @@ -43,7 +42,7 @@ func GenerateAttestation(ctx context.Context, tro *objects.TaskRunObject, slsaCo StatementHeader: intoto.StatementHeader{ Type: intoto.StatementInTotoV01, PredicateType: slsa.PredicateSLSAProvenance, - Subject: extract.SubjectDigests(ctx, tro), + Subject: extract.SubjectDigests(ctx, tro, slsaConfig), }, Predicate: slsa.ProvenancePredicate{ BuildDefinition: slsa.ProvenanceBuildDefinition{ @@ -128,7 +127,7 @@ func byproducts(tro *objects.TaskRunObject) ([]slsa.ResourceDescriptor, error) { bp := slsa.ResourceDescriptor{ Name: fmt.Sprintf(taskRunResults, key.Name), Content: content, - MediaType: pipelinerun.JsonMediaType, + MediaType: "application/json", } byProd = append(byProd, bp) } diff --git a/pkg/chains/formats/slsa/v2alpha2/slsav2.go b/pkg/chains/formats/slsa/v2alpha2/slsav2.go index af5dae04df..8c806bd2be 100644 --- a/pkg/chains/formats/slsa/v2alpha2/slsav2.go +++ b/pkg/chains/formats/slsa/v2alpha2/slsav2.go @@ -43,7 +43,8 @@ type Slsa struct { func NewFormatter(_ context.Context, cfg config.Config) (formats.Payloader, error) { return &Slsa{ slsaConfig: &slsaconfig.SlsaConfig{ - BuilderID: cfg.Builder.ID, + BuilderID: cfg.Builder.ID, + DeepInspectionEnabled: cfg.Artifacts.PipelineRuns.DeepInspectionEnabled, }, }, nil } diff --git a/pkg/chains/formats/slsa/v2alpha2/slsav2_test.go b/pkg/chains/formats/slsa/v2alpha2/slsav2_test.go index a43e8ecb20..2ec055f3b1 100644 --- a/pkg/chains/formats/slsa/v2alpha2/slsav2_test.go +++ b/pkg/chains/formats/slsa/v2alpha2/slsav2_test.go @@ -293,7 +293,7 @@ func TestMultipleSubjects(t *testing.T) { resultValue := v1beta1.ParamValue{ Type: "string", - StringVal: "gcr.io/myimage@sha256:d4b63d3e24d6eef04a6dc0795cf8a73470688803d97c52cffa3c8d4efd3397b6,gcr.io/myimage@sha256:daa1a56e13c85cf164e7d9e595006649e3a04c47fe4a8261320e18a0bf3b0367", + StringVal: "gcr.io/myimage1@sha256:d4b63d3e24d6eef04a6dc0795cf8a73470688803d97c52cffa3c8d4efd3397b6,gcr.io/myimage2@sha256:daa1a56e13c85cf164e7d9e595006649e3a04c47fe4a8261320e18a0bf3b0367", } resultBytes, err := json.Marshal(resultValue) if err != nil { @@ -310,12 +310,12 @@ func TestMultipleSubjects(t *testing.T) { PredicateType: slsa.PredicateSLSAProvenance, Subject: []in_toto.Subject{ { - Name: "gcr.io/myimage", + Name: "gcr.io/myimage1", Digest: common.DigestSet{ "sha256": "d4b63d3e24d6eef04a6dc0795cf8a73470688803d97c52cffa3c8d4efd3397b6", }, }, { - Name: "gcr.io/myimage", + Name: "gcr.io/myimage2", Digest: common.DigestSet{ "sha256": "daa1a56e13c85cf164e7d9e595006649e3a04c47fe4a8261320e18a0bf3b0367", }, diff --git a/pkg/chains/storage/grafeas/grafeas.go b/pkg/chains/storage/grafeas/grafeas.go index fdaa1997c3..7f04f3e86e 100644 --- a/pkg/chains/storage/grafeas/grafeas.go +++ b/pkg/chains/storage/grafeas/grafeas.go @@ -253,7 +253,7 @@ func (b *Backend) createOccurrence(ctx context.Context, obj objects.TektonObject } // create Occurrence_Build for TaskRun - allURIs := extract.RetrieveAllArtifactURIs(ctx, obj) + allURIs := extract.RetrieveAllArtifactURIs(ctx, obj, b.cfg.Artifacts.PipelineRuns.DeepInspectionEnabled) for _, uri := range allURIs { occ, err := b.createBuildOccurrence(ctx, obj, payload, signature, uri) if err != nil { @@ -364,7 +364,7 @@ func (b *Backend) getBuildNotePath(obj objects.TektonObject) string { func (b *Backend) getAllOccurrences(ctx context.Context, obj objects.TektonObject, opts config.StorageOpts) ([]*pb.Occurrence, error) { result := []*pb.Occurrence{} // step 1: get all resource URIs created under the taskrun - uriFilters := extract.RetrieveAllArtifactURIs(ctx, obj) + uriFilters := extract.RetrieveAllArtifactURIs(ctx, obj, b.cfg.Artifacts.PipelineRuns.DeepInspectionEnabled) // step 2: find all build occurrences if _, ok := formats.IntotoAttestationSet[opts.PayloadFormat]; ok { diff --git a/pkg/chains/storage/grafeas/grafeas_test.go b/pkg/chains/storage/grafeas/grafeas_test.go index 0c4d28e5a1..295ceacc50 100644 --- a/pkg/chains/storage/grafeas/grafeas_test.go +++ b/pkg/chains/storage/grafeas/grafeas_test.go @@ -349,6 +349,11 @@ func TestGrafeasBackend_StoreAndRetrieve(t *testing.T) { NoteID: NoteID, }, }, + Artifacts: config.ArtifactConfigs{ + PipelineRuns: config.Artifact{ + DeepInspectionEnabled: false, + }, + }, }, } // test if the attestation of the taskrun/oci artifact can be successfully stored into grafeas server @@ -398,7 +403,7 @@ func testStoreAndRetrieveHelper(ctx context.Context, t *testing.T, test testConf expectSignature[test.args.opts.FullKey] = []string{test.args.signature} } if _, ok := formats.IntotoAttestationSet[test.args.opts.PayloadFormat]; ok { - allURIs := extract.RetrieveAllArtifactURIs(ctx, test.args.runObject) + allURIs := extract.RetrieveAllArtifactURIs(ctx, test.args.runObject, false) for _, u := range allURIs { expectSignature[u] = []string{test.args.signature} } @@ -420,7 +425,7 @@ func testStoreAndRetrieveHelper(ctx context.Context, t *testing.T, test testConf expectPayload[test.args.opts.FullKey] = string(test.args.payload) } if _, ok := formats.IntotoAttestationSet[test.args.opts.PayloadFormat]; ok { - allURIs := extract.RetrieveAllArtifactURIs(ctx, test.args.runObject) + allURIs := extract.RetrieveAllArtifactURIs(ctx, test.args.runObject, false) for _, u := range allURIs { expectPayload[u] = string(test.args.payload) } diff --git a/pkg/config/config.go b/pkg/config/config.go index 7ddc78e862..77009b9418 100644 --- a/pkg/config/config.go +++ b/pkg/config/config.go @@ -45,9 +45,10 @@ type ArtifactConfigs struct { // Artifact contains the configuration for how to sign/store/format the signatures for a single artifact type Artifact struct { - Format string - StorageBackend sets.Set[string] - Signer string + Format string + StorageBackend sets.Set[string] + Signer string + DeepInspectionEnabled bool } // SBOMArtifact contains the configuration for how to sign/store/format SBOM artifacts @@ -157,9 +158,10 @@ const ( taskrunStorageKey = "artifacts.taskrun.storage" taskrunSignerKey = "artifacts.taskrun.signer" - pipelinerunFormatKey = "artifacts.pipelinerun.format" - pipelinerunStorageKey = "artifacts.pipelinerun.storage" - pipelinerunSignerKey = "artifacts.pipelinerun.signer" + pipelinerunFormatKey = "artifacts.pipelinerun.format" + pipelinerunStorageKey = "artifacts.pipelinerun.storage" + pipelinerunSignerKey = "artifacts.pipelinerun.signer" + pipelinerunEnableDeepInspectionKey = "artifacts.pipelinerun.enable-deep-inspection" ociFormatKey = "artifacts.oci.format" ociStorageKey = "artifacts.oci.storage" @@ -229,9 +231,10 @@ func defaultConfig() *Config { Signer: "x509", }, PipelineRuns: Artifact{ - Format: "in-toto", - StorageBackend: sets.New[string]("tekton"), - Signer: "x509", + Format: "in-toto", + StorageBackend: sets.New[string]("tekton"), + Signer: "x509", + DeepInspectionEnabled: false, }, OCI: Artifact{ Format: "simplesigning", @@ -283,6 +286,7 @@ func NewConfigFromMap(data map[string]string) (*Config, error) { asString(pipelinerunFormatKey, &cfg.Artifacts.PipelineRuns.Format, "in-toto", "slsa/v1", "slsa/v2alpha2"), asStringSet(pipelinerunStorageKey, &cfg.Artifacts.PipelineRuns.StorageBackend, sets.New[string]("tekton", "oci", "docdb", "grafeas")), asString(pipelinerunSignerKey, &cfg.Artifacts.PipelineRuns.Signer, "x509", "kms"), + asBool(pipelinerunEnableDeepInspectionKey, &cfg.Artifacts.PipelineRuns.DeepInspectionEnabled), // OCI asString(ociFormatKey, &cfg.Artifacts.OCI.Format, "simplesigning"), diff --git a/pkg/config/store_test.go b/pkg/config/store_test.go index e2afc486f5..7f0aea5923 100644 --- a/pkg/config/store_test.go +++ b/pkg/config/store_test.go @@ -103,9 +103,10 @@ var defaultArtifacts = ArtifactConfigs{ Signer: "x509", }, PipelineRuns: Artifact{ - Format: "in-toto", - Signer: "x509", - StorageBackend: sets.New[string]("tekton"), + Format: "in-toto", + Signer: "x509", + StorageBackend: sets.New[string]("tekton"), + DeepInspectionEnabled: false, }, OCI: Artifact{ Format: "simplesigning", @@ -206,9 +207,10 @@ func TestParse(t *testing.T) { Signer: "x509", }, PipelineRuns: Artifact{ - Format: "in-toto", - Signer: "x509", - StorageBackend: sets.New[string]("tekton"), + Format: "in-toto", + Signer: "x509", + StorageBackend: sets.New[string]("tekton"), + DeepInspectionEnabled: false, }, OCI: Artifact{ Format: "simplesigning", @@ -244,9 +246,10 @@ func TestParse(t *testing.T) { Signer: "x509", }, PipelineRuns: Artifact{ - Format: "in-toto", - Signer: "x509", - StorageBackend: sets.New[string]("tekton", "docdb"), + Format: "in-toto", + Signer: "x509", + StorageBackend: sets.New[string]("tekton", "docdb"), + DeepInspectionEnabled: false, }, OCI: Artifact{ Format: "simplesigning", @@ -282,9 +285,10 @@ func TestParse(t *testing.T) { Signer: "x509", }, PipelineRuns: Artifact{ - Format: "in-toto", - Signer: "x509", - StorageBackend: sets.New[string]("tekton"), + Format: "in-toto", + Signer: "x509", + StorageBackend: sets.New[string]("tekton"), + DeepInspectionEnabled: false, }, OCI: Artifact{ Format: "simplesigning", @@ -320,9 +324,10 @@ func TestParse(t *testing.T) { Signer: "x509", }, PipelineRuns: Artifact{ - Format: "in-toto", - Signer: "x509", - StorageBackend: sets.New[string]("tekton"), + Format: "in-toto", + Signer: "x509", + StorageBackend: sets.New[string]("tekton"), + DeepInspectionEnabled: false, }, OCI: Artifact{ Format: "simplesigning", @@ -358,9 +363,10 @@ func TestParse(t *testing.T) { Signer: "x509", }, PipelineRuns: Artifact{ - Format: "in-toto", - Signer: "x509", - StorageBackend: sets.New[string]("tekton"), + Format: "in-toto", + Signer: "x509", + StorageBackend: sets.New[string]("tekton"), + DeepInspectionEnabled: false, }, OCI: Artifact{ Format: "simplesigning", @@ -399,9 +405,10 @@ func TestParse(t *testing.T) { Signer: "x509", }, PipelineRuns: Artifact{ - Format: "in-toto", - Signer: "x509", - StorageBackend: sets.New[string]("tekton"), + Format: "in-toto", + Signer: "x509", + StorageBackend: sets.New[string]("tekton"), + DeepInspectionEnabled: false, }, OCI: Artifact{ Format: "simplesigning", @@ -440,9 +447,10 @@ func TestParse(t *testing.T) { Signer: "x509", }, PipelineRuns: Artifact{ - Format: "in-toto", - Signer: "x509", - StorageBackend: sets.New[string]("tekton"), + Format: "in-toto", + Signer: "x509", + StorageBackend: sets.New[string]("tekton"), + DeepInspectionEnabled: false, }, OCI: Artifact{ Format: "simplesigning", @@ -563,9 +571,10 @@ func TestParse(t *testing.T) { StorageBackend: sets.New[string]("tekton"), }, PipelineRuns: Artifact{ - Format: "in-toto", - Signer: "x509", - StorageBackend: sets.New[string]("tekton"), + Format: "in-toto", + Signer: "x509", + StorageBackend: sets.New[string]("tekton"), + DeepInspectionEnabled: false, }, OCI: Artifact{ Format: "simplesigning", @@ -607,8 +616,9 @@ func TestParse(t *testing.T) { { name: "extra", data: map[string]string{ - taskrunSignerKey: "x509", - "other-key": "foo", + taskrunSignerKey: "x509", + "other-key": "foo", + pipelinerunEnableDeepInspectionKey: "tr", }, taskrunEnabled: true, ociEnbaled: true, @@ -622,9 +632,10 @@ func TestParse(t *testing.T) { StorageBackend: sets.New[string]("tekton"), }, PipelineRuns: Artifact{ - Format: "in-toto", - Signer: "x509", - StorageBackend: sets.New[string]("tekton"), + Format: "in-toto", + Signer: "x509", + StorageBackend: sets.New[string]("tekton"), + DeepInspectionEnabled: false, }, OCI: Artifact{ Format: "simplesigning", @@ -663,9 +674,10 @@ func TestParse(t *testing.T) { StorageBackend: sets.New[string]("tekton"), }, PipelineRuns: Artifact{ - Format: "in-toto", - Signer: "x509", - StorageBackend: sets.New[string]("tekton"), + Format: "in-toto", + Signer: "x509", + StorageBackend: sets.New[string]("tekton"), + DeepInspectionEnabled: false, }, OCI: Artifact{ Format: "simplesigning", diff --git a/vendor/cloud.google.com/go/compute/internal/version.go b/vendor/cloud.google.com/go/compute/internal/version.go index eddfee04b0..6395537003 100644 --- a/vendor/cloud.google.com/go/compute/internal/version.go +++ b/vendor/cloud.google.com/go/compute/internal/version.go @@ -15,4 +15,4 @@ package internal // Version is the current tagged release of the library. -const Version = "1.22.0" +const Version = "1.23.0" diff --git a/vendor/cloud.google.com/go/firestore/apiv1/firestorepb/common.pb.go b/vendor/cloud.google.com/go/firestore/apiv1/firestorepb/common.pb.go index 3638d6ff53..c32527aa6b 100644 --- a/vendor/cloud.google.com/go/firestore/apiv1/firestorepb/common.pb.go +++ b/vendor/cloud.google.com/go/firestore/apiv1/firestorepb/common.pb.go @@ -265,6 +265,9 @@ func (*TransactionOptions_ReadOnly_) isTransactionOptions_Mode() {} func (*TransactionOptions_ReadWrite_) isTransactionOptions_Mode() {} // Options for a transaction that can be used to read and write documents. +// +// Firestore does not allow 3rd party auth requests to create read-write. +// transactions. type TransactionOptions_ReadWrite struct { state protoimpl.MessageState sizeCache protoimpl.SizeCache @@ -379,7 +382,10 @@ type isTransactionOptions_ReadOnly_ConsistencySelector interface { type TransactionOptions_ReadOnly_ReadTime struct { // Reads documents at the given time. - // This may not be older than 60 seconds. + // + // This must be a microsecond precision timestamp within the past one + // hour, or if Point-in-Time Recovery is enabled, can additionally be a + // whole minute timestamp within the past 7 days. ReadTime *timestamppb.Timestamp `protobuf:"bytes,2,opt,name=read_time,json=readTime,proto3,oneof"` } diff --git a/vendor/cloud.google.com/go/firestore/apiv1/firestorepb/firestore.pb.go b/vendor/cloud.google.com/go/firestore/apiv1/firestorepb/firestore.pb.go index 9fd2bfbce1..d43409fed4 100644 --- a/vendor/cloud.google.com/go/firestore/apiv1/firestorepb/firestore.pb.go +++ b/vendor/cloud.google.com/go/firestore/apiv1/firestorepb/firestore.pb.go @@ -218,7 +218,10 @@ type GetDocumentRequest_Transaction struct { type GetDocumentRequest_ReadTime struct { // Reads the version of the document at the given time. - // This may not be older than 270 seconds. + // + // This must be a microsecond precision timestamp within the past one hour, + // or if Point-in-Time Recovery is enabled, can additionally be a whole + // minute timestamp within the past 7 days. ReadTime *timestamppb.Timestamp `protobuf:"bytes,5,opt,name=read_time,json=readTime,proto3,oneof"` } @@ -404,7 +407,9 @@ type ListDocumentsRequest_Transaction struct { type ListDocumentsRequest_ReadTime struct { // Perform the read at the provided time. // - // This may not be older than 270 seconds. + // This must be a microsecond precision timestamp within the past one hour, + // or if Point-in-Time Recovery is enabled, can additionally be a whole + // minute timestamp within the past 7 days. ReadTime *timestamppb.Timestamp `protobuf:"bytes,10,opt,name=read_time,json=readTime,proto3,oneof"` } @@ -846,7 +851,10 @@ type BatchGetDocumentsRequest_NewTransaction struct { type BatchGetDocumentsRequest_ReadTime struct { // Reads documents as they were at the given time. - // This may not be older than 270 seconds. + // + // This must be a microsecond precision timestamp within the past one hour, + // or if Point-in-Time Recovery is enabled, can additionally be a whole + // minute timestamp within the past 7 days. ReadTime *timestamppb.Timestamp `protobuf:"bytes,7,opt,name=read_time,json=readTime,proto3,oneof"` } @@ -1411,7 +1419,10 @@ type RunQueryRequest_NewTransaction struct { type RunQueryRequest_ReadTime struct { // Reads documents as they were at the given time. - // This may not be older than 270 seconds. + // + // This must be a microsecond precision timestamp within the past one hour, + // or if Point-in-Time Recovery is enabled, can additionally be a whole + // minute timestamp within the past 7 days. ReadTime *timestamppb.Timestamp `protobuf:"bytes,7,opt,name=read_time,json=readTime,proto3,oneof"` } @@ -1685,9 +1696,9 @@ type RunAggregationQueryRequest_NewTransaction struct { type RunAggregationQueryRequest_ReadTime struct { // Executes the query at the given timestamp. // - // Requires: - // - // * Cannot be more than 270 seconds in the past. + // This must be a microsecond precision timestamp within the past one hour, + // or if Point-in-Time Recovery is enabled, can additionally be a whole + // minute timestamp within the past 7 days. ReadTime *timestamppb.Timestamp `protobuf:"bytes,6,opt,name=read_time,json=readTime,proto3,oneof"` } @@ -1942,7 +1953,10 @@ type isPartitionQueryRequest_ConsistencySelector interface { type PartitionQueryRequest_ReadTime struct { // Reads documents as they were at the given time. - // This may not be older than 270 seconds. + // + // This must be a microsecond precision timestamp within the past one hour, + // or if Point-in-Time Recovery is enabled, can additionally be a whole + // minute timestamp within the past 7 days. ReadTime *timestamppb.Timestamp `protobuf:"bytes,6,opt,name=read_time,json=readTime,proto3,oneof"` } @@ -2478,8 +2492,9 @@ type Target struct { TargetType isTarget_TargetType `protobuf_oneof:"target_type"` // When to start listening. // - // If not specified, all matching Documents are returned before any - // subsequent changes. + // If specified, only the matching Documents that have been updated AFTER the + // `resume_token` or `read_time` will be returned. Otherwise, all matching + // Documents are returned before any subsequent changes. // // Types that are assignable to ResumeType: // *Target_ResumeToken @@ -2834,7 +2849,10 @@ type isListCollectionIdsRequest_ConsistencySelector interface { type ListCollectionIdsRequest_ReadTime struct { // Reads documents as they were at the given time. - // This may not be older than 270 seconds. + // + // This must be a microsecond precision timestamp within the past one hour, + // or if Point-in-Time Recovery is enabled, can additionally be a whole + // minute timestamp within the past 7 days. ReadTime *timestamppb.Timestamp `protobuf:"bytes,4,opt,name=read_time,json=readTime,proto3,oneof"` } diff --git a/vendor/cloud.google.com/go/firestore/apiv1/firestorepb/query.pb.go b/vendor/cloud.google.com/go/firestore/apiv1/firestorepb/query.pb.go index 309c57a5af..56f0f8130a 100644 --- a/vendor/cloud.google.com/go/firestore/apiv1/firestorepb/query.pb.go +++ b/vendor/cloud.google.com/go/firestore/apiv1/firestorepb/query.pb.go @@ -1217,6 +1217,8 @@ type StructuredAggregationQuery_Aggregation struct { // // Types that are assignable to Operator: // *StructuredAggregationQuery_Aggregation_Count_ + // *StructuredAggregationQuery_Aggregation_Sum_ + // *StructuredAggregationQuery_Aggregation_Avg_ Operator isStructuredAggregationQuery_Aggregation_Operator `protobuf_oneof:"operator"` // Optional. Optional name of the field to store the result of the // aggregation into. @@ -1302,6 +1304,20 @@ func (x *StructuredAggregationQuery_Aggregation) GetCount() *StructuredAggregati return nil } +func (x *StructuredAggregationQuery_Aggregation) GetSum() *StructuredAggregationQuery_Aggregation_Sum { + if x, ok := x.GetOperator().(*StructuredAggregationQuery_Aggregation_Sum_); ok { + return x.Sum + } + return nil +} + +func (x *StructuredAggregationQuery_Aggregation) GetAvg() *StructuredAggregationQuery_Aggregation_Avg { + if x, ok := x.GetOperator().(*StructuredAggregationQuery_Aggregation_Avg_); ok { + return x.Avg + } + return nil +} + func (x *StructuredAggregationQuery_Aggregation) GetAlias() string { if x != nil { return x.Alias @@ -1318,9 +1334,25 @@ type StructuredAggregationQuery_Aggregation_Count_ struct { Count *StructuredAggregationQuery_Aggregation_Count `protobuf:"bytes,1,opt,name=count,proto3,oneof"` } +type StructuredAggregationQuery_Aggregation_Sum_ struct { + // Sum aggregator. + Sum *StructuredAggregationQuery_Aggregation_Sum `protobuf:"bytes,2,opt,name=sum,proto3,oneof"` +} + +type StructuredAggregationQuery_Aggregation_Avg_ struct { + // Average aggregator. + Avg *StructuredAggregationQuery_Aggregation_Avg `protobuf:"bytes,3,opt,name=avg,proto3,oneof"` +} + func (*StructuredAggregationQuery_Aggregation_Count_) isStructuredAggregationQuery_Aggregation_Operator() { } +func (*StructuredAggregationQuery_Aggregation_Sum_) isStructuredAggregationQuery_Aggregation_Operator() { +} + +func (*StructuredAggregationQuery_Aggregation_Avg_) isStructuredAggregationQuery_Aggregation_Operator() { +} + // Count of documents that match the query. // // The `COUNT(*)` aggregation function operates on the entire document @@ -1389,6 +1421,134 @@ func (x *StructuredAggregationQuery_Aggregation_Count) GetUpTo() *wrapperspb.Int return nil } +// Sum of the values of the requested field. +// +// * Only numeric values will be aggregated. All non-numeric values +// including `NULL` are skipped. +// +// * If the aggregated values contain `NaN`, returns `NaN`. Infinity math +// follows IEEE-754 standards. +// +// * If the aggregated value set is empty, returns 0. +// +// * Returns a 64-bit integer if all aggregated numbers are integers and the +// sum result does not overflow. Otherwise, the result is returned as a +// double. Note that even if all the aggregated values are integers, the +// result is returned as a double if it cannot fit within a 64-bit signed +// integer. When this occurs, the returned value will lose precision. +// +// * When underflow occurs, floating-point aggregation is non-deterministic. +// This means that running the same query repeatedly without any changes to +// the underlying values could produce slightly different results each +// time. In those cases, values should be stored as integers over +// floating-point numbers. +type StructuredAggregationQuery_Aggregation_Sum struct { + state protoimpl.MessageState + sizeCache protoimpl.SizeCache + unknownFields protoimpl.UnknownFields + + // The field to aggregate on. + Field *StructuredQuery_FieldReference `protobuf:"bytes,1,opt,name=field,proto3" json:"field,omitempty"` +} + +func (x *StructuredAggregationQuery_Aggregation_Sum) Reset() { + *x = StructuredAggregationQuery_Aggregation_Sum{} + if protoimpl.UnsafeEnabled { + mi := &file_google_firestore_v1_query_proto_msgTypes[13] + ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) + ms.StoreMessageInfo(mi) + } +} + +func (x *StructuredAggregationQuery_Aggregation_Sum) String() string { + return protoimpl.X.MessageStringOf(x) +} + +func (*StructuredAggregationQuery_Aggregation_Sum) ProtoMessage() {} + +func (x *StructuredAggregationQuery_Aggregation_Sum) ProtoReflect() protoreflect.Message { + mi := &file_google_firestore_v1_query_proto_msgTypes[13] + if protoimpl.UnsafeEnabled && x != nil { + ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) + if ms.LoadMessageInfo() == nil { + ms.StoreMessageInfo(mi) + } + return ms + } + return mi.MessageOf(x) +} + +// Deprecated: Use StructuredAggregationQuery_Aggregation_Sum.ProtoReflect.Descriptor instead. +func (*StructuredAggregationQuery_Aggregation_Sum) Descriptor() ([]byte, []int) { + return file_google_firestore_v1_query_proto_rawDescGZIP(), []int{1, 0, 1} +} + +func (x *StructuredAggregationQuery_Aggregation_Sum) GetField() *StructuredQuery_FieldReference { + if x != nil { + return x.Field + } + return nil +} + +// Average of the values of the requested field. +// +// * Only numeric values will be aggregated. All non-numeric values +// including `NULL` are skipped. +// +// * If the aggregated values contain `NaN`, returns `NaN`. Infinity math +// follows IEEE-754 standards. +// +// * If the aggregated value set is empty, returns `NULL`. +// +// * Always returns the result as a double. +type StructuredAggregationQuery_Aggregation_Avg struct { + state protoimpl.MessageState + sizeCache protoimpl.SizeCache + unknownFields protoimpl.UnknownFields + + // The field to aggregate on. + Field *StructuredQuery_FieldReference `protobuf:"bytes,1,opt,name=field,proto3" json:"field,omitempty"` +} + +func (x *StructuredAggregationQuery_Aggregation_Avg) Reset() { + *x = StructuredAggregationQuery_Aggregation_Avg{} + if protoimpl.UnsafeEnabled { + mi := &file_google_firestore_v1_query_proto_msgTypes[14] + ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) + ms.StoreMessageInfo(mi) + } +} + +func (x *StructuredAggregationQuery_Aggregation_Avg) String() string { + return protoimpl.X.MessageStringOf(x) +} + +func (*StructuredAggregationQuery_Aggregation_Avg) ProtoMessage() {} + +func (x *StructuredAggregationQuery_Aggregation_Avg) ProtoReflect() protoreflect.Message { + mi := &file_google_firestore_v1_query_proto_msgTypes[14] + if protoimpl.UnsafeEnabled && x != nil { + ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) + if ms.LoadMessageInfo() == nil { + ms.StoreMessageInfo(mi) + } + return ms + } + return mi.MessageOf(x) +} + +// Deprecated: Use StructuredAggregationQuery_Aggregation_Avg.ProtoReflect.Descriptor instead. +func (*StructuredAggregationQuery_Aggregation_Avg) Descriptor() ([]byte, []int) { + return file_google_firestore_v1_query_proto_rawDescGZIP(), []int{1, 0, 2} +} + +func (x *StructuredAggregationQuery_Aggregation_Avg) GetField() *StructuredQuery_FieldReference { + if x != nil { + return x.Field + } + return nil +} + var File_google_firestore_v1_query_proto protoreflect.FileDescriptor var file_google_firestore_v1_query_proto_rawDesc = []byte{ @@ -1539,7 +1699,7 @@ var file_google_firestore_v1_query_proto_rawDesc = []byte{ 0x54, 0x49, 0x4f, 0x4e, 0x5f, 0x55, 0x4e, 0x53, 0x50, 0x45, 0x43, 0x49, 0x46, 0x49, 0x45, 0x44, 0x10, 0x00, 0x12, 0x0d, 0x0a, 0x09, 0x41, 0x53, 0x43, 0x45, 0x4e, 0x44, 0x49, 0x4e, 0x47, 0x10, 0x01, 0x12, 0x0e, 0x0a, 0x0a, 0x44, 0x45, 0x53, 0x43, 0x45, 0x4e, 0x44, 0x49, 0x4e, 0x47, 0x10, - 0x02, 0x22, 0xb5, 0x03, 0x0a, 0x1a, 0x53, 0x74, 0x72, 0x75, 0x63, 0x74, 0x75, 0x72, 0x65, 0x64, + 0x02, 0x22, 0x83, 0x06, 0x0a, 0x1a, 0x53, 0x74, 0x72, 0x75, 0x63, 0x74, 0x75, 0x72, 0x65, 0x64, 0x41, 0x67, 0x67, 0x72, 0x65, 0x67, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x51, 0x75, 0x65, 0x72, 0x79, 0x12, 0x51, 0x0a, 0x10, 0x73, 0x74, 0x72, 0x75, 0x63, 0x74, 0x75, 0x72, 0x65, 0x64, 0x5f, 0x71, 0x75, 0x65, 0x72, 0x79, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x24, 0x2e, 0x67, 0x6f, 0x6f, @@ -1552,39 +1712,60 @@ var file_google_firestore_v1_query_proto_rawDesc = []byte{ 0x53, 0x74, 0x72, 0x75, 0x63, 0x74, 0x75, 0x72, 0x65, 0x64, 0x41, 0x67, 0x67, 0x72, 0x65, 0x67, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x51, 0x75, 0x65, 0x72, 0x79, 0x2e, 0x41, 0x67, 0x67, 0x72, 0x65, 0x67, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x42, 0x03, 0xe0, 0x41, 0x01, 0x52, 0x0c, 0x61, 0x67, 0x67, - 0x72, 0x65, 0x67, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x1a, 0xcf, 0x01, 0x0a, 0x0b, 0x41, 0x67, + 0x72, 0x65, 0x67, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x1a, 0x9d, 0x04, 0x0a, 0x0b, 0x41, 0x67, 0x67, 0x72, 0x65, 0x67, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x12, 0x59, 0x0a, 0x05, 0x63, 0x6f, 0x75, 0x6e, 0x74, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x41, 0x2e, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2e, 0x66, 0x69, 0x72, 0x65, 0x73, 0x74, 0x6f, 0x72, 0x65, 0x2e, 0x76, 0x31, 0x2e, 0x53, 0x74, 0x72, 0x75, 0x63, 0x74, 0x75, 0x72, 0x65, 0x64, 0x41, 0x67, 0x67, 0x72, 0x65, 0x67, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x51, 0x75, 0x65, 0x72, 0x79, 0x2e, 0x41, 0x67, 0x67, 0x72, 0x65, 0x67, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x2e, 0x43, 0x6f, 0x75, 0x6e, 0x74, 0x48, 0x00, 0x52, 0x05, 0x63, - 0x6f, 0x75, 0x6e, 0x74, 0x12, 0x19, 0x0a, 0x05, 0x61, 0x6c, 0x69, 0x61, 0x73, 0x18, 0x07, 0x20, - 0x01, 0x28, 0x09, 0x42, 0x03, 0xe0, 0x41, 0x01, 0x52, 0x05, 0x61, 0x6c, 0x69, 0x61, 0x73, 0x1a, - 0x3e, 0x0a, 0x05, 0x43, 0x6f, 0x75, 0x6e, 0x74, 0x12, 0x35, 0x0a, 0x05, 0x75, 0x70, 0x5f, 0x74, - 0x6f, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x1b, 0x2e, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, - 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x62, 0x75, 0x66, 0x2e, 0x49, 0x6e, 0x74, 0x36, 0x34, 0x56, - 0x61, 0x6c, 0x75, 0x65, 0x42, 0x03, 0xe0, 0x41, 0x01, 0x52, 0x04, 0x75, 0x70, 0x54, 0x6f, 0x42, - 0x0a, 0x0a, 0x08, 0x6f, 0x70, 0x65, 0x72, 0x61, 0x74, 0x6f, 0x72, 0x42, 0x0c, 0x0a, 0x0a, 0x71, - 0x75, 0x65, 0x72, 0x79, 0x5f, 0x74, 0x79, 0x70, 0x65, 0x22, 0x54, 0x0a, 0x06, 0x43, 0x75, 0x72, - 0x73, 0x6f, 0x72, 0x12, 0x32, 0x0a, 0x06, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x73, 0x18, 0x01, 0x20, - 0x03, 0x28, 0x0b, 0x32, 0x1a, 0x2e, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2e, 0x66, 0x69, 0x72, - 0x65, 0x73, 0x74, 0x6f, 0x72, 0x65, 0x2e, 0x76, 0x31, 0x2e, 0x56, 0x61, 0x6c, 0x75, 0x65, 0x52, - 0x06, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x73, 0x12, 0x16, 0x0a, 0x06, 0x62, 0x65, 0x66, 0x6f, 0x72, - 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x08, 0x52, 0x06, 0x62, 0x65, 0x66, 0x6f, 0x72, 0x65, 0x42, - 0xc2, 0x01, 0x0a, 0x17, 0x63, 0x6f, 0x6d, 0x2e, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2e, 0x66, - 0x69, 0x72, 0x65, 0x73, 0x74, 0x6f, 0x72, 0x65, 0x2e, 0x76, 0x31, 0x42, 0x0a, 0x51, 0x75, 0x65, - 0x72, 0x79, 0x50, 0x72, 0x6f, 0x74, 0x6f, 0x50, 0x01, 0x5a, 0x3b, 0x63, 0x6c, 0x6f, 0x75, 0x64, - 0x2e, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x67, 0x6f, 0x2f, 0x66, - 0x69, 0x72, 0x65, 0x73, 0x74, 0x6f, 0x72, 0x65, 0x2f, 0x61, 0x70, 0x69, 0x76, 0x31, 0x2f, 0x66, - 0x69, 0x72, 0x65, 0x73, 0x74, 0x6f, 0x72, 0x65, 0x70, 0x62, 0x3b, 0x66, 0x69, 0x72, 0x65, 0x73, - 0x74, 0x6f, 0x72, 0x65, 0x70, 0x62, 0xa2, 0x02, 0x04, 0x47, 0x43, 0x46, 0x53, 0xaa, 0x02, 0x19, - 0x47, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2e, 0x43, 0x6c, 0x6f, 0x75, 0x64, 0x2e, 0x46, 0x69, 0x72, - 0x65, 0x73, 0x74, 0x6f, 0x72, 0x65, 0x2e, 0x56, 0x31, 0xca, 0x02, 0x19, 0x47, 0x6f, 0x6f, 0x67, - 0x6c, 0x65, 0x5c, 0x43, 0x6c, 0x6f, 0x75, 0x64, 0x5c, 0x46, 0x69, 0x72, 0x65, 0x73, 0x74, 0x6f, - 0x72, 0x65, 0x5c, 0x56, 0x31, 0xea, 0x02, 0x1c, 0x47, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x3a, 0x3a, - 0x43, 0x6c, 0x6f, 0x75, 0x64, 0x3a, 0x3a, 0x46, 0x69, 0x72, 0x65, 0x73, 0x74, 0x6f, 0x72, 0x65, - 0x3a, 0x3a, 0x56, 0x31, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33, + 0x6f, 0x75, 0x6e, 0x74, 0x12, 0x53, 0x0a, 0x03, 0x73, 0x75, 0x6d, 0x18, 0x02, 0x20, 0x01, 0x28, + 0x0b, 0x32, 0x3f, 0x2e, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2e, 0x66, 0x69, 0x72, 0x65, 0x73, + 0x74, 0x6f, 0x72, 0x65, 0x2e, 0x76, 0x31, 0x2e, 0x53, 0x74, 0x72, 0x75, 0x63, 0x74, 0x75, 0x72, + 0x65, 0x64, 0x41, 0x67, 0x67, 0x72, 0x65, 0x67, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x51, 0x75, 0x65, + 0x72, 0x79, 0x2e, 0x41, 0x67, 0x67, 0x72, 0x65, 0x67, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x2e, 0x53, + 0x75, 0x6d, 0x48, 0x00, 0x52, 0x03, 0x73, 0x75, 0x6d, 0x12, 0x53, 0x0a, 0x03, 0x61, 0x76, 0x67, + 0x18, 0x03, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x3f, 0x2e, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2e, + 0x66, 0x69, 0x72, 0x65, 0x73, 0x74, 0x6f, 0x72, 0x65, 0x2e, 0x76, 0x31, 0x2e, 0x53, 0x74, 0x72, + 0x75, 0x63, 0x74, 0x75, 0x72, 0x65, 0x64, 0x41, 0x67, 0x67, 0x72, 0x65, 0x67, 0x61, 0x74, 0x69, + 0x6f, 0x6e, 0x51, 0x75, 0x65, 0x72, 0x79, 0x2e, 0x41, 0x67, 0x67, 0x72, 0x65, 0x67, 0x61, 0x74, + 0x69, 0x6f, 0x6e, 0x2e, 0x41, 0x76, 0x67, 0x48, 0x00, 0x52, 0x03, 0x61, 0x76, 0x67, 0x12, 0x19, + 0x0a, 0x05, 0x61, 0x6c, 0x69, 0x61, 0x73, 0x18, 0x07, 0x20, 0x01, 0x28, 0x09, 0x42, 0x03, 0xe0, + 0x41, 0x01, 0x52, 0x05, 0x61, 0x6c, 0x69, 0x61, 0x73, 0x1a, 0x3e, 0x0a, 0x05, 0x43, 0x6f, 0x75, + 0x6e, 0x74, 0x12, 0x35, 0x0a, 0x05, 0x75, 0x70, 0x5f, 0x74, 0x6f, 0x18, 0x01, 0x20, 0x01, 0x28, + 0x0b, 0x32, 0x1b, 0x2e, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, + 0x62, 0x75, 0x66, 0x2e, 0x49, 0x6e, 0x74, 0x36, 0x34, 0x56, 0x61, 0x6c, 0x75, 0x65, 0x42, 0x03, + 0xe0, 0x41, 0x01, 0x52, 0x04, 0x75, 0x70, 0x54, 0x6f, 0x1a, 0x50, 0x0a, 0x03, 0x53, 0x75, 0x6d, + 0x12, 0x49, 0x0a, 0x05, 0x66, 0x69, 0x65, 0x6c, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0b, 0x32, + 0x33, 0x2e, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2e, 0x66, 0x69, 0x72, 0x65, 0x73, 0x74, 0x6f, + 0x72, 0x65, 0x2e, 0x76, 0x31, 0x2e, 0x53, 0x74, 0x72, 0x75, 0x63, 0x74, 0x75, 0x72, 0x65, 0x64, + 0x51, 0x75, 0x65, 0x72, 0x79, 0x2e, 0x46, 0x69, 0x65, 0x6c, 0x64, 0x52, 0x65, 0x66, 0x65, 0x72, + 0x65, 0x6e, 0x63, 0x65, 0x52, 0x05, 0x66, 0x69, 0x65, 0x6c, 0x64, 0x1a, 0x50, 0x0a, 0x03, 0x41, + 0x76, 0x67, 0x12, 0x49, 0x0a, 0x05, 0x66, 0x69, 0x65, 0x6c, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, + 0x0b, 0x32, 0x33, 0x2e, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2e, 0x66, 0x69, 0x72, 0x65, 0x73, + 0x74, 0x6f, 0x72, 0x65, 0x2e, 0x76, 0x31, 0x2e, 0x53, 0x74, 0x72, 0x75, 0x63, 0x74, 0x75, 0x72, + 0x65, 0x64, 0x51, 0x75, 0x65, 0x72, 0x79, 0x2e, 0x46, 0x69, 0x65, 0x6c, 0x64, 0x52, 0x65, 0x66, + 0x65, 0x72, 0x65, 0x6e, 0x63, 0x65, 0x52, 0x05, 0x66, 0x69, 0x65, 0x6c, 0x64, 0x42, 0x0a, 0x0a, + 0x08, 0x6f, 0x70, 0x65, 0x72, 0x61, 0x74, 0x6f, 0x72, 0x42, 0x0c, 0x0a, 0x0a, 0x71, 0x75, 0x65, + 0x72, 0x79, 0x5f, 0x74, 0x79, 0x70, 0x65, 0x22, 0x54, 0x0a, 0x06, 0x43, 0x75, 0x72, 0x73, 0x6f, + 0x72, 0x12, 0x32, 0x0a, 0x06, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x73, 0x18, 0x01, 0x20, 0x03, 0x28, + 0x0b, 0x32, 0x1a, 0x2e, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2e, 0x66, 0x69, 0x72, 0x65, 0x73, + 0x74, 0x6f, 0x72, 0x65, 0x2e, 0x76, 0x31, 0x2e, 0x56, 0x61, 0x6c, 0x75, 0x65, 0x52, 0x06, 0x76, + 0x61, 0x6c, 0x75, 0x65, 0x73, 0x12, 0x16, 0x0a, 0x06, 0x62, 0x65, 0x66, 0x6f, 0x72, 0x65, 0x18, + 0x02, 0x20, 0x01, 0x28, 0x08, 0x52, 0x06, 0x62, 0x65, 0x66, 0x6f, 0x72, 0x65, 0x42, 0xc2, 0x01, + 0x0a, 0x17, 0x63, 0x6f, 0x6d, 0x2e, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2e, 0x66, 0x69, 0x72, + 0x65, 0x73, 0x74, 0x6f, 0x72, 0x65, 0x2e, 0x76, 0x31, 0x42, 0x0a, 0x51, 0x75, 0x65, 0x72, 0x79, + 0x50, 0x72, 0x6f, 0x74, 0x6f, 0x50, 0x01, 0x5a, 0x3b, 0x63, 0x6c, 0x6f, 0x75, 0x64, 0x2e, 0x67, + 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x67, 0x6f, 0x2f, 0x66, 0x69, 0x72, + 0x65, 0x73, 0x74, 0x6f, 0x72, 0x65, 0x2f, 0x61, 0x70, 0x69, 0x76, 0x31, 0x2f, 0x66, 0x69, 0x72, + 0x65, 0x73, 0x74, 0x6f, 0x72, 0x65, 0x70, 0x62, 0x3b, 0x66, 0x69, 0x72, 0x65, 0x73, 0x74, 0x6f, + 0x72, 0x65, 0x70, 0x62, 0xa2, 0x02, 0x04, 0x47, 0x43, 0x46, 0x53, 0xaa, 0x02, 0x19, 0x47, 0x6f, + 0x6f, 0x67, 0x6c, 0x65, 0x2e, 0x43, 0x6c, 0x6f, 0x75, 0x64, 0x2e, 0x46, 0x69, 0x72, 0x65, 0x73, + 0x74, 0x6f, 0x72, 0x65, 0x2e, 0x56, 0x31, 0xca, 0x02, 0x19, 0x47, 0x6f, 0x6f, 0x67, 0x6c, 0x65, + 0x5c, 0x43, 0x6c, 0x6f, 0x75, 0x64, 0x5c, 0x46, 0x69, 0x72, 0x65, 0x73, 0x74, 0x6f, 0x72, 0x65, + 0x5c, 0x56, 0x31, 0xea, 0x02, 0x1c, 0x47, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x3a, 0x3a, 0x43, 0x6c, + 0x6f, 0x75, 0x64, 0x3a, 0x3a, 0x46, 0x69, 0x72, 0x65, 0x73, 0x74, 0x6f, 0x72, 0x65, 0x3a, 0x3a, + 0x56, 0x31, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33, } var ( @@ -1600,7 +1781,7 @@ func file_google_firestore_v1_query_proto_rawDescGZIP() []byte { } var file_google_firestore_v1_query_proto_enumTypes = make([]protoimpl.EnumInfo, 4) -var file_google_firestore_v1_query_proto_msgTypes = make([]protoimpl.MessageInfo, 13) +var file_google_firestore_v1_query_proto_msgTypes = make([]protoimpl.MessageInfo, 15) var file_google_firestore_v1_query_proto_goTypes = []interface{}{ (StructuredQuery_Direction)(0), // 0: google.firestore.v1.StructuredQuery.Direction (StructuredQuery_CompositeFilter_Operator)(0), // 1: google.firestore.v1.StructuredQuery.CompositeFilter.Operator @@ -1619,9 +1800,11 @@ var file_google_firestore_v1_query_proto_goTypes = []interface{}{ (*StructuredQuery_Projection)(nil), // 14: google.firestore.v1.StructuredQuery.Projection (*StructuredAggregationQuery_Aggregation)(nil), // 15: google.firestore.v1.StructuredAggregationQuery.Aggregation (*StructuredAggregationQuery_Aggregation_Count)(nil), // 16: google.firestore.v1.StructuredAggregationQuery.Aggregation.Count - (*wrapperspb.Int32Value)(nil), // 17: google.protobuf.Int32Value - (*Value)(nil), // 18: google.firestore.v1.Value - (*wrapperspb.Int64Value)(nil), // 19: google.protobuf.Int64Value + (*StructuredAggregationQuery_Aggregation_Sum)(nil), // 17: google.firestore.v1.StructuredAggregationQuery.Aggregation.Sum + (*StructuredAggregationQuery_Aggregation_Avg)(nil), // 18: google.firestore.v1.StructuredAggregationQuery.Aggregation.Avg + (*wrapperspb.Int32Value)(nil), // 19: google.protobuf.Int32Value + (*Value)(nil), // 20: google.firestore.v1.Value + (*wrapperspb.Int64Value)(nil), // 21: google.protobuf.Int64Value } var file_google_firestore_v1_query_proto_depIdxs = []int32{ 14, // 0: google.firestore.v1.StructuredQuery.select:type_name -> google.firestore.v1.StructuredQuery.Projection @@ -1630,10 +1813,10 @@ var file_google_firestore_v1_query_proto_depIdxs = []int32{ 12, // 3: google.firestore.v1.StructuredQuery.order_by:type_name -> google.firestore.v1.StructuredQuery.Order 6, // 4: google.firestore.v1.StructuredQuery.start_at:type_name -> google.firestore.v1.Cursor 6, // 5: google.firestore.v1.StructuredQuery.end_at:type_name -> google.firestore.v1.Cursor - 17, // 6: google.firestore.v1.StructuredQuery.limit:type_name -> google.protobuf.Int32Value + 19, // 6: google.firestore.v1.StructuredQuery.limit:type_name -> google.protobuf.Int32Value 4, // 7: google.firestore.v1.StructuredAggregationQuery.structured_query:type_name -> google.firestore.v1.StructuredQuery 15, // 8: google.firestore.v1.StructuredAggregationQuery.aggregations:type_name -> google.firestore.v1.StructuredAggregationQuery.Aggregation - 18, // 9: google.firestore.v1.Cursor.values:type_name -> google.firestore.v1.Value + 20, // 9: google.firestore.v1.Cursor.values:type_name -> google.firestore.v1.Value 9, // 10: google.firestore.v1.StructuredQuery.Filter.composite_filter:type_name -> google.firestore.v1.StructuredQuery.CompositeFilter 10, // 11: google.firestore.v1.StructuredQuery.Filter.field_filter:type_name -> google.firestore.v1.StructuredQuery.FieldFilter 11, // 12: google.firestore.v1.StructuredQuery.Filter.unary_filter:type_name -> google.firestore.v1.StructuredQuery.UnaryFilter @@ -1641,19 +1824,23 @@ var file_google_firestore_v1_query_proto_depIdxs = []int32{ 8, // 14: google.firestore.v1.StructuredQuery.CompositeFilter.filters:type_name -> google.firestore.v1.StructuredQuery.Filter 13, // 15: google.firestore.v1.StructuredQuery.FieldFilter.field:type_name -> google.firestore.v1.StructuredQuery.FieldReference 2, // 16: google.firestore.v1.StructuredQuery.FieldFilter.op:type_name -> google.firestore.v1.StructuredQuery.FieldFilter.Operator - 18, // 17: google.firestore.v1.StructuredQuery.FieldFilter.value:type_name -> google.firestore.v1.Value + 20, // 17: google.firestore.v1.StructuredQuery.FieldFilter.value:type_name -> google.firestore.v1.Value 3, // 18: google.firestore.v1.StructuredQuery.UnaryFilter.op:type_name -> google.firestore.v1.StructuredQuery.UnaryFilter.Operator 13, // 19: google.firestore.v1.StructuredQuery.UnaryFilter.field:type_name -> google.firestore.v1.StructuredQuery.FieldReference 13, // 20: google.firestore.v1.StructuredQuery.Order.field:type_name -> google.firestore.v1.StructuredQuery.FieldReference 0, // 21: google.firestore.v1.StructuredQuery.Order.direction:type_name -> google.firestore.v1.StructuredQuery.Direction 13, // 22: google.firestore.v1.StructuredQuery.Projection.fields:type_name -> google.firestore.v1.StructuredQuery.FieldReference 16, // 23: google.firestore.v1.StructuredAggregationQuery.Aggregation.count:type_name -> google.firestore.v1.StructuredAggregationQuery.Aggregation.Count - 19, // 24: google.firestore.v1.StructuredAggregationQuery.Aggregation.Count.up_to:type_name -> google.protobuf.Int64Value - 25, // [25:25] is the sub-list for method output_type - 25, // [25:25] is the sub-list for method input_type - 25, // [25:25] is the sub-list for extension type_name - 25, // [25:25] is the sub-list for extension extendee - 0, // [0:25] is the sub-list for field type_name + 17, // 24: google.firestore.v1.StructuredAggregationQuery.Aggregation.sum:type_name -> google.firestore.v1.StructuredAggregationQuery.Aggregation.Sum + 18, // 25: google.firestore.v1.StructuredAggregationQuery.Aggregation.avg:type_name -> google.firestore.v1.StructuredAggregationQuery.Aggregation.Avg + 21, // 26: google.firestore.v1.StructuredAggregationQuery.Aggregation.Count.up_to:type_name -> google.protobuf.Int64Value + 13, // 27: google.firestore.v1.StructuredAggregationQuery.Aggregation.Sum.field:type_name -> google.firestore.v1.StructuredQuery.FieldReference + 13, // 28: google.firestore.v1.StructuredAggregationQuery.Aggregation.Avg.field:type_name -> google.firestore.v1.StructuredQuery.FieldReference + 29, // [29:29] is the sub-list for method output_type + 29, // [29:29] is the sub-list for method input_type + 29, // [29:29] is the sub-list for extension type_name + 29, // [29:29] is the sub-list for extension extendee + 0, // [0:29] is the sub-list for field type_name } func init() { file_google_firestore_v1_query_proto_init() } @@ -1819,6 +2006,30 @@ func file_google_firestore_v1_query_proto_init() { return nil } } + file_google_firestore_v1_query_proto_msgTypes[13].Exporter = func(v interface{}, i int) interface{} { + switch v := v.(*StructuredAggregationQuery_Aggregation_Sum); i { + case 0: + return &v.state + case 1: + return &v.sizeCache + case 2: + return &v.unknownFields + default: + return nil + } + } + file_google_firestore_v1_query_proto_msgTypes[14].Exporter = func(v interface{}, i int) interface{} { + switch v := v.(*StructuredAggregationQuery_Aggregation_Avg); i { + case 0: + return &v.state + case 1: + return &v.sizeCache + case 2: + return &v.unknownFields + default: + return nil + } + } } file_google_firestore_v1_query_proto_msgTypes[1].OneofWrappers = []interface{}{ (*StructuredAggregationQuery_StructuredQuery)(nil), @@ -1833,6 +2044,8 @@ func file_google_firestore_v1_query_proto_init() { } file_google_firestore_v1_query_proto_msgTypes[11].OneofWrappers = []interface{}{ (*StructuredAggregationQuery_Aggregation_Count_)(nil), + (*StructuredAggregationQuery_Aggregation_Sum_)(nil), + (*StructuredAggregationQuery_Aggregation_Avg_)(nil), } type x struct{} out := protoimpl.TypeBuilder{ @@ -1840,7 +2053,7 @@ func file_google_firestore_v1_query_proto_init() { GoPackagePath: reflect.TypeOf(x{}).PkgPath(), RawDescriptor: file_google_firestore_v1_query_proto_rawDesc, NumEnums: 4, - NumMessages: 13, + NumMessages: 15, NumExtensions: 0, NumServices: 0, }, diff --git a/vendor/cloud.google.com/go/firestore/apiv1/firestorepb/write.pb.go b/vendor/cloud.google.com/go/firestore/apiv1/firestorepb/write.pb.go index 958ea23fde..e330a1fb13 100644 --- a/vendor/cloud.google.com/go/firestore/apiv1/firestorepb/write.pb.go +++ b/vendor/cloud.google.com/go/firestore/apiv1/firestorepb/write.pb.go @@ -601,14 +601,14 @@ type ExistenceFilter struct { // client must manually determine which documents no longer match the target. // // The client can use the `unchanged_names` bloom filter to assist with - // this determination. + // this determination by testing ALL the document names against the filter; + // if the document name is NOT in the filter, it means the document no + // longer matches the target. Count int32 `protobuf:"varint,2,opt,name=count,proto3" json:"count,omitempty"` - // A bloom filter that contains the UTF-8 byte encodings of the resource names - // of the documents that match + // A bloom filter that, despite its name, contains the UTF-8 byte encodings of + // the resource names of ALL the documents that match // [target_id][google.firestore.v1.ExistenceFilter.target_id], in the form - // `projects/{project_id}/databases/{database_id}/documents/{document_path}` - // that have NOT changed since the query results indicated by the resume token - // or timestamp given in `Target.resume_type`. + // `projects/{project_id}/databases/{database_id}/documents/{document_path}`. // // This bloom filter may be omitted at the server's discretion, such as if it // is deemed that the client will not make use of it or if it is too diff --git a/vendor/cloud.google.com/go/firestore/internal/version.go b/vendor/cloud.google.com/go/firestore/internal/version.go index 77cefca24d..4518b5fb40 100644 --- a/vendor/cloud.google.com/go/firestore/internal/version.go +++ b/vendor/cloud.google.com/go/firestore/internal/version.go @@ -15,4 +15,4 @@ package internal // Version is the current tagged release of the library. -const Version = "1.11.0" +const Version = "1.12.0" diff --git a/vendor/cloud.google.com/go/internal/.repo-metadata-full.json b/vendor/cloud.google.com/go/internal/.repo-metadata-full.json index d953f44e9c..95b54b1378 100644 --- a/vendor/cloud.google.com/go/internal/.repo-metadata-full.json +++ b/vendor/cloud.google.com/go/internal/.repo-metadata-full.json @@ -26,7 +26,7 @@ "language": "go", "client_library_type": "generated", "client_documentation": "https://cloud.google.com/go/docs/reference/cloud.google.com/go/advisorynotifications/latest/apiv1", - "release_level": "preview", + "release_level": "stable", "library_type": "GAPIC_AUTO" }, "cloud.google.com/go/ai/generativelanguage/apiv1beta2": { @@ -89,6 +89,16 @@ "release_level": "preview", "library_type": "GAPIC_AUTO" }, + "cloud.google.com/go/alloydb/connectors/apiv1alpha": { + "api_shortname": "connectors", + "distribution_name": "cloud.google.com/go/alloydb/connectors/apiv1alpha", + "description": "AlloyDB connectors", + "language": "go", + "client_library_type": "generated", + "client_documentation": "https://cloud.google.com/go/docs/reference/cloud.google.com/go/alloydb/latest/connectors/apiv1alpha", + "release_level": "preview", + "library_type": "GAPIC_AUTO" + }, "cloud.google.com/go/analytics/admin/apiv1alpha": { "api_shortname": "analyticsadmin", "distribution_name": "cloud.google.com/go/analytics/admin/apiv1alpha", @@ -276,7 +286,7 @@ "language": "go", "client_library_type": "generated", "client_documentation": "https://cloud.google.com/go/docs/reference/cloud.google.com/go/beyondcorp/latest/appconnections/apiv1", - "release_level": "preview", + "release_level": "stable", "library_type": "GAPIC_AUTO" }, "cloud.google.com/go/beyondcorp/appconnectors/apiv1": { @@ -286,7 +296,7 @@ "language": "go", "client_library_type": "generated", "client_documentation": "https://cloud.google.com/go/docs/reference/cloud.google.com/go/beyondcorp/latest/appconnectors/apiv1", - "release_level": "preview", + "release_level": "stable", "library_type": "GAPIC_AUTO" }, "cloud.google.com/go/beyondcorp/appgateways/apiv1": { @@ -296,7 +306,7 @@ "language": "go", "client_library_type": "generated", "client_documentation": "https://cloud.google.com/go/docs/reference/cloud.google.com/go/beyondcorp/latest/appgateways/apiv1", - "release_level": "preview", + "release_level": "stable", "library_type": "GAPIC_AUTO" }, "cloud.google.com/go/beyondcorp/clientconnectorservices/apiv1": { @@ -306,7 +316,7 @@ "language": "go", "client_library_type": "generated", "client_documentation": "https://cloud.google.com/go/docs/reference/cloud.google.com/go/beyondcorp/latest/clientconnectorservices/apiv1", - "release_level": "preview", + "release_level": "stable", "library_type": "GAPIC_AUTO" }, "cloud.google.com/go/beyondcorp/clientgateways/apiv1": { @@ -316,7 +326,7 @@ "language": "go", "client_library_type": "generated", "client_documentation": "https://cloud.google.com/go/docs/reference/cloud.google.com/go/beyondcorp/latest/clientgateways/apiv1", - "release_level": "preview", + "release_level": "stable", "library_type": "GAPIC_AUTO" }, "cloud.google.com/go/bigquery": { @@ -336,7 +346,7 @@ "language": "go", "client_library_type": "generated", "client_documentation": "https://cloud.google.com/go/docs/reference/cloud.google.com/go/bigquery/latest/analyticshub/apiv1", - "release_level": "preview", + "release_level": "stable", "library_type": "GAPIC_AUTO" }, "cloud.google.com/go/bigquery/connection/apiv1": { @@ -376,7 +386,7 @@ "language": "go", "client_library_type": "generated", "client_documentation": "https://cloud.google.com/go/docs/reference/cloud.google.com/go/bigquery/latest/datapolicies/apiv1", - "release_level": "preview", + "release_level": "stable", "library_type": "GAPIC_AUTO" }, "cloud.google.com/go/bigquery/datapolicies/apiv1beta1": { @@ -545,7 +555,7 @@ "description": "Cloud Build API", "language": "go", "client_library_type": "generated", - "client_documentation": "https://cloud.google.com/go/docs/reference/cloud.google.com/go/latest/cloudbuild/apiv1/v2", + "client_documentation": "https://cloud.google.com/go/docs/reference/cloud.google.com/go/cloudbuild/latest/apiv1/v2", "release_level": "stable", "library_type": "GAPIC_AUTO" }, @@ -599,6 +609,16 @@ "release_level": "preview", "library_type": "GAPIC_AUTO" }, + "cloud.google.com/go/commerce/consumer/procurement/apiv1": { + "api_shortname": "cloudcommerceconsumerprocurement", + "distribution_name": "cloud.google.com/go/commerce/consumer/procurement/apiv1", + "description": "Cloud Commerce Consumer Procurement API", + "language": "go", + "client_library_type": "generated", + "client_documentation": "https://cloud.google.com/go/docs/reference/cloud.google.com/go/commerce/latest/consumer/procurement/apiv1", + "release_level": "preview", + "library_type": "GAPIC_AUTO" + }, "cloud.google.com/go/compute/apiv1": { "api_shortname": "compute", "distribution_name": "cloud.google.com/go/compute/apiv1", @@ -626,7 +646,7 @@ "language": "go", "client_library_type": "generated", "client_documentation": "https://cloud.google.com/go/docs/reference/cloud.google.com/go/confidentialcomputing/latest/apiv1", - "release_level": "preview", + "release_level": "stable", "library_type": "GAPIC_AUTO" }, "cloud.google.com/go/confidentialcomputing/apiv1alpha1": { @@ -696,7 +716,7 @@ "language": "go", "client_library_type": "generated", "client_documentation": "https://cloud.google.com/go/docs/reference/cloud.google.com/go/datacatalog/latest/lineage/apiv1", - "release_level": "preview", + "release_level": "stable", "library_type": "GAPIC_AUTO" }, "cloud.google.com/go/dataflow/apiv1beta3": { @@ -826,13 +846,13 @@ "language": "go", "client_library_type": "generated", "client_documentation": "https://cloud.google.com/go/docs/reference/cloud.google.com/go/latest/debugger/apiv2", - "release_level": "stable", + "release_level": "preview", "library_type": "GAPIC_AUTO" }, "cloud.google.com/go/deploy/apiv1": { "api_shortname": "clouddeploy", "distribution_name": "cloud.google.com/go/deploy/apiv1", - "description": "Google Cloud Deploy API", + "description": "Cloud Deploy API", "language": "go", "client_library_type": "generated", "client_documentation": "https://cloud.google.com/go/docs/reference/cloud.google.com/go/deploy/latest/apiv1", @@ -886,7 +906,7 @@ "language": "go", "client_library_type": "generated", "client_documentation": "https://cloud.google.com/go/docs/reference/cloud.google.com/go/discoveryengine/latest/apiv1", - "release_level": "preview", + "release_level": "stable", "library_type": "GAPIC_AUTO" }, "cloud.google.com/go/discoveryengine/apiv1beta": { @@ -996,7 +1016,7 @@ "language": "go", "client_library_type": "generated", "client_documentation": "https://cloud.google.com/go/docs/reference/cloud.google.com/go/eventarc/latest/publishing/apiv1", - "release_level": "preview", + "release_level": "stable", "library_type": "GAPIC_AUTO" }, "cloud.google.com/go/filestore/apiv1": { @@ -1106,7 +1126,7 @@ "language": "go", "client_library_type": "generated", "client_documentation": "https://cloud.google.com/go/docs/reference/cloud.google.com/go/gkemulticloud/latest/apiv1", - "release_level": "preview", + "release_level": "stable", "library_type": "GAPIC_AUTO" }, "cloud.google.com/go/gsuiteaddons/apiv1": { @@ -1306,7 +1326,7 @@ "language": "go", "client_library_type": "generated", "client_documentation": "https://cloud.google.com/go/docs/reference/cloud.google.com/go/maps/latest/places/apiv1", - "release_level": "preview", + "release_level": "stable", "library_type": "GAPIC_AUTO" }, "cloud.google.com/go/maps/routing/apiv2": { @@ -1419,6 +1439,16 @@ "release_level": "stable", "library_type": "GAPIC_AUTO" }, + "cloud.google.com/go/netapp/apiv1": { + "api_shortname": "netapp", + "distribution_name": "cloud.google.com/go/netapp/apiv1", + "description": "NetApp API", + "language": "go", + "client_library_type": "generated", + "client_documentation": "https://cloud.google.com/go/docs/reference/cloud.google.com/go/netapp/latest/apiv1", + "release_level": "preview", + "library_type": "GAPIC_AUTO" + }, "cloud.google.com/go/networkconnectivity/apiv1": { "api_shortname": "networkconnectivity", "distribution_name": "cloud.google.com/go/networkconnectivity/apiv1", @@ -1589,6 +1619,16 @@ "release_level": "preview", "library_type": "GAPIC_AUTO" }, + "cloud.google.com/go/policysimulator/apiv1": { + "api_shortname": "policysimulator", + "distribution_name": "cloud.google.com/go/policysimulator/apiv1", + "description": "Policy Simulator API", + "language": "go", + "client_library_type": "generated", + "client_documentation": "https://cloud.google.com/go/docs/reference/cloud.google.com/go/policysimulator/latest/apiv1", + "release_level": "preview", + "library_type": "GAPIC_AUTO" + }, "cloud.google.com/go/policytroubleshooter/apiv1": { "api_shortname": "policytroubleshooter", "distribution_name": "cloud.google.com/go/policytroubleshooter/apiv1", @@ -1666,7 +1706,7 @@ "language": "go", "client_library_type": "generated", "client_documentation": "https://cloud.google.com/go/docs/reference/cloud.google.com/go/rapidmigrationassessment/latest/apiv1", - "release_level": "preview", + "release_level": "stable", "library_type": "GAPIC_AUTO" }, "cloud.google.com/go/recaptchaenterprise/v2/apiv1": { @@ -2036,7 +2076,7 @@ "language": "go", "client_library_type": "generated", "client_documentation": "https://cloud.google.com/go/docs/reference/cloud.google.com/go/speech/latest/apiv2", - "release_level": "preview", + "release_level": "stable", "library_type": "GAPIC_AUTO" }, "cloud.google.com/go/storage": { @@ -2086,7 +2126,7 @@ "language": "go", "client_library_type": "generated", "client_documentation": "https://cloud.google.com/go/docs/reference/cloud.google.com/go/support/latest/apiv2", - "release_level": "preview", + "release_level": "stable", "library_type": "GAPIC_AUTO" }, "cloud.google.com/go/talent/apiv4": { @@ -2176,7 +2216,7 @@ "language": "go", "client_library_type": "generated", "client_documentation": "https://cloud.google.com/go/docs/reference/cloud.google.com/go/latest/video/stitcher/apiv1", - "release_level": "stable", + "release_level": "preview", "library_type": "GAPIC_AUTO" }, "cloud.google.com/go/video/transcoder/apiv1": { @@ -2256,7 +2296,7 @@ "language": "go", "client_library_type": "generated", "client_documentation": "https://cloud.google.com/go/docs/reference/cloud.google.com/go/vmwareengine/latest/apiv1", - "release_level": "preview", + "release_level": "stable", "library_type": "GAPIC_AUTO" }, "cloud.google.com/go/vpcaccess/apiv1": { diff --git a/vendor/cloud.google.com/go/kms/apiv1/kmspb/resources.pb.go b/vendor/cloud.google.com/go/kms/apiv1/kmspb/resources.pb.go index b43ba13acd..1594af87e0 100644 --- a/vendor/cloud.google.com/go/kms/apiv1/kmspb/resources.pb.go +++ b/vendor/cloud.google.com/go/kms/apiv1/kmspb/resources.pb.go @@ -300,6 +300,14 @@ const ( CryptoKeyVersion_AES_128_GCM CryptoKeyVersion_CryptoKeyVersionAlgorithm = 41 // AES-GCM (Galois Counter Mode) using 256-bit keys. CryptoKeyVersion_AES_256_GCM CryptoKeyVersion_CryptoKeyVersionAlgorithm = 19 + // AES-CBC (Cipher Block Chaining Mode) using 128-bit keys. + CryptoKeyVersion_AES_128_CBC CryptoKeyVersion_CryptoKeyVersionAlgorithm = 42 + // AES-CBC (Cipher Block Chaining Mode) using 256-bit keys. + CryptoKeyVersion_AES_256_CBC CryptoKeyVersion_CryptoKeyVersionAlgorithm = 43 + // AES-CTR (Counter Mode) using 128-bit keys. + CryptoKeyVersion_AES_128_CTR CryptoKeyVersion_CryptoKeyVersionAlgorithm = 44 + // AES-CTR (Counter Mode) using 256-bit keys. + CryptoKeyVersion_AES_256_CTR CryptoKeyVersion_CryptoKeyVersionAlgorithm = 45 // RSASSA-PSS 2048 bit key with a SHA256 digest. CryptoKeyVersion_RSA_SIGN_PSS_2048_SHA256 CryptoKeyVersion_CryptoKeyVersionAlgorithm = 2 // RSASSA-PSS 3072 bit key with a SHA256 digest. @@ -370,6 +378,10 @@ var ( 1: "GOOGLE_SYMMETRIC_ENCRYPTION", 41: "AES_128_GCM", 19: "AES_256_GCM", + 42: "AES_128_CBC", + 43: "AES_256_CBC", + 44: "AES_128_CTR", + 45: "AES_256_CTR", 2: "RSA_SIGN_PSS_2048_SHA256", 3: "RSA_SIGN_PSS_3072_SHA256", 4: "RSA_SIGN_PSS_4096_SHA256", @@ -403,6 +415,10 @@ var ( "GOOGLE_SYMMETRIC_ENCRYPTION": 1, "AES_128_GCM": 41, "AES_256_GCM": 19, + "AES_128_CBC": 42, + "AES_256_CBC": 43, + "AES_128_CTR": 44, + "AES_256_CTR": 45, "RSA_SIGN_PSS_2048_SHA256": 2, "RSA_SIGN_PSS_3072_SHA256": 3, "RSA_SIGN_PSS_4096_SHA256": 4, @@ -2097,7 +2113,7 @@ var file_google_cloud_kms_v1_resources_proto_rawDesc = []byte{ 0x45, 0x43, 0x49, 0x46, 0x49, 0x45, 0x44, 0x10, 0x00, 0x12, 0x18, 0x0a, 0x14, 0x43, 0x41, 0x56, 0x49, 0x55, 0x4d, 0x5f, 0x56, 0x31, 0x5f, 0x43, 0x4f, 0x4d, 0x50, 0x52, 0x45, 0x53, 0x53, 0x45, 0x44, 0x10, 0x03, 0x12, 0x18, 0x0a, 0x14, 0x43, 0x41, 0x56, 0x49, 0x55, 0x4d, 0x5f, 0x56, 0x32, - 0x5f, 0x43, 0x4f, 0x4d, 0x50, 0x52, 0x45, 0x53, 0x53, 0x45, 0x44, 0x10, 0x04, 0x22, 0xb0, 0x14, + 0x5f, 0x43, 0x4f, 0x4d, 0x50, 0x52, 0x45, 0x53, 0x53, 0x45, 0x44, 0x10, 0x04, 0x22, 0xf4, 0x14, 0x0a, 0x10, 0x43, 0x72, 0x79, 0x70, 0x74, 0x6f, 0x4b, 0x65, 0x79, 0x56, 0x65, 0x72, 0x73, 0x69, 0x6f, 0x6e, 0x12, 0x17, 0x0a, 0x04, 0x6e, 0x61, 0x6d, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x42, 0x03, 0xe0, 0x41, 0x03, 0x52, 0x04, 0x6e, 0x61, 0x6d, 0x65, 0x12, 0x51, 0x0a, 0x05, 0x73, @@ -2170,7 +2186,7 @@ var file_google_cloud_kms_v1_resources_proto_rawDesc = []byte{ 0x4c, 0x65, 0x76, 0x65, 0x6c, 0x4f, 0x70, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x12, 0x30, 0x0a, 0x11, 0x72, 0x65, 0x69, 0x6d, 0x70, 0x6f, 0x72, 0x74, 0x5f, 0x65, 0x6c, 0x69, 0x67, 0x69, 0x62, 0x6c, 0x65, 0x18, 0x12, 0x20, 0x01, 0x28, 0x08, 0x42, 0x03, 0xe0, 0x41, 0x03, 0x52, 0x10, 0x72, 0x65, - 0x69, 0x6d, 0x70, 0x6f, 0x72, 0x74, 0x45, 0x6c, 0x69, 0x67, 0x69, 0x62, 0x6c, 0x65, 0x22, 0x89, + 0x69, 0x6d, 0x70, 0x6f, 0x72, 0x74, 0x45, 0x6c, 0x69, 0x67, 0x69, 0x62, 0x6c, 0x65, 0x22, 0xcd, 0x07, 0x0a, 0x19, 0x43, 0x72, 0x79, 0x70, 0x74, 0x6f, 0x4b, 0x65, 0x79, 0x56, 0x65, 0x72, 0x73, 0x69, 0x6f, 0x6e, 0x41, 0x6c, 0x67, 0x6f, 0x72, 0x69, 0x74, 0x68, 0x6d, 0x12, 0x2c, 0x0a, 0x28, 0x43, 0x52, 0x59, 0x50, 0x54, 0x4f, 0x5f, 0x4b, 0x45, 0x59, 0x5f, 0x56, 0x45, 0x52, 0x53, 0x49, @@ -2179,219 +2195,223 @@ var file_google_cloud_kms_v1_resources_proto_rawDesc = []byte{ 0x4f, 0x47, 0x4c, 0x45, 0x5f, 0x53, 0x59, 0x4d, 0x4d, 0x45, 0x54, 0x52, 0x49, 0x43, 0x5f, 0x45, 0x4e, 0x43, 0x52, 0x59, 0x50, 0x54, 0x49, 0x4f, 0x4e, 0x10, 0x01, 0x12, 0x0f, 0x0a, 0x0b, 0x41, 0x45, 0x53, 0x5f, 0x31, 0x32, 0x38, 0x5f, 0x47, 0x43, 0x4d, 0x10, 0x29, 0x12, 0x0f, 0x0a, 0x0b, - 0x41, 0x45, 0x53, 0x5f, 0x32, 0x35, 0x36, 0x5f, 0x47, 0x43, 0x4d, 0x10, 0x13, 0x12, 0x1c, 0x0a, - 0x18, 0x52, 0x53, 0x41, 0x5f, 0x53, 0x49, 0x47, 0x4e, 0x5f, 0x50, 0x53, 0x53, 0x5f, 0x32, 0x30, - 0x34, 0x38, 0x5f, 0x53, 0x48, 0x41, 0x32, 0x35, 0x36, 0x10, 0x02, 0x12, 0x1c, 0x0a, 0x18, 0x52, - 0x53, 0x41, 0x5f, 0x53, 0x49, 0x47, 0x4e, 0x5f, 0x50, 0x53, 0x53, 0x5f, 0x33, 0x30, 0x37, 0x32, - 0x5f, 0x53, 0x48, 0x41, 0x32, 0x35, 0x36, 0x10, 0x03, 0x12, 0x1c, 0x0a, 0x18, 0x52, 0x53, 0x41, - 0x5f, 0x53, 0x49, 0x47, 0x4e, 0x5f, 0x50, 0x53, 0x53, 0x5f, 0x34, 0x30, 0x39, 0x36, 0x5f, 0x53, - 0x48, 0x41, 0x32, 0x35, 0x36, 0x10, 0x04, 0x12, 0x1c, 0x0a, 0x18, 0x52, 0x53, 0x41, 0x5f, 0x53, - 0x49, 0x47, 0x4e, 0x5f, 0x50, 0x53, 0x53, 0x5f, 0x34, 0x30, 0x39, 0x36, 0x5f, 0x53, 0x48, 0x41, - 0x35, 0x31, 0x32, 0x10, 0x0f, 0x12, 0x1e, 0x0a, 0x1a, 0x52, 0x53, 0x41, 0x5f, 0x53, 0x49, 0x47, - 0x4e, 0x5f, 0x50, 0x4b, 0x43, 0x53, 0x31, 0x5f, 0x32, 0x30, 0x34, 0x38, 0x5f, 0x53, 0x48, 0x41, - 0x32, 0x35, 0x36, 0x10, 0x05, 0x12, 0x1e, 0x0a, 0x1a, 0x52, 0x53, 0x41, 0x5f, 0x53, 0x49, 0x47, - 0x4e, 0x5f, 0x50, 0x4b, 0x43, 0x53, 0x31, 0x5f, 0x33, 0x30, 0x37, 0x32, 0x5f, 0x53, 0x48, 0x41, - 0x32, 0x35, 0x36, 0x10, 0x06, 0x12, 0x1e, 0x0a, 0x1a, 0x52, 0x53, 0x41, 0x5f, 0x53, 0x49, 0x47, - 0x4e, 0x5f, 0x50, 0x4b, 0x43, 0x53, 0x31, 0x5f, 0x34, 0x30, 0x39, 0x36, 0x5f, 0x53, 0x48, 0x41, - 0x32, 0x35, 0x36, 0x10, 0x07, 0x12, 0x1e, 0x0a, 0x1a, 0x52, 0x53, 0x41, 0x5f, 0x53, 0x49, 0x47, - 0x4e, 0x5f, 0x50, 0x4b, 0x43, 0x53, 0x31, 0x5f, 0x34, 0x30, 0x39, 0x36, 0x5f, 0x53, 0x48, 0x41, - 0x35, 0x31, 0x32, 0x10, 0x10, 0x12, 0x1b, 0x0a, 0x17, 0x52, 0x53, 0x41, 0x5f, 0x53, 0x49, 0x47, - 0x4e, 0x5f, 0x52, 0x41, 0x57, 0x5f, 0x50, 0x4b, 0x43, 0x53, 0x31, 0x5f, 0x32, 0x30, 0x34, 0x38, - 0x10, 0x1c, 0x12, 0x1b, 0x0a, 0x17, 0x52, 0x53, 0x41, 0x5f, 0x53, 0x49, 0x47, 0x4e, 0x5f, 0x52, - 0x41, 0x57, 0x5f, 0x50, 0x4b, 0x43, 0x53, 0x31, 0x5f, 0x33, 0x30, 0x37, 0x32, 0x10, 0x1d, 0x12, - 0x1b, 0x0a, 0x17, 0x52, 0x53, 0x41, 0x5f, 0x53, 0x49, 0x47, 0x4e, 0x5f, 0x52, 0x41, 0x57, 0x5f, - 0x50, 0x4b, 0x43, 0x53, 0x31, 0x5f, 0x34, 0x30, 0x39, 0x36, 0x10, 0x1e, 0x12, 0x20, 0x0a, 0x1c, - 0x52, 0x53, 0x41, 0x5f, 0x44, 0x45, 0x43, 0x52, 0x59, 0x50, 0x54, 0x5f, 0x4f, 0x41, 0x45, 0x50, - 0x5f, 0x32, 0x30, 0x34, 0x38, 0x5f, 0x53, 0x48, 0x41, 0x32, 0x35, 0x36, 0x10, 0x08, 0x12, 0x20, - 0x0a, 0x1c, 0x52, 0x53, 0x41, 0x5f, 0x44, 0x45, 0x43, 0x52, 0x59, 0x50, 0x54, 0x5f, 0x4f, 0x41, - 0x45, 0x50, 0x5f, 0x33, 0x30, 0x37, 0x32, 0x5f, 0x53, 0x48, 0x41, 0x32, 0x35, 0x36, 0x10, 0x09, + 0x41, 0x45, 0x53, 0x5f, 0x32, 0x35, 0x36, 0x5f, 0x47, 0x43, 0x4d, 0x10, 0x13, 0x12, 0x0f, 0x0a, + 0x0b, 0x41, 0x45, 0x53, 0x5f, 0x31, 0x32, 0x38, 0x5f, 0x43, 0x42, 0x43, 0x10, 0x2a, 0x12, 0x0f, + 0x0a, 0x0b, 0x41, 0x45, 0x53, 0x5f, 0x32, 0x35, 0x36, 0x5f, 0x43, 0x42, 0x43, 0x10, 0x2b, 0x12, + 0x0f, 0x0a, 0x0b, 0x41, 0x45, 0x53, 0x5f, 0x31, 0x32, 0x38, 0x5f, 0x43, 0x54, 0x52, 0x10, 0x2c, + 0x12, 0x0f, 0x0a, 0x0b, 0x41, 0x45, 0x53, 0x5f, 0x32, 0x35, 0x36, 0x5f, 0x43, 0x54, 0x52, 0x10, + 0x2d, 0x12, 0x1c, 0x0a, 0x18, 0x52, 0x53, 0x41, 0x5f, 0x53, 0x49, 0x47, 0x4e, 0x5f, 0x50, 0x53, + 0x53, 0x5f, 0x32, 0x30, 0x34, 0x38, 0x5f, 0x53, 0x48, 0x41, 0x32, 0x35, 0x36, 0x10, 0x02, 0x12, + 0x1c, 0x0a, 0x18, 0x52, 0x53, 0x41, 0x5f, 0x53, 0x49, 0x47, 0x4e, 0x5f, 0x50, 0x53, 0x53, 0x5f, + 0x33, 0x30, 0x37, 0x32, 0x5f, 0x53, 0x48, 0x41, 0x32, 0x35, 0x36, 0x10, 0x03, 0x12, 0x1c, 0x0a, + 0x18, 0x52, 0x53, 0x41, 0x5f, 0x53, 0x49, 0x47, 0x4e, 0x5f, 0x50, 0x53, 0x53, 0x5f, 0x34, 0x30, + 0x39, 0x36, 0x5f, 0x53, 0x48, 0x41, 0x32, 0x35, 0x36, 0x10, 0x04, 0x12, 0x1c, 0x0a, 0x18, 0x52, + 0x53, 0x41, 0x5f, 0x53, 0x49, 0x47, 0x4e, 0x5f, 0x50, 0x53, 0x53, 0x5f, 0x34, 0x30, 0x39, 0x36, + 0x5f, 0x53, 0x48, 0x41, 0x35, 0x31, 0x32, 0x10, 0x0f, 0x12, 0x1e, 0x0a, 0x1a, 0x52, 0x53, 0x41, + 0x5f, 0x53, 0x49, 0x47, 0x4e, 0x5f, 0x50, 0x4b, 0x43, 0x53, 0x31, 0x5f, 0x32, 0x30, 0x34, 0x38, + 0x5f, 0x53, 0x48, 0x41, 0x32, 0x35, 0x36, 0x10, 0x05, 0x12, 0x1e, 0x0a, 0x1a, 0x52, 0x53, 0x41, + 0x5f, 0x53, 0x49, 0x47, 0x4e, 0x5f, 0x50, 0x4b, 0x43, 0x53, 0x31, 0x5f, 0x33, 0x30, 0x37, 0x32, + 0x5f, 0x53, 0x48, 0x41, 0x32, 0x35, 0x36, 0x10, 0x06, 0x12, 0x1e, 0x0a, 0x1a, 0x52, 0x53, 0x41, + 0x5f, 0x53, 0x49, 0x47, 0x4e, 0x5f, 0x50, 0x4b, 0x43, 0x53, 0x31, 0x5f, 0x34, 0x30, 0x39, 0x36, + 0x5f, 0x53, 0x48, 0x41, 0x32, 0x35, 0x36, 0x10, 0x07, 0x12, 0x1e, 0x0a, 0x1a, 0x52, 0x53, 0x41, + 0x5f, 0x53, 0x49, 0x47, 0x4e, 0x5f, 0x50, 0x4b, 0x43, 0x53, 0x31, 0x5f, 0x34, 0x30, 0x39, 0x36, + 0x5f, 0x53, 0x48, 0x41, 0x35, 0x31, 0x32, 0x10, 0x10, 0x12, 0x1b, 0x0a, 0x17, 0x52, 0x53, 0x41, + 0x5f, 0x53, 0x49, 0x47, 0x4e, 0x5f, 0x52, 0x41, 0x57, 0x5f, 0x50, 0x4b, 0x43, 0x53, 0x31, 0x5f, + 0x32, 0x30, 0x34, 0x38, 0x10, 0x1c, 0x12, 0x1b, 0x0a, 0x17, 0x52, 0x53, 0x41, 0x5f, 0x53, 0x49, + 0x47, 0x4e, 0x5f, 0x52, 0x41, 0x57, 0x5f, 0x50, 0x4b, 0x43, 0x53, 0x31, 0x5f, 0x33, 0x30, 0x37, + 0x32, 0x10, 0x1d, 0x12, 0x1b, 0x0a, 0x17, 0x52, 0x53, 0x41, 0x5f, 0x53, 0x49, 0x47, 0x4e, 0x5f, + 0x52, 0x41, 0x57, 0x5f, 0x50, 0x4b, 0x43, 0x53, 0x31, 0x5f, 0x34, 0x30, 0x39, 0x36, 0x10, 0x1e, 0x12, 0x20, 0x0a, 0x1c, 0x52, 0x53, 0x41, 0x5f, 0x44, 0x45, 0x43, 0x52, 0x59, 0x50, 0x54, 0x5f, - 0x4f, 0x41, 0x45, 0x50, 0x5f, 0x34, 0x30, 0x39, 0x36, 0x5f, 0x53, 0x48, 0x41, 0x32, 0x35, 0x36, - 0x10, 0x0a, 0x12, 0x20, 0x0a, 0x1c, 0x52, 0x53, 0x41, 0x5f, 0x44, 0x45, 0x43, 0x52, 0x59, 0x50, - 0x54, 0x5f, 0x4f, 0x41, 0x45, 0x50, 0x5f, 0x34, 0x30, 0x39, 0x36, 0x5f, 0x53, 0x48, 0x41, 0x35, - 0x31, 0x32, 0x10, 0x11, 0x12, 0x1e, 0x0a, 0x1a, 0x52, 0x53, 0x41, 0x5f, 0x44, 0x45, 0x43, 0x52, - 0x59, 0x50, 0x54, 0x5f, 0x4f, 0x41, 0x45, 0x50, 0x5f, 0x32, 0x30, 0x34, 0x38, 0x5f, 0x53, 0x48, - 0x41, 0x31, 0x10, 0x25, 0x12, 0x1e, 0x0a, 0x1a, 0x52, 0x53, 0x41, 0x5f, 0x44, 0x45, 0x43, 0x52, - 0x59, 0x50, 0x54, 0x5f, 0x4f, 0x41, 0x45, 0x50, 0x5f, 0x33, 0x30, 0x37, 0x32, 0x5f, 0x53, 0x48, - 0x41, 0x31, 0x10, 0x26, 0x12, 0x1e, 0x0a, 0x1a, 0x52, 0x53, 0x41, 0x5f, 0x44, 0x45, 0x43, 0x52, + 0x4f, 0x41, 0x45, 0x50, 0x5f, 0x32, 0x30, 0x34, 0x38, 0x5f, 0x53, 0x48, 0x41, 0x32, 0x35, 0x36, + 0x10, 0x08, 0x12, 0x20, 0x0a, 0x1c, 0x52, 0x53, 0x41, 0x5f, 0x44, 0x45, 0x43, 0x52, 0x59, 0x50, + 0x54, 0x5f, 0x4f, 0x41, 0x45, 0x50, 0x5f, 0x33, 0x30, 0x37, 0x32, 0x5f, 0x53, 0x48, 0x41, 0x32, + 0x35, 0x36, 0x10, 0x09, 0x12, 0x20, 0x0a, 0x1c, 0x52, 0x53, 0x41, 0x5f, 0x44, 0x45, 0x43, 0x52, 0x59, 0x50, 0x54, 0x5f, 0x4f, 0x41, 0x45, 0x50, 0x5f, 0x34, 0x30, 0x39, 0x36, 0x5f, 0x53, 0x48, - 0x41, 0x31, 0x10, 0x27, 0x12, 0x17, 0x0a, 0x13, 0x45, 0x43, 0x5f, 0x53, 0x49, 0x47, 0x4e, 0x5f, - 0x50, 0x32, 0x35, 0x36, 0x5f, 0x53, 0x48, 0x41, 0x32, 0x35, 0x36, 0x10, 0x0c, 0x12, 0x17, 0x0a, - 0x13, 0x45, 0x43, 0x5f, 0x53, 0x49, 0x47, 0x4e, 0x5f, 0x50, 0x33, 0x38, 0x34, 0x5f, 0x53, 0x48, - 0x41, 0x33, 0x38, 0x34, 0x10, 0x0d, 0x12, 0x1c, 0x0a, 0x18, 0x45, 0x43, 0x5f, 0x53, 0x49, 0x47, - 0x4e, 0x5f, 0x53, 0x45, 0x43, 0x50, 0x32, 0x35, 0x36, 0x4b, 0x31, 0x5f, 0x53, 0x48, 0x41, 0x32, - 0x35, 0x36, 0x10, 0x1f, 0x12, 0x0f, 0x0a, 0x0b, 0x48, 0x4d, 0x41, 0x43, 0x5f, 0x53, 0x48, 0x41, - 0x32, 0x35, 0x36, 0x10, 0x20, 0x12, 0x0d, 0x0a, 0x09, 0x48, 0x4d, 0x41, 0x43, 0x5f, 0x53, 0x48, - 0x41, 0x31, 0x10, 0x21, 0x12, 0x0f, 0x0a, 0x0b, 0x48, 0x4d, 0x41, 0x43, 0x5f, 0x53, 0x48, 0x41, - 0x33, 0x38, 0x34, 0x10, 0x22, 0x12, 0x0f, 0x0a, 0x0b, 0x48, 0x4d, 0x41, 0x43, 0x5f, 0x53, 0x48, - 0x41, 0x35, 0x31, 0x32, 0x10, 0x23, 0x12, 0x0f, 0x0a, 0x0b, 0x48, 0x4d, 0x41, 0x43, 0x5f, 0x53, - 0x48, 0x41, 0x32, 0x32, 0x34, 0x10, 0x24, 0x12, 0x21, 0x0a, 0x1d, 0x45, 0x58, 0x54, 0x45, 0x52, - 0x4e, 0x41, 0x4c, 0x5f, 0x53, 0x59, 0x4d, 0x4d, 0x45, 0x54, 0x52, 0x49, 0x43, 0x5f, 0x45, 0x4e, - 0x43, 0x52, 0x59, 0x50, 0x54, 0x49, 0x4f, 0x4e, 0x10, 0x12, 0x22, 0x9b, 0x02, 0x0a, 0x15, 0x43, - 0x72, 0x79, 0x70, 0x74, 0x6f, 0x4b, 0x65, 0x79, 0x56, 0x65, 0x72, 0x73, 0x69, 0x6f, 0x6e, 0x53, - 0x74, 0x61, 0x74, 0x65, 0x12, 0x28, 0x0a, 0x24, 0x43, 0x52, 0x59, 0x50, 0x54, 0x4f, 0x5f, 0x4b, - 0x45, 0x59, 0x5f, 0x56, 0x45, 0x52, 0x53, 0x49, 0x4f, 0x4e, 0x5f, 0x53, 0x54, 0x41, 0x54, 0x45, - 0x5f, 0x55, 0x4e, 0x53, 0x50, 0x45, 0x43, 0x49, 0x46, 0x49, 0x45, 0x44, 0x10, 0x00, 0x12, 0x16, - 0x0a, 0x12, 0x50, 0x45, 0x4e, 0x44, 0x49, 0x4e, 0x47, 0x5f, 0x47, 0x45, 0x4e, 0x45, 0x52, 0x41, - 0x54, 0x49, 0x4f, 0x4e, 0x10, 0x05, 0x12, 0x0b, 0x0a, 0x07, 0x45, 0x4e, 0x41, 0x42, 0x4c, 0x45, - 0x44, 0x10, 0x01, 0x12, 0x0c, 0x0a, 0x08, 0x44, 0x49, 0x53, 0x41, 0x42, 0x4c, 0x45, 0x44, 0x10, - 0x02, 0x12, 0x0d, 0x0a, 0x09, 0x44, 0x45, 0x53, 0x54, 0x52, 0x4f, 0x59, 0x45, 0x44, 0x10, 0x03, - 0x12, 0x15, 0x0a, 0x11, 0x44, 0x45, 0x53, 0x54, 0x52, 0x4f, 0x59, 0x5f, 0x53, 0x43, 0x48, 0x45, - 0x44, 0x55, 0x4c, 0x45, 0x44, 0x10, 0x04, 0x12, 0x12, 0x0a, 0x0e, 0x50, 0x45, 0x4e, 0x44, 0x49, - 0x4e, 0x47, 0x5f, 0x49, 0x4d, 0x50, 0x4f, 0x52, 0x54, 0x10, 0x06, 0x12, 0x11, 0x0a, 0x0d, 0x49, - 0x4d, 0x50, 0x4f, 0x52, 0x54, 0x5f, 0x46, 0x41, 0x49, 0x4c, 0x45, 0x44, 0x10, 0x07, 0x12, 0x15, - 0x0a, 0x11, 0x47, 0x45, 0x4e, 0x45, 0x52, 0x41, 0x54, 0x49, 0x4f, 0x4e, 0x5f, 0x46, 0x41, 0x49, - 0x4c, 0x45, 0x44, 0x10, 0x08, 0x12, 0x20, 0x0a, 0x1c, 0x50, 0x45, 0x4e, 0x44, 0x49, 0x4e, 0x47, - 0x5f, 0x45, 0x58, 0x54, 0x45, 0x52, 0x4e, 0x41, 0x4c, 0x5f, 0x44, 0x45, 0x53, 0x54, 0x52, 0x55, - 0x43, 0x54, 0x49, 0x4f, 0x4e, 0x10, 0x09, 0x12, 0x1f, 0x0a, 0x1b, 0x45, 0x58, 0x54, 0x45, 0x52, - 0x4e, 0x41, 0x4c, 0x5f, 0x44, 0x45, 0x53, 0x54, 0x52, 0x55, 0x43, 0x54, 0x49, 0x4f, 0x4e, 0x5f, - 0x46, 0x41, 0x49, 0x4c, 0x45, 0x44, 0x10, 0x0a, 0x22, 0x49, 0x0a, 0x14, 0x43, 0x72, 0x79, 0x70, - 0x74, 0x6f, 0x4b, 0x65, 0x79, 0x56, 0x65, 0x72, 0x73, 0x69, 0x6f, 0x6e, 0x56, 0x69, 0x65, 0x77, - 0x12, 0x27, 0x0a, 0x23, 0x43, 0x52, 0x59, 0x50, 0x54, 0x4f, 0x5f, 0x4b, 0x45, 0x59, 0x5f, 0x56, - 0x45, 0x52, 0x53, 0x49, 0x4f, 0x4e, 0x5f, 0x56, 0x49, 0x45, 0x57, 0x5f, 0x55, 0x4e, 0x53, 0x50, - 0x45, 0x43, 0x49, 0x46, 0x49, 0x45, 0x44, 0x10, 0x00, 0x12, 0x08, 0x0a, 0x04, 0x46, 0x55, 0x4c, - 0x4c, 0x10, 0x01, 0x3a, 0xaa, 0x01, 0xea, 0x41, 0xa6, 0x01, 0x0a, 0x28, 0x63, 0x6c, 0x6f, 0x75, - 0x64, 0x6b, 0x6d, 0x73, 0x2e, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x61, 0x70, 0x69, 0x73, 0x2e, - 0x63, 0x6f, 0x6d, 0x2f, 0x43, 0x72, 0x79, 0x70, 0x74, 0x6f, 0x4b, 0x65, 0x79, 0x56, 0x65, 0x72, - 0x73, 0x69, 0x6f, 0x6e, 0x12, 0x7a, 0x70, 0x72, 0x6f, 0x6a, 0x65, 0x63, 0x74, 0x73, 0x2f, 0x7b, - 0x70, 0x72, 0x6f, 0x6a, 0x65, 0x63, 0x74, 0x7d, 0x2f, 0x6c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, - 0x6e, 0x73, 0x2f, 0x7b, 0x6c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x7d, 0x2f, 0x6b, 0x65, - 0x79, 0x52, 0x69, 0x6e, 0x67, 0x73, 0x2f, 0x7b, 0x6b, 0x65, 0x79, 0x5f, 0x72, 0x69, 0x6e, 0x67, - 0x7d, 0x2f, 0x63, 0x72, 0x79, 0x70, 0x74, 0x6f, 0x4b, 0x65, 0x79, 0x73, 0x2f, 0x7b, 0x63, 0x72, - 0x79, 0x70, 0x74, 0x6f, 0x5f, 0x6b, 0x65, 0x79, 0x7d, 0x2f, 0x63, 0x72, 0x79, 0x70, 0x74, 0x6f, - 0x4b, 0x65, 0x79, 0x56, 0x65, 0x72, 0x73, 0x69, 0x6f, 0x6e, 0x73, 0x2f, 0x7b, 0x63, 0x72, 0x79, - 0x70, 0x74, 0x6f, 0x5f, 0x6b, 0x65, 0x79, 0x5f, 0x76, 0x65, 0x72, 0x73, 0x69, 0x6f, 0x6e, 0x7d, - 0x22, 0xce, 0x03, 0x0a, 0x09, 0x50, 0x75, 0x62, 0x6c, 0x69, 0x63, 0x4b, 0x65, 0x79, 0x12, 0x10, - 0x0a, 0x03, 0x70, 0x65, 0x6d, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x03, 0x70, 0x65, 0x6d, - 0x12, 0x5d, 0x0a, 0x09, 0x61, 0x6c, 0x67, 0x6f, 0x72, 0x69, 0x74, 0x68, 0x6d, 0x18, 0x02, 0x20, - 0x01, 0x28, 0x0e, 0x32, 0x3f, 0x2e, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2e, 0x63, 0x6c, 0x6f, - 0x75, 0x64, 0x2e, 0x6b, 0x6d, 0x73, 0x2e, 0x76, 0x31, 0x2e, 0x43, 0x72, 0x79, 0x70, 0x74, 0x6f, - 0x4b, 0x65, 0x79, 0x56, 0x65, 0x72, 0x73, 0x69, 0x6f, 0x6e, 0x2e, 0x43, 0x72, 0x79, 0x70, 0x74, - 0x6f, 0x4b, 0x65, 0x79, 0x56, 0x65, 0x72, 0x73, 0x69, 0x6f, 0x6e, 0x41, 0x6c, 0x67, 0x6f, 0x72, - 0x69, 0x74, 0x68, 0x6d, 0x52, 0x09, 0x61, 0x6c, 0x67, 0x6f, 0x72, 0x69, 0x74, 0x68, 0x6d, 0x12, - 0x3a, 0x0a, 0x0a, 0x70, 0x65, 0x6d, 0x5f, 0x63, 0x72, 0x63, 0x33, 0x32, 0x63, 0x18, 0x03, 0x20, - 0x01, 0x28, 0x0b, 0x32, 0x1b, 0x2e, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2e, 0x70, 0x72, 0x6f, - 0x74, 0x6f, 0x62, 0x75, 0x66, 0x2e, 0x49, 0x6e, 0x74, 0x36, 0x34, 0x56, 0x61, 0x6c, 0x75, 0x65, - 0x52, 0x09, 0x70, 0x65, 0x6d, 0x43, 0x72, 0x63, 0x33, 0x32, 0x63, 0x12, 0x12, 0x0a, 0x04, 0x6e, - 0x61, 0x6d, 0x65, 0x18, 0x04, 0x20, 0x01, 0x28, 0x09, 0x52, 0x04, 0x6e, 0x61, 0x6d, 0x65, 0x12, - 0x4f, 0x0a, 0x10, 0x70, 0x72, 0x6f, 0x74, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x5f, 0x6c, 0x65, - 0x76, 0x65, 0x6c, 0x18, 0x05, 0x20, 0x01, 0x28, 0x0e, 0x32, 0x24, 0x2e, 0x67, 0x6f, 0x6f, 0x67, - 0x6c, 0x65, 0x2e, 0x63, 0x6c, 0x6f, 0x75, 0x64, 0x2e, 0x6b, 0x6d, 0x73, 0x2e, 0x76, 0x31, 0x2e, - 0x50, 0x72, 0x6f, 0x74, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x4c, 0x65, 0x76, 0x65, 0x6c, 0x52, - 0x0f, 0x70, 0x72, 0x6f, 0x74, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x4c, 0x65, 0x76, 0x65, 0x6c, - 0x3a, 0xae, 0x01, 0xea, 0x41, 0xaa, 0x01, 0x0a, 0x21, 0x63, 0x6c, 0x6f, 0x75, 0x64, 0x6b, 0x6d, - 0x73, 0x2e, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x61, 0x70, 0x69, 0x73, 0x2e, 0x63, 0x6f, 0x6d, - 0x2f, 0x50, 0x75, 0x62, 0x6c, 0x69, 0x63, 0x4b, 0x65, 0x79, 0x12, 0x84, 0x01, 0x70, 0x72, 0x6f, - 0x6a, 0x65, 0x63, 0x74, 0x73, 0x2f, 0x7b, 0x70, 0x72, 0x6f, 0x6a, 0x65, 0x63, 0x74, 0x7d, 0x2f, - 0x6c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x2f, 0x7b, 0x6c, 0x6f, 0x63, 0x61, 0x74, - 0x69, 0x6f, 0x6e, 0x7d, 0x2f, 0x6b, 0x65, 0x79, 0x52, 0x69, 0x6e, 0x67, 0x73, 0x2f, 0x7b, 0x6b, - 0x65, 0x79, 0x5f, 0x72, 0x69, 0x6e, 0x67, 0x7d, 0x2f, 0x63, 0x72, 0x79, 0x70, 0x74, 0x6f, 0x4b, - 0x65, 0x79, 0x73, 0x2f, 0x7b, 0x63, 0x72, 0x79, 0x70, 0x74, 0x6f, 0x5f, 0x6b, 0x65, 0x79, 0x7d, - 0x2f, 0x63, 0x72, 0x79, 0x70, 0x74, 0x6f, 0x4b, 0x65, 0x79, 0x56, 0x65, 0x72, 0x73, 0x69, 0x6f, - 0x6e, 0x73, 0x2f, 0x7b, 0x63, 0x72, 0x79, 0x70, 0x74, 0x6f, 0x5f, 0x6b, 0x65, 0x79, 0x5f, 0x76, - 0x65, 0x72, 0x73, 0x69, 0x6f, 0x6e, 0x7d, 0x2f, 0x70, 0x75, 0x62, 0x6c, 0x69, 0x63, 0x4b, 0x65, - 0x79, 0x22, 0xd4, 0x09, 0x0a, 0x09, 0x49, 0x6d, 0x70, 0x6f, 0x72, 0x74, 0x4a, 0x6f, 0x62, 0x12, - 0x17, 0x0a, 0x04, 0x6e, 0x61, 0x6d, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x42, 0x03, 0xe0, - 0x41, 0x03, 0x52, 0x04, 0x6e, 0x61, 0x6d, 0x65, 0x12, 0x58, 0x0a, 0x0d, 0x69, 0x6d, 0x70, 0x6f, - 0x72, 0x74, 0x5f, 0x6d, 0x65, 0x74, 0x68, 0x6f, 0x64, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0e, 0x32, - 0x2b, 0x2e, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2e, 0x63, 0x6c, 0x6f, 0x75, 0x64, 0x2e, 0x6b, - 0x6d, 0x73, 0x2e, 0x76, 0x31, 0x2e, 0x49, 0x6d, 0x70, 0x6f, 0x72, 0x74, 0x4a, 0x6f, 0x62, 0x2e, - 0x49, 0x6d, 0x70, 0x6f, 0x72, 0x74, 0x4d, 0x65, 0x74, 0x68, 0x6f, 0x64, 0x42, 0x06, 0xe0, 0x41, - 0x02, 0xe0, 0x41, 0x05, 0x52, 0x0c, 0x69, 0x6d, 0x70, 0x6f, 0x72, 0x74, 0x4d, 0x65, 0x74, 0x68, - 0x6f, 0x64, 0x12, 0x57, 0x0a, 0x10, 0x70, 0x72, 0x6f, 0x74, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, - 0x5f, 0x6c, 0x65, 0x76, 0x65, 0x6c, 0x18, 0x09, 0x20, 0x01, 0x28, 0x0e, 0x32, 0x24, 0x2e, 0x67, - 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2e, 0x63, 0x6c, 0x6f, 0x75, 0x64, 0x2e, 0x6b, 0x6d, 0x73, 0x2e, - 0x76, 0x31, 0x2e, 0x50, 0x72, 0x6f, 0x74, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x4c, 0x65, 0x76, - 0x65, 0x6c, 0x42, 0x06, 0xe0, 0x41, 0x02, 0xe0, 0x41, 0x05, 0x52, 0x0f, 0x70, 0x72, 0x6f, 0x74, - 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x4c, 0x65, 0x76, 0x65, 0x6c, 0x12, 0x40, 0x0a, 0x0b, 0x63, - 0x72, 0x65, 0x61, 0x74, 0x65, 0x5f, 0x74, 0x69, 0x6d, 0x65, 0x18, 0x03, 0x20, 0x01, 0x28, 0x0b, - 0x32, 0x1a, 0x2e, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x62, - 0x75, 0x66, 0x2e, 0x54, 0x69, 0x6d, 0x65, 0x73, 0x74, 0x61, 0x6d, 0x70, 0x42, 0x03, 0xe0, 0x41, - 0x03, 0x52, 0x0a, 0x63, 0x72, 0x65, 0x61, 0x74, 0x65, 0x54, 0x69, 0x6d, 0x65, 0x12, 0x44, 0x0a, - 0x0d, 0x67, 0x65, 0x6e, 0x65, 0x72, 0x61, 0x74, 0x65, 0x5f, 0x74, 0x69, 0x6d, 0x65, 0x18, 0x04, + 0x41, 0x32, 0x35, 0x36, 0x10, 0x0a, 0x12, 0x20, 0x0a, 0x1c, 0x52, 0x53, 0x41, 0x5f, 0x44, 0x45, + 0x43, 0x52, 0x59, 0x50, 0x54, 0x5f, 0x4f, 0x41, 0x45, 0x50, 0x5f, 0x34, 0x30, 0x39, 0x36, 0x5f, + 0x53, 0x48, 0x41, 0x35, 0x31, 0x32, 0x10, 0x11, 0x12, 0x1e, 0x0a, 0x1a, 0x52, 0x53, 0x41, 0x5f, + 0x44, 0x45, 0x43, 0x52, 0x59, 0x50, 0x54, 0x5f, 0x4f, 0x41, 0x45, 0x50, 0x5f, 0x32, 0x30, 0x34, + 0x38, 0x5f, 0x53, 0x48, 0x41, 0x31, 0x10, 0x25, 0x12, 0x1e, 0x0a, 0x1a, 0x52, 0x53, 0x41, 0x5f, + 0x44, 0x45, 0x43, 0x52, 0x59, 0x50, 0x54, 0x5f, 0x4f, 0x41, 0x45, 0x50, 0x5f, 0x33, 0x30, 0x37, + 0x32, 0x5f, 0x53, 0x48, 0x41, 0x31, 0x10, 0x26, 0x12, 0x1e, 0x0a, 0x1a, 0x52, 0x53, 0x41, 0x5f, + 0x44, 0x45, 0x43, 0x52, 0x59, 0x50, 0x54, 0x5f, 0x4f, 0x41, 0x45, 0x50, 0x5f, 0x34, 0x30, 0x39, + 0x36, 0x5f, 0x53, 0x48, 0x41, 0x31, 0x10, 0x27, 0x12, 0x17, 0x0a, 0x13, 0x45, 0x43, 0x5f, 0x53, + 0x49, 0x47, 0x4e, 0x5f, 0x50, 0x32, 0x35, 0x36, 0x5f, 0x53, 0x48, 0x41, 0x32, 0x35, 0x36, 0x10, + 0x0c, 0x12, 0x17, 0x0a, 0x13, 0x45, 0x43, 0x5f, 0x53, 0x49, 0x47, 0x4e, 0x5f, 0x50, 0x33, 0x38, + 0x34, 0x5f, 0x53, 0x48, 0x41, 0x33, 0x38, 0x34, 0x10, 0x0d, 0x12, 0x1c, 0x0a, 0x18, 0x45, 0x43, + 0x5f, 0x53, 0x49, 0x47, 0x4e, 0x5f, 0x53, 0x45, 0x43, 0x50, 0x32, 0x35, 0x36, 0x4b, 0x31, 0x5f, + 0x53, 0x48, 0x41, 0x32, 0x35, 0x36, 0x10, 0x1f, 0x12, 0x0f, 0x0a, 0x0b, 0x48, 0x4d, 0x41, 0x43, + 0x5f, 0x53, 0x48, 0x41, 0x32, 0x35, 0x36, 0x10, 0x20, 0x12, 0x0d, 0x0a, 0x09, 0x48, 0x4d, 0x41, + 0x43, 0x5f, 0x53, 0x48, 0x41, 0x31, 0x10, 0x21, 0x12, 0x0f, 0x0a, 0x0b, 0x48, 0x4d, 0x41, 0x43, + 0x5f, 0x53, 0x48, 0x41, 0x33, 0x38, 0x34, 0x10, 0x22, 0x12, 0x0f, 0x0a, 0x0b, 0x48, 0x4d, 0x41, + 0x43, 0x5f, 0x53, 0x48, 0x41, 0x35, 0x31, 0x32, 0x10, 0x23, 0x12, 0x0f, 0x0a, 0x0b, 0x48, 0x4d, + 0x41, 0x43, 0x5f, 0x53, 0x48, 0x41, 0x32, 0x32, 0x34, 0x10, 0x24, 0x12, 0x21, 0x0a, 0x1d, 0x45, + 0x58, 0x54, 0x45, 0x52, 0x4e, 0x41, 0x4c, 0x5f, 0x53, 0x59, 0x4d, 0x4d, 0x45, 0x54, 0x52, 0x49, + 0x43, 0x5f, 0x45, 0x4e, 0x43, 0x52, 0x59, 0x50, 0x54, 0x49, 0x4f, 0x4e, 0x10, 0x12, 0x22, 0x9b, + 0x02, 0x0a, 0x15, 0x43, 0x72, 0x79, 0x70, 0x74, 0x6f, 0x4b, 0x65, 0x79, 0x56, 0x65, 0x72, 0x73, + 0x69, 0x6f, 0x6e, 0x53, 0x74, 0x61, 0x74, 0x65, 0x12, 0x28, 0x0a, 0x24, 0x43, 0x52, 0x59, 0x50, + 0x54, 0x4f, 0x5f, 0x4b, 0x45, 0x59, 0x5f, 0x56, 0x45, 0x52, 0x53, 0x49, 0x4f, 0x4e, 0x5f, 0x53, + 0x54, 0x41, 0x54, 0x45, 0x5f, 0x55, 0x4e, 0x53, 0x50, 0x45, 0x43, 0x49, 0x46, 0x49, 0x45, 0x44, + 0x10, 0x00, 0x12, 0x16, 0x0a, 0x12, 0x50, 0x45, 0x4e, 0x44, 0x49, 0x4e, 0x47, 0x5f, 0x47, 0x45, + 0x4e, 0x45, 0x52, 0x41, 0x54, 0x49, 0x4f, 0x4e, 0x10, 0x05, 0x12, 0x0b, 0x0a, 0x07, 0x45, 0x4e, + 0x41, 0x42, 0x4c, 0x45, 0x44, 0x10, 0x01, 0x12, 0x0c, 0x0a, 0x08, 0x44, 0x49, 0x53, 0x41, 0x42, + 0x4c, 0x45, 0x44, 0x10, 0x02, 0x12, 0x0d, 0x0a, 0x09, 0x44, 0x45, 0x53, 0x54, 0x52, 0x4f, 0x59, + 0x45, 0x44, 0x10, 0x03, 0x12, 0x15, 0x0a, 0x11, 0x44, 0x45, 0x53, 0x54, 0x52, 0x4f, 0x59, 0x5f, + 0x53, 0x43, 0x48, 0x45, 0x44, 0x55, 0x4c, 0x45, 0x44, 0x10, 0x04, 0x12, 0x12, 0x0a, 0x0e, 0x50, + 0x45, 0x4e, 0x44, 0x49, 0x4e, 0x47, 0x5f, 0x49, 0x4d, 0x50, 0x4f, 0x52, 0x54, 0x10, 0x06, 0x12, + 0x11, 0x0a, 0x0d, 0x49, 0x4d, 0x50, 0x4f, 0x52, 0x54, 0x5f, 0x46, 0x41, 0x49, 0x4c, 0x45, 0x44, + 0x10, 0x07, 0x12, 0x15, 0x0a, 0x11, 0x47, 0x45, 0x4e, 0x45, 0x52, 0x41, 0x54, 0x49, 0x4f, 0x4e, + 0x5f, 0x46, 0x41, 0x49, 0x4c, 0x45, 0x44, 0x10, 0x08, 0x12, 0x20, 0x0a, 0x1c, 0x50, 0x45, 0x4e, + 0x44, 0x49, 0x4e, 0x47, 0x5f, 0x45, 0x58, 0x54, 0x45, 0x52, 0x4e, 0x41, 0x4c, 0x5f, 0x44, 0x45, + 0x53, 0x54, 0x52, 0x55, 0x43, 0x54, 0x49, 0x4f, 0x4e, 0x10, 0x09, 0x12, 0x1f, 0x0a, 0x1b, 0x45, + 0x58, 0x54, 0x45, 0x52, 0x4e, 0x41, 0x4c, 0x5f, 0x44, 0x45, 0x53, 0x54, 0x52, 0x55, 0x43, 0x54, + 0x49, 0x4f, 0x4e, 0x5f, 0x46, 0x41, 0x49, 0x4c, 0x45, 0x44, 0x10, 0x0a, 0x22, 0x49, 0x0a, 0x14, + 0x43, 0x72, 0x79, 0x70, 0x74, 0x6f, 0x4b, 0x65, 0x79, 0x56, 0x65, 0x72, 0x73, 0x69, 0x6f, 0x6e, + 0x56, 0x69, 0x65, 0x77, 0x12, 0x27, 0x0a, 0x23, 0x43, 0x52, 0x59, 0x50, 0x54, 0x4f, 0x5f, 0x4b, + 0x45, 0x59, 0x5f, 0x56, 0x45, 0x52, 0x53, 0x49, 0x4f, 0x4e, 0x5f, 0x56, 0x49, 0x45, 0x57, 0x5f, + 0x55, 0x4e, 0x53, 0x50, 0x45, 0x43, 0x49, 0x46, 0x49, 0x45, 0x44, 0x10, 0x00, 0x12, 0x08, 0x0a, + 0x04, 0x46, 0x55, 0x4c, 0x4c, 0x10, 0x01, 0x3a, 0xaa, 0x01, 0xea, 0x41, 0xa6, 0x01, 0x0a, 0x28, + 0x63, 0x6c, 0x6f, 0x75, 0x64, 0x6b, 0x6d, 0x73, 0x2e, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x61, + 0x70, 0x69, 0x73, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x43, 0x72, 0x79, 0x70, 0x74, 0x6f, 0x4b, 0x65, + 0x79, 0x56, 0x65, 0x72, 0x73, 0x69, 0x6f, 0x6e, 0x12, 0x7a, 0x70, 0x72, 0x6f, 0x6a, 0x65, 0x63, + 0x74, 0x73, 0x2f, 0x7b, 0x70, 0x72, 0x6f, 0x6a, 0x65, 0x63, 0x74, 0x7d, 0x2f, 0x6c, 0x6f, 0x63, + 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x2f, 0x7b, 0x6c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, + 0x7d, 0x2f, 0x6b, 0x65, 0x79, 0x52, 0x69, 0x6e, 0x67, 0x73, 0x2f, 0x7b, 0x6b, 0x65, 0x79, 0x5f, + 0x72, 0x69, 0x6e, 0x67, 0x7d, 0x2f, 0x63, 0x72, 0x79, 0x70, 0x74, 0x6f, 0x4b, 0x65, 0x79, 0x73, + 0x2f, 0x7b, 0x63, 0x72, 0x79, 0x70, 0x74, 0x6f, 0x5f, 0x6b, 0x65, 0x79, 0x7d, 0x2f, 0x63, 0x72, + 0x79, 0x70, 0x74, 0x6f, 0x4b, 0x65, 0x79, 0x56, 0x65, 0x72, 0x73, 0x69, 0x6f, 0x6e, 0x73, 0x2f, + 0x7b, 0x63, 0x72, 0x79, 0x70, 0x74, 0x6f, 0x5f, 0x6b, 0x65, 0x79, 0x5f, 0x76, 0x65, 0x72, 0x73, + 0x69, 0x6f, 0x6e, 0x7d, 0x22, 0xce, 0x03, 0x0a, 0x09, 0x50, 0x75, 0x62, 0x6c, 0x69, 0x63, 0x4b, + 0x65, 0x79, 0x12, 0x10, 0x0a, 0x03, 0x70, 0x65, 0x6d, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, + 0x03, 0x70, 0x65, 0x6d, 0x12, 0x5d, 0x0a, 0x09, 0x61, 0x6c, 0x67, 0x6f, 0x72, 0x69, 0x74, 0x68, + 0x6d, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0e, 0x32, 0x3f, 0x2e, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, + 0x2e, 0x63, 0x6c, 0x6f, 0x75, 0x64, 0x2e, 0x6b, 0x6d, 0x73, 0x2e, 0x76, 0x31, 0x2e, 0x43, 0x72, + 0x79, 0x70, 0x74, 0x6f, 0x4b, 0x65, 0x79, 0x56, 0x65, 0x72, 0x73, 0x69, 0x6f, 0x6e, 0x2e, 0x43, + 0x72, 0x79, 0x70, 0x74, 0x6f, 0x4b, 0x65, 0x79, 0x56, 0x65, 0x72, 0x73, 0x69, 0x6f, 0x6e, 0x41, + 0x6c, 0x67, 0x6f, 0x72, 0x69, 0x74, 0x68, 0x6d, 0x52, 0x09, 0x61, 0x6c, 0x67, 0x6f, 0x72, 0x69, + 0x74, 0x68, 0x6d, 0x12, 0x3a, 0x0a, 0x0a, 0x70, 0x65, 0x6d, 0x5f, 0x63, 0x72, 0x63, 0x33, 0x32, + 0x63, 0x18, 0x03, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x1b, 0x2e, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, + 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x62, 0x75, 0x66, 0x2e, 0x49, 0x6e, 0x74, 0x36, 0x34, 0x56, + 0x61, 0x6c, 0x75, 0x65, 0x52, 0x09, 0x70, 0x65, 0x6d, 0x43, 0x72, 0x63, 0x33, 0x32, 0x63, 0x12, + 0x12, 0x0a, 0x04, 0x6e, 0x61, 0x6d, 0x65, 0x18, 0x04, 0x20, 0x01, 0x28, 0x09, 0x52, 0x04, 0x6e, + 0x61, 0x6d, 0x65, 0x12, 0x4f, 0x0a, 0x10, 0x70, 0x72, 0x6f, 0x74, 0x65, 0x63, 0x74, 0x69, 0x6f, + 0x6e, 0x5f, 0x6c, 0x65, 0x76, 0x65, 0x6c, 0x18, 0x05, 0x20, 0x01, 0x28, 0x0e, 0x32, 0x24, 0x2e, + 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2e, 0x63, 0x6c, 0x6f, 0x75, 0x64, 0x2e, 0x6b, 0x6d, 0x73, + 0x2e, 0x76, 0x31, 0x2e, 0x50, 0x72, 0x6f, 0x74, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x4c, 0x65, + 0x76, 0x65, 0x6c, 0x52, 0x0f, 0x70, 0x72, 0x6f, 0x74, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x4c, + 0x65, 0x76, 0x65, 0x6c, 0x3a, 0xae, 0x01, 0xea, 0x41, 0xaa, 0x01, 0x0a, 0x21, 0x63, 0x6c, 0x6f, + 0x75, 0x64, 0x6b, 0x6d, 0x73, 0x2e, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x61, 0x70, 0x69, 0x73, + 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x50, 0x75, 0x62, 0x6c, 0x69, 0x63, 0x4b, 0x65, 0x79, 0x12, 0x84, + 0x01, 0x70, 0x72, 0x6f, 0x6a, 0x65, 0x63, 0x74, 0x73, 0x2f, 0x7b, 0x70, 0x72, 0x6f, 0x6a, 0x65, + 0x63, 0x74, 0x7d, 0x2f, 0x6c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x2f, 0x7b, 0x6c, + 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x7d, 0x2f, 0x6b, 0x65, 0x79, 0x52, 0x69, 0x6e, 0x67, + 0x73, 0x2f, 0x7b, 0x6b, 0x65, 0x79, 0x5f, 0x72, 0x69, 0x6e, 0x67, 0x7d, 0x2f, 0x63, 0x72, 0x79, + 0x70, 0x74, 0x6f, 0x4b, 0x65, 0x79, 0x73, 0x2f, 0x7b, 0x63, 0x72, 0x79, 0x70, 0x74, 0x6f, 0x5f, + 0x6b, 0x65, 0x79, 0x7d, 0x2f, 0x63, 0x72, 0x79, 0x70, 0x74, 0x6f, 0x4b, 0x65, 0x79, 0x56, 0x65, + 0x72, 0x73, 0x69, 0x6f, 0x6e, 0x73, 0x2f, 0x7b, 0x63, 0x72, 0x79, 0x70, 0x74, 0x6f, 0x5f, 0x6b, + 0x65, 0x79, 0x5f, 0x76, 0x65, 0x72, 0x73, 0x69, 0x6f, 0x6e, 0x7d, 0x2f, 0x70, 0x75, 0x62, 0x6c, + 0x69, 0x63, 0x4b, 0x65, 0x79, 0x22, 0xd4, 0x09, 0x0a, 0x09, 0x49, 0x6d, 0x70, 0x6f, 0x72, 0x74, + 0x4a, 0x6f, 0x62, 0x12, 0x17, 0x0a, 0x04, 0x6e, 0x61, 0x6d, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, + 0x09, 0x42, 0x03, 0xe0, 0x41, 0x03, 0x52, 0x04, 0x6e, 0x61, 0x6d, 0x65, 0x12, 0x58, 0x0a, 0x0d, + 0x69, 0x6d, 0x70, 0x6f, 0x72, 0x74, 0x5f, 0x6d, 0x65, 0x74, 0x68, 0x6f, 0x64, 0x18, 0x02, 0x20, + 0x01, 0x28, 0x0e, 0x32, 0x2b, 0x2e, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2e, 0x63, 0x6c, 0x6f, + 0x75, 0x64, 0x2e, 0x6b, 0x6d, 0x73, 0x2e, 0x76, 0x31, 0x2e, 0x49, 0x6d, 0x70, 0x6f, 0x72, 0x74, + 0x4a, 0x6f, 0x62, 0x2e, 0x49, 0x6d, 0x70, 0x6f, 0x72, 0x74, 0x4d, 0x65, 0x74, 0x68, 0x6f, 0x64, + 0x42, 0x06, 0xe0, 0x41, 0x02, 0xe0, 0x41, 0x05, 0x52, 0x0c, 0x69, 0x6d, 0x70, 0x6f, 0x72, 0x74, + 0x4d, 0x65, 0x74, 0x68, 0x6f, 0x64, 0x12, 0x57, 0x0a, 0x10, 0x70, 0x72, 0x6f, 0x74, 0x65, 0x63, + 0x74, 0x69, 0x6f, 0x6e, 0x5f, 0x6c, 0x65, 0x76, 0x65, 0x6c, 0x18, 0x09, 0x20, 0x01, 0x28, 0x0e, + 0x32, 0x24, 0x2e, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2e, 0x63, 0x6c, 0x6f, 0x75, 0x64, 0x2e, + 0x6b, 0x6d, 0x73, 0x2e, 0x76, 0x31, 0x2e, 0x50, 0x72, 0x6f, 0x74, 0x65, 0x63, 0x74, 0x69, 0x6f, + 0x6e, 0x4c, 0x65, 0x76, 0x65, 0x6c, 0x42, 0x06, 0xe0, 0x41, 0x02, 0xe0, 0x41, 0x05, 0x52, 0x0f, + 0x70, 0x72, 0x6f, 0x74, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x4c, 0x65, 0x76, 0x65, 0x6c, 0x12, + 0x40, 0x0a, 0x0b, 0x63, 0x72, 0x65, 0x61, 0x74, 0x65, 0x5f, 0x74, 0x69, 0x6d, 0x65, 0x18, 0x03, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x1a, 0x2e, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x62, 0x75, 0x66, 0x2e, 0x54, 0x69, 0x6d, 0x65, 0x73, 0x74, 0x61, 0x6d, 0x70, - 0x42, 0x03, 0xe0, 0x41, 0x03, 0x52, 0x0c, 0x67, 0x65, 0x6e, 0x65, 0x72, 0x61, 0x74, 0x65, 0x54, - 0x69, 0x6d, 0x65, 0x12, 0x40, 0x0a, 0x0b, 0x65, 0x78, 0x70, 0x69, 0x72, 0x65, 0x5f, 0x74, 0x69, - 0x6d, 0x65, 0x18, 0x05, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x1a, 0x2e, 0x67, 0x6f, 0x6f, 0x67, 0x6c, + 0x42, 0x03, 0xe0, 0x41, 0x03, 0x52, 0x0a, 0x63, 0x72, 0x65, 0x61, 0x74, 0x65, 0x54, 0x69, 0x6d, + 0x65, 0x12, 0x44, 0x0a, 0x0d, 0x67, 0x65, 0x6e, 0x65, 0x72, 0x61, 0x74, 0x65, 0x5f, 0x74, 0x69, + 0x6d, 0x65, 0x18, 0x04, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x1a, 0x2e, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x62, 0x75, 0x66, 0x2e, 0x54, 0x69, 0x6d, 0x65, 0x73, - 0x74, 0x61, 0x6d, 0x70, 0x42, 0x03, 0xe0, 0x41, 0x03, 0x52, 0x0a, 0x65, 0x78, 0x70, 0x69, 0x72, - 0x65, 0x54, 0x69, 0x6d, 0x65, 0x12, 0x4b, 0x0a, 0x11, 0x65, 0x78, 0x70, 0x69, 0x72, 0x65, 0x5f, - 0x65, 0x76, 0x65, 0x6e, 0x74, 0x5f, 0x74, 0x69, 0x6d, 0x65, 0x18, 0x0a, 0x20, 0x01, 0x28, 0x0b, - 0x32, 0x1a, 0x2e, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x62, - 0x75, 0x66, 0x2e, 0x54, 0x69, 0x6d, 0x65, 0x73, 0x74, 0x61, 0x6d, 0x70, 0x42, 0x03, 0xe0, 0x41, - 0x03, 0x52, 0x0f, 0x65, 0x78, 0x70, 0x69, 0x72, 0x65, 0x45, 0x76, 0x65, 0x6e, 0x74, 0x54, 0x69, - 0x6d, 0x65, 0x12, 0x48, 0x0a, 0x05, 0x73, 0x74, 0x61, 0x74, 0x65, 0x18, 0x06, 0x20, 0x01, 0x28, - 0x0e, 0x32, 0x2d, 0x2e, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2e, 0x63, 0x6c, 0x6f, 0x75, 0x64, - 0x2e, 0x6b, 0x6d, 0x73, 0x2e, 0x76, 0x31, 0x2e, 0x49, 0x6d, 0x70, 0x6f, 0x72, 0x74, 0x4a, 0x6f, - 0x62, 0x2e, 0x49, 0x6d, 0x70, 0x6f, 0x72, 0x74, 0x4a, 0x6f, 0x62, 0x53, 0x74, 0x61, 0x74, 0x65, - 0x42, 0x03, 0xe0, 0x41, 0x03, 0x52, 0x05, 0x73, 0x74, 0x61, 0x74, 0x65, 0x12, 0x54, 0x0a, 0x0a, - 0x70, 0x75, 0x62, 0x6c, 0x69, 0x63, 0x5f, 0x6b, 0x65, 0x79, 0x18, 0x07, 0x20, 0x01, 0x28, 0x0b, - 0x32, 0x30, 0x2e, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2e, 0x63, 0x6c, 0x6f, 0x75, 0x64, 0x2e, - 0x6b, 0x6d, 0x73, 0x2e, 0x76, 0x31, 0x2e, 0x49, 0x6d, 0x70, 0x6f, 0x72, 0x74, 0x4a, 0x6f, 0x62, - 0x2e, 0x57, 0x72, 0x61, 0x70, 0x70, 0x69, 0x6e, 0x67, 0x50, 0x75, 0x62, 0x6c, 0x69, 0x63, 0x4b, - 0x65, 0x79, 0x42, 0x03, 0xe0, 0x41, 0x03, 0x52, 0x09, 0x70, 0x75, 0x62, 0x6c, 0x69, 0x63, 0x4b, - 0x65, 0x79, 0x12, 0x53, 0x0a, 0x0b, 0x61, 0x74, 0x74, 0x65, 0x73, 0x74, 0x61, 0x74, 0x69, 0x6f, - 0x6e, 0x18, 0x08, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x2c, 0x2e, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, - 0x2e, 0x63, 0x6c, 0x6f, 0x75, 0x64, 0x2e, 0x6b, 0x6d, 0x73, 0x2e, 0x76, 0x31, 0x2e, 0x4b, 0x65, - 0x79, 0x4f, 0x70, 0x65, 0x72, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x41, 0x74, 0x74, 0x65, 0x73, 0x74, - 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x42, 0x03, 0xe0, 0x41, 0x03, 0x52, 0x0b, 0x61, 0x74, 0x74, 0x65, - 0x73, 0x74, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x1a, 0x25, 0x0a, 0x11, 0x57, 0x72, 0x61, 0x70, 0x70, - 0x69, 0x6e, 0x67, 0x50, 0x75, 0x62, 0x6c, 0x69, 0x63, 0x4b, 0x65, 0x79, 0x12, 0x10, 0x0a, 0x03, - 0x70, 0x65, 0x6d, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x03, 0x70, 0x65, 0x6d, 0x22, 0xe5, - 0x01, 0x0a, 0x0c, 0x49, 0x6d, 0x70, 0x6f, 0x72, 0x74, 0x4d, 0x65, 0x74, 0x68, 0x6f, 0x64, 0x12, - 0x1d, 0x0a, 0x19, 0x49, 0x4d, 0x50, 0x4f, 0x52, 0x54, 0x5f, 0x4d, 0x45, 0x54, 0x48, 0x4f, 0x44, - 0x5f, 0x55, 0x4e, 0x53, 0x50, 0x45, 0x43, 0x49, 0x46, 0x49, 0x45, 0x44, 0x10, 0x00, 0x12, 0x1e, - 0x0a, 0x1a, 0x52, 0x53, 0x41, 0x5f, 0x4f, 0x41, 0x45, 0x50, 0x5f, 0x33, 0x30, 0x37, 0x32, 0x5f, - 0x53, 0x48, 0x41, 0x31, 0x5f, 0x41, 0x45, 0x53, 0x5f, 0x32, 0x35, 0x36, 0x10, 0x01, 0x12, 0x1e, - 0x0a, 0x1a, 0x52, 0x53, 0x41, 0x5f, 0x4f, 0x41, 0x45, 0x50, 0x5f, 0x34, 0x30, 0x39, 0x36, 0x5f, - 0x53, 0x48, 0x41, 0x31, 0x5f, 0x41, 0x45, 0x53, 0x5f, 0x32, 0x35, 0x36, 0x10, 0x02, 0x12, 0x20, - 0x0a, 0x1c, 0x52, 0x53, 0x41, 0x5f, 0x4f, 0x41, 0x45, 0x50, 0x5f, 0x33, 0x30, 0x37, 0x32, 0x5f, - 0x53, 0x48, 0x41, 0x32, 0x35, 0x36, 0x5f, 0x41, 0x45, 0x53, 0x5f, 0x32, 0x35, 0x36, 0x10, 0x03, - 0x12, 0x20, 0x0a, 0x1c, 0x52, 0x53, 0x41, 0x5f, 0x4f, 0x41, 0x45, 0x50, 0x5f, 0x34, 0x30, 0x39, - 0x36, 0x5f, 0x53, 0x48, 0x41, 0x32, 0x35, 0x36, 0x5f, 0x41, 0x45, 0x53, 0x5f, 0x32, 0x35, 0x36, - 0x10, 0x04, 0x12, 0x18, 0x0a, 0x14, 0x52, 0x53, 0x41, 0x5f, 0x4f, 0x41, 0x45, 0x50, 0x5f, 0x33, - 0x30, 0x37, 0x32, 0x5f, 0x53, 0x48, 0x41, 0x32, 0x35, 0x36, 0x10, 0x05, 0x12, 0x18, 0x0a, 0x14, - 0x52, 0x53, 0x41, 0x5f, 0x4f, 0x41, 0x45, 0x50, 0x5f, 0x34, 0x30, 0x39, 0x36, 0x5f, 0x53, 0x48, - 0x41, 0x32, 0x35, 0x36, 0x10, 0x06, 0x22, 0x63, 0x0a, 0x0e, 0x49, 0x6d, 0x70, 0x6f, 0x72, 0x74, - 0x4a, 0x6f, 0x62, 0x53, 0x74, 0x61, 0x74, 0x65, 0x12, 0x20, 0x0a, 0x1c, 0x49, 0x4d, 0x50, 0x4f, - 0x52, 0x54, 0x5f, 0x4a, 0x4f, 0x42, 0x5f, 0x53, 0x54, 0x41, 0x54, 0x45, 0x5f, 0x55, 0x4e, 0x53, - 0x50, 0x45, 0x43, 0x49, 0x46, 0x49, 0x45, 0x44, 0x10, 0x00, 0x12, 0x16, 0x0a, 0x12, 0x50, 0x45, - 0x4e, 0x44, 0x49, 0x4e, 0x47, 0x5f, 0x47, 0x45, 0x4e, 0x45, 0x52, 0x41, 0x54, 0x49, 0x4f, 0x4e, - 0x10, 0x01, 0x12, 0x0a, 0x0a, 0x06, 0x41, 0x43, 0x54, 0x49, 0x56, 0x45, 0x10, 0x02, 0x12, 0x0b, - 0x0a, 0x07, 0x45, 0x58, 0x50, 0x49, 0x52, 0x45, 0x44, 0x10, 0x03, 0x3a, 0x7b, 0xea, 0x41, 0x78, - 0x0a, 0x21, 0x63, 0x6c, 0x6f, 0x75, 0x64, 0x6b, 0x6d, 0x73, 0x2e, 0x67, 0x6f, 0x6f, 0x67, 0x6c, - 0x65, 0x61, 0x70, 0x69, 0x73, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x49, 0x6d, 0x70, 0x6f, 0x72, 0x74, - 0x4a, 0x6f, 0x62, 0x12, 0x53, 0x70, 0x72, 0x6f, 0x6a, 0x65, 0x63, 0x74, 0x73, 0x2f, 0x7b, 0x70, - 0x72, 0x6f, 0x6a, 0x65, 0x63, 0x74, 0x7d, 0x2f, 0x6c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, - 0x73, 0x2f, 0x7b, 0x6c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x7d, 0x2f, 0x6b, 0x65, 0x79, - 0x52, 0x69, 0x6e, 0x67, 0x73, 0x2f, 0x7b, 0x6b, 0x65, 0x79, 0x5f, 0x72, 0x69, 0x6e, 0x67, 0x7d, - 0x2f, 0x69, 0x6d, 0x70, 0x6f, 0x72, 0x74, 0x4a, 0x6f, 0x62, 0x73, 0x2f, 0x7b, 0x69, 0x6d, 0x70, - 0x6f, 0x72, 0x74, 0x5f, 0x6a, 0x6f, 0x62, 0x7d, 0x22, 0x81, 0x01, 0x0a, 0x1e, 0x45, 0x78, 0x74, - 0x65, 0x72, 0x6e, 0x61, 0x6c, 0x50, 0x72, 0x6f, 0x74, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x4c, - 0x65, 0x76, 0x65, 0x6c, 0x4f, 0x70, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x12, 0x28, 0x0a, 0x10, 0x65, - 0x78, 0x74, 0x65, 0x72, 0x6e, 0x61, 0x6c, 0x5f, 0x6b, 0x65, 0x79, 0x5f, 0x75, 0x72, 0x69, 0x18, - 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0e, 0x65, 0x78, 0x74, 0x65, 0x72, 0x6e, 0x61, 0x6c, 0x4b, - 0x65, 0x79, 0x55, 0x72, 0x69, 0x12, 0x35, 0x0a, 0x17, 0x65, 0x6b, 0x6d, 0x5f, 0x63, 0x6f, 0x6e, - 0x6e, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x5f, 0x6b, 0x65, 0x79, 0x5f, 0x70, 0x61, 0x74, 0x68, - 0x18, 0x02, 0x20, 0x01, 0x28, 0x09, 0x52, 0x14, 0x65, 0x6b, 0x6d, 0x43, 0x6f, 0x6e, 0x6e, 0x65, - 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x4b, 0x65, 0x79, 0x50, 0x61, 0x74, 0x68, 0x2a, 0x6a, 0x0a, 0x0f, - 0x50, 0x72, 0x6f, 0x74, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x4c, 0x65, 0x76, 0x65, 0x6c, 0x12, - 0x20, 0x0a, 0x1c, 0x50, 0x52, 0x4f, 0x54, 0x45, 0x43, 0x54, 0x49, 0x4f, 0x4e, 0x5f, 0x4c, 0x45, - 0x56, 0x45, 0x4c, 0x5f, 0x55, 0x4e, 0x53, 0x50, 0x45, 0x43, 0x49, 0x46, 0x49, 0x45, 0x44, 0x10, - 0x00, 0x12, 0x0c, 0x0a, 0x08, 0x53, 0x4f, 0x46, 0x54, 0x57, 0x41, 0x52, 0x45, 0x10, 0x01, 0x12, - 0x07, 0x0a, 0x03, 0x48, 0x53, 0x4d, 0x10, 0x02, 0x12, 0x0c, 0x0a, 0x08, 0x45, 0x58, 0x54, 0x45, - 0x52, 0x4e, 0x41, 0x4c, 0x10, 0x03, 0x12, 0x10, 0x0a, 0x0c, 0x45, 0x58, 0x54, 0x45, 0x52, 0x4e, - 0x41, 0x4c, 0x5f, 0x56, 0x50, 0x43, 0x10, 0x04, 0x42, 0x88, 0x01, 0x0a, 0x17, 0x63, 0x6f, 0x6d, - 0x2e, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2e, 0x63, 0x6c, 0x6f, 0x75, 0x64, 0x2e, 0x6b, 0x6d, - 0x73, 0x2e, 0x76, 0x31, 0x42, 0x11, 0x4b, 0x6d, 0x73, 0x52, 0x65, 0x73, 0x6f, 0x75, 0x72, 0x63, - 0x65, 0x73, 0x50, 0x72, 0x6f, 0x74, 0x6f, 0x50, 0x01, 0x5a, 0x29, 0x63, 0x6c, 0x6f, 0x75, 0x64, - 0x2e, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x67, 0x6f, 0x2f, 0x6b, - 0x6d, 0x73, 0x2f, 0x61, 0x70, 0x69, 0x76, 0x31, 0x2f, 0x6b, 0x6d, 0x73, 0x70, 0x62, 0x3b, 0x6b, - 0x6d, 0x73, 0x70, 0x62, 0xf8, 0x01, 0x01, 0xaa, 0x02, 0x13, 0x47, 0x6f, 0x6f, 0x67, 0x6c, 0x65, - 0x2e, 0x43, 0x6c, 0x6f, 0x75, 0x64, 0x2e, 0x4b, 0x6d, 0x73, 0x2e, 0x56, 0x31, 0xca, 0x02, 0x13, - 0x47, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x5c, 0x43, 0x6c, 0x6f, 0x75, 0x64, 0x5c, 0x4b, 0x6d, 0x73, - 0x5c, 0x56, 0x31, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33, + 0x74, 0x61, 0x6d, 0x70, 0x42, 0x03, 0xe0, 0x41, 0x03, 0x52, 0x0c, 0x67, 0x65, 0x6e, 0x65, 0x72, + 0x61, 0x74, 0x65, 0x54, 0x69, 0x6d, 0x65, 0x12, 0x40, 0x0a, 0x0b, 0x65, 0x78, 0x70, 0x69, 0x72, + 0x65, 0x5f, 0x74, 0x69, 0x6d, 0x65, 0x18, 0x05, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x1a, 0x2e, 0x67, + 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x62, 0x75, 0x66, 0x2e, 0x54, + 0x69, 0x6d, 0x65, 0x73, 0x74, 0x61, 0x6d, 0x70, 0x42, 0x03, 0xe0, 0x41, 0x03, 0x52, 0x0a, 0x65, + 0x78, 0x70, 0x69, 0x72, 0x65, 0x54, 0x69, 0x6d, 0x65, 0x12, 0x4b, 0x0a, 0x11, 0x65, 0x78, 0x70, + 0x69, 0x72, 0x65, 0x5f, 0x65, 0x76, 0x65, 0x6e, 0x74, 0x5f, 0x74, 0x69, 0x6d, 0x65, 0x18, 0x0a, + 0x20, 0x01, 0x28, 0x0b, 0x32, 0x1a, 0x2e, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2e, 0x70, 0x72, + 0x6f, 0x74, 0x6f, 0x62, 0x75, 0x66, 0x2e, 0x54, 0x69, 0x6d, 0x65, 0x73, 0x74, 0x61, 0x6d, 0x70, + 0x42, 0x03, 0xe0, 0x41, 0x03, 0x52, 0x0f, 0x65, 0x78, 0x70, 0x69, 0x72, 0x65, 0x45, 0x76, 0x65, + 0x6e, 0x74, 0x54, 0x69, 0x6d, 0x65, 0x12, 0x48, 0x0a, 0x05, 0x73, 0x74, 0x61, 0x74, 0x65, 0x18, + 0x06, 0x20, 0x01, 0x28, 0x0e, 0x32, 0x2d, 0x2e, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2e, 0x63, + 0x6c, 0x6f, 0x75, 0x64, 0x2e, 0x6b, 0x6d, 0x73, 0x2e, 0x76, 0x31, 0x2e, 0x49, 0x6d, 0x70, 0x6f, + 0x72, 0x74, 0x4a, 0x6f, 0x62, 0x2e, 0x49, 0x6d, 0x70, 0x6f, 0x72, 0x74, 0x4a, 0x6f, 0x62, 0x53, + 0x74, 0x61, 0x74, 0x65, 0x42, 0x03, 0xe0, 0x41, 0x03, 0x52, 0x05, 0x73, 0x74, 0x61, 0x74, 0x65, + 0x12, 0x54, 0x0a, 0x0a, 0x70, 0x75, 0x62, 0x6c, 0x69, 0x63, 0x5f, 0x6b, 0x65, 0x79, 0x18, 0x07, + 0x20, 0x01, 0x28, 0x0b, 0x32, 0x30, 0x2e, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2e, 0x63, 0x6c, + 0x6f, 0x75, 0x64, 0x2e, 0x6b, 0x6d, 0x73, 0x2e, 0x76, 0x31, 0x2e, 0x49, 0x6d, 0x70, 0x6f, 0x72, + 0x74, 0x4a, 0x6f, 0x62, 0x2e, 0x57, 0x72, 0x61, 0x70, 0x70, 0x69, 0x6e, 0x67, 0x50, 0x75, 0x62, + 0x6c, 0x69, 0x63, 0x4b, 0x65, 0x79, 0x42, 0x03, 0xe0, 0x41, 0x03, 0x52, 0x09, 0x70, 0x75, 0x62, + 0x6c, 0x69, 0x63, 0x4b, 0x65, 0x79, 0x12, 0x53, 0x0a, 0x0b, 0x61, 0x74, 0x74, 0x65, 0x73, 0x74, + 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x18, 0x08, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x2c, 0x2e, 0x67, 0x6f, + 0x6f, 0x67, 0x6c, 0x65, 0x2e, 0x63, 0x6c, 0x6f, 0x75, 0x64, 0x2e, 0x6b, 0x6d, 0x73, 0x2e, 0x76, + 0x31, 0x2e, 0x4b, 0x65, 0x79, 0x4f, 0x70, 0x65, 0x72, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x41, 0x74, + 0x74, 0x65, 0x73, 0x74, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x42, 0x03, 0xe0, 0x41, 0x03, 0x52, 0x0b, + 0x61, 0x74, 0x74, 0x65, 0x73, 0x74, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x1a, 0x25, 0x0a, 0x11, 0x57, + 0x72, 0x61, 0x70, 0x70, 0x69, 0x6e, 0x67, 0x50, 0x75, 0x62, 0x6c, 0x69, 0x63, 0x4b, 0x65, 0x79, + 0x12, 0x10, 0x0a, 0x03, 0x70, 0x65, 0x6d, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x03, 0x70, + 0x65, 0x6d, 0x22, 0xe5, 0x01, 0x0a, 0x0c, 0x49, 0x6d, 0x70, 0x6f, 0x72, 0x74, 0x4d, 0x65, 0x74, + 0x68, 0x6f, 0x64, 0x12, 0x1d, 0x0a, 0x19, 0x49, 0x4d, 0x50, 0x4f, 0x52, 0x54, 0x5f, 0x4d, 0x45, + 0x54, 0x48, 0x4f, 0x44, 0x5f, 0x55, 0x4e, 0x53, 0x50, 0x45, 0x43, 0x49, 0x46, 0x49, 0x45, 0x44, + 0x10, 0x00, 0x12, 0x1e, 0x0a, 0x1a, 0x52, 0x53, 0x41, 0x5f, 0x4f, 0x41, 0x45, 0x50, 0x5f, 0x33, + 0x30, 0x37, 0x32, 0x5f, 0x53, 0x48, 0x41, 0x31, 0x5f, 0x41, 0x45, 0x53, 0x5f, 0x32, 0x35, 0x36, + 0x10, 0x01, 0x12, 0x1e, 0x0a, 0x1a, 0x52, 0x53, 0x41, 0x5f, 0x4f, 0x41, 0x45, 0x50, 0x5f, 0x34, + 0x30, 0x39, 0x36, 0x5f, 0x53, 0x48, 0x41, 0x31, 0x5f, 0x41, 0x45, 0x53, 0x5f, 0x32, 0x35, 0x36, + 0x10, 0x02, 0x12, 0x20, 0x0a, 0x1c, 0x52, 0x53, 0x41, 0x5f, 0x4f, 0x41, 0x45, 0x50, 0x5f, 0x33, + 0x30, 0x37, 0x32, 0x5f, 0x53, 0x48, 0x41, 0x32, 0x35, 0x36, 0x5f, 0x41, 0x45, 0x53, 0x5f, 0x32, + 0x35, 0x36, 0x10, 0x03, 0x12, 0x20, 0x0a, 0x1c, 0x52, 0x53, 0x41, 0x5f, 0x4f, 0x41, 0x45, 0x50, + 0x5f, 0x34, 0x30, 0x39, 0x36, 0x5f, 0x53, 0x48, 0x41, 0x32, 0x35, 0x36, 0x5f, 0x41, 0x45, 0x53, + 0x5f, 0x32, 0x35, 0x36, 0x10, 0x04, 0x12, 0x18, 0x0a, 0x14, 0x52, 0x53, 0x41, 0x5f, 0x4f, 0x41, + 0x45, 0x50, 0x5f, 0x33, 0x30, 0x37, 0x32, 0x5f, 0x53, 0x48, 0x41, 0x32, 0x35, 0x36, 0x10, 0x05, + 0x12, 0x18, 0x0a, 0x14, 0x52, 0x53, 0x41, 0x5f, 0x4f, 0x41, 0x45, 0x50, 0x5f, 0x34, 0x30, 0x39, + 0x36, 0x5f, 0x53, 0x48, 0x41, 0x32, 0x35, 0x36, 0x10, 0x06, 0x22, 0x63, 0x0a, 0x0e, 0x49, 0x6d, + 0x70, 0x6f, 0x72, 0x74, 0x4a, 0x6f, 0x62, 0x53, 0x74, 0x61, 0x74, 0x65, 0x12, 0x20, 0x0a, 0x1c, + 0x49, 0x4d, 0x50, 0x4f, 0x52, 0x54, 0x5f, 0x4a, 0x4f, 0x42, 0x5f, 0x53, 0x54, 0x41, 0x54, 0x45, + 0x5f, 0x55, 0x4e, 0x53, 0x50, 0x45, 0x43, 0x49, 0x46, 0x49, 0x45, 0x44, 0x10, 0x00, 0x12, 0x16, + 0x0a, 0x12, 0x50, 0x45, 0x4e, 0x44, 0x49, 0x4e, 0x47, 0x5f, 0x47, 0x45, 0x4e, 0x45, 0x52, 0x41, + 0x54, 0x49, 0x4f, 0x4e, 0x10, 0x01, 0x12, 0x0a, 0x0a, 0x06, 0x41, 0x43, 0x54, 0x49, 0x56, 0x45, + 0x10, 0x02, 0x12, 0x0b, 0x0a, 0x07, 0x45, 0x58, 0x50, 0x49, 0x52, 0x45, 0x44, 0x10, 0x03, 0x3a, + 0x7b, 0xea, 0x41, 0x78, 0x0a, 0x21, 0x63, 0x6c, 0x6f, 0x75, 0x64, 0x6b, 0x6d, 0x73, 0x2e, 0x67, + 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x61, 0x70, 0x69, 0x73, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x49, 0x6d, + 0x70, 0x6f, 0x72, 0x74, 0x4a, 0x6f, 0x62, 0x12, 0x53, 0x70, 0x72, 0x6f, 0x6a, 0x65, 0x63, 0x74, + 0x73, 0x2f, 0x7b, 0x70, 0x72, 0x6f, 0x6a, 0x65, 0x63, 0x74, 0x7d, 0x2f, 0x6c, 0x6f, 0x63, 0x61, + 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x2f, 0x7b, 0x6c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x7d, + 0x2f, 0x6b, 0x65, 0x79, 0x52, 0x69, 0x6e, 0x67, 0x73, 0x2f, 0x7b, 0x6b, 0x65, 0x79, 0x5f, 0x72, + 0x69, 0x6e, 0x67, 0x7d, 0x2f, 0x69, 0x6d, 0x70, 0x6f, 0x72, 0x74, 0x4a, 0x6f, 0x62, 0x73, 0x2f, + 0x7b, 0x69, 0x6d, 0x70, 0x6f, 0x72, 0x74, 0x5f, 0x6a, 0x6f, 0x62, 0x7d, 0x22, 0x81, 0x01, 0x0a, + 0x1e, 0x45, 0x78, 0x74, 0x65, 0x72, 0x6e, 0x61, 0x6c, 0x50, 0x72, 0x6f, 0x74, 0x65, 0x63, 0x74, + 0x69, 0x6f, 0x6e, 0x4c, 0x65, 0x76, 0x65, 0x6c, 0x4f, 0x70, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x12, + 0x28, 0x0a, 0x10, 0x65, 0x78, 0x74, 0x65, 0x72, 0x6e, 0x61, 0x6c, 0x5f, 0x6b, 0x65, 0x79, 0x5f, + 0x75, 0x72, 0x69, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0e, 0x65, 0x78, 0x74, 0x65, 0x72, + 0x6e, 0x61, 0x6c, 0x4b, 0x65, 0x79, 0x55, 0x72, 0x69, 0x12, 0x35, 0x0a, 0x17, 0x65, 0x6b, 0x6d, + 0x5f, 0x63, 0x6f, 0x6e, 0x6e, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x5f, 0x6b, 0x65, 0x79, 0x5f, + 0x70, 0x61, 0x74, 0x68, 0x18, 0x02, 0x20, 0x01, 0x28, 0x09, 0x52, 0x14, 0x65, 0x6b, 0x6d, 0x43, + 0x6f, 0x6e, 0x6e, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x4b, 0x65, 0x79, 0x50, 0x61, 0x74, 0x68, + 0x2a, 0x6a, 0x0a, 0x0f, 0x50, 0x72, 0x6f, 0x74, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x4c, 0x65, + 0x76, 0x65, 0x6c, 0x12, 0x20, 0x0a, 0x1c, 0x50, 0x52, 0x4f, 0x54, 0x45, 0x43, 0x54, 0x49, 0x4f, + 0x4e, 0x5f, 0x4c, 0x45, 0x56, 0x45, 0x4c, 0x5f, 0x55, 0x4e, 0x53, 0x50, 0x45, 0x43, 0x49, 0x46, + 0x49, 0x45, 0x44, 0x10, 0x00, 0x12, 0x0c, 0x0a, 0x08, 0x53, 0x4f, 0x46, 0x54, 0x57, 0x41, 0x52, + 0x45, 0x10, 0x01, 0x12, 0x07, 0x0a, 0x03, 0x48, 0x53, 0x4d, 0x10, 0x02, 0x12, 0x0c, 0x0a, 0x08, + 0x45, 0x58, 0x54, 0x45, 0x52, 0x4e, 0x41, 0x4c, 0x10, 0x03, 0x12, 0x10, 0x0a, 0x0c, 0x45, 0x58, + 0x54, 0x45, 0x52, 0x4e, 0x41, 0x4c, 0x5f, 0x56, 0x50, 0x43, 0x10, 0x04, 0x42, 0x88, 0x01, 0x0a, + 0x17, 0x63, 0x6f, 0x6d, 0x2e, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2e, 0x63, 0x6c, 0x6f, 0x75, + 0x64, 0x2e, 0x6b, 0x6d, 0x73, 0x2e, 0x76, 0x31, 0x42, 0x11, 0x4b, 0x6d, 0x73, 0x52, 0x65, 0x73, + 0x6f, 0x75, 0x72, 0x63, 0x65, 0x73, 0x50, 0x72, 0x6f, 0x74, 0x6f, 0x50, 0x01, 0x5a, 0x29, 0x63, + 0x6c, 0x6f, 0x75, 0x64, 0x2e, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, + 0x67, 0x6f, 0x2f, 0x6b, 0x6d, 0x73, 0x2f, 0x61, 0x70, 0x69, 0x76, 0x31, 0x2f, 0x6b, 0x6d, 0x73, + 0x70, 0x62, 0x3b, 0x6b, 0x6d, 0x73, 0x70, 0x62, 0xf8, 0x01, 0x01, 0xaa, 0x02, 0x13, 0x47, 0x6f, + 0x6f, 0x67, 0x6c, 0x65, 0x2e, 0x43, 0x6c, 0x6f, 0x75, 0x64, 0x2e, 0x4b, 0x6d, 0x73, 0x2e, 0x56, + 0x31, 0xca, 0x02, 0x13, 0x47, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x5c, 0x43, 0x6c, 0x6f, 0x75, 0x64, + 0x5c, 0x4b, 0x6d, 0x73, 0x5c, 0x56, 0x31, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33, } var ( diff --git a/vendor/cloud.google.com/go/kms/internal/version.go b/vendor/cloud.google.com/go/kms/internal/version.go index c9ba91825c..43a2a84ef8 100644 --- a/vendor/cloud.google.com/go/kms/internal/version.go +++ b/vendor/cloud.google.com/go/kms/internal/version.go @@ -15,4 +15,4 @@ package internal // Version is the current tagged release of the library. -const Version = "1.14.0" +const Version = "1.15.0" diff --git a/vendor/github.com/aws/aws-sdk-go-v2/CHANGELOG.md b/vendor/github.com/aws/aws-sdk-go-v2/CHANGELOG.md index 660ecbd8f7..49f3a918ce 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/CHANGELOG.md +++ b/vendor/github.com/aws/aws-sdk-go-v2/CHANGELOG.md @@ -1,3 +1,236 @@ +# Release (2023-07-31) + +## General Highlights +* **Feature**: Adds support for smithy-modeled endpoint resolution. A new rules-based endpoint resolution will be added to the SDK which will supercede and deprecate existing endpoint resolution. Specifically, EndpointResolver will be deprecated while BaseEndpoint and EndpointResolverV2 will take its place. For more information, please see the Endpoints section in our Developer Guide. +* **Dependency Update**: Updated to the latest SDK module versions + +## Module Highlights +* `github.com/aws/aws-sdk-go-v2/service/amplifyuibuilder`: [v1.12.0](service/amplifyuibuilder/CHANGELOG.md#v1120-2023-07-31) + * **Feature**: Amplify Studio releases GraphQL support for codegen job action. +* `github.com/aws/aws-sdk-go-v2/service/autoscaling`: [v1.30.0](service/autoscaling/CHANGELOG.md#v1300-2023-07-31) + * **Feature**: You can now configure an instance refresh to set its status to 'failed' when it detects that a specified CloudWatch alarm has gone into the ALARM state. You can also choose to roll back the instance refresh automatically when the alarm threshold is met. +* `github.com/aws/aws-sdk-go-v2/service/cleanrooms`: [v1.3.0](service/cleanrooms/CHANGELOG.md#v130-2023-07-31) + * **Feature**: This release introduces custom SQL queries - an expanded set of SQL you can run. This release adds analysis templates, a new resource for storing pre-defined custom SQL queries ahead of time. This release also adds the Custom analysis rule, which lets you approve analysis templates for querying. +* `github.com/aws/aws-sdk-go-v2/service/codestarconnections`: [v1.15.0](service/codestarconnections/CHANGELOG.md#v1150-2023-07-31) + * **Feature**: New integration with the Gitlab provider type. +* `github.com/aws/aws-sdk-go-v2/service/drs`: [v1.15.0](service/drs/CHANGELOG.md#v1150-2023-07-31) + * **Feature**: Add support for in-aws right sizing +* `github.com/aws/aws-sdk-go-v2/service/inspector2`: [v1.16.0](service/inspector2/CHANGELOG.md#v1160-2023-07-31) + * **Feature**: This release adds 1 new API: BatchGetFindingDetails to retrieve enhanced vulnerability intelligence details for findings. +* `github.com/aws/aws-sdk-go-v2/service/lookoutequipment`: [v1.18.0](service/lookoutequipment/CHANGELOG.md#v1180-2023-07-31) + * **Feature**: This release includes new import resource, model versioning and resource policy features. +* `github.com/aws/aws-sdk-go-v2/service/omics`: [v1.6.0](service/omics/CHANGELOG.md#v160-2023-07-31) + * **Feature**: Add CreationType filter for ListReadSets +* `github.com/aws/aws-sdk-go-v2/service/rds`: [v1.49.0](service/rds/CHANGELOG.md#v1490-2023-07-31) + * **Feature**: This release adds support for Aurora MySQL local write forwarding, which allows for forwarding of write operations from reader DB instances to the writer DB instance. +* `github.com/aws/aws-sdk-go-v2/service/route53`: [v1.29.0](service/route53/CHANGELOG.md#v1290-2023-07-31) + * **Feature**: Amazon Route 53 now supports the Israel (Tel Aviv) Region (il-central-1) for latency records, geoproximity records, and private DNS for Amazon VPCs in that region. +* `github.com/aws/aws-sdk-go-v2/service/scheduler`: [v1.2.0](service/scheduler/CHANGELOG.md#v120-2023-07-31) + * **Feature**: This release introduces automatic deletion of schedules in EventBridge Scheduler. If configured, EventBridge Scheduler automatically deletes a schedule after the schedule has completed its last invocation. + +# Release (2023-07-28.2) + +## Module Highlights +* `github.com/aws/aws-sdk-go-v2/service/applicationinsights`: [v1.18.0](service/applicationinsights/CHANGELOG.md#v1180-2023-07-282) + * **Feature**: This release enable customer to add/remove/update more than one workload for a component +* `github.com/aws/aws-sdk-go-v2/service/cloudformation`: [v1.33.0](service/cloudformation/CHANGELOG.md#v1330-2023-07-282) + * **Feature**: This SDK release is for the feature launch of AWS CloudFormation RetainExceptOnCreate. It adds a new parameter retainExceptOnCreate in the following APIs: CreateStack, UpdateStack, RollbackStack, ExecuteChangeSet. +* `github.com/aws/aws-sdk-go-v2/service/cloudfront`: [v1.27.0](service/cloudfront/CHANGELOG.md#v1270-2023-07-282) + * **Feature**: Add a new JavaScript runtime version for CloudFront Functions. +* `github.com/aws/aws-sdk-go-v2/service/connect`: [v1.62.0](service/connect/CHANGELOG.md#v1620-2023-07-282) + * **Feature**: This release adds support for new number types. +* `github.com/aws/aws-sdk-go-v2/service/kafka`: [v1.21.0](service/kafka/CHANGELOG.md#v1210-2023-07-282) + * **Feature**: Amazon MSK has introduced new versions of ListClusterOperations and DescribeClusterOperation APIs. These v2 APIs provide information and insights into the ongoing operations of both MSK Provisioned and MSK Serverless clusters. +* `github.com/aws/aws-sdk-go-v2/service/pinpoint`: [v1.21.0](service/pinpoint/CHANGELOG.md#v1210-2023-07-282) + * **Feature**: Added support for sending push notifications using the FCM v1 API with json credentials. Amazon Pinpoint customers can now deliver messages to Android devices using both FCM v1 API and the legacy FCM/GCM API + +# Release (2023-07-28) + +## General Highlights +* **Dependency Update**: Updated to the latest SDK module versions + +## Module Highlights +* `github.com/aws/aws-sdk-go-v2/service/sqs`: [v1.23.4](service/sqs/CHANGELOG.md#v1234-2023-07-28) + * **Documentation**: Documentation changes related to SQS APIs. + +# Release (2023-07-27) + +## Module Highlights +* `github.com/aws/aws-sdk-go-v2/service/autoscaling`: [v1.29.0](service/autoscaling/CHANGELOG.md#v1290-2023-07-27) + * **Feature**: This release updates validation for instance types used in the AllowedInstanceTypes and ExcludedInstanceTypes parameters of the InstanceRequirements property of a MixedInstancesPolicy. +* `github.com/aws/aws-sdk-go-v2/service/ebs`: [v1.17.0](service/ebs/CHANGELOG.md#v1170-2023-07-27) + * **Feature**: SDK and documentation updates for Amazon Elastic Block Store API +* `github.com/aws/aws-sdk-go-v2/service/ec2`: [v1.108.0](service/ec2/CHANGELOG.md#v11080-2023-07-27) + * **Feature**: SDK and documentation updates for Amazon Elastic Block Store APIs +* `github.com/aws/aws-sdk-go-v2/service/eks`: [v1.28.0](service/eks/CHANGELOG.md#v1280-2023-07-27) + * **Feature**: Add multiple customer error code to handle customer caused failure when managing EKS node groups +* `github.com/aws/aws-sdk-go-v2/service/sagemaker`: [v1.95.0](service/sagemaker/CHANGELOG.md#v1950-2023-07-27) + * **Feature**: Expose ProfilerConfig attribute in SageMaker Search API response. + +# Release (2023-07-26) + +## Module Highlights +* `github.com/aws/aws-sdk-go-v2/service/entityresolution`: [v1.0.0](service/entityresolution/CHANGELOG.md#v100-2023-07-26) + * **Release**: New AWS service client module + * **Feature**: AWS Entity Resolution can effectively match a source record from a customer relationship management (CRM) system with a source record from a marketing system containing campaign information. +* `github.com/aws/aws-sdk-go-v2/service/glue`: [v1.58.0](service/glue/CHANGELOG.md#v1580-2023-07-26) + * **Feature**: Release Glue Studio Snowflake Connector Node for SDK/CLI +* `github.com/aws/aws-sdk-go-v2/service/healthlake`: [v1.16.4](service/healthlake/CHANGELOG.md#v1164-2023-07-26) + * **Documentation**: Updating the HealthLake service documentation. +* `github.com/aws/aws-sdk-go-v2/service/managedblockchainquery`: [v1.0.0](service/managedblockchainquery/CHANGELOG.md#v100-2023-07-26) + * **Release**: New AWS service client module + * **Feature**: Amazon Managed Blockchain (AMB) Query provides serverless access to standardized, multi-blockchain datasets with developer-friendly APIs. +* `github.com/aws/aws-sdk-go-v2/service/mediaconvert`: [v1.39.1](service/mediaconvert/CHANGELOG.md#v1391-2023-07-26) + * **Documentation**: This release includes general updates to user documentation. +* `github.com/aws/aws-sdk-go-v2/service/omics`: [v1.5.2](service/omics/CHANGELOG.md#v152-2023-07-26) + * **Documentation**: The service is renaming as a part of AWS Health. +* `github.com/aws/aws-sdk-go-v2/service/opensearchserverless`: [v1.3.0](service/opensearchserverless/CHANGELOG.md#v130-2023-07-26) + * **Feature**: This release adds new collection type VectorSearch. +* `github.com/aws/aws-sdk-go-v2/service/polly`: [v1.27.0](service/polly/CHANGELOG.md#v1270-2023-07-26) + * **Feature**: Amazon Polly adds 1 new voice - Lisa (nl-BE) +* `github.com/aws/aws-sdk-go-v2/service/route53`: [v1.28.5](service/route53/CHANGELOG.md#v1285-2023-07-26) + * **Documentation**: Update that corrects the documents for received feedback. + +# Release (2023-07-25) + +## General Highlights +* **Dependency Update**: Updated to the latest SDK module versions + +## Module Highlights +* `github.com/aws/aws-sdk-go-v2/service/billingconductor`: [v1.7.0](service/billingconductor/CHANGELOG.md#v170-2023-07-25) + * **Feature**: Added support for Auto-Assocate Billing Groups for CreateBillingGroup, UpdateBillingGroup, and ListBillingGroups. +* `github.com/aws/aws-sdk-go-v2/service/customerprofiles`: [v1.26.0](service/customerprofiles/CHANGELOG.md#v1260-2023-07-25) + * **Feature**: Amazon Connect Customer Profiles now supports rule-based resolution to match and merge similar profiles into unified profiles, helping companies deliver faster and more personalized customer service by providing access to relevant customer information for agents and automated experiences. +* `github.com/aws/aws-sdk-go-v2/service/datasync`: [v1.26.0](service/datasync/CHANGELOG.md#v1260-2023-07-25) + * **Feature**: AWS DataSync now supports Microsoft Azure Blob Storage locations. +* `github.com/aws/aws-sdk-go-v2/service/dynamodb`: [v1.20.2](service/dynamodb/CHANGELOG.md#v1202-2023-07-25) + * **Documentation**: Documentation updates for DynamoDB +* `github.com/aws/aws-sdk-go-v2/service/ec2`: [v1.107.0](service/ec2/CHANGELOG.md#v11070-2023-07-25) + * **Feature**: This release adds an instance's peak and baseline network bandwidth as well as the memory sizes of an instance's inference accelerators to DescribeInstanceTypes. +* `github.com/aws/aws-sdk-go-v2/service/emrserverless`: [v1.9.0](service/emrserverless/CHANGELOG.md#v190-2023-07-25) + * **Feature**: This release adds support for publishing application logs to CloudWatch. +* `github.com/aws/aws-sdk-go-v2/service/lambda`: [v1.38.0](service/lambda/CHANGELOG.md#v1380-2023-07-25) + * **Feature**: Add Python 3.11 (python3.11) support to AWS Lambda +* `github.com/aws/aws-sdk-go-v2/service/rds`: [v1.48.0](service/rds/CHANGELOG.md#v1480-2023-07-25) + * **Feature**: This release adds support for monitoring storage optimization progress on the DescribeDBInstances API. +* `github.com/aws/aws-sdk-go-v2/service/sagemaker`: [v1.94.0](service/sagemaker/CHANGELOG.md#v1940-2023-07-25) + * **Feature**: Mark ContentColumn and TargetLabelColumn as required Targets in TextClassificationJobConfig in CreateAutoMLJobV2API +* `github.com/aws/aws-sdk-go-v2/service/securityhub`: [v1.34.0](service/securityhub/CHANGELOG.md#v1340-2023-07-25) + * **Feature**: Add support for CONTAINS and NOT_CONTAINS comparison operators for Automation Rules string filters and map filters +* `github.com/aws/aws-sdk-go-v2/service/sts`: [v1.20.0](service/sts/CHANGELOG.md#v1200-2023-07-25) + * **Feature**: API updates for the AWS Security Token Service +* `github.com/aws/aws-sdk-go-v2/service/transfer`: [v1.32.0](service/transfer/CHANGELOG.md#v1320-2023-07-25) + * **Feature**: This release adds support for SFTP Connectors. +* `github.com/aws/aws-sdk-go-v2/service/wisdom`: [v1.14.0](service/wisdom/CHANGELOG.md#v1140-2023-07-25) + * **Feature**: This release added two new data types: AssistantIntegrationConfiguration, and SessionIntegrationConfiguration to support Wisdom integration with Amazon Connect Chat + +# Release (2023-07-24) + +## Module Highlights +* `github.com/aws/aws-sdk-go-v2/service/apigatewayv2`: [v1.13.15](service/apigatewayv2/CHANGELOG.md#v11315-2023-07-24) + * **Documentation**: Documentation updates for Amazon API Gateway. +* `github.com/aws/aws-sdk-go-v2/service/chimesdkmediapipelines`: [v1.5.0](service/chimesdkmediapipelines/CHANGELOG.md#v150-2023-07-24) + * **Feature**: AWS Media Pipeline compositing enhancement and Media Insights Pipeline auto language identification. +* `github.com/aws/aws-sdk-go-v2/service/cloudformation`: [v1.32.0](service/cloudformation/CHANGELOG.md#v1320-2023-07-24) + * **Feature**: This release supports filtering by DRIFT_STATUS for existing API ListStackInstances and adds support for a new API ListStackInstanceResourceDrifts. Customers can now view resource drift information from their StackSet management accounts. +* `github.com/aws/aws-sdk-go-v2/service/costexplorer`: [v1.26.0](service/costexplorer/CHANGELOG.md#v1260-2023-07-24) + * **Feature**: This release introduces the new API 'GetSavingsPlanPurchaseRecommendationDetails', which retrieves the details for a Savings Plan recommendation. It also updates the existing API 'GetSavingsPlansPurchaseRecommendation' to include the recommendation detail ID. +* `github.com/aws/aws-sdk-go-v2/service/ec2`: [v1.106.0](service/ec2/CHANGELOG.md#v11060-2023-07-24) + * **Feature**: Add "disabled" enum value to SpotInstanceState. +* `github.com/aws/aws-sdk-go-v2/service/glue`: [v1.57.0](service/glue/CHANGELOG.md#v1570-2023-07-24) + * **Feature**: Added support for Data Preparation Recipe node in Glue Studio jobs +* `github.com/aws/aws-sdk-go-v2/service/quicksight`: [v1.39.0](service/quicksight/CHANGELOG.md#v1390-2023-07-24) + * **Feature**: This release launches new Snapshot APIs for CSV and PDF exports, adds support for info icon for filters and parameters in Exploration APIs, adds modeled exception to the DeleteAccountCustomization API, and introduces AttributeAggregationFunction's ability to add UNIQUE_VALUE aggregation in tooltips. + +# Release (2023-07-21) + +## Module Highlights +* `github.com/aws/aws-sdk-go-v2/service/glue`: [v1.56.0](service/glue/CHANGELOG.md#v1560-2023-07-21) + * **Feature**: This release adds support for AWS Glue Crawler with Apache Hudi Tables, allowing Crawlers to discover Hudi Tables in S3 and register them in Glue Data Catalog for query engines to query against. +* `github.com/aws/aws-sdk-go-v2/service/mediaconvert`: [v1.39.0](service/mediaconvert/CHANGELOG.md#v1390-2023-07-21) + * **Feature**: This release includes improvements to Preserve 444 handling, compatibility of HEVC sources without frame rates, and general improvements to MP4 outputs. +* `github.com/aws/aws-sdk-go-v2/service/rds`: [v1.47.0](service/rds/CHANGELOG.md#v1470-2023-07-21) + * **Feature**: Adds support for the DBSystemID parameter of CreateDBInstance to RDS Custom for Oracle. +* `github.com/aws/aws-sdk-go-v2/service/workspaces`: [v1.28.17](service/workspaces/CHANGELOG.md#v12817-2023-07-21) + * **Documentation**: Fixed VolumeEncryptionKey descriptions + +# Release (2023-07-20.2) + +## Module Highlights +* `github.com/aws/aws-sdk-go-v2/service/codecatalyst`: [v1.4.0](service/codecatalyst/CHANGELOG.md#v140-2023-07-202) + * **Feature**: This release adds support for updating and deleting spaces and projects in Amazon CodeCatalyst. It also adds support for creating, getting, and deleting source repositories in CodeCatalyst projects. +* `github.com/aws/aws-sdk-go-v2/service/connectcases`: [v1.5.0](service/connectcases/CHANGELOG.md#v150-2023-07-202) + * **Feature**: This release adds the ability to assign a case to a queue or user. +* `github.com/aws/aws-sdk-go-v2/service/lexmodelsv2`: [v1.31.0](service/lexmodelsv2/CHANGELOG.md#v1310-2023-07-202) + * **Feature**: This release updates type for Channel field in SessionSpecification and UtteranceSpecification +* `github.com/aws/aws-sdk-go-v2/service/route53resolver`: [v1.18.0](service/route53resolver/CHANGELOG.md#v1180-2023-07-202) + * **Feature**: This release adds support for Route 53 On Outposts, a new feature that allows customers to run Route 53 Resolver and Resolver endpoints locally on their Outposts. +* `github.com/aws/aws-sdk-go-v2/service/sagemaker`: [v1.93.0](service/sagemaker/CHANGELOG.md#v1930-2023-07-202) + * **Feature**: Cross account support for SageMaker Feature Store +* `github.com/aws/aws-sdk-go-v2/service/sagemakerfeaturestoreruntime`: [v1.16.0](service/sagemakerfeaturestoreruntime/CHANGELOG.md#v1160-2023-07-202) + * **Feature**: Cross account support for SageMaker Feature Store +* `github.com/aws/aws-sdk-go-v2/service/securitylake`: [v1.5.0](service/securitylake/CHANGELOG.md#v150-2023-07-202) + * **Feature**: Adding support for Tags on Create and Resource Tagging API. +* `github.com/aws/aws-sdk-go-v2/service/transcribe`: [v1.27.0](service/transcribe/CHANGELOG.md#v1270-2023-07-202) + * **Feature**: Added API argument --toxicity-detection to startTranscriptionJob API, which allows users to view toxicity scores of submitted audio. + +# Release (2023-07-20) + +## Module Highlights +* `github.com/aws/aws-sdk-go-v2/service/savingsplans`: [v1.12.14](service/savingsplans/CHANGELOG.md#v11214-2023-07-20) + * **Documentation**: Savings Plans endpoints update + +# Release (2023-07-19) + +## Module Highlights +* `github.com/aws/aws-sdk-go-v2/service/cloudformation`: [v1.31.0](service/cloudformation/CHANGELOG.md#v1310-2023-07-19) + * **Feature**: SDK and documentation updates for GetTemplateSummary API (unrecognized resources) +* `github.com/aws/aws-sdk-go-v2/service/ec2`: [v1.105.1](service/ec2/CHANGELOG.md#v11051-2023-07-19) + * **Documentation**: Amazon EC2 documentation updates. +* `github.com/aws/aws-sdk-go-v2/service/grafana`: [v1.14.0](service/grafana/CHANGELOG.md#v1140-2023-07-19) + * **Feature**: Amazon Managed Grafana now supports grafanaVersion update for existing workspaces with UpdateWorkspaceConfiguration API. DescribeWorkspaceConfiguration API additionally returns grafanaVersion. A new ListVersions API lists available versions or, if given a workspaceId, the versions it can upgrade to. +* `github.com/aws/aws-sdk-go-v2/service/medicalimaging`: [v1.0.0](service/medicalimaging/CHANGELOG.md#v100-2023-07-19) + * **Release**: New AWS service client module + * **Feature**: General Availability (GA) release of AWS Health Imaging, enabling customers to store, transform, and analyze medical imaging data at petabyte-scale. +* `github.com/aws/aws-sdk-go-v2/service/ram`: [v1.19.0](service/ram/CHANGELOG.md#v1190-2023-07-19) + * **Feature**: This release adds support for securely sharing with AWS service principals. +* `github.com/aws/aws-sdk-go-v2/service/ssmsap`: [v1.3.0](service/ssmsap/CHANGELOG.md#v130-2023-07-19) + * **Feature**: Added support for SAP Hana High Availability discovery (primary and secondary nodes) and Backint agent installation with SSM for SAP. +* `github.com/aws/aws-sdk-go-v2/service/wafv2`: [v1.36.0](service/wafv2/CHANGELOG.md#v1360-2023-07-19) + * **Feature**: Added the URI path to the custom aggregation keys that you can specify for a rate-based rule. + +# Release (2023-07-18) + +## Module Highlights +* `github.com/aws/aws-sdk-go-v2/service/codegurusecurity`: [v1.0.3](service/codegurusecurity/CHANGELOG.md#v103-2023-07-18) + * **Documentation**: Documentation updates for CodeGuru Security. +* `github.com/aws/aws-sdk-go-v2/service/connect`: [v1.61.1](service/connect/CHANGELOG.md#v1611-2023-07-18) + * **Documentation**: GetMetricDataV2 API: Update to include Contact Lens Conversational Analytics Metrics +* `github.com/aws/aws-sdk-go-v2/service/lexmodelsv2`: [v1.30.0](service/lexmodelsv2/CHANGELOG.md#v1300-2023-07-18) + * **Feature**: This release adds support for Lex Developers to view analytics for their bots. +* `github.com/aws/aws-sdk-go-v2/service/m2`: [v1.6.0](service/m2/CHANGELOG.md#v160-2023-07-18) + * **Feature**: Allows UpdateEnvironment to update the environment to 0 host capacity. New GetSignedBluinsightsUrl API +* `github.com/aws/aws-sdk-go-v2/service/snowball`: [v1.20.0](service/snowball/CHANGELOG.md#v1200-2023-07-18) + * **Feature**: Adds support for RACK_5U_C. This is the first AWS Snow Family device designed to meet U.S. Military Ruggedization Standards (MIL-STD-810H) with 208 vCPU device in a portable, compact 5U, half-rack width form-factor. +* `github.com/aws/aws-sdk-go-v2/service/translate`: [v1.18.4](service/translate/CHANGELOG.md#v1184-2023-07-18) + * **Documentation**: Added DOCX word document support to TranslateDocument API + +# Release (2023-07-17) + +## Module Highlights +* `github.com/aws/aws-sdk-go-v2/service/codeartifact`: [v1.18.8](service/codeartifact/CHANGELOG.md#v1188-2023-07-17) + * **Documentation**: Doc only update for AWS CodeArtifact +* `github.com/aws/aws-sdk-go-v2/service/docdb`: [v1.22.0](service/docdb/CHANGELOG.md#v1220-2023-07-17) + * **Feature**: Added major version upgrade option in ModifyDBCluster API +* `github.com/aws/aws-sdk-go-v2/service/ec2`: [v1.105.0](service/ec2/CHANGELOG.md#v11050-2023-07-17) + * **Feature**: Add Nitro TPM support on DescribeInstanceTypes +* `github.com/aws/aws-sdk-go-v2/service/glue`: [v1.55.0](service/glue/CHANGELOG.md#v1550-2023-07-17) + * **Feature**: Adding new supported permission type flags to get-unfiltered endpoints that callers may pass to indicate support for enforcing Lake Formation fine-grained access control on nested column attributes. +* `github.com/aws/aws-sdk-go-v2/service/ivs`: [v1.24.0](service/ivs/CHANGELOG.md#v1240-2023-07-17) + * **Feature**: This release provides the flexibility to configure what renditions or thumbnail qualities to record when creating recording configuration. +* `github.com/aws/aws-sdk-go-v2/service/lakeformation`: [v1.22.0](service/lakeformation/CHANGELOG.md#v1220-2023-07-17) + * **Feature**: Adds supports for ReadOnlyAdmins and AllowFullTableExternalDataAccess. Adds NESTED_PERMISSION and NESTED_CELL_PERMISSION to SUPPORTED_PERMISSION_TYPES enum. Adds CREATE_LF_TAG on catalog resource and ALTER, DROP, and GRANT_WITH_LF_TAG_EXPRESSION on LF Tag resource. + # Release (2023-07-13) ## General Highlights diff --git a/vendor/github.com/aws/aws-sdk-go-v2/Makefile b/vendor/github.com/aws/aws-sdk-go-v2/Makefile index 4f74a26541..996c13e1a8 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/Makefile +++ b/vendor/github.com/aws/aws-sdk-go-v2/Makefile @@ -1,6 +1,9 @@ # Lint rules to ignore LINTIGNORESINGLEFIGHT='internal/sync/singleflight/singleflight.go:.+error should be the last type' LINT_IGNORE_S3MANAGER_INPUT='feature/s3/manager/upload.go:.+struct field SSEKMSKeyId should be SSEKMSKeyID' +# Names of these are tied to endpoint rules and they're internal so ignore them +LINT_IGNORE_AWSRULESFN_ARN='internal/endpoints/awsrulesfn/arn.go' +LINT_IGNORE_AWSRULESFN_PARTITION='internal/endpoints/awsrulesfn/partition.go' UNIT_TEST_TAGS= BUILD_TAGS=-tags "example,codegen,integration,ec2env,perftest" @@ -81,6 +84,10 @@ generate: smithy-generate update-requires gen-repo-mod-replace update-module-met gen-config-asserts gen-internal-codegen copy-attributevalue-feature gen-mod-dropreplace-smithy-. min-go-version-. \ tidy-modules-. add-module-license-files gen-aws-ptrs format +generate-tmpreplace-smithy: smithy-generate update-requires gen-repo-mod-replace update-module-metadata smithy-annotate-stable \ +gen-config-asserts gen-internal-codegen copy-attributevalue-feature gen-mod-replace-smithy-. min-go-version-. \ +tidy-modules-. add-module-license-files gen-aws-ptrs format gen-mod-dropreplace-smithy-. + smithy-generate: cd codegen && ./gradlew clean build -Plog-tests && ./gradlew clean @@ -460,7 +467,9 @@ lint: @lint=`golint ./...`; \ dolint=`echo "$$lint" | grep -E -v \ -e ${LINT_IGNORE_S3MANAGER_INPUT} \ - -e ${LINTIGNORESINGLEFIGHT}`; \ + -e ${LINTIGNORESINGLEFIGHT} \ + -e ${LINT_IGNORE_AWSRULESFN_ARN} \ + -e ${LINT_IGNORE_AWSRULESFN_PARTITION}`; \ echo "$$dolint"; \ if [ "$$dolint" != "" ]; then exit 1; fi diff --git a/vendor/github.com/aws/aws-sdk-go-v2/aws/config.go b/vendor/github.com/aws/aws-sdk-go-v2/aws/config.go index bd0df3df6b..fe7aacbfa6 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/aws/config.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/aws/config.go @@ -68,6 +68,12 @@ type Config struct { // // See the `aws.EndpointResolverWithOptions` documentation for additional // usage information. + // + // Deprecated: with the release of endpoint resolution v2 in API clients, + // EndpointResolver and EndpointResolverWithOptions are deprecated. + // Providing a value for this field will likely prevent you from using + // newer endpoint-related service features. See API client options + // EndpointResolverV2 and BaseEndpoint. EndpointResolverWithOptions EndpointResolverWithOptions // RetryMaxAttempts specifies the maximum number attempts an API client diff --git a/vendor/github.com/aws/aws-sdk-go-v2/aws/go_module_metadata.go b/vendor/github.com/aws/aws-sdk-go-v2/aws/go_module_metadata.go index 1abaa445ea..46f3b15cbf 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/aws/go_module_metadata.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/aws/go_module_metadata.go @@ -3,4 +3,4 @@ package aws // goModuleVersion is the tagged release for this module -const goModuleVersion = "1.19.0" +const goModuleVersion = "1.20.0" diff --git a/vendor/github.com/aws/aws-sdk-go-v2/aws/middleware/metadata.go b/vendor/github.com/aws/aws-sdk-go-v2/aws/middleware/metadata.go index e6e87ac777..2de15528c9 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/aws/middleware/metadata.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/aws/middleware/metadata.go @@ -2,6 +2,7 @@ package middleware import ( "context" + "github.com/aws/aws-sdk-go-v2/aws" "github.com/aws/smithy-go/middleware" @@ -42,12 +43,13 @@ func (s RegisterServiceMetadata) HandleInitialize( // service metadata keys for storing and lookup of runtime stack information. type ( - serviceIDKey struct{} - signingNameKey struct{} - signingRegionKey struct{} - regionKey struct{} - operationNameKey struct{} - partitionIDKey struct{} + serviceIDKey struct{} + signingNameKey struct{} + signingRegionKey struct{} + regionKey struct{} + operationNameKey struct{} + partitionIDKey struct{} + requiresLegacyEndpointsKey struct{} ) // GetServiceID retrieves the service id from the context. @@ -104,6 +106,25 @@ func GetPartitionID(ctx context.Context) string { return v } +// GetRequiresLegacyEndpoints the flag used to indicate if legacy endpoint +// customizations need to be executed. +// +// Scoped to stack values. Use github.com/aws/smithy-go/middleware#ClearStackValues +// to clear all stack values. +func GetRequiresLegacyEndpoints(ctx context.Context) bool { + v, _ := middleware.GetStackValue(ctx, requiresLegacyEndpointsKey{}).(bool) + return v +} + +// SetRequiresLegacyEndpoints set or modifies the flag indicated that +// legacy endpoint customizations are needed. +// +// Scoped to stack values. Use github.com/aws/smithy-go/middleware#ClearStackValues +// to clear all stack values. +func SetRequiresLegacyEndpoints(ctx context.Context, value bool) context.Context { + return middleware.WithStackValue(ctx, requiresLegacyEndpointsKey{}, value) +} + // SetSigningName set or modifies the signing name on the context. // // Scoped to stack values. Use github.com/aws/smithy-go/middleware#ClearStackValues diff --git a/vendor/github.com/aws/aws-sdk-go-v2/aws/signer/v4/middleware.go b/vendor/github.com/aws/aws-sdk-go-v2/aws/signer/v4/middleware.go index 749bda69ee..0fb9b24e4a 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/aws/signer/v4/middleware.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/aws/signer/v4/middleware.go @@ -12,6 +12,7 @@ import ( "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" v4Internal "github.com/aws/aws-sdk-go-v2/aws/signer/internal/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" "github.com/aws/aws-sdk-go-v2/internal/sdk" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" @@ -301,11 +302,23 @@ func (s *SignHTTPRequestMiddleware) HandleFinalize(ctx context.Context, in middl return out, metadata, &SigningError{Err: fmt.Errorf("failed to retrieve credentials: %w", err)} } - err = s.signer.SignHTTP(ctx, credentials, req.Request, payloadHash, signingName, signingRegion, sdk.NowTime(), + signerOptions := []func(o *SignerOptions){ func(o *SignerOptions) { o.Logger = middleware.GetLogger(ctx) o.LogSigning = s.logSigning + }, + } + + // existing DisableURIPathEscaping is equivalent in purpose + // to authentication scheme property DisableDoubleEncoding + disableDoubleEncoding, overridden := internalauth.GetDisableDoubleEncoding(ctx) + if overridden { + signerOptions = append(signerOptions, func(o *SignerOptions) { + o.DisableURIPathEscaping = disableDoubleEncoding }) + } + + err = s.signer.SignHTTP(ctx, credentials, req.Request, payloadHash, signingName, signingRegion, sdk.NowTime(), signerOptions...) if err != nil { return out, metadata, &SigningError{Err: fmt.Errorf("failed to sign http request, %w", err)} } diff --git a/vendor/github.com/aws/aws-sdk-go-v2/aws/signer/v4/v4.go b/vendor/github.com/aws/aws-sdk-go-v2/aws/signer/v4/v4.go index afd069c1f3..4d162556bb 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/aws/signer/v4/v4.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/aws/signer/v4/v4.go @@ -335,7 +335,7 @@ func (s Signer) SignHTTP(ctx context.Context, credentials aws.Credentials, r *ht // // expires := 20 * time.Minute // query := req.URL.Query() -// query.Set("X-Amz-Expires", strconv.FormatInt(int64(expires/time.Second), 10) +// query.Set("X-Amz-Expires", strconv.FormatInt(int64(expires/time.Second), 10)) // req.URL.RawQuery = query.Encode() // // This method does not modify the provided request. diff --git a/vendor/github.com/aws/aws-sdk-go-v2/config/CHANGELOG.md b/vendor/github.com/aws/aws-sdk-go-v2/config/CHANGELOG.md index e2a6948d60..4a57f946f7 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/config/CHANGELOG.md +++ b/vendor/github.com/aws/aws-sdk-go-v2/config/CHANGELOG.md @@ -1,3 +1,19 @@ +# v1.18.32 (2023-08-01) + +* **Dependency Update**: Updated to the latest SDK module versions + +# v1.18.31 (2023-07-31) + +* **Dependency Update**: Updated to the latest SDK module versions + +# v1.18.30 (2023-07-28) + +* **Dependency Update**: Updated to the latest SDK module versions + +# v1.18.29 (2023-07-25) + +* **Dependency Update**: Updated to the latest SDK module versions + # v1.18.28 (2023-07-13) * **Dependency Update**: Updated to the latest SDK module versions diff --git a/vendor/github.com/aws/aws-sdk-go-v2/config/go_module_metadata.go b/vendor/github.com/aws/aws-sdk-go-v2/config/go_module_metadata.go index 36e8486e28..8b9e49f10c 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/config/go_module_metadata.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/config/go_module_metadata.go @@ -3,4 +3,4 @@ package config // goModuleVersion is the tagged release for this module -const goModuleVersion = "1.18.28" +const goModuleVersion = "1.18.32" diff --git a/vendor/github.com/aws/aws-sdk-go-v2/credentials/CHANGELOG.md b/vendor/github.com/aws/aws-sdk-go-v2/credentials/CHANGELOG.md index c8fc33df56..29211db0fe 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/credentials/CHANGELOG.md +++ b/vendor/github.com/aws/aws-sdk-go-v2/credentials/CHANGELOG.md @@ -1,3 +1,19 @@ +# v1.13.31 (2023-08-01) + +* **Dependency Update**: Updated to the latest SDK module versions + +# v1.13.30 (2023-07-31) + +* **Dependency Update**: Updated to the latest SDK module versions + +# v1.13.29 (2023-07-28) + +* **Dependency Update**: Updated to the latest SDK module versions + +# v1.13.28 (2023-07-25) + +* **Dependency Update**: Updated to the latest SDK module versions + # v1.13.27 (2023-07-13) * **Dependency Update**: Updated to the latest SDK module versions diff --git a/vendor/github.com/aws/aws-sdk-go-v2/credentials/go_module_metadata.go b/vendor/github.com/aws/aws-sdk-go-v2/credentials/go_module_metadata.go index e268c4b5a3..ca741fd8d4 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/credentials/go_module_metadata.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/credentials/go_module_metadata.go @@ -3,4 +3,4 @@ package credentials // goModuleVersion is the tagged release for this module -const goModuleVersion = "1.13.27" +const goModuleVersion = "1.13.31" diff --git a/vendor/github.com/aws/aws-sdk-go-v2/feature/ec2/imds/CHANGELOG.md b/vendor/github.com/aws/aws-sdk-go-v2/feature/ec2/imds/CHANGELOG.md index d4c69c47bb..64281a8a82 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/feature/ec2/imds/CHANGELOG.md +++ b/vendor/github.com/aws/aws-sdk-go-v2/feature/ec2/imds/CHANGELOG.md @@ -1,3 +1,11 @@ +# v1.13.7 (2023-07-31) + +* **Dependency Update**: Updated to the latest SDK module versions + +# v1.13.6 (2023-07-28) + +* **Dependency Update**: Updated to the latest SDK module versions + # v1.13.5 (2023-07-13) * **Dependency Update**: Updated to the latest SDK module versions diff --git a/vendor/github.com/aws/aws-sdk-go-v2/feature/ec2/imds/go_module_metadata.go b/vendor/github.com/aws/aws-sdk-go-v2/feature/ec2/imds/go_module_metadata.go index 0dd34c97c6..945242c434 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/feature/ec2/imds/go_module_metadata.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/feature/ec2/imds/go_module_metadata.go @@ -3,4 +3,4 @@ package imds // goModuleVersion is the tagged release for this module -const goModuleVersion = "1.13.5" +const goModuleVersion = "1.13.7" diff --git a/vendor/github.com/aws/aws-sdk-go-v2/internal/auth/scheme.go b/vendor/github.com/aws/aws-sdk-go-v2/internal/auth/scheme.go new file mode 100644 index 0000000000..ff229c048f --- /dev/null +++ b/vendor/github.com/aws/aws-sdk-go-v2/internal/auth/scheme.go @@ -0,0 +1,186 @@ +package auth + +import ( + "context" + "fmt" + + smithy "github.com/aws/smithy-go" + "github.com/aws/smithy-go/middleware" +) + +// SigV4 is a constant representing +// Authentication Scheme Signature Version 4 +const SigV4 = "sigv4" + +// SigV4A is a constant representing +// Authentication Scheme Signature Version 4A +const SigV4A = "sigv4a" + +// None is a constant representing the +// None Authentication Scheme +const None = "none" + +// SupportedSchemes is a data structure +// that indicates the list of supported AWS +// authentication schemes +var SupportedSchemes = map[string]bool{ + SigV4: true, + SigV4A: true, + None: true, +} + +// AuthenticationScheme is a representation of +// AWS authentication schemes +type AuthenticationScheme interface { + isAuthenticationScheme() +} + +// AuthenticationSchemeV4 is a AWS SigV4 representation +type AuthenticationSchemeV4 struct { + Name string + SigningName *string + SigningRegion *string + DisableDoubleEncoding *bool +} + +func (a *AuthenticationSchemeV4) isAuthenticationScheme() {} + +// AuthenticationSchemeV4A is a AWS SigV4A representation +type AuthenticationSchemeV4A struct { + Name string + SigningName *string + SigningRegionSet []string + DisableDoubleEncoding *bool +} + +func (a *AuthenticationSchemeV4A) isAuthenticationScheme() {} + +// AuthenticationSchemeNone is a representation for the none auth scheme +type AuthenticationSchemeNone struct{} + +func (a *AuthenticationSchemeNone) isAuthenticationScheme() {} + +// NoAuthenticationSchemesFoundError is used in signaling +// that no authentication schemes have been specified. +type NoAuthenticationSchemesFoundError struct{} + +func (e *NoAuthenticationSchemesFoundError) Error() string { + return fmt.Sprint("No authentication schemes specified.") +} + +// UnSupportedAuthenticationSchemeSpecifiedError is used in +// signaling that only unsupported authentication schemes +// were specified. +type UnSupportedAuthenticationSchemeSpecifiedError struct { + UnsupportedSchemes []string +} + +func (e *UnSupportedAuthenticationSchemeSpecifiedError) Error() string { + return fmt.Sprint("Unsupported authentication scheme specified.") +} + +// GetAuthenticationSchemes extracts the relevant authentication scheme data +// into a custom strongly typed Go data structure. +func GetAuthenticationSchemes(p *smithy.Properties) ([]AuthenticationScheme, error) { + var result []AuthenticationScheme + if !p.Has("authSchemes") { + return nil, &NoAuthenticationSchemesFoundError{} + } + + authSchemes, _ := p.Get("authSchemes").([]interface{}) + + var unsupportedSchemes []string + for _, scheme := range authSchemes { + authScheme, _ := scheme.(map[string]interface{}) + + switch authScheme["name"] { + case SigV4: + v4Scheme := AuthenticationSchemeV4{ + Name: SigV4, + SigningName: getSigningName(authScheme), + SigningRegion: getSigningRegion(authScheme), + DisableDoubleEncoding: getDisableDoubleEncoding(authScheme), + } + result = append(result, AuthenticationScheme(&v4Scheme)) + case SigV4A: + v4aScheme := AuthenticationSchemeV4A{ + Name: SigV4A, + SigningName: getSigningName(authScheme), + SigningRegionSet: getSigningRegionSet(authScheme), + DisableDoubleEncoding: getDisableDoubleEncoding(authScheme), + } + result = append(result, AuthenticationScheme(&v4aScheme)) + case None: + noneScheme := AuthenticationSchemeNone{} + result = append(result, AuthenticationScheme(&noneScheme)) + default: + unsupportedSchemes = append(unsupportedSchemes, authScheme["name"].(string)) + continue + } + } + + if len(result) == 0 { + return nil, &UnSupportedAuthenticationSchemeSpecifiedError{ + UnsupportedSchemes: unsupportedSchemes, + } + } + + return result, nil +} + +type disableDoubleEncoding struct{} + +// SetDisableDoubleEncoding sets or modifies the disable double encoding option +// on the context. +// +// Scoped to stack values. Use github.com/aws/smithy-go/middleware#ClearStackValues +// to clear all stack values. +func SetDisableDoubleEncoding(ctx context.Context, value bool) context.Context { + return middleware.WithStackValue(ctx, disableDoubleEncoding{}, value) +} + +// GetDisableDoubleEncoding retrieves the disable double encoding option +// from the context. +// +// Scoped to stack values. Use github.com/aws/smithy-go/middleware#ClearStackValues +// to clear all stack values. +func GetDisableDoubleEncoding(ctx context.Context) (value bool, ok bool) { + value, ok = middleware.GetStackValue(ctx, disableDoubleEncoding{}).(bool) + return value, ok +} + +func getSigningName(authScheme map[string]interface{}) *string { + signingName, ok := authScheme["signingName"].(string) + if !ok || signingName == "" { + return nil + } + return &signingName +} + +func getSigningRegionSet(authScheme map[string]interface{}) []string { + untypedSigningRegionSet, ok := authScheme["signingRegionSet"].([]interface{}) + if !ok { + return nil + } + signingRegionSet := []string{} + for _, item := range untypedSigningRegionSet { + signingRegionSet = append(signingRegionSet, item.(string)) + } + return signingRegionSet +} + +func getSigningRegion(authScheme map[string]interface{}) *string { + signingRegion, ok := authScheme["signingRegion"].(string) + if !ok || signingRegion == "" { + return nil + } + return &signingRegion +} + +func getDisableDoubleEncoding(authScheme map[string]interface{}) *bool { + disableDoubleEncoding, ok := authScheme["disableDoubleEncoding"].(bool) + if !ok { + return nil + } + return &disableDoubleEncoding +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/internal/configsources/CHANGELOG.md b/vendor/github.com/aws/aws-sdk-go-v2/internal/configsources/CHANGELOG.md index 0e40769332..8bcba5d093 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/internal/configsources/CHANGELOG.md +++ b/vendor/github.com/aws/aws-sdk-go-v2/internal/configsources/CHANGELOG.md @@ -1,3 +1,11 @@ +# v1.1.37 (2023-07-31) + +* **Dependency Update**: Updated to the latest SDK module versions + +# v1.1.36 (2023-07-28) + +* **Dependency Update**: Updated to the latest SDK module versions + # v1.1.35 (2023-07-13) * **Dependency Update**: Updated to the latest SDK module versions diff --git a/vendor/github.com/aws/aws-sdk-go-v2/internal/configsources/go_module_metadata.go b/vendor/github.com/aws/aws-sdk-go-v2/internal/configsources/go_module_metadata.go index 623c67bf81..0f108d3cc3 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/internal/configsources/go_module_metadata.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/internal/configsources/go_module_metadata.go @@ -3,4 +3,4 @@ package configsources // goModuleVersion is the tagged release for this module -const goModuleVersion = "1.1.35" +const goModuleVersion = "1.1.37" diff --git a/vendor/github.com/aws/aws-sdk-go-v2/internal/endpoints/awsrulesfn/arn.go b/vendor/github.com/aws/aws-sdk-go-v2/internal/endpoints/awsrulesfn/arn.go new file mode 100644 index 0000000000..e6223dd3b3 --- /dev/null +++ b/vendor/github.com/aws/aws-sdk-go-v2/internal/endpoints/awsrulesfn/arn.go @@ -0,0 +1,94 @@ +package awsrulesfn + +import ( + "strings" +) + +// ARN provides AWS ARN components broken out into a data structure. +type ARN struct { + Partition string + Service string + Region string + AccountId string + ResourceId OptionalStringSlice +} + +const ( + arnDelimiters = ":" + resourceDelimiters = "/:" + arnSections = 6 + arnPrefix = "arn:" + + // zero-indexed + sectionPartition = 1 + sectionService = 2 + sectionRegion = 3 + sectionAccountID = 4 + sectionResource = 5 +) + +// ParseARN returns an [ARN] value parsed from the input string provided. If +// the ARN cannot be parsed nil will be returned, and error added to +// [ErrorCollector]. +func ParseARN(input string) *ARN { + if !strings.HasPrefix(input, arnPrefix) { + return nil + } + + sections := strings.SplitN(input, arnDelimiters, arnSections) + if numSections := len(sections); numSections != arnSections { + return nil + } + + if sections[sectionPartition] == "" { + return nil + } + if sections[sectionService] == "" { + return nil + } + if sections[sectionResource] == "" { + return nil + } + + return &ARN{ + Partition: sections[sectionPartition], + Service: sections[sectionService], + Region: sections[sectionRegion], + AccountId: sections[sectionAccountID], + ResourceId: splitResource(sections[sectionResource]), + } +} + +// splitResource splits the resource components by the ARN resource delimiters. +func splitResource(v string) []string { + var parts []string + var offset int + + for offset <= len(v) { + idx := strings.IndexAny(v[offset:], "/:") + if idx < 0 { + parts = append(parts, v[offset:]) + break + } + parts = append(parts, v[offset:idx+offset]) + offset += idx + 1 + } + + return parts +} + +// OptionalStringSlice provides a helper to safely get the index of a string +// slice that may be out of bounds. Returns pointer to string if index is +// valid. Otherwise returns nil. +type OptionalStringSlice []string + +// Get returns a string pointer of the string at index i if the index is valid. +// Otherwise returns nil. +func (s OptionalStringSlice) Get(i int) *string { + if i < 0 || i >= len(s) { + return nil + } + + v := s[i] + return &v +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/internal/endpoints/awsrulesfn/doc.go b/vendor/github.com/aws/aws-sdk-go-v2/internal/endpoints/awsrulesfn/doc.go new file mode 100644 index 0000000000..d5a365853f --- /dev/null +++ b/vendor/github.com/aws/aws-sdk-go-v2/internal/endpoints/awsrulesfn/doc.go @@ -0,0 +1,3 @@ +// Package awsrulesfn provides AWS focused endpoint rule functions for +// evaluating endpoint resolution rules. +package awsrulesfn diff --git a/vendor/github.com/aws/aws-sdk-go-v2/internal/endpoints/awsrulesfn/generate.go b/vendor/github.com/aws/aws-sdk-go-v2/internal/endpoints/awsrulesfn/generate.go new file mode 100644 index 0000000000..df72da97ce --- /dev/null +++ b/vendor/github.com/aws/aws-sdk-go-v2/internal/endpoints/awsrulesfn/generate.go @@ -0,0 +1,7 @@ +//go:build codegen +// +build codegen + +package awsrulesfn + +//go:generate go run -tags codegen ./internal/partition/codegen.go -model partitions.json -output partitions.go +//go:generate gofmt -w -s . diff --git a/vendor/github.com/aws/aws-sdk-go-v2/internal/endpoints/awsrulesfn/host.go b/vendor/github.com/aws/aws-sdk-go-v2/internal/endpoints/awsrulesfn/host.go new file mode 100644 index 0000000000..637e5fc18e --- /dev/null +++ b/vendor/github.com/aws/aws-sdk-go-v2/internal/endpoints/awsrulesfn/host.go @@ -0,0 +1,51 @@ +package awsrulesfn + +import ( + "net" + "strings" + + smithyhttp "github.com/aws/smithy-go/transport/http" +) + +// IsVirtualHostableS3Bucket returns if the input is a DNS compatible bucket +// name and can be used with Amazon S3 virtual hosted style addressing. Similar +// to [rulesfn.IsValidHostLabel] with the added restriction that the length of label +// must be [3:63] characters long, all lowercase, and not formatted as an IP +// address. +func IsVirtualHostableS3Bucket(input string, allowSubDomains bool) bool { + // input should not be formatted as an IP address + // NOTE: this will technically trip up on IPv6 hosts with zone IDs, but + // validation further down will catch that anyway (it's guaranteed to have + // unfriendly characters % and : if that's the case) + if net.ParseIP(input) != nil { + return false + } + + var labels []string + if allowSubDomains { + labels = strings.Split(input, ".") + } else { + labels = []string{input} + } + + for _, label := range labels { + // validate special length constraints + if l := len(label); l < 3 || l > 63 { + return false + } + + // Validate no capital letters + for _, r := range label { + if r >= 'A' && r <= 'Z' { + return false + } + } + + // Validate valid host label + if !smithyhttp.ValidHostLabel(label) { + return false + } + } + + return true +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/internal/endpoints/awsrulesfn/partition.go b/vendor/github.com/aws/aws-sdk-go-v2/internal/endpoints/awsrulesfn/partition.go new file mode 100644 index 0000000000..ba6032758a --- /dev/null +++ b/vendor/github.com/aws/aws-sdk-go-v2/internal/endpoints/awsrulesfn/partition.go @@ -0,0 +1,75 @@ +package awsrulesfn + +import "regexp" + +// Partition provides the metadata describing an AWS partition. +type Partition struct { + ID string `json:"id"` + Regions map[string]RegionOverrides `json:"regions"` + RegionRegex string `json:"regionRegex"` + DefaultConfig PartitionConfig `json:"outputs"` +} + +// PartitionConfig provides the endpoint metadata for an AWS region or partition. +type PartitionConfig struct { + Name string `json:"name"` + DnsSuffix string `json:"dnsSuffix"` + DualStackDnsSuffix string `json:"dualStackDnsSuffix"` + SupportsFIPS bool `json:"supportsFIPS"` + SupportsDualStack bool `json:"supportsDualStack"` +} + +type RegionOverrides struct { + Name *string `json:"name"` + DnsSuffix *string `json:"dnsSuffix"` + DualStackDnsSuffix *string `json:"dualStackDnsSuffix"` + SupportsFIPS *bool `json:"supportsFIPS"` + SupportsDualStack *bool `json:"supportsDualStack"` +} + +const defaultPartition = "aws" + +func getPartition(partitions []Partition, region string) *PartitionConfig { + for _, partition := range partitions { + if v, ok := partition.Regions[region]; ok { + p := mergeOverrides(partition.DefaultConfig, v) + return &p + } + } + + for _, partition := range partitions { + regionRegex := regexp.MustCompile(partition.RegionRegex) + if regionRegex.MatchString(region) { + v := partition.DefaultConfig + return &v + } + } + + for _, partition := range partitions { + if partition.ID == defaultPartition { + v := partition.DefaultConfig + return &v + } + } + + return nil +} + +func mergeOverrides(into PartitionConfig, from RegionOverrides) PartitionConfig { + if from.Name != nil { + into.Name = *from.Name + } + if from.DnsSuffix != nil { + into.DnsSuffix = *from.DnsSuffix + } + if from.DualStackDnsSuffix != nil { + into.DualStackDnsSuffix = *from.DualStackDnsSuffix + } + if from.SupportsFIPS != nil { + into.SupportsFIPS = *from.SupportsFIPS + } + if from.SupportsDualStack != nil { + into.SupportsDualStack = *from.SupportsDualStack + } + return into +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/internal/endpoints/awsrulesfn/partitions.go b/vendor/github.com/aws/aws-sdk-go-v2/internal/endpoints/awsrulesfn/partitions.go new file mode 100644 index 0000000000..7ea49d4ea4 --- /dev/null +++ b/vendor/github.com/aws/aws-sdk-go-v2/internal/endpoints/awsrulesfn/partitions.go @@ -0,0 +1,343 @@ +// Code generated by endpoint/awsrulesfn/internal/partition. DO NOT EDIT. + +package awsrulesfn + +// GetPartition returns an AWS [Partition] for the region provided. If the +// partition cannot be determined nil will be returned. +func GetPartition(region string) *PartitionConfig { + return getPartition(partitions, region) +} + +var partitions = []Partition{ + { + ID: "aws", + RegionRegex: "^(us|eu|ap|sa|ca|me|af)\\-\\w+\\-\\d+$", + DefaultConfig: PartitionConfig{ + Name: "aws", + DnsSuffix: "amazonaws.com", + DualStackDnsSuffix: "api.aws", + SupportsFIPS: true, + SupportsDualStack: true, + }, + Regions: map[string]RegionOverrides{ + "af-south-1": { + Name: nil, + DnsSuffix: nil, + DualStackDnsSuffix: nil, + SupportsFIPS: nil, + SupportsDualStack: nil, + }, + "ap-east-1": { + Name: nil, + DnsSuffix: nil, + DualStackDnsSuffix: nil, + SupportsFIPS: nil, + SupportsDualStack: nil, + }, + "ap-northeast-1": { + Name: nil, + DnsSuffix: nil, + DualStackDnsSuffix: nil, + SupportsFIPS: nil, + SupportsDualStack: nil, + }, + "ap-northeast-2": { + Name: nil, + DnsSuffix: nil, + DualStackDnsSuffix: nil, + SupportsFIPS: nil, + SupportsDualStack: nil, + }, + "ap-northeast-3": { + Name: nil, + DnsSuffix: nil, + DualStackDnsSuffix: nil, + SupportsFIPS: nil, + SupportsDualStack: nil, + }, + "ap-south-1": { + Name: nil, + DnsSuffix: nil, + DualStackDnsSuffix: nil, + SupportsFIPS: nil, + SupportsDualStack: nil, + }, + "ap-south-2": { + Name: nil, + DnsSuffix: nil, + DualStackDnsSuffix: nil, + SupportsFIPS: nil, + SupportsDualStack: nil, + }, + "ap-southeast-1": { + Name: nil, + DnsSuffix: nil, + DualStackDnsSuffix: nil, + SupportsFIPS: nil, + SupportsDualStack: nil, + }, + "ap-southeast-2": { + Name: nil, + DnsSuffix: nil, + DualStackDnsSuffix: nil, + SupportsFIPS: nil, + SupportsDualStack: nil, + }, + "ap-southeast-3": { + Name: nil, + DnsSuffix: nil, + DualStackDnsSuffix: nil, + SupportsFIPS: nil, + SupportsDualStack: nil, + }, + "aws-global": { + Name: nil, + DnsSuffix: nil, + DualStackDnsSuffix: nil, + SupportsFIPS: nil, + SupportsDualStack: nil, + }, + "ca-central-1": { + Name: nil, + DnsSuffix: nil, + DualStackDnsSuffix: nil, + SupportsFIPS: nil, + SupportsDualStack: nil, + }, + "eu-central-1": { + Name: nil, + DnsSuffix: nil, + DualStackDnsSuffix: nil, + SupportsFIPS: nil, + SupportsDualStack: nil, + }, + "eu-central-2": { + Name: nil, + DnsSuffix: nil, + DualStackDnsSuffix: nil, + SupportsFIPS: nil, + SupportsDualStack: nil, + }, + "eu-north-1": { + Name: nil, + DnsSuffix: nil, + DualStackDnsSuffix: nil, + SupportsFIPS: nil, + SupportsDualStack: nil, + }, + "eu-south-1": { + Name: nil, + DnsSuffix: nil, + DualStackDnsSuffix: nil, + SupportsFIPS: nil, + SupportsDualStack: nil, + }, + "eu-south-2": { + Name: nil, + DnsSuffix: nil, + DualStackDnsSuffix: nil, + SupportsFIPS: nil, + SupportsDualStack: nil, + }, + "eu-west-1": { + Name: nil, + DnsSuffix: nil, + DualStackDnsSuffix: nil, + SupportsFIPS: nil, + SupportsDualStack: nil, + }, + "eu-west-2": { + Name: nil, + DnsSuffix: nil, + DualStackDnsSuffix: nil, + SupportsFIPS: nil, + SupportsDualStack: nil, + }, + "eu-west-3": { + Name: nil, + DnsSuffix: nil, + DualStackDnsSuffix: nil, + SupportsFIPS: nil, + SupportsDualStack: nil, + }, + "me-central-1": { + Name: nil, + DnsSuffix: nil, + DualStackDnsSuffix: nil, + SupportsFIPS: nil, + SupportsDualStack: nil, + }, + "me-south-1": { + Name: nil, + DnsSuffix: nil, + DualStackDnsSuffix: nil, + SupportsFIPS: nil, + SupportsDualStack: nil, + }, + "sa-east-1": { + Name: nil, + DnsSuffix: nil, + DualStackDnsSuffix: nil, + SupportsFIPS: nil, + SupportsDualStack: nil, + }, + "us-east-1": { + Name: nil, + DnsSuffix: nil, + DualStackDnsSuffix: nil, + SupportsFIPS: nil, + SupportsDualStack: nil, + }, + "us-east-2": { + Name: nil, + DnsSuffix: nil, + DualStackDnsSuffix: nil, + SupportsFIPS: nil, + SupportsDualStack: nil, + }, + "us-west-1": { + Name: nil, + DnsSuffix: nil, + DualStackDnsSuffix: nil, + SupportsFIPS: nil, + SupportsDualStack: nil, + }, + "us-west-2": { + Name: nil, + DnsSuffix: nil, + DualStackDnsSuffix: nil, + SupportsFIPS: nil, + SupportsDualStack: nil, + }, + }, + }, + { + ID: "aws-cn", + RegionRegex: "^cn\\-\\w+\\-\\d+$", + DefaultConfig: PartitionConfig{ + Name: "aws-cn", + DnsSuffix: "amazonaws.com.cn", + DualStackDnsSuffix: "api.amazonwebservices.com.cn", + SupportsFIPS: true, + SupportsDualStack: true, + }, + Regions: map[string]RegionOverrides{ + "aws-cn-global": { + Name: nil, + DnsSuffix: nil, + DualStackDnsSuffix: nil, + SupportsFIPS: nil, + SupportsDualStack: nil, + }, + "cn-north-1": { + Name: nil, + DnsSuffix: nil, + DualStackDnsSuffix: nil, + SupportsFIPS: nil, + SupportsDualStack: nil, + }, + "cn-northwest-1": { + Name: nil, + DnsSuffix: nil, + DualStackDnsSuffix: nil, + SupportsFIPS: nil, + SupportsDualStack: nil, + }, + }, + }, + { + ID: "aws-us-gov", + RegionRegex: "^us\\-gov\\-\\w+\\-\\d+$", + DefaultConfig: PartitionConfig{ + Name: "aws-us-gov", + DnsSuffix: "amazonaws.com", + DualStackDnsSuffix: "api.aws", + SupportsFIPS: true, + SupportsDualStack: true, + }, + Regions: map[string]RegionOverrides{ + "aws-us-gov-global": { + Name: nil, + DnsSuffix: nil, + DualStackDnsSuffix: nil, + SupportsFIPS: nil, + SupportsDualStack: nil, + }, + "us-gov-east-1": { + Name: nil, + DnsSuffix: nil, + DualStackDnsSuffix: nil, + SupportsFIPS: nil, + SupportsDualStack: nil, + }, + "us-gov-west-1": { + Name: nil, + DnsSuffix: nil, + DualStackDnsSuffix: nil, + SupportsFIPS: nil, + SupportsDualStack: nil, + }, + }, + }, + { + ID: "aws-iso", + RegionRegex: "^us\\-iso\\-\\w+\\-\\d+$", + DefaultConfig: PartitionConfig{ + Name: "aws-iso", + DnsSuffix: "c2s.ic.gov", + DualStackDnsSuffix: "c2s.ic.gov", + SupportsFIPS: true, + SupportsDualStack: false, + }, + Regions: map[string]RegionOverrides{ + "aws-iso-global": { + Name: nil, + DnsSuffix: nil, + DualStackDnsSuffix: nil, + SupportsFIPS: nil, + SupportsDualStack: nil, + }, + "us-iso-east-1": { + Name: nil, + DnsSuffix: nil, + DualStackDnsSuffix: nil, + SupportsFIPS: nil, + SupportsDualStack: nil, + }, + "us-iso-west-1": { + Name: nil, + DnsSuffix: nil, + DualStackDnsSuffix: nil, + SupportsFIPS: nil, + SupportsDualStack: nil, + }, + }, + }, + { + ID: "aws-iso-b", + RegionRegex: "^us\\-isob\\-\\w+\\-\\d+$", + DefaultConfig: PartitionConfig{ + Name: "aws-iso-b", + DnsSuffix: "sc2s.sgov.gov", + DualStackDnsSuffix: "sc2s.sgov.gov", + SupportsFIPS: true, + SupportsDualStack: false, + }, + Regions: map[string]RegionOverrides{ + "aws-iso-b-global": { + Name: nil, + DnsSuffix: nil, + DualStackDnsSuffix: nil, + SupportsFIPS: nil, + SupportsDualStack: nil, + }, + "us-isob-east-1": { + Name: nil, + DnsSuffix: nil, + DualStackDnsSuffix: nil, + SupportsFIPS: nil, + SupportsDualStack: nil, + }, + }, + }, +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/internal/endpoints/awsrulesfn/partitions.json b/vendor/github.com/aws/aws-sdk-go-v2/internal/endpoints/awsrulesfn/partitions.json new file mode 100644 index 0000000000..2018b804f3 --- /dev/null +++ b/vendor/github.com/aws/aws-sdk-go-v2/internal/endpoints/awsrulesfn/partitions.json @@ -0,0 +1,203 @@ +{ + "partitions" : [ { + "id" : "aws", + "outputs" : { + "dnsSuffix" : "amazonaws.com", + "dualStackDnsSuffix" : "api.aws", + "name" : "aws", + "supportsDualStack" : true, + "supportsFIPS" : true + }, + "regionRegex" : "^(us|eu|ap|sa|ca|me|af)\\-\\w+\\-\\d+$", + "regions" : { + "af-south-1" : { + "description" : "Africa (Cape Town)" + }, + "ap-east-1" : { + "description" : "Asia Pacific (Hong Kong)" + }, + "ap-northeast-1" : { + "description" : "Asia Pacific (Tokyo)" + }, + "ap-northeast-2" : { + "description" : "Asia Pacific (Seoul)" + }, + "ap-northeast-3" : { + "description" : "Asia Pacific (Osaka)" + }, + "ap-south-1" : { + "description" : "Asia Pacific (Mumbai)" + }, + "ap-south-2" : { + "description" : "Asia Pacific (Hyderabad)" + }, + "ap-southeast-1" : { + "description" : "Asia Pacific (Singapore)" + }, + "ap-southeast-2" : { + "description" : "Asia Pacific (Sydney)" + }, + "ap-southeast-3" : { + "description" : "Asia Pacific (Jakarta)" + }, + "ap-southeast-4" : { + "description" : "Asia Pacific (Melbourne)" + }, + "aws-global" : { + "description" : "AWS Standard global region" + }, + "ca-central-1" : { + "description" : "Canada (Central)" + }, + "eu-central-1" : { + "description" : "Europe (Frankfurt)" + }, + "eu-central-2" : { + "description" : "Europe (Zurich)" + }, + "eu-north-1" : { + "description" : "Europe (Stockholm)" + }, + "eu-south-1" : { + "description" : "Europe (Milan)" + }, + "eu-south-2" : { + "description" : "Europe (Spain)" + }, + "eu-west-1" : { + "description" : "Europe (Ireland)" + }, + "eu-west-2" : { + "description" : "Europe (London)" + }, + "eu-west-3" : { + "description" : "Europe (Paris)" + }, + "me-central-1" : { + "description" : "Middle East (UAE)" + }, + "me-south-1" : { + "description" : "Middle East (Bahrain)" + }, + "sa-east-1" : { + "description" : "South America (Sao Paulo)" + }, + "us-east-1" : { + "description" : "US East (N. Virginia)" + }, + "us-east-2" : { + "description" : "US East (Ohio)" + }, + "us-west-1" : { + "description" : "US West (N. California)" + }, + "us-west-2" : { + "description" : "US West (Oregon)" + } + } + }, { + "id" : "aws-cn", + "outputs" : { + "dnsSuffix" : "amazonaws.com.cn", + "dualStackDnsSuffix" : "api.amazonwebservices.com.cn", + "name" : "aws-cn", + "supportsDualStack" : true, + "supportsFIPS" : true + }, + "regionRegex" : "^cn\\-\\w+\\-\\d+$", + "regions" : { + "aws-cn-global" : { + "description" : "AWS China global region" + }, + "cn-north-1" : { + "description" : "China (Beijing)" + }, + "cn-northwest-1" : { + "description" : "China (Ningxia)" + } + } + }, { + "id" : "aws-us-gov", + "outputs" : { + "dnsSuffix" : "amazonaws.com", + "dualStackDnsSuffix" : "api.aws", + "name" : "aws-us-gov", + "supportsDualStack" : true, + "supportsFIPS" : true + }, + "regionRegex" : "^us\\-gov\\-\\w+\\-\\d+$", + "regions" : { + "aws-us-gov-global" : { + "description" : "AWS GovCloud (US) global region" + }, + "us-gov-east-1" : { + "description" : "AWS GovCloud (US-East)" + }, + "us-gov-west-1" : { + "description" : "AWS GovCloud (US-West)" + } + } + }, { + "id" : "aws-iso", + "outputs" : { + "dnsSuffix" : "c2s.ic.gov", + "dualStackDnsSuffix" : "c2s.ic.gov", + "name" : "aws-iso", + "supportsDualStack" : false, + "supportsFIPS" : true + }, + "regionRegex" : "^us\\-iso\\-\\w+\\-\\d+$", + "regions" : { + "aws-iso-global" : { + "description" : "AWS ISO (US) global region" + }, + "us-iso-east-1" : { + "description" : "US ISO East" + }, + "us-iso-west-1" : { + "description" : "US ISO WEST" + } + } + }, { + "id" : "aws-iso-b", + "outputs" : { + "dnsSuffix" : "sc2s.sgov.gov", + "dualStackDnsSuffix" : "sc2s.sgov.gov", + "name" : "aws-iso-b", + "supportsDualStack" : false, + "supportsFIPS" : true + }, + "regionRegex" : "^us\\-isob\\-\\w+\\-\\d+$", + "regions" : { + "aws-iso-b-global" : { + "description" : "AWS ISOB (US) global region" + }, + "us-isob-east-1" : { + "description" : "US ISOB East (Ohio)" + } + } + }, { + "id" : "aws-iso-e", + "outputs" : { + "dnsSuffix" : "cloud.adc-e.uk", + "dualStackDnsSuffix" : "cloud.adc-e.uk", + "name" : "aws-iso-e", + "supportsDualStack" : false, + "supportsFIPS" : true + }, + "regionRegex" : "^eu\\-isoe\\-\\w+\\-\\d+$", + "regions" : { } + }, { + "id" : "aws-iso-f", + "outputs" : { + "dnsSuffix" : "csp.hci.ic.gov", + "dualStackDnsSuffix" : "csp.hci.ic.gov", + "name" : "aws-iso-f", + "supportsDualStack" : false, + "supportsFIPS" : true + }, + "regionRegex" : "^us\\-isof\\-\\w+\\-\\d+$", + "regions" : { } + } ], + "version" : "1.1" +} \ No newline at end of file diff --git a/vendor/github.com/aws/aws-sdk-go-v2/internal/endpoints/v2/CHANGELOG.md b/vendor/github.com/aws/aws-sdk-go-v2/internal/endpoints/v2/CHANGELOG.md index 27f3c45c11..4714b847d4 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/internal/endpoints/v2/CHANGELOG.md +++ b/vendor/github.com/aws/aws-sdk-go-v2/internal/endpoints/v2/CHANGELOG.md @@ -1,3 +1,11 @@ +# v2.4.31 (2023-07-31) + +* **Dependency Update**: Updated to the latest SDK module versions + +# v2.4.30 (2023-07-28) + +* **Dependency Update**: Updated to the latest SDK module versions + # v2.4.29 (2023-07-13) * **Dependency Update**: Updated to the latest SDK module versions diff --git a/vendor/github.com/aws/aws-sdk-go-v2/internal/endpoints/v2/go_module_metadata.go b/vendor/github.com/aws/aws-sdk-go-v2/internal/endpoints/v2/go_module_metadata.go index 3d7336599a..96d0bf8545 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/internal/endpoints/v2/go_module_metadata.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/internal/endpoints/v2/go_module_metadata.go @@ -3,4 +3,4 @@ package endpoints // goModuleVersion is the tagged release for this module -const goModuleVersion = "2.4.29" +const goModuleVersion = "2.4.31" diff --git a/vendor/github.com/aws/aws-sdk-go-v2/internal/ini/CHANGELOG.md b/vendor/github.com/aws/aws-sdk-go-v2/internal/ini/CHANGELOG.md index 81535ed95e..2bf5607a30 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/internal/ini/CHANGELOG.md +++ b/vendor/github.com/aws/aws-sdk-go-v2/internal/ini/CHANGELOG.md @@ -1,3 +1,11 @@ +# v1.3.38 (2023-07-31) + +* **Dependency Update**: Updated to the latest SDK module versions + +# v1.3.37 (2023-07-28) + +* **Dependency Update**: Updated to the latest SDK module versions + # v1.3.36 (2023-07-13) * **Dependency Update**: Updated to the latest SDK module versions diff --git a/vendor/github.com/aws/aws-sdk-go-v2/internal/ini/go_module_metadata.go b/vendor/github.com/aws/aws-sdk-go-v2/internal/ini/go_module_metadata.go index cf3525a0b8..3637b605b4 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/internal/ini/go_module_metadata.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/internal/ini/go_module_metadata.go @@ -3,4 +3,4 @@ package ini // goModuleVersion is the tagged release for this module -const goModuleVersion = "1.3.36" +const goModuleVersion = "1.3.38" diff --git a/vendor/github.com/aws/aws-sdk-go-v2/modman.toml b/vendor/github.com/aws/aws-sdk-go-v2/modman.toml index b6d07cdd6d..c759788972 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/modman.toml +++ b/vendor/github.com/aws/aws-sdk-go-v2/modman.toml @@ -1,7 +1,7 @@ [dependencies] "github.com/aws/aws-sdk-go" = "v1.44.28" - "github.com/aws/smithy-go" = "v1.13.5" + "github.com/aws/smithy-go" = "v1.14.0" "github.com/google/go-cmp" = "v0.5.8" "github.com/jmespath/go-jmespath" = "v0.4.0" "golang.org/x/net" = "v0.1.0" diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/internal/presigned-url/CHANGELOG.md b/vendor/github.com/aws/aws-sdk-go-v2/service/internal/presigned-url/CHANGELOG.md index bc2c638307..89a9149861 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/internal/presigned-url/CHANGELOG.md +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/internal/presigned-url/CHANGELOG.md @@ -1,3 +1,11 @@ +# v1.9.31 (2023-07-31) + +* **Dependency Update**: Updated to the latest SDK module versions + +# v1.9.30 (2023-07-28) + +* **Dependency Update**: Updated to the latest SDK module versions + # v1.9.29 (2023-07-13) * **Dependency Update**: Updated to the latest SDK module versions diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/internal/presigned-url/go_module_metadata.go b/vendor/github.com/aws/aws-sdk-go-v2/service/internal/presigned-url/go_module_metadata.go index 42608eaf2d..003f1792c3 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/internal/presigned-url/go_module_metadata.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/internal/presigned-url/go_module_metadata.go @@ -3,4 +3,4 @@ package presignedurl // goModuleVersion is the tagged release for this module -const goModuleVersion = "1.9.29" +const goModuleVersion = "1.9.31" diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/CHANGELOG.md b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/CHANGELOG.md index c428585473..0c99497448 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/CHANGELOG.md +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/CHANGELOG.md @@ -1,3 +1,16 @@ +# v1.24.1 (2023-08-01) + +* No change notes available for this release. + +# v1.24.0 (2023-07-31) + +* **Feature**: Adds support for smithy-modeled endpoint resolution. A new rules-based endpoint resolution will be added to the SDK which will supercede and deprecate existing endpoint resolution. Specifically, EndpointResolver will be deprecated while BaseEndpoint and EndpointResolverV2 will take its place. For more information, please see the Endpoints section in our Developer Guide. +* **Dependency Update**: Updated to the latest SDK module versions + +# v1.23.2 (2023-07-28) + +* **Dependency Update**: Updated to the latest SDK module versions + # v1.23.1 (2023-07-13) * **Dependency Update**: Updated to the latest SDK module versions diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_client.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_client.go index 76d48df3ce..b82ba62679 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_client.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_client.go @@ -4,6 +4,7 @@ package kms import ( "context" + "fmt" "github.com/aws/aws-sdk-go-v2/aws" "github.com/aws/aws-sdk-go-v2/aws/defaults" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" @@ -46,8 +47,6 @@ func New(options Options, optFns ...func(*Options)) *Client { resolveHTTPSignerV4(&options) - resolveDefaultEndpointConfiguration(&options) - for _, fn := range optFns { fn(&options) } @@ -68,6 +67,11 @@ type Options struct { // The optional application specific identifier appended to the User-Agent header. AppID string + // This endpoint will be given as input to an EndpointResolverV2. It is used for + // providing a custom base endpoint that is subject to modifications by the + // processing EndpointResolverV2. + BaseEndpoint *string + // Configures the events that will be sent to the configured logger. ClientLogMode aws.ClientLogMode @@ -82,8 +86,18 @@ type Options struct { EndpointOptions EndpointResolverOptions // The service endpoint resolver. + // + // Deprecated: Deprecated: EndpointResolver and WithEndpointResolver. Providing a + // value for this field will likely prevent you from using any endpoint-related + // service features released after the introduction of EndpointResolverV2 and + // BaseEndpoint. To migrate an EndpointResolver implementation that uses a custom + // endpoint, set the client option BaseEndpoint instead. EndpointResolver EndpointResolver + // Resolves the endpoint used for a particular service. This should be used over + // the deprecated EndpointResolver + EndpointResolverV2 EndpointResolverV2 + // Signature Version 4 (SigV4) Signer HTTPSignerV4 HTTPSignerV4 @@ -142,14 +156,25 @@ func WithAPIOptions(optFns ...func(*middleware.Stack) error) func(*Options) { } } -// WithEndpointResolver returns a functional option for setting the Client's -// EndpointResolver option. +// Deprecated: EndpointResolver and WithEndpointResolver. Providing a value for +// this field will likely prevent you from using any endpoint-related service +// features released after the introduction of EndpointResolverV2 and BaseEndpoint. +// To migrate an EndpointResolver implementation that uses a custom endpoint, set +// the client option BaseEndpoint instead. func WithEndpointResolver(v EndpointResolver) func(*Options) { return func(o *Options) { o.EndpointResolver = v } } +// WithEndpointResolverV2 returns a functional option for setting the Client's +// EndpointResolverV2 option. +func WithEndpointResolverV2(v EndpointResolverV2) func(*Options) { + return func(o *Options) { + o.EndpointResolverV2 = v + } +} + type HTTPClient interface { Do(*http.Request) (*http.Response, error) } @@ -166,6 +191,8 @@ func (c *Client) invokeOperation(ctx context.Context, opID string, params interf ctx = middleware.ClearStackValues(ctx) stack := middleware.NewStack(opID, smithyhttp.NewStackRequest) options := c.options.Copy() + resolveEndpointResolverV2(&options) + for _, fn := range optFns { fn(&options) } @@ -200,6 +227,30 @@ func (c *Client) invokeOperation(ctx context.Context, opID string, params interf type noSmithyDocumentSerde = smithydocument.NoSerde +type legacyEndpointContextSetter struct { + LegacyResolver EndpointResolver +} + +func (*legacyEndpointContextSetter) ID() string { + return "legacyEndpointContextSetter" +} + +func (m *legacyEndpointContextSetter) HandleInitialize(ctx context.Context, in middleware.InitializeInput, next middleware.InitializeHandler) ( + out middleware.InitializeOutput, metadata middleware.Metadata, err error, +) { + if m.LegacyResolver != nil { + ctx = awsmiddleware.SetRequiresLegacyEndpoints(ctx, true) + } + + return next.HandleInitialize(ctx, in) + +} +func addlegacyEndpointContextSetter(stack *middleware.Stack, o Options) error { + return stack.Initialize.Add(&legacyEndpointContextSetter{ + LegacyResolver: o.EndpointResolver, + }, middleware.Before) +} + func resolveDefaultLogger(o *Options) { if o.Logger != nil { return @@ -348,7 +399,7 @@ func resolveAWSEndpointResolver(cfg aws.Config, o *Options) { if cfg.EndpointResolver == nil && cfg.EndpointResolverWithOptions == nil { return } - o.EndpointResolver = withEndpointResolver(cfg.EndpointResolver, cfg.EndpointResolverWithOptions, NewDefaultEndpointResolver()) + o.EndpointResolver = withEndpointResolver(cfg.EndpointResolver, cfg.EndpointResolverWithOptions) } func addClientUserAgent(stack *middleware.Stack, options Options) error { @@ -444,3 +495,32 @@ func addRequestResponseLogging(stack *middleware.Stack, o Options) error { LogResponseWithBody: o.ClientLogMode.IsResponseWithBody(), }, middleware.After) } + +type endpointDisableHTTPSMiddleware struct { + EndpointDisableHTTPS bool +} + +func (*endpointDisableHTTPSMiddleware) ID() string { + return "endpointDisableHTTPSMiddleware" +} + +func (m *endpointDisableHTTPSMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointDisableHTTPS && !smithyhttp.GetHostnameImmutable(ctx) { + req.URL.Scheme = "http" + } + + return next.HandleSerialize(ctx, in) + +} +func addendpointDisableHTTPSMiddleware(stack *middleware.Stack, o Options) error { + return stack.Serialize.Insert(&endpointDisableHTTPSMiddleware{ + EndpointDisableHTTPS: o.EndpointOptions.DisableHTTPS, + }, "OperationSerializer", middleware.Before) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_CancelKeyDeletion.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_CancelKeyDeletion.go index cfde2f0c2d..fe0cc8d5ed 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_CancelKeyDeletion.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_CancelKeyDeletion.go @@ -4,8 +4,13 @@ package kms import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -72,6 +77,9 @@ func (c *Client) addOperationCancelKeyDeletionMiddlewares(stack *middleware.Stac if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -108,6 +116,9 @@ func (c *Client) addOperationCancelKeyDeletionMiddlewares(stack *middleware.Stac if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addCancelKeyDeletionResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpCancelKeyDeletionValidationMiddleware(stack); err != nil { return err } @@ -126,6 +137,9 @@ func (c *Client) addOperationCancelKeyDeletionMiddlewares(stack *middleware.Stac if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -137,3 +151,126 @@ func newServiceMetadataMiddleware_opCancelKeyDeletion(region string) *awsmiddlew OperationName: "CancelKeyDeletion", } } + +type opCancelKeyDeletionResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opCancelKeyDeletionResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opCancelKeyDeletionResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "kms" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "kms" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("kms") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addCancelKeyDeletionResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opCancelKeyDeletionResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_ConnectCustomKeyStore.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_ConnectCustomKeyStore.go index e5deb3f2b3..e807e3a46e 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_ConnectCustomKeyStore.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_ConnectCustomKeyStore.go @@ -4,8 +4,13 @@ package kms import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -108,6 +113,9 @@ func (c *Client) addOperationConnectCustomKeyStoreMiddlewares(stack *middleware. if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -144,6 +152,9 @@ func (c *Client) addOperationConnectCustomKeyStoreMiddlewares(stack *middleware. if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addConnectCustomKeyStoreResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpConnectCustomKeyStoreValidationMiddleware(stack); err != nil { return err } @@ -162,6 +173,9 @@ func (c *Client) addOperationConnectCustomKeyStoreMiddlewares(stack *middleware. if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -173,3 +187,126 @@ func newServiceMetadataMiddleware_opConnectCustomKeyStore(region string) *awsmid OperationName: "ConnectCustomKeyStore", } } + +type opConnectCustomKeyStoreResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opConnectCustomKeyStoreResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opConnectCustomKeyStoreResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "kms" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "kms" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("kms") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addConnectCustomKeyStoreResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opConnectCustomKeyStoreResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_CreateAlias.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_CreateAlias.go index d0979ddd4b..fbd3a81adf 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_CreateAlias.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_CreateAlias.go @@ -4,8 +4,13 @@ package kms import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -103,6 +108,9 @@ func (c *Client) addOperationCreateAliasMiddlewares(stack *middleware.Stack, opt if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -139,6 +147,9 @@ func (c *Client) addOperationCreateAliasMiddlewares(stack *middleware.Stack, opt if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addCreateAliasResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpCreateAliasValidationMiddleware(stack); err != nil { return err } @@ -157,6 +168,9 @@ func (c *Client) addOperationCreateAliasMiddlewares(stack *middleware.Stack, opt if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -168,3 +182,126 @@ func newServiceMetadataMiddleware_opCreateAlias(region string) *awsmiddleware.Re OperationName: "CreateAlias", } } + +type opCreateAliasResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opCreateAliasResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opCreateAliasResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "kms" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "kms" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("kms") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addCreateAliasResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opCreateAliasResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_CreateCustomKeyStore.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_CreateCustomKeyStore.go index 180b8b9733..68f843ffea 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_CreateCustomKeyStore.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_CreateCustomKeyStore.go @@ -4,9 +4,14 @@ package kms import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" "github.com/aws/aws-sdk-go-v2/service/kms/types" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -228,6 +233,9 @@ func (c *Client) addOperationCreateCustomKeyStoreMiddlewares(stack *middleware.S if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -264,6 +272,9 @@ func (c *Client) addOperationCreateCustomKeyStoreMiddlewares(stack *middleware.S if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addCreateCustomKeyStoreResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpCreateCustomKeyStoreValidationMiddleware(stack); err != nil { return err } @@ -282,6 +293,9 @@ func (c *Client) addOperationCreateCustomKeyStoreMiddlewares(stack *middleware.S if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -293,3 +307,126 @@ func newServiceMetadataMiddleware_opCreateCustomKeyStore(region string) *awsmidd OperationName: "CreateCustomKeyStore", } } + +type opCreateCustomKeyStoreResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opCreateCustomKeyStoreResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opCreateCustomKeyStoreResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "kms" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "kms" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("kms") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addCreateCustomKeyStoreResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opCreateCustomKeyStoreResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_CreateGrant.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_CreateGrant.go index 42fe832868..6e5b455df0 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_CreateGrant.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_CreateGrant.go @@ -4,9 +4,14 @@ package kms import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" "github.com/aws/aws-sdk-go-v2/service/kms/types" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -190,6 +195,9 @@ func (c *Client) addOperationCreateGrantMiddlewares(stack *middleware.Stack, opt if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -226,6 +234,9 @@ func (c *Client) addOperationCreateGrantMiddlewares(stack *middleware.Stack, opt if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addCreateGrantResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpCreateGrantValidationMiddleware(stack); err != nil { return err } @@ -244,6 +255,9 @@ func (c *Client) addOperationCreateGrantMiddlewares(stack *middleware.Stack, opt if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -255,3 +269,126 @@ func newServiceMetadataMiddleware_opCreateGrant(region string) *awsmiddleware.Re OperationName: "CreateGrant", } } + +type opCreateGrantResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opCreateGrantResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opCreateGrantResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "kms" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "kms" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("kms") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addCreateGrantResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opCreateGrantResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_CreateKey.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_CreateKey.go index d49c3e1871..9c0b903bee 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_CreateKey.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_CreateKey.go @@ -4,9 +4,14 @@ package kms import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" "github.com/aws/aws-sdk-go-v2/service/kms/types" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -360,6 +365,9 @@ func (c *Client) addOperationCreateKeyMiddlewares(stack *middleware.Stack, optio if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -396,6 +404,9 @@ func (c *Client) addOperationCreateKeyMiddlewares(stack *middleware.Stack, optio if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addCreateKeyResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpCreateKeyValidationMiddleware(stack); err != nil { return err } @@ -414,6 +425,9 @@ func (c *Client) addOperationCreateKeyMiddlewares(stack *middleware.Stack, optio if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -425,3 +439,126 @@ func newServiceMetadataMiddleware_opCreateKey(region string) *awsmiddleware.Regi OperationName: "CreateKey", } } + +type opCreateKeyResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opCreateKeyResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opCreateKeyResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "kms" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "kms" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("kms") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addCreateKeyResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opCreateKeyResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_Decrypt.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_Decrypt.go index 16a1536dae..eb9d915c49 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_Decrypt.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_Decrypt.go @@ -4,9 +4,14 @@ package kms import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" "github.com/aws/aws-sdk-go-v2/service/kms/types" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -202,6 +207,9 @@ func (c *Client) addOperationDecryptMiddlewares(stack *middleware.Stack, options if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -238,6 +246,9 @@ func (c *Client) addOperationDecryptMiddlewares(stack *middleware.Stack, options if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addDecryptResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpDecryptValidationMiddleware(stack); err != nil { return err } @@ -256,6 +267,9 @@ func (c *Client) addOperationDecryptMiddlewares(stack *middleware.Stack, options if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -267,3 +281,126 @@ func newServiceMetadataMiddleware_opDecrypt(region string) *awsmiddleware.Regist OperationName: "Decrypt", } } + +type opDecryptResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opDecryptResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opDecryptResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "kms" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "kms" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("kms") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addDecryptResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opDecryptResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_DeleteAlias.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_DeleteAlias.go index 6265f58c22..f91f23262d 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_DeleteAlias.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_DeleteAlias.go @@ -4,8 +4,13 @@ package kms import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -73,6 +78,9 @@ func (c *Client) addOperationDeleteAliasMiddlewares(stack *middleware.Stack, opt if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -109,6 +117,9 @@ func (c *Client) addOperationDeleteAliasMiddlewares(stack *middleware.Stack, opt if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addDeleteAliasResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpDeleteAliasValidationMiddleware(stack); err != nil { return err } @@ -127,6 +138,9 @@ func (c *Client) addOperationDeleteAliasMiddlewares(stack *middleware.Stack, opt if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -138,3 +152,126 @@ func newServiceMetadataMiddleware_opDeleteAlias(region string) *awsmiddleware.Re OperationName: "DeleteAlias", } } + +type opDeleteAliasResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opDeleteAliasResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opDeleteAliasResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "kms" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "kms" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("kms") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addDeleteAliasResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opDeleteAliasResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_DeleteCustomKeyStore.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_DeleteCustomKeyStore.go index 295069a252..e326efe687 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_DeleteCustomKeyStore.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_DeleteCustomKeyStore.go @@ -4,8 +4,13 @@ package kms import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -87,6 +92,9 @@ func (c *Client) addOperationDeleteCustomKeyStoreMiddlewares(stack *middleware.S if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -123,6 +131,9 @@ func (c *Client) addOperationDeleteCustomKeyStoreMiddlewares(stack *middleware.S if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addDeleteCustomKeyStoreResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpDeleteCustomKeyStoreValidationMiddleware(stack); err != nil { return err } @@ -141,6 +152,9 @@ func (c *Client) addOperationDeleteCustomKeyStoreMiddlewares(stack *middleware.S if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -152,3 +166,126 @@ func newServiceMetadataMiddleware_opDeleteCustomKeyStore(region string) *awsmidd OperationName: "DeleteCustomKeyStore", } } + +type opDeleteCustomKeyStoreResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opDeleteCustomKeyStoreResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opDeleteCustomKeyStoreResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "kms" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "kms" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("kms") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addDeleteCustomKeyStoreResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opDeleteCustomKeyStoreResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_DeleteImportedKeyMaterial.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_DeleteImportedKeyMaterial.go index cf5fff6df0..0bd9cad986 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_DeleteImportedKeyMaterial.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_DeleteImportedKeyMaterial.go @@ -4,8 +4,13 @@ package kms import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -72,6 +77,9 @@ func (c *Client) addOperationDeleteImportedKeyMaterialMiddlewares(stack *middlew if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -108,6 +116,9 @@ func (c *Client) addOperationDeleteImportedKeyMaterialMiddlewares(stack *middlew if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addDeleteImportedKeyMaterialResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpDeleteImportedKeyMaterialValidationMiddleware(stack); err != nil { return err } @@ -126,6 +137,9 @@ func (c *Client) addOperationDeleteImportedKeyMaterialMiddlewares(stack *middlew if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -137,3 +151,126 @@ func newServiceMetadataMiddleware_opDeleteImportedKeyMaterial(region string) *aw OperationName: "DeleteImportedKeyMaterial", } } + +type opDeleteImportedKeyMaterialResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opDeleteImportedKeyMaterialResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opDeleteImportedKeyMaterialResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "kms" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "kms" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("kms") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addDeleteImportedKeyMaterialResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opDeleteImportedKeyMaterialResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_DescribeCustomKeyStores.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_DescribeCustomKeyStores.go index b28085ef43..7bf95a2013 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_DescribeCustomKeyStores.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_DescribeCustomKeyStores.go @@ -4,10 +4,14 @@ package kms import ( "context" + "errors" "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" "github.com/aws/aws-sdk-go-v2/service/kms/types" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -120,6 +124,9 @@ func (c *Client) addOperationDescribeCustomKeyStoresMiddlewares(stack *middlewar if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -156,6 +163,9 @@ func (c *Client) addOperationDescribeCustomKeyStoresMiddlewares(stack *middlewar if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addDescribeCustomKeyStoresResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = stack.Initialize.Add(newServiceMetadataMiddleware_opDescribeCustomKeyStores(options.Region), middleware.Before); err != nil { return err } @@ -171,6 +181,9 @@ func (c *Client) addOperationDescribeCustomKeyStoresMiddlewares(stack *middlewar if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -276,3 +289,126 @@ func newServiceMetadataMiddleware_opDescribeCustomKeyStores(region string) *awsm OperationName: "DescribeCustomKeyStores", } } + +type opDescribeCustomKeyStoresResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opDescribeCustomKeyStoresResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opDescribeCustomKeyStoresResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "kms" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "kms" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("kms") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addDescribeCustomKeyStoresResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opDescribeCustomKeyStoresResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_DescribeKey.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_DescribeKey.go index 2d2c32a3eb..ddc9d2f0a1 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_DescribeKey.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_DescribeKey.go @@ -4,9 +4,14 @@ package kms import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" "github.com/aws/aws-sdk-go-v2/service/kms/types" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -116,6 +121,9 @@ func (c *Client) addOperationDescribeKeyMiddlewares(stack *middleware.Stack, opt if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -152,6 +160,9 @@ func (c *Client) addOperationDescribeKeyMiddlewares(stack *middleware.Stack, opt if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addDescribeKeyResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpDescribeKeyValidationMiddleware(stack); err != nil { return err } @@ -170,6 +181,9 @@ func (c *Client) addOperationDescribeKeyMiddlewares(stack *middleware.Stack, opt if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -181,3 +195,126 @@ func newServiceMetadataMiddleware_opDescribeKey(region string) *awsmiddleware.Re OperationName: "DescribeKey", } } + +type opDescribeKeyResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opDescribeKeyResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opDescribeKeyResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "kms" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "kms" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("kms") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addDescribeKeyResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opDescribeKeyResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_DisableKey.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_DisableKey.go index 816d804b25..215e02b566 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_DisableKey.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_DisableKey.go @@ -4,8 +4,13 @@ package kms import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -67,6 +72,9 @@ func (c *Client) addOperationDisableKeyMiddlewares(stack *middleware.Stack, opti if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -103,6 +111,9 @@ func (c *Client) addOperationDisableKeyMiddlewares(stack *middleware.Stack, opti if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addDisableKeyResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpDisableKeyValidationMiddleware(stack); err != nil { return err } @@ -121,6 +132,9 @@ func (c *Client) addOperationDisableKeyMiddlewares(stack *middleware.Stack, opti if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -132,3 +146,126 @@ func newServiceMetadataMiddleware_opDisableKey(region string) *awsmiddleware.Reg OperationName: "DisableKey", } } + +type opDisableKeyResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opDisableKeyResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opDisableKeyResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "kms" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "kms" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("kms") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addDisableKeyResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opDisableKeyResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_DisableKeyRotation.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_DisableKeyRotation.go index 2089e92914..6a8ebe1845 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_DisableKeyRotation.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_DisableKeyRotation.go @@ -4,8 +4,13 @@ package kms import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -83,6 +88,9 @@ func (c *Client) addOperationDisableKeyRotationMiddlewares(stack *middleware.Sta if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -119,6 +127,9 @@ func (c *Client) addOperationDisableKeyRotationMiddlewares(stack *middleware.Sta if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addDisableKeyRotationResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpDisableKeyRotationValidationMiddleware(stack); err != nil { return err } @@ -137,6 +148,9 @@ func (c *Client) addOperationDisableKeyRotationMiddlewares(stack *middleware.Sta if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -148,3 +162,126 @@ func newServiceMetadataMiddleware_opDisableKeyRotation(region string) *awsmiddle OperationName: "DisableKeyRotation", } } + +type opDisableKeyRotationResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opDisableKeyRotationResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opDisableKeyRotationResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "kms" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "kms" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("kms") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addDisableKeyRotationResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opDisableKeyRotationResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_DisconnectCustomKeyStore.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_DisconnectCustomKeyStore.go index 252deb9edb..40985526cb 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_DisconnectCustomKeyStore.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_DisconnectCustomKeyStore.go @@ -4,8 +4,13 @@ package kms import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -78,6 +83,9 @@ func (c *Client) addOperationDisconnectCustomKeyStoreMiddlewares(stack *middlewa if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -114,6 +122,9 @@ func (c *Client) addOperationDisconnectCustomKeyStoreMiddlewares(stack *middlewa if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addDisconnectCustomKeyStoreResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpDisconnectCustomKeyStoreValidationMiddleware(stack); err != nil { return err } @@ -132,6 +143,9 @@ func (c *Client) addOperationDisconnectCustomKeyStoreMiddlewares(stack *middlewa if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -143,3 +157,126 @@ func newServiceMetadataMiddleware_opDisconnectCustomKeyStore(region string) *aws OperationName: "DisconnectCustomKeyStore", } } + +type opDisconnectCustomKeyStoreResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opDisconnectCustomKeyStoreResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opDisconnectCustomKeyStoreResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "kms" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "kms" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("kms") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addDisconnectCustomKeyStoreResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opDisconnectCustomKeyStoreResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_EnableKey.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_EnableKey.go index e1e0d8b6f6..f0a3e045d1 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_EnableKey.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_EnableKey.go @@ -4,8 +4,13 @@ package kms import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -64,6 +69,9 @@ func (c *Client) addOperationEnableKeyMiddlewares(stack *middleware.Stack, optio if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -100,6 +108,9 @@ func (c *Client) addOperationEnableKeyMiddlewares(stack *middleware.Stack, optio if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addEnableKeyResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpEnableKeyValidationMiddleware(stack); err != nil { return err } @@ -118,6 +129,9 @@ func (c *Client) addOperationEnableKeyMiddlewares(stack *middleware.Stack, optio if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -129,3 +143,126 @@ func newServiceMetadataMiddleware_opEnableKey(region string) *awsmiddleware.Regi OperationName: "EnableKey", } } + +type opEnableKeyResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opEnableKeyResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opEnableKeyResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "kms" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "kms" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("kms") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addEnableKeyResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opEnableKeyResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_EnableKeyRotation.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_EnableKeyRotation.go index f47cbd0b2e..f45c60dfec 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_EnableKeyRotation.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_EnableKeyRotation.go @@ -4,8 +4,13 @@ package kms import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -94,6 +99,9 @@ func (c *Client) addOperationEnableKeyRotationMiddlewares(stack *middleware.Stac if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -130,6 +138,9 @@ func (c *Client) addOperationEnableKeyRotationMiddlewares(stack *middleware.Stac if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addEnableKeyRotationResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpEnableKeyRotationValidationMiddleware(stack); err != nil { return err } @@ -148,6 +159,9 @@ func (c *Client) addOperationEnableKeyRotationMiddlewares(stack *middleware.Stac if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -159,3 +173,126 @@ func newServiceMetadataMiddleware_opEnableKeyRotation(region string) *awsmiddlew OperationName: "EnableKeyRotation", } } + +type opEnableKeyRotationResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opEnableKeyRotationResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opEnableKeyRotationResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "kms" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "kms" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("kms") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addEnableKeyRotationResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opEnableKeyRotationResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_Encrypt.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_Encrypt.go index 32b80d29e6..275752f188 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_Encrypt.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_Encrypt.go @@ -4,9 +4,14 @@ package kms import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" "github.com/aws/aws-sdk-go-v2/service/kms/types" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -165,6 +170,9 @@ func (c *Client) addOperationEncryptMiddlewares(stack *middleware.Stack, options if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -201,6 +209,9 @@ func (c *Client) addOperationEncryptMiddlewares(stack *middleware.Stack, options if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addEncryptResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpEncryptValidationMiddleware(stack); err != nil { return err } @@ -219,6 +230,9 @@ func (c *Client) addOperationEncryptMiddlewares(stack *middleware.Stack, options if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -230,3 +244,126 @@ func newServiceMetadataMiddleware_opEncrypt(region string) *awsmiddleware.Regist OperationName: "Encrypt", } } + +type opEncryptResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opEncryptResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opEncryptResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "kms" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "kms" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("kms") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addEncryptResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opEncryptResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_GenerateDataKey.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_GenerateDataKey.go index a3167b6fea..8aff105d15 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_GenerateDataKey.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_GenerateDataKey.go @@ -4,9 +4,14 @@ package kms import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" "github.com/aws/aws-sdk-go-v2/service/kms/types" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -216,6 +221,9 @@ func (c *Client) addOperationGenerateDataKeyMiddlewares(stack *middleware.Stack, if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -252,6 +260,9 @@ func (c *Client) addOperationGenerateDataKeyMiddlewares(stack *middleware.Stack, if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addGenerateDataKeyResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpGenerateDataKeyValidationMiddleware(stack); err != nil { return err } @@ -270,6 +281,9 @@ func (c *Client) addOperationGenerateDataKeyMiddlewares(stack *middleware.Stack, if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -281,3 +295,126 @@ func newServiceMetadataMiddleware_opGenerateDataKey(region string) *awsmiddlewar OperationName: "GenerateDataKey", } } + +type opGenerateDataKeyResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opGenerateDataKeyResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opGenerateDataKeyResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "kms" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "kms" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("kms") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addGenerateDataKeyResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opGenerateDataKeyResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_GenerateDataKeyPair.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_GenerateDataKeyPair.go index d530b8c3b3..525f8b3a1c 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_GenerateDataKeyPair.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_GenerateDataKeyPair.go @@ -4,9 +4,14 @@ package kms import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" "github.com/aws/aws-sdk-go-v2/service/kms/types" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -214,6 +219,9 @@ func (c *Client) addOperationGenerateDataKeyPairMiddlewares(stack *middleware.St if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -250,6 +258,9 @@ func (c *Client) addOperationGenerateDataKeyPairMiddlewares(stack *middleware.St if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addGenerateDataKeyPairResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpGenerateDataKeyPairValidationMiddleware(stack); err != nil { return err } @@ -268,6 +279,9 @@ func (c *Client) addOperationGenerateDataKeyPairMiddlewares(stack *middleware.St if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -279,3 +293,126 @@ func newServiceMetadataMiddleware_opGenerateDataKeyPair(region string) *awsmiddl OperationName: "GenerateDataKeyPair", } } + +type opGenerateDataKeyPairResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opGenerateDataKeyPairResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opGenerateDataKeyPairResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "kms" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "kms" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("kms") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addGenerateDataKeyPairResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opGenerateDataKeyPairResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_GenerateDataKeyPairWithoutPlaintext.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_GenerateDataKeyPairWithoutPlaintext.go index 040f400e04..fdfc76c7cd 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_GenerateDataKeyPairWithoutPlaintext.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_GenerateDataKeyPairWithoutPlaintext.go @@ -4,9 +4,14 @@ package kms import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" "github.com/aws/aws-sdk-go-v2/service/kms/types" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -156,6 +161,9 @@ func (c *Client) addOperationGenerateDataKeyPairWithoutPlaintextMiddlewares(stac if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -192,6 +200,9 @@ func (c *Client) addOperationGenerateDataKeyPairWithoutPlaintextMiddlewares(stac if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addGenerateDataKeyPairWithoutPlaintextResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpGenerateDataKeyPairWithoutPlaintextValidationMiddleware(stack); err != nil { return err } @@ -210,6 +221,9 @@ func (c *Client) addOperationGenerateDataKeyPairWithoutPlaintextMiddlewares(stac if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -221,3 +235,126 @@ func newServiceMetadataMiddleware_opGenerateDataKeyPairWithoutPlaintext(region s OperationName: "GenerateDataKeyPairWithoutPlaintext", } } + +type opGenerateDataKeyPairWithoutPlaintextResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opGenerateDataKeyPairWithoutPlaintextResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opGenerateDataKeyPairWithoutPlaintextResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "kms" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "kms" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("kms") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addGenerateDataKeyPairWithoutPlaintextResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opGenerateDataKeyPairWithoutPlaintextResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_GenerateDataKeyWithoutPlaintext.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_GenerateDataKeyWithoutPlaintext.go index 388300e830..f8af8fb61b 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_GenerateDataKeyWithoutPlaintext.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_GenerateDataKeyWithoutPlaintext.go @@ -4,9 +4,14 @@ package kms import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" "github.com/aws/aws-sdk-go-v2/service/kms/types" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -153,6 +158,9 @@ func (c *Client) addOperationGenerateDataKeyWithoutPlaintextMiddlewares(stack *m if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -189,6 +197,9 @@ func (c *Client) addOperationGenerateDataKeyWithoutPlaintextMiddlewares(stack *m if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addGenerateDataKeyWithoutPlaintextResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpGenerateDataKeyWithoutPlaintextValidationMiddleware(stack); err != nil { return err } @@ -207,6 +218,9 @@ func (c *Client) addOperationGenerateDataKeyWithoutPlaintextMiddlewares(stack *m if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -218,3 +232,126 @@ func newServiceMetadataMiddleware_opGenerateDataKeyWithoutPlaintext(region strin OperationName: "GenerateDataKeyWithoutPlaintext", } } + +type opGenerateDataKeyWithoutPlaintextResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opGenerateDataKeyWithoutPlaintextResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opGenerateDataKeyWithoutPlaintextResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "kms" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "kms" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("kms") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addGenerateDataKeyWithoutPlaintextResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opGenerateDataKeyWithoutPlaintextResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_GenerateMac.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_GenerateMac.go index b31fbc6a05..1cf9cb6a24 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_GenerateMac.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_GenerateMac.go @@ -4,9 +4,14 @@ package kms import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" "github.com/aws/aws-sdk-go-v2/service/kms/types" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -117,6 +122,9 @@ func (c *Client) addOperationGenerateMacMiddlewares(stack *middleware.Stack, opt if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -153,6 +161,9 @@ func (c *Client) addOperationGenerateMacMiddlewares(stack *middleware.Stack, opt if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addGenerateMacResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpGenerateMacValidationMiddleware(stack); err != nil { return err } @@ -171,6 +182,9 @@ func (c *Client) addOperationGenerateMacMiddlewares(stack *middleware.Stack, opt if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -182,3 +196,126 @@ func newServiceMetadataMiddleware_opGenerateMac(region string) *awsmiddleware.Re OperationName: "GenerateMac", } } + +type opGenerateMacResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opGenerateMacResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opGenerateMacResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "kms" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "kms" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("kms") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addGenerateMacResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opGenerateMacResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_GenerateRandom.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_GenerateRandom.go index b6af617cca..e1df822da2 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_GenerateRandom.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_GenerateRandom.go @@ -4,9 +4,14 @@ package kms import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" "github.com/aws/aws-sdk-go-v2/service/kms/types" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -112,6 +117,9 @@ func (c *Client) addOperationGenerateRandomMiddlewares(stack *middleware.Stack, if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -148,6 +156,9 @@ func (c *Client) addOperationGenerateRandomMiddlewares(stack *middleware.Stack, if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addGenerateRandomResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = stack.Initialize.Add(newServiceMetadataMiddleware_opGenerateRandom(options.Region), middleware.Before); err != nil { return err } @@ -163,6 +174,9 @@ func (c *Client) addOperationGenerateRandomMiddlewares(stack *middleware.Stack, if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -174,3 +188,126 @@ func newServiceMetadataMiddleware_opGenerateRandom(region string) *awsmiddleware OperationName: "GenerateRandom", } } + +type opGenerateRandomResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opGenerateRandomResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opGenerateRandomResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "kms" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "kms" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("kms") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addGenerateRandomResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opGenerateRandomResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_GetKeyPolicy.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_GetKeyPolicy.go index ddc51a7dcf..6fbe726cd9 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_GetKeyPolicy.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_GetKeyPolicy.go @@ -4,8 +4,13 @@ package kms import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -70,6 +75,9 @@ func (c *Client) addOperationGetKeyPolicyMiddlewares(stack *middleware.Stack, op if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -106,6 +114,9 @@ func (c *Client) addOperationGetKeyPolicyMiddlewares(stack *middleware.Stack, op if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addGetKeyPolicyResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpGetKeyPolicyValidationMiddleware(stack); err != nil { return err } @@ -124,6 +135,9 @@ func (c *Client) addOperationGetKeyPolicyMiddlewares(stack *middleware.Stack, op if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -135,3 +149,126 @@ func newServiceMetadataMiddleware_opGetKeyPolicy(region string) *awsmiddleware.R OperationName: "GetKeyPolicy", } } + +type opGetKeyPolicyResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opGetKeyPolicyResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opGetKeyPolicyResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "kms" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "kms" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("kms") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addGetKeyPolicyResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opGetKeyPolicyResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_GetKeyRotationStatus.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_GetKeyRotationStatus.go index 6882a189f9..201fa5b034 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_GetKeyRotationStatus.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_GetKeyRotationStatus.go @@ -4,8 +4,13 @@ package kms import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -102,6 +107,9 @@ func (c *Client) addOperationGetKeyRotationStatusMiddlewares(stack *middleware.S if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -138,6 +146,9 @@ func (c *Client) addOperationGetKeyRotationStatusMiddlewares(stack *middleware.S if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addGetKeyRotationStatusResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpGetKeyRotationStatusValidationMiddleware(stack); err != nil { return err } @@ -156,6 +167,9 @@ func (c *Client) addOperationGetKeyRotationStatusMiddlewares(stack *middleware.S if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -167,3 +181,126 @@ func newServiceMetadataMiddleware_opGetKeyRotationStatus(region string) *awsmidd OperationName: "GetKeyRotationStatus", } } + +type opGetKeyRotationStatusResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opGetKeyRotationStatusResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opGetKeyRotationStatusResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "kms" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "kms" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("kms") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addGetKeyRotationStatusResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opGetKeyRotationStatusResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_GetParametersForImport.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_GetParametersForImport.go index 09eb94c811..a26c7d83af 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_GetParametersForImport.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_GetParametersForImport.go @@ -4,9 +4,14 @@ package kms import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" "github.com/aws/aws-sdk-go-v2/service/kms/types" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" "time" @@ -157,6 +162,9 @@ func (c *Client) addOperationGetParametersForImportMiddlewares(stack *middleware if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -193,6 +201,9 @@ func (c *Client) addOperationGetParametersForImportMiddlewares(stack *middleware if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addGetParametersForImportResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpGetParametersForImportValidationMiddleware(stack); err != nil { return err } @@ -211,6 +222,9 @@ func (c *Client) addOperationGetParametersForImportMiddlewares(stack *middleware if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -222,3 +236,126 @@ func newServiceMetadataMiddleware_opGetParametersForImport(region string) *awsmi OperationName: "GetParametersForImport", } } + +type opGetParametersForImportResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opGetParametersForImportResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opGetParametersForImportResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "kms" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "kms" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("kms") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addGetParametersForImportResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opGetParametersForImportResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_GetPublicKey.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_GetPublicKey.go index 15f726e805..71dce586d8 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_GetPublicKey.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_GetPublicKey.go @@ -4,9 +4,14 @@ package kms import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" "github.com/aws/aws-sdk-go-v2/service/kms/types" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -146,6 +151,9 @@ func (c *Client) addOperationGetPublicKeyMiddlewares(stack *middleware.Stack, op if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -182,6 +190,9 @@ func (c *Client) addOperationGetPublicKeyMiddlewares(stack *middleware.Stack, op if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addGetPublicKeyResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpGetPublicKeyValidationMiddleware(stack); err != nil { return err } @@ -200,6 +211,9 @@ func (c *Client) addOperationGetPublicKeyMiddlewares(stack *middleware.Stack, op if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -211,3 +225,126 @@ func newServiceMetadataMiddleware_opGetPublicKey(region string) *awsmiddleware.R OperationName: "GetPublicKey", } } + +type opGetPublicKeyResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opGetPublicKeyResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opGetPublicKeyResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "kms" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "kms" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("kms") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addGetPublicKeyResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opGetPublicKeyResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_ImportKeyMaterial.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_ImportKeyMaterial.go index 8fbe635fdf..f3542e9b13 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_ImportKeyMaterial.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_ImportKeyMaterial.go @@ -4,9 +4,14 @@ package kms import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" "github.com/aws/aws-sdk-go-v2/service/kms/types" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" "time" @@ -175,6 +180,9 @@ func (c *Client) addOperationImportKeyMaterialMiddlewares(stack *middleware.Stac if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -211,6 +219,9 @@ func (c *Client) addOperationImportKeyMaterialMiddlewares(stack *middleware.Stac if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addImportKeyMaterialResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpImportKeyMaterialValidationMiddleware(stack); err != nil { return err } @@ -229,6 +240,9 @@ func (c *Client) addOperationImportKeyMaterialMiddlewares(stack *middleware.Stac if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -240,3 +254,126 @@ func newServiceMetadataMiddleware_opImportKeyMaterial(region string) *awsmiddlew OperationName: "ImportKeyMaterial", } } + +type opImportKeyMaterialResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opImportKeyMaterialResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opImportKeyMaterialResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "kms" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "kms" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("kms") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addImportKeyMaterialResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opImportKeyMaterialResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_ListAliases.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_ListAliases.go index 188b30f7ab..53693bce8b 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_ListAliases.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_ListAliases.go @@ -4,10 +4,14 @@ package kms import ( "context" + "errors" "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" "github.com/aws/aws-sdk-go-v2/service/kms/types" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -104,6 +108,9 @@ func (c *Client) addOperationListAliasesMiddlewares(stack *middleware.Stack, opt if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -140,6 +147,9 @@ func (c *Client) addOperationListAliasesMiddlewares(stack *middleware.Stack, opt if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addListAliasesResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = stack.Initialize.Add(newServiceMetadataMiddleware_opListAliases(options.Region), middleware.Before); err != nil { return err } @@ -155,6 +165,9 @@ func (c *Client) addOperationListAliasesMiddlewares(stack *middleware.Stack, opt if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -259,3 +272,126 @@ func newServiceMetadataMiddleware_opListAliases(region string) *awsmiddleware.Re OperationName: "ListAliases", } } + +type opListAliasesResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opListAliasesResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opListAliasesResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "kms" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "kms" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("kms") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addListAliasesResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opListAliasesResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_ListGrants.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_ListGrants.go index 1356b568a6..e47a9550ca 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_ListGrants.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_ListGrants.go @@ -4,10 +4,14 @@ package kms import ( "context" + "errors" "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" "github.com/aws/aws-sdk-go-v2/service/kms/types" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -112,6 +116,9 @@ func (c *Client) addOperationListGrantsMiddlewares(stack *middleware.Stack, opti if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -148,6 +155,9 @@ func (c *Client) addOperationListGrantsMiddlewares(stack *middleware.Stack, opti if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addListGrantsResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpListGrantsValidationMiddleware(stack); err != nil { return err } @@ -166,6 +176,9 @@ func (c *Client) addOperationListGrantsMiddlewares(stack *middleware.Stack, opti if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -270,3 +283,126 @@ func newServiceMetadataMiddleware_opListGrants(region string) *awsmiddleware.Reg OperationName: "ListGrants", } } + +type opListGrantsResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opListGrantsResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opListGrantsResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "kms" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "kms" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("kms") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addListGrantsResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opListGrantsResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_ListKeyPolicies.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_ListKeyPolicies.go index d215351d94..ce9648bfeb 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_ListKeyPolicies.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_ListKeyPolicies.go @@ -4,9 +4,13 @@ package kms import ( "context" + "errors" "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -91,6 +95,9 @@ func (c *Client) addOperationListKeyPoliciesMiddlewares(stack *middleware.Stack, if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -127,6 +134,9 @@ func (c *Client) addOperationListKeyPoliciesMiddlewares(stack *middleware.Stack, if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addListKeyPoliciesResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpListKeyPoliciesValidationMiddleware(stack); err != nil { return err } @@ -145,6 +155,9 @@ func (c *Client) addOperationListKeyPoliciesMiddlewares(stack *middleware.Stack, if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -250,3 +263,126 @@ func newServiceMetadataMiddleware_opListKeyPolicies(region string) *awsmiddlewar OperationName: "ListKeyPolicies", } } + +type opListKeyPoliciesResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opListKeyPoliciesResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opListKeyPoliciesResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "kms" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "kms" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("kms") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addListKeyPoliciesResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opListKeyPoliciesResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_ListKeys.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_ListKeys.go index bf29fe806a..b69da7090d 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_ListKeys.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_ListKeys.go @@ -4,10 +4,14 @@ package kms import ( "context" + "errors" "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" "github.com/aws/aws-sdk-go-v2/service/kms/types" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -82,6 +86,9 @@ func (c *Client) addOperationListKeysMiddlewares(stack *middleware.Stack, option if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -118,6 +125,9 @@ func (c *Client) addOperationListKeysMiddlewares(stack *middleware.Stack, option if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addListKeysResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = stack.Initialize.Add(newServiceMetadataMiddleware_opListKeys(options.Region), middleware.Before); err != nil { return err } @@ -133,6 +143,9 @@ func (c *Client) addOperationListKeysMiddlewares(stack *middleware.Stack, option if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -237,3 +250,126 @@ func newServiceMetadataMiddleware_opListKeys(region string) *awsmiddleware.Regis OperationName: "ListKeys", } } + +type opListKeysResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opListKeysResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opListKeysResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "kms" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "kms" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("kms") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addListKeysResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opListKeysResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_ListResourceTags.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_ListResourceTags.go index 05c28dba38..50be86fbfe 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_ListResourceTags.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_ListResourceTags.go @@ -4,10 +4,14 @@ package kms import ( "context" + "errors" "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" "github.com/aws/aws-sdk-go-v2/service/kms/types" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -101,6 +105,9 @@ func (c *Client) addOperationListResourceTagsMiddlewares(stack *middleware.Stack if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -137,6 +144,9 @@ func (c *Client) addOperationListResourceTagsMiddlewares(stack *middleware.Stack if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addListResourceTagsResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpListResourceTagsValidationMiddleware(stack); err != nil { return err } @@ -155,6 +165,9 @@ func (c *Client) addOperationListResourceTagsMiddlewares(stack *middleware.Stack if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -260,3 +273,126 @@ func newServiceMetadataMiddleware_opListResourceTags(region string) *awsmiddlewa OperationName: "ListResourceTags", } } + +type opListResourceTagsResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opListResourceTagsResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opListResourceTagsResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "kms" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "kms" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("kms") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addListResourceTagsResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opListResourceTagsResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_ListRetirableGrants.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_ListRetirableGrants.go index 3156e5812a..850774e070 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_ListRetirableGrants.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_ListRetirableGrants.go @@ -4,10 +4,14 @@ package kms import ( "context" + "errors" "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" "github.com/aws/aws-sdk-go-v2/service/kms/types" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -104,6 +108,9 @@ func (c *Client) addOperationListRetirableGrantsMiddlewares(stack *middleware.St if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -140,6 +147,9 @@ func (c *Client) addOperationListRetirableGrantsMiddlewares(stack *middleware.St if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addListRetirableGrantsResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpListRetirableGrantsValidationMiddleware(stack); err != nil { return err } @@ -158,6 +168,9 @@ func (c *Client) addOperationListRetirableGrantsMiddlewares(stack *middleware.St if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -264,3 +277,126 @@ func newServiceMetadataMiddleware_opListRetirableGrants(region string) *awsmiddl OperationName: "ListRetirableGrants", } } + +type opListRetirableGrantsResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opListRetirableGrantsResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opListRetirableGrantsResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "kms" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "kms" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("kms") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addListRetirableGrantsResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opListRetirableGrantsResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_PutKeyPolicy.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_PutKeyPolicy.go index 8c3e7bca73..5b021ca2b8 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_PutKeyPolicy.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_PutKeyPolicy.go @@ -4,8 +4,13 @@ package kms import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -109,6 +114,9 @@ func (c *Client) addOperationPutKeyPolicyMiddlewares(stack *middleware.Stack, op if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -145,6 +153,9 @@ func (c *Client) addOperationPutKeyPolicyMiddlewares(stack *middleware.Stack, op if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addPutKeyPolicyResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpPutKeyPolicyValidationMiddleware(stack); err != nil { return err } @@ -163,6 +174,9 @@ func (c *Client) addOperationPutKeyPolicyMiddlewares(stack *middleware.Stack, op if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -174,3 +188,126 @@ func newServiceMetadataMiddleware_opPutKeyPolicy(region string) *awsmiddleware.R OperationName: "PutKeyPolicy", } } + +type opPutKeyPolicyResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opPutKeyPolicyResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opPutKeyPolicyResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "kms" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "kms" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("kms") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addPutKeyPolicyResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opPutKeyPolicyResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_ReEncrypt.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_ReEncrypt.go index 32a72df542..0123d678ed 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_ReEncrypt.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_ReEncrypt.go @@ -4,9 +4,14 @@ package kms import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" "github.com/aws/aws-sdk-go-v2/service/kms/types" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -229,6 +234,9 @@ func (c *Client) addOperationReEncryptMiddlewares(stack *middleware.Stack, optio if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -265,6 +273,9 @@ func (c *Client) addOperationReEncryptMiddlewares(stack *middleware.Stack, optio if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addReEncryptResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpReEncryptValidationMiddleware(stack); err != nil { return err } @@ -283,6 +294,9 @@ func (c *Client) addOperationReEncryptMiddlewares(stack *middleware.Stack, optio if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -294,3 +308,126 @@ func newServiceMetadataMiddleware_opReEncrypt(region string) *awsmiddleware.Regi OperationName: "ReEncrypt", } } + +type opReEncryptResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opReEncryptResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opReEncryptResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "kms" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "kms" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("kms") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addReEncryptResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opReEncryptResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_ReplicateKey.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_ReplicateKey.go index 82299cf17c..d7a6784d7e 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_ReplicateKey.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_ReplicateKey.go @@ -4,9 +4,14 @@ package kms import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" "github.com/aws/aws-sdk-go-v2/service/kms/types" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -230,6 +235,9 @@ func (c *Client) addOperationReplicateKeyMiddlewares(stack *middleware.Stack, op if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -266,6 +274,9 @@ func (c *Client) addOperationReplicateKeyMiddlewares(stack *middleware.Stack, op if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addReplicateKeyResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpReplicateKeyValidationMiddleware(stack); err != nil { return err } @@ -284,6 +295,9 @@ func (c *Client) addOperationReplicateKeyMiddlewares(stack *middleware.Stack, op if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -295,3 +309,126 @@ func newServiceMetadataMiddleware_opReplicateKey(region string) *awsmiddleware.R OperationName: "ReplicateKey", } } + +type opReplicateKeyResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opReplicateKeyResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opReplicateKeyResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "kms" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "kms" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("kms") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addReplicateKeyResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opReplicateKeyResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_RetireGrant.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_RetireGrant.go index dd742efcc1..e6cd7d9072 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_RetireGrant.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_RetireGrant.go @@ -4,8 +4,13 @@ package kms import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -90,6 +95,9 @@ func (c *Client) addOperationRetireGrantMiddlewares(stack *middleware.Stack, opt if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -126,6 +134,9 @@ func (c *Client) addOperationRetireGrantMiddlewares(stack *middleware.Stack, opt if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addRetireGrantResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = stack.Initialize.Add(newServiceMetadataMiddleware_opRetireGrant(options.Region), middleware.Before); err != nil { return err } @@ -141,6 +152,9 @@ func (c *Client) addOperationRetireGrantMiddlewares(stack *middleware.Stack, opt if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -152,3 +166,126 @@ func newServiceMetadataMiddleware_opRetireGrant(region string) *awsmiddleware.Re OperationName: "RetireGrant", } } + +type opRetireGrantResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opRetireGrantResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opRetireGrantResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "kms" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "kms" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("kms") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addRetireGrantResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opRetireGrantResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_RevokeGrant.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_RevokeGrant.go index 0031fd5c29..5925a30e65 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_RevokeGrant.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_RevokeGrant.go @@ -4,8 +4,13 @@ package kms import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -87,6 +92,9 @@ func (c *Client) addOperationRevokeGrantMiddlewares(stack *middleware.Stack, opt if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -123,6 +131,9 @@ func (c *Client) addOperationRevokeGrantMiddlewares(stack *middleware.Stack, opt if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addRevokeGrantResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpRevokeGrantValidationMiddleware(stack); err != nil { return err } @@ -141,6 +152,9 @@ func (c *Client) addOperationRevokeGrantMiddlewares(stack *middleware.Stack, opt if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -152,3 +166,126 @@ func newServiceMetadataMiddleware_opRevokeGrant(region string) *awsmiddleware.Re OperationName: "RevokeGrant", } } + +type opRevokeGrantResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opRevokeGrantResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opRevokeGrantResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "kms" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "kms" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("kms") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addRevokeGrantResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opRevokeGrantResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_ScheduleKeyDeletion.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_ScheduleKeyDeletion.go index 589a6ada4d..784a98570f 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_ScheduleKeyDeletion.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_ScheduleKeyDeletion.go @@ -4,9 +4,14 @@ package kms import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" "github.com/aws/aws-sdk-go-v2/service/kms/types" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" "time" @@ -132,6 +137,9 @@ func (c *Client) addOperationScheduleKeyDeletionMiddlewares(stack *middleware.St if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -168,6 +176,9 @@ func (c *Client) addOperationScheduleKeyDeletionMiddlewares(stack *middleware.St if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addScheduleKeyDeletionResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpScheduleKeyDeletionValidationMiddleware(stack); err != nil { return err } @@ -186,6 +197,9 @@ func (c *Client) addOperationScheduleKeyDeletionMiddlewares(stack *middleware.St if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -197,3 +211,126 @@ func newServiceMetadataMiddleware_opScheduleKeyDeletion(region string) *awsmiddl OperationName: "ScheduleKeyDeletion", } } + +type opScheduleKeyDeletionResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opScheduleKeyDeletionResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opScheduleKeyDeletionResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "kms" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "kms" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("kms") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addScheduleKeyDeletionResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opScheduleKeyDeletionResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_Sign.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_Sign.go index 6cfa7f19f0..7b2ef38792 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_Sign.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_Sign.go @@ -4,9 +4,14 @@ package kms import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" "github.com/aws/aws-sdk-go-v2/service/kms/types" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -176,6 +181,9 @@ func (c *Client) addOperationSignMiddlewares(stack *middleware.Stack, options Op if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -212,6 +220,9 @@ func (c *Client) addOperationSignMiddlewares(stack *middleware.Stack, options Op if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addSignResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpSignValidationMiddleware(stack); err != nil { return err } @@ -230,6 +241,9 @@ func (c *Client) addOperationSignMiddlewares(stack *middleware.Stack, options Op if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -241,3 +255,126 @@ func newServiceMetadataMiddleware_opSign(region string) *awsmiddleware.RegisterS OperationName: "Sign", } } + +type opSignResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opSignResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opSignResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "kms" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "kms" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("kms") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addSignResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opSignResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_TagResource.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_TagResource.go index 86d2a05478..1199a720e4 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_TagResource.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_TagResource.go @@ -4,9 +4,14 @@ package kms import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" "github.com/aws/aws-sdk-go-v2/service/kms/types" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -95,6 +100,9 @@ func (c *Client) addOperationTagResourceMiddlewares(stack *middleware.Stack, opt if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -131,6 +139,9 @@ func (c *Client) addOperationTagResourceMiddlewares(stack *middleware.Stack, opt if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addTagResourceResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpTagResourceValidationMiddleware(stack); err != nil { return err } @@ -149,6 +160,9 @@ func (c *Client) addOperationTagResourceMiddlewares(stack *middleware.Stack, opt if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -160,3 +174,126 @@ func newServiceMetadataMiddleware_opTagResource(region string) *awsmiddleware.Re OperationName: "TagResource", } } + +type opTagResourceResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opTagResourceResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opTagResourceResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "kms" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "kms" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("kms") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addTagResourceResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opTagResourceResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_UntagResource.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_UntagResource.go index 4c3b414d95..14020fdf1b 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_UntagResource.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_UntagResource.go @@ -4,8 +4,13 @@ package kms import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -83,6 +88,9 @@ func (c *Client) addOperationUntagResourceMiddlewares(stack *middleware.Stack, o if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -119,6 +127,9 @@ func (c *Client) addOperationUntagResourceMiddlewares(stack *middleware.Stack, o if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addUntagResourceResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpUntagResourceValidationMiddleware(stack); err != nil { return err } @@ -137,6 +148,9 @@ func (c *Client) addOperationUntagResourceMiddlewares(stack *middleware.Stack, o if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -148,3 +162,126 @@ func newServiceMetadataMiddleware_opUntagResource(region string) *awsmiddleware. OperationName: "UntagResource", } } + +type opUntagResourceResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opUntagResourceResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opUntagResourceResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "kms" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "kms" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("kms") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addUntagResourceResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opUntagResourceResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_UpdateAlias.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_UpdateAlias.go index 7d46df62d8..551f8fe9ef 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_UpdateAlias.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_UpdateAlias.go @@ -4,8 +4,13 @@ package kms import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -104,6 +109,9 @@ func (c *Client) addOperationUpdateAliasMiddlewares(stack *middleware.Stack, opt if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -140,6 +148,9 @@ func (c *Client) addOperationUpdateAliasMiddlewares(stack *middleware.Stack, opt if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addUpdateAliasResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpUpdateAliasValidationMiddleware(stack); err != nil { return err } @@ -158,6 +169,9 @@ func (c *Client) addOperationUpdateAliasMiddlewares(stack *middleware.Stack, opt if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -169,3 +183,126 @@ func newServiceMetadataMiddleware_opUpdateAlias(region string) *awsmiddleware.Re OperationName: "UpdateAlias", } } + +type opUpdateAliasResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opUpdateAliasResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opUpdateAliasResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "kms" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "kms" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("kms") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addUpdateAliasResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opUpdateAliasResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_UpdateCustomKeyStore.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_UpdateCustomKeyStore.go index 18d296d9b1..8cff478dfe 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_UpdateCustomKeyStore.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_UpdateCustomKeyStore.go @@ -4,9 +4,14 @@ package kms import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" "github.com/aws/aws-sdk-go-v2/service/kms/types" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -194,6 +199,9 @@ func (c *Client) addOperationUpdateCustomKeyStoreMiddlewares(stack *middleware.S if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -230,6 +238,9 @@ func (c *Client) addOperationUpdateCustomKeyStoreMiddlewares(stack *middleware.S if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addUpdateCustomKeyStoreResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpUpdateCustomKeyStoreValidationMiddleware(stack); err != nil { return err } @@ -248,6 +259,9 @@ func (c *Client) addOperationUpdateCustomKeyStoreMiddlewares(stack *middleware.S if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -259,3 +273,126 @@ func newServiceMetadataMiddleware_opUpdateCustomKeyStore(region string) *awsmidd OperationName: "UpdateCustomKeyStore", } } + +type opUpdateCustomKeyStoreResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opUpdateCustomKeyStoreResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opUpdateCustomKeyStoreResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "kms" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "kms" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("kms") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addUpdateCustomKeyStoreResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opUpdateCustomKeyStoreResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_UpdateKeyDescription.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_UpdateKeyDescription.go index e6a48dd51b..f7e787adfe 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_UpdateKeyDescription.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_UpdateKeyDescription.go @@ -4,8 +4,13 @@ package kms import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -72,6 +77,9 @@ func (c *Client) addOperationUpdateKeyDescriptionMiddlewares(stack *middleware.S if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -108,6 +116,9 @@ func (c *Client) addOperationUpdateKeyDescriptionMiddlewares(stack *middleware.S if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addUpdateKeyDescriptionResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpUpdateKeyDescriptionValidationMiddleware(stack); err != nil { return err } @@ -126,6 +137,9 @@ func (c *Client) addOperationUpdateKeyDescriptionMiddlewares(stack *middleware.S if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -137,3 +151,126 @@ func newServiceMetadataMiddleware_opUpdateKeyDescription(region string) *awsmidd OperationName: "UpdateKeyDescription", } } + +type opUpdateKeyDescriptionResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opUpdateKeyDescriptionResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opUpdateKeyDescriptionResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "kms" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "kms" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("kms") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addUpdateKeyDescriptionResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opUpdateKeyDescriptionResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_UpdatePrimaryRegion.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_UpdatePrimaryRegion.go index a6800a8022..1f7a490102 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_UpdatePrimaryRegion.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_UpdatePrimaryRegion.go @@ -4,8 +4,13 @@ package kms import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -116,6 +121,9 @@ func (c *Client) addOperationUpdatePrimaryRegionMiddlewares(stack *middleware.St if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -152,6 +160,9 @@ func (c *Client) addOperationUpdatePrimaryRegionMiddlewares(stack *middleware.St if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addUpdatePrimaryRegionResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpUpdatePrimaryRegionValidationMiddleware(stack); err != nil { return err } @@ -170,6 +181,9 @@ func (c *Client) addOperationUpdatePrimaryRegionMiddlewares(stack *middleware.St if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -181,3 +195,126 @@ func newServiceMetadataMiddleware_opUpdatePrimaryRegion(region string) *awsmiddl OperationName: "UpdatePrimaryRegion", } } + +type opUpdatePrimaryRegionResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opUpdatePrimaryRegionResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opUpdatePrimaryRegionResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "kms" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "kms" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("kms") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addUpdatePrimaryRegionResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opUpdatePrimaryRegionResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_Verify.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_Verify.go index a8822993c7..3414bd508f 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_Verify.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_Verify.go @@ -4,9 +4,14 @@ package kms import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" "github.com/aws/aws-sdk-go-v2/service/kms/types" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -164,6 +169,9 @@ func (c *Client) addOperationVerifyMiddlewares(stack *middleware.Stack, options if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -200,6 +208,9 @@ func (c *Client) addOperationVerifyMiddlewares(stack *middleware.Stack, options if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addVerifyResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpVerifyValidationMiddleware(stack); err != nil { return err } @@ -218,6 +229,9 @@ func (c *Client) addOperationVerifyMiddlewares(stack *middleware.Stack, options if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -229,3 +243,126 @@ func newServiceMetadataMiddleware_opVerify(region string) *awsmiddleware.Registe OperationName: "Verify", } } + +type opVerifyResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opVerifyResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opVerifyResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "kms" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "kms" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("kms") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addVerifyResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opVerifyResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_VerifyMac.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_VerifyMac.go index 3b8e519740..74dec7a37d 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_VerifyMac.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/api_op_VerifyMac.go @@ -4,9 +4,14 @@ package kms import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" "github.com/aws/aws-sdk-go-v2/service/kms/types" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -121,6 +126,9 @@ func (c *Client) addOperationVerifyMacMiddlewares(stack *middleware.Stack, optio if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -157,6 +165,9 @@ func (c *Client) addOperationVerifyMacMiddlewares(stack *middleware.Stack, optio if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addVerifyMacResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpVerifyMacValidationMiddleware(stack); err != nil { return err } @@ -175,6 +186,9 @@ func (c *Client) addOperationVerifyMacMiddlewares(stack *middleware.Stack, optio if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -186,3 +200,126 @@ func newServiceMetadataMiddleware_opVerifyMac(region string) *awsmiddleware.Regi OperationName: "VerifyMac", } } + +type opVerifyMacResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opVerifyMacResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opVerifyMacResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "kms" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "kms" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("kms") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addVerifyMacResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opVerifyMacResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/endpoints.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/endpoints.go index 43b65e982c..d32d8865d1 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/endpoints.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/endpoints.go @@ -8,9 +8,13 @@ import ( "fmt" "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" + "github.com/aws/aws-sdk-go-v2/internal/endpoints/awsrulesfn" internalendpoints "github.com/aws/aws-sdk-go-v2/service/kms/internal/endpoints" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" + "github.com/aws/smithy-go/ptr" smithyhttp "github.com/aws/smithy-go/transport/http" + "net/http" "net/url" "strings" ) @@ -39,13 +43,6 @@ func (fn EndpointResolverFunc) ResolveEndpoint(region string, options EndpointRe return fn(region, options) } -func resolveDefaultEndpointConfiguration(o *Options) { - if o.EndpointResolver != nil { - return - } - o.EndpointResolver = NewDefaultEndpointResolver() -} - // EndpointResolverFromURL returns an EndpointResolver configured using the // provided endpoint url. By default, the resolved endpoint resolver uses the // client region as signing region, and the endpoint source is set to @@ -79,6 +76,10 @@ func (*ResolveEndpoint) ID() string { func (m *ResolveEndpoint) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( out middleware.SerializeOutput, metadata middleware.Metadata, err error, ) { + if !awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + req, ok := in.Request.(*smithyhttp.Request) if !ok { return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) @@ -94,6 +95,11 @@ func (m *ResolveEndpoint) HandleSerialize(ctx context.Context, in middleware.Ser var endpoint aws.Endpoint endpoint, err = m.Resolver.ResolveEndpoint(awsmiddleware.GetRegion(ctx), eo) if err != nil { + nf := (&aws.EndpointNotFoundError{}) + if errors.As(err, &nf) { + ctx = awsmiddleware.SetRequiresLegacyEndpoints(ctx, false) + return next.HandleSerialize(ctx, in) + } return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) } @@ -129,27 +135,10 @@ func removeResolveEndpointMiddleware(stack *middleware.Stack) error { type wrappedEndpointResolver struct { awsResolver aws.EndpointResolverWithOptions - resolver EndpointResolver } func (w *wrappedEndpointResolver) ResolveEndpoint(region string, options EndpointResolverOptions) (endpoint aws.Endpoint, err error) { - if w.awsResolver == nil { - goto fallback - } - endpoint, err = w.awsResolver.ResolveEndpoint(ServiceID, region, options) - if err == nil { - return endpoint, nil - } - - if nf := (&aws.EndpointNotFoundError{}); !errors.As(err, &nf) { - return endpoint, err - } - -fallback: - if w.resolver == nil { - return endpoint, fmt.Errorf("default endpoint resolver provided was nil") - } - return w.resolver.ResolveEndpoint(region, options) + return w.awsResolver.ResolveEndpoint(ServiceID, region, options) } type awsEndpointResolverAdaptor func(service, region string) (aws.Endpoint, error) @@ -160,12 +149,13 @@ func (a awsEndpointResolverAdaptor) ResolveEndpoint(service, region string, opti var _ aws.EndpointResolverWithOptions = awsEndpointResolverAdaptor(nil) -// withEndpointResolver returns an EndpointResolver that first delegates endpoint resolution to the awsResolver. -// If awsResolver returns aws.EndpointNotFoundError error, the resolver will use the the provided -// fallbackResolver for resolution. +// withEndpointResolver returns an aws.EndpointResolverWithOptions that first delegates endpoint resolution to the awsResolver. +// If awsResolver returns aws.EndpointNotFoundError error, the v1 resolver middleware will swallow the error, +// and set an appropriate context flag such that fallback will occur when EndpointResolverV2 is invoked +// via its middleware. // -// fallbackResolver must not be nil -func withEndpointResolver(awsResolver aws.EndpointResolver, awsResolverWithOptions aws.EndpointResolverWithOptions, fallbackResolver EndpointResolver) EndpointResolver { +// If another error (besides aws.EndpointNotFoundError) is returned, then that error will be propagated. +func withEndpointResolver(awsResolver aws.EndpointResolver, awsResolverWithOptions aws.EndpointResolverWithOptions) EndpointResolver { var resolver aws.EndpointResolverWithOptions if awsResolverWithOptions != nil { @@ -176,7 +166,6 @@ func withEndpointResolver(awsResolver aws.EndpointResolver, awsResolverWithOptio return &wrappedEndpointResolver{ awsResolver: resolver, - resolver: fallbackResolver, } } @@ -198,3 +187,294 @@ func finalizeClientEndpointResolverOptions(options *Options) { } } + +func resolveEndpointResolverV2(options *Options) { + if options.EndpointResolverV2 == nil { + options.EndpointResolverV2 = NewDefaultEndpointResolverV2() + } +} + +// Utility function to aid with translating pseudo-regions to classical regions +// with the appropriate setting indicated by the pseudo-region +func mapPseudoRegion(pr string) (region string, fips aws.FIPSEndpointState) { + const fipsInfix = "-fips-" + const fipsPrefix = "fips-" + const fipsSuffix = "-fips" + + if strings.Contains(pr, fipsInfix) || + strings.Contains(pr, fipsPrefix) || + strings.Contains(pr, fipsSuffix) { + region = strings.ReplaceAll(strings.ReplaceAll(strings.ReplaceAll( + pr, fipsInfix, "-"), fipsPrefix, ""), fipsSuffix, "") + fips = aws.FIPSEndpointStateEnabled + } else { + region = pr + } + + return region, fips +} + +// builtInParameterResolver is the interface responsible for resolving BuiltIn +// values during the sourcing of EndpointParameters +type builtInParameterResolver interface { + ResolveBuiltIns(*EndpointParameters) error +} + +// builtInResolver resolves modeled BuiltIn values using only the members defined +// below. +type builtInResolver struct { + // The AWS region used to dispatch the request. + Region string + + // Sourced BuiltIn value in a historical enabled or disabled state. + UseDualStack aws.DualStackEndpointState + + // Sourced BuiltIn value in a historical enabled or disabled state. + UseFIPS aws.FIPSEndpointState + + // Base endpoint that can potentially be modified during Endpoint resolution. + Endpoint *string +} + +// Invoked at runtime to resolve BuiltIn Values. Only resolution code specific to +// each BuiltIn value is generated. +func (b *builtInResolver) ResolveBuiltIns(params *EndpointParameters) error { + + region, _ := mapPseudoRegion(b.Region) + if len(region) == 0 { + return fmt.Errorf("Could not resolve AWS::Region") + } else { + params.Region = aws.String(region) + } + if b.UseDualStack == aws.DualStackEndpointStateEnabled { + params.UseDualStack = aws.Bool(true) + } else { + params.UseDualStack = aws.Bool(false) + } + if b.UseFIPS == aws.FIPSEndpointStateEnabled { + params.UseFIPS = aws.Bool(true) + } else { + params.UseFIPS = aws.Bool(false) + } + params.Endpoint = b.Endpoint + return nil +} + +// EndpointParameters provides the parameters that influence how endpoints are +// resolved. +type EndpointParameters struct { + // The AWS region used to dispatch the request. + // + // Parameter is + // required. + // + // AWS::Region + Region *string + + // When true, use the dual-stack endpoint. If the configured endpoint does not + // support dual-stack, dispatching the request MAY return an error. + // + // Defaults to + // false if no value is provided. + // + // AWS::UseDualStack + UseDualStack *bool + + // When true, send this request to the FIPS-compliant regional endpoint. If the + // configured endpoint does not have a FIPS compliant endpoint, dispatching the + // request will return an error. + // + // Defaults to false if no value is + // provided. + // + // AWS::UseFIPS + UseFIPS *bool + + // Override the endpoint used to send this request + // + // Parameter is + // required. + // + // SDK::Endpoint + Endpoint *string +} + +// ValidateRequired validates required parameters are set. +func (p EndpointParameters) ValidateRequired() error { + if p.UseDualStack == nil { + return fmt.Errorf("parameter UseDualStack is required") + } + + if p.UseFIPS == nil { + return fmt.Errorf("parameter UseFIPS is required") + } + + return nil +} + +// WithDefaults returns a shallow copy of EndpointParameterswith default values +// applied to members where applicable. +func (p EndpointParameters) WithDefaults() EndpointParameters { + if p.UseDualStack == nil { + p.UseDualStack = ptr.Bool(false) + } + + if p.UseFIPS == nil { + p.UseFIPS = ptr.Bool(false) + } + return p +} + +// EndpointResolverV2 provides the interface for resolving service endpoints. +type EndpointResolverV2 interface { + // ResolveEndpoint attempts to resolve the endpoint with the provided options, + // returning the endpoint if found. Otherwise an error is returned. + ResolveEndpoint(ctx context.Context, params EndpointParameters) ( + smithyendpoints.Endpoint, error, + ) +} + +// resolver provides the implementation for resolving endpoints. +type resolver struct{} + +func NewDefaultEndpointResolverV2() EndpointResolverV2 { + return &resolver{} +} + +// ResolveEndpoint attempts to resolve the endpoint with the provided options, +// returning the endpoint if found. Otherwise an error is returned. +func (r *resolver) ResolveEndpoint( + ctx context.Context, params EndpointParameters, +) ( + endpoint smithyendpoints.Endpoint, err error, +) { + params = params.WithDefaults() + if err = params.ValidateRequired(); err != nil { + return endpoint, fmt.Errorf("endpoint parameters are not valid, %w", err) + } + _UseDualStack := *params.UseDualStack + _UseFIPS := *params.UseFIPS + + if exprVal := params.Endpoint; exprVal != nil { + _Endpoint := *exprVal + _ = _Endpoint + if _UseFIPS == true { + return endpoint, fmt.Errorf("endpoint rule error, %s", "Invalid Configuration: FIPS and custom endpoint are not supported") + } + if _UseDualStack == true { + return endpoint, fmt.Errorf("endpoint rule error, %s", "Invalid Configuration: Dualstack and custom endpoint are not supported") + } + uriString := _Endpoint + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + if exprVal := params.Region; exprVal != nil { + _Region := *exprVal + _ = _Region + if exprVal := awsrulesfn.GetPartition(_Region); exprVal != nil { + _PartitionResult := *exprVal + _ = _PartitionResult + if _UseFIPS == true { + if _UseDualStack == true { + if true == _PartitionResult.SupportsFIPS { + if true == _PartitionResult.SupportsDualStack { + uriString := func() string { + var out strings.Builder + out.WriteString("https://kms-fips.") + out.WriteString(_Region) + out.WriteString(".") + out.WriteString(_PartitionResult.DualStackDnsSuffix) + return out.String() + }() + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + } + return endpoint, fmt.Errorf("endpoint rule error, %s", "FIPS and DualStack are enabled, but this partition does not support one or both") + } + } + if _UseFIPS == true { + if true == _PartitionResult.SupportsFIPS { + uriString := func() string { + var out strings.Builder + out.WriteString("https://kms-fips.") + out.WriteString(_Region) + out.WriteString(".") + out.WriteString(_PartitionResult.DnsSuffix) + return out.String() + }() + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + return endpoint, fmt.Errorf("endpoint rule error, %s", "FIPS is enabled but this partition does not support FIPS") + } + if _UseDualStack == true { + if true == _PartitionResult.SupportsDualStack { + uriString := func() string { + var out strings.Builder + out.WriteString("https://kms.") + out.WriteString(_Region) + out.WriteString(".") + out.WriteString(_PartitionResult.DualStackDnsSuffix) + return out.String() + }() + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + return endpoint, fmt.Errorf("endpoint rule error, %s", "DualStack is enabled but this partition does not support DualStack") + } + uriString := func() string { + var out strings.Builder + out.WriteString("https://kms.") + out.WriteString(_Region) + out.WriteString(".") + out.WriteString(_PartitionResult.DnsSuffix) + return out.String() + }() + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + return endpoint, fmt.Errorf("Endpoint resolution failed. Invalid operation or environment input.") + } + return endpoint, fmt.Errorf("endpoint rule error, %s", "Invalid Configuration: Missing Region") +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/generated.json b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/generated.json index 68a551b7b6..954824f6dc 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/generated.json +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/generated.json @@ -3,7 +3,8 @@ "github.com/aws/aws-sdk-go-v2": "v1.4.0", "github.com/aws/aws-sdk-go-v2/internal/configsources": "v0.0.0-00010101000000-000000000000", "github.com/aws/aws-sdk-go-v2/internal/endpoints/v2": "v2.0.0-00010101000000-000000000000", - "github.com/aws/smithy-go": "v1.4.0" + "github.com/aws/smithy-go": "v1.4.0", + "github.com/google/go-cmp": "v0.5.4" }, "files": [ "api_client.go", @@ -61,6 +62,7 @@ "deserializers.go", "doc.go", "endpoints.go", + "endpoints_test.go", "generated.json", "internal/endpoints/endpoints.go", "internal/endpoints/endpoints_test.go", diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/go_module_metadata.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/go_module_metadata.go index 79e1512c24..25fcd4dced 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/go_module_metadata.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/go_module_metadata.go @@ -3,4 +3,4 @@ package kms // goModuleVersion is the tagged release for this module -const goModuleVersion = "1.23.1" +const goModuleVersion = "1.24.1" diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/internal/endpoints/endpoints.go b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/internal/endpoints/endpoints.go index cb5a6b5a7f..fc0d645da9 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/kms/internal/endpoints/endpoints.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/kms/internal/endpoints/endpoints.go @@ -94,7 +94,7 @@ var partitionRegexp = struct { AwsUsGov *regexp.Regexp }{ - Aws: regexp.MustCompile("^(us|eu|ap|sa|ca|me|af)\\-\\w+\\-\\d+$"), + Aws: regexp.MustCompile("^(us|eu|ap|sa|ca|me|af|il)\\-\\w+\\-\\d+$"), AwsCn: regexp.MustCompile("^cn\\-\\w+\\-\\d+$"), AwsIso: regexp.MustCompile("^us\\-iso\\-\\w+\\-\\d+$"), AwsIsoB: regexp.MustCompile("^us\\-isob\\-\\w+\\-\\d+$"), @@ -508,6 +508,15 @@ var defaultPartitions = endpoints.Partitions{ }, Deprecated: aws.TrueTernary, }, + endpoints.EndpointKey{ + Region: "il-central-1", + }: endpoints.Endpoint{}, + endpoints.EndpointKey{ + Region: "il-central-1", + Variant: endpoints.FIPSVariant, + }: { + Hostname: "kms-fips.il-central-1.amazonaws.com", + }, endpoints.EndpointKey{ Region: "il-central-1-fips", }: endpoints.Endpoint{ @@ -515,6 +524,7 @@ var defaultPartitions = endpoints.Partitions{ CredentialScope: endpoints.CredentialScope{ Region: "il-central-1", }, + Deprecated: aws.TrueTernary, }, endpoints.EndpointKey{ Region: "me-central-1", diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/sso/CHANGELOG.md b/vendor/github.com/aws/aws-sdk-go-v2/service/sso/CHANGELOG.md index f75997cc82..18e40354e0 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/sso/CHANGELOG.md +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/sso/CHANGELOG.md @@ -1,3 +1,16 @@ +# v1.13.1 (2023-08-01) + +* No change notes available for this release. + +# v1.13.0 (2023-07-31) + +* **Feature**: Adds support for smithy-modeled endpoint resolution. A new rules-based endpoint resolution will be added to the SDK which will supercede and deprecate existing endpoint resolution. Specifically, EndpointResolver will be deprecated while BaseEndpoint and EndpointResolverV2 will take its place. For more information, please see the Endpoints section in our Developer Guide. +* **Dependency Update**: Updated to the latest SDK module versions + +# v1.12.14 (2023-07-28) + +* **Dependency Update**: Updated to the latest SDK module versions + # v1.12.13 (2023-07-13) * **Dependency Update**: Updated to the latest SDK module versions diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/sso/api_client.go b/vendor/github.com/aws/aws-sdk-go-v2/service/sso/api_client.go index 4930b54ee3..da4e470a60 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/sso/api_client.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/sso/api_client.go @@ -4,6 +4,7 @@ package sso import ( "context" + "fmt" "github.com/aws/aws-sdk-go-v2/aws" "github.com/aws/aws-sdk-go-v2/aws/defaults" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" @@ -45,8 +46,6 @@ func New(options Options, optFns ...func(*Options)) *Client { resolveHTTPSignerV4(&options) - resolveDefaultEndpointConfiguration(&options) - for _, fn := range optFns { fn(&options) } @@ -67,6 +66,11 @@ type Options struct { // The optional application specific identifier appended to the User-Agent header. AppID string + // This endpoint will be given as input to an EndpointResolverV2. It is used for + // providing a custom base endpoint that is subject to modifications by the + // processing EndpointResolverV2. + BaseEndpoint *string + // Configures the events that will be sent to the configured logger. ClientLogMode aws.ClientLogMode @@ -81,8 +85,18 @@ type Options struct { EndpointOptions EndpointResolverOptions // The service endpoint resolver. + // + // Deprecated: Deprecated: EndpointResolver and WithEndpointResolver. Providing a + // value for this field will likely prevent you from using any endpoint-related + // service features released after the introduction of EndpointResolverV2 and + // BaseEndpoint. To migrate an EndpointResolver implementation that uses a custom + // endpoint, set the client option BaseEndpoint instead. EndpointResolver EndpointResolver + // Resolves the endpoint used for a particular service. This should be used over + // the deprecated EndpointResolver + EndpointResolverV2 EndpointResolverV2 + // Signature Version 4 (SigV4) Signer HTTPSignerV4 HTTPSignerV4 @@ -141,14 +155,25 @@ func WithAPIOptions(optFns ...func(*middleware.Stack) error) func(*Options) { } } -// WithEndpointResolver returns a functional option for setting the Client's -// EndpointResolver option. +// Deprecated: EndpointResolver and WithEndpointResolver. Providing a value for +// this field will likely prevent you from using any endpoint-related service +// features released after the introduction of EndpointResolverV2 and BaseEndpoint. +// To migrate an EndpointResolver implementation that uses a custom endpoint, set +// the client option BaseEndpoint instead. func WithEndpointResolver(v EndpointResolver) func(*Options) { return func(o *Options) { o.EndpointResolver = v } } +// WithEndpointResolverV2 returns a functional option for setting the Client's +// EndpointResolverV2 option. +func WithEndpointResolverV2(v EndpointResolverV2) func(*Options) { + return func(o *Options) { + o.EndpointResolverV2 = v + } +} + type HTTPClient interface { Do(*http.Request) (*http.Response, error) } @@ -165,6 +190,8 @@ func (c *Client) invokeOperation(ctx context.Context, opID string, params interf ctx = middleware.ClearStackValues(ctx) stack := middleware.NewStack(opID, smithyhttp.NewStackRequest) options := c.options.Copy() + resolveEndpointResolverV2(&options) + for _, fn := range optFns { fn(&options) } @@ -199,6 +226,30 @@ func (c *Client) invokeOperation(ctx context.Context, opID string, params interf type noSmithyDocumentSerde = smithydocument.NoSerde +type legacyEndpointContextSetter struct { + LegacyResolver EndpointResolver +} + +func (*legacyEndpointContextSetter) ID() string { + return "legacyEndpointContextSetter" +} + +func (m *legacyEndpointContextSetter) HandleInitialize(ctx context.Context, in middleware.InitializeInput, next middleware.InitializeHandler) ( + out middleware.InitializeOutput, metadata middleware.Metadata, err error, +) { + if m.LegacyResolver != nil { + ctx = awsmiddleware.SetRequiresLegacyEndpoints(ctx, true) + } + + return next.HandleInitialize(ctx, in) + +} +func addlegacyEndpointContextSetter(stack *middleware.Stack, o Options) error { + return stack.Initialize.Add(&legacyEndpointContextSetter{ + LegacyResolver: o.EndpointResolver, + }, middleware.Before) +} + func resolveDefaultLogger(o *Options) { if o.Logger != nil { return @@ -347,7 +398,7 @@ func resolveAWSEndpointResolver(cfg aws.Config, o *Options) { if cfg.EndpointResolver == nil && cfg.EndpointResolverWithOptions == nil { return } - o.EndpointResolver = withEndpointResolver(cfg.EndpointResolver, cfg.EndpointResolverWithOptions, NewDefaultEndpointResolver()) + o.EndpointResolver = withEndpointResolver(cfg.EndpointResolver, cfg.EndpointResolverWithOptions) } func addClientUserAgent(stack *middleware.Stack, options Options) error { @@ -443,3 +494,32 @@ func addRequestResponseLogging(stack *middleware.Stack, o Options) error { LogResponseWithBody: o.ClientLogMode.IsResponseWithBody(), }, middleware.After) } + +type endpointDisableHTTPSMiddleware struct { + EndpointDisableHTTPS bool +} + +func (*endpointDisableHTTPSMiddleware) ID() string { + return "endpointDisableHTTPSMiddleware" +} + +func (m *endpointDisableHTTPSMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointDisableHTTPS && !smithyhttp.GetHostnameImmutable(ctx) { + req.URL.Scheme = "http" + } + + return next.HandleSerialize(ctx, in) + +} +func addendpointDisableHTTPSMiddleware(stack *middleware.Stack, o Options) error { + return stack.Serialize.Insert(&endpointDisableHTTPSMiddleware{ + EndpointDisableHTTPS: o.EndpointOptions.DisableHTTPS, + }, "OperationSerializer", middleware.Before) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/sso/api_op_GetRoleCredentials.go b/vendor/github.com/aws/aws-sdk-go-v2/service/sso/api_op_GetRoleCredentials.go index 535325281a..0383bb0bd0 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/sso/api_op_GetRoleCredentials.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/sso/api_op_GetRoleCredentials.go @@ -4,8 +4,13 @@ package sso import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" "github.com/aws/aws-sdk-go-v2/service/sso/types" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -69,6 +74,9 @@ func (c *Client) addOperationGetRoleCredentialsMiddlewares(stack *middleware.Sta if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -99,6 +107,9 @@ func (c *Client) addOperationGetRoleCredentialsMiddlewares(stack *middleware.Sta if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addGetRoleCredentialsResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpGetRoleCredentialsValidationMiddleware(stack); err != nil { return err } @@ -117,6 +128,9 @@ func (c *Client) addOperationGetRoleCredentialsMiddlewares(stack *middleware.Sta if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -127,3 +141,126 @@ func newServiceMetadataMiddleware_opGetRoleCredentials(region string) *awsmiddle OperationName: "GetRoleCredentials", } } + +type opGetRoleCredentialsResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opGetRoleCredentialsResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opGetRoleCredentialsResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "awsssoportal" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "awsssoportal" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("awsssoportal") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addGetRoleCredentialsResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opGetRoleCredentialsResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/sso/api_op_ListAccountRoles.go b/vendor/github.com/aws/aws-sdk-go-v2/service/sso/api_op_ListAccountRoles.go index 98547502b6..cc28543f8c 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/sso/api_op_ListAccountRoles.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/sso/api_op_ListAccountRoles.go @@ -4,9 +4,13 @@ package sso import ( "context" + "errors" "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" "github.com/aws/aws-sdk-go-v2/service/sso/types" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -75,6 +79,9 @@ func (c *Client) addOperationListAccountRolesMiddlewares(stack *middleware.Stack if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -105,6 +112,9 @@ func (c *Client) addOperationListAccountRolesMiddlewares(stack *middleware.Stack if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addListAccountRolesResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpListAccountRolesValidationMiddleware(stack); err != nil { return err } @@ -123,6 +133,9 @@ func (c *Client) addOperationListAccountRolesMiddlewares(stack *middleware.Stack if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -223,3 +236,126 @@ func newServiceMetadataMiddleware_opListAccountRoles(region string) *awsmiddlewa OperationName: "ListAccountRoles", } } + +type opListAccountRolesResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opListAccountRolesResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opListAccountRolesResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "awsssoportal" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "awsssoportal" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("awsssoportal") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addListAccountRolesResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opListAccountRolesResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/sso/api_op_ListAccounts.go b/vendor/github.com/aws/aws-sdk-go-v2/service/sso/api_op_ListAccounts.go index d13109b02f..567f6c6691 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/sso/api_op_ListAccounts.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/sso/api_op_ListAccounts.go @@ -4,9 +4,13 @@ package sso import ( "context" + "errors" "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" "github.com/aws/aws-sdk-go-v2/service/sso/types" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -73,6 +77,9 @@ func (c *Client) addOperationListAccountsMiddlewares(stack *middleware.Stack, op if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -103,6 +110,9 @@ func (c *Client) addOperationListAccountsMiddlewares(stack *middleware.Stack, op if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addListAccountsResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpListAccountsValidationMiddleware(stack); err != nil { return err } @@ -121,6 +131,9 @@ func (c *Client) addOperationListAccountsMiddlewares(stack *middleware.Stack, op if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -220,3 +233,126 @@ func newServiceMetadataMiddleware_opListAccounts(region string) *awsmiddleware.R OperationName: "ListAccounts", } } + +type opListAccountsResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opListAccountsResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opListAccountsResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "awsssoportal" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "awsssoportal" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("awsssoportal") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addListAccountsResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opListAccountsResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/sso/api_op_Logout.go b/vendor/github.com/aws/aws-sdk-go-v2/service/sso/api_op_Logout.go index 1c3ef1d065..c30da0296f 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/sso/api_op_Logout.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/sso/api_op_Logout.go @@ -4,7 +4,12 @@ package sso import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -64,6 +69,9 @@ func (c *Client) addOperationLogoutMiddlewares(stack *middleware.Stack, options if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -94,6 +102,9 @@ func (c *Client) addOperationLogoutMiddlewares(stack *middleware.Stack, options if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addLogoutResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpLogoutValidationMiddleware(stack); err != nil { return err } @@ -112,6 +123,9 @@ func (c *Client) addOperationLogoutMiddlewares(stack *middleware.Stack, options if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -122,3 +136,126 @@ func newServiceMetadataMiddleware_opLogout(region string) *awsmiddleware.Registe OperationName: "Logout", } } + +type opLogoutResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opLogoutResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opLogoutResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "awsssoportal" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "awsssoportal" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("awsssoportal") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addLogoutResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opLogoutResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/sso/endpoints.go b/vendor/github.com/aws/aws-sdk-go-v2/service/sso/endpoints.go index 43c06f11af..9395e91e24 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/sso/endpoints.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/sso/endpoints.go @@ -8,9 +8,13 @@ import ( "fmt" "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" + "github.com/aws/aws-sdk-go-v2/internal/endpoints/awsrulesfn" internalendpoints "github.com/aws/aws-sdk-go-v2/service/sso/internal/endpoints" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" + "github.com/aws/smithy-go/ptr" smithyhttp "github.com/aws/smithy-go/transport/http" + "net/http" "net/url" "strings" ) @@ -39,13 +43,6 @@ func (fn EndpointResolverFunc) ResolveEndpoint(region string, options EndpointRe return fn(region, options) } -func resolveDefaultEndpointConfiguration(o *Options) { - if o.EndpointResolver != nil { - return - } - o.EndpointResolver = NewDefaultEndpointResolver() -} - // EndpointResolverFromURL returns an EndpointResolver configured using the // provided endpoint url. By default, the resolved endpoint resolver uses the // client region as signing region, and the endpoint source is set to @@ -79,6 +76,10 @@ func (*ResolveEndpoint) ID() string { func (m *ResolveEndpoint) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( out middleware.SerializeOutput, metadata middleware.Metadata, err error, ) { + if !awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + req, ok := in.Request.(*smithyhttp.Request) if !ok { return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) @@ -94,6 +95,11 @@ func (m *ResolveEndpoint) HandleSerialize(ctx context.Context, in middleware.Ser var endpoint aws.Endpoint endpoint, err = m.Resolver.ResolveEndpoint(awsmiddleware.GetRegion(ctx), eo) if err != nil { + nf := (&aws.EndpointNotFoundError{}) + if errors.As(err, &nf) { + ctx = awsmiddleware.SetRequiresLegacyEndpoints(ctx, false) + return next.HandleSerialize(ctx, in) + } return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) } @@ -129,27 +135,10 @@ func removeResolveEndpointMiddleware(stack *middleware.Stack) error { type wrappedEndpointResolver struct { awsResolver aws.EndpointResolverWithOptions - resolver EndpointResolver } func (w *wrappedEndpointResolver) ResolveEndpoint(region string, options EndpointResolverOptions) (endpoint aws.Endpoint, err error) { - if w.awsResolver == nil { - goto fallback - } - endpoint, err = w.awsResolver.ResolveEndpoint(ServiceID, region, options) - if err == nil { - return endpoint, nil - } - - if nf := (&aws.EndpointNotFoundError{}); !errors.As(err, &nf) { - return endpoint, err - } - -fallback: - if w.resolver == nil { - return endpoint, fmt.Errorf("default endpoint resolver provided was nil") - } - return w.resolver.ResolveEndpoint(region, options) + return w.awsResolver.ResolveEndpoint(ServiceID, region, options) } type awsEndpointResolverAdaptor func(service, region string) (aws.Endpoint, error) @@ -160,12 +149,13 @@ func (a awsEndpointResolverAdaptor) ResolveEndpoint(service, region string, opti var _ aws.EndpointResolverWithOptions = awsEndpointResolverAdaptor(nil) -// withEndpointResolver returns an EndpointResolver that first delegates endpoint resolution to the awsResolver. -// If awsResolver returns aws.EndpointNotFoundError error, the resolver will use the the provided -// fallbackResolver for resolution. +// withEndpointResolver returns an aws.EndpointResolverWithOptions that first delegates endpoint resolution to the awsResolver. +// If awsResolver returns aws.EndpointNotFoundError error, the v1 resolver middleware will swallow the error, +// and set an appropriate context flag such that fallback will occur when EndpointResolverV2 is invoked +// via its middleware. // -// fallbackResolver must not be nil -func withEndpointResolver(awsResolver aws.EndpointResolver, awsResolverWithOptions aws.EndpointResolverWithOptions, fallbackResolver EndpointResolver) EndpointResolver { +// If another error (besides aws.EndpointNotFoundError) is returned, then that error will be propagated. +func withEndpointResolver(awsResolver aws.EndpointResolver, awsResolverWithOptions aws.EndpointResolverWithOptions) EndpointResolver { var resolver aws.EndpointResolverWithOptions if awsResolverWithOptions != nil { @@ -176,7 +166,6 @@ func withEndpointResolver(awsResolver aws.EndpointResolver, awsResolverWithOptio return &wrappedEndpointResolver{ awsResolver: resolver, - resolver: fallbackResolver, } } @@ -198,3 +187,567 @@ func finalizeClientEndpointResolverOptions(options *Options) { } } + +func resolveEndpointResolverV2(options *Options) { + if options.EndpointResolverV2 == nil { + options.EndpointResolverV2 = NewDefaultEndpointResolverV2() + } +} + +// Utility function to aid with translating pseudo-regions to classical regions +// with the appropriate setting indicated by the pseudo-region +func mapPseudoRegion(pr string) (region string, fips aws.FIPSEndpointState) { + const fipsInfix = "-fips-" + const fipsPrefix = "fips-" + const fipsSuffix = "-fips" + + if strings.Contains(pr, fipsInfix) || + strings.Contains(pr, fipsPrefix) || + strings.Contains(pr, fipsSuffix) { + region = strings.ReplaceAll(strings.ReplaceAll(strings.ReplaceAll( + pr, fipsInfix, "-"), fipsPrefix, ""), fipsSuffix, "") + fips = aws.FIPSEndpointStateEnabled + } else { + region = pr + } + + return region, fips +} + +// builtInParameterResolver is the interface responsible for resolving BuiltIn +// values during the sourcing of EndpointParameters +type builtInParameterResolver interface { + ResolveBuiltIns(*EndpointParameters) error +} + +// builtInResolver resolves modeled BuiltIn values using only the members defined +// below. +type builtInResolver struct { + // The AWS region used to dispatch the request. + Region string + + // Sourced BuiltIn value in a historical enabled or disabled state. + UseDualStack aws.DualStackEndpointState + + // Sourced BuiltIn value in a historical enabled or disabled state. + UseFIPS aws.FIPSEndpointState + + // Base endpoint that can potentially be modified during Endpoint resolution. + Endpoint *string +} + +// Invoked at runtime to resolve BuiltIn Values. Only resolution code specific to +// each BuiltIn value is generated. +func (b *builtInResolver) ResolveBuiltIns(params *EndpointParameters) error { + + region, _ := mapPseudoRegion(b.Region) + if len(region) == 0 { + return fmt.Errorf("Could not resolve AWS::Region") + } else { + params.Region = aws.String(region) + } + if b.UseDualStack == aws.DualStackEndpointStateEnabled { + params.UseDualStack = aws.Bool(true) + } else { + params.UseDualStack = aws.Bool(false) + } + if b.UseFIPS == aws.FIPSEndpointStateEnabled { + params.UseFIPS = aws.Bool(true) + } else { + params.UseFIPS = aws.Bool(false) + } + params.Endpoint = b.Endpoint + return nil +} + +// EndpointParameters provides the parameters that influence how endpoints are +// resolved. +type EndpointParameters struct { + // The AWS region used to dispatch the request. + // + // Parameter is + // required. + // + // AWS::Region + Region *string + + // When true, use the dual-stack endpoint. If the configured endpoint does not + // support dual-stack, dispatching the request MAY return an error. + // + // Defaults to + // false if no value is provided. + // + // AWS::UseDualStack + UseDualStack *bool + + // When true, send this request to the FIPS-compliant regional endpoint. If the + // configured endpoint does not have a FIPS compliant endpoint, dispatching the + // request will return an error. + // + // Defaults to false if no value is + // provided. + // + // AWS::UseFIPS + UseFIPS *bool + + // Override the endpoint used to send this request + // + // Parameter is + // required. + // + // SDK::Endpoint + Endpoint *string +} + +// ValidateRequired validates required parameters are set. +func (p EndpointParameters) ValidateRequired() error { + if p.UseDualStack == nil { + return fmt.Errorf("parameter UseDualStack is required") + } + + if p.UseFIPS == nil { + return fmt.Errorf("parameter UseFIPS is required") + } + + return nil +} + +// WithDefaults returns a shallow copy of EndpointParameterswith default values +// applied to members where applicable. +func (p EndpointParameters) WithDefaults() EndpointParameters { + if p.UseDualStack == nil { + p.UseDualStack = ptr.Bool(false) + } + + if p.UseFIPS == nil { + p.UseFIPS = ptr.Bool(false) + } + return p +} + +// EndpointResolverV2 provides the interface for resolving service endpoints. +type EndpointResolverV2 interface { + // ResolveEndpoint attempts to resolve the endpoint with the provided options, + // returning the endpoint if found. Otherwise an error is returned. + ResolveEndpoint(ctx context.Context, params EndpointParameters) ( + smithyendpoints.Endpoint, error, + ) +} + +// resolver provides the implementation for resolving endpoints. +type resolver struct{} + +func NewDefaultEndpointResolverV2() EndpointResolverV2 { + return &resolver{} +} + +// ResolveEndpoint attempts to resolve the endpoint with the provided options, +// returning the endpoint if found. Otherwise an error is returned. +func (r *resolver) ResolveEndpoint( + ctx context.Context, params EndpointParameters, +) ( + endpoint smithyendpoints.Endpoint, err error, +) { + params = params.WithDefaults() + if err = params.ValidateRequired(); err != nil { + return endpoint, fmt.Errorf("endpoint parameters are not valid, %w", err) + } + _UseDualStack := *params.UseDualStack + _UseFIPS := *params.UseFIPS + + if exprVal := params.Endpoint; exprVal != nil { + _Endpoint := *exprVal + _ = _Endpoint + if _UseFIPS == true { + return endpoint, fmt.Errorf("endpoint rule error, %s", "Invalid Configuration: FIPS and custom endpoint are not supported") + } + if _UseDualStack == true { + return endpoint, fmt.Errorf("endpoint rule error, %s", "Invalid Configuration: Dualstack and custom endpoint are not supported") + } + uriString := _Endpoint + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + if exprVal := params.Region; exprVal != nil { + _Region := *exprVal + _ = _Region + if exprVal := awsrulesfn.GetPartition(_Region); exprVal != nil { + _PartitionResult := *exprVal + _ = _PartitionResult + if _UseFIPS == true { + if _UseDualStack == true { + if true == _PartitionResult.SupportsFIPS { + if true == _PartitionResult.SupportsDualStack { + uriString := func() string { + var out strings.Builder + out.WriteString("https://portal.sso-fips.") + out.WriteString(_Region) + out.WriteString(".") + out.WriteString(_PartitionResult.DualStackDnsSuffix) + return out.String() + }() + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + } + return endpoint, fmt.Errorf("endpoint rule error, %s", "FIPS and DualStack are enabled, but this partition does not support one or both") + } + } + if _UseFIPS == true { + if true == _PartitionResult.SupportsFIPS { + uriString := func() string { + var out strings.Builder + out.WriteString("https://portal.sso-fips.") + out.WriteString(_Region) + out.WriteString(".") + out.WriteString(_PartitionResult.DnsSuffix) + return out.String() + }() + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + return endpoint, fmt.Errorf("endpoint rule error, %s", "FIPS is enabled but this partition does not support FIPS") + } + if _UseDualStack == true { + if true == _PartitionResult.SupportsDualStack { + uriString := func() string { + var out strings.Builder + out.WriteString("https://portal.sso.") + out.WriteString(_Region) + out.WriteString(".") + out.WriteString(_PartitionResult.DualStackDnsSuffix) + return out.String() + }() + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + return endpoint, fmt.Errorf("endpoint rule error, %s", "DualStack is enabled but this partition does not support DualStack") + } + if _Region == "ap-east-1" { + uriString := "https://portal.sso.ap-east-1.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + if _Region == "ap-northeast-1" { + uriString := "https://portal.sso.ap-northeast-1.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + if _Region == "ap-northeast-2" { + uriString := "https://portal.sso.ap-northeast-2.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + if _Region == "ap-northeast-3" { + uriString := "https://portal.sso.ap-northeast-3.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + if _Region == "ap-south-1" { + uriString := "https://portal.sso.ap-south-1.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + if _Region == "ap-southeast-1" { + uriString := "https://portal.sso.ap-southeast-1.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + if _Region == "ap-southeast-2" { + uriString := "https://portal.sso.ap-southeast-2.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + if _Region == "ca-central-1" { + uriString := "https://portal.sso.ca-central-1.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + if _Region == "eu-central-1" { + uriString := "https://portal.sso.eu-central-1.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + if _Region == "eu-north-1" { + uriString := "https://portal.sso.eu-north-1.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + if _Region == "eu-south-1" { + uriString := "https://portal.sso.eu-south-1.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + if _Region == "eu-west-1" { + uriString := "https://portal.sso.eu-west-1.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + if _Region == "eu-west-2" { + uriString := "https://portal.sso.eu-west-2.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + if _Region == "eu-west-3" { + uriString := "https://portal.sso.eu-west-3.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + if _Region == "me-south-1" { + uriString := "https://portal.sso.me-south-1.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + if _Region == "sa-east-1" { + uriString := "https://portal.sso.sa-east-1.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + if _Region == "us-east-1" { + uriString := "https://portal.sso.us-east-1.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + if _Region == "us-east-2" { + uriString := "https://portal.sso.us-east-2.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + if _Region == "us-west-2" { + uriString := "https://portal.sso.us-west-2.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + if _Region == "us-gov-east-1" { + uriString := "https://portal.sso.us-gov-east-1.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + if _Region == "us-gov-west-1" { + uriString := "https://portal.sso.us-gov-west-1.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + uriString := func() string { + var out strings.Builder + out.WriteString("https://portal.sso.") + out.WriteString(_Region) + out.WriteString(".") + out.WriteString(_PartitionResult.DnsSuffix) + return out.String() + }() + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + return endpoint, fmt.Errorf("Endpoint resolution failed. Invalid operation or environment input.") + } + return endpoint, fmt.Errorf("endpoint rule error, %s", "Invalid Configuration: Missing Region") +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/sso/generated.json b/vendor/github.com/aws/aws-sdk-go-v2/service/sso/generated.json index 5be0e34cd6..ab6af36e87 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/sso/generated.json +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/sso/generated.json @@ -3,7 +3,8 @@ "github.com/aws/aws-sdk-go-v2": "v1.4.0", "github.com/aws/aws-sdk-go-v2/internal/configsources": "v0.0.0-00010101000000-000000000000", "github.com/aws/aws-sdk-go-v2/internal/endpoints/v2": "v2.0.0-00010101000000-000000000000", - "github.com/aws/smithy-go": "v1.4.0" + "github.com/aws/smithy-go": "v1.4.0", + "github.com/google/go-cmp": "v0.5.4" }, "files": [ "api_client.go", @@ -15,6 +16,7 @@ "deserializers.go", "doc.go", "endpoints.go", + "endpoints_test.go", "generated.json", "internal/endpoints/endpoints.go", "internal/endpoints/endpoints_test.go", diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/sso/go_module_metadata.go b/vendor/github.com/aws/aws-sdk-go-v2/service/sso/go_module_metadata.go index 2c35ca37a6..cfd18ea9d6 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/sso/go_module_metadata.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/sso/go_module_metadata.go @@ -3,4 +3,4 @@ package sso // goModuleVersion is the tagged release for this module -const goModuleVersion = "1.12.13" +const goModuleVersion = "1.13.1" diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/sso/internal/endpoints/endpoints.go b/vendor/github.com/aws/aws-sdk-go-v2/service/sso/internal/endpoints/endpoints.go index b1ce03a5d9..1da26791c3 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/sso/internal/endpoints/endpoints.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/sso/internal/endpoints/endpoints.go @@ -94,7 +94,7 @@ var partitionRegexp = struct { AwsUsGov *regexp.Regexp }{ - Aws: regexp.MustCompile("^(us|eu|ap|sa|ca|me|af)\\-\\w+\\-\\d+$"), + Aws: regexp.MustCompile("^(us|eu|ap|sa|ca|me|af|il)\\-\\w+\\-\\d+$"), AwsCn: regexp.MustCompile("^cn\\-\\w+\\-\\d+$"), AwsIso: regexp.MustCompile("^us\\-iso\\-\\w+\\-\\d+$"), AwsIsoB: regexp.MustCompile("^us\\-isob\\-\\w+\\-\\d+$"), diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/sso/serializers.go b/vendor/github.com/aws/aws-sdk-go-v2/service/sso/serializers.go index 29e3208119..02e3141156 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/sso/serializers.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/sso/serializers.go @@ -36,7 +36,14 @@ func (m *awsRestjson1_serializeOpGetRoleCredentials) HandleSerialize(ctx context request.URL.Path = smithyhttp.JoinPath(request.URL.Path, opPath) request.URL.RawQuery = smithyhttp.JoinRawQuery(request.URL.RawQuery, opQuery) request.Method = "GET" - restEncoder, err := httpbinding.NewEncoder(request.URL.Path, request.URL.RawQuery, request.Header) + var restEncoder *httpbinding.Encoder + if request.URL.RawPath == "" { + restEncoder, err = httpbinding.NewEncoder(request.URL.Path, request.URL.RawQuery, request.Header) + } else { + request.URL.RawPath = smithyhttp.JoinPath(request.URL.RawPath, opPath) + restEncoder, err = httpbinding.NewEncoderWithRawPath(request.URL.Path, request.URL.RawPath, request.URL.RawQuery, request.Header) + } + if err != nil { return out, metadata, &smithy.SerializationError{Err: err} } @@ -98,7 +105,14 @@ func (m *awsRestjson1_serializeOpListAccountRoles) HandleSerialize(ctx context.C request.URL.Path = smithyhttp.JoinPath(request.URL.Path, opPath) request.URL.RawQuery = smithyhttp.JoinRawQuery(request.URL.RawQuery, opQuery) request.Method = "GET" - restEncoder, err := httpbinding.NewEncoder(request.URL.Path, request.URL.RawQuery, request.Header) + var restEncoder *httpbinding.Encoder + if request.URL.RawPath == "" { + restEncoder, err = httpbinding.NewEncoder(request.URL.Path, request.URL.RawQuery, request.Header) + } else { + request.URL.RawPath = smithyhttp.JoinPath(request.URL.RawPath, opPath) + restEncoder, err = httpbinding.NewEncoderWithRawPath(request.URL.Path, request.URL.RawPath, request.URL.RawQuery, request.Header) + } + if err != nil { return out, metadata, &smithy.SerializationError{Err: err} } @@ -164,7 +178,14 @@ func (m *awsRestjson1_serializeOpListAccounts) HandleSerialize(ctx context.Conte request.URL.Path = smithyhttp.JoinPath(request.URL.Path, opPath) request.URL.RawQuery = smithyhttp.JoinRawQuery(request.URL.RawQuery, opQuery) request.Method = "GET" - restEncoder, err := httpbinding.NewEncoder(request.URL.Path, request.URL.RawQuery, request.Header) + var restEncoder *httpbinding.Encoder + if request.URL.RawPath == "" { + restEncoder, err = httpbinding.NewEncoder(request.URL.Path, request.URL.RawQuery, request.Header) + } else { + request.URL.RawPath = smithyhttp.JoinPath(request.URL.RawPath, opPath) + restEncoder, err = httpbinding.NewEncoderWithRawPath(request.URL.Path, request.URL.RawPath, request.URL.RawQuery, request.Header) + } + if err != nil { return out, metadata, &smithy.SerializationError{Err: err} } @@ -226,7 +247,14 @@ func (m *awsRestjson1_serializeOpLogout) HandleSerialize(ctx context.Context, in request.URL.Path = smithyhttp.JoinPath(request.URL.Path, opPath) request.URL.RawQuery = smithyhttp.JoinRawQuery(request.URL.RawQuery, opQuery) request.Method = "POST" - restEncoder, err := httpbinding.NewEncoder(request.URL.Path, request.URL.RawQuery, request.Header) + var restEncoder *httpbinding.Encoder + if request.URL.RawPath == "" { + restEncoder, err = httpbinding.NewEncoder(request.URL.Path, request.URL.RawQuery, request.Header) + } else { + request.URL.RawPath = smithyhttp.JoinPath(request.URL.RawPath, opPath) + restEncoder, err = httpbinding.NewEncoderWithRawPath(request.URL.Path, request.URL.RawPath, request.URL.RawQuery, request.Header) + } + if err != nil { return out, metadata, &smithy.SerializationError{Err: err} } diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/ssooidc/CHANGELOG.md b/vendor/github.com/aws/aws-sdk-go-v2/service/ssooidc/CHANGELOG.md index 9a72935807..46ee62ae1c 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/ssooidc/CHANGELOG.md +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/ssooidc/CHANGELOG.md @@ -1,3 +1,16 @@ +# v1.15.1 (2023-08-01) + +* No change notes available for this release. + +# v1.15.0 (2023-07-31) + +* **Feature**: Adds support for smithy-modeled endpoint resolution. A new rules-based endpoint resolution will be added to the SDK which will supercede and deprecate existing endpoint resolution. Specifically, EndpointResolver will be deprecated while BaseEndpoint and EndpointResolverV2 will take its place. For more information, please see the Endpoints section in our Developer Guide. +* **Dependency Update**: Updated to the latest SDK module versions + +# v1.14.14 (2023-07-28) + +* **Dependency Update**: Updated to the latest SDK module versions + # v1.14.13 (2023-07-13) * **Dependency Update**: Updated to the latest SDK module versions diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/ssooidc/api_client.go b/vendor/github.com/aws/aws-sdk-go-v2/service/ssooidc/api_client.go index 26c8d14966..24a692276f 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/ssooidc/api_client.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/ssooidc/api_client.go @@ -4,6 +4,7 @@ package ssooidc import ( "context" + "fmt" "github.com/aws/aws-sdk-go-v2/aws" "github.com/aws/aws-sdk-go-v2/aws/defaults" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" @@ -45,8 +46,6 @@ func New(options Options, optFns ...func(*Options)) *Client { resolveHTTPSignerV4(&options) - resolveDefaultEndpointConfiguration(&options) - for _, fn := range optFns { fn(&options) } @@ -67,6 +66,11 @@ type Options struct { // The optional application specific identifier appended to the User-Agent header. AppID string + // This endpoint will be given as input to an EndpointResolverV2. It is used for + // providing a custom base endpoint that is subject to modifications by the + // processing EndpointResolverV2. + BaseEndpoint *string + // Configures the events that will be sent to the configured logger. ClientLogMode aws.ClientLogMode @@ -81,8 +85,18 @@ type Options struct { EndpointOptions EndpointResolverOptions // The service endpoint resolver. + // + // Deprecated: Deprecated: EndpointResolver and WithEndpointResolver. Providing a + // value for this field will likely prevent you from using any endpoint-related + // service features released after the introduction of EndpointResolverV2 and + // BaseEndpoint. To migrate an EndpointResolver implementation that uses a custom + // endpoint, set the client option BaseEndpoint instead. EndpointResolver EndpointResolver + // Resolves the endpoint used for a particular service. This should be used over + // the deprecated EndpointResolver + EndpointResolverV2 EndpointResolverV2 + // Signature Version 4 (SigV4) Signer HTTPSignerV4 HTTPSignerV4 @@ -141,14 +155,25 @@ func WithAPIOptions(optFns ...func(*middleware.Stack) error) func(*Options) { } } -// WithEndpointResolver returns a functional option for setting the Client's -// EndpointResolver option. +// Deprecated: EndpointResolver and WithEndpointResolver. Providing a value for +// this field will likely prevent you from using any endpoint-related service +// features released after the introduction of EndpointResolverV2 and BaseEndpoint. +// To migrate an EndpointResolver implementation that uses a custom endpoint, set +// the client option BaseEndpoint instead. func WithEndpointResolver(v EndpointResolver) func(*Options) { return func(o *Options) { o.EndpointResolver = v } } +// WithEndpointResolverV2 returns a functional option for setting the Client's +// EndpointResolverV2 option. +func WithEndpointResolverV2(v EndpointResolverV2) func(*Options) { + return func(o *Options) { + o.EndpointResolverV2 = v + } +} + type HTTPClient interface { Do(*http.Request) (*http.Response, error) } @@ -165,6 +190,8 @@ func (c *Client) invokeOperation(ctx context.Context, opID string, params interf ctx = middleware.ClearStackValues(ctx) stack := middleware.NewStack(opID, smithyhttp.NewStackRequest) options := c.options.Copy() + resolveEndpointResolverV2(&options) + for _, fn := range optFns { fn(&options) } @@ -199,6 +226,30 @@ func (c *Client) invokeOperation(ctx context.Context, opID string, params interf type noSmithyDocumentSerde = smithydocument.NoSerde +type legacyEndpointContextSetter struct { + LegacyResolver EndpointResolver +} + +func (*legacyEndpointContextSetter) ID() string { + return "legacyEndpointContextSetter" +} + +func (m *legacyEndpointContextSetter) HandleInitialize(ctx context.Context, in middleware.InitializeInput, next middleware.InitializeHandler) ( + out middleware.InitializeOutput, metadata middleware.Metadata, err error, +) { + if m.LegacyResolver != nil { + ctx = awsmiddleware.SetRequiresLegacyEndpoints(ctx, true) + } + + return next.HandleInitialize(ctx, in) + +} +func addlegacyEndpointContextSetter(stack *middleware.Stack, o Options) error { + return stack.Initialize.Add(&legacyEndpointContextSetter{ + LegacyResolver: o.EndpointResolver, + }, middleware.Before) +} + func resolveDefaultLogger(o *Options) { if o.Logger != nil { return @@ -347,7 +398,7 @@ func resolveAWSEndpointResolver(cfg aws.Config, o *Options) { if cfg.EndpointResolver == nil && cfg.EndpointResolverWithOptions == nil { return } - o.EndpointResolver = withEndpointResolver(cfg.EndpointResolver, cfg.EndpointResolverWithOptions, NewDefaultEndpointResolver()) + o.EndpointResolver = withEndpointResolver(cfg.EndpointResolver, cfg.EndpointResolverWithOptions) } func addClientUserAgent(stack *middleware.Stack, options Options) error { @@ -443,3 +494,32 @@ func addRequestResponseLogging(stack *middleware.Stack, o Options) error { LogResponseWithBody: o.ClientLogMode.IsResponseWithBody(), }, middleware.After) } + +type endpointDisableHTTPSMiddleware struct { + EndpointDisableHTTPS bool +} + +func (*endpointDisableHTTPSMiddleware) ID() string { + return "endpointDisableHTTPSMiddleware" +} + +func (m *endpointDisableHTTPSMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointDisableHTTPS && !smithyhttp.GetHostnameImmutable(ctx) { + req.URL.Scheme = "http" + } + + return next.HandleSerialize(ctx, in) + +} +func addendpointDisableHTTPSMiddleware(stack *middleware.Stack, o Options) error { + return stack.Serialize.Insert(&endpointDisableHTTPSMiddleware{ + EndpointDisableHTTPS: o.EndpointOptions.DisableHTTPS, + }, "OperationSerializer", middleware.Before) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/ssooidc/api_op_CreateToken.go b/vendor/github.com/aws/aws-sdk-go-v2/service/ssooidc/api_op_CreateToken.go index 86e5d635b8..43df6256cf 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/ssooidc/api_op_CreateToken.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/ssooidc/api_op_CreateToken.go @@ -4,7 +4,12 @@ package ssooidc import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -119,6 +124,9 @@ func (c *Client) addOperationCreateTokenMiddlewares(stack *middleware.Stack, opt if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -149,6 +157,9 @@ func (c *Client) addOperationCreateTokenMiddlewares(stack *middleware.Stack, opt if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addCreateTokenResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpCreateTokenValidationMiddleware(stack); err != nil { return err } @@ -167,6 +178,9 @@ func (c *Client) addOperationCreateTokenMiddlewares(stack *middleware.Stack, opt if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -177,3 +191,126 @@ func newServiceMetadataMiddleware_opCreateToken(region string) *awsmiddleware.Re OperationName: "CreateToken", } } + +type opCreateTokenResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opCreateTokenResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opCreateTokenResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "awsssooidc" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "awsssooidc" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("awsssooidc") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addCreateTokenResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opCreateTokenResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/ssooidc/api_op_RegisterClient.go b/vendor/github.com/aws/aws-sdk-go-v2/service/ssooidc/api_op_RegisterClient.go index d8c3c22358..b88ebb7067 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/ssooidc/api_op_RegisterClient.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/ssooidc/api_op_RegisterClient.go @@ -4,7 +4,12 @@ package ssooidc import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -84,6 +89,9 @@ func (c *Client) addOperationRegisterClientMiddlewares(stack *middleware.Stack, if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -114,6 +122,9 @@ func (c *Client) addOperationRegisterClientMiddlewares(stack *middleware.Stack, if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addRegisterClientResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpRegisterClientValidationMiddleware(stack); err != nil { return err } @@ -132,6 +143,9 @@ func (c *Client) addOperationRegisterClientMiddlewares(stack *middleware.Stack, if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -142,3 +156,126 @@ func newServiceMetadataMiddleware_opRegisterClient(region string) *awsmiddleware OperationName: "RegisterClient", } } + +type opRegisterClientResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opRegisterClientResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opRegisterClientResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "awsssooidc" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "awsssooidc" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("awsssooidc") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addRegisterClientResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opRegisterClientResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/ssooidc/api_op_StartDeviceAuthorization.go b/vendor/github.com/aws/aws-sdk-go-v2/service/ssooidc/api_op_StartDeviceAuthorization.go index 7ac14676ed..327da5f737 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/ssooidc/api_op_StartDeviceAuthorization.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/ssooidc/api_op_StartDeviceAuthorization.go @@ -4,7 +4,12 @@ package ssooidc import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -92,6 +97,9 @@ func (c *Client) addOperationStartDeviceAuthorizationMiddlewares(stack *middlewa if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -122,6 +130,9 @@ func (c *Client) addOperationStartDeviceAuthorizationMiddlewares(stack *middlewa if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addStartDeviceAuthorizationResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpStartDeviceAuthorizationValidationMiddleware(stack); err != nil { return err } @@ -140,6 +151,9 @@ func (c *Client) addOperationStartDeviceAuthorizationMiddlewares(stack *middlewa if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -150,3 +164,126 @@ func newServiceMetadataMiddleware_opStartDeviceAuthorization(region string) *aws OperationName: "StartDeviceAuthorization", } } + +type opStartDeviceAuthorizationResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opStartDeviceAuthorizationResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opStartDeviceAuthorizationResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "awsssooidc" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "awsssooidc" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("awsssooidc") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addStartDeviceAuthorizationResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opStartDeviceAuthorizationResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/ssooidc/endpoints.go b/vendor/github.com/aws/aws-sdk-go-v2/service/ssooidc/endpoints.go index 35cd21f18c..282d078b5c 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/ssooidc/endpoints.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/ssooidc/endpoints.go @@ -8,9 +8,13 @@ import ( "fmt" "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" + "github.com/aws/aws-sdk-go-v2/internal/endpoints/awsrulesfn" internalendpoints "github.com/aws/aws-sdk-go-v2/service/ssooidc/internal/endpoints" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" + "github.com/aws/smithy-go/ptr" smithyhttp "github.com/aws/smithy-go/transport/http" + "net/http" "net/url" "strings" ) @@ -39,13 +43,6 @@ func (fn EndpointResolverFunc) ResolveEndpoint(region string, options EndpointRe return fn(region, options) } -func resolveDefaultEndpointConfiguration(o *Options) { - if o.EndpointResolver != nil { - return - } - o.EndpointResolver = NewDefaultEndpointResolver() -} - // EndpointResolverFromURL returns an EndpointResolver configured using the // provided endpoint url. By default, the resolved endpoint resolver uses the // client region as signing region, and the endpoint source is set to @@ -79,6 +76,10 @@ func (*ResolveEndpoint) ID() string { func (m *ResolveEndpoint) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( out middleware.SerializeOutput, metadata middleware.Metadata, err error, ) { + if !awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + req, ok := in.Request.(*smithyhttp.Request) if !ok { return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) @@ -94,6 +95,11 @@ func (m *ResolveEndpoint) HandleSerialize(ctx context.Context, in middleware.Ser var endpoint aws.Endpoint endpoint, err = m.Resolver.ResolveEndpoint(awsmiddleware.GetRegion(ctx), eo) if err != nil { + nf := (&aws.EndpointNotFoundError{}) + if errors.As(err, &nf) { + ctx = awsmiddleware.SetRequiresLegacyEndpoints(ctx, false) + return next.HandleSerialize(ctx, in) + } return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) } @@ -129,27 +135,10 @@ func removeResolveEndpointMiddleware(stack *middleware.Stack) error { type wrappedEndpointResolver struct { awsResolver aws.EndpointResolverWithOptions - resolver EndpointResolver } func (w *wrappedEndpointResolver) ResolveEndpoint(region string, options EndpointResolverOptions) (endpoint aws.Endpoint, err error) { - if w.awsResolver == nil { - goto fallback - } - endpoint, err = w.awsResolver.ResolveEndpoint(ServiceID, region, options) - if err == nil { - return endpoint, nil - } - - if nf := (&aws.EndpointNotFoundError{}); !errors.As(err, &nf) { - return endpoint, err - } - -fallback: - if w.resolver == nil { - return endpoint, fmt.Errorf("default endpoint resolver provided was nil") - } - return w.resolver.ResolveEndpoint(region, options) + return w.awsResolver.ResolveEndpoint(ServiceID, region, options) } type awsEndpointResolverAdaptor func(service, region string) (aws.Endpoint, error) @@ -160,12 +149,13 @@ func (a awsEndpointResolverAdaptor) ResolveEndpoint(service, region string, opti var _ aws.EndpointResolverWithOptions = awsEndpointResolverAdaptor(nil) -// withEndpointResolver returns an EndpointResolver that first delegates endpoint resolution to the awsResolver. -// If awsResolver returns aws.EndpointNotFoundError error, the resolver will use the the provided -// fallbackResolver for resolution. +// withEndpointResolver returns an aws.EndpointResolverWithOptions that first delegates endpoint resolution to the awsResolver. +// If awsResolver returns aws.EndpointNotFoundError error, the v1 resolver middleware will swallow the error, +// and set an appropriate context flag such that fallback will occur when EndpointResolverV2 is invoked +// via its middleware. // -// fallbackResolver must not be nil -func withEndpointResolver(awsResolver aws.EndpointResolver, awsResolverWithOptions aws.EndpointResolverWithOptions, fallbackResolver EndpointResolver) EndpointResolver { +// If another error (besides aws.EndpointNotFoundError) is returned, then that error will be propagated. +func withEndpointResolver(awsResolver aws.EndpointResolver, awsResolverWithOptions aws.EndpointResolverWithOptions) EndpointResolver { var resolver aws.EndpointResolverWithOptions if awsResolverWithOptions != nil { @@ -176,7 +166,6 @@ func withEndpointResolver(awsResolver aws.EndpointResolver, awsResolverWithOptio return &wrappedEndpointResolver{ awsResolver: resolver, - resolver: fallbackResolver, } } @@ -198,3 +187,567 @@ func finalizeClientEndpointResolverOptions(options *Options) { } } + +func resolveEndpointResolverV2(options *Options) { + if options.EndpointResolverV2 == nil { + options.EndpointResolverV2 = NewDefaultEndpointResolverV2() + } +} + +// Utility function to aid with translating pseudo-regions to classical regions +// with the appropriate setting indicated by the pseudo-region +func mapPseudoRegion(pr string) (region string, fips aws.FIPSEndpointState) { + const fipsInfix = "-fips-" + const fipsPrefix = "fips-" + const fipsSuffix = "-fips" + + if strings.Contains(pr, fipsInfix) || + strings.Contains(pr, fipsPrefix) || + strings.Contains(pr, fipsSuffix) { + region = strings.ReplaceAll(strings.ReplaceAll(strings.ReplaceAll( + pr, fipsInfix, "-"), fipsPrefix, ""), fipsSuffix, "") + fips = aws.FIPSEndpointStateEnabled + } else { + region = pr + } + + return region, fips +} + +// builtInParameterResolver is the interface responsible for resolving BuiltIn +// values during the sourcing of EndpointParameters +type builtInParameterResolver interface { + ResolveBuiltIns(*EndpointParameters) error +} + +// builtInResolver resolves modeled BuiltIn values using only the members defined +// below. +type builtInResolver struct { + // The AWS region used to dispatch the request. + Region string + + // Sourced BuiltIn value in a historical enabled or disabled state. + UseDualStack aws.DualStackEndpointState + + // Sourced BuiltIn value in a historical enabled or disabled state. + UseFIPS aws.FIPSEndpointState + + // Base endpoint that can potentially be modified during Endpoint resolution. + Endpoint *string +} + +// Invoked at runtime to resolve BuiltIn Values. Only resolution code specific to +// each BuiltIn value is generated. +func (b *builtInResolver) ResolveBuiltIns(params *EndpointParameters) error { + + region, _ := mapPseudoRegion(b.Region) + if len(region) == 0 { + return fmt.Errorf("Could not resolve AWS::Region") + } else { + params.Region = aws.String(region) + } + if b.UseDualStack == aws.DualStackEndpointStateEnabled { + params.UseDualStack = aws.Bool(true) + } else { + params.UseDualStack = aws.Bool(false) + } + if b.UseFIPS == aws.FIPSEndpointStateEnabled { + params.UseFIPS = aws.Bool(true) + } else { + params.UseFIPS = aws.Bool(false) + } + params.Endpoint = b.Endpoint + return nil +} + +// EndpointParameters provides the parameters that influence how endpoints are +// resolved. +type EndpointParameters struct { + // The AWS region used to dispatch the request. + // + // Parameter is + // required. + // + // AWS::Region + Region *string + + // When true, use the dual-stack endpoint. If the configured endpoint does not + // support dual-stack, dispatching the request MAY return an error. + // + // Defaults to + // false if no value is provided. + // + // AWS::UseDualStack + UseDualStack *bool + + // When true, send this request to the FIPS-compliant regional endpoint. If the + // configured endpoint does not have a FIPS compliant endpoint, dispatching the + // request will return an error. + // + // Defaults to false if no value is + // provided. + // + // AWS::UseFIPS + UseFIPS *bool + + // Override the endpoint used to send this request + // + // Parameter is + // required. + // + // SDK::Endpoint + Endpoint *string +} + +// ValidateRequired validates required parameters are set. +func (p EndpointParameters) ValidateRequired() error { + if p.UseDualStack == nil { + return fmt.Errorf("parameter UseDualStack is required") + } + + if p.UseFIPS == nil { + return fmt.Errorf("parameter UseFIPS is required") + } + + return nil +} + +// WithDefaults returns a shallow copy of EndpointParameterswith default values +// applied to members where applicable. +func (p EndpointParameters) WithDefaults() EndpointParameters { + if p.UseDualStack == nil { + p.UseDualStack = ptr.Bool(false) + } + + if p.UseFIPS == nil { + p.UseFIPS = ptr.Bool(false) + } + return p +} + +// EndpointResolverV2 provides the interface for resolving service endpoints. +type EndpointResolverV2 interface { + // ResolveEndpoint attempts to resolve the endpoint with the provided options, + // returning the endpoint if found. Otherwise an error is returned. + ResolveEndpoint(ctx context.Context, params EndpointParameters) ( + smithyendpoints.Endpoint, error, + ) +} + +// resolver provides the implementation for resolving endpoints. +type resolver struct{} + +func NewDefaultEndpointResolverV2() EndpointResolverV2 { + return &resolver{} +} + +// ResolveEndpoint attempts to resolve the endpoint with the provided options, +// returning the endpoint if found. Otherwise an error is returned. +func (r *resolver) ResolveEndpoint( + ctx context.Context, params EndpointParameters, +) ( + endpoint smithyendpoints.Endpoint, err error, +) { + params = params.WithDefaults() + if err = params.ValidateRequired(); err != nil { + return endpoint, fmt.Errorf("endpoint parameters are not valid, %w", err) + } + _UseDualStack := *params.UseDualStack + _UseFIPS := *params.UseFIPS + + if exprVal := params.Endpoint; exprVal != nil { + _Endpoint := *exprVal + _ = _Endpoint + if _UseFIPS == true { + return endpoint, fmt.Errorf("endpoint rule error, %s", "Invalid Configuration: FIPS and custom endpoint are not supported") + } + if _UseDualStack == true { + return endpoint, fmt.Errorf("endpoint rule error, %s", "Invalid Configuration: Dualstack and custom endpoint are not supported") + } + uriString := _Endpoint + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + if exprVal := params.Region; exprVal != nil { + _Region := *exprVal + _ = _Region + if exprVal := awsrulesfn.GetPartition(_Region); exprVal != nil { + _PartitionResult := *exprVal + _ = _PartitionResult + if _UseFIPS == true { + if _UseDualStack == true { + if true == _PartitionResult.SupportsFIPS { + if true == _PartitionResult.SupportsDualStack { + uriString := func() string { + var out strings.Builder + out.WriteString("https://oidc-fips.") + out.WriteString(_Region) + out.WriteString(".") + out.WriteString(_PartitionResult.DualStackDnsSuffix) + return out.String() + }() + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + } + return endpoint, fmt.Errorf("endpoint rule error, %s", "FIPS and DualStack are enabled, but this partition does not support one or both") + } + } + if _UseFIPS == true { + if true == _PartitionResult.SupportsFIPS { + uriString := func() string { + var out strings.Builder + out.WriteString("https://oidc-fips.") + out.WriteString(_Region) + out.WriteString(".") + out.WriteString(_PartitionResult.DnsSuffix) + return out.String() + }() + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + return endpoint, fmt.Errorf("endpoint rule error, %s", "FIPS is enabled but this partition does not support FIPS") + } + if _UseDualStack == true { + if true == _PartitionResult.SupportsDualStack { + uriString := func() string { + var out strings.Builder + out.WriteString("https://oidc.") + out.WriteString(_Region) + out.WriteString(".") + out.WriteString(_PartitionResult.DualStackDnsSuffix) + return out.String() + }() + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + return endpoint, fmt.Errorf("endpoint rule error, %s", "DualStack is enabled but this partition does not support DualStack") + } + if _Region == "ap-east-1" { + uriString := "https://oidc.ap-east-1.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + if _Region == "ap-northeast-1" { + uriString := "https://oidc.ap-northeast-1.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + if _Region == "ap-northeast-2" { + uriString := "https://oidc.ap-northeast-2.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + if _Region == "ap-northeast-3" { + uriString := "https://oidc.ap-northeast-3.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + if _Region == "ap-south-1" { + uriString := "https://oidc.ap-south-1.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + if _Region == "ap-southeast-1" { + uriString := "https://oidc.ap-southeast-1.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + if _Region == "ap-southeast-2" { + uriString := "https://oidc.ap-southeast-2.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + if _Region == "ca-central-1" { + uriString := "https://oidc.ca-central-1.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + if _Region == "eu-central-1" { + uriString := "https://oidc.eu-central-1.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + if _Region == "eu-north-1" { + uriString := "https://oidc.eu-north-1.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + if _Region == "eu-south-1" { + uriString := "https://oidc.eu-south-1.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + if _Region == "eu-west-1" { + uriString := "https://oidc.eu-west-1.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + if _Region == "eu-west-2" { + uriString := "https://oidc.eu-west-2.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + if _Region == "eu-west-3" { + uriString := "https://oidc.eu-west-3.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + if _Region == "me-south-1" { + uriString := "https://oidc.me-south-1.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + if _Region == "sa-east-1" { + uriString := "https://oidc.sa-east-1.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + if _Region == "us-east-1" { + uriString := "https://oidc.us-east-1.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + if _Region == "us-east-2" { + uriString := "https://oidc.us-east-2.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + if _Region == "us-west-2" { + uriString := "https://oidc.us-west-2.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + if _Region == "us-gov-east-1" { + uriString := "https://oidc.us-gov-east-1.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + if _Region == "us-gov-west-1" { + uriString := "https://oidc.us-gov-west-1.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + uriString := func() string { + var out strings.Builder + out.WriteString("https://oidc.") + out.WriteString(_Region) + out.WriteString(".") + out.WriteString(_PartitionResult.DnsSuffix) + return out.String() + }() + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + return endpoint, fmt.Errorf("Endpoint resolution failed. Invalid operation or environment input.") + } + return endpoint, fmt.Errorf("endpoint rule error, %s", "Invalid Configuration: Missing Region") +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/ssooidc/generated.json b/vendor/github.com/aws/aws-sdk-go-v2/service/ssooidc/generated.json index 4afe3223e2..fe2d075ad7 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/ssooidc/generated.json +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/ssooidc/generated.json @@ -3,7 +3,8 @@ "github.com/aws/aws-sdk-go-v2": "v1.4.0", "github.com/aws/aws-sdk-go-v2/internal/configsources": "v0.0.0-00010101000000-000000000000", "github.com/aws/aws-sdk-go-v2/internal/endpoints/v2": "v2.0.0-00010101000000-000000000000", - "github.com/aws/smithy-go": "v1.4.0" + "github.com/aws/smithy-go": "v1.4.0", + "github.com/google/go-cmp": "v0.5.4" }, "files": [ "api_client.go", @@ -14,6 +15,7 @@ "deserializers.go", "doc.go", "endpoints.go", + "endpoints_test.go", "generated.json", "internal/endpoints/endpoints.go", "internal/endpoints/endpoints_test.go", diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/ssooidc/go_module_metadata.go b/vendor/github.com/aws/aws-sdk-go-v2/service/ssooidc/go_module_metadata.go index bcf9f45f9f..973c0aac24 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/ssooidc/go_module_metadata.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/ssooidc/go_module_metadata.go @@ -3,4 +3,4 @@ package ssooidc // goModuleVersion is the tagged release for this module -const goModuleVersion = "1.14.13" +const goModuleVersion = "1.15.1" diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/ssooidc/internal/endpoints/endpoints.go b/vendor/github.com/aws/aws-sdk-go-v2/service/ssooidc/internal/endpoints/endpoints.go index b04fb46fe6..8df344e93e 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/ssooidc/internal/endpoints/endpoints.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/ssooidc/internal/endpoints/endpoints.go @@ -94,7 +94,7 @@ var partitionRegexp = struct { AwsUsGov *regexp.Regexp }{ - Aws: regexp.MustCompile("^(us|eu|ap|sa|ca|me|af)\\-\\w+\\-\\d+$"), + Aws: regexp.MustCompile("^(us|eu|ap|sa|ca|me|af|il)\\-\\w+\\-\\d+$"), AwsCn: regexp.MustCompile("^cn\\-\\w+\\-\\d+$"), AwsIso: regexp.MustCompile("^us\\-iso\\-\\w+\\-\\d+$"), AwsIsoB: regexp.MustCompile("^us\\-isob\\-\\w+\\-\\d+$"), diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/ssooidc/serializers.go b/vendor/github.com/aws/aws-sdk-go-v2/service/ssooidc/serializers.go index a8cfd7b46c..efca8b2507 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/ssooidc/serializers.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/ssooidc/serializers.go @@ -38,7 +38,14 @@ func (m *awsRestjson1_serializeOpCreateToken) HandleSerialize(ctx context.Contex request.URL.Path = smithyhttp.JoinPath(request.URL.Path, opPath) request.URL.RawQuery = smithyhttp.JoinRawQuery(request.URL.RawQuery, opQuery) request.Method = "POST" - restEncoder, err := httpbinding.NewEncoder(request.URL.Path, request.URL.RawQuery, request.Header) + var restEncoder *httpbinding.Encoder + if request.URL.RawPath == "" { + restEncoder, err = httpbinding.NewEncoder(request.URL.Path, request.URL.RawQuery, request.Header) + } else { + request.URL.RawPath = smithyhttp.JoinPath(request.URL.RawPath, opPath) + restEncoder, err = httpbinding.NewEncoderWithRawPath(request.URL.Path, request.URL.RawPath, request.URL.RawQuery, request.Header) + } + if err != nil { return out, metadata, &smithy.SerializationError{Err: err} } @@ -143,7 +150,14 @@ func (m *awsRestjson1_serializeOpRegisterClient) HandleSerialize(ctx context.Con request.URL.Path = smithyhttp.JoinPath(request.URL.Path, opPath) request.URL.RawQuery = smithyhttp.JoinRawQuery(request.URL.RawQuery, opQuery) request.Method = "POST" - restEncoder, err := httpbinding.NewEncoder(request.URL.Path, request.URL.RawQuery, request.Header) + var restEncoder *httpbinding.Encoder + if request.URL.RawPath == "" { + restEncoder, err = httpbinding.NewEncoder(request.URL.Path, request.URL.RawQuery, request.Header) + } else { + request.URL.RawPath = smithyhttp.JoinPath(request.URL.RawPath, opPath) + restEncoder, err = httpbinding.NewEncoderWithRawPath(request.URL.Path, request.URL.RawPath, request.URL.RawQuery, request.Header) + } + if err != nil { return out, metadata, &smithy.SerializationError{Err: err} } @@ -223,7 +237,14 @@ func (m *awsRestjson1_serializeOpStartDeviceAuthorization) HandleSerialize(ctx c request.URL.Path = smithyhttp.JoinPath(request.URL.Path, opPath) request.URL.RawQuery = smithyhttp.JoinRawQuery(request.URL.RawQuery, opQuery) request.Method = "POST" - restEncoder, err := httpbinding.NewEncoder(request.URL.Path, request.URL.RawQuery, request.Header) + var restEncoder *httpbinding.Encoder + if request.URL.RawPath == "" { + restEncoder, err = httpbinding.NewEncoder(request.URL.Path, request.URL.RawQuery, request.Header) + } else { + request.URL.RawPath = smithyhttp.JoinPath(request.URL.RawPath, opPath) + restEncoder, err = httpbinding.NewEncoderWithRawPath(request.URL.Path, request.URL.RawPath, request.URL.RawQuery, request.Header) + } + if err != nil { return out, metadata, &smithy.SerializationError{Err: err} } diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/sts/CHANGELOG.md b/vendor/github.com/aws/aws-sdk-go-v2/service/sts/CHANGELOG.md index c85620ac45..63304f764d 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/sts/CHANGELOG.md +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/sts/CHANGELOG.md @@ -1,3 +1,20 @@ +# v1.21.1 (2023-08-01) + +* No change notes available for this release. + +# v1.21.0 (2023-07-31) + +* **Feature**: Adds support for smithy-modeled endpoint resolution. A new rules-based endpoint resolution will be added to the SDK which will supercede and deprecate existing endpoint resolution. Specifically, EndpointResolver will be deprecated while BaseEndpoint and EndpointResolverV2 will take its place. For more information, please see the Endpoints section in our Developer Guide. +* **Dependency Update**: Updated to the latest SDK module versions + +# v1.20.1 (2023-07-28) + +* **Dependency Update**: Updated to the latest SDK module versions + +# v1.20.0 (2023-07-25) + +* **Feature**: API updates for the AWS Security Token Service + # v1.19.3 (2023-07-13) * **Dependency Update**: Updated to the latest SDK module versions diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/sts/api_client.go b/vendor/github.com/aws/aws-sdk-go-v2/service/sts/api_client.go index 613c0fa58a..22ac690430 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/sts/api_client.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/sts/api_client.go @@ -4,6 +4,7 @@ package sts import ( "context" + "fmt" "github.com/aws/aws-sdk-go-v2/aws" "github.com/aws/aws-sdk-go-v2/aws/defaults" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" @@ -48,8 +49,6 @@ func New(options Options, optFns ...func(*Options)) *Client { resolveHTTPSignerV4(&options) - resolveDefaultEndpointConfiguration(&options) - for _, fn := range optFns { fn(&options) } @@ -70,6 +69,11 @@ type Options struct { // The optional application specific identifier appended to the User-Agent header. AppID string + // This endpoint will be given as input to an EndpointResolverV2. It is used for + // providing a custom base endpoint that is subject to modifications by the + // processing EndpointResolverV2. + BaseEndpoint *string + // Configures the events that will be sent to the configured logger. ClientLogMode aws.ClientLogMode @@ -84,8 +88,18 @@ type Options struct { EndpointOptions EndpointResolverOptions // The service endpoint resolver. + // + // Deprecated: Deprecated: EndpointResolver and WithEndpointResolver. Providing a + // value for this field will likely prevent you from using any endpoint-related + // service features released after the introduction of EndpointResolverV2 and + // BaseEndpoint. To migrate an EndpointResolver implementation that uses a custom + // endpoint, set the client option BaseEndpoint instead. EndpointResolver EndpointResolver + // Resolves the endpoint used for a particular service. This should be used over + // the deprecated EndpointResolver + EndpointResolverV2 EndpointResolverV2 + // Signature Version 4 (SigV4) Signer HTTPSignerV4 HTTPSignerV4 @@ -144,14 +158,25 @@ func WithAPIOptions(optFns ...func(*middleware.Stack) error) func(*Options) { } } -// WithEndpointResolver returns a functional option for setting the Client's -// EndpointResolver option. +// Deprecated: EndpointResolver and WithEndpointResolver. Providing a value for +// this field will likely prevent you from using any endpoint-related service +// features released after the introduction of EndpointResolverV2 and BaseEndpoint. +// To migrate an EndpointResolver implementation that uses a custom endpoint, set +// the client option BaseEndpoint instead. func WithEndpointResolver(v EndpointResolver) func(*Options) { return func(o *Options) { o.EndpointResolver = v } } +// WithEndpointResolverV2 returns a functional option for setting the Client's +// EndpointResolverV2 option. +func WithEndpointResolverV2(v EndpointResolverV2) func(*Options) { + return func(o *Options) { + o.EndpointResolverV2 = v + } +} + type HTTPClient interface { Do(*http.Request) (*http.Response, error) } @@ -168,6 +193,8 @@ func (c *Client) invokeOperation(ctx context.Context, opID string, params interf ctx = middleware.ClearStackValues(ctx) stack := middleware.NewStack(opID, smithyhttp.NewStackRequest) options := c.options.Copy() + resolveEndpointResolverV2(&options) + for _, fn := range optFns { fn(&options) } @@ -202,6 +229,30 @@ func (c *Client) invokeOperation(ctx context.Context, opID string, params interf type noSmithyDocumentSerde = smithydocument.NoSerde +type legacyEndpointContextSetter struct { + LegacyResolver EndpointResolver +} + +func (*legacyEndpointContextSetter) ID() string { + return "legacyEndpointContextSetter" +} + +func (m *legacyEndpointContextSetter) HandleInitialize(ctx context.Context, in middleware.InitializeInput, next middleware.InitializeHandler) ( + out middleware.InitializeOutput, metadata middleware.Metadata, err error, +) { + if m.LegacyResolver != nil { + ctx = awsmiddleware.SetRequiresLegacyEndpoints(ctx, true) + } + + return next.HandleInitialize(ctx, in) + +} +func addlegacyEndpointContextSetter(stack *middleware.Stack, o Options) error { + return stack.Initialize.Add(&legacyEndpointContextSetter{ + LegacyResolver: o.EndpointResolver, + }, middleware.Before) +} + func resolveDefaultLogger(o *Options) { if o.Logger != nil { return @@ -350,7 +401,7 @@ func resolveAWSEndpointResolver(cfg aws.Config, o *Options) { if cfg.EndpointResolver == nil && cfg.EndpointResolverWithOptions == nil { return } - o.EndpointResolver = withEndpointResolver(cfg.EndpointResolver, cfg.EndpointResolverWithOptions, NewDefaultEndpointResolver()) + o.EndpointResolver = withEndpointResolver(cfg.EndpointResolver, cfg.EndpointResolverWithOptions) } func addClientUserAgent(stack *middleware.Stack, options Options) error { @@ -547,3 +598,32 @@ func addRequestResponseLogging(stack *middleware.Stack, o Options) error { LogResponseWithBody: o.ClientLogMode.IsResponseWithBody(), }, middleware.After) } + +type endpointDisableHTTPSMiddleware struct { + EndpointDisableHTTPS bool +} + +func (*endpointDisableHTTPSMiddleware) ID() string { + return "endpointDisableHTTPSMiddleware" +} + +func (m *endpointDisableHTTPSMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointDisableHTTPS && !smithyhttp.GetHostnameImmutable(ctx) { + req.URL.Scheme = "http" + } + + return next.HandleSerialize(ctx, in) + +} +func addendpointDisableHTTPSMiddleware(stack *middleware.Stack, o Options) error { + return stack.Serialize.Insert(&endpointDisableHTTPSMiddleware{ + EndpointDisableHTTPS: o.EndpointOptions.DisableHTTPS, + }, "OperationSerializer", middleware.Before) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/sts/api_op_AssumeRole.go b/vendor/github.com/aws/aws-sdk-go-v2/service/sts/api_op_AssumeRole.go index 634b6caf1e..0ef7affc59 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/sts/api_op_AssumeRole.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/sts/api_op_AssumeRole.go @@ -4,9 +4,14 @@ package sts import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" "github.com/aws/aws-sdk-go-v2/service/sts/types" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -199,6 +204,9 @@ type AssumeRoleInput struct { // in the IAM User Guide. PolicyArns []types.PolicyDescriptorType + // Reserved for future use. + ProvidedContexts []types.ProvidedContext + // The identification number of the MFA device that is associated with the user // who is making the AssumeRole call. Specify this value if the trust policy of // the role being assumed includes a condition that requires MFA authentication. @@ -327,6 +335,9 @@ func (c *Client) addOperationAssumeRoleMiddlewares(stack *middleware.Stack, opti if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -363,6 +374,9 @@ func (c *Client) addOperationAssumeRoleMiddlewares(stack *middleware.Stack, opti if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addAssumeRoleResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpAssumeRoleValidationMiddleware(stack); err != nil { return err } @@ -381,6 +395,9 @@ func (c *Client) addOperationAssumeRoleMiddlewares(stack *middleware.Stack, opti if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -416,3 +433,126 @@ func (c *PresignClient) PresignAssumeRole(ctx context.Context, params *AssumeRol out := result.(*v4.PresignedHTTPRequest) return out, nil } + +type opAssumeRoleResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opAssumeRoleResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opAssumeRoleResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "sts" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "sts" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("sts") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addAssumeRoleResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opAssumeRoleResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/sts/api_op_AssumeRoleWithSAML.go b/vendor/github.com/aws/aws-sdk-go-v2/service/sts/api_op_AssumeRoleWithSAML.go index a036cb2873..9c33720d41 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/sts/api_op_AssumeRoleWithSAML.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/sts/api_op_AssumeRoleWithSAML.go @@ -4,8 +4,13 @@ package sts import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" "github.com/aws/aws-sdk-go-v2/service/sts/types" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -284,6 +289,9 @@ func (c *Client) addOperationAssumeRoleWithSAMLMiddlewares(stack *middleware.Sta if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -314,6 +322,9 @@ func (c *Client) addOperationAssumeRoleWithSAMLMiddlewares(stack *middleware.Sta if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addAssumeRoleWithSAMLResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpAssumeRoleWithSAMLValidationMiddleware(stack); err != nil { return err } @@ -332,6 +343,9 @@ func (c *Client) addOperationAssumeRoleWithSAMLMiddlewares(stack *middleware.Sta if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -343,3 +357,126 @@ func newServiceMetadataMiddleware_opAssumeRoleWithSAML(region string) *awsmiddle OperationName: "AssumeRoleWithSAML", } } + +type opAssumeRoleWithSAMLResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opAssumeRoleWithSAMLResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opAssumeRoleWithSAMLResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "sts" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "sts" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("sts") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addAssumeRoleWithSAMLResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opAssumeRoleWithSAMLResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/sts/api_op_AssumeRoleWithWebIdentity.go b/vendor/github.com/aws/aws-sdk-go-v2/service/sts/api_op_AssumeRoleWithWebIdentity.go index dd039aa8c2..fa4a608459 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/sts/api_op_AssumeRoleWithWebIdentity.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/sts/api_op_AssumeRoleWithWebIdentity.go @@ -4,8 +4,13 @@ package sts import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" "github.com/aws/aws-sdk-go-v2/service/sts/types" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -149,7 +154,8 @@ type AssumeRoleWithWebIdentityInput struct { // The OAuth 2.0 access token or OpenID Connect ID token that is provided by the // identity provider. Your application must get this token by authenticating the // user who is using your application with a web identity provider before the - // application makes an AssumeRoleWithWebIdentity call. + // application makes an AssumeRoleWithWebIdentity call. Only tokens with RSA + // algorithms (RS256) are supported. // // This member is required. WebIdentityToken *string @@ -302,6 +308,9 @@ func (c *Client) addOperationAssumeRoleWithWebIdentityMiddlewares(stack *middlew if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -332,6 +341,9 @@ func (c *Client) addOperationAssumeRoleWithWebIdentityMiddlewares(stack *middlew if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addAssumeRoleWithWebIdentityResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpAssumeRoleWithWebIdentityValidationMiddleware(stack); err != nil { return err } @@ -350,6 +362,9 @@ func (c *Client) addOperationAssumeRoleWithWebIdentityMiddlewares(stack *middlew if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -361,3 +376,126 @@ func newServiceMetadataMiddleware_opAssumeRoleWithWebIdentity(region string) *aw OperationName: "AssumeRoleWithWebIdentity", } } + +type opAssumeRoleWithWebIdentityResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opAssumeRoleWithWebIdentityResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opAssumeRoleWithWebIdentityResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "sts" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "sts" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("sts") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addAssumeRoleWithWebIdentityResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opAssumeRoleWithWebIdentityResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/sts/api_op_DecodeAuthorizationMessage.go b/vendor/github.com/aws/aws-sdk-go-v2/service/sts/api_op_DecodeAuthorizationMessage.go index fedf95304e..baf2f96866 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/sts/api_op_DecodeAuthorizationMessage.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/sts/api_op_DecodeAuthorizationMessage.go @@ -4,8 +4,13 @@ package sts import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -81,6 +86,9 @@ func (c *Client) addOperationDecodeAuthorizationMessageMiddlewares(stack *middle if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -117,6 +125,9 @@ func (c *Client) addOperationDecodeAuthorizationMessageMiddlewares(stack *middle if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addDecodeAuthorizationMessageResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpDecodeAuthorizationMessageValidationMiddleware(stack); err != nil { return err } @@ -135,6 +146,9 @@ func (c *Client) addOperationDecodeAuthorizationMessageMiddlewares(stack *middle if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -146,3 +160,126 @@ func newServiceMetadataMiddleware_opDecodeAuthorizationMessage(region string) *a OperationName: "DecodeAuthorizationMessage", } } + +type opDecodeAuthorizationMessageResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opDecodeAuthorizationMessageResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opDecodeAuthorizationMessageResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "sts" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "sts" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("sts") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addDecodeAuthorizationMessageResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opDecodeAuthorizationMessageResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/sts/api_op_GetAccessKeyInfo.go b/vendor/github.com/aws/aws-sdk-go-v2/service/sts/api_op_GetAccessKeyInfo.go index d98d56451f..f1dd167da9 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/sts/api_op_GetAccessKeyInfo.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/sts/api_op_GetAccessKeyInfo.go @@ -4,8 +4,13 @@ package sts import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -74,6 +79,9 @@ func (c *Client) addOperationGetAccessKeyInfoMiddlewares(stack *middleware.Stack if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -110,6 +118,9 @@ func (c *Client) addOperationGetAccessKeyInfoMiddlewares(stack *middleware.Stack if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addGetAccessKeyInfoResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpGetAccessKeyInfoValidationMiddleware(stack); err != nil { return err } @@ -128,6 +139,9 @@ func (c *Client) addOperationGetAccessKeyInfoMiddlewares(stack *middleware.Stack if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -139,3 +153,126 @@ func newServiceMetadataMiddleware_opGetAccessKeyInfo(region string) *awsmiddlewa OperationName: "GetAccessKeyInfo", } } + +type opGetAccessKeyInfoResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opGetAccessKeyInfoResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opGetAccessKeyInfoResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "sts" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "sts" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("sts") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addGetAccessKeyInfoResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opGetAccessKeyInfoResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/sts/api_op_GetCallerIdentity.go b/vendor/github.com/aws/aws-sdk-go-v2/service/sts/api_op_GetCallerIdentity.go index e0343c0ff8..66e5d99d49 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/sts/api_op_GetCallerIdentity.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/sts/api_op_GetCallerIdentity.go @@ -4,8 +4,13 @@ package sts import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -69,6 +74,9 @@ func (c *Client) addOperationGetCallerIdentityMiddlewares(stack *middleware.Stac if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -105,6 +113,9 @@ func (c *Client) addOperationGetCallerIdentityMiddlewares(stack *middleware.Stac if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addGetCallerIdentityResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = stack.Initialize.Add(newServiceMetadataMiddleware_opGetCallerIdentity(options.Region), middleware.Before); err != nil { return err } @@ -120,6 +131,9 @@ func (c *Client) addOperationGetCallerIdentityMiddlewares(stack *middleware.Stac if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -155,3 +169,126 @@ func (c *PresignClient) PresignGetCallerIdentity(ctx context.Context, params *Ge out := result.(*v4.PresignedHTTPRequest) return out, nil } + +type opGetCallerIdentityResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opGetCallerIdentityResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opGetCallerIdentityResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "sts" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "sts" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("sts") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addGetCallerIdentityResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opGetCallerIdentityResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/sts/api_op_GetFederationToken.go b/vendor/github.com/aws/aws-sdk-go-v2/service/sts/api_op_GetFederationToken.go index 6c003d2a55..d577ef686e 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/sts/api_op_GetFederationToken.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/sts/api_op_GetFederationToken.go @@ -4,9 +4,14 @@ package sts import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" "github.com/aws/aws-sdk-go-v2/service/sts/types" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -241,6 +246,9 @@ func (c *Client) addOperationGetFederationTokenMiddlewares(stack *middleware.Sta if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -277,6 +285,9 @@ func (c *Client) addOperationGetFederationTokenMiddlewares(stack *middleware.Sta if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addGetFederationTokenResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = addOpGetFederationTokenValidationMiddleware(stack); err != nil { return err } @@ -295,6 +306,9 @@ func (c *Client) addOperationGetFederationTokenMiddlewares(stack *middleware.Sta if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -306,3 +320,126 @@ func newServiceMetadataMiddleware_opGetFederationToken(region string) *awsmiddle OperationName: "GetFederationToken", } } + +type opGetFederationTokenResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opGetFederationTokenResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opGetFederationTokenResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "sts" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "sts" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("sts") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addGetFederationTokenResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opGetFederationTokenResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/sts/api_op_GetSessionToken.go b/vendor/github.com/aws/aws-sdk-go-v2/service/sts/api_op_GetSessionToken.go index f488a25d8f..7a2345e803 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/sts/api_op_GetSessionToken.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/sts/api_op_GetSessionToken.go @@ -4,9 +4,14 @@ package sts import ( "context" + "errors" + "fmt" + "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" "github.com/aws/aws-sdk-go-v2/aws/signer/v4" + internalauth "github.com/aws/aws-sdk-go-v2/internal/auth" "github.com/aws/aws-sdk-go-v2/service/sts/types" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" smithyhttp "github.com/aws/smithy-go/transport/http" ) @@ -127,6 +132,9 @@ func (c *Client) addOperationGetSessionTokenMiddlewares(stack *middleware.Stack, if err != nil { return err } + if err = addlegacyEndpointContextSetter(stack, options); err != nil { + return err + } if err = addSetLoggerMiddleware(stack, options); err != nil { return err } @@ -163,6 +171,9 @@ func (c *Client) addOperationGetSessionTokenMiddlewares(stack *middleware.Stack, if err = smithyhttp.AddCloseResponseBodyMiddleware(stack); err != nil { return err } + if err = addGetSessionTokenResolveEndpointMiddleware(stack, options); err != nil { + return err + } if err = stack.Initialize.Add(newServiceMetadataMiddleware_opGetSessionToken(options.Region), middleware.Before); err != nil { return err } @@ -178,6 +189,9 @@ func (c *Client) addOperationGetSessionTokenMiddlewares(stack *middleware.Stack, if err = addRequestResponseLogging(stack, options); err != nil { return err } + if err = addendpointDisableHTTPSMiddleware(stack, options); err != nil { + return err + } return nil } @@ -189,3 +203,126 @@ func newServiceMetadataMiddleware_opGetSessionToken(region string) *awsmiddlewar OperationName: "GetSessionToken", } } + +type opGetSessionTokenResolveEndpointMiddleware struct { + EndpointResolver EndpointResolverV2 + BuiltInResolver builtInParameterResolver +} + +func (*opGetSessionTokenResolveEndpointMiddleware) ID() string { + return "ResolveEndpointV2" +} + +func (m *opGetSessionTokenResolveEndpointMiddleware) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( + out middleware.SerializeOutput, metadata middleware.Metadata, err error, +) { + if awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + + req, ok := in.Request.(*smithyhttp.Request) + if !ok { + return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) + } + + if m.EndpointResolver == nil { + return out, metadata, fmt.Errorf("expected endpoint resolver to not be nil") + } + + params := EndpointParameters{} + + m.BuiltInResolver.ResolveBuiltIns(¶ms) + + var resolvedEndpoint smithyendpoints.Endpoint + resolvedEndpoint, err = m.EndpointResolver.ResolveEndpoint(ctx, params) + if err != nil { + return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) + } + + req.URL = &resolvedEndpoint.URI + + for k := range resolvedEndpoint.Headers { + req.Header.Set( + k, + resolvedEndpoint.Headers.Get(k), + ) + } + + authSchemes, err := internalauth.GetAuthenticationSchemes(&resolvedEndpoint.Properties) + if err != nil { + var nfe *internalauth.NoAuthenticationSchemesFoundError + if errors.As(err, &nfe) { + // if no auth scheme is found, default to sigv4 + signingName := "sts" + signingRegion := m.BuiltInResolver.(*builtInResolver).Region + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + + } + var ue *internalauth.UnSupportedAuthenticationSchemeSpecifiedError + if errors.As(err, &ue) { + return out, metadata, fmt.Errorf( + "This operation requests signer version(s) %v but the client only supports %v", + ue.UnsupportedSchemes, + internalauth.SupportedSchemes, + ) + } + } + + for _, authScheme := range authSchemes { + switch authScheme.(type) { + case *internalauth.AuthenticationSchemeV4: + v4Scheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4) + var signingName, signingRegion string + if v4Scheme.SigningName == nil { + signingName = "sts" + } else { + signingName = *v4Scheme.SigningName + } + if v4Scheme.SigningRegion == nil { + signingRegion = m.BuiltInResolver.(*builtInResolver).Region + } else { + signingRegion = *v4Scheme.SigningRegion + } + if v4Scheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4Scheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, signingName) + ctx = awsmiddleware.SetSigningRegion(ctx, signingRegion) + break + case *internalauth.AuthenticationSchemeV4A: + v4aScheme, _ := authScheme.(*internalauth.AuthenticationSchemeV4A) + if v4aScheme.SigningName == nil { + v4aScheme.SigningName = aws.String("sts") + } + if v4aScheme.DisableDoubleEncoding != nil { + // The signer sets an equivalent value at client initialization time. + // Setting this context value will cause the signer to extract it + // and override the value set at client initialization time. + ctx = internalauth.SetDisableDoubleEncoding(ctx, *v4aScheme.DisableDoubleEncoding) + } + ctx = awsmiddleware.SetSigningName(ctx, *v4aScheme.SigningName) + ctx = awsmiddleware.SetSigningRegion(ctx, v4aScheme.SigningRegionSet[0]) + break + case *internalauth.AuthenticationSchemeNone: + break + } + } + + return next.HandleSerialize(ctx, in) +} + +func addGetSessionTokenResolveEndpointMiddleware(stack *middleware.Stack, options Options) error { + return stack.Serialize.Insert(&opGetSessionTokenResolveEndpointMiddleware{ + EndpointResolver: options.EndpointResolverV2, + BuiltInResolver: &builtInResolver{ + Region: options.Region, + UseDualStack: options.EndpointOptions.UseDualStackEndpoint, + UseFIPS: options.EndpointOptions.UseFIPSEndpoint, + Endpoint: options.BaseEndpoint, + }, + }, "ResolveEndpoint", middleware.After) +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/sts/endpoints.go b/vendor/github.com/aws/aws-sdk-go-v2/service/sts/endpoints.go index cababea22d..ef1caae8d3 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/sts/endpoints.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/sts/endpoints.go @@ -8,9 +8,14 @@ import ( "fmt" "github.com/aws/aws-sdk-go-v2/aws" awsmiddleware "github.com/aws/aws-sdk-go-v2/aws/middleware" + "github.com/aws/aws-sdk-go-v2/internal/endpoints/awsrulesfn" internalendpoints "github.com/aws/aws-sdk-go-v2/service/sts/internal/endpoints" + smithy "github.com/aws/smithy-go" + smithyendpoints "github.com/aws/smithy-go/endpoints" "github.com/aws/smithy-go/middleware" + "github.com/aws/smithy-go/ptr" smithyhttp "github.com/aws/smithy-go/transport/http" + "net/http" "net/url" "strings" ) @@ -39,13 +44,6 @@ func (fn EndpointResolverFunc) ResolveEndpoint(region string, options EndpointRe return fn(region, options) } -func resolveDefaultEndpointConfiguration(o *Options) { - if o.EndpointResolver != nil { - return - } - o.EndpointResolver = NewDefaultEndpointResolver() -} - // EndpointResolverFromURL returns an EndpointResolver configured using the // provided endpoint url. By default, the resolved endpoint resolver uses the // client region as signing region, and the endpoint source is set to @@ -79,6 +77,10 @@ func (*ResolveEndpoint) ID() string { func (m *ResolveEndpoint) HandleSerialize(ctx context.Context, in middleware.SerializeInput, next middleware.SerializeHandler) ( out middleware.SerializeOutput, metadata middleware.Metadata, err error, ) { + if !awsmiddleware.GetRequiresLegacyEndpoints(ctx) { + return next.HandleSerialize(ctx, in) + } + req, ok := in.Request.(*smithyhttp.Request) if !ok { return out, metadata, fmt.Errorf("unknown transport type %T", in.Request) @@ -94,6 +96,11 @@ func (m *ResolveEndpoint) HandleSerialize(ctx context.Context, in middleware.Ser var endpoint aws.Endpoint endpoint, err = m.Resolver.ResolveEndpoint(awsmiddleware.GetRegion(ctx), eo) if err != nil { + nf := (&aws.EndpointNotFoundError{}) + if errors.As(err, &nf) { + ctx = awsmiddleware.SetRequiresLegacyEndpoints(ctx, false) + return next.HandleSerialize(ctx, in) + } return out, metadata, fmt.Errorf("failed to resolve service endpoint, %w", err) } @@ -129,27 +136,10 @@ func removeResolveEndpointMiddleware(stack *middleware.Stack) error { type wrappedEndpointResolver struct { awsResolver aws.EndpointResolverWithOptions - resolver EndpointResolver } func (w *wrappedEndpointResolver) ResolveEndpoint(region string, options EndpointResolverOptions) (endpoint aws.Endpoint, err error) { - if w.awsResolver == nil { - goto fallback - } - endpoint, err = w.awsResolver.ResolveEndpoint(ServiceID, region, options) - if err == nil { - return endpoint, nil - } - - if nf := (&aws.EndpointNotFoundError{}); !errors.As(err, &nf) { - return endpoint, err - } - -fallback: - if w.resolver == nil { - return endpoint, fmt.Errorf("default endpoint resolver provided was nil") - } - return w.resolver.ResolveEndpoint(region, options) + return w.awsResolver.ResolveEndpoint(ServiceID, region, options) } type awsEndpointResolverAdaptor func(service, region string) (aws.Endpoint, error) @@ -160,12 +150,13 @@ func (a awsEndpointResolverAdaptor) ResolveEndpoint(service, region string, opti var _ aws.EndpointResolverWithOptions = awsEndpointResolverAdaptor(nil) -// withEndpointResolver returns an EndpointResolver that first delegates endpoint resolution to the awsResolver. -// If awsResolver returns aws.EndpointNotFoundError error, the resolver will use the the provided -// fallbackResolver for resolution. +// withEndpointResolver returns an aws.EndpointResolverWithOptions that first delegates endpoint resolution to the awsResolver. +// If awsResolver returns aws.EndpointNotFoundError error, the v1 resolver middleware will swallow the error, +// and set an appropriate context flag such that fallback will occur when EndpointResolverV2 is invoked +// via its middleware. // -// fallbackResolver must not be nil -func withEndpointResolver(awsResolver aws.EndpointResolver, awsResolverWithOptions aws.EndpointResolverWithOptions, fallbackResolver EndpointResolver) EndpointResolver { +// If another error (besides aws.EndpointNotFoundError) is returned, then that error will be propagated. +func withEndpointResolver(awsResolver aws.EndpointResolver, awsResolverWithOptions aws.EndpointResolverWithOptions) EndpointResolver { var resolver aws.EndpointResolverWithOptions if awsResolverWithOptions != nil { @@ -176,7 +167,6 @@ func withEndpointResolver(awsResolver aws.EndpointResolver, awsResolverWithOptio return &wrappedEndpointResolver{ awsResolver: resolver, - resolver: fallbackResolver, } } @@ -198,3 +188,789 @@ func finalizeClientEndpointResolverOptions(options *Options) { } } + +func resolveEndpointResolverV2(options *Options) { + if options.EndpointResolverV2 == nil { + options.EndpointResolverV2 = NewDefaultEndpointResolverV2() + } +} + +// Utility function to aid with translating pseudo-regions to classical regions +// with the appropriate setting indicated by the pseudo-region +func mapPseudoRegion(pr string) (region string, fips aws.FIPSEndpointState) { + const fipsInfix = "-fips-" + const fipsPrefix = "fips-" + const fipsSuffix = "-fips" + + if strings.Contains(pr, fipsInfix) || + strings.Contains(pr, fipsPrefix) || + strings.Contains(pr, fipsSuffix) { + region = strings.ReplaceAll(strings.ReplaceAll(strings.ReplaceAll( + pr, fipsInfix, "-"), fipsPrefix, ""), fipsSuffix, "") + fips = aws.FIPSEndpointStateEnabled + } else { + region = pr + } + + return region, fips +} + +// builtInParameterResolver is the interface responsible for resolving BuiltIn +// values during the sourcing of EndpointParameters +type builtInParameterResolver interface { + ResolveBuiltIns(*EndpointParameters) error +} + +// builtInResolver resolves modeled BuiltIn values using only the members defined +// below. +type builtInResolver struct { + // The AWS region used to dispatch the request. + Region string + + // Sourced BuiltIn value in a historical enabled or disabled state. + UseDualStack aws.DualStackEndpointState + + // Sourced BuiltIn value in a historical enabled or disabled state. + UseFIPS aws.FIPSEndpointState + + // Base endpoint that can potentially be modified during Endpoint resolution. + Endpoint *string + + // Whether the global endpoint should be used, rather then the regional endpoint + // for us-east-1. + UseGlobalEndpoint bool +} + +// Invoked at runtime to resolve BuiltIn Values. Only resolution code specific to +// each BuiltIn value is generated. +func (b *builtInResolver) ResolveBuiltIns(params *EndpointParameters) error { + + region, _ := mapPseudoRegion(b.Region) + if len(region) == 0 { + return fmt.Errorf("Could not resolve AWS::Region") + } else { + params.Region = aws.String(region) + } + if b.UseDualStack == aws.DualStackEndpointStateEnabled { + params.UseDualStack = aws.Bool(true) + } else { + params.UseDualStack = aws.Bool(false) + } + if b.UseFIPS == aws.FIPSEndpointStateEnabled { + params.UseFIPS = aws.Bool(true) + } else { + params.UseFIPS = aws.Bool(false) + } + params.Endpoint = b.Endpoint + params.UseGlobalEndpoint = aws.Bool(b.UseGlobalEndpoint) + return nil +} + +// EndpointParameters provides the parameters that influence how endpoints are +// resolved. +type EndpointParameters struct { + // The AWS region used to dispatch the request. + // + // Parameter is + // required. + // + // AWS::Region + Region *string + + // When true, use the dual-stack endpoint. If the configured endpoint does not + // support dual-stack, dispatching the request MAY return an error. + // + // Defaults to + // false if no value is provided. + // + // AWS::UseDualStack + UseDualStack *bool + + // When true, send this request to the FIPS-compliant regional endpoint. If the + // configured endpoint does not have a FIPS compliant endpoint, dispatching the + // request will return an error. + // + // Defaults to false if no value is + // provided. + // + // AWS::UseFIPS + UseFIPS *bool + + // Override the endpoint used to send this request + // + // Parameter is + // required. + // + // SDK::Endpoint + Endpoint *string + + // Whether the global endpoint should be used, rather then the regional endpoint + // for us-east-1. + // + // Defaults to false if no value is + // provided. + // + // AWS::STS::UseGlobalEndpoint + UseGlobalEndpoint *bool +} + +// ValidateRequired validates required parameters are set. +func (p EndpointParameters) ValidateRequired() error { + if p.UseDualStack == nil { + return fmt.Errorf("parameter UseDualStack is required") + } + + if p.UseFIPS == nil { + return fmt.Errorf("parameter UseFIPS is required") + } + + if p.UseGlobalEndpoint == nil { + return fmt.Errorf("parameter UseGlobalEndpoint is required") + } + + return nil +} + +// WithDefaults returns a shallow copy of EndpointParameterswith default values +// applied to members where applicable. +func (p EndpointParameters) WithDefaults() EndpointParameters { + if p.UseDualStack == nil { + p.UseDualStack = ptr.Bool(false) + } + + if p.UseFIPS == nil { + p.UseFIPS = ptr.Bool(false) + } + + if p.UseGlobalEndpoint == nil { + p.UseGlobalEndpoint = ptr.Bool(false) + } + return p +} + +// EndpointResolverV2 provides the interface for resolving service endpoints. +type EndpointResolverV2 interface { + // ResolveEndpoint attempts to resolve the endpoint with the provided options, + // returning the endpoint if found. Otherwise an error is returned. + ResolveEndpoint(ctx context.Context, params EndpointParameters) ( + smithyendpoints.Endpoint, error, + ) +} + +// resolver provides the implementation for resolving endpoints. +type resolver struct{} + +func NewDefaultEndpointResolverV2() EndpointResolverV2 { + return &resolver{} +} + +// ResolveEndpoint attempts to resolve the endpoint with the provided options, +// returning the endpoint if found. Otherwise an error is returned. +func (r *resolver) ResolveEndpoint( + ctx context.Context, params EndpointParameters, +) ( + endpoint smithyendpoints.Endpoint, err error, +) { + params = params.WithDefaults() + if err = params.ValidateRequired(); err != nil { + return endpoint, fmt.Errorf("endpoint parameters are not valid, %w", err) + } + _UseDualStack := *params.UseDualStack + _UseFIPS := *params.UseFIPS + _UseGlobalEndpoint := *params.UseGlobalEndpoint + + if _UseGlobalEndpoint == true { + if !(params.Endpoint != nil) { + if exprVal := params.Region; exprVal != nil { + _Region := *exprVal + _ = _Region + if exprVal := awsrulesfn.GetPartition(_Region); exprVal != nil { + _PartitionResult := *exprVal + _ = _PartitionResult + if _UseFIPS == false { + if _UseDualStack == false { + if _Region == "ap-northeast-1" { + uriString := "https://sts.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + Properties: func() smithy.Properties { + var out smithy.Properties + out.Set("authSchemes", []interface{}{ + map[string]interface{}{ + "name": "sigv4", + "signingName": "sts", + "signingRegion": "us-east-1", + }, + }) + return out + }(), + }, nil + } + if _Region == "ap-south-1" { + uriString := "https://sts.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + Properties: func() smithy.Properties { + var out smithy.Properties + out.Set("authSchemes", []interface{}{ + map[string]interface{}{ + "name": "sigv4", + "signingName": "sts", + "signingRegion": "us-east-1", + }, + }) + return out + }(), + }, nil + } + if _Region == "ap-southeast-1" { + uriString := "https://sts.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + Properties: func() smithy.Properties { + var out smithy.Properties + out.Set("authSchemes", []interface{}{ + map[string]interface{}{ + "name": "sigv4", + "signingName": "sts", + "signingRegion": "us-east-1", + }, + }) + return out + }(), + }, nil + } + if _Region == "ap-southeast-2" { + uriString := "https://sts.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + Properties: func() smithy.Properties { + var out smithy.Properties + out.Set("authSchemes", []interface{}{ + map[string]interface{}{ + "name": "sigv4", + "signingName": "sts", + "signingRegion": "us-east-1", + }, + }) + return out + }(), + }, nil + } + if _Region == "aws-global" { + uriString := "https://sts.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + Properties: func() smithy.Properties { + var out smithy.Properties + out.Set("authSchemes", []interface{}{ + map[string]interface{}{ + "name": "sigv4", + "signingName": "sts", + "signingRegion": "us-east-1", + }, + }) + return out + }(), + }, nil + } + if _Region == "ca-central-1" { + uriString := "https://sts.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + Properties: func() smithy.Properties { + var out smithy.Properties + out.Set("authSchemes", []interface{}{ + map[string]interface{}{ + "name": "sigv4", + "signingName": "sts", + "signingRegion": "us-east-1", + }, + }) + return out + }(), + }, nil + } + if _Region == "eu-central-1" { + uriString := "https://sts.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + Properties: func() smithy.Properties { + var out smithy.Properties + out.Set("authSchemes", []interface{}{ + map[string]interface{}{ + "name": "sigv4", + "signingName": "sts", + "signingRegion": "us-east-1", + }, + }) + return out + }(), + }, nil + } + if _Region == "eu-north-1" { + uriString := "https://sts.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + Properties: func() smithy.Properties { + var out smithy.Properties + out.Set("authSchemes", []interface{}{ + map[string]interface{}{ + "name": "sigv4", + "signingName": "sts", + "signingRegion": "us-east-1", + }, + }) + return out + }(), + }, nil + } + if _Region == "eu-west-1" { + uriString := "https://sts.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + Properties: func() smithy.Properties { + var out smithy.Properties + out.Set("authSchemes", []interface{}{ + map[string]interface{}{ + "name": "sigv4", + "signingName": "sts", + "signingRegion": "us-east-1", + }, + }) + return out + }(), + }, nil + } + if _Region == "eu-west-2" { + uriString := "https://sts.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + Properties: func() smithy.Properties { + var out smithy.Properties + out.Set("authSchemes", []interface{}{ + map[string]interface{}{ + "name": "sigv4", + "signingName": "sts", + "signingRegion": "us-east-1", + }, + }) + return out + }(), + }, nil + } + if _Region == "eu-west-3" { + uriString := "https://sts.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + Properties: func() smithy.Properties { + var out smithy.Properties + out.Set("authSchemes", []interface{}{ + map[string]interface{}{ + "name": "sigv4", + "signingName": "sts", + "signingRegion": "us-east-1", + }, + }) + return out + }(), + }, nil + } + if _Region == "sa-east-1" { + uriString := "https://sts.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + Properties: func() smithy.Properties { + var out smithy.Properties + out.Set("authSchemes", []interface{}{ + map[string]interface{}{ + "name": "sigv4", + "signingName": "sts", + "signingRegion": "us-east-1", + }, + }) + return out + }(), + }, nil + } + if _Region == "us-east-1" { + uriString := "https://sts.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + Properties: func() smithy.Properties { + var out smithy.Properties + out.Set("authSchemes", []interface{}{ + map[string]interface{}{ + "name": "sigv4", + "signingName": "sts", + "signingRegion": "us-east-1", + }, + }) + return out + }(), + }, nil + } + if _Region == "us-east-2" { + uriString := "https://sts.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + Properties: func() smithy.Properties { + var out smithy.Properties + out.Set("authSchemes", []interface{}{ + map[string]interface{}{ + "name": "sigv4", + "signingName": "sts", + "signingRegion": "us-east-1", + }, + }) + return out + }(), + }, nil + } + if _Region == "us-west-1" { + uriString := "https://sts.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + Properties: func() smithy.Properties { + var out smithy.Properties + out.Set("authSchemes", []interface{}{ + map[string]interface{}{ + "name": "sigv4", + "signingName": "sts", + "signingRegion": "us-east-1", + }, + }) + return out + }(), + }, nil + } + if _Region == "us-west-2" { + uriString := "https://sts.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + Properties: func() smithy.Properties { + var out smithy.Properties + out.Set("authSchemes", []interface{}{ + map[string]interface{}{ + "name": "sigv4", + "signingName": "sts", + "signingRegion": "us-east-1", + }, + }) + return out + }(), + }, nil + } + uriString := func() string { + var out strings.Builder + out.WriteString("https://sts.") + out.WriteString(_Region) + out.WriteString(".") + out.WriteString(_PartitionResult.DnsSuffix) + return out.String() + }() + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + Properties: func() smithy.Properties { + var out smithy.Properties + out.Set("authSchemes", []interface{}{ + map[string]interface{}{ + "name": "sigv4", + "signingName": "sts", + "signingRegion": _Region, + }, + }) + return out + }(), + }, nil + } + } + } + } + } + } + if exprVal := params.Endpoint; exprVal != nil { + _Endpoint := *exprVal + _ = _Endpoint + if _UseFIPS == true { + return endpoint, fmt.Errorf("endpoint rule error, %s", "Invalid Configuration: FIPS and custom endpoint are not supported") + } + if _UseDualStack == true { + return endpoint, fmt.Errorf("endpoint rule error, %s", "Invalid Configuration: Dualstack and custom endpoint are not supported") + } + uriString := _Endpoint + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + if exprVal := params.Region; exprVal != nil { + _Region := *exprVal + _ = _Region + if exprVal := awsrulesfn.GetPartition(_Region); exprVal != nil { + _PartitionResult := *exprVal + _ = _PartitionResult + if _UseFIPS == true { + if _UseDualStack == true { + if true == _PartitionResult.SupportsFIPS { + if true == _PartitionResult.SupportsDualStack { + uriString := func() string { + var out strings.Builder + out.WriteString("https://sts-fips.") + out.WriteString(_Region) + out.WriteString(".") + out.WriteString(_PartitionResult.DualStackDnsSuffix) + return out.String() + }() + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + } + return endpoint, fmt.Errorf("endpoint rule error, %s", "FIPS and DualStack are enabled, but this partition does not support one or both") + } + } + if _UseFIPS == true { + if true == _PartitionResult.SupportsFIPS { + if "aws-us-gov" == _PartitionResult.Name { + uriString := func() string { + var out strings.Builder + out.WriteString("https://sts.") + out.WriteString(_Region) + out.WriteString(".amazonaws.com") + return out.String() + }() + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + uriString := func() string { + var out strings.Builder + out.WriteString("https://sts-fips.") + out.WriteString(_Region) + out.WriteString(".") + out.WriteString(_PartitionResult.DnsSuffix) + return out.String() + }() + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + return endpoint, fmt.Errorf("endpoint rule error, %s", "FIPS is enabled but this partition does not support FIPS") + } + if _UseDualStack == true { + if true == _PartitionResult.SupportsDualStack { + uriString := func() string { + var out strings.Builder + out.WriteString("https://sts.") + out.WriteString(_Region) + out.WriteString(".") + out.WriteString(_PartitionResult.DualStackDnsSuffix) + return out.String() + }() + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + return endpoint, fmt.Errorf("endpoint rule error, %s", "DualStack is enabled but this partition does not support DualStack") + } + if _Region == "aws-global" { + uriString := "https://sts.amazonaws.com" + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + Properties: func() smithy.Properties { + var out smithy.Properties + out.Set("authSchemes", []interface{}{ + map[string]interface{}{ + "name": "sigv4", + "signingName": "sts", + "signingRegion": "us-east-1", + }, + }) + return out + }(), + }, nil + } + uriString := func() string { + var out strings.Builder + out.WriteString("https://sts.") + out.WriteString(_Region) + out.WriteString(".") + out.WriteString(_PartitionResult.DnsSuffix) + return out.String() + }() + + uri, err := url.Parse(uriString) + if err != nil { + return endpoint, fmt.Errorf("Failed to parse uri: %s", uriString) + } + + return smithyendpoints.Endpoint{ + URI: *uri, + Headers: http.Header{}, + }, nil + } + return endpoint, fmt.Errorf("Endpoint resolution failed. Invalid operation or environment input.") + } + return endpoint, fmt.Errorf("endpoint rule error, %s", "Invalid Configuration: Missing Region") +} diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/sts/generated.json b/vendor/github.com/aws/aws-sdk-go-v2/service/sts/generated.json index 86341bb7d7..2ae7a9b23b 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/sts/generated.json +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/sts/generated.json @@ -4,7 +4,8 @@ "github.com/aws/aws-sdk-go-v2/internal/configsources": "v0.0.0-00010101000000-000000000000", "github.com/aws/aws-sdk-go-v2/internal/endpoints/v2": "v2.0.0-00010101000000-000000000000", "github.com/aws/aws-sdk-go-v2/service/internal/presigned-url": "v1.0.7", - "github.com/aws/smithy-go": "v1.4.0" + "github.com/aws/smithy-go": "v1.4.0", + "github.com/google/go-cmp": "v0.5.4" }, "files": [ "api_client.go", @@ -20,6 +21,7 @@ "deserializers.go", "doc.go", "endpoints.go", + "endpoints_test.go", "generated.json", "internal/endpoints/endpoints.go", "internal/endpoints/endpoints_test.go", diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/sts/go_module_metadata.go b/vendor/github.com/aws/aws-sdk-go-v2/service/sts/go_module_metadata.go index 47db08ddae..28de6615e3 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/sts/go_module_metadata.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/sts/go_module_metadata.go @@ -3,4 +3,4 @@ package sts // goModuleVersion is the tagged release for this module -const goModuleVersion = "1.19.3" +const goModuleVersion = "1.21.1" diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/sts/internal/endpoints/endpoints.go b/vendor/github.com/aws/aws-sdk-go-v2/service/sts/internal/endpoints/endpoints.go index 0413fd89ab..ca4c881909 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/sts/internal/endpoints/endpoints.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/sts/internal/endpoints/endpoints.go @@ -94,7 +94,7 @@ var partitionRegexp = struct { AwsUsGov *regexp.Regexp }{ - Aws: regexp.MustCompile("^(us|eu|ap|sa|ca|me|af)\\-\\w+\\-\\d+$"), + Aws: regexp.MustCompile("^(us|eu|ap|sa|ca|me|af|il)\\-\\w+\\-\\d+$"), AwsCn: regexp.MustCompile("^cn\\-\\w+\\-\\d+$"), AwsIso: regexp.MustCompile("^us\\-iso\\-\\w+\\-\\d+$"), AwsIsoB: regexp.MustCompile("^us\\-isob\\-\\w+\\-\\d+$"), @@ -207,6 +207,9 @@ var defaultPartitions = endpoints.Partitions{ endpoints.EndpointKey{ Region: "eu-west-3", }: endpoints.Endpoint{}, + endpoints.EndpointKey{ + Region: "il-central-1", + }: endpoints.Endpoint{}, endpoints.EndpointKey{ Region: "me-central-1", }: endpoints.Endpoint{}, diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/sts/serializers.go b/vendor/github.com/aws/aws-sdk-go-v2/service/sts/serializers.go index eb60f61b16..4c08061c0c 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/sts/serializers.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/sts/serializers.go @@ -546,6 +546,35 @@ func awsAwsquery_serializeDocumentPolicyDescriptorType(v *types.PolicyDescriptor return nil } +func awsAwsquery_serializeDocumentProvidedContext(v *types.ProvidedContext, value query.Value) error { + object := value.Object() + _ = object + + if v.ContextAssertion != nil { + objectKey := object.Key("ContextAssertion") + objectKey.String(*v.ContextAssertion) + } + + if v.ProviderArn != nil { + objectKey := object.Key("ProviderArn") + objectKey.String(*v.ProviderArn) + } + + return nil +} + +func awsAwsquery_serializeDocumentProvidedContextsListType(v []types.ProvidedContext, value query.Value) error { + array := value.Array("member") + + for i := range v { + av := array.Value() + if err := awsAwsquery_serializeDocumentProvidedContext(&v[i], av); err != nil { + return err + } + } + return nil +} + func awsAwsquery_serializeDocumentTag(v *types.Tag, value query.Value) error { object := value.Object() _ = object @@ -611,6 +640,13 @@ func awsAwsquery_serializeOpDocumentAssumeRoleInput(v *AssumeRoleInput, value qu } } + if v.ProvidedContexts != nil { + objectKey := object.Key("ProvidedContexts") + if err := awsAwsquery_serializeDocumentProvidedContextsListType(v.ProvidedContexts, objectKey); err != nil { + return err + } + } + if v.RoleArn != nil { objectKey := object.Key("RoleArn") objectKey.String(*v.RoleArn) diff --git a/vendor/github.com/aws/aws-sdk-go-v2/service/sts/types/types.go b/vendor/github.com/aws/aws-sdk-go-v2/service/sts/types/types.go index 90d4f62ae9..572a705122 100644 --- a/vendor/github.com/aws/aws-sdk-go-v2/service/sts/types/types.go +++ b/vendor/github.com/aws/aws-sdk-go-v2/service/sts/types/types.go @@ -89,6 +89,18 @@ type PolicyDescriptorType struct { noSmithyDocumentSerde } +// Reserved for future use. +type ProvidedContext struct { + + // Reserved for future use. + ContextAssertion *string + + // Reserved for future use. + ProviderArn *string + + noSmithyDocumentSerde +} + // You can pass custom key-value pair attributes when you assume a role or // federate a user. These are called session tags. You can then use the session // tags to control access to resources. For more information, see Tagging Amazon diff --git a/vendor/github.com/aws/aws-sdk-go/aws/endpoints/defaults.go b/vendor/github.com/aws/aws-sdk-go/aws/endpoints/defaults.go index aedb4f56a3..620d9e7b11 100644 --- a/vendor/github.com/aws/aws-sdk-go/aws/endpoints/defaults.go +++ b/vendor/github.com/aws/aws-sdk-go/aws/endpoints/defaults.go @@ -39,6 +39,7 @@ const ( EuWest1RegionID = "eu-west-1" // Europe (Ireland). EuWest2RegionID = "eu-west-2" // Europe (London). EuWest3RegionID = "eu-west-3" // Europe (Paris). + IlCentral1RegionID = "il-central-1" // Israel (Tel Aviv). MeCentral1RegionID = "me-central-1" // Middle East (UAE). MeSouth1RegionID = "me-south-1" // Middle East (Bahrain). SaEast1RegionID = "sa-east-1" // South America (Sao Paulo). @@ -117,7 +118,7 @@ var awsPartition = partition{ DNSSuffix: "amazonaws.com", RegionRegex: regionRegex{ Regexp: func() *regexp.Regexp { - reg, _ := regexp.Compile("^(us|eu|ap|sa|ca|me|af)\\-\\w+\\-\\d+$") + reg, _ := regexp.Compile("^(us|eu|ap|sa|ca|me|af|il)\\-\\w+\\-\\d+$") return reg }(), }, @@ -213,6 +214,9 @@ var awsPartition = partition{ "eu-west-3": region{ Description: "Europe (Paris)", }, + "il-central-1": region{ + Description: "Israel (Tel Aviv)", + }, "me-central-1": region{ Description: "Middle East (UAE)", }, @@ -356,6 +360,9 @@ var awsPartition = partition{ }, Deprecated: boxedTrue, }, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -494,6 +501,9 @@ var awsPartition = partition{ endpointKey{ Region: "eu-west-3", }: endpoint{}, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -1439,6 +1449,14 @@ var awsPartition = partition{ }, Deprecated: boxedTrue, }, + endpointKey{ + Region: "il-central-1", + }: endpoint{ + Hostname: "api.ecr.il-central-1.amazonaws.com", + CredentialScope: credentialScope{ + Region: "il-central-1", + }, + }, endpointKey{ Region: "me-central-1", }: endpoint{ @@ -1907,6 +1925,9 @@ var awsPartition = partition{ endpointKey{ Region: "eu-west-3", }: endpoint{}, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -2247,6 +2268,9 @@ var awsPartition = partition{ }, Deprecated: boxedTrue, }, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -2390,6 +2414,9 @@ var awsPartition = partition{ endpointKey{ Region: "eu-west-3", }: endpoint{}, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -2475,6 +2502,9 @@ var awsPartition = partition{ endpointKey{ Region: "eu-west-3", }: endpoint{}, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -2617,6 +2647,9 @@ var awsPartition = partition{ endpointKey{ Region: "eu-west-3", }: endpoint{}, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -2660,6 +2693,9 @@ var awsPartition = partition{ endpointKey{ Region: "ap-south-1", }: endpoint{}, + endpointKey{ + Region: "ap-south-2", + }: endpoint{}, endpointKey{ Region: "ap-southeast-1", }: endpoint{}, @@ -2675,12 +2711,18 @@ var awsPartition = partition{ endpointKey{ Region: "eu-central-1", }: endpoint{}, + endpointKey{ + Region: "eu-central-2", + }: endpoint{}, endpointKey{ Region: "eu-north-1", }: endpoint{}, endpointKey{ Region: "eu-south-1", }: endpoint{}, + endpointKey{ + Region: "eu-south-2", + }: endpoint{}, endpointKey{ Region: "eu-west-1", }: endpoint{}, @@ -2690,6 +2732,9 @@ var awsPartition = partition{ endpointKey{ Region: "eu-west-3", }: endpoint{}, + endpointKey{ + Region: "me-central-1", + }: endpoint{}, endpointKey{ Region: "me-south-1", }: endpoint{}, @@ -3375,6 +3420,9 @@ var awsPartition = partition{ endpointKey{ Region: "eu-west-3", }: endpoint{}, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -3454,6 +3502,15 @@ var awsPartition = partition{ }: endpoint{ Hostname: "athena.ap-south-1.api.aws", }, + endpointKey{ + Region: "ap-south-2", + }: endpoint{}, + endpointKey{ + Region: "ap-south-2", + Variant: dualStackVariant, + }: endpoint{ + Hostname: "athena.ap-south-2.api.aws", + }, endpointKey{ Region: "ap-southeast-1", }: endpoint{}, @@ -3481,6 +3538,15 @@ var awsPartition = partition{ }: endpoint{ Hostname: "athena.ap-southeast-3.api.aws", }, + endpointKey{ + Region: "ap-southeast-4", + }: endpoint{}, + endpointKey{ + Region: "ap-southeast-4", + Variant: dualStackVariant, + }: endpoint{ + Hostname: "athena.ap-southeast-4.api.aws", + }, endpointKey{ Region: "ca-central-1", }: endpoint{}, @@ -3499,6 +3565,15 @@ var awsPartition = partition{ }: endpoint{ Hostname: "athena.eu-central-1.api.aws", }, + endpointKey{ + Region: "eu-central-2", + }: endpoint{}, + endpointKey{ + Region: "eu-central-2", + Variant: dualStackVariant, + }: endpoint{ + Hostname: "athena.eu-central-2.api.aws", + }, endpointKey{ Region: "eu-north-1", }: endpoint{}, @@ -3517,6 +3592,15 @@ var awsPartition = partition{ }: endpoint{ Hostname: "athena.eu-south-1.api.aws", }, + endpointKey{ + Region: "eu-south-2", + }: endpoint{}, + endpointKey{ + Region: "eu-south-2", + Variant: dualStackVariant, + }: endpoint{ + Hostname: "athena.eu-south-2.api.aws", + }, endpointKey{ Region: "eu-west-1", }: endpoint{}, @@ -3800,6 +3884,9 @@ var awsPartition = partition{ endpointKey{ Region: "eu-west-3", }: endpoint{}, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -4723,6 +4810,9 @@ var awsPartition = partition{ }, Deprecated: boxedTrue, }, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -4863,6 +4953,9 @@ var awsPartition = partition{ endpointKey{ Region: "eu-west-3", }: endpoint{}, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -5028,6 +5121,9 @@ var awsPartition = partition{ endpointKey{ Region: "eu-west-3", }: endpoint{}, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -5183,6 +5279,9 @@ var awsPartition = partition{ }, Deprecated: boxedTrue, }, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -5405,6 +5504,9 @@ var awsPartition = partition{ endpointKey{ Region: "eu-west-3", }: endpoint{}, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -5721,6 +5823,9 @@ var awsPartition = partition{ endpointKey{ Region: "eu-west-3", }: endpoint{}, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -6839,6 +6944,9 @@ var awsPartition = partition{ }, Deprecated: boxedTrue, }, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -7007,6 +7115,12 @@ var awsPartition = partition{ endpointKey{ Region: "ap-northeast-2", }: endpoint{}, + endpointKey{ + Region: "ap-south-1", + }: endpoint{}, + endpointKey{ + Region: "ap-southeast-1", + }: endpoint{}, endpointKey{ Region: "ap-southeast-2", }: endpoint{}, @@ -8104,6 +8218,9 @@ var awsPartition = partition{ }, Deprecated: boxedTrue, }, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -8196,6 +8313,9 @@ var awsPartition = partition{ endpointKey{ Region: "ap-south-1", }: endpoint{}, + endpointKey{ + Region: "ap-south-2", + }: endpoint{}, endpointKey{ Region: "ap-southeast-1", }: endpoint{}, @@ -8347,6 +8467,9 @@ var awsPartition = partition{ endpointKey{ Region: "eu-west-3", }: endpoint{}, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -8566,6 +8689,9 @@ var awsPartition = partition{ endpointKey{ Region: "ap-south-1", }: endpoint{}, + endpointKey{ + Region: "ap-south-2", + }: endpoint{}, endpointKey{ Region: "ap-southeast-1", }: endpoint{}, @@ -8575,18 +8701,27 @@ var awsPartition = partition{ endpointKey{ Region: "ap-southeast-3", }: endpoint{}, + endpointKey{ + Region: "ap-southeast-4", + }: endpoint{}, endpointKey{ Region: "ca-central-1", }: endpoint{}, endpointKey{ Region: "eu-central-1", }: endpoint{}, + endpointKey{ + Region: "eu-central-2", + }: endpoint{}, endpointKey{ Region: "eu-north-1", }: endpoint{}, endpointKey{ Region: "eu-south-1", }: endpoint{}, + endpointKey{ + Region: "eu-south-2", + }: endpoint{}, endpointKey{ Region: "eu-west-1", }: endpoint{}, @@ -8596,6 +8731,9 @@ var awsPartition = partition{ endpointKey{ Region: "eu-west-3", }: endpoint{}, + endpointKey{ + Region: "me-central-1", + }: endpoint{}, endpointKey{ Region: "me-south-1", }: endpoint{}, @@ -8729,6 +8867,9 @@ var awsPartition = partition{ }, Deprecated: boxedTrue, }, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -8858,6 +8999,9 @@ var awsPartition = partition{ endpointKey{ Region: "eu-west-3", }: endpoint{}, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "local", }: endpoint{ @@ -9063,6 +9207,9 @@ var awsPartition = partition{ }, Deprecated: boxedTrue, }, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -9240,6 +9387,9 @@ var awsPartition = partition{ }, Deprecated: boxedTrue, }, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -9409,6 +9559,9 @@ var awsPartition = partition{ }, Deprecated: boxedTrue, }, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -9587,6 +9740,9 @@ var awsPartition = partition{ }, Deprecated: boxedTrue, }, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -9705,6 +9861,9 @@ var awsPartition = partition{ }, Deprecated: boxedTrue, }, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -9874,6 +10033,9 @@ var awsPartition = partition{ }, Deprecated: boxedTrue, }, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-south-1", }: endpoint{}, @@ -10511,6 +10673,9 @@ var awsPartition = partition{ }, Deprecated: boxedTrue, }, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -10679,6 +10844,9 @@ var awsPartition = partition{ }, Deprecated: boxedTrue, }, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -10856,6 +11024,9 @@ var awsPartition = partition{ }, "emr-containers": service{ Endpoints: serviceEndpoints{ + endpointKey{ + Region: "af-south-1", + }: endpoint{}, endpointKey{ Region: "ap-east-1", }: endpoint{}, @@ -10889,6 +11060,9 @@ var awsPartition = partition{ endpointKey{ Region: "eu-north-1", }: endpoint{}, + endpointKey{ + Region: "eu-south-1", + }: endpoint{}, endpointKey{ Region: "eu-west-1", }: endpoint{}, @@ -11205,6 +11379,9 @@ var awsPartition = partition{ }, Deprecated: boxedTrue, }, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -11386,6 +11563,9 @@ var awsPartition = partition{ }, Deprecated: boxedTrue, }, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -11618,6 +11798,9 @@ var awsPartition = partition{ }, Deprecated: boxedTrue, }, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -12805,6 +12988,9 @@ var awsPartition = partition{ endpointKey{ Region: "ap-south-1", }: endpoint{}, + endpointKey{ + Region: "ap-south-2", + }: endpoint{}, endpointKey{ Region: "ap-southeast-1", }: endpoint{}, @@ -12814,6 +13000,9 @@ var awsPartition = partition{ endpointKey{ Region: "ap-southeast-3", }: endpoint{}, + endpointKey{ + Region: "ap-southeast-4", + }: endpoint{}, endpointKey{ Region: "ca-central-1", }: endpoint{}, @@ -12877,6 +13066,9 @@ var awsPartition = partition{ }, Deprecated: boxedTrue, }, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -13926,6 +14118,12 @@ var awsPartition = partition{ }: endpoint{ Hostname: "internetmonitor.ca-central-1.api.aws", }, + endpointKey{ + Region: "ca-central-1", + Variant: fipsVariant, + }: endpoint{ + Hostname: "internetmonitor-fips.ca-central-1.api.aws", + }, endpointKey{ Region: "eu-central-1", }: endpoint{ @@ -13966,6 +14164,11 @@ var awsPartition = partition{ }: endpoint{ Hostname: "internetmonitor.eu-west-3.api.aws", }, + endpointKey{ + Region: "il-central-1", + }: endpoint{ + Hostname: "internetmonitor.il-central-1.api.aws", + }, endpointKey{ Region: "me-central-1", }: endpoint{ @@ -13986,21 +14189,45 @@ var awsPartition = partition{ }: endpoint{ Hostname: "internetmonitor.us-east-1.api.aws", }, + endpointKey{ + Region: "us-east-1", + Variant: fipsVariant, + }: endpoint{ + Hostname: "internetmonitor-fips.us-east-1.api.aws", + }, endpointKey{ Region: "us-east-2", }: endpoint{ Hostname: "internetmonitor.us-east-2.api.aws", }, + endpointKey{ + Region: "us-east-2", + Variant: fipsVariant, + }: endpoint{ + Hostname: "internetmonitor-fips.us-east-2.api.aws", + }, endpointKey{ Region: "us-west-1", }: endpoint{ Hostname: "internetmonitor.us-west-1.api.aws", }, + endpointKey{ + Region: "us-west-1", + Variant: fipsVariant, + }: endpoint{ + Hostname: "internetmonitor-fips.us-west-1.api.aws", + }, endpointKey{ Region: "us-west-2", }: endpoint{ Hostname: "internetmonitor.us-west-2.api.aws", }, + endpointKey{ + Region: "us-west-2", + Variant: fipsVariant, + }: endpoint{ + Hostname: "internetmonitor-fips.us-west-2.api.aws", + }, }, }, "iot": service{ @@ -15415,6 +15642,11 @@ var awsPartition = partition{ }: endpoint{ Hostname: "kendra-ranking.eu-west-3.api.aws", }, + endpointKey{ + Region: "il-central-1", + }: endpoint{ + Hostname: "kendra-ranking.il-central-1.api.aws", + }, endpointKey{ Region: "me-central-1", }: endpoint{ @@ -15568,6 +15800,9 @@ var awsPartition = partition{ }, Deprecated: boxedTrue, }, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -16123,6 +16358,15 @@ var awsPartition = partition{ }, Deprecated: boxedTrue, }, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, + endpointKey{ + Region: "il-central-1", + Variant: fipsVariant, + }: endpoint{ + Hostname: "kms-fips.il-central-1.amazonaws.com", + }, endpointKey{ Region: "il-central-1-fips", }: endpoint{ @@ -16130,6 +16374,7 @@ var awsPartition = partition{ CredentialScope: credentialScope{ Region: "il-central-1", }, + Deprecated: boxedTrue, }, endpointKey{ Region: "me-central-1", @@ -16616,6 +16861,15 @@ var awsPartition = partition{ }, Deprecated: boxedTrue, }, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, + endpointKey{ + Region: "il-central-1", + Variant: dualStackVariant, + }: endpoint{ + Hostname: "lambda.il-central-1.api.aws", + }, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -17251,6 +17505,9 @@ var awsPartition = partition{ }, Deprecated: boxedTrue, }, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -18393,6 +18650,9 @@ var awsPartition = partition{ endpointKey{ Region: "eu-west-3", }: endpoint{}, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -18478,6 +18738,9 @@ var awsPartition = partition{ endpointKey{ Region: "eu-west-3", }: endpoint{}, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -18941,6 +19204,9 @@ var awsPartition = partition{ }, Deprecated: boxedTrue, }, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -19567,6 +19833,9 @@ var awsPartition = partition{ endpointKey{ Region: "eu-west-3", }: endpoint{}, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -20312,6 +20581,9 @@ var awsPartition = partition{ endpointKey{ Region: "eu-west-3", }: endpoint{}, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -21251,6 +21523,9 @@ var awsPartition = partition{ }, Deprecated: boxedTrue, }, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -21411,6 +21686,9 @@ var awsPartition = partition{ }, Deprecated: boxedTrue, }, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -21535,6 +21813,9 @@ var awsPartition = partition{ endpointKey{ Region: "eu-west-3", }: endpoint{}, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -21975,6 +22256,9 @@ var awsPartition = partition{ }, Deprecated: boxedTrue, }, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -22476,6 +22760,11 @@ var awsPartition = partition{ }: endpoint{ Hostname: "resource-explorer-2.eu-west-3.api.aws", }, + endpointKey{ + Region: "il-central-1", + }: endpoint{ + Hostname: "resource-explorer-2.il-central-1.api.aws", + }, endpointKey{ Region: "sa-east-1", }: endpoint{ @@ -22601,6 +22890,9 @@ var awsPartition = partition{ }, Deprecated: boxedTrue, }, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -23098,6 +23390,9 @@ var awsPartition = partition{ endpointKey{ Region: "eu-west-3", }: endpoint{}, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -23469,6 +23764,15 @@ var awsPartition = partition{ }, Deprecated: boxedTrue, }, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, + endpointKey{ + Region: "il-central-1", + Variant: dualStackVariant, + }: endpoint{ + Hostname: "s3.dualstack.il-central-1.amazonaws.com", + }, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -24506,6 +24810,9 @@ var awsPartition = partition{ endpointKey{ Region: "eu-west-3", }: endpoint{}, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -25178,7 +25485,7 @@ var awsPartition = partition{ Region: "af-south-1", Variant: dualStackVariant, }: endpoint{ - Hostname: "servicediscovery.af-south-1.amazonaws.com", + Hostname: "servicediscovery.af-south-1.api.aws", }, endpointKey{ Region: "ap-east-1", @@ -25187,7 +25494,7 @@ var awsPartition = partition{ Region: "ap-east-1", Variant: dualStackVariant, }: endpoint{ - Hostname: "servicediscovery.ap-east-1.amazonaws.com", + Hostname: "servicediscovery.ap-east-1.api.aws", }, endpointKey{ Region: "ap-northeast-1", @@ -25196,7 +25503,7 @@ var awsPartition = partition{ Region: "ap-northeast-1", Variant: dualStackVariant, }: endpoint{ - Hostname: "servicediscovery.ap-northeast-1.amazonaws.com", + Hostname: "servicediscovery.ap-northeast-1.api.aws", }, endpointKey{ Region: "ap-northeast-2", @@ -25205,7 +25512,7 @@ var awsPartition = partition{ Region: "ap-northeast-2", Variant: dualStackVariant, }: endpoint{ - Hostname: "servicediscovery.ap-northeast-2.amazonaws.com", + Hostname: "servicediscovery.ap-northeast-2.api.aws", }, endpointKey{ Region: "ap-northeast-3", @@ -25214,7 +25521,7 @@ var awsPartition = partition{ Region: "ap-northeast-3", Variant: dualStackVariant, }: endpoint{ - Hostname: "servicediscovery.ap-northeast-3.amazonaws.com", + Hostname: "servicediscovery.ap-northeast-3.api.aws", }, endpointKey{ Region: "ap-south-1", @@ -25223,7 +25530,7 @@ var awsPartition = partition{ Region: "ap-south-1", Variant: dualStackVariant, }: endpoint{ - Hostname: "servicediscovery.ap-south-1.amazonaws.com", + Hostname: "servicediscovery.ap-south-1.api.aws", }, endpointKey{ Region: "ap-south-2", @@ -25232,7 +25539,7 @@ var awsPartition = partition{ Region: "ap-south-2", Variant: dualStackVariant, }: endpoint{ - Hostname: "servicediscovery.ap-south-2.amazonaws.com", + Hostname: "servicediscovery.ap-south-2.api.aws", }, endpointKey{ Region: "ap-southeast-1", @@ -25241,7 +25548,7 @@ var awsPartition = partition{ Region: "ap-southeast-1", Variant: dualStackVariant, }: endpoint{ - Hostname: "servicediscovery.ap-southeast-1.amazonaws.com", + Hostname: "servicediscovery.ap-southeast-1.api.aws", }, endpointKey{ Region: "ap-southeast-2", @@ -25250,7 +25557,7 @@ var awsPartition = partition{ Region: "ap-southeast-2", Variant: dualStackVariant, }: endpoint{ - Hostname: "servicediscovery.ap-southeast-2.amazonaws.com", + Hostname: "servicediscovery.ap-southeast-2.api.aws", }, endpointKey{ Region: "ap-southeast-3", @@ -25259,7 +25566,7 @@ var awsPartition = partition{ Region: "ap-southeast-3", Variant: dualStackVariant, }: endpoint{ - Hostname: "servicediscovery.ap-southeast-3.amazonaws.com", + Hostname: "servicediscovery.ap-southeast-3.api.aws", }, endpointKey{ Region: "ap-southeast-4", @@ -25268,7 +25575,7 @@ var awsPartition = partition{ Region: "ap-southeast-4", Variant: dualStackVariant, }: endpoint{ - Hostname: "servicediscovery.ap-southeast-4.amazonaws.com", + Hostname: "servicediscovery.ap-southeast-4.api.aws", }, endpointKey{ Region: "ca-central-1", @@ -25277,7 +25584,7 @@ var awsPartition = partition{ Region: "ca-central-1", Variant: dualStackVariant, }: endpoint{ - Hostname: "servicediscovery.ca-central-1.amazonaws.com", + Hostname: "servicediscovery.ca-central-1.api.aws", }, endpointKey{ Region: "ca-central-1", @@ -25285,6 +25592,12 @@ var awsPartition = partition{ }: endpoint{ Hostname: "servicediscovery-fips.ca-central-1.amazonaws.com", }, + endpointKey{ + Region: "ca-central-1", + Variant: fipsVariant | dualStackVariant, + }: endpoint{ + Hostname: "servicediscovery-fips.ca-central-1.api.aws", + }, endpointKey{ Region: "ca-central-1-fips", }: endpoint{ @@ -25301,7 +25614,7 @@ var awsPartition = partition{ Region: "eu-central-1", Variant: dualStackVariant, }: endpoint{ - Hostname: "servicediscovery.eu-central-1.amazonaws.com", + Hostname: "servicediscovery.eu-central-1.api.aws", }, endpointKey{ Region: "eu-central-2", @@ -25310,7 +25623,7 @@ var awsPartition = partition{ Region: "eu-central-2", Variant: dualStackVariant, }: endpoint{ - Hostname: "servicediscovery.eu-central-2.amazonaws.com", + Hostname: "servicediscovery.eu-central-2.api.aws", }, endpointKey{ Region: "eu-north-1", @@ -25319,7 +25632,7 @@ var awsPartition = partition{ Region: "eu-north-1", Variant: dualStackVariant, }: endpoint{ - Hostname: "servicediscovery.eu-north-1.amazonaws.com", + Hostname: "servicediscovery.eu-north-1.api.aws", }, endpointKey{ Region: "eu-south-1", @@ -25328,7 +25641,7 @@ var awsPartition = partition{ Region: "eu-south-1", Variant: dualStackVariant, }: endpoint{ - Hostname: "servicediscovery.eu-south-1.amazonaws.com", + Hostname: "servicediscovery.eu-south-1.api.aws", }, endpointKey{ Region: "eu-south-2", @@ -25337,7 +25650,7 @@ var awsPartition = partition{ Region: "eu-south-2", Variant: dualStackVariant, }: endpoint{ - Hostname: "servicediscovery.eu-south-2.amazonaws.com", + Hostname: "servicediscovery.eu-south-2.api.aws", }, endpointKey{ Region: "eu-west-1", @@ -25346,7 +25659,7 @@ var awsPartition = partition{ Region: "eu-west-1", Variant: dualStackVariant, }: endpoint{ - Hostname: "servicediscovery.eu-west-1.amazonaws.com", + Hostname: "servicediscovery.eu-west-1.api.aws", }, endpointKey{ Region: "eu-west-2", @@ -25355,7 +25668,7 @@ var awsPartition = partition{ Region: "eu-west-2", Variant: dualStackVariant, }: endpoint{ - Hostname: "servicediscovery.eu-west-2.amazonaws.com", + Hostname: "servicediscovery.eu-west-2.api.aws", }, endpointKey{ Region: "eu-west-3", @@ -25364,7 +25677,16 @@ var awsPartition = partition{ Region: "eu-west-3", Variant: dualStackVariant, }: endpoint{ - Hostname: "servicediscovery.eu-west-3.amazonaws.com", + Hostname: "servicediscovery.eu-west-3.api.aws", + }, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, + endpointKey{ + Region: "il-central-1", + Variant: dualStackVariant, + }: endpoint{ + Hostname: "servicediscovery.il-central-1.api.aws", }, endpointKey{ Region: "me-central-1", @@ -25373,7 +25695,7 @@ var awsPartition = partition{ Region: "me-central-1", Variant: dualStackVariant, }: endpoint{ - Hostname: "servicediscovery.me-central-1.amazonaws.com", + Hostname: "servicediscovery.me-central-1.api.aws", }, endpointKey{ Region: "me-south-1", @@ -25382,7 +25704,7 @@ var awsPartition = partition{ Region: "me-south-1", Variant: dualStackVariant, }: endpoint{ - Hostname: "servicediscovery.me-south-1.amazonaws.com", + Hostname: "servicediscovery.me-south-1.api.aws", }, endpointKey{ Region: "sa-east-1", @@ -25391,7 +25713,7 @@ var awsPartition = partition{ Region: "sa-east-1", Variant: dualStackVariant, }: endpoint{ - Hostname: "servicediscovery.sa-east-1.amazonaws.com", + Hostname: "servicediscovery.sa-east-1.api.aws", }, endpointKey{ Region: "us-east-1", @@ -25400,7 +25722,7 @@ var awsPartition = partition{ Region: "us-east-1", Variant: dualStackVariant, }: endpoint{ - Hostname: "servicediscovery.us-east-1.amazonaws.com", + Hostname: "servicediscovery.us-east-1.api.aws", }, endpointKey{ Region: "us-east-1", @@ -25408,6 +25730,12 @@ var awsPartition = partition{ }: endpoint{ Hostname: "servicediscovery-fips.us-east-1.amazonaws.com", }, + endpointKey{ + Region: "us-east-1", + Variant: fipsVariant | dualStackVariant, + }: endpoint{ + Hostname: "servicediscovery-fips.us-east-1.api.aws", + }, endpointKey{ Region: "us-east-1-fips", }: endpoint{ @@ -25424,7 +25752,7 @@ var awsPartition = partition{ Region: "us-east-2", Variant: dualStackVariant, }: endpoint{ - Hostname: "servicediscovery.us-east-2.amazonaws.com", + Hostname: "servicediscovery.us-east-2.api.aws", }, endpointKey{ Region: "us-east-2", @@ -25432,6 +25760,12 @@ var awsPartition = partition{ }: endpoint{ Hostname: "servicediscovery-fips.us-east-2.amazonaws.com", }, + endpointKey{ + Region: "us-east-2", + Variant: fipsVariant | dualStackVariant, + }: endpoint{ + Hostname: "servicediscovery-fips.us-east-2.api.aws", + }, endpointKey{ Region: "us-east-2-fips", }: endpoint{ @@ -25448,7 +25782,7 @@ var awsPartition = partition{ Region: "us-west-1", Variant: dualStackVariant, }: endpoint{ - Hostname: "servicediscovery.us-west-1.amazonaws.com", + Hostname: "servicediscovery.us-west-1.api.aws", }, endpointKey{ Region: "us-west-1", @@ -25456,6 +25790,12 @@ var awsPartition = partition{ }: endpoint{ Hostname: "servicediscovery-fips.us-west-1.amazonaws.com", }, + endpointKey{ + Region: "us-west-1", + Variant: fipsVariant | dualStackVariant, + }: endpoint{ + Hostname: "servicediscovery-fips.us-west-1.api.aws", + }, endpointKey{ Region: "us-west-1-fips", }: endpoint{ @@ -25472,7 +25812,7 @@ var awsPartition = partition{ Region: "us-west-2", Variant: dualStackVariant, }: endpoint{ - Hostname: "servicediscovery.us-west-2.amazonaws.com", + Hostname: "servicediscovery.us-west-2.api.aws", }, endpointKey{ Region: "us-west-2", @@ -25480,6 +25820,12 @@ var awsPartition = partition{ }: endpoint{ Hostname: "servicediscovery-fips.us-west-2.amazonaws.com", }, + endpointKey{ + Region: "us-west-2", + Variant: fipsVariant | dualStackVariant, + }: endpoint{ + Hostname: "servicediscovery-fips.us-west-2.api.aws", + }, endpointKey{ Region: "us-west-2-fips", }: endpoint{ @@ -25855,75 +26201,6 @@ var awsPartition = partition{ }, "sms": service{ Endpoints: serviceEndpoints{ - endpointKey{ - Region: "af-south-1", - }: endpoint{}, - endpointKey{ - Region: "ap-east-1", - }: endpoint{}, - endpointKey{ - Region: "ap-northeast-1", - }: endpoint{}, - endpointKey{ - Region: "ap-northeast-2", - }: endpoint{}, - endpointKey{ - Region: "ap-south-1", - }: endpoint{}, - endpointKey{ - Region: "ap-southeast-1", - }: endpoint{}, - endpointKey{ - Region: "ap-southeast-2", - }: endpoint{}, - endpointKey{ - Region: "ca-central-1", - }: endpoint{}, - endpointKey{ - Region: "eu-central-1", - }: endpoint{}, - endpointKey{ - Region: "eu-north-1", - }: endpoint{}, - endpointKey{ - Region: "eu-south-1", - }: endpoint{}, - endpointKey{ - Region: "eu-west-1", - }: endpoint{}, - endpointKey{ - Region: "eu-west-2", - }: endpoint{}, - endpointKey{ - Region: "eu-west-3", - }: endpoint{}, - endpointKey{ - Region: "fips-us-east-1", - }: endpoint{ - Hostname: "sms-fips.us-east-1.amazonaws.com", - CredentialScope: credentialScope{ - Region: "us-east-1", - }, - Deprecated: boxedTrue, - }, - endpointKey{ - Region: "fips-us-east-2", - }: endpoint{ - Hostname: "sms-fips.us-east-2.amazonaws.com", - CredentialScope: credentialScope{ - Region: "us-east-2", - }, - Deprecated: boxedTrue, - }, - endpointKey{ - Region: "fips-us-west-1", - }: endpoint{ - Hostname: "sms-fips.us-west-1.amazonaws.com", - CredentialScope: credentialScope{ - Region: "us-west-1", - }, - Deprecated: boxedTrue, - }, endpointKey{ Region: "fips-us-west-2", }: endpoint{ @@ -25933,39 +26210,6 @@ var awsPartition = partition{ }, Deprecated: boxedTrue, }, - endpointKey{ - Region: "me-south-1", - }: endpoint{}, - endpointKey{ - Region: "sa-east-1", - }: endpoint{}, - endpointKey{ - Region: "us-east-1", - }: endpoint{}, - endpointKey{ - Region: "us-east-1", - Variant: fipsVariant, - }: endpoint{ - Hostname: "sms-fips.us-east-1.amazonaws.com", - }, - endpointKey{ - Region: "us-east-2", - }: endpoint{}, - endpointKey{ - Region: "us-east-2", - Variant: fipsVariant, - }: endpoint{ - Hostname: "sms-fips.us-east-2.amazonaws.com", - }, - endpointKey{ - Region: "us-west-1", - }: endpoint{}, - endpointKey{ - Region: "us-west-1", - Variant: fipsVariant, - }: endpoint{ - Hostname: "sms-fips.us-west-1.amazonaws.com", - }, endpointKey{ Region: "us-west-2", }: endpoint{}, @@ -26469,6 +26713,9 @@ var awsPartition = partition{ }, Deprecated: boxedTrue, }, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -26620,6 +26867,9 @@ var awsPartition = partition{ }, Deprecated: boxedTrue, }, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -26783,6 +27033,9 @@ var awsPartition = partition{ }, Deprecated: boxedTrue, }, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -27382,6 +27635,9 @@ var awsPartition = partition{ }, Deprecated: boxedTrue, }, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -27659,6 +27915,9 @@ var awsPartition = partition{ endpointKey{ Region: "eu-west-3", }: endpoint{}, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "local", }: endpoint{ @@ -27762,6 +28021,9 @@ var awsPartition = partition{ endpointKey{ Region: "eu-west-3", }: endpoint{}, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -27969,6 +28231,9 @@ var awsPartition = partition{ }, Deprecated: boxedTrue, }, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -28114,6 +28379,9 @@ var awsPartition = partition{ }, Deprecated: boxedTrue, }, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -28223,6 +28491,9 @@ var awsPartition = partition{ endpointKey{ Region: "eu-west-3", }: endpoint{}, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -29774,6 +30045,7 @@ var awsPartition = partition{ CredentialScope: credentialScope{ Region: "il-central-1", }, + Deprecated: boxedTrue, }, endpointKey{ Region: "fips-me-central-1", @@ -29838,6 +30110,23 @@ var awsPartition = partition{ }, Deprecated: boxedTrue, }, + endpointKey{ + Region: "il-central-1", + }: endpoint{ + Hostname: "waf-regional.il-central-1.amazonaws.com", + CredentialScope: credentialScope{ + Region: "il-central-1", + }, + }, + endpointKey{ + Region: "il-central-1", + Variant: fipsVariant, + }: endpoint{ + Hostname: "waf-regional-fips.il-central-1.amazonaws.com", + CredentialScope: credentialScope{ + Region: "il-central-1", + }, + }, endpointKey{ Region: "me-central-1", }: endpoint{ @@ -30488,6 +30777,7 @@ var awsPartition = partition{ CredentialScope: credentialScope{ Region: "il-central-1", }, + Deprecated: boxedTrue, }, endpointKey{ Region: "fips-me-central-1", @@ -30552,6 +30842,23 @@ var awsPartition = partition{ }, Deprecated: boxedTrue, }, + endpointKey{ + Region: "il-central-1", + }: endpoint{ + Hostname: "wafv2.il-central-1.amazonaws.com", + CredentialScope: credentialScope{ + Region: "il-central-1", + }, + }, + endpointKey{ + Region: "il-central-1", + Variant: fipsVariant, + }: endpoint{ + Hostname: "wafv2-fips.il-central-1.amazonaws.com", + CredentialScope: credentialScope{ + Region: "il-central-1", + }, + }, endpointKey{ Region: "me-central-1", }: endpoint{ @@ -31066,6 +31373,9 @@ var awsPartition = partition{ }, Deprecated: boxedTrue, }, + endpointKey{ + Region: "il-central-1", + }: endpoint{}, endpointKey{ Region: "me-central-1", }: endpoint{}, @@ -32598,11 +32908,18 @@ var awscnPartition = partition{ }, }, "savingsplans": service{ - PartitionEndpoint: "aws-cn", - IsRegionalized: boxedFalse, + IsRegionalized: boxedTrue, Endpoints: serviceEndpoints{ endpointKey{ - Region: "aws-cn", + Region: "cn-north-1", + }: endpoint{ + Hostname: "savingsplans.cn-north-1.amazonaws.com.cn", + CredentialScope: credentialScope{ + Region: "cn-north-1", + }, + }, + endpointKey{ + Region: "cn-northwest-1", }: endpoint{ Hostname: "savingsplans.cn-northwest-1.amazonaws.com.cn", CredentialScope: credentialScope{ @@ -32669,7 +32986,7 @@ var awscnPartition = partition{ Region: "cn-north-1", Variant: dualStackVariant, }: endpoint{ - Hostname: "servicediscovery.cn-north-1.amazonaws.com.cn", + Hostname: "servicediscovery.cn-north-1.api.amazonwebservices.com.cn", }, endpointKey{ Region: "cn-northwest-1", @@ -32678,7 +32995,7 @@ var awscnPartition = partition{ Region: "cn-northwest-1", Variant: dualStackVariant, }: endpoint{ - Hostname: "servicediscovery.cn-northwest-1.amazonaws.com.cn", + Hostname: "servicediscovery.cn-northwest-1.api.amazonwebservices.com.cn", }, }, }, @@ -32712,9 +33029,6 @@ var awscnPartition = partition{ endpointKey{ Region: "cn-north-1", }: endpoint{}, - endpointKey{ - Region: "cn-northwest-1", - }: endpoint{}, }, }, "snowball": service{ @@ -37848,20 +38162,6 @@ var awsusgovPartition = partition{ }: endpoint{}, }, }, - "savingsplans": service{ - PartitionEndpoint: "aws-us-gov-global", - IsRegionalized: boxedFalse, - Endpoints: serviceEndpoints{ - endpointKey{ - Region: "aws-us-gov-global", - }: endpoint{ - Hostname: "savingsplans.amazonaws.com", - CredentialScope: credentialScope{ - Region: "us-gov-west-1", - }, - }, - }, - }, "secretsmanager": service{ Endpoints: serviceEndpoints{ endpointKey{ @@ -38095,6 +38395,12 @@ var awsusgovPartition = partition{ }: endpoint{ Hostname: "servicediscovery-fips.us-gov-east-1.amazonaws.com", }, + endpointKey{ + Region: "us-gov-east-1", + Variant: fipsVariant | dualStackVariant, + }: endpoint{ + Hostname: "servicediscovery-fips.us-gov-east-1.amazonaws.com", + }, endpointKey{ Region: "us-gov-east-1-fips", }: endpoint{ @@ -38119,6 +38425,12 @@ var awsusgovPartition = partition{ }: endpoint{ Hostname: "servicediscovery-fips.us-gov-west-1.amazonaws.com", }, + endpointKey{ + Region: "us-gov-west-1", + Variant: fipsVariant | dualStackVariant, + }: endpoint{ + Hostname: "servicediscovery-fips.us-gov-west-1.amazonaws.com", + }, endpointKey{ Region: "us-gov-west-1-fips", }: endpoint{ @@ -38193,15 +38505,6 @@ var awsusgovPartition = partition{ }, "sms": service{ Endpoints: serviceEndpoints{ - endpointKey{ - Region: "fips-us-gov-east-1", - }: endpoint{ - Hostname: "sms-fips.us-gov-east-1.amazonaws.com", - CredentialScope: credentialScope{ - Region: "us-gov-east-1", - }, - Deprecated: boxedTrue, - }, endpointKey{ Region: "fips-us-gov-west-1", }: endpoint{ @@ -38211,15 +38514,6 @@ var awsusgovPartition = partition{ }, Deprecated: boxedTrue, }, - endpointKey{ - Region: "us-gov-east-1", - }: endpoint{}, - endpointKey{ - Region: "us-gov-east-1", - Variant: fipsVariant, - }: endpoint{ - Hostname: "sms-fips.us-gov-east-1.amazonaws.com", - }, endpointKey{ Region: "us-gov-west-1", }: endpoint{}, @@ -39789,6 +40083,15 @@ var awsisoPartition = partition{ }, Deprecated: boxedTrue, }, + endpointKey{ + Region: "fips-us-iso-west-1", + }: endpoint{ + Hostname: "rbin-fips.us-iso-west-1.c2s.ic.gov", + CredentialScope: credentialScope{ + Region: "us-iso-west-1", + }, + Deprecated: boxedTrue, + }, endpointKey{ Region: "us-iso-east-1", }: endpoint{}, @@ -39798,6 +40101,15 @@ var awsisoPartition = partition{ }: endpoint{ Hostname: "rbin-fips.us-iso-east-1.c2s.ic.gov", }, + endpointKey{ + Region: "us-iso-west-1", + }: endpoint{}, + endpointKey{ + Region: "us-iso-west-1", + Variant: fipsVariant, + }: endpoint{ + Hostname: "rbin-fips.us-iso-west-1.c2s.ic.gov", + }, }, }, "rds": service{ diff --git a/vendor/github.com/aws/aws-sdk-go/aws/session/credentials.go b/vendor/github.com/aws/aws-sdk-go/aws/session/credentials.go index 504d726859..ea8e353765 100644 --- a/vendor/github.com/aws/aws-sdk-go/aws/session/credentials.go +++ b/vendor/github.com/aws/aws-sdk-go/aws/session/credentials.go @@ -191,7 +191,10 @@ func resolveSSOCredentials(cfg *aws.Config, sharedCfg sharedConfig, handlers req if err != nil { return nil, err } - mySession := Must(NewSession()) + // create oidcClient with AnonymousCredentials to avoid recursively resolving credentials + mySession := Must(NewSession(&aws.Config{ + Credentials: credentials.AnonymousCredentials, + })) oidcClient := ssooidc.New(mySession, cfgCopy) tokenProvider := ssocreds.NewSSOTokenProvider(oidcClient, cachedPath) optFns = append(optFns, func(p *ssocreds.Provider) { diff --git a/vendor/github.com/aws/aws-sdk-go/aws/signer/v4/v4.go b/vendor/github.com/aws/aws-sdk-go/aws/signer/v4/v4.go index 0240bd0be3..41386bab12 100644 --- a/vendor/github.com/aws/aws-sdk-go/aws/signer/v4/v4.go +++ b/vendor/github.com/aws/aws-sdk-go/aws/signer/v4/v4.go @@ -8,7 +8,7 @@ // Generally using the signer outside of the SDK should not require any additional // logic when using Go v1.5 or higher. The signer does this by taking advantage // of the URL.EscapedPath method. If your request URI requires additional escaping -// you many need to use the URL.Opaque to define what the raw URI should be sent +// you may need to use the URL.Opaque to define what the raw URI should be sent // to the service as. // // The signer will first check the URL.Opaque field, and use its value if set. diff --git a/vendor/github.com/aws/aws-sdk-go/aws/version.go b/vendor/github.com/aws/aws-sdk-go/aws/version.go index 2654f65574..373fdecbb2 100644 --- a/vendor/github.com/aws/aws-sdk-go/aws/version.go +++ b/vendor/github.com/aws/aws-sdk-go/aws/version.go @@ -5,4 +5,4 @@ package aws const SDKName = "aws-sdk-go" // SDKVersion is the version of this SDK -const SDKVersion = "1.44.303" +const SDKVersion = "1.44.314" diff --git a/vendor/github.com/aws/aws-sdk-go/service/dynamodb/api.go b/vendor/github.com/aws/aws-sdk-go/service/dynamodb/api.go index 47f359cd6f..a250c7622d 100644 --- a/vendor/github.com/aws/aws-sdk-go/service/dynamodb/api.go +++ b/vendor/github.com/aws/aws-sdk-go/service/dynamodb/api.go @@ -5672,17 +5672,24 @@ func (c *DynamoDB) ScanRequest(input *ScanInput) (req *request.Request, output * // every item in a table or a secondary index. To have DynamoDB return fewer // items, you can provide a FilterExpression operation. // -// If the total number of scanned items exceeds the maximum dataset size limit -// of 1 MB, the scan stops and results are returned to the user as a LastEvaluatedKey -// value to continue the scan in a subsequent operation. The results also include -// the number of items exceeding the limit. A scan can result in no table data -// meeting the filter criteria. -// -// A single Scan operation reads up to the maximum number of items set (if using -// the Limit parameter) or a maximum of 1 MB of data and then apply any filtering -// to the results using FilterExpression. If LastEvaluatedKey is present in -// the response, you need to paginate the result set. For more information, -// see Paginating the Results (https://docs.aws.amazon.com/amazondynamodb/latest/developerguide/Scan.html#Scan.Pagination) +// If the total size of scanned items exceeds the maximum dataset size limit +// of 1 MB, the scan completes and results are returned to the user. The LastEvaluatedKey +// value is also returned and the requestor can use the LastEvaluatedKey to +// continue the scan in a subsequent operation. Each scan response also includes +// number of items that were scanned (ScannedCount) as part of the request. +// If using a FilterExpression, a scan result can result in no items meeting +// the criteria and the Count will result in zero. If you did not use a FilterExpression +// in the scan request, then Count is the same as ScannedCount. +// +// Count and ScannedCount only return the count of items specific to a single +// scan request and, unless the table is less than 1MB, do not represent the +// total number of items in the table. +// +// A single Scan operation first reads up to the maximum number of items set +// (if using the Limit parameter) or a maximum of 1 MB of data and then applies +// any filtering to the results if a FilterExpression is provided. If LastEvaluatedKey +// is present in the response, pagination is required to complete the full table +// scan. For more information, see Paginating the Results (https://docs.aws.amazon.com/amazondynamodb/latest/developerguide/Scan.html#Scan.Pagination) // in the Amazon DynamoDB Developer Guide. // // Scan operations proceed sequentially; however, for faster performance on @@ -5691,11 +5698,18 @@ func (c *DynamoDB) ScanRequest(input *ScanInput) (req *request.Request, output * // information, see Parallel Scan (https://docs.aws.amazon.com/amazondynamodb/latest/developerguide/Scan.html#Scan.ParallelScan) // in the Amazon DynamoDB Developer Guide. // -// Scan uses eventually consistent reads when accessing the data in a table; -// therefore, the result set might not include the changes to data in the table -// immediately before the operation began. If you need a consistent copy of -// the data, as of the time that the Scan begins, you can set the ConsistentRead -// parameter to true. +// By default, a Scan uses eventually consistent reads when accessing the items +// in a table. Therefore, the results from an eventually consistent Scan may +// not include the latest item changes at the time the scan iterates through +// each item in the table. If you require a strongly consistent read of each +// item as the scan iterates through the items in the table, you can set the +// ConsistentRead parameter to true. Strong consistency only relates to the +// consistency of the read at the item level. +// +// DynamoDB does not provide snapshot isolation for a scan operation when the +// ConsistentRead parameter is set to true. Thus, a DynamoDB scan operation +// does not guarantee that all reads in a scan see a consistent snapshot of +// the table when the scan operation was requested. // // Returns awserr.Error for service API and SDK errors. Use runtime type assertions // with awserr.Error's Code and Message methods to get detailed information about @@ -9018,7 +9032,8 @@ type BatchExecuteStatementOutput struct { // are ordered according to the ordering of the statements. ConsumedCapacity []*ConsumedCapacity `type:"list"` - // The response to each PartiQL statement in the batch. + // The response to each PartiQL statement in the batch. The values of the list + // are ordered according to the ordering of the request statements. Responses []*BatchStatementResponse `type:"list"` } @@ -24831,7 +24846,7 @@ type Update struct { // Use ReturnValuesOnConditionCheckFailure to get the item attributes if the // Update condition fails. For ReturnValuesOnConditionCheckFailure, the valid - // values are: NONE, ALL_OLD, UPDATED_OLD, ALL_NEW, UPDATED_NEW. + // values are: NONE and ALL_OLD. ReturnValuesOnConditionCheckFailure *string `type:"string" enum:"ReturnValuesOnConditionCheckFailure"` // Name of the table for the UpdateItem request. diff --git a/vendor/github.com/aws/aws-sdk-go/service/sts/api.go b/vendor/github.com/aws/aws-sdk-go/service/sts/api.go index 7ac6b93f44..11af63b4d8 100644 --- a/vendor/github.com/aws/aws-sdk-go/service/sts/api.go +++ b/vendor/github.com/aws/aws-sdk-go/service/sts/api.go @@ -1460,6 +1460,9 @@ type AssumeRoleInput struct { // in the IAM User Guide. PolicyArns []*PolicyDescriptorType `type:"list"` + // Reserved for future use. + ProvidedContexts []*ProvidedContext `type:"list"` + // The Amazon Resource Name (ARN) of the role to assume. // // RoleArn is a required field @@ -1633,6 +1636,16 @@ func (s *AssumeRoleInput) Validate() error { } } } + if s.ProvidedContexts != nil { + for i, v := range s.ProvidedContexts { + if v == nil { + continue + } + if err := v.Validate(); err != nil { + invalidParams.AddNested(fmt.Sprintf("%s[%v]", "ProvidedContexts", i), err.(request.ErrInvalidParams)) + } + } + } if s.Tags != nil { for i, v := range s.Tags { if v == nil { @@ -1674,6 +1687,12 @@ func (s *AssumeRoleInput) SetPolicyArns(v []*PolicyDescriptorType) *AssumeRoleIn return s } +// SetProvidedContexts sets the ProvidedContexts field's value. +func (s *AssumeRoleInput) SetProvidedContexts(v []*ProvidedContext) *AssumeRoleInput { + s.ProvidedContexts = v + return s +} + // SetRoleArn sets the RoleArn field's value. func (s *AssumeRoleInput) SetRoleArn(v string) *AssumeRoleInput { s.RoleArn = &v @@ -2266,7 +2285,8 @@ type AssumeRoleWithWebIdentityInput struct { // The OAuth 2.0 access token or OpenID Connect ID token that is provided by // the identity provider. Your application must get this token by authenticating // the user who is using your application with a web identity provider before - // the application makes an AssumeRoleWithWebIdentity call. + // the application makes an AssumeRoleWithWebIdentity call. Only tokens with + // RSA algorithms (RS256) are supported. // // WebIdentityToken is a sensitive parameter and its value will be // replaced with "sensitive" in string returned by AssumeRoleWithWebIdentityInput's @@ -3385,6 +3405,63 @@ func (s *PolicyDescriptorType) SetArn(v string) *PolicyDescriptorType { return s } +// Reserved for future use. +type ProvidedContext struct { + _ struct{} `type:"structure"` + + // Reserved for future use. + ContextAssertion *string `min:"4" type:"string"` + + // Reserved for future use. + ProviderArn *string `min:"20" type:"string"` +} + +// String returns the string representation. +// +// API parameter values that are decorated as "sensitive" in the API will not +// be included in the string output. The member name will be present, but the +// value will be replaced with "sensitive". +func (s ProvidedContext) String() string { + return awsutil.Prettify(s) +} + +// GoString returns the string representation. +// +// API parameter values that are decorated as "sensitive" in the API will not +// be included in the string output. The member name will be present, but the +// value will be replaced with "sensitive". +func (s ProvidedContext) GoString() string { + return s.String() +} + +// Validate inspects the fields of the type to determine if they are valid. +func (s *ProvidedContext) Validate() error { + invalidParams := request.ErrInvalidParams{Context: "ProvidedContext"} + if s.ContextAssertion != nil && len(*s.ContextAssertion) < 4 { + invalidParams.Add(request.NewErrParamMinLen("ContextAssertion", 4)) + } + if s.ProviderArn != nil && len(*s.ProviderArn) < 20 { + invalidParams.Add(request.NewErrParamMinLen("ProviderArn", 20)) + } + + if invalidParams.Len() > 0 { + return invalidParams + } + return nil +} + +// SetContextAssertion sets the ContextAssertion field's value. +func (s *ProvidedContext) SetContextAssertion(v string) *ProvidedContext { + s.ContextAssertion = &v + return s +} + +// SetProviderArn sets the ProviderArn field's value. +func (s *ProvidedContext) SetProviderArn(v string) *ProvidedContext { + s.ProviderArn = &v + return s +} + // You can pass custom key-value pair attributes when you assume a role or federate // a user. These are called session tags. You can then use the session tags // to control access to resources. For more information, see Tagging Amazon diff --git a/vendor/github.com/aws/smithy-go/.gitignore b/vendor/github.com/aws/smithy-go/.gitignore index c01141aa45..c92d6105eb 100644 --- a/vendor/github.com/aws/smithy-go/.gitignore +++ b/vendor/github.com/aws/smithy-go/.gitignore @@ -20,3 +20,7 @@ target/ build/ */out/ */*/out/ + +# VS Code +bin/ +.vscode/ diff --git a/vendor/github.com/aws/smithy-go/CHANGELOG.md b/vendor/github.com/aws/smithy-go/CHANGELOG.md index 1e23bf95b3..a7ebd2012c 100644 --- a/vendor/github.com/aws/smithy-go/CHANGELOG.md +++ b/vendor/github.com/aws/smithy-go/CHANGELOG.md @@ -1,3 +1,8 @@ +# Release (2023-07-31) + +## General Highlights +* **Feature**: Adds support for smithy-modeled endpoint resolution. + # Release (2022-12-02) * No change notes available for this release. diff --git a/vendor/github.com/aws/smithy-go/encoding/httpbinding/encode.go b/vendor/github.com/aws/smithy-go/encoding/httpbinding/encode.go index 96abd073ab..543e7cf038 100644 --- a/vendor/github.com/aws/smithy-go/encoding/httpbinding/encode.go +++ b/vendor/github.com/aws/smithy-go/encoding/httpbinding/encode.go @@ -26,10 +26,17 @@ type Encoder struct { header http.Header } -// NewEncoder creates a new encoder from the passed in request. All query and +// NewEncoder creates a new encoder from the passed in request. It assumes that +// raw path contains no valuable information at this point, so it passes in path +// as path and raw path for subsequent trans +func NewEncoder(path, query string, headers http.Header) (*Encoder, error) { + return NewEncoderWithRawPath(path, path, query, headers) +} + +// NewHTTPBindingEncoder creates a new encoder from the passed in request. All query and // header values will be added on top of the request's existing values. Overwriting // duplicate values. -func NewEncoder(path, query string, headers http.Header) (*Encoder, error) { +func NewEncoderWithRawPath(path, rawPath, query string, headers http.Header) (*Encoder, error) { parseQuery, err := url.ParseQuery(query) if err != nil { return nil, fmt.Errorf("failed to parse query string: %w", err) @@ -37,7 +44,7 @@ func NewEncoder(path, query string, headers http.Header) (*Encoder, error) { e := &Encoder{ path: []byte(path), - rawPath: []byte(path), + rawPath: []byte(rawPath), query: parseQuery, header: headers.Clone(), } diff --git a/vendor/github.com/aws/smithy-go/endpoints/endpoint.go b/vendor/github.com/aws/smithy-go/endpoints/endpoint.go new file mode 100644 index 0000000000..a935283974 --- /dev/null +++ b/vendor/github.com/aws/smithy-go/endpoints/endpoint.go @@ -0,0 +1,23 @@ +package transport + +import ( + "net/http" + "net/url" + + "github.com/aws/smithy-go" +) + +// Endpoint is the endpoint object returned by Endpoint resolution V2 +type Endpoint struct { + // The complete URL minimally specfiying the scheme and host. + // May optionally specify the port and base path component. + URI url.URL + + // An optional set of headers to be sent using transport layer headers. + Headers http.Header + + // A grab-bag property map of endpoint attributes. The + // values present here are subject to change, or being add/removed at any + // time. + Properties smithy.Properties +} diff --git a/vendor/github.com/aws/smithy-go/go_module_metadata.go b/vendor/github.com/aws/smithy-go/go_module_metadata.go index 8eaac41e7a..a7cfd686d7 100644 --- a/vendor/github.com/aws/smithy-go/go_module_metadata.go +++ b/vendor/github.com/aws/smithy-go/go_module_metadata.go @@ -3,4 +3,4 @@ package smithy // goModuleVersion is the tagged release for this module -const goModuleVersion = "1.13.5" +const goModuleVersion = "1.14.0" diff --git a/vendor/github.com/aws/smithy-go/properties.go b/vendor/github.com/aws/smithy-go/properties.go new file mode 100644 index 0000000000..17d659c539 --- /dev/null +++ b/vendor/github.com/aws/smithy-go/properties.go @@ -0,0 +1,52 @@ +package smithy + +// PropertiesReader provides an interface for reading metadata from the +// underlying metadata container. +type PropertiesReader interface { + Get(key interface{}) interface{} +} + +// Properties provides storing and reading metadata values. Keys may be any +// comparable value type. Get and set will panic if key is not a comparable +// value type. +// +// Properties uses lazy initialization, and Set method must be called as an +// addressable value, or pointer. Not doing so may cause key/value pair to not +// be set. +type Properties struct { + values map[interface{}]interface{} +} + +// Get attempts to retrieve the value the key points to. Returns nil if the +// key was not found. +// +// Panics if key type is not comparable. +func (m *Properties) Get(key interface{}) interface{} { + return m.values[key] +} + +// Set stores the value pointed to by the key. If a value already exists at +// that key it will be replaced with the new value. +// +// Set method must be called as an addressable value, or pointer. If Set is not +// called as an addressable value or pointer, the key value pair being set may +// be lost. +// +// Panics if the key type is not comparable. +func (m *Properties) Set(key, value interface{}) { + if m.values == nil { + m.values = map[interface{}]interface{}{} + } + m.values[key] = value +} + +// Has returns whether the key exists in the metadata. +// +// Panics if the key type is not comparable. +func (m *Properties) Has(key interface{}) bool { + if m.values == nil { + return false + } + _, ok := m.values[key] + return ok +} diff --git a/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/array_codec.go b/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/array_codec.go index 4e24f9eed6..6ca8d9ad6c 100644 --- a/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/array_codec.go +++ b/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/array_codec.go @@ -14,17 +14,23 @@ import ( ) // ArrayCodec is the Codec used for bsoncore.Array values. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with the +// ArrayCodec registered. type ArrayCodec struct{} var defaultArrayCodec = NewArrayCodec() // NewArrayCodec returns an ArrayCodec. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with the +// ArrayCodec registered. func NewArrayCodec() *ArrayCodec { return &ArrayCodec{} } // EncodeValue is the ValueEncoder for bsoncore.Array values. -func (ac *ArrayCodec) EncodeValue(ec EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { +func (ac *ArrayCodec) EncodeValue(_ EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { if !val.IsValid() || val.Type() != tCoreArray { return ValueEncoderError{Name: "CoreArrayEncodeValue", Types: []reflect.Type{tCoreArray}, Received: val} } @@ -34,7 +40,7 @@ func (ac *ArrayCodec) EncodeValue(ec EncodeContext, vw bsonrw.ValueWriter, val r } // DecodeValue is the ValueDecoder for bsoncore.Array values. -func (ac *ArrayCodec) DecodeValue(dc DecodeContext, vr bsonrw.ValueReader, val reflect.Value) error { +func (ac *ArrayCodec) DecodeValue(_ DecodeContext, vr bsonrw.ValueReader, val reflect.Value) error { if !val.CanSet() || val.Type() != tCoreArray { return ValueDecoderError{Name: "CoreArrayDecodeValue", Types: []reflect.Type{tCoreArray}, Received: val} } diff --git a/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/bsoncodec.go b/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/bsoncodec.go index 098ed69f98..0693bd432f 100644 --- a/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/bsoncodec.go +++ b/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/bsoncodec.go @@ -23,6 +23,8 @@ var ( // Marshaler is an interface implemented by types that can marshal themselves // into a BSON document represented as bytes. The bytes returned must be a valid // BSON document if the error is nil. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.Marshaler] instead. type Marshaler interface { MarshalBSON() ([]byte, error) } @@ -31,6 +33,8 @@ type Marshaler interface { // themselves into a BSON value as bytes. The type must be the valid type for // the bytes returned. The bytes and byte type together must be valid if the // error is nil. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.ValueMarshaler] instead. type ValueMarshaler interface { MarshalBSONValue() (bsontype.Type, []byte, error) } @@ -39,6 +43,8 @@ type ValueMarshaler interface { // document representation of themselves. The BSON bytes can be assumed to be // valid. UnmarshalBSON must copy the BSON bytes if it wishes to retain the data // after returning. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.Unmarshaler] instead. type Unmarshaler interface { UnmarshalBSON([]byte) error } @@ -47,6 +53,8 @@ type Unmarshaler interface { // BSON value representation of themselves. The BSON bytes and type can be // assumed to be valid. UnmarshalBSONValue must copy the BSON value bytes if it // wishes to retain the data after returning. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.ValueUnmarshaler] instead. type ValueUnmarshaler interface { UnmarshalBSONValue(bsontype.Type, []byte) error } @@ -111,13 +119,93 @@ func (vde ValueDecoderError) Error() string { // value. type EncodeContext struct { *Registry + + // MinSize causes the Encoder to marshal Go integer values (int, int8, int16, int32, int64, + // uint, uint8, uint16, uint32, or uint64) as the minimum BSON int size (either 32 or 64 bits) + // that can represent the integer value. + // + // Deprecated: Use bson.Encoder.IntMinSize instead. MinSize bool + + errorOnInlineDuplicates bool + stringifyMapKeysWithFmt bool + nilMapAsEmpty bool + nilSliceAsEmpty bool + nilByteSliceAsEmpty bool + omitZeroStruct bool + useJSONStructTags bool +} + +// ErrorOnInlineDuplicates causes the Encoder to return an error if there is a duplicate field in +// the marshaled BSON when the "inline" struct tag option is set. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.Encoder.ErrorOnInlineDuplicates] instead. +func (ec *EncodeContext) ErrorOnInlineDuplicates() { + ec.errorOnInlineDuplicates = true +} + +// StringifyMapKeysWithFmt causes the Encoder to convert Go map keys to BSON document field name +// strings using fmt.Sprintf() instead of the default string conversion logic. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.Encoder.StringifyMapKeysWithFmt] instead. +func (ec *EncodeContext) StringifyMapKeysWithFmt() { + ec.stringifyMapKeysWithFmt = true +} + +// NilMapAsEmpty causes the Encoder to marshal nil Go maps as empty BSON documents instead of BSON +// null. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.Encoder.NilMapAsEmpty] instead. +func (ec *EncodeContext) NilMapAsEmpty() { + ec.nilMapAsEmpty = true +} + +// NilSliceAsEmpty causes the Encoder to marshal nil Go slices as empty BSON arrays instead of BSON +// null. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.Encoder.NilSliceAsEmpty] instead. +func (ec *EncodeContext) NilSliceAsEmpty() { + ec.nilSliceAsEmpty = true +} + +// NilByteSliceAsEmpty causes the Encoder to marshal nil Go byte slices as empty BSON binary values +// instead of BSON null. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.Encoder.NilByteSliceAsEmpty] instead. +func (ec *EncodeContext) NilByteSliceAsEmpty() { + ec.nilByteSliceAsEmpty = true +} + +// OmitZeroStruct causes the Encoder to consider the zero value for a struct (e.g. MyStruct{}) +// as empty and omit it from the marshaled BSON when the "omitempty" struct tag option is set. +// +// Note that the Encoder only examines exported struct fields when determining if a struct is the +// zero value. It considers pointers to a zero struct value (e.g. &MyStruct{}) not empty. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.Encoder.OmitZeroStruct] instead. +func (ec *EncodeContext) OmitZeroStruct() { + ec.omitZeroStruct = true +} + +// UseJSONStructTags causes the Encoder to fall back to using the "json" struct tag if a "bson" +// struct tag is not specified. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.Encoder.UseJSONStructTags] instead. +func (ec *EncodeContext) UseJSONStructTags() { + ec.useJSONStructTags = true } // DecodeContext is the contextual information required for a Codec to decode a // value. type DecodeContext struct { *Registry + + // Truncate, if true, instructs decoders to to truncate the fractional part of BSON "double" + // values when attempting to unmarshal them into a Go integer (int, int8, int16, int32, int64, + // uint, uint8, uint16, uint32, or uint64) struct field. The truncation logic does not apply to + // BSON "decimal128" values. + // + // Deprecated: Use bson.Decoder.AllowTruncatingDoubles instead. Truncate bool // Ancestor is the type of a containing document. This is mainly used to determine what type @@ -125,7 +213,7 @@ type DecodeContext struct { // Ancestor is a bson.M, BSON embedded document values being decoded into an empty interface // will be decoded into a bson.M. // - // Deprecated: Use DefaultDocumentM or DefaultDocumentD instead. + // Deprecated: Use bson.Decoder.DefaultDocumentM or bson.Decoder.DefaultDocumentD instead. Ancestor reflect.Type // defaultDocumentType specifies the Go type to decode top-level and nested BSON documents into. In particular, the @@ -133,22 +221,74 @@ type DecodeContext struct { // set to a type that a BSON document cannot be unmarshaled into (e.g. "string"), unmarshalling will result in an // error. DocumentType overrides the Ancestor field. defaultDocumentType reflect.Type + + binaryAsSlice bool + useJSONStructTags bool + useLocalTimeZone bool + zeroMaps bool + zeroStructs bool } -// DefaultDocumentM will decode empty documents using the primitive.M type. This behavior is restricted to data typed as -// "interface{}" or "map[string]interface{}". +// BinaryAsSlice causes the Decoder to unmarshal BSON binary field values that are the "Generic" or +// "Old" BSON binary subtype as a Go byte slice instead of a primitive.Binary. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.Decoder.BinaryAsSlice] instead. +func (dc *DecodeContext) BinaryAsSlice() { + dc.binaryAsSlice = true +} + +// UseJSONStructTags causes the Decoder to fall back to using the "json" struct tag if a "bson" +// struct tag is not specified. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.Decoder.UseJSONStructTags] instead. +func (dc *DecodeContext) UseJSONStructTags() { + dc.useJSONStructTags = true +} + +// UseLocalTimeZone causes the Decoder to unmarshal time.Time values in the local timezone instead +// of the UTC timezone. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.Decoder.UseLocalTimeZone] instead. +func (dc *DecodeContext) UseLocalTimeZone() { + dc.useLocalTimeZone = true +} + +// ZeroMaps causes the Decoder to delete any existing values from Go maps in the destination value +// passed to Decode before unmarshaling BSON documents into them. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.Decoder.ZeroMaps] instead. +func (dc *DecodeContext) ZeroMaps() { + dc.zeroMaps = true +} + +// ZeroStructs causes the Decoder to delete any existing values from Go structs in the destination +// value passed to Decode before unmarshaling BSON documents into them. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.Decoder.ZeroStructs] instead. +func (dc *DecodeContext) ZeroStructs() { + dc.zeroStructs = true +} + +// DefaultDocumentM causes the Decoder to always unmarshal documents into the primitive.M type. This +// behavior is restricted to data typed as "interface{}" or "map[string]interface{}". +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.Decoder.DefaultDocumentM] instead. func (dc *DecodeContext) DefaultDocumentM() { dc.defaultDocumentType = reflect.TypeOf(primitive.M{}) } -// DefaultDocumentD will decode empty documents using the primitive.D type. This behavior is restricted to data typed as -// "interface{}" or "map[string]interface{}". +// DefaultDocumentD causes the Decoder to always unmarshal documents into the primitive.D type. This +// behavior is restricted to data typed as "interface{}" or "map[string]interface{}". +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.Decoder.DefaultDocumentD] instead. func (dc *DecodeContext) DefaultDocumentD() { dc.defaultDocumentType = reflect.TypeOf(primitive.D{}) } -// ValueCodec is the interface that groups the methods to encode and decode +// ValueCodec is an interface for encoding and decoding a reflect.Value. // values. +// +// Deprecated: Use [ValueEncoder] and [ValueDecoder] instead. type ValueCodec interface { ValueEncoder ValueDecoder @@ -233,6 +373,10 @@ func decodeTypeOrValueWithInfo(vd ValueDecoder, td typeDecoder, dc DecodeContext // CodecZeroer is the interface implemented by Codecs that can also determine if // a value of the type that would be encoded is zero. +// +// Deprecated: Defining custom rules for the zero/empty value will not be supported in Go Driver +// 2.0. Users who want to omit empty complex values should use a pointer field and set the value to +// nil instead. type CodecZeroer interface { IsTypeZero(interface{}) bool } diff --git a/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/byte_slice_codec.go b/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/byte_slice_codec.go index 5a916cc159..dde3e76815 100644 --- a/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/byte_slice_codec.go +++ b/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/byte_slice_codec.go @@ -16,18 +16,30 @@ import ( ) // ByteSliceCodec is the Codec used for []byte values. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with the +// ByteSliceCodec registered. type ByteSliceCodec struct { + // EncodeNilAsEmpty causes EncodeValue to marshal nil Go byte slices as empty BSON binary values + // instead of BSON null. + // + // Deprecated: Use bson.Encoder.NilByteSliceAsEmpty instead. EncodeNilAsEmpty bool } var ( defaultByteSliceCodec = NewByteSliceCodec() - _ ValueCodec = defaultByteSliceCodec + // Assert that defaultByteSliceCodec satisfies the typeDecoder interface, which allows it to be + // used by collection type decoders (e.g. map, slice, etc) to set individual values in a + // collection. _ typeDecoder = defaultByteSliceCodec ) -// NewByteSliceCodec returns a StringCodec with options opts. +// NewByteSliceCodec returns a ByteSliceCodec with options opts. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with the +// ByteSliceCodec registered. func NewByteSliceCodec(opts ...*bsonoptions.ByteSliceCodecOptions) *ByteSliceCodec { byteSliceOpt := bsonoptions.MergeByteSliceCodecOptions(opts...) codec := ByteSliceCodec{} @@ -42,13 +54,13 @@ func (bsc *ByteSliceCodec) EncodeValue(ec EncodeContext, vw bsonrw.ValueWriter, if !val.IsValid() || val.Type() != tByteSlice { return ValueEncoderError{Name: "ByteSliceEncodeValue", Types: []reflect.Type{tByteSlice}, Received: val} } - if val.IsNil() && !bsc.EncodeNilAsEmpty { + if val.IsNil() && !bsc.EncodeNilAsEmpty && !ec.nilByteSliceAsEmpty { return vw.WriteNull() } return vw.WriteBinary(val.Interface().([]byte)) } -func (bsc *ByteSliceCodec) decodeType(dc DecodeContext, vr bsonrw.ValueReader, t reflect.Type) (reflect.Value, error) { +func (bsc *ByteSliceCodec) decodeType(_ DecodeContext, vr bsonrw.ValueReader, t reflect.Type) (reflect.Value, error) { if t != tByteSlice { return emptyValue, ValueDecoderError{ Name: "ByteSliceDecodeValue", diff --git a/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/default_value_decoders.go b/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/default_value_decoders.go index e95cab585f..b5e22c498a 100644 --- a/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/default_value_decoders.go +++ b/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/default_value_decoders.go @@ -48,6 +48,9 @@ func newDefaultStructCodec() *StructCodec { // DefaultValueDecoders is a namespace type for the default ValueDecoders used // when creating a registry. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value decoders registered. type DefaultValueDecoders struct{} // RegisterDefaultDecoders will register the decoder methods attached to DefaultValueDecoders with @@ -56,6 +59,9 @@ type DefaultValueDecoders struct{} // There is no support for decoding map[string]interface{} because there is no decoder for // interface{}, so users must either register this decoder themselves or use the // EmptyInterfaceDecoder available in the bson package. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value decoders registered. func (dvd DefaultValueDecoders) RegisterDefaultDecoders(rb *RegistryBuilder) { if rb == nil { panic(errors.New("argument to RegisterDefaultDecoders must not be nil")) @@ -132,6 +138,9 @@ func (dvd DefaultValueDecoders) RegisterDefaultDecoders(rb *RegistryBuilder) { } // DDecodeValue is the ValueDecoderFunc for primitive.D instances. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value decoders registered. func (dvd DefaultValueDecoders) DDecodeValue(dc DecodeContext, vr bsonrw.ValueReader, val reflect.Value) error { if !val.IsValid() || !val.CanSet() || val.Type() != tD { return ValueDecoderError{Name: "DDecodeValue", Kinds: []reflect.Kind{reflect.Slice}, Received: val} @@ -188,7 +197,7 @@ func (dvd DefaultValueDecoders) DDecodeValue(dc DecodeContext, vr bsonrw.ValueRe return nil } -func (dvd DefaultValueDecoders) booleanDecodeType(dctx DecodeContext, vr bsonrw.ValueReader, t reflect.Type) (reflect.Value, error) { +func (dvd DefaultValueDecoders) booleanDecodeType(_ DecodeContext, vr bsonrw.ValueReader, t reflect.Type) (reflect.Value, error) { if t.Kind() != reflect.Bool { return emptyValue, ValueDecoderError{ Name: "BooleanDecodeValue", @@ -235,6 +244,9 @@ func (dvd DefaultValueDecoders) booleanDecodeType(dctx DecodeContext, vr bsonrw. } // BooleanDecodeValue is the ValueDecoderFunc for bool types. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value decoders registered. func (dvd DefaultValueDecoders) BooleanDecodeValue(dctx DecodeContext, vr bsonrw.ValueReader, val reflect.Value) error { if !val.IsValid() || !val.CanSet() || val.Kind() != reflect.Bool { return ValueDecoderError{Name: "BooleanDecodeValue", Kinds: []reflect.Kind{reflect.Bool}, Received: val} @@ -333,6 +345,9 @@ func (DefaultValueDecoders) intDecodeType(dc DecodeContext, vr bsonrw.ValueReade } // IntDecodeValue is the ValueDecoderFunc for int types. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value decoders registered. func (dvd DefaultValueDecoders) IntDecodeValue(dc DecodeContext, vr bsonrw.ValueReader, val reflect.Value) error { if !val.CanSet() { return ValueDecoderError{ @@ -434,7 +449,7 @@ func (dvd DefaultValueDecoders) UintDecodeValue(dc DecodeContext, vr bsonrw.Valu return nil } -func (dvd DefaultValueDecoders) floatDecodeType(ec DecodeContext, vr bsonrw.ValueReader, t reflect.Type) (reflect.Value, error) { +func (dvd DefaultValueDecoders) floatDecodeType(dc DecodeContext, vr bsonrw.ValueReader, t reflect.Type) (reflect.Value, error) { var f float64 var err error switch vrType := vr.Type(); vrType { @@ -477,7 +492,7 @@ func (dvd DefaultValueDecoders) floatDecodeType(ec DecodeContext, vr bsonrw.Valu switch t.Kind() { case reflect.Float32: - if !ec.Truncate && float64(float32(f)) != f { + if !dc.Truncate && float64(float32(f)) != f { return emptyValue, errCannotTruncate } @@ -494,6 +509,9 @@ func (dvd DefaultValueDecoders) floatDecodeType(ec DecodeContext, vr bsonrw.Valu } // FloatDecodeValue is the ValueDecoderFunc for float types. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value decoders registered. func (dvd DefaultValueDecoders) FloatDecodeValue(ec DecodeContext, vr bsonrw.ValueReader, val reflect.Value) error { if !val.CanSet() { return ValueDecoderError{ @@ -515,7 +533,7 @@ func (dvd DefaultValueDecoders) FloatDecodeValue(ec DecodeContext, vr bsonrw.Val // StringDecodeValue is the ValueDecoderFunc for string types. // // Deprecated: StringDecodeValue is not registered by default. Use StringCodec.DecodeValue instead. -func (dvd DefaultValueDecoders) StringDecodeValue(dctx DecodeContext, vr bsonrw.ValueReader, val reflect.Value) error { +func (dvd DefaultValueDecoders) StringDecodeValue(_ DecodeContext, vr bsonrw.ValueReader, val reflect.Value) error { var str string var err error switch vr.Type() { @@ -536,7 +554,7 @@ func (dvd DefaultValueDecoders) StringDecodeValue(dctx DecodeContext, vr bsonrw. return nil } -func (DefaultValueDecoders) javaScriptDecodeType(dctx DecodeContext, vr bsonrw.ValueReader, t reflect.Type) (reflect.Value, error) { +func (DefaultValueDecoders) javaScriptDecodeType(_ DecodeContext, vr bsonrw.ValueReader, t reflect.Type) (reflect.Value, error) { if t != tJavaScript { return emptyValue, ValueDecoderError{ Name: "JavaScriptDecodeValue", @@ -565,6 +583,9 @@ func (DefaultValueDecoders) javaScriptDecodeType(dctx DecodeContext, vr bsonrw.V } // JavaScriptDecodeValue is the ValueDecoderFunc for the primitive.JavaScript type. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value decoders registered. func (dvd DefaultValueDecoders) JavaScriptDecodeValue(dctx DecodeContext, vr bsonrw.ValueReader, val reflect.Value) error { if !val.CanSet() || val.Type() != tJavaScript { return ValueDecoderError{Name: "JavaScriptDecodeValue", Types: []reflect.Type{tJavaScript}, Received: val} @@ -579,7 +600,7 @@ func (dvd DefaultValueDecoders) JavaScriptDecodeValue(dctx DecodeContext, vr bso return nil } -func (DefaultValueDecoders) symbolDecodeType(dctx DecodeContext, vr bsonrw.ValueReader, t reflect.Type) (reflect.Value, error) { +func (DefaultValueDecoders) symbolDecodeType(_ DecodeContext, vr bsonrw.ValueReader, t reflect.Type) (reflect.Value, error) { if t != tSymbol { return emptyValue, ValueDecoderError{ Name: "SymbolDecodeValue", @@ -620,6 +641,9 @@ func (DefaultValueDecoders) symbolDecodeType(dctx DecodeContext, vr bsonrw.Value } // SymbolDecodeValue is the ValueDecoderFunc for the primitive.Symbol type. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value decoders registered. func (dvd DefaultValueDecoders) SymbolDecodeValue(dctx DecodeContext, vr bsonrw.ValueReader, val reflect.Value) error { if !val.CanSet() || val.Type() != tSymbol { return ValueDecoderError{Name: "SymbolDecodeValue", Types: []reflect.Type{tSymbol}, Received: val} @@ -634,7 +658,7 @@ func (dvd DefaultValueDecoders) SymbolDecodeValue(dctx DecodeContext, vr bsonrw. return nil } -func (DefaultValueDecoders) binaryDecodeType(dc DecodeContext, vr bsonrw.ValueReader, t reflect.Type) (reflect.Value, error) { +func (DefaultValueDecoders) binaryDecodeType(_ DecodeContext, vr bsonrw.ValueReader, t reflect.Type) (reflect.Value, error) { if t != tBinary { return emptyValue, ValueDecoderError{ Name: "BinaryDecodeValue", @@ -664,6 +688,9 @@ func (DefaultValueDecoders) binaryDecodeType(dc DecodeContext, vr bsonrw.ValueRe } // BinaryDecodeValue is the ValueDecoderFunc for Binary. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value decoders registered. func (dvd DefaultValueDecoders) BinaryDecodeValue(dc DecodeContext, vr bsonrw.ValueReader, val reflect.Value) error { if !val.CanSet() || val.Type() != tBinary { return ValueDecoderError{Name: "BinaryDecodeValue", Types: []reflect.Type{tBinary}, Received: val} @@ -678,7 +705,7 @@ func (dvd DefaultValueDecoders) BinaryDecodeValue(dc DecodeContext, vr bsonrw.Va return nil } -func (DefaultValueDecoders) undefinedDecodeType(dc DecodeContext, vr bsonrw.ValueReader, t reflect.Type) (reflect.Value, error) { +func (DefaultValueDecoders) undefinedDecodeType(_ DecodeContext, vr bsonrw.ValueReader, t reflect.Type) (reflect.Value, error) { if t != tUndefined { return emptyValue, ValueDecoderError{ Name: "UndefinedDecodeValue", @@ -704,6 +731,9 @@ func (DefaultValueDecoders) undefinedDecodeType(dc DecodeContext, vr bsonrw.Valu } // UndefinedDecodeValue is the ValueDecoderFunc for Undefined. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value decoders registered. func (dvd DefaultValueDecoders) UndefinedDecodeValue(dc DecodeContext, vr bsonrw.ValueReader, val reflect.Value) error { if !val.CanSet() || val.Type() != tUndefined { return ValueDecoderError{Name: "UndefinedDecodeValue", Types: []reflect.Type{tUndefined}, Received: val} @@ -719,7 +749,7 @@ func (dvd DefaultValueDecoders) UndefinedDecodeValue(dc DecodeContext, vr bsonrw } // Accept both 12-byte string and pretty-printed 24-byte hex string formats. -func (dvd DefaultValueDecoders) objectIDDecodeType(dc DecodeContext, vr bsonrw.ValueReader, t reflect.Type) (reflect.Value, error) { +func (dvd DefaultValueDecoders) objectIDDecodeType(_ DecodeContext, vr bsonrw.ValueReader, t reflect.Type) (reflect.Value, error) { if t != tOID { return emptyValue, ValueDecoderError{ Name: "ObjectIDDecodeValue", @@ -765,6 +795,9 @@ func (dvd DefaultValueDecoders) objectIDDecodeType(dc DecodeContext, vr bsonrw.V } // ObjectIDDecodeValue is the ValueDecoderFunc for primitive.ObjectID. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value decoders registered. func (dvd DefaultValueDecoders) ObjectIDDecodeValue(dc DecodeContext, vr bsonrw.ValueReader, val reflect.Value) error { if !val.CanSet() || val.Type() != tOID { return ValueDecoderError{Name: "ObjectIDDecodeValue", Types: []reflect.Type{tOID}, Received: val} @@ -779,7 +812,7 @@ func (dvd DefaultValueDecoders) ObjectIDDecodeValue(dc DecodeContext, vr bsonrw. return nil } -func (DefaultValueDecoders) dateTimeDecodeType(dc DecodeContext, vr bsonrw.ValueReader, t reflect.Type) (reflect.Value, error) { +func (DefaultValueDecoders) dateTimeDecodeType(_ DecodeContext, vr bsonrw.ValueReader, t reflect.Type) (reflect.Value, error) { if t != tDateTime { return emptyValue, ValueDecoderError{ Name: "DateTimeDecodeValue", @@ -808,6 +841,9 @@ func (DefaultValueDecoders) dateTimeDecodeType(dc DecodeContext, vr bsonrw.Value } // DateTimeDecodeValue is the ValueDecoderFunc for DateTime. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value decoders registered. func (dvd DefaultValueDecoders) DateTimeDecodeValue(dc DecodeContext, vr bsonrw.ValueReader, val reflect.Value) error { if !val.CanSet() || val.Type() != tDateTime { return ValueDecoderError{Name: "DateTimeDecodeValue", Types: []reflect.Type{tDateTime}, Received: val} @@ -822,7 +858,7 @@ func (dvd DefaultValueDecoders) DateTimeDecodeValue(dc DecodeContext, vr bsonrw. return nil } -func (DefaultValueDecoders) nullDecodeType(dc DecodeContext, vr bsonrw.ValueReader, t reflect.Type) (reflect.Value, error) { +func (DefaultValueDecoders) nullDecodeType(_ DecodeContext, vr bsonrw.ValueReader, t reflect.Type) (reflect.Value, error) { if t != tNull { return emptyValue, ValueDecoderError{ Name: "NullDecodeValue", @@ -848,6 +884,9 @@ func (DefaultValueDecoders) nullDecodeType(dc DecodeContext, vr bsonrw.ValueRead } // NullDecodeValue is the ValueDecoderFunc for Null. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value decoders registered. func (dvd DefaultValueDecoders) NullDecodeValue(dc DecodeContext, vr bsonrw.ValueReader, val reflect.Value) error { if !val.CanSet() || val.Type() != tNull { return ValueDecoderError{Name: "NullDecodeValue", Types: []reflect.Type{tNull}, Received: val} @@ -862,7 +901,7 @@ func (dvd DefaultValueDecoders) NullDecodeValue(dc DecodeContext, vr bsonrw.Valu return nil } -func (DefaultValueDecoders) regexDecodeType(dc DecodeContext, vr bsonrw.ValueReader, t reflect.Type) (reflect.Value, error) { +func (DefaultValueDecoders) regexDecodeType(_ DecodeContext, vr bsonrw.ValueReader, t reflect.Type) (reflect.Value, error) { if t != tRegex { return emptyValue, ValueDecoderError{ Name: "RegexDecodeValue", @@ -891,6 +930,9 @@ func (DefaultValueDecoders) regexDecodeType(dc DecodeContext, vr bsonrw.ValueRea } // RegexDecodeValue is the ValueDecoderFunc for Regex. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value decoders registered. func (dvd DefaultValueDecoders) RegexDecodeValue(dc DecodeContext, vr bsonrw.ValueReader, val reflect.Value) error { if !val.CanSet() || val.Type() != tRegex { return ValueDecoderError{Name: "RegexDecodeValue", Types: []reflect.Type{tRegex}, Received: val} @@ -905,7 +947,7 @@ func (dvd DefaultValueDecoders) RegexDecodeValue(dc DecodeContext, vr bsonrw.Val return nil } -func (DefaultValueDecoders) dBPointerDecodeType(dc DecodeContext, vr bsonrw.ValueReader, t reflect.Type) (reflect.Value, error) { +func (DefaultValueDecoders) dBPointerDecodeType(_ DecodeContext, vr bsonrw.ValueReader, t reflect.Type) (reflect.Value, error) { if t != tDBPointer { return emptyValue, ValueDecoderError{ Name: "DBPointerDecodeValue", @@ -935,6 +977,9 @@ func (DefaultValueDecoders) dBPointerDecodeType(dc DecodeContext, vr bsonrw.Valu } // DBPointerDecodeValue is the ValueDecoderFunc for DBPointer. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value decoders registered. func (dvd DefaultValueDecoders) DBPointerDecodeValue(dc DecodeContext, vr bsonrw.ValueReader, val reflect.Value) error { if !val.CanSet() || val.Type() != tDBPointer { return ValueDecoderError{Name: "DBPointerDecodeValue", Types: []reflect.Type{tDBPointer}, Received: val} @@ -949,7 +994,7 @@ func (dvd DefaultValueDecoders) DBPointerDecodeValue(dc DecodeContext, vr bsonrw return nil } -func (DefaultValueDecoders) timestampDecodeType(dc DecodeContext, vr bsonrw.ValueReader, reflectType reflect.Type) (reflect.Value, error) { +func (DefaultValueDecoders) timestampDecodeType(_ DecodeContext, vr bsonrw.ValueReader, reflectType reflect.Type) (reflect.Value, error) { if reflectType != tTimestamp { return emptyValue, ValueDecoderError{ Name: "TimestampDecodeValue", @@ -978,6 +1023,9 @@ func (DefaultValueDecoders) timestampDecodeType(dc DecodeContext, vr bsonrw.Valu } // TimestampDecodeValue is the ValueDecoderFunc for Timestamp. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value decoders registered. func (dvd DefaultValueDecoders) TimestampDecodeValue(dc DecodeContext, vr bsonrw.ValueReader, val reflect.Value) error { if !val.CanSet() || val.Type() != tTimestamp { return ValueDecoderError{Name: "TimestampDecodeValue", Types: []reflect.Type{tTimestamp}, Received: val} @@ -992,7 +1040,7 @@ func (dvd DefaultValueDecoders) TimestampDecodeValue(dc DecodeContext, vr bsonrw return nil } -func (DefaultValueDecoders) minKeyDecodeType(dc DecodeContext, vr bsonrw.ValueReader, t reflect.Type) (reflect.Value, error) { +func (DefaultValueDecoders) minKeyDecodeType(_ DecodeContext, vr bsonrw.ValueReader, t reflect.Type) (reflect.Value, error) { if t != tMinKey { return emptyValue, ValueDecoderError{ Name: "MinKeyDecodeValue", @@ -1020,6 +1068,9 @@ func (DefaultValueDecoders) minKeyDecodeType(dc DecodeContext, vr bsonrw.ValueRe } // MinKeyDecodeValue is the ValueDecoderFunc for MinKey. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value decoders registered. func (dvd DefaultValueDecoders) MinKeyDecodeValue(dc DecodeContext, vr bsonrw.ValueReader, val reflect.Value) error { if !val.CanSet() || val.Type() != tMinKey { return ValueDecoderError{Name: "MinKeyDecodeValue", Types: []reflect.Type{tMinKey}, Received: val} @@ -1034,7 +1085,7 @@ func (dvd DefaultValueDecoders) MinKeyDecodeValue(dc DecodeContext, vr bsonrw.Va return nil } -func (DefaultValueDecoders) maxKeyDecodeType(dc DecodeContext, vr bsonrw.ValueReader, t reflect.Type) (reflect.Value, error) { +func (DefaultValueDecoders) maxKeyDecodeType(_ DecodeContext, vr bsonrw.ValueReader, t reflect.Type) (reflect.Value, error) { if t != tMaxKey { return emptyValue, ValueDecoderError{ Name: "MaxKeyDecodeValue", @@ -1062,6 +1113,9 @@ func (DefaultValueDecoders) maxKeyDecodeType(dc DecodeContext, vr bsonrw.ValueRe } // MaxKeyDecodeValue is the ValueDecoderFunc for MaxKey. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value decoders registered. func (dvd DefaultValueDecoders) MaxKeyDecodeValue(dc DecodeContext, vr bsonrw.ValueReader, val reflect.Value) error { if !val.CanSet() || val.Type() != tMaxKey { return ValueDecoderError{Name: "MaxKeyDecodeValue", Types: []reflect.Type{tMaxKey}, Received: val} @@ -1076,7 +1130,7 @@ func (dvd DefaultValueDecoders) MaxKeyDecodeValue(dc DecodeContext, vr bsonrw.Va return nil } -func (dvd DefaultValueDecoders) decimal128DecodeType(dctx DecodeContext, vr bsonrw.ValueReader, t reflect.Type) (reflect.Value, error) { +func (dvd DefaultValueDecoders) decimal128DecodeType(_ DecodeContext, vr bsonrw.ValueReader, t reflect.Type) (reflect.Value, error) { if t != tDecimal { return emptyValue, ValueDecoderError{ Name: "Decimal128DecodeValue", @@ -1105,6 +1159,9 @@ func (dvd DefaultValueDecoders) decimal128DecodeType(dctx DecodeContext, vr bson } // Decimal128DecodeValue is the ValueDecoderFunc for primitive.Decimal128. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value decoders registered. func (dvd DefaultValueDecoders) Decimal128DecodeValue(dctx DecodeContext, vr bsonrw.ValueReader, val reflect.Value) error { if !val.CanSet() || val.Type() != tDecimal { return ValueDecoderError{Name: "Decimal128DecodeValue", Types: []reflect.Type{tDecimal}, Received: val} @@ -1119,7 +1176,7 @@ func (dvd DefaultValueDecoders) Decimal128DecodeValue(dctx DecodeContext, vr bso return nil } -func (dvd DefaultValueDecoders) jsonNumberDecodeType(dc DecodeContext, vr bsonrw.ValueReader, t reflect.Type) (reflect.Value, error) { +func (dvd DefaultValueDecoders) jsonNumberDecodeType(_ DecodeContext, vr bsonrw.ValueReader, t reflect.Type) (reflect.Value, error) { if t != tJSONNumber { return emptyValue, ValueDecoderError{ Name: "JSONNumberDecodeValue", @@ -1164,6 +1221,9 @@ func (dvd DefaultValueDecoders) jsonNumberDecodeType(dc DecodeContext, vr bsonrw } // JSONNumberDecodeValue is the ValueDecoderFunc for json.Number. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value decoders registered. func (dvd DefaultValueDecoders) JSONNumberDecodeValue(dc DecodeContext, vr bsonrw.ValueReader, val reflect.Value) error { if !val.CanSet() || val.Type() != tJSONNumber { return ValueDecoderError{Name: "JSONNumberDecodeValue", Types: []reflect.Type{tJSONNumber}, Received: val} @@ -1178,7 +1238,7 @@ func (dvd DefaultValueDecoders) JSONNumberDecodeValue(dc DecodeContext, vr bsonr return nil } -func (dvd DefaultValueDecoders) urlDecodeType(dc DecodeContext, vr bsonrw.ValueReader, t reflect.Type) (reflect.Value, error) { +func (dvd DefaultValueDecoders) urlDecodeType(_ DecodeContext, vr bsonrw.ValueReader, t reflect.Type) (reflect.Value, error) { if t != tURL { return emptyValue, ValueDecoderError{ Name: "URLDecodeValue", @@ -1213,6 +1273,9 @@ func (dvd DefaultValueDecoders) urlDecodeType(dc DecodeContext, vr bsonrw.ValueR } // URLDecodeValue is the ValueDecoderFunc for url.URL. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value decoders registered. func (dvd DefaultValueDecoders) URLDecodeValue(dc DecodeContext, vr bsonrw.ValueReader, val reflect.Value) error { if !val.CanSet() || val.Type() != tURL { return ValueDecoderError{Name: "URLDecodeValue", Types: []reflect.Type{tURL}, Received: val} @@ -1230,7 +1293,7 @@ func (dvd DefaultValueDecoders) URLDecodeValue(dc DecodeContext, vr bsonrw.Value // TimeDecodeValue is the ValueDecoderFunc for time.Time. // // Deprecated: TimeDecodeValue is not registered by default. Use TimeCodec.DecodeValue instead. -func (dvd DefaultValueDecoders) TimeDecodeValue(dc DecodeContext, vr bsonrw.ValueReader, val reflect.Value) error { +func (dvd DefaultValueDecoders) TimeDecodeValue(_ DecodeContext, vr bsonrw.ValueReader, val reflect.Value) error { if vr.Type() != bsontype.DateTime { return fmt.Errorf("cannot decode %v into a time.Time", vr.Type()) } @@ -1251,7 +1314,7 @@ func (dvd DefaultValueDecoders) TimeDecodeValue(dc DecodeContext, vr bsonrw.Valu // ByteSliceDecodeValue is the ValueDecoderFunc for []byte. // // Deprecated: ByteSliceDecodeValue is not registered by default. Use ByteSliceCodec.DecodeValue instead. -func (dvd DefaultValueDecoders) ByteSliceDecodeValue(dc DecodeContext, vr bsonrw.ValueReader, val reflect.Value) error { +func (dvd DefaultValueDecoders) ByteSliceDecodeValue(_ DecodeContext, vr bsonrw.ValueReader, val reflect.Value) error { if vr.Type() != bsontype.Binary && vr.Type() != bsontype.Null { return fmt.Errorf("cannot decode %v into a []byte", vr.Type()) } @@ -1336,6 +1399,9 @@ func (dvd DefaultValueDecoders) MapDecodeValue(dc DecodeContext, vr bsonrw.Value } // ArrayDecodeValue is the ValueDecoderFunc for array types. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value decoders registered. func (dvd DefaultValueDecoders) ArrayDecodeValue(dc DecodeContext, vr bsonrw.ValueReader, val reflect.Value) error { if !val.IsValid() || val.Kind() != reflect.Array { return ValueDecoderError{Name: "ArrayDecodeValue", Kinds: []reflect.Kind{reflect.Array}, Received: val} @@ -1447,7 +1513,10 @@ func (dvd DefaultValueDecoders) SliceDecodeValue(dc DecodeContext, vr bsonrw.Val } // ValueUnmarshalerDecodeValue is the ValueDecoderFunc for ValueUnmarshaler implementations. -func (dvd DefaultValueDecoders) ValueUnmarshalerDecodeValue(dc DecodeContext, vr bsonrw.ValueReader, val reflect.Value) error { +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value decoders registered. +func (dvd DefaultValueDecoders) ValueUnmarshalerDecodeValue(_ DecodeContext, vr bsonrw.ValueReader, val reflect.Value) error { if !val.IsValid() || (!val.Type().Implements(tValueUnmarshaler) && !reflect.PtrTo(val.Type()).Implements(tValueUnmarshaler)) { return ValueDecoderError{Name: "ValueUnmarshalerDecodeValue", Types: []reflect.Type{tValueUnmarshaler}, Received: val} } @@ -1480,7 +1549,10 @@ func (dvd DefaultValueDecoders) ValueUnmarshalerDecodeValue(dc DecodeContext, vr } // UnmarshalerDecodeValue is the ValueDecoderFunc for Unmarshaler implementations. -func (dvd DefaultValueDecoders) UnmarshalerDecodeValue(dc DecodeContext, vr bsonrw.ValueReader, val reflect.Value) error { +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value decoders registered. +func (dvd DefaultValueDecoders) UnmarshalerDecodeValue(_ DecodeContext, vr bsonrw.ValueReader, val reflect.Value) error { if !val.IsValid() || (!val.Type().Implements(tUnmarshaler) && !reflect.PtrTo(val.Type()).Implements(tUnmarshaler)) { return ValueDecoderError{Name: "UnmarshalerDecodeValue", Types: []reflect.Type{tUnmarshaler}, Received: val} } @@ -1565,7 +1637,10 @@ func (dvd DefaultValueDecoders) EmptyInterfaceDecodeValue(dc DecodeContext, vr b } // CoreDocumentDecodeValue is the ValueDecoderFunc for bsoncore.Document. -func (DefaultValueDecoders) CoreDocumentDecodeValue(dc DecodeContext, vr bsonrw.ValueReader, val reflect.Value) error { +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value decoders registered. +func (DefaultValueDecoders) CoreDocumentDecodeValue(_ DecodeContext, vr bsonrw.ValueReader, val reflect.Value) error { if !val.CanSet() || val.Type() != tCoreDocument { return ValueDecoderError{Name: "CoreDocumentDecodeValue", Types: []reflect.Type{tCoreDocument}, Received: val} } @@ -1671,6 +1746,9 @@ func (dvd DefaultValueDecoders) codeWithScopeDecodeType(dc DecodeContext, vr bso } // CodeWithScopeDecodeValue is the ValueDecoderFunc for CodeWithScope. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value decoders registered. func (dvd DefaultValueDecoders) CodeWithScopeDecodeValue(dc DecodeContext, vr bsonrw.ValueReader, val reflect.Value) error { if !val.CanSet() || val.Type() != tCodeWithScope { return ValueDecoderError{Name: "CodeWithScopeDecodeValue", Types: []reflect.Type{tCodeWithScope}, Received: val} diff --git a/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/default_value_encoders.go b/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/default_value_encoders.go index 6bdb43cb43..7d526c4ef8 100644 --- a/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/default_value_encoders.go +++ b/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/default_value_encoders.go @@ -58,10 +58,16 @@ func encodeElement(ec EncodeContext, dw bsonrw.DocumentWriter, e primitive.E) er // DefaultValueEncoders is a namespace type for the default ValueEncoders used // when creating a registry. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value encoders registered. type DefaultValueEncoders struct{} // RegisterDefaultEncoders will register the encoder methods attached to DefaultValueEncoders with // the provided RegistryBuilder. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value encoders registered. func (dve DefaultValueEncoders) RegisterDefaultEncoders(rb *RegistryBuilder) { if rb == nil { panic(errors.New("argument to RegisterDefaultEncoders must not be nil")) @@ -113,7 +119,10 @@ func (dve DefaultValueEncoders) RegisterDefaultEncoders(rb *RegistryBuilder) { } // BooleanEncodeValue is the ValueEncoderFunc for bool types. -func (dve DefaultValueEncoders) BooleanEncodeValue(ectx EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value encoders registered. +func (dve DefaultValueEncoders) BooleanEncodeValue(_ EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { if !val.IsValid() || val.Kind() != reflect.Bool { return ValueEncoderError{Name: "BooleanEncodeValue", Kinds: []reflect.Kind{reflect.Bool}, Received: val} } @@ -125,6 +134,9 @@ func fitsIn32Bits(i int64) bool { } // IntEncodeValue is the ValueEncoderFunc for int types. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value encoders registered. func (dve DefaultValueEncoders) IntEncodeValue(ec EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { switch val.Kind() { case reflect.Int8, reflect.Int16, reflect.Int32: @@ -176,7 +188,10 @@ func (dve DefaultValueEncoders) UintEncodeValue(ec EncodeContext, vw bsonrw.Valu } // FloatEncodeValue is the ValueEncoderFunc for float types. -func (dve DefaultValueEncoders) FloatEncodeValue(ec EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value encoders registered. +func (dve DefaultValueEncoders) FloatEncodeValue(_ EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { switch val.Kind() { case reflect.Float32, reflect.Float64: return vw.WriteDouble(val.Float()) @@ -188,7 +203,7 @@ func (dve DefaultValueEncoders) FloatEncodeValue(ec EncodeContext, vw bsonrw.Val // StringEncodeValue is the ValueEncoderFunc for string types. // // Deprecated: StringEncodeValue is not registered by default. Use StringCodec.EncodeValue instead. -func (dve DefaultValueEncoders) StringEncodeValue(ectx EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { +func (dve DefaultValueEncoders) StringEncodeValue(_ EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { if val.Kind() != reflect.String { return ValueEncoderError{ Name: "StringEncodeValue", @@ -201,7 +216,10 @@ func (dve DefaultValueEncoders) StringEncodeValue(ectx EncodeContext, vw bsonrw. } // ObjectIDEncodeValue is the ValueEncoderFunc for primitive.ObjectID. -func (dve DefaultValueEncoders) ObjectIDEncodeValue(ec EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value encoders registered. +func (dve DefaultValueEncoders) ObjectIDEncodeValue(_ EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { if !val.IsValid() || val.Type() != tOID { return ValueEncoderError{Name: "ObjectIDEncodeValue", Types: []reflect.Type{tOID}, Received: val} } @@ -209,7 +227,10 @@ func (dve DefaultValueEncoders) ObjectIDEncodeValue(ec EncodeContext, vw bsonrw. } // Decimal128EncodeValue is the ValueEncoderFunc for primitive.Decimal128. -func (dve DefaultValueEncoders) Decimal128EncodeValue(ec EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value encoders registered. +func (dve DefaultValueEncoders) Decimal128EncodeValue(_ EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { if !val.IsValid() || val.Type() != tDecimal { return ValueEncoderError{Name: "Decimal128EncodeValue", Types: []reflect.Type{tDecimal}, Received: val} } @@ -217,6 +238,9 @@ func (dve DefaultValueEncoders) Decimal128EncodeValue(ec EncodeContext, vw bsonr } // JSONNumberEncodeValue is the ValueEncoderFunc for json.Number. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value encoders registered. func (dve DefaultValueEncoders) JSONNumberEncodeValue(ec EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { if !val.IsValid() || val.Type() != tJSONNumber { return ValueEncoderError{Name: "JSONNumberEncodeValue", Types: []reflect.Type{tJSONNumber}, Received: val} @@ -237,7 +261,10 @@ func (dve DefaultValueEncoders) JSONNumberEncodeValue(ec EncodeContext, vw bsonr } // URLEncodeValue is the ValueEncoderFunc for url.URL. -func (dve DefaultValueEncoders) URLEncodeValue(ec EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value encoders registered. +func (dve DefaultValueEncoders) URLEncodeValue(_ EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { if !val.IsValid() || val.Type() != tURL { return ValueEncoderError{Name: "URLEncodeValue", Types: []reflect.Type{tURL}, Received: val} } @@ -248,7 +275,7 @@ func (dve DefaultValueEncoders) URLEncodeValue(ec EncodeContext, vw bsonrw.Value // TimeEncodeValue is the ValueEncoderFunc for time.TIme. // // Deprecated: TimeEncodeValue is not registered by default. Use TimeCodec.EncodeValue instead. -func (dve DefaultValueEncoders) TimeEncodeValue(ec EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { +func (dve DefaultValueEncoders) TimeEncodeValue(_ EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { if !val.IsValid() || val.Type() != tTime { return ValueEncoderError{Name: "TimeEncodeValue", Types: []reflect.Type{tTime}, Received: val} } @@ -260,7 +287,7 @@ func (dve DefaultValueEncoders) TimeEncodeValue(ec EncodeContext, vw bsonrw.Valu // ByteSliceEncodeValue is the ValueEncoderFunc for []byte. // // Deprecated: ByteSliceEncodeValue is not registered by default. Use ByteSliceCodec.EncodeValue instead. -func (dve DefaultValueEncoders) ByteSliceEncodeValue(ec EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { +func (dve DefaultValueEncoders) ByteSliceEncodeValue(_ EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { if !val.IsValid() || val.Type() != tByteSlice { return ValueEncoderError{Name: "ByteSliceEncodeValue", Types: []reflect.Type{tByteSlice}, Received: val} } @@ -343,6 +370,9 @@ func (dve DefaultValueEncoders) mapEncodeValue(ec EncodeContext, dw bsonrw.Docum } // ArrayEncodeValue is the ValueEncoderFunc for array types. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value encoders registered. func (dve DefaultValueEncoders) ArrayEncodeValue(ec EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { if !val.IsValid() || val.Kind() != reflect.Array { return ValueEncoderError{Name: "ArrayEncodeValue", Kinds: []reflect.Kind{reflect.Array}, Received: val} @@ -515,7 +545,10 @@ func (dve DefaultValueEncoders) EmptyInterfaceEncodeValue(ec EncodeContext, vw b } // ValueMarshalerEncodeValue is the ValueEncoderFunc for ValueMarshaler implementations. -func (dve DefaultValueEncoders) ValueMarshalerEncodeValue(ec EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value encoders registered. +func (dve DefaultValueEncoders) ValueMarshalerEncodeValue(_ EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { // Either val or a pointer to val must implement ValueMarshaler switch { case !val.IsValid(): @@ -541,7 +574,10 @@ func (dve DefaultValueEncoders) ValueMarshalerEncodeValue(ec EncodeContext, vw b } // MarshalerEncodeValue is the ValueEncoderFunc for Marshaler implementations. -func (dve DefaultValueEncoders) MarshalerEncodeValue(ec EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value encoders registered. +func (dve DefaultValueEncoders) MarshalerEncodeValue(_ EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { // Either val or a pointer to val must implement Marshaler switch { case !val.IsValid(): @@ -567,6 +603,9 @@ func (dve DefaultValueEncoders) MarshalerEncodeValue(ec EncodeContext, vw bsonrw } // ProxyEncodeValue is the ValueEncoderFunc for Proxy implementations. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value encoders registered. func (dve DefaultValueEncoders) ProxyEncodeValue(ec EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { // Either val or a pointer to val must implement Proxy switch { @@ -603,7 +642,10 @@ func (dve DefaultValueEncoders) ProxyEncodeValue(ec EncodeContext, vw bsonrw.Val } // JavaScriptEncodeValue is the ValueEncoderFunc for the primitive.JavaScript type. -func (DefaultValueEncoders) JavaScriptEncodeValue(ectx EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value encoders registered. +func (DefaultValueEncoders) JavaScriptEncodeValue(_ EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { if !val.IsValid() || val.Type() != tJavaScript { return ValueEncoderError{Name: "JavaScriptEncodeValue", Types: []reflect.Type{tJavaScript}, Received: val} } @@ -612,7 +654,10 @@ func (DefaultValueEncoders) JavaScriptEncodeValue(ectx EncodeContext, vw bsonrw. } // SymbolEncodeValue is the ValueEncoderFunc for the primitive.Symbol type. -func (DefaultValueEncoders) SymbolEncodeValue(ectx EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value encoders registered. +func (DefaultValueEncoders) SymbolEncodeValue(_ EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { if !val.IsValid() || val.Type() != tSymbol { return ValueEncoderError{Name: "SymbolEncodeValue", Types: []reflect.Type{tSymbol}, Received: val} } @@ -621,7 +666,10 @@ func (DefaultValueEncoders) SymbolEncodeValue(ectx EncodeContext, vw bsonrw.Valu } // BinaryEncodeValue is the ValueEncoderFunc for Binary. -func (DefaultValueEncoders) BinaryEncodeValue(ec EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value encoders registered. +func (DefaultValueEncoders) BinaryEncodeValue(_ EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { if !val.IsValid() || val.Type() != tBinary { return ValueEncoderError{Name: "BinaryEncodeValue", Types: []reflect.Type{tBinary}, Received: val} } @@ -631,7 +679,10 @@ func (DefaultValueEncoders) BinaryEncodeValue(ec EncodeContext, vw bsonrw.ValueW } // UndefinedEncodeValue is the ValueEncoderFunc for Undefined. -func (DefaultValueEncoders) UndefinedEncodeValue(ec EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value encoders registered. +func (DefaultValueEncoders) UndefinedEncodeValue(_ EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { if !val.IsValid() || val.Type() != tUndefined { return ValueEncoderError{Name: "UndefinedEncodeValue", Types: []reflect.Type{tUndefined}, Received: val} } @@ -640,7 +691,10 @@ func (DefaultValueEncoders) UndefinedEncodeValue(ec EncodeContext, vw bsonrw.Val } // DateTimeEncodeValue is the ValueEncoderFunc for DateTime. -func (DefaultValueEncoders) DateTimeEncodeValue(ec EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value encoders registered. +func (DefaultValueEncoders) DateTimeEncodeValue(_ EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { if !val.IsValid() || val.Type() != tDateTime { return ValueEncoderError{Name: "DateTimeEncodeValue", Types: []reflect.Type{tDateTime}, Received: val} } @@ -649,7 +703,10 @@ func (DefaultValueEncoders) DateTimeEncodeValue(ec EncodeContext, vw bsonrw.Valu } // NullEncodeValue is the ValueEncoderFunc for Null. -func (DefaultValueEncoders) NullEncodeValue(ec EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value encoders registered. +func (DefaultValueEncoders) NullEncodeValue(_ EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { if !val.IsValid() || val.Type() != tNull { return ValueEncoderError{Name: "NullEncodeValue", Types: []reflect.Type{tNull}, Received: val} } @@ -658,7 +715,10 @@ func (DefaultValueEncoders) NullEncodeValue(ec EncodeContext, vw bsonrw.ValueWri } // RegexEncodeValue is the ValueEncoderFunc for Regex. -func (DefaultValueEncoders) RegexEncodeValue(ec EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value encoders registered. +func (DefaultValueEncoders) RegexEncodeValue(_ EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { if !val.IsValid() || val.Type() != tRegex { return ValueEncoderError{Name: "RegexEncodeValue", Types: []reflect.Type{tRegex}, Received: val} } @@ -669,7 +729,10 @@ func (DefaultValueEncoders) RegexEncodeValue(ec EncodeContext, vw bsonrw.ValueWr } // DBPointerEncodeValue is the ValueEncoderFunc for DBPointer. -func (DefaultValueEncoders) DBPointerEncodeValue(ec EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value encoders registered. +func (DefaultValueEncoders) DBPointerEncodeValue(_ EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { if !val.IsValid() || val.Type() != tDBPointer { return ValueEncoderError{Name: "DBPointerEncodeValue", Types: []reflect.Type{tDBPointer}, Received: val} } @@ -680,7 +743,10 @@ func (DefaultValueEncoders) DBPointerEncodeValue(ec EncodeContext, vw bsonrw.Val } // TimestampEncodeValue is the ValueEncoderFunc for Timestamp. -func (DefaultValueEncoders) TimestampEncodeValue(ec EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value encoders registered. +func (DefaultValueEncoders) TimestampEncodeValue(_ EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { if !val.IsValid() || val.Type() != tTimestamp { return ValueEncoderError{Name: "TimestampEncodeValue", Types: []reflect.Type{tTimestamp}, Received: val} } @@ -691,7 +757,10 @@ func (DefaultValueEncoders) TimestampEncodeValue(ec EncodeContext, vw bsonrw.Val } // MinKeyEncodeValue is the ValueEncoderFunc for MinKey. -func (DefaultValueEncoders) MinKeyEncodeValue(ec EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value encoders registered. +func (DefaultValueEncoders) MinKeyEncodeValue(_ EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { if !val.IsValid() || val.Type() != tMinKey { return ValueEncoderError{Name: "MinKeyEncodeValue", Types: []reflect.Type{tMinKey}, Received: val} } @@ -700,7 +769,10 @@ func (DefaultValueEncoders) MinKeyEncodeValue(ec EncodeContext, vw bsonrw.ValueW } // MaxKeyEncodeValue is the ValueEncoderFunc for MaxKey. -func (DefaultValueEncoders) MaxKeyEncodeValue(ec EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value encoders registered. +func (DefaultValueEncoders) MaxKeyEncodeValue(_ EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { if !val.IsValid() || val.Type() != tMaxKey { return ValueEncoderError{Name: "MaxKeyEncodeValue", Types: []reflect.Type{tMaxKey}, Received: val} } @@ -709,7 +781,10 @@ func (DefaultValueEncoders) MaxKeyEncodeValue(ec EncodeContext, vw bsonrw.ValueW } // CoreDocumentEncodeValue is the ValueEncoderFunc for bsoncore.Document. -func (DefaultValueEncoders) CoreDocumentEncodeValue(ec EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value encoders registered. +func (DefaultValueEncoders) CoreDocumentEncodeValue(_ EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { if !val.IsValid() || val.Type() != tCoreDocument { return ValueEncoderError{Name: "CoreDocumentEncodeValue", Types: []reflect.Type{tCoreDocument}, Received: val} } @@ -720,6 +795,9 @@ func (DefaultValueEncoders) CoreDocumentEncodeValue(ec EncodeContext, vw bsonrw. } // CodeWithScopeEncodeValue is the ValueEncoderFunc for CodeWithScope. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with all default +// value encoders registered. func (dve DefaultValueEncoders) CodeWithScopeEncodeValue(ec EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { if !val.IsValid() || val.Type() != tCodeWithScope { return ValueEncoderError{Name: "CodeWithScopeEncodeValue", Types: []reflect.Type{tCodeWithScope}, Received: val} diff --git a/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/doc.go b/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/doc.go index 5f903ebea6..4613e5a1ec 100644 --- a/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/doc.go +++ b/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/doc.go @@ -31,35 +31,39 @@ // allow the use of a function with the correct signature as a ValueDecoder. A DecodeContext // instance is provided and serves similar functionality to the EncodeContext. // -// # Registry and RegistryBuilder -// -// A Registry is an immutable store for ValueEncoders, ValueDecoders, and a type map. See the Registry type -// documentation for examples of registering various custom encoders and decoders. A Registry can be constructed using a -// RegistryBuilder, which handles three main types of codecs: -// -// 1. Type encoders/decoders - These can be registered using the RegisterTypeEncoder and RegisterTypeDecoder methods. -// The registered codec will be invoked when encoding/decoding a value whose type matches the registered type exactly. -// If the registered type is an interface, the codec will be invoked when encoding or decoding values whose type is the -// interface, but not for values with concrete types that implement the interface. -// -// 2. Hook encoders/decoders - These can be registered using the RegisterHookEncoder and RegisterHookDecoder methods. -// These methods only accept interface types and the registered codecs will be invoked when encoding or decoding values -// whose types implement the interface. An example of a hook defined by the driver is bson.Marshaler. The driver will -// call the MarshalBSON method for any value whose type implements bson.Marshaler, regardless of the value's concrete -// type. -// -// 3. Type map entries - This can be used to associate a BSON type with a Go type. These type associations are used when -// decoding into a bson.D/bson.M or a struct field of type interface{}. For example, by default, BSON int32 and int64 -// values decode as Go int32 and int64 instances, respectively, when decoding into a bson.D. The following code would -// change the behavior so these values decode as Go int instances instead: +// # Registry +// +// A Registry is a store for ValueEncoders, ValueDecoders, and a type map. See the Registry type +// documentation for examples of registering various custom encoders and decoders. A Registry can +// have three main types of codecs: +// +// 1. Type encoders/decoders - These can be registered using the RegisterTypeEncoder and +// RegisterTypeDecoder methods. The registered codec will be invoked when encoding/decoding a value +// whose type matches the registered type exactly. +// If the registered type is an interface, the codec will be invoked when encoding or decoding +// values whose type is the interface, but not for values with concrete types that implement the +// interface. +// +// 2. Hook encoders/decoders - These can be registered using the RegisterHookEncoder and +// RegisterHookDecoder methods. These methods only accept interface types and the registered codecs +// will be invoked when encoding or decoding values whose types implement the interface. An example +// of a hook defined by the driver is bson.Marshaler. The driver will call the MarshalBSON method +// for any value whose type implements bson.Marshaler, regardless of the value's concrete type. +// +// 3. Type map entries - This can be used to associate a BSON type with a Go type. These type +// associations are used when decoding into a bson.D/bson.M or a struct field of type interface{}. +// For example, by default, BSON int32 and int64 values decode as Go int32 and int64 instances, +// respectively, when decoding into a bson.D. The following code would change the behavior so these +// values decode as Go int instances instead: // // intType := reflect.TypeOf(int(0)) -// registryBuilder.RegisterTypeMapEntry(bsontype.Int32, intType).RegisterTypeMapEntry(bsontype.Int64, intType) +// registry.RegisterTypeMapEntry(bsontype.Int32, intType).RegisterTypeMapEntry(bsontype.Int64, intType) // -// 4. Kind encoder/decoders - These can be registered using the RegisterDefaultEncoder and RegisterDefaultDecoder -// methods. The registered codec will be invoked when encoding or decoding values whose reflect.Kind matches the -// registered reflect.Kind as long as the value's type doesn't match a registered type or hook encoder/decoder first. -// These methods should be used to change the behavior for all values for a specific kind. +// 4. Kind encoder/decoders - These can be registered using the RegisterDefaultEncoder and +// RegisterDefaultDecoder methods. The registered codec will be invoked when encoding or decoding +// values whose reflect.Kind matches the registered reflect.Kind as long as the value's type doesn't +// match a registered type or hook encoder/decoder first. These methods should be used to change the +// behavior for all values for a specific kind. // // # Registry Lookup Procedure // @@ -67,17 +71,18 @@ // // 1. A type encoder registered for the exact type of the value. // -// 2. A hook encoder registered for an interface that is implemented by the value or by a pointer to the value. If the -// value matches multiple hooks (e.g. the type implements bsoncodec.Marshaler and bsoncodec.ValueMarshaler), the first -// one registered will be selected. Note that registries constructed using bson.NewRegistryBuilder have driver-defined -// hooks registered for the bsoncodec.Marshaler, bsoncodec.ValueMarshaler, and bsoncodec.Proxy interfaces, so those -// will take precedence over any new hooks. +// 2. A hook encoder registered for an interface that is implemented by the value or by a pointer to +// the value. If the value matches multiple hooks (e.g. the type implements bsoncodec.Marshaler and +// bsoncodec.ValueMarshaler), the first one registered will be selected. Note that registries +// constructed using bson.NewRegistry have driver-defined hooks registered for the +// bsoncodec.Marshaler, bsoncodec.ValueMarshaler, and bsoncodec.Proxy interfaces, so those will take +// precedence over any new hooks. // // 3. A kind encoder registered for the value's kind. // -// If all of these lookups fail to find an encoder, an error of type ErrNoEncoder is returned. The same precedence -// rules apply for decoders, with the exception that an error of type ErrNoDecoder will be returned if no decoder is -// found. +// If all of these lookups fail to find an encoder, an error of type ErrNoEncoder is returned. The +// same precedence rules apply for decoders, with the exception that an error of type ErrNoDecoder +// will be returned if no decoder is found. // // # DefaultValueEncoders and DefaultValueDecoders // diff --git a/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/empty_interface_codec.go b/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/empty_interface_codec.go index eda417cff8..94f7dcf1eb 100644 --- a/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/empty_interface_codec.go +++ b/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/empty_interface_codec.go @@ -16,18 +16,30 @@ import ( ) // EmptyInterfaceCodec is the Codec used for interface{} values. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with the +// EmptyInterfaceCodec registered. type EmptyInterfaceCodec struct { + // DecodeBinaryAsSlice causes DecodeValue to unmarshal BSON binary field values that are the + // "Generic" or "Old" BSON binary subtype as a Go byte slice instead of a primitive.Binary. + // + // Deprecated: Use bson.Decoder.BinaryAsSlice instead. DecodeBinaryAsSlice bool } var ( defaultEmptyInterfaceCodec = NewEmptyInterfaceCodec() - _ ValueCodec = defaultEmptyInterfaceCodec + // Assert that defaultEmptyInterfaceCodec satisfies the typeDecoder interface, which allows it + // to be used by collection type decoders (e.g. map, slice, etc) to set individual values in a + // collection. _ typeDecoder = defaultEmptyInterfaceCodec ) // NewEmptyInterfaceCodec returns a EmptyInterfaceCodec with options opts. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with the +// EmptyInterfaceCodec registered. func NewEmptyInterfaceCodec(opts ...*bsonoptions.EmptyInterfaceCodecOptions) *EmptyInterfaceCodec { interfaceOpt := bsonoptions.MergeEmptyInterfaceCodecOptions(opts...) @@ -121,7 +133,7 @@ func (eic EmptyInterfaceCodec) decodeType(dc DecodeContext, vr bsonrw.ValueReade return emptyValue, err } - if eic.DecodeBinaryAsSlice && rtype == tBinary { + if (eic.DecodeBinaryAsSlice || dc.binaryAsSlice) && rtype == tBinary { binElem := elem.Interface().(primitive.Binary) if binElem.Subtype == bsontype.BinaryGeneric || binElem.Subtype == bsontype.BinaryBinaryOld { elem = reflect.ValueOf(binElem.Data) diff --git a/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/map_codec.go b/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/map_codec.go index e1fbef9c6c..325c1738ab 100644 --- a/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/map_codec.go +++ b/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/map_codec.go @@ -20,14 +20,29 @@ import ( var defaultMapCodec = NewMapCodec() // MapCodec is the Codec used for map values. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with the +// MapCodec registered. type MapCodec struct { - DecodeZerosMap bool - EncodeNilAsEmpty bool + // DecodeZerosMap causes DecodeValue to delete any existing values from Go maps in the destination + // value passed to Decode before unmarshaling BSON documents into them. + // + // Deprecated: Use bson.Decoder.ZeroMaps instead. + DecodeZerosMap bool + + // EncodeNilAsEmpty causes EncodeValue to marshal nil Go maps as empty BSON documents instead of + // BSON null. + // + // Deprecated: Use bson.Encoder.NilMapAsEmpty instead. + EncodeNilAsEmpty bool + + // EncodeKeysWithStringer causes the Encoder to convert Go map keys to BSON document field name + // strings using fmt.Sprintf() instead of the default string conversion logic. + // + // Deprecated: Use bson.Encoder.StringifyMapKeysWithFmt instead. EncodeKeysWithStringer bool } -var _ ValueCodec = &MapCodec{} - // KeyMarshaler is the interface implemented by an object that can marshal itself into a string key. // This applies to types used as map keys and is similar to encoding.TextMarshaler. type KeyMarshaler interface { @@ -45,6 +60,9 @@ type KeyUnmarshaler interface { } // NewMapCodec returns a MapCodec with options opts. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with the +// MapCodec registered. func NewMapCodec(opts ...*bsonoptions.MapCodecOptions) *MapCodec { mapOpt := bsonoptions.MergeMapCodecOptions(opts...) @@ -67,7 +85,7 @@ func (mc *MapCodec) EncodeValue(ec EncodeContext, vw bsonrw.ValueWriter, val ref return ValueEncoderError{Name: "MapEncodeValue", Kinds: []reflect.Kind{reflect.Map}, Received: val} } - if val.IsNil() && !mc.EncodeNilAsEmpty { + if val.IsNil() && !mc.EncodeNilAsEmpty && !ec.nilMapAsEmpty { // If we have a nil map but we can't WriteNull, that means we're probably trying to encode // to a TopLevel document. We can't currently tell if this is what actually happened, but if // there's a deeper underlying problem, the error will also be returned from WriteDocument, @@ -100,7 +118,7 @@ func (mc *MapCodec) mapEncodeValue(ec EncodeContext, dw bsonrw.DocumentWriter, v keys := val.MapKeys() for _, key := range keys { - keyStr, err := mc.encodeKey(key) + keyStr, err := mc.encodeKey(key, ec.stringifyMapKeysWithFmt) if err != nil { return err } @@ -163,7 +181,7 @@ func (mc *MapCodec) DecodeValue(dc DecodeContext, vr bsonrw.ValueReader, val ref val.Set(reflect.MakeMap(val.Type())) } - if val.Len() > 0 && mc.DecodeZerosMap { + if val.Len() > 0 && (mc.DecodeZerosMap || dc.zeroMaps) { clearMap(val) } @@ -211,8 +229,8 @@ func clearMap(m reflect.Value) { } } -func (mc *MapCodec) encodeKey(val reflect.Value) (string, error) { - if mc.EncodeKeysWithStringer { +func (mc *MapCodec) encodeKey(val reflect.Value, encodeKeysWithStringer bool) (string, error) { + if mc.EncodeKeysWithStringer || encodeKeysWithStringer { return fmt.Sprint(val), nil } diff --git a/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/pointer_codec.go b/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/pointer_codec.go index 616a3e701b..a1bf9c3e2b 100644 --- a/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/pointer_codec.go +++ b/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/pointer_codec.go @@ -18,6 +18,9 @@ var _ ValueEncoder = &PointerCodec{} var _ ValueDecoder = &PointerCodec{} // PointerCodec is the Codec used for pointers. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with the +// PointerCodec registered. type PointerCodec struct { ecache map[reflect.Type]ValueEncoder dcache map[reflect.Type]ValueDecoder @@ -25,6 +28,9 @@ type PointerCodec struct { } // NewPointerCodec returns a PointerCodec that has been initialized. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with the +// PointerCodec registered. func NewPointerCodec() *PointerCodec { return &PointerCodec{ ecache: make(map[reflect.Type]ValueEncoder), diff --git a/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/registry.go b/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/registry.go index 80644023c2..930de28490 100644 --- a/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/registry.go +++ b/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/registry.go @@ -16,12 +16,18 @@ import ( ) // ErrNilType is returned when nil is passed to either LookupEncoder or LookupDecoder. +// +// Deprecated: ErrNilType will not be supported in Go Driver 2.0. var ErrNilType = errors.New("cannot perform a decoder lookup on ") // ErrNotPointer is returned when a non-pointer type is provided to LookupDecoder. +// +// Deprecated: ErrNotPointer will not be supported in Go Driver 2.0. var ErrNotPointer = errors.New("non-pointer provided to LookupDecoder") // ErrNoEncoder is returned when there wasn't an encoder available for a type. +// +// Deprecated: ErrNoEncoder will not be supported in Go Driver 2.0. type ErrNoEncoder struct { Type reflect.Type } @@ -34,6 +40,8 @@ func (ene ErrNoEncoder) Error() string { } // ErrNoDecoder is returned when there wasn't a decoder available for a type. +// +// Deprecated: ErrNoDecoder will not be supported in Go Driver 2.0. type ErrNoDecoder struct { Type reflect.Type } @@ -43,6 +51,8 @@ func (end ErrNoDecoder) Error() string { } // ErrNoTypeMapEntry is returned when there wasn't a type available for the provided BSON type. +// +// Deprecated: ErrNoTypeMapEntry will not be supported in Go Driver 2.0. type ErrNoTypeMapEntry struct { Type bsontype.Type } @@ -52,63 +62,30 @@ func (entme ErrNoTypeMapEntry) Error() string { } // ErrNotInterface is returned when the provided type is not an interface. +// +// Deprecated: ErrNotInterface will not be supported in Go Driver 2.0. var ErrNotInterface = errors.New("The provided type is not an interface") // A RegistryBuilder is used to build a Registry. This type is not goroutine // safe. +// +// Deprecated: Use Registry instead. type RegistryBuilder struct { - typeEncoders map[reflect.Type]ValueEncoder - interfaceEncoders []interfaceValueEncoder - kindEncoders map[reflect.Kind]ValueEncoder - - typeDecoders map[reflect.Type]ValueDecoder - interfaceDecoders []interfaceValueDecoder - kindDecoders map[reflect.Kind]ValueDecoder - - typeMap map[bsontype.Type]reflect.Type -} - -// A Registry is used to store and retrieve codecs for types and interfaces. This type is the main -// typed passed around and Encoders and Decoders are constructed from it. -type Registry struct { - typeEncoders map[reflect.Type]ValueEncoder - typeDecoders map[reflect.Type]ValueDecoder - - interfaceEncoders []interfaceValueEncoder - interfaceDecoders []interfaceValueDecoder - - kindEncoders map[reflect.Kind]ValueEncoder - kindDecoders map[reflect.Kind]ValueDecoder - - typeMap map[bsontype.Type]reflect.Type - - mu sync.RWMutex + registry *Registry } // NewRegistryBuilder creates a new empty RegistryBuilder. +// +// Deprecated: Use NewRegistry instead. func NewRegistryBuilder() *RegistryBuilder { return &RegistryBuilder{ - typeEncoders: make(map[reflect.Type]ValueEncoder), - typeDecoders: make(map[reflect.Type]ValueDecoder), - - interfaceEncoders: make([]interfaceValueEncoder, 0), - interfaceDecoders: make([]interfaceValueDecoder, 0), - - kindEncoders: make(map[reflect.Kind]ValueEncoder), - kindDecoders: make(map[reflect.Kind]ValueDecoder), - - typeMap: make(map[bsontype.Type]reflect.Type), + registry: NewRegistry(), } } -func buildDefaultRegistry() *Registry { - rb := NewRegistryBuilder() - defaultValueEncoders.RegisterDefaultEncoders(rb) - defaultValueDecoders.RegisterDefaultDecoders(rb) - return rb.Build() -} - // RegisterCodec will register the provided ValueCodec for the provided type. +// +// Deprecated: Use Registry.RegisterTypeEncoder and Registry.RegisterTypeDecoder instead. func (rb *RegistryBuilder) RegisterCodec(t reflect.Type, codec ValueCodec) *RegistryBuilder { rb.RegisterTypeEncoder(t, codec) rb.RegisterTypeDecoder(t, codec) @@ -120,31 +97,22 @@ func (rb *RegistryBuilder) RegisterCodec(t reflect.Type, codec ValueCodec) *Regi // The type will be used directly, so an encoder can be registered for a type and a different encoder can be registered // for a pointer to that type. // -// If the given type is an interface, the encoder will be called when marshalling a type that is that interface. It -// will not be called when marshalling a non-interface type that implements the interface. +// If the given type is an interface, the encoder will be called when marshaling a type that is that interface. It +// will not be called when marshaling a non-interface type that implements the interface. +// +// Deprecated: Use Registry.RegisterTypeEncoder instead. func (rb *RegistryBuilder) RegisterTypeEncoder(t reflect.Type, enc ValueEncoder) *RegistryBuilder { - rb.typeEncoders[t] = enc + rb.registry.RegisterTypeEncoder(t, enc) return rb } // RegisterHookEncoder will register an encoder for the provided interface type t. This encoder will be called when -// marshalling a type if the type implements t or a pointer to the type implements t. If the provided type is not +// marshaling a type if the type implements t or a pointer to the type implements t. If the provided type is not // an interface (i.e. t.Kind() != reflect.Interface), this method will panic. +// +// Deprecated: Use Registry.RegisterInterfaceEncoder instead. func (rb *RegistryBuilder) RegisterHookEncoder(t reflect.Type, enc ValueEncoder) *RegistryBuilder { - if t.Kind() != reflect.Interface { - panicStr := fmt.Sprintf("RegisterHookEncoder expects a type with kind reflect.Interface, "+ - "got type %s with kind %s", t, t.Kind()) - panic(panicStr) - } - - for idx, encoder := range rb.interfaceEncoders { - if encoder.i == t { - rb.interfaceEncoders[idx].ve = enc - return rb - } - } - - rb.interfaceEncoders = append(rb.interfaceEncoders, interfaceValueEncoder{i: t, ve: enc}) + rb.registry.RegisterInterfaceEncoder(t, enc) return rb } @@ -153,97 +121,78 @@ func (rb *RegistryBuilder) RegisterHookEncoder(t reflect.Type, enc ValueEncoder) // The type will be used directly, so a decoder can be registered for a type and a different decoder can be registered // for a pointer to that type. // -// If the given type is an interface, the decoder will be called when unmarshalling into a type that is that interface. -// It will not be called when unmarshalling into a non-interface type that implements the interface. +// If the given type is an interface, the decoder will be called when unmarshaling into a type that is that interface. +// It will not be called when unmarshaling into a non-interface type that implements the interface. +// +// Deprecated: Use Registry.RegisterTypeDecoder instead. func (rb *RegistryBuilder) RegisterTypeDecoder(t reflect.Type, dec ValueDecoder) *RegistryBuilder { - rb.typeDecoders[t] = dec + rb.registry.RegisterTypeDecoder(t, dec) return rb } // RegisterHookDecoder will register an decoder for the provided interface type t. This decoder will be called when -// unmarshalling into a type if the type implements t or a pointer to the type implements t. If the provided type is not +// unmarshaling into a type if the type implements t or a pointer to the type implements t. If the provided type is not // an interface (i.e. t.Kind() != reflect.Interface), this method will panic. +// +// Deprecated: Use Registry.RegisterInterfaceDecoder instead. func (rb *RegistryBuilder) RegisterHookDecoder(t reflect.Type, dec ValueDecoder) *RegistryBuilder { - if t.Kind() != reflect.Interface { - panicStr := fmt.Sprintf("RegisterHookDecoder expects a type with kind reflect.Interface, "+ - "got type %s with kind %s", t, t.Kind()) - panic(panicStr) - } - - for idx, decoder := range rb.interfaceDecoders { - if decoder.i == t { - rb.interfaceDecoders[idx].vd = dec - return rb - } - } - - rb.interfaceDecoders = append(rb.interfaceDecoders, interfaceValueDecoder{i: t, vd: dec}) + rb.registry.RegisterInterfaceDecoder(t, dec) return rb } // RegisterEncoder registers the provided type and encoder pair. // -// Deprecated: Use RegisterTypeEncoder or RegisterHookEncoder instead. +// Deprecated: Use Registry.RegisterTypeEncoder or Registry.RegisterInterfaceEncoder instead. func (rb *RegistryBuilder) RegisterEncoder(t reflect.Type, enc ValueEncoder) *RegistryBuilder { if t == tEmpty { - rb.typeEncoders[t] = enc + rb.registry.RegisterTypeEncoder(t, enc) return rb } switch t.Kind() { case reflect.Interface: - for idx, ir := range rb.interfaceEncoders { - if ir.i == t { - rb.interfaceEncoders[idx].ve = enc - return rb - } - } - - rb.interfaceEncoders = append(rb.interfaceEncoders, interfaceValueEncoder{i: t, ve: enc}) + rb.registry.RegisterInterfaceEncoder(t, enc) default: - rb.typeEncoders[t] = enc + rb.registry.RegisterTypeEncoder(t, enc) } return rb } // RegisterDecoder registers the provided type and decoder pair. // -// Deprecated: Use RegisterTypeDecoder or RegisterHookDecoder instead. +// Deprecated: Use Registry.RegisterTypeDecoder or Registry.RegisterInterfaceDecoder instead. func (rb *RegistryBuilder) RegisterDecoder(t reflect.Type, dec ValueDecoder) *RegistryBuilder { if t == nil { - rb.typeDecoders[nil] = dec + rb.registry.RegisterTypeDecoder(t, dec) return rb } if t == tEmpty { - rb.typeDecoders[t] = dec + rb.registry.RegisterTypeDecoder(t, dec) return rb } switch t.Kind() { case reflect.Interface: - for idx, ir := range rb.interfaceDecoders { - if ir.i == t { - rb.interfaceDecoders[idx].vd = dec - return rb - } - } - - rb.interfaceDecoders = append(rb.interfaceDecoders, interfaceValueDecoder{i: t, vd: dec}) + rb.registry.RegisterInterfaceDecoder(t, dec) default: - rb.typeDecoders[t] = dec + rb.registry.RegisterTypeDecoder(t, dec) } return rb } -// RegisterDefaultEncoder will registr the provided ValueEncoder to the provided +// RegisterDefaultEncoder will register the provided ValueEncoder to the provided // kind. +// +// Deprecated: Use Registry.RegisterKindEncoder instead. func (rb *RegistryBuilder) RegisterDefaultEncoder(kind reflect.Kind, enc ValueEncoder) *RegistryBuilder { - rb.kindEncoders[kind] = enc + rb.registry.RegisterKindEncoder(kind, enc) return rb } // RegisterDefaultDecoder will register the provided ValueDecoder to the // provided kind. +// +// Deprecated: Use Registry.RegisterKindDecoder instead. func (rb *RegistryBuilder) RegisterDefaultDecoder(kind reflect.Kind, dec ValueDecoder) *RegistryBuilder { - rb.kindDecoders[kind] = dec + rb.registry.RegisterKindDecoder(kind, dec) return rb } @@ -256,120 +205,277 @@ func (rb *RegistryBuilder) RegisterDefaultDecoder(kind reflect.Kind, dec ValueDe // to decode to bson.Raw, use the following code: // // rb.RegisterTypeMapEntry(bsontype.EmbeddedDocument, reflect.TypeOf(bson.Raw{})) +// +// Deprecated: Use Registry.RegisterTypeMapEntry instead. func (rb *RegistryBuilder) RegisterTypeMapEntry(bt bsontype.Type, rt reflect.Type) *RegistryBuilder { - rb.typeMap[bt] = rt + rb.registry.RegisterTypeMapEntry(bt, rt) return rb } // Build creates a Registry from the current state of this RegistryBuilder. +// +// Deprecated: Use NewRegistry instead. func (rb *RegistryBuilder) Build() *Registry { registry := new(Registry) - registry.typeEncoders = make(map[reflect.Type]ValueEncoder) - for t, enc := range rb.typeEncoders { + registry.typeEncoders = make(map[reflect.Type]ValueEncoder, len(rb.registry.typeEncoders)) + for t, enc := range rb.registry.typeEncoders { registry.typeEncoders[t] = enc } - registry.typeDecoders = make(map[reflect.Type]ValueDecoder) - for t, dec := range rb.typeDecoders { + registry.typeDecoders = make(map[reflect.Type]ValueDecoder, len(rb.registry.typeDecoders)) + for t, dec := range rb.registry.typeDecoders { registry.typeDecoders[t] = dec } - registry.interfaceEncoders = make([]interfaceValueEncoder, len(rb.interfaceEncoders)) - copy(registry.interfaceEncoders, rb.interfaceEncoders) + registry.interfaceEncoders = make([]interfaceValueEncoder, len(rb.registry.interfaceEncoders)) + copy(registry.interfaceEncoders, rb.registry.interfaceEncoders) - registry.interfaceDecoders = make([]interfaceValueDecoder, len(rb.interfaceDecoders)) - copy(registry.interfaceDecoders, rb.interfaceDecoders) + registry.interfaceDecoders = make([]interfaceValueDecoder, len(rb.registry.interfaceDecoders)) + copy(registry.interfaceDecoders, rb.registry.interfaceDecoders) registry.kindEncoders = make(map[reflect.Kind]ValueEncoder) - for kind, enc := range rb.kindEncoders { + for kind, enc := range rb.registry.kindEncoders { registry.kindEncoders[kind] = enc } registry.kindDecoders = make(map[reflect.Kind]ValueDecoder) - for kind, dec := range rb.kindDecoders { + for kind, dec := range rb.registry.kindDecoders { registry.kindDecoders[kind] = dec } registry.typeMap = make(map[bsontype.Type]reflect.Type) - for bt, rt := range rb.typeMap { + for bt, rt := range rb.registry.typeMap { registry.typeMap[bt] = rt } return registry } -// LookupEncoder inspects the registry for an encoder for the given type. The lookup precedence works as follows: +// A Registry is used to store and retrieve codecs for types and interfaces. This type is the main +// typed passed around and Encoders and Decoders are constructed from it. +type Registry struct { + typeEncoders map[reflect.Type]ValueEncoder + typeDecoders map[reflect.Type]ValueDecoder + + interfaceEncoders []interfaceValueEncoder + interfaceDecoders []interfaceValueDecoder + + kindEncoders map[reflect.Kind]ValueEncoder + kindDecoders map[reflect.Kind]ValueDecoder + + typeMap map[bsontype.Type]reflect.Type + + mu sync.RWMutex +} + +// NewRegistry creates a new empty Registry. +func NewRegistry() *Registry { + return &Registry{ + typeEncoders: make(map[reflect.Type]ValueEncoder), + typeDecoders: make(map[reflect.Type]ValueDecoder), + + interfaceEncoders: make([]interfaceValueEncoder, 0), + interfaceDecoders: make([]interfaceValueDecoder, 0), + + kindEncoders: make(map[reflect.Kind]ValueEncoder), + kindDecoders: make(map[reflect.Kind]ValueDecoder), + + typeMap: make(map[bsontype.Type]reflect.Type), + } +} + +// RegisterTypeEncoder registers the provided ValueEncoder for the provided type. +// +// The type will be used as provided, so an encoder can be registered for a type and a different +// encoder can be registered for a pointer to that type. +// +// If the given type is an interface, the encoder will be called when marshaling a type that is +// that interface. It will not be called when marshaling a non-interface type that implements the +// interface. To get the latter behavior, call RegisterHookEncoder instead. +// +// RegisterTypeEncoder should not be called concurrently with any other Registry method. +func (r *Registry) RegisterTypeEncoder(valueType reflect.Type, enc ValueEncoder) { + r.typeEncoders[valueType] = enc +} + +// RegisterTypeDecoder registers the provided ValueDecoder for the provided type. +// +// The type will be used as provided, so a decoder can be registered for a type and a different +// decoder can be registered for a pointer to that type. +// +// If the given type is an interface, the decoder will be called when unmarshaling into a type that +// is that interface. It will not be called when unmarshaling into a non-interface type that +// implements the interface. To get the latter behavior, call RegisterHookDecoder instead. +// +// RegisterTypeDecoder should not be called concurrently with any other Registry method. +func (r *Registry) RegisterTypeDecoder(valueType reflect.Type, dec ValueDecoder) { + r.typeDecoders[valueType] = dec +} + +// RegisterKindEncoder registers the provided ValueEncoder for the provided kind. +// +// Use RegisterKindEncoder to register an encoder for any type with the same underlying kind. For +// example, consider the type MyInt defined as +// +// type MyInt int32 +// +// To define an encoder for MyInt and int32, use RegisterKindEncoder like +// +// reg.RegisterKindEncoder(reflect.Int32, myEncoder) +// +// RegisterKindEncoder should not be called concurrently with any other Registry method. +func (r *Registry) RegisterKindEncoder(kind reflect.Kind, enc ValueEncoder) { + r.kindEncoders[kind] = enc +} + +// RegisterKindDecoder registers the provided ValueDecoder for the provided kind. +// +// Use RegisterKindDecoder to register a decoder for any type with the same underlying kind. For +// example, consider the type MyInt defined as // -// 1. An encoder registered for the exact type. If the given type represents an interface, an encoder registered using -// RegisterTypeEncoder for the interface will be selected. +// type MyInt int32 // -// 2. An encoder registered using RegisterHookEncoder for an interface implemented by the type or by a pointer to the -// type. +// To define an decoder for MyInt and int32, use RegisterKindDecoder like // -// 3. An encoder registered for the reflect.Kind of the value. +// reg.RegisterKindDecoder(reflect.Int32, myDecoder) // -// If no encoder is found, an error of type ErrNoEncoder is returned. -func (r *Registry) LookupEncoder(t reflect.Type) (ValueEncoder, error) { - encodererr := ErrNoEncoder{Type: t} +// RegisterKindDecoder should not be called concurrently with any other Registry method. +func (r *Registry) RegisterKindDecoder(kind reflect.Kind, dec ValueDecoder) { + r.kindDecoders[kind] = dec +} + +// RegisterInterfaceEncoder registers an encoder for the provided interface type iface. This encoder will +// be called when marshaling a type if the type implements iface or a pointer to the type +// implements iface. If the provided type is not an interface +// (i.e. iface.Kind() != reflect.Interface), this method will panic. +// +// RegisterInterfaceEncoder should not be called concurrently with any other Registry method. +func (r *Registry) RegisterInterfaceEncoder(iface reflect.Type, enc ValueEncoder) { + if iface.Kind() != reflect.Interface { + panicStr := fmt.Errorf("RegisterInterfaceEncoder expects a type with kind reflect.Interface, "+ + "got type %s with kind %s", iface, iface.Kind()) + panic(panicStr) + } + + for idx, encoder := range r.interfaceEncoders { + if encoder.i == iface { + r.interfaceEncoders[idx].ve = enc + return + } + } + + r.interfaceEncoders = append(r.interfaceEncoders, interfaceValueEncoder{i: iface, ve: enc}) +} + +// RegisterInterfaceDecoder registers an decoder for the provided interface type iface. This decoder will +// be called when unmarshaling into a type if the type implements iface or a pointer to the type +// implements iface. If the provided type is not an interface (i.e. iface.Kind() != reflect.Interface), +// this method will panic. +// +// RegisterInterfaceDecoder should not be called concurrently with any other Registry method. +func (r *Registry) RegisterInterfaceDecoder(iface reflect.Type, dec ValueDecoder) { + if iface.Kind() != reflect.Interface { + panicStr := fmt.Errorf("RegisterInterfaceDecoder expects a type with kind reflect.Interface, "+ + "got type %s with kind %s", iface, iface.Kind()) + panic(panicStr) + } + + for idx, decoder := range r.interfaceDecoders { + if decoder.i == iface { + r.interfaceDecoders[idx].vd = dec + return + } + } + + r.interfaceDecoders = append(r.interfaceDecoders, interfaceValueDecoder{i: iface, vd: dec}) +} + +// RegisterTypeMapEntry will register the provided type to the BSON type. The primary usage for this +// mapping is decoding situations where an empty interface is used and a default type needs to be +// created and decoded into. +// +// By default, BSON documents will decode into interface{} values as bson.D. To change the default type for BSON +// documents, a type map entry for bsontype.EmbeddedDocument should be registered. For example, to force BSON documents +// to decode to bson.Raw, use the following code: +// +// reg.RegisterTypeMapEntry(bsontype.EmbeddedDocument, reflect.TypeOf(bson.Raw{})) +func (r *Registry) RegisterTypeMapEntry(bt bsontype.Type, rt reflect.Type) { + r.typeMap[bt] = rt +} + +// LookupEncoder returns the first matching encoder in the Registry. It uses the following lookup +// order: +// +// 1. An encoder registered for the exact type. If the given type is an interface, an encoder +// registered using RegisterTypeEncoder for that interface will be selected. +// +// 2. An encoder registered using RegisterInterfaceEncoder for an interface implemented by the type +// or by a pointer to the type. +// +// 3. An encoder registered using RegisterKindEncoder for the kind of value. +// +// If no encoder is found, an error of type ErrNoEncoder is returned. LookupEncoder is safe for +// concurrent use by multiple goroutines after all codecs and encoders are registered. +func (r *Registry) LookupEncoder(valueType reflect.Type) (ValueEncoder, error) { r.mu.RLock() - enc, found := r.lookupTypeEncoder(t) + enc, found := r.lookupTypeEncoder(valueType) r.mu.RUnlock() if found { if enc == nil { - return nil, ErrNoEncoder{Type: t} + return nil, ErrNoEncoder{Type: valueType} } return enc, nil } - enc, found = r.lookupInterfaceEncoder(t, true) + enc, found = r.lookupInterfaceEncoder(valueType, true) if found { r.mu.Lock() - r.typeEncoders[t] = enc + r.typeEncoders[valueType] = enc r.mu.Unlock() return enc, nil } - if t == nil { + if valueType == nil { r.mu.Lock() - r.typeEncoders[t] = nil + r.typeEncoders[valueType] = nil r.mu.Unlock() - return nil, encodererr + return nil, ErrNoEncoder{Type: valueType} } - enc, found = r.kindEncoders[t.Kind()] + enc, found = r.kindEncoders[valueType.Kind()] if !found { r.mu.Lock() - r.typeEncoders[t] = nil + r.typeEncoders[valueType] = nil r.mu.Unlock() - return nil, encodererr + return nil, ErrNoEncoder{Type: valueType} } r.mu.Lock() - r.typeEncoders[t] = enc + r.typeEncoders[valueType] = enc r.mu.Unlock() return enc, nil } -func (r *Registry) lookupTypeEncoder(t reflect.Type) (ValueEncoder, bool) { - enc, found := r.typeEncoders[t] +func (r *Registry) lookupTypeEncoder(valueType reflect.Type) (ValueEncoder, bool) { + enc, found := r.typeEncoders[valueType] return enc, found } -func (r *Registry) lookupInterfaceEncoder(t reflect.Type, allowAddr bool) (ValueEncoder, bool) { - if t == nil { +func (r *Registry) lookupInterfaceEncoder(valueType reflect.Type, allowAddr bool) (ValueEncoder, bool) { + if valueType == nil { return nil, false } for _, ienc := range r.interfaceEncoders { - if t.Implements(ienc.i) { + if valueType.Implements(ienc.i) { return ienc.ve, true } - if allowAddr && t.Kind() != reflect.Ptr && reflect.PtrTo(t).Implements(ienc.i) { - // if *t implements an interface, this will catch if t implements an interface further ahead - // in interfaceEncoders - defaultEnc, found := r.lookupInterfaceEncoder(t, false) + if allowAddr && valueType.Kind() != reflect.Ptr && reflect.PtrTo(valueType).Implements(ienc.i) { + // if *t implements an interface, this will catch if t implements an interface further + // ahead in interfaceEncoders + defaultEnc, found := r.lookupInterfaceEncoder(valueType, false) if !found { - defaultEnc = r.kindEncoders[t.Kind()] + defaultEnc = r.kindEncoders[valueType.Kind()] } return newCondAddrEncoder(ienc.ve, defaultEnc), true } @@ -377,70 +483,72 @@ func (r *Registry) lookupInterfaceEncoder(t reflect.Type, allowAddr bool) (Value return nil, false } -// LookupDecoder inspects the registry for an decoder for the given type. The lookup precedence works as follows: +// LookupDecoder returns the first matching decoder in the Registry. It uses the following lookup +// order: // -// 1. A decoder registered for the exact type. If the given type represents an interface, a decoder registered using -// RegisterTypeDecoder for the interface will be selected. +// 1. A decoder registered for the exact type. If the given type is an interface, a decoder +// registered using RegisterTypeDecoder for that interface will be selected. // -// 2. A decoder registered using RegisterHookDecoder for an interface implemented by the type or by a pointer to the -// type. +// 2. A decoder registered using RegisterInterfaceDecoder for an interface implemented by the type or by +// a pointer to the type. // -// 3. A decoder registered for the reflect.Kind of the value. +// 3. A decoder registered using RegisterKindDecoder for the kind of value. // -// If no decoder is found, an error of type ErrNoDecoder is returned. -func (r *Registry) LookupDecoder(t reflect.Type) (ValueDecoder, error) { - if t == nil { +// If no decoder is found, an error of type ErrNoDecoder is returned. LookupDecoder is safe for +// concurrent use by multiple goroutines after all codecs and decoders are registered. +func (r *Registry) LookupDecoder(valueType reflect.Type) (ValueDecoder, error) { + if valueType == nil { return nil, ErrNilType } - decodererr := ErrNoDecoder{Type: t} + decodererr := ErrNoDecoder{Type: valueType} r.mu.RLock() - dec, found := r.lookupTypeDecoder(t) + dec, found := r.lookupTypeDecoder(valueType) r.mu.RUnlock() if found { if dec == nil { - return nil, ErrNoDecoder{Type: t} + return nil, ErrNoDecoder{Type: valueType} } return dec, nil } - dec, found = r.lookupInterfaceDecoder(t, true) + dec, found = r.lookupInterfaceDecoder(valueType, true) if found { r.mu.Lock() - r.typeDecoders[t] = dec + r.typeDecoders[valueType] = dec r.mu.Unlock() return dec, nil } - dec, found = r.kindDecoders[t.Kind()] + dec, found = r.kindDecoders[valueType.Kind()] if !found { r.mu.Lock() - r.typeDecoders[t] = nil + r.typeDecoders[valueType] = nil r.mu.Unlock() return nil, decodererr } r.mu.Lock() - r.typeDecoders[t] = dec + r.typeDecoders[valueType] = dec r.mu.Unlock() return dec, nil } -func (r *Registry) lookupTypeDecoder(t reflect.Type) (ValueDecoder, bool) { - dec, found := r.typeDecoders[t] +func (r *Registry) lookupTypeDecoder(valueType reflect.Type) (ValueDecoder, bool) { + dec, found := r.typeDecoders[valueType] return dec, found } -func (r *Registry) lookupInterfaceDecoder(t reflect.Type, allowAddr bool) (ValueDecoder, bool) { +func (r *Registry) lookupInterfaceDecoder(valueType reflect.Type, allowAddr bool) (ValueDecoder, bool) { for _, idec := range r.interfaceDecoders { - if t.Implements(idec.i) { + if valueType.Implements(idec.i) { return idec.vd, true } - if allowAddr && t.Kind() != reflect.Ptr && reflect.PtrTo(t).Implements(idec.i) { - // if *t implements an interface, this will catch if t implements an interface further ahead - // in interfaceDecoders - defaultDec, found := r.lookupInterfaceDecoder(t, false) + if allowAddr && valueType.Kind() != reflect.Ptr && reflect.PtrTo(valueType).Implements(idec.i) { + // if *t implements an interface, this will catch if t implements an interface further + // ahead in interfaceDecoders + defaultDec, found := r.lookupInterfaceDecoder(valueType, false) if !found { - defaultDec = r.kindDecoders[t.Kind()] + defaultDec = r.kindDecoders[valueType.Kind()] } return newCondAddrDecoder(idec.vd, defaultDec), true } @@ -450,6 +558,8 @@ func (r *Registry) lookupInterfaceDecoder(t reflect.Type, allowAddr bool) (Value // LookupTypeMapEntry inspects the registry's type map for a Go type for the corresponding BSON // type. If no type is found, ErrNoTypeMapEntry is returned. +// +// LookupTypeMapEntry should not be called concurrently with any other Registry method. func (r *Registry) LookupTypeMapEntry(bt bsontype.Type) (reflect.Type, error) { t, ok := r.typeMap[bt] if !ok || t == nil { diff --git a/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/slice_codec.go b/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/slice_codec.go index 3c1b6b860a..20c3e7549c 100644 --- a/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/slice_codec.go +++ b/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/slice_codec.go @@ -19,13 +19,21 @@ import ( var defaultSliceCodec = NewSliceCodec() // SliceCodec is the Codec used for slice values. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with the +// SliceCodec registered. type SliceCodec struct { + // EncodeNilAsEmpty causes EncodeValue to marshal nil Go slices as empty BSON arrays instead of + // BSON null. + // + // Deprecated: Use bson.Encoder.NilSliceAsEmpty instead. EncodeNilAsEmpty bool } -var _ ValueCodec = &MapCodec{} - // NewSliceCodec returns a MapCodec with options opts. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with the +// SliceCodec registered. func NewSliceCodec(opts ...*bsonoptions.SliceCodecOptions) *SliceCodec { sliceOpt := bsonoptions.MergeSliceCodecOptions(opts...) @@ -42,16 +50,14 @@ func (sc SliceCodec) EncodeValue(ec EncodeContext, vw bsonrw.ValueWriter, val re return ValueEncoderError{Name: "SliceEncodeValue", Kinds: []reflect.Kind{reflect.Slice}, Received: val} } - if val.IsNil() && !sc.EncodeNilAsEmpty { + if val.IsNil() && !sc.EncodeNilAsEmpty && !ec.nilSliceAsEmpty { return vw.WriteNull() } // If we have a []byte we want to treat it as a binary instead of as an array. if val.Type().Elem() == tByte { - var byteSlice []byte - for idx := 0; idx < val.Len(); idx++ { - byteSlice = append(byteSlice, val.Index(idx).Interface().(byte)) - } + byteSlice := make([]byte, val.Len()) + reflect.Copy(reflect.ValueOf(byteSlice), val) return vw.WriteBinary(byteSlice) } @@ -145,11 +151,8 @@ func (sc *SliceCodec) DecodeValue(dc DecodeContext, vr bsonrw.ValueReader, val r if val.IsNil() { val.Set(reflect.MakeSlice(val.Type(), 0, len(data))) } - val.SetLen(0) - for _, elem := range data { - val.Set(reflect.Append(val, reflect.ValueOf(elem))) - } + val.Set(reflect.AppendSlice(val, reflect.ValueOf(data))) return nil case bsontype.String: if sliceType := val.Type().Elem(); sliceType != tByte { @@ -164,11 +167,8 @@ func (sc *SliceCodec) DecodeValue(dc DecodeContext, vr bsonrw.ValueReader, val r if val.IsNil() { val.Set(reflect.MakeSlice(val.Type(), 0, len(byteStr))) } - val.SetLen(0) - for _, elem := range byteStr { - val.Set(reflect.Append(val, reflect.ValueOf(elem))) - } + val.Set(reflect.AppendSlice(val, reflect.ValueOf(byteStr))) return nil default: return fmt.Errorf("cannot decode %v into a slice", vrType) diff --git a/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/string_codec.go b/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/string_codec.go index 5332b7c3b5..ff931b7253 100644 --- a/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/string_codec.go +++ b/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/string_codec.go @@ -15,26 +15,38 @@ import ( "go.mongodb.org/mongo-driver/bson/bsontype" ) -// StringCodec is the Codec used for struct values. +// StringCodec is the Codec used for string values. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with the +// StringCodec registered. type StringCodec struct { + // DecodeObjectIDAsHex specifies if object IDs should be decoded as their hex representation. + // If false, a string made from the raw object ID bytes will be used. Defaults to true. + // + // Deprecated: Decoding object IDs as raw bytes will not be supported in Go Driver 2.0. DecodeObjectIDAsHex bool } var ( defaultStringCodec = NewStringCodec() - _ ValueCodec = defaultStringCodec + // Assert that defaultStringCodec satisfies the typeDecoder interface, which allows it to be + // used by collection type decoders (e.g. map, slice, etc) to set individual values in a + // collection. _ typeDecoder = defaultStringCodec ) // NewStringCodec returns a StringCodec with options opts. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with the +// StringCodec registered. func NewStringCodec(opts ...*bsonoptions.StringCodecOptions) *StringCodec { stringOpt := bsonoptions.MergeStringCodecOptions(opts...) return &StringCodec{*stringOpt.DecodeObjectIDAsHex} } // EncodeValue is the ValueEncoder for string types. -func (sc *StringCodec) EncodeValue(ectx EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { +func (sc *StringCodec) EncodeValue(_ EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { if val.Kind() != reflect.String { return ValueEncoderError{ Name: "StringEncodeValue", @@ -46,7 +58,7 @@ func (sc *StringCodec) EncodeValue(ectx EncodeContext, vw bsonrw.ValueWriter, va return vw.WriteString(val.String()) } -func (sc *StringCodec) decodeType(dc DecodeContext, vr bsonrw.ValueReader, t reflect.Type) (reflect.Value, error) { +func (sc *StringCodec) decodeType(_ DecodeContext, vr bsonrw.ValueReader, t reflect.Type) (reflect.Value, error) { if t.Kind() != reflect.String { return emptyValue, ValueDecoderError{ Name: "StringDecodeValue", @@ -71,6 +83,7 @@ func (sc *StringCodec) decodeType(dc DecodeContext, vr bsonrw.ValueReader, t ref if sc.DecodeObjectIDAsHex { str = oid.Hex() } else { + // TODO(GODRIVER-2796): Return an error here instead of decoding to a garbled string. byteArray := [12]byte(oid) str = string(byteArray[:]) } diff --git a/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/struct_codec.go b/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/struct_codec.go index da1ae18e02..1dfdd98865 100644 --- a/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/struct_codec.go +++ b/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/struct_codec.go @@ -59,14 +59,44 @@ type Zeroer interface { } // StructCodec is the Codec used for struct values. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with the +// StructCodec registered. type StructCodec struct { - cache map[reflect.Type]*structDescription - l sync.RWMutex - parser StructTagParser - DecodeZeroStruct bool - DecodeDeepZeroInline bool - EncodeOmitDefaultStruct bool - AllowUnexportedFields bool + cache map[reflect.Type]*structDescription + l sync.RWMutex + parser StructTagParser + + // DecodeZeroStruct causes DecodeValue to delete any existing values from Go structs in the + // destination value passed to Decode before unmarshaling BSON documents into them. + // + // Deprecated: Use bson.Decoder.ZeroStructs instead. + DecodeZeroStruct bool + + // DecodeDeepZeroInline causes DecodeValue to delete any existing values from Go structs in the + // destination value passed to Decode before unmarshaling BSON documents into them. + // + // Deprecated: DecodeDeepZeroInline will not be supported in Go Driver 2.0. + DecodeDeepZeroInline bool + + // EncodeOmitDefaultStruct causes the Encoder to consider the zero value for a struct (e.g. + // MyStruct{}) as empty and omit it from the marshaled BSON when the "omitempty" struct tag + // option is set. + // + // Deprecated: Use bson.Encoder.OmitZeroStruct instead. + EncodeOmitDefaultStruct bool + + // AllowUnexportedFields allows encoding and decoding values from un-exported struct fields. + // + // Deprecated: AllowUnexportedFields does not work on recent versions of Go and will not be + // supported in Go Driver 2.0. + AllowUnexportedFields bool + + // OverwriteDuplicatedInlinedFields, if false, causes EncodeValue to return an error if there is + // a duplicate field in the marshaled BSON when the "inline" struct tag option is set. The + // default value is true. + // + // Deprecated: Use bson.Encoder.ErrorOnInlineDuplicates instead. OverwriteDuplicatedInlinedFields bool } @@ -74,6 +104,9 @@ var _ ValueEncoder = &StructCodec{} var _ ValueDecoder = &StructCodec{} // NewStructCodec returns a StructCodec that uses p for struct tag parsing. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with the +// StructCodec registered. func NewStructCodec(p StructTagParser, opts ...*bsonoptions.StructCodecOptions) (*StructCodec, error) { if p == nil { return nil, errors.New("a StructTagParser must be provided to NewStructCodec") @@ -106,12 +139,12 @@ func NewStructCodec(p StructTagParser, opts ...*bsonoptions.StructCodecOptions) } // EncodeValue handles encoding generic struct types. -func (sc *StructCodec) EncodeValue(r EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { +func (sc *StructCodec) EncodeValue(ec EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { if !val.IsValid() || val.Kind() != reflect.Struct { return ValueEncoderError{Name: "StructCodec.EncodeValue", Kinds: []reflect.Kind{reflect.Struct}, Received: val} } - sd, err := sc.describeStruct(r.Registry, val.Type()) + sd, err := sc.describeStruct(ec.Registry, val.Type(), ec.useJSONStructTags, ec.errorOnInlineDuplicates) if err != nil { return err } @@ -131,7 +164,7 @@ func (sc *StructCodec) EncodeValue(r EncodeContext, vw bsonrw.ValueWriter, val r } } - desc.encoder, rv, err = defaultValueEncoders.lookupElementEncoder(r, desc.encoder, rv) + desc.encoder, rv, err = defaultValueEncoders.lookupElementEncoder(ec, desc.encoder, rv) if err != nil && err != errInvalidValue { return err @@ -158,17 +191,18 @@ func (sc *StructCodec) EncodeValue(r EncodeContext, vw bsonrw.ValueWriter, val r encoder := desc.encoder - var isZero bool + var zero bool rvInterface := rv.Interface() if cz, ok := encoder.(CodecZeroer); ok { - isZero = cz.IsTypeZero(rvInterface) + zero = cz.IsTypeZero(rvInterface) } else if rv.Kind() == reflect.Interface { - // sc.isZero will not treat an interface rv as an interface, so we need to check for the zero interface separately. - isZero = rv.IsNil() + // isZero will not treat an interface rv as an interface, so we need to check for the + // zero interface separately. + zero = rv.IsNil() } else { - isZero = sc.isZero(rvInterface) + zero = isZero(rvInterface, sc.EncodeOmitDefaultStruct || ec.omitZeroStruct) } - if desc.omitEmpty && isZero { + if desc.omitEmpty && zero { continue } @@ -177,7 +211,17 @@ func (sc *StructCodec) EncodeValue(r EncodeContext, vw bsonrw.ValueWriter, val r return err } - ectx := EncodeContext{Registry: r.Registry, MinSize: desc.minSize} + ectx := EncodeContext{ + Registry: ec.Registry, + MinSize: desc.minSize || ec.MinSize, + errorOnInlineDuplicates: ec.errorOnInlineDuplicates, + stringifyMapKeysWithFmt: ec.stringifyMapKeysWithFmt, + nilMapAsEmpty: ec.nilMapAsEmpty, + nilSliceAsEmpty: ec.nilSliceAsEmpty, + nilByteSliceAsEmpty: ec.nilByteSliceAsEmpty, + omitZeroStruct: ec.omitZeroStruct, + useJSONStructTags: ec.useJSONStructTags, + } err = encoder.EncodeValue(ectx, vw2, rv) if err != nil { return err @@ -191,7 +235,7 @@ func (sc *StructCodec) EncodeValue(r EncodeContext, vw bsonrw.ValueWriter, val r return exists } - return defaultMapCodec.mapEncodeValue(r, dw, rv, collisionFn) + return defaultMapCodec.mapEncodeValue(ec, dw, rv, collisionFn) } return dw.WriteDocumentEnd() @@ -213,7 +257,7 @@ func newDecodeError(key string, original error) error { // DecodeValue implements the Codec interface. // By default, map types in val will not be cleared. If a map has existing key/value pairs, it will be extended with the new ones from vr. // For slices, the decoder will set the length of the slice to zero and append all elements. The underlying array will not be cleared. -func (sc *StructCodec) DecodeValue(r DecodeContext, vr bsonrw.ValueReader, val reflect.Value) error { +func (sc *StructCodec) DecodeValue(dc DecodeContext, vr bsonrw.ValueReader, val reflect.Value) error { if !val.CanSet() || val.Kind() != reflect.Struct { return ValueDecoderError{Name: "StructCodec.DecodeValue", Kinds: []reflect.Kind{reflect.Struct}, Received: val} } @@ -238,12 +282,12 @@ func (sc *StructCodec) DecodeValue(r DecodeContext, vr bsonrw.ValueReader, val r return fmt.Errorf("cannot decode %v into a %s", vrType, val.Type()) } - sd, err := sc.describeStruct(r.Registry, val.Type()) + sd, err := sc.describeStruct(dc.Registry, val.Type(), dc.useJSONStructTags, false) if err != nil { return err } - if sc.DecodeZeroStruct { + if sc.DecodeZeroStruct || dc.zeroStructs { val.Set(reflect.Zero(val.Type())) } if sc.DecodeDeepZeroInline && sd.inline { @@ -254,7 +298,7 @@ func (sc *StructCodec) DecodeValue(r DecodeContext, vr bsonrw.ValueReader, val r var inlineMap reflect.Value if sd.inlineMap >= 0 { inlineMap = val.Field(sd.inlineMap) - decoder, err = r.LookupDecoder(inlineMap.Type().Elem()) + decoder, err = dc.LookupDecoder(inlineMap.Type().Elem()) if err != nil { return err } @@ -298,8 +342,8 @@ func (sc *StructCodec) DecodeValue(r DecodeContext, vr bsonrw.ValueReader, val r } elem := reflect.New(inlineMap.Type().Elem()).Elem() - r.Ancestor = inlineMap.Type() - err = decoder.DecodeValue(r, vr, elem) + dc.Ancestor = inlineMap.Type() + err = decoder.DecodeValue(dc, vr, elem) if err != nil { return err } @@ -327,9 +371,14 @@ func (sc *StructCodec) DecodeValue(r DecodeContext, vr bsonrw.ValueReader, val r field = field.Addr() dctx := DecodeContext{ - Registry: r.Registry, - Truncate: fd.truncate || r.Truncate, - defaultDocumentType: r.defaultDocumentType, + Registry: dc.Registry, + Truncate: fd.truncate || dc.Truncate, + defaultDocumentType: dc.defaultDocumentType, + binaryAsSlice: dc.binaryAsSlice, + useJSONStructTags: dc.useJSONStructTags, + useLocalTimeZone: dc.useLocalTimeZone, + zeroMaps: dc.zeroMaps, + zeroStructs: dc.zeroStructs, } if fd.decoder == nil { @@ -345,7 +394,7 @@ func (sc *StructCodec) DecodeValue(r DecodeContext, vr bsonrw.ValueReader, val r return nil } -func (sc *StructCodec) isZero(i interface{}) bool { +func isZero(i interface{}, omitZeroStruct bool) bool { v := reflect.ValueOf(i) // check the value validity @@ -371,22 +420,27 @@ func (sc *StructCodec) isZero(i interface{}) bool { case reflect.Interface, reflect.Ptr: return v.IsNil() case reflect.Struct: - if sc.EncodeOmitDefaultStruct { - vt := v.Type() - if vt == tTime { - return v.Interface().(time.Time).IsZero() + if !omitZeroStruct { + return false + } + + // TODO(GODRIVER-2820): Update the logic to be able to handle private struct fields. + // TODO Use condition "reflect.Zero(v.Type()).Equal(v)" instead. + + vt := v.Type() + if vt == tTime { + return v.Interface().(time.Time).IsZero() + } + for i := 0; i < v.NumField(); i++ { + if vt.Field(i).PkgPath != "" && !vt.Field(i).Anonymous { + continue // Private field } - for i := 0; i < v.NumField(); i++ { - if vt.Field(i).PkgPath != "" && !vt.Field(i).Anonymous { - continue // Private field - } - fld := v.Field(i) - if !sc.isZero(fld.Interface()) { - return false - } + fld := v.Field(i) + if !isZero(fld.Interface(), omitZeroStruct) { + return false } - return true } + return true } return false @@ -440,7 +494,12 @@ func (bi byIndex) Less(i, j int) bool { return len(bi[i].inline) < len(bi[j].inline) } -func (sc *StructCodec) describeStruct(r *Registry, t reflect.Type) (*structDescription, error) { +func (sc *StructCodec) describeStruct( + r *Registry, + t reflect.Type, + useJSONStructTags bool, + errorOnDuplicates bool, +) (*structDescription, error) { // We need to analyze the struct, including getting the tags, collecting // information about inlining, and create a map of the field name to the field. sc.l.RLock() @@ -482,7 +541,14 @@ func (sc *StructCodec) describeStruct(r *Registry, t reflect.Type) (*structDescr decoder: decoder, } - stags, err := sc.parser.ParseStructTags(sf) + var stags StructTags + // If the caller requested that we use JSON struct tags, use the JSONFallbackStructTagParser + // instead of the parser defined on the codec. + if useJSONStructTags { + stags, err = JSONFallbackStructTagParser.ParseStructTags(sf) + } else { + stags, err = sc.parser.ParseStructTags(sf) + } if err != nil { return nil, err } @@ -512,7 +578,7 @@ func (sc *StructCodec) describeStruct(r *Registry, t reflect.Type) (*structDescr } fallthrough case reflect.Struct: - inlinesf, err := sc.describeStruct(r, sfType) + inlinesf, err := sc.describeStruct(r, sfType, useJSONStructTags, errorOnDuplicates) if err != nil { return nil, err } @@ -564,7 +630,7 @@ func (sc *StructCodec) describeStruct(r *Registry, t reflect.Type) (*structDescr continue } dominant, ok := dominantField(fields[i : i+advance]) - if !ok || !sc.OverwriteDuplicatedInlinedFields { + if !ok || !sc.OverwriteDuplicatedInlinedFields || errorOnDuplicates { return nil, fmt.Errorf("struct %s has duplicated key %s", t.String(), name) } sd.fl = append(sd.fl, dominant) diff --git a/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/struct_tag_parser.go b/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/struct_tag_parser.go index 62708c5c74..18d85bfb03 100644 --- a/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/struct_tag_parser.go +++ b/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/struct_tag_parser.go @@ -12,12 +12,16 @@ import ( ) // StructTagParser returns the struct tags for a given struct field. +// +// Deprecated: Defining custom BSON struct tag parsers will not be supported in Go Driver 2.0. type StructTagParser interface { ParseStructTags(reflect.StructField) (StructTags, error) } // StructTagParserFunc is an adapter that allows a generic function to be used // as a StructTagParser. +// +// Deprecated: Defining custom BSON struct tag parsers will not be supported in Go Driver 2.0. type StructTagParserFunc func(reflect.StructField) (StructTags, error) // ParseStructTags implements the StructTagParser interface. @@ -50,7 +54,7 @@ func (stpf StructTagParserFunc) ParseStructTags(sf reflect.StructField) (StructT // Skip This struct field should be skipped. This is usually denoted by parsing a "-" // for the name. // -// TODO(skriptble): Add tags for undefined as nil and for null as nil. +// Deprecated: Defining custom BSON struct tag parsers will not be supported in Go Driver 2.0. type StructTags struct { Name string OmitEmpty bool @@ -85,6 +89,8 @@ type StructTags struct { // A struct tag either consisting entirely of '-' or with a bson key with a // value consisting entirely of '-' will return a StructTags with Skip true and // the remaining fields will be their default values. +// +// Deprecated: DefaultStructTagParser will be removed in Go Driver 2.0. var DefaultStructTagParser StructTagParserFunc = func(sf reflect.StructField) (StructTags, error) { key := strings.ToLower(sf.Name) tag, ok := sf.Tag.Lookup("bson") @@ -125,6 +131,9 @@ func parseTags(key string, tag string) (StructTags, error) { // JSONFallbackStructTagParser has the same behavior as DefaultStructTagParser // but will also fallback to parsing the json tag instead on a field where the // bson tag isn't available. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.Encoder.UseJSONStructTags] and +// [go.mongodb.org/mongo-driver/bson.Decoder.UseJSONStructTags] instead. var JSONFallbackStructTagParser StructTagParserFunc = func(sf reflect.StructField) (StructTags, error) { key := strings.ToLower(sf.Name) tag, ok := sf.Tag.Lookup("bson") diff --git a/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/time_codec.go b/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/time_codec.go index ec7e30f724..7b005a9958 100644 --- a/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/time_codec.go +++ b/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/time_codec.go @@ -22,18 +22,28 @@ const ( ) // TimeCodec is the Codec used for time.Time values. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with the +// TimeCodec registered. type TimeCodec struct { + // UseLocalTimeZone specifies if we should decode into the local time zone. Defaults to false. + // + // Deprecated: Use bson.Decoder.UseLocalTimeZone instead. UseLocalTimeZone bool } var ( defaultTimeCodec = NewTimeCodec() - _ ValueCodec = defaultTimeCodec + // Assert that defaultTimeCodec satisfies the typeDecoder interface, which allows it to be used + // by collection type decoders (e.g. map, slice, etc) to set individual values in a collection. _ typeDecoder = defaultTimeCodec ) // NewTimeCodec returns a TimeCodec with options opts. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with the +// TimeCodec registered. func NewTimeCodec(opts ...*bsonoptions.TimeCodecOptions) *TimeCodec { timeOpt := bsonoptions.MergeTimeCodecOptions(opts...) @@ -95,7 +105,7 @@ func (tc *TimeCodec) decodeType(dc DecodeContext, vr bsonrw.ValueReader, t refle return emptyValue, fmt.Errorf("cannot decode %v into a time.Time", vrType) } - if !tc.UseLocalTimeZone { + if !tc.UseLocalTimeZone && !dc.useLocalTimeZone { timeVal = timeVal.UTC() } return reflect.ValueOf(timeVal), nil @@ -117,7 +127,7 @@ func (tc *TimeCodec) DecodeValue(dc DecodeContext, vr bsonrw.ValueReader, val re } // EncodeValue is the ValueEncoderFunc for time.TIme. -func (tc *TimeCodec) EncodeValue(ec EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { +func (tc *TimeCodec) EncodeValue(_ EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { if !val.IsValid() || val.Type() != tTime { return ValueEncoderError{Name: "TimeEncodeValue", Types: []reflect.Type{tTime}, Received: val} } diff --git a/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/uint_codec.go b/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/uint_codec.go index 0b21ce999c..7eb1069050 100644 --- a/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/uint_codec.go +++ b/vendor/go.mongodb.org/mongo-driver/bson/bsoncodec/uint_codec.go @@ -17,18 +17,29 @@ import ( ) // UIntCodec is the Codec used for uint values. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with the +// UIntCodec registered. type UIntCodec struct { + // EncodeToMinSize causes EncodeValue to marshal Go uint values (excluding uint64) as the + // minimum BSON int size (either 32-bit or 64-bit) that can represent the integer value. + // + // Deprecated: Use bson.Encoder.IntMinSize instead. EncodeToMinSize bool } var ( defaultUIntCodec = NewUIntCodec() - _ ValueCodec = defaultUIntCodec + // Assert that defaultUIntCodec satisfies the typeDecoder interface, which allows it to be used + // by collection type decoders (e.g. map, slice, etc) to set individual values in a collection. _ typeDecoder = defaultUIntCodec ) // NewUIntCodec returns a UIntCodec with options opts. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.NewRegistry] to get a registry with the +// UIntCodec registered. func NewUIntCodec(opts ...*bsonoptions.UIntCodecOptions) *UIntCodec { uintOpt := bsonoptions.MergeUIntCodecOptions(opts...) diff --git a/vendor/go.mongodb.org/mongo-driver/bson/bsonoptions/byte_slice_codec_options.go b/vendor/go.mongodb.org/mongo-driver/bson/bsonoptions/byte_slice_codec_options.go index b1256a4dca..996bd17127 100644 --- a/vendor/go.mongodb.org/mongo-driver/bson/bsonoptions/byte_slice_codec_options.go +++ b/vendor/go.mongodb.org/mongo-driver/bson/bsonoptions/byte_slice_codec_options.go @@ -7,22 +7,33 @@ package bsonoptions // ByteSliceCodecOptions represents all possible options for byte slice encoding and decoding. +// +// Deprecated: Use the bson.Encoder and bson.Decoder configuration methods to set the desired BSON marshal +// and unmarshal behavior instead. type ByteSliceCodecOptions struct { EncodeNilAsEmpty *bool // Specifies if a nil byte slice should encode as an empty binary instead of null. Defaults to false. } // ByteSliceCodec creates a new *ByteSliceCodecOptions +// +// Deprecated: Use the bson.Encoder and bson.Decoder configuration methods to set the desired BSON marshal +// and unmarshal behavior instead. func ByteSliceCodec() *ByteSliceCodecOptions { return &ByteSliceCodecOptions{} } // SetEncodeNilAsEmpty specifies if a nil byte slice should encode as an empty binary instead of null. Defaults to false. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.Encoder.NilByteSliceAsEmpty] instead. func (bs *ByteSliceCodecOptions) SetEncodeNilAsEmpty(b bool) *ByteSliceCodecOptions { bs.EncodeNilAsEmpty = &b return bs } // MergeByteSliceCodecOptions combines the given *ByteSliceCodecOptions into a single *ByteSliceCodecOptions in a last one wins fashion. +// +// Deprecated: Merging options structs will not be supported in Go Driver 2.0. Users should create a +// single options struct instead. func MergeByteSliceCodecOptions(opts ...*ByteSliceCodecOptions) *ByteSliceCodecOptions { bs := ByteSliceCodec() for _, opt := range opts { diff --git a/vendor/go.mongodb.org/mongo-driver/bson/bsonoptions/empty_interface_codec_options.go b/vendor/go.mongodb.org/mongo-driver/bson/bsonoptions/empty_interface_codec_options.go index 6caaa000e6..f522c7e03f 100644 --- a/vendor/go.mongodb.org/mongo-driver/bson/bsonoptions/empty_interface_codec_options.go +++ b/vendor/go.mongodb.org/mongo-driver/bson/bsonoptions/empty_interface_codec_options.go @@ -7,22 +7,33 @@ package bsonoptions // EmptyInterfaceCodecOptions represents all possible options for interface{} encoding and decoding. +// +// Deprecated: Use the bson.Encoder and bson.Decoder configuration methods to set the desired BSON marshal +// and unmarshal behavior instead. type EmptyInterfaceCodecOptions struct { DecodeBinaryAsSlice *bool // Specifies if Old and Generic type binarys should default to []slice instead of primitive.Binary. Defaults to false. } // EmptyInterfaceCodec creates a new *EmptyInterfaceCodecOptions +// +// Deprecated: Use the bson.Encoder and bson.Decoder configuration methods to set the desired BSON marshal +// and unmarshal behavior instead. func EmptyInterfaceCodec() *EmptyInterfaceCodecOptions { return &EmptyInterfaceCodecOptions{} } // SetDecodeBinaryAsSlice specifies if Old and Generic type binarys should default to []slice instead of primitive.Binary. Defaults to false. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.Decoder.BinaryAsSlice] instead. func (e *EmptyInterfaceCodecOptions) SetDecodeBinaryAsSlice(b bool) *EmptyInterfaceCodecOptions { e.DecodeBinaryAsSlice = &b return e } // MergeEmptyInterfaceCodecOptions combines the given *EmptyInterfaceCodecOptions into a single *EmptyInterfaceCodecOptions in a last one wins fashion. +// +// Deprecated: Merging options structs will not be supported in Go Driver 2.0. Users should create a +// single options struct instead. func MergeEmptyInterfaceCodecOptions(opts ...*EmptyInterfaceCodecOptions) *EmptyInterfaceCodecOptions { e := EmptyInterfaceCodec() for _, opt := range opts { diff --git a/vendor/go.mongodb.org/mongo-driver/bson/bsonoptions/map_codec_options.go b/vendor/go.mongodb.org/mongo-driver/bson/bsonoptions/map_codec_options.go index 7a6a880b88..a7a7c1d980 100644 --- a/vendor/go.mongodb.org/mongo-driver/bson/bsonoptions/map_codec_options.go +++ b/vendor/go.mongodb.org/mongo-driver/bson/bsonoptions/map_codec_options.go @@ -7,6 +7,9 @@ package bsonoptions // MapCodecOptions represents all possible options for map encoding and decoding. +// +// Deprecated: Use the bson.Encoder and bson.Decoder configuration methods to set the desired BSON marshal +// and unmarshal behavior instead. type MapCodecOptions struct { DecodeZerosMap *bool // Specifies if the map should be zeroed before decoding into it. Defaults to false. EncodeNilAsEmpty *bool // Specifies if a nil map should encode as an empty document instead of null. Defaults to false. @@ -19,17 +22,24 @@ type MapCodecOptions struct { } // MapCodec creates a new *MapCodecOptions +// +// Deprecated: Use the bson.Encoder and bson.Decoder configuration methods to set the desired BSON marshal +// and unmarshal behavior instead. func MapCodec() *MapCodecOptions { return &MapCodecOptions{} } // SetDecodeZerosMap specifies if the map should be zeroed before decoding into it. Defaults to false. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.Decoder.ZeroMaps] instead. func (t *MapCodecOptions) SetDecodeZerosMap(b bool) *MapCodecOptions { t.DecodeZerosMap = &b return t } // SetEncodeNilAsEmpty specifies if a nil map should encode as an empty document instead of null. Defaults to false. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.Encoder.NilMapAsEmpty] instead. func (t *MapCodecOptions) SetEncodeNilAsEmpty(b bool) *MapCodecOptions { t.EncodeNilAsEmpty = &b return t @@ -40,12 +50,17 @@ func (t *MapCodecOptions) SetEncodeNilAsEmpty(b bool) *MapCodecOptions { // type must either be a string, an integer type, or implement bsoncodec.KeyUnmarshaler. If true, keys are encoded with // fmt.Sprint() and the encoding key type must be a string, an integer type, or a float. If true, the use of Stringer // will override TextMarshaler/TextUnmarshaler. Defaults to false. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.Encoder.StringifyMapKeysWithFmt] instead. func (t *MapCodecOptions) SetEncodeKeysWithStringer(b bool) *MapCodecOptions { t.EncodeKeysWithStringer = &b return t } // MergeMapCodecOptions combines the given *MapCodecOptions into a single *MapCodecOptions in a last one wins fashion. +// +// Deprecated: Merging options structs will not be supported in Go Driver 2.0. Users should create a +// single options struct instead. func MergeMapCodecOptions(opts ...*MapCodecOptions) *MapCodecOptions { s := MapCodec() for _, opt := range opts { diff --git a/vendor/go.mongodb.org/mongo-driver/bson/bsonoptions/slice_codec_options.go b/vendor/go.mongodb.org/mongo-driver/bson/bsonoptions/slice_codec_options.go index ef965e4b41..3c1e4f35ba 100644 --- a/vendor/go.mongodb.org/mongo-driver/bson/bsonoptions/slice_codec_options.go +++ b/vendor/go.mongodb.org/mongo-driver/bson/bsonoptions/slice_codec_options.go @@ -7,22 +7,33 @@ package bsonoptions // SliceCodecOptions represents all possible options for slice encoding and decoding. +// +// Deprecated: Use the bson.Encoder and bson.Decoder configuration methods to set the desired BSON marshal +// and unmarshal behavior instead. type SliceCodecOptions struct { EncodeNilAsEmpty *bool // Specifies if a nil slice should encode as an empty array instead of null. Defaults to false. } // SliceCodec creates a new *SliceCodecOptions +// +// Deprecated: Use the bson.Encoder and bson.Decoder configuration methods to set the desired BSON marshal +// and unmarshal behavior instead. func SliceCodec() *SliceCodecOptions { return &SliceCodecOptions{} } // SetEncodeNilAsEmpty specifies if a nil slice should encode as an empty array instead of null. Defaults to false. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.Encoder.NilSliceAsEmpty] instead. func (s *SliceCodecOptions) SetEncodeNilAsEmpty(b bool) *SliceCodecOptions { s.EncodeNilAsEmpty = &b return s } // MergeSliceCodecOptions combines the given *SliceCodecOptions into a single *SliceCodecOptions in a last one wins fashion. +// +// Deprecated: Merging options structs will not be supported in Go Driver 2.0. Users should create a +// single options struct instead. func MergeSliceCodecOptions(opts ...*SliceCodecOptions) *SliceCodecOptions { s := SliceCodec() for _, opt := range opts { diff --git a/vendor/go.mongodb.org/mongo-driver/bson/bsonoptions/string_codec_options.go b/vendor/go.mongodb.org/mongo-driver/bson/bsonoptions/string_codec_options.go index 65964f4207..f8b76f996e 100644 --- a/vendor/go.mongodb.org/mongo-driver/bson/bsonoptions/string_codec_options.go +++ b/vendor/go.mongodb.org/mongo-driver/bson/bsonoptions/string_codec_options.go @@ -9,23 +9,34 @@ package bsonoptions var defaultDecodeOIDAsHex = true // StringCodecOptions represents all possible options for string encoding and decoding. +// +// Deprecated: Use the bson.Encoder and bson.Decoder configuration methods to set the desired BSON marshal +// and unmarshal behavior instead. type StringCodecOptions struct { DecodeObjectIDAsHex *bool // Specifies if we should decode ObjectID as the hex value. Defaults to true. } // StringCodec creates a new *StringCodecOptions +// +// Deprecated: Use the bson.Encoder and bson.Decoder configuration methods to set the desired BSON marshal +// and unmarshal behavior instead. func StringCodec() *StringCodecOptions { return &StringCodecOptions{} } // SetDecodeObjectIDAsHex specifies if object IDs should be decoded as their hex representation. If false, a string made // from the raw object ID bytes will be used. Defaults to true. +// +// Deprecated: Decoding object IDs as raw bytes will not be supported in Go Driver 2.0. func (t *StringCodecOptions) SetDecodeObjectIDAsHex(b bool) *StringCodecOptions { t.DecodeObjectIDAsHex = &b return t } // MergeStringCodecOptions combines the given *StringCodecOptions into a single *StringCodecOptions in a last one wins fashion. +// +// Deprecated: Merging options structs will not be supported in Go Driver 2.0. Users should create a +// single options struct instead. func MergeStringCodecOptions(opts ...*StringCodecOptions) *StringCodecOptions { s := &StringCodecOptions{&defaultDecodeOIDAsHex} for _, opt := range opts { diff --git a/vendor/go.mongodb.org/mongo-driver/bson/bsonoptions/struct_codec_options.go b/vendor/go.mongodb.org/mongo-driver/bson/bsonoptions/struct_codec_options.go index 78d1dd8668..1cbfa32e8b 100644 --- a/vendor/go.mongodb.org/mongo-driver/bson/bsonoptions/struct_codec_options.go +++ b/vendor/go.mongodb.org/mongo-driver/bson/bsonoptions/struct_codec_options.go @@ -9,6 +9,9 @@ package bsonoptions var defaultOverwriteDuplicatedInlinedFields = true // StructCodecOptions represents all possible options for struct encoding and decoding. +// +// Deprecated: Use the bson.Encoder and bson.Decoder configuration methods to set the desired BSON marshal +// and unmarshal behavior instead. type StructCodecOptions struct { DecodeZeroStruct *bool // Specifies if structs should be zeroed before decoding into them. Defaults to false. DecodeDeepZeroInline *bool // Specifies if structs should be recursively zeroed when a inline value is decoded. Defaults to false. @@ -18,17 +21,24 @@ type StructCodecOptions struct { } // StructCodec creates a new *StructCodecOptions +// +// Deprecated: Use the bson.Encoder and bson.Decoder configuration methods to set the desired BSON marshal +// and unmarshal behavior instead. func StructCodec() *StructCodecOptions { return &StructCodecOptions{} } // SetDecodeZeroStruct specifies if structs should be zeroed before decoding into them. Defaults to false. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.Decoder.ZeroStructs] instead. func (t *StructCodecOptions) SetDecodeZeroStruct(b bool) *StructCodecOptions { t.DecodeZeroStruct = &b return t } // SetDecodeDeepZeroInline specifies if structs should be zeroed before decoding into them. Defaults to false. +// +// Deprecated: DecodeDeepZeroInline will not be supported in Go Driver 2.0. func (t *StructCodecOptions) SetDecodeDeepZeroInline(b bool) *StructCodecOptions { t.DecodeDeepZeroInline = &b return t @@ -36,6 +46,8 @@ func (t *StructCodecOptions) SetDecodeDeepZeroInline(b bool) *StructCodecOptions // SetEncodeOmitDefaultStruct specifies if default structs should be considered empty by omitempty. A default struct has all // its values set to their default value. Defaults to false. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.Encoder.OmitZeroStruct] instead. func (t *StructCodecOptions) SetEncodeOmitDefaultStruct(b bool) *StructCodecOptions { t.EncodeOmitDefaultStruct = &b return t @@ -45,18 +57,26 @@ func (t *StructCodecOptions) SetEncodeOmitDefaultStruct(b bool) *StructCodecOpti // same bson key. When true and decoding, values will be written to the outermost struct with a matching key, and when // encoding, keys will have the value of the top-most matching field. When false, decoding and encoding will error if // there are duplicate keys after the struct is inlined. Defaults to true. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.Encoder.ErrorOnInlineDuplicates] instead. func (t *StructCodecOptions) SetOverwriteDuplicatedInlinedFields(b bool) *StructCodecOptions { t.OverwriteDuplicatedInlinedFields = &b return t } // SetAllowUnexportedFields specifies if unexported fields should be marshaled/unmarshaled. Defaults to false. +// +// Deprecated: AllowUnexportedFields does not work on recent versions of Go and will not be +// supported in Go Driver 2.0. func (t *StructCodecOptions) SetAllowUnexportedFields(b bool) *StructCodecOptions { t.AllowUnexportedFields = &b return t } // MergeStructCodecOptions combines the given *StructCodecOptions into a single *StructCodecOptions in a last one wins fashion. +// +// Deprecated: Merging options structs will not be supported in Go Driver 2.0. Users should create a +// single options struct instead. func MergeStructCodecOptions(opts ...*StructCodecOptions) *StructCodecOptions { s := &StructCodecOptions{ OverwriteDuplicatedInlinedFields: &defaultOverwriteDuplicatedInlinedFields, diff --git a/vendor/go.mongodb.org/mongo-driver/bson/bsonoptions/time_codec_options.go b/vendor/go.mongodb.org/mongo-driver/bson/bsonoptions/time_codec_options.go index 13496d1217..3f38433d22 100644 --- a/vendor/go.mongodb.org/mongo-driver/bson/bsonoptions/time_codec_options.go +++ b/vendor/go.mongodb.org/mongo-driver/bson/bsonoptions/time_codec_options.go @@ -7,22 +7,33 @@ package bsonoptions // TimeCodecOptions represents all possible options for time.Time encoding and decoding. +// +// Deprecated: Use the bson.Encoder and bson.Decoder configuration methods to set the desired BSON marshal +// and unmarshal behavior instead. type TimeCodecOptions struct { UseLocalTimeZone *bool // Specifies if we should decode into the local time zone. Defaults to false. } // TimeCodec creates a new *TimeCodecOptions +// +// Deprecated: Use the bson.Encoder and bson.Decoder configuration methods to set the desired BSON marshal +// and unmarshal behavior instead. func TimeCodec() *TimeCodecOptions { return &TimeCodecOptions{} } // SetUseLocalTimeZone specifies if we should decode into the local time zone. Defaults to false. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.Decoder.UseLocalTimeZone] instead. func (t *TimeCodecOptions) SetUseLocalTimeZone(b bool) *TimeCodecOptions { t.UseLocalTimeZone = &b return t } // MergeTimeCodecOptions combines the given *TimeCodecOptions into a single *TimeCodecOptions in a last one wins fashion. +// +// Deprecated: Merging options structs will not be supported in Go Driver 2.0. Users should create a +// single options struct instead. func MergeTimeCodecOptions(opts ...*TimeCodecOptions) *TimeCodecOptions { t := TimeCodec() for _, opt := range opts { diff --git a/vendor/go.mongodb.org/mongo-driver/bson/bsonoptions/uint_codec_options.go b/vendor/go.mongodb.org/mongo-driver/bson/bsonoptions/uint_codec_options.go index e08b7f192e..5091e4d963 100644 --- a/vendor/go.mongodb.org/mongo-driver/bson/bsonoptions/uint_codec_options.go +++ b/vendor/go.mongodb.org/mongo-driver/bson/bsonoptions/uint_codec_options.go @@ -7,22 +7,33 @@ package bsonoptions // UIntCodecOptions represents all possible options for uint encoding and decoding. +// +// Deprecated: Use the bson.Encoder and bson.Decoder configuration methods to set the desired BSON marshal +// and unmarshal behavior instead. type UIntCodecOptions struct { EncodeToMinSize *bool // Specifies if all uints except uint64 should be decoded to minimum size bsontype. Defaults to false. } // UIntCodec creates a new *UIntCodecOptions +// +// Deprecated: Use the bson.Encoder and bson.Decoder configuration methods to set the desired BSON marshal +// and unmarshal behavior instead. func UIntCodec() *UIntCodecOptions { return &UIntCodecOptions{} } // SetEncodeToMinSize specifies if all uints except uint64 should be decoded to minimum size bsontype. Defaults to false. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.Encoder.IntMinSize] instead. func (u *UIntCodecOptions) SetEncodeToMinSize(b bool) *UIntCodecOptions { u.EncodeToMinSize = &b return u } // MergeUIntCodecOptions combines the given *UIntCodecOptions into a single *UIntCodecOptions in a last one wins fashion. +// +// Deprecated: Merging options structs will not be supported in Go Driver 2.0. Users should create a +// single options struct instead. func MergeUIntCodecOptions(opts ...*UIntCodecOptions) *UIntCodecOptions { u := UIntCodec() for _, opt := range opts { diff --git a/vendor/go.mongodb.org/mongo-driver/bson/bsonrw/copier.go b/vendor/go.mongodb.org/mongo-driver/bson/bsonrw/copier.go index 5cdf6460bc..33d59bd258 100644 --- a/vendor/go.mongodb.org/mongo-driver/bson/bsonrw/copier.go +++ b/vendor/go.mongodb.org/mongo-driver/bson/bsonrw/copier.go @@ -17,20 +17,32 @@ import ( // Copier is a type that allows copying between ValueReaders, ValueWriters, and // []byte values. +// +// Deprecated: Copying BSON documents using the ValueWriter and ValueReader interfaces will not be +// supported in Go Driver 2.0. type Copier struct{} // NewCopier creates a new copier with the given registry. If a nil registry is provided // a default registry is used. +// +// Deprecated: Copying BSON documents using the ValueWriter and ValueReader interfaces will not be +// supported in Go Driver 2.0. func NewCopier() Copier { return Copier{} } // CopyDocument handles copying a document from src to dst. +// +// Deprecated: Copying BSON documents using the ValueWriter and ValueReader interfaces will not be +// supported in Go Driver 2.0. func CopyDocument(dst ValueWriter, src ValueReader) error { return Copier{}.CopyDocument(dst, src) } // CopyDocument handles copying one document from the src to the dst. +// +// Deprecated: Copying BSON documents using the ValueWriter and ValueReader interfaces will not be +// supported in Go Driver 2.0. func (c Copier) CopyDocument(dst ValueWriter, src ValueReader) error { dr, err := src.ReadDocument() if err != nil { @@ -47,6 +59,9 @@ func (c Copier) CopyDocument(dst ValueWriter, src ValueReader) error { // CopyArrayFromBytes copies the values from a BSON array represented as a // []byte to a ValueWriter. +// +// Deprecated: Copying BSON arrays using the ValueWriter and ValueReader interfaces will not be +// supported in Go Driver 2.0. func (c Copier) CopyArrayFromBytes(dst ValueWriter, src []byte) error { aw, err := dst.WriteArray() if err != nil { @@ -63,6 +78,9 @@ func (c Copier) CopyArrayFromBytes(dst ValueWriter, src []byte) error { // CopyDocumentFromBytes copies the values from a BSON document represented as a // []byte to a ValueWriter. +// +// Deprecated: Copying BSON documents using the ValueWriter and ValueReader interfaces will not be +// supported in Go Driver 2.0. func (c Copier) CopyDocumentFromBytes(dst ValueWriter, src []byte) error { dw, err := dst.WriteDocument() if err != nil { @@ -81,6 +99,9 @@ type writeElementFn func(key string) (ValueWriter, error) // CopyBytesToArrayWriter copies the values from a BSON Array represented as a []byte to an // ArrayWriter. +// +// Deprecated: Copying BSON arrays using the ArrayWriter interface will not be supported in Go +// Driver 2.0. func (c Copier) CopyBytesToArrayWriter(dst ArrayWriter, src []byte) error { wef := func(_ string) (ValueWriter, error) { return dst.WriteArrayElement() @@ -91,6 +112,9 @@ func (c Copier) CopyBytesToArrayWriter(dst ArrayWriter, src []byte) error { // CopyBytesToDocumentWriter copies the values from a BSON document represented as a []byte to a // DocumentWriter. +// +// Deprecated: Copying BSON documents using the ValueWriter and ValueReader interfaces will not be +// supported in Go Driver 2.0. func (c Copier) CopyBytesToDocumentWriter(dst DocumentWriter, src []byte) error { wef := func(key string) (ValueWriter, error) { return dst.WriteDocumentElement(key) @@ -150,12 +174,18 @@ func (c Copier) copyBytesToValueWriter(src []byte, wef writeElementFn) error { // CopyDocumentToBytes copies an entire document from the ValueReader and // returns it as bytes. +// +// Deprecated: Copying BSON documents using the ValueWriter and ValueReader interfaces will not be +// supported in Go Driver 2.0. func (c Copier) CopyDocumentToBytes(src ValueReader) ([]byte, error) { return c.AppendDocumentBytes(nil, src) } // AppendDocumentBytes functions the same as CopyDocumentToBytes, but will // append the result to dst. +// +// Deprecated: Copying BSON documents using the ValueWriter and ValueReader interfaces will not be +// supported in Go Driver 2.0. func (c Copier) AppendDocumentBytes(dst []byte, src ValueReader) ([]byte, error) { if br, ok := src.(BytesReader); ok { _, dst, err := br.ReadValueBytes(dst) @@ -173,6 +203,9 @@ func (c Copier) AppendDocumentBytes(dst []byte, src ValueReader) ([]byte, error) } // AppendArrayBytes copies an array from the ValueReader to dst. +// +// Deprecated: Copying BSON arrays using the ValueWriter and ValueReader interfaces will not be +// supported in Go Driver 2.0. func (c Copier) AppendArrayBytes(dst []byte, src ValueReader) ([]byte, error) { if br, ok := src.(BytesReader); ok { _, dst, err := br.ReadValueBytes(dst) @@ -190,6 +223,8 @@ func (c Copier) AppendArrayBytes(dst []byte, src ValueReader) ([]byte, error) { } // CopyValueFromBytes will write the value represtend by t and src to dst. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.UnmarshalValue] instead. func (c Copier) CopyValueFromBytes(dst ValueWriter, t bsontype.Type, src []byte) error { if wvb, ok := dst.(BytesWriter); ok { return wvb.WriteValueBytes(t, src) @@ -206,12 +241,17 @@ func (c Copier) CopyValueFromBytes(dst ValueWriter, t bsontype.Type, src []byte) // CopyValueToBytes copies a value from src and returns it as a bsontype.Type and a // []byte. +// +// Deprecated: Use [go.mongodb.org/mongo-driver/bson.MarshalValue] instead. func (c Copier) CopyValueToBytes(src ValueReader) (bsontype.Type, []byte, error) { return c.AppendValueBytes(nil, src) } // AppendValueBytes functions the same as CopyValueToBytes, but will append the // result to dst. +// +// Deprecated: Appending individual BSON elements to an existing slice will not be supported in Go +// Driver 2.0. func (c Copier) AppendValueBytes(dst []byte, src ValueReader) (bsontype.Type, []byte, error) { if br, ok := src.(BytesReader); ok { return br.ReadValueBytes(dst) @@ -234,6 +274,9 @@ func (c Copier) AppendValueBytes(dst []byte, src ValueReader) (bsontype.Type, [] } // CopyValue will copy a single value from src to dst. +// +// Deprecated: Copying BSON values using the ValueWriter and ValueReader interfaces will not be +// supported in Go Driver 2.0. func (c Copier) CopyValue(dst ValueWriter, src ValueReader) error { var err error switch src.Type() { diff --git a/vendor/go.mongodb.org/mongo-driver/bson/bsonrw/extjson_reader.go b/vendor/go.mongodb.org/mongo-driver/bson/bsonrw/extjson_reader.go index 35832d73aa..2aca37a91f 100644 --- a/vendor/go.mongodb.org/mongo-driver/bson/bsonrw/extjson_reader.go +++ b/vendor/go.mongodb.org/mongo-driver/bson/bsonrw/extjson_reader.go @@ -16,11 +16,15 @@ import ( ) // ExtJSONValueReaderPool is a pool for ValueReaders that read ExtJSON. +// +// Deprecated: ExtJSONValueReaderPool will not be supported in Go Driver 2.0. type ExtJSONValueReaderPool struct { pool sync.Pool } // NewExtJSONValueReaderPool instantiates a new ExtJSONValueReaderPool. +// +// Deprecated: ExtJSONValueReaderPool will not be supported in Go Driver 2.0. func NewExtJSONValueReaderPool() *ExtJSONValueReaderPool { return &ExtJSONValueReaderPool{ pool: sync.Pool{ @@ -32,6 +36,8 @@ func NewExtJSONValueReaderPool() *ExtJSONValueReaderPool { } // Get retrieves a ValueReader from the pool and uses src as the underlying ExtJSON. +// +// Deprecated: ExtJSONValueReaderPool will not be supported in Go Driver 2.0. func (bvrp *ExtJSONValueReaderPool) Get(r io.Reader, canonical bool) (ValueReader, error) { vr := bvrp.pool.Get().(*extJSONValueReader) return vr.reset(r, canonical) @@ -39,6 +45,8 @@ func (bvrp *ExtJSONValueReaderPool) Get(r io.Reader, canonical bool) (ValueReade // Put inserts a ValueReader into the pool. If the ValueReader is not a ExtJSON ValueReader nothing // is inserted into the pool and ok will be false. +// +// Deprecated: ExtJSONValueReaderPool will not be supported in Go Driver 2.0. func (bvrp *ExtJSONValueReaderPool) Put(vr ValueReader) (ok bool) { bvr, ok := vr.(*extJSONValueReader) if !ok { diff --git a/vendor/go.mongodb.org/mongo-driver/bson/bsonrw/extjson_writer.go b/vendor/go.mongodb.org/mongo-driver/bson/bsonrw/extjson_writer.go index 99ed524b77..bb9303167c 100644 --- a/vendor/go.mongodb.org/mongo-driver/bson/bsonrw/extjson_writer.go +++ b/vendor/go.mongodb.org/mongo-driver/bson/bsonrw/extjson_writer.go @@ -23,11 +23,15 @@ import ( ) // ExtJSONValueWriterPool is a pool for ExtJSON ValueWriters. +// +// Deprecated: ExtJSONValueWriterPool will not be supported in Go Driver 2.0. type ExtJSONValueWriterPool struct { pool sync.Pool } // NewExtJSONValueWriterPool creates a new pool for ValueWriter instances that write to ExtJSON. +// +// Deprecated: ExtJSONValueWriterPool will not be supported in Go Driver 2.0. func NewExtJSONValueWriterPool() *ExtJSONValueWriterPool { return &ExtJSONValueWriterPool{ pool: sync.Pool{ @@ -39,6 +43,8 @@ func NewExtJSONValueWriterPool() *ExtJSONValueWriterPool { } // Get retrieves a ExtJSON ValueWriter from the pool and resets it to use w as the destination. +// +// Deprecated: ExtJSONValueWriterPool will not be supported in Go Driver 2.0. func (bvwp *ExtJSONValueWriterPool) Get(w io.Writer, canonical, escapeHTML bool) ValueWriter { vw := bvwp.pool.Get().(*extJSONValueWriter) if writer, ok := w.(*SliceWriter); ok { @@ -53,6 +59,8 @@ func (bvwp *ExtJSONValueWriterPool) Get(w io.Writer, canonical, escapeHTML bool) // Put inserts a ValueWriter into the pool. If the ValueWriter is not a ExtJSON ValueWriter, nothing // happens and ok will be false. +// +// Deprecated: ExtJSONValueWriterPool will not be supported in Go Driver 2.0. func (bvwp *ExtJSONValueWriterPool) Put(vw ValueWriter) (ok bool) { bvw, ok := vw.(*extJSONValueWriter) if !ok { @@ -80,6 +88,7 @@ type extJSONValueWriter struct { frame int64 canonical bool escapeHTML bool + newlines bool } // NewExtJSONValueWriter creates a ValueWriter that writes Extended JSON to w. @@ -88,10 +97,13 @@ func NewExtJSONValueWriter(w io.Writer, canonical, escapeHTML bool) (ValueWriter return nil, errNilWriter } - return newExtJSONWriter(w, canonical, escapeHTML), nil + // Enable newlines for all Extended JSON value writers created by NewExtJSONValueWriter. We + // expect these value writers to be used with an Encoder, which should add newlines after + // encoded Extended JSON documents. + return newExtJSONWriter(w, canonical, escapeHTML, true), nil } -func newExtJSONWriter(w io.Writer, canonical, escapeHTML bool) *extJSONValueWriter { +func newExtJSONWriter(w io.Writer, canonical, escapeHTML, newlines bool) *extJSONValueWriter { stack := make([]ejvwState, 1, 5) stack[0] = ejvwState{mode: mTopLevel} @@ -101,6 +113,7 @@ func newExtJSONWriter(w io.Writer, canonical, escapeHTML bool) *extJSONValueWrit stack: stack, canonical: canonical, escapeHTML: escapeHTML, + newlines: newlines, } } @@ -564,6 +577,12 @@ func (ejvw *extJSONValueWriter) WriteDocumentEnd() error { case mDocument: ejvw.buf = append(ejvw.buf, ',') case mTopLevel: + // If the value writer has newlines enabled, end top-level documents with a newline so that + // multiple documents encoded to the same writer are separated by newlines. That matches the + // Go json.Encoder behavior and also works with bsonrw.NewExtJSONValueReader. + if ejvw.newlines { + ejvw.buf = append(ejvw.buf, '\n') + } if ejvw.w != nil { if _, err := ejvw.w.Write(ejvw.buf); err != nil { return err diff --git a/vendor/go.mongodb.org/mongo-driver/bson/bsonrw/reader.go b/vendor/go.mongodb.org/mongo-driver/bson/bsonrw/reader.go index 0b8fa28d57..324b10b616 100644 --- a/vendor/go.mongodb.org/mongo-driver/bson/bsonrw/reader.go +++ b/vendor/go.mongodb.org/mongo-driver/bson/bsonrw/reader.go @@ -58,6 +58,8 @@ type ValueReader interface { // types that implement ValueReader may also implement this interface. // // The bytes of the value will be appended to dst. +// +// Deprecated: BytesReader will not be supported in Go Driver 2.0. type BytesReader interface { ReadValueBytes(dst []byte) (bsontype.Type, []byte, error) } diff --git a/vendor/go.mongodb.org/mongo-driver/bson/bsonrw/value_reader.go b/vendor/go.mongodb.org/mongo-driver/bson/bsonrw/value_reader.go index ef5d837c2f..9bf24fae0b 100644 --- a/vendor/go.mongodb.org/mongo-driver/bson/bsonrw/value_reader.go +++ b/vendor/go.mongodb.org/mongo-driver/bson/bsonrw/value_reader.go @@ -28,11 +28,15 @@ var vrPool = sync.Pool{ } // BSONValueReaderPool is a pool for ValueReaders that read BSON. +// +// Deprecated: BSONValueReaderPool will not be supported in Go Driver 2.0. type BSONValueReaderPool struct { pool sync.Pool } // NewBSONValueReaderPool instantiates a new BSONValueReaderPool. +// +// Deprecated: BSONValueReaderPool will not be supported in Go Driver 2.0. func NewBSONValueReaderPool() *BSONValueReaderPool { return &BSONValueReaderPool{ pool: sync.Pool{ @@ -44,6 +48,8 @@ func NewBSONValueReaderPool() *BSONValueReaderPool { } // Get retrieves a ValueReader from the pool and uses src as the underlying BSON. +// +// Deprecated: BSONValueReaderPool will not be supported in Go Driver 2.0. func (bvrp *BSONValueReaderPool) Get(src []byte) ValueReader { vr := bvrp.pool.Get().(*valueReader) vr.reset(src) @@ -52,6 +58,8 @@ func (bvrp *BSONValueReaderPool) Get(src []byte) ValueReader { // Put inserts a ValueReader into the pool. If the ValueReader is not a BSON ValueReader nothing // is inserted into the pool and ok will be false. +// +// Deprecated: BSONValueReaderPool will not be supported in Go Driver 2.0. func (bvrp *BSONValueReaderPool) Put(vr ValueReader) (ok bool) { bvr, ok := vr.(*valueReader) if !ok { diff --git a/vendor/go.mongodb.org/mongo-driver/bson/bsonrw/value_writer.go b/vendor/go.mongodb.org/mongo-driver/bson/bsonrw/value_writer.go index f95a08afd5..a6dd8d34f5 100644 --- a/vendor/go.mongodb.org/mongo-driver/bson/bsonrw/value_writer.go +++ b/vendor/go.mongodb.org/mongo-driver/bson/bsonrw/value_writer.go @@ -29,11 +29,15 @@ var vwPool = sync.Pool{ } // BSONValueWriterPool is a pool for BSON ValueWriters. +// +// Deprecated: BSONValueWriterPool will not be supported in Go Driver 2.0. type BSONValueWriterPool struct { pool sync.Pool } // NewBSONValueWriterPool creates a new pool for ValueWriter instances that write to BSON. +// +// Deprecated: BSONValueWriterPool will not be supported in Go Driver 2.0. func NewBSONValueWriterPool() *BSONValueWriterPool { return &BSONValueWriterPool{ pool: sync.Pool{ @@ -45,6 +49,8 @@ func NewBSONValueWriterPool() *BSONValueWriterPool { } // Get retrieves a BSON ValueWriter from the pool and resets it to use w as the destination. +// +// Deprecated: BSONValueWriterPool will not be supported in Go Driver 2.0. func (bvwp *BSONValueWriterPool) Get(w io.Writer) ValueWriter { vw := bvwp.pool.Get().(*valueWriter) @@ -56,6 +62,8 @@ func (bvwp *BSONValueWriterPool) Get(w io.Writer) ValueWriter { } // GetAtModeElement retrieves a ValueWriterFlusher from the pool and resets it to use w as the destination. +// +// Deprecated: BSONValueWriterPool will not be supported in Go Driver 2.0. func (bvwp *BSONValueWriterPool) GetAtModeElement(w io.Writer) ValueWriterFlusher { vw := bvwp.Get(w).(*valueWriter) vw.push(mElement) @@ -64,6 +72,8 @@ func (bvwp *BSONValueWriterPool) GetAtModeElement(w io.Writer) ValueWriterFlushe // Put inserts a ValueWriter into the pool. If the ValueWriter is not a BSON ValueWriter, nothing // happens and ok will be false. +// +// Deprecated: BSONValueWriterPool will not be supported in Go Driver 2.0. func (bvwp *BSONValueWriterPool) Put(vw ValueWriter) (ok bool) { bvw, ok := vw.(*valueWriter) if !ok { diff --git a/vendor/go.mongodb.org/mongo-driver/bson/bsonrw/writer.go b/vendor/go.mongodb.org/mongo-driver/bson/bsonrw/writer.go index dff65f87f7..628f452932 100644 --- a/vendor/go.mongodb.org/mongo-driver/bson/bsonrw/writer.go +++ b/vendor/go.mongodb.org/mongo-driver/bson/bsonrw/writer.go @@ -56,6 +56,8 @@ type ValueWriter interface { } // ValueWriterFlusher is a superset of ValueWriter that exposes functionality to flush to the underlying buffer. +// +// Deprecated: ValueWriterFlusher will not be supported in Go Driver 2.0. type ValueWriterFlusher interface { ValueWriter Flush() error @@ -64,13 +66,20 @@ type ValueWriterFlusher interface { // BytesWriter is the interface used to write BSON bytes to a ValueWriter. // This interface is meant to be a superset of ValueWriter, so that types that // implement ValueWriter may also implement this interface. +// +// Deprecated: BytesWriter will not be supported in Go Driver 2.0. type BytesWriter interface { WriteValueBytes(t bsontype.Type, b []byte) error } // SliceWriter allows a pointer to a slice of bytes to be used as an io.Writer. +// +// Deprecated: SliceWriter will not be supported in Go Driver 2.0. type SliceWriter []byte +// Write writes the bytes to the underlying slice. +// +// Deprecated: SliceWriter will not be supported in Go Driver 2.0. func (sw *SliceWriter) Write(p []byte) (int, error) { written := len(p) *sw = append(*sw, p...) diff --git a/vendor/go.mongodb.org/mongo-driver/bson/bsontype/bsontype.go b/vendor/go.mongodb.org/mongo-driver/bson/bsontype/bsontype.go index 7c91ae5186..f38c263a4c 100644 --- a/vendor/go.mongodb.org/mongo-driver/bson/bsontype/bsontype.go +++ b/vendor/go.mongodb.org/mongo-driver/bson/bsontype/bsontype.go @@ -8,7 +8,9 @@ // a stringifier for the Type to enable easier debugging when working with BSON. package bsontype // import "go.mongodb.org/mongo-driver/bson/bsontype" -// These constants uniquely refer to each BSON type. +// BSON element types as described in https://bsonspec.org/spec.html. +// +// Deprecated: Use bson.Type* constants instead. const ( Double Type = 0x01 String Type = 0x02 @@ -31,7 +33,12 @@ const ( Decimal128 Type = 0x13 MinKey Type = 0xFF MaxKey Type = 0x7F +) +// BSON binary element subtypes as described in https://bsonspec.org/spec.html. +// +// Deprecated: Use the bson.TypeBinary* constants instead. +const ( BinaryGeneric byte = 0x00 BinaryFunction byte = 0x01 BinaryBinaryOld byte = 0x02 diff --git a/vendor/go.mongodb.org/mongo-driver/bson/decoder.go b/vendor/go.mongodb.org/mongo-driver/bson/decoder.go index 6e189fa589..eac74cd399 100644 --- a/vendor/go.mongodb.org/mongo-driver/bson/decoder.go +++ b/vendor/go.mongodb.org/mongo-driver/bson/decoder.go @@ -38,6 +38,12 @@ type Decoder struct { // (*Decoder).SetContext. defaultDocumentM bool defaultDocumentD bool + + binaryAsSlice bool + useJSONStructTags bool + useLocalTimeZone bool + zeroMaps bool + zeroStructs bool } // NewDecoder returns a new decoder that uses the DefaultRegistry to read from vr. @@ -53,6 +59,9 @@ func NewDecoder(vr bsonrw.ValueReader) (*Decoder, error) { } // NewDecoderWithContext returns a new decoder that uses DecodeContext dc to read from vr. +// +// Deprecated: Use [NewDecoder] and use the Decoder configuration methods set the desired unmarshal +// behavior instead. func NewDecoderWithContext(dc bsoncodec.DecodeContext, vr bsonrw.ValueReader) (*Decoder, error) { if dc.Registry == nil { dc.Registry = DefaultRegistry @@ -70,8 +79,7 @@ func NewDecoderWithContext(dc bsoncodec.DecodeContext, vr bsonrw.ValueReader) (* // Decode reads the next BSON document from the stream and decodes it into the // value pointed to by val. // -// The documentation for Unmarshal contains details about of BSON into a Go -// value. +// See [Unmarshal] for details about BSON unmarshaling behavior. func (d *Decoder) Decode(val interface{}) error { if unmarshaler, ok := val.(Unmarshaler); ok { // TODO(skriptble): Reuse a []byte here and use the AppendDocumentBytes method. @@ -100,42 +108,101 @@ func (d *Decoder) Decode(val interface{}) error { if err != nil { return err } + if d.defaultDocumentM { d.dc.DefaultDocumentM() } if d.defaultDocumentD { d.dc.DefaultDocumentD() } + if d.binaryAsSlice { + d.dc.BinaryAsSlice() + } + if d.useJSONStructTags { + d.dc.UseJSONStructTags() + } + if d.useLocalTimeZone { + d.dc.UseLocalTimeZone() + } + if d.zeroMaps { + d.dc.ZeroMaps() + } + if d.zeroStructs { + d.dc.ZeroStructs() + } + return decoder.DecodeValue(d.dc, d.vr, rval) } // Reset will reset the state of the decoder, using the same *DecodeContext used in // the original construction but using vr for reading. func (d *Decoder) Reset(vr bsonrw.ValueReader) error { + // TODO:(GODRIVER-2719): Remove error return value. d.vr = vr return nil } // SetRegistry replaces the current registry of the decoder with r. func (d *Decoder) SetRegistry(r *bsoncodec.Registry) error { + // TODO:(GODRIVER-2719): Remove error return value. d.dc.Registry = r return nil } // SetContext replaces the current registry of the decoder with dc. +// +// Deprecated: Use the Decoder configuration methods to set the desired unmarshal behavior instead. func (d *Decoder) SetContext(dc bsoncodec.DecodeContext) error { + // TODO:(GODRIVER-2719): Remove error return value. d.dc = dc return nil } -// DefaultDocumentM will decode empty documents using the primitive.M type. This behavior is restricted to data typed as -// "interface{}" or "map[string]interface{}". +// DefaultDocumentM causes the Decoder to always unmarshal documents into the primitive.M type. This +// behavior is restricted to data typed as "interface{}" or "map[string]interface{}". func (d *Decoder) DefaultDocumentM() { d.defaultDocumentM = true } -// DefaultDocumentD will decode empty documents using the primitive.D type. This behavior is restricted to data typed as -// "interface{}" or "map[string]interface{}". +// DefaultDocumentD causes the Decoder to always unmarshal documents into the primitive.D type. This +// behavior is restricted to data typed as "interface{}" or "map[string]interface{}". func (d *Decoder) DefaultDocumentD() { d.defaultDocumentD = true } + +// AllowTruncatingDoubles causes the Decoder to truncate the fractional part of BSON "double" values +// when attempting to unmarshal them into a Go integer (int, int8, int16, int32, or int64) struct +// field. The truncation logic does not apply to BSON "decimal128" values. +func (d *Decoder) AllowTruncatingDoubles() { + d.dc.Truncate = true +} + +// BinaryAsSlice causes the Decoder to unmarshal BSON binary field values that are the "Generic" or +// "Old" BSON binary subtype as a Go byte slice instead of a primitive.Binary. +func (d *Decoder) BinaryAsSlice() { + d.binaryAsSlice = true +} + +// UseJSONStructTags causes the Decoder to fall back to using the "json" struct tag if a "bson" +// struct tag is not specified. +func (d *Decoder) UseJSONStructTags() { + d.useJSONStructTags = true +} + +// UseLocalTimeZone causes the Decoder to unmarshal time.Time values in the local timezone instead +// of the UTC timezone. +func (d *Decoder) UseLocalTimeZone() { + d.useLocalTimeZone = true +} + +// ZeroMaps causes the Decoder to delete any existing values from Go maps in the destination value +// passed to Decode before unmarshaling BSON documents into them. +func (d *Decoder) ZeroMaps() { + d.zeroMaps = true +} + +// ZeroStructs causes the Decoder to delete any existing values from Go structs in the destination +// value passed to Decode before unmarshaling BSON documents into them. +func (d *Decoder) ZeroStructs() { + d.zeroStructs = true +} diff --git a/vendor/go.mongodb.org/mongo-driver/bson/doc.go b/vendor/go.mongodb.org/mongo-driver/bson/doc.go index 0134006d8e..048b5eb998 100644 --- a/vendor/go.mongodb.org/mongo-driver/bson/doc.go +++ b/vendor/go.mongodb.org/mongo-driver/bson/doc.go @@ -7,7 +7,8 @@ // Package bson is a library for reading, writing, and manipulating BSON. BSON is a binary serialization format used to // store documents and make remote procedure calls in MongoDB. The BSON specification is located at https://bsonspec.org. // The BSON library handles marshalling and unmarshalling of values through a configurable codec system. For a description -// of the codec system and examples of registering custom codecs, see the bsoncodec package. +// of the codec system and examples of registering custom codecs, see the bsoncodec package. For additional information and +// usage examples, check out the [Work with BSON] page in the Go Driver docs site. // // # Raw BSON // @@ -138,4 +139,6 @@ // # Marshalling and Unmarshalling // // Manually marshalling and unmarshalling can be done with the Marshal and Unmarshal family of functions. +// +// [Work with BSON]: https://www.mongodb.com/docs/drivers/go/current/fundamentals/bson/ package bson diff --git a/vendor/go.mongodb.org/mongo-driver/bson/encoder.go b/vendor/go.mongodb.org/mongo-driver/bson/encoder.go index fe5125d086..0be2a97fbc 100644 --- a/vendor/go.mongodb.org/mongo-driver/bson/encoder.go +++ b/vendor/go.mongodb.org/mongo-driver/bson/encoder.go @@ -29,10 +29,20 @@ var encPool = sync.Pool{ type Encoder struct { ec bsoncodec.EncodeContext vw bsonrw.ValueWriter + + errorOnInlineDuplicates bool + intMinSize bool + stringifyMapKeysWithFmt bool + nilMapAsEmpty bool + nilSliceAsEmpty bool + nilByteSliceAsEmpty bool + omitZeroStruct bool + useJSONStructTags bool } // NewEncoder returns a new encoder that uses the DefaultRegistry to write to vw. func NewEncoder(vw bsonrw.ValueWriter) (*Encoder, error) { + // TODO:(GODRIVER-2719): Remove error return value. if vw == nil { return nil, errors.New("cannot create a new Encoder with a nil ValueWriter") } @@ -44,6 +54,9 @@ func NewEncoder(vw bsonrw.ValueWriter) (*Encoder, error) { } // NewEncoderWithContext returns a new encoder that uses EncodeContext ec to write to vw. +// +// Deprecated: Use [NewEncoder] and use the Encoder configuration methods to set the desired marshal +// behavior instead. func NewEncoderWithContext(ec bsoncodec.EncodeContext, vw bsonrw.ValueWriter) (*Encoder, error) { if ec.Registry == nil { ec = bsoncodec.EncodeContext{Registry: DefaultRegistry} @@ -60,8 +73,7 @@ func NewEncoderWithContext(ec bsoncodec.EncodeContext, vw bsonrw.ValueWriter) (* // Encode writes the BSON encoding of val to the stream. // -// The documentation for Marshal contains details about the conversion of Go -// values to BSON. +// See [Marshal] for details about BSON marshaling behavior. func (e *Encoder) Encode(val interface{}) error { if marshaler, ok := val.(Marshaler); ok { // TODO(skriptble): Should we have a MarshalAppender interface so that we can have []byte reuse? @@ -76,24 +88,112 @@ func (e *Encoder) Encode(val interface{}) error { if err != nil { return err } + + // Copy the configurations applied to the Encoder over to the EncodeContext, which actually + // communicates those configurations to the default ValueEncoders. + if e.errorOnInlineDuplicates { + e.ec.ErrorOnInlineDuplicates() + } + if e.intMinSize { + e.ec.MinSize = true + } + if e.stringifyMapKeysWithFmt { + e.ec.StringifyMapKeysWithFmt() + } + if e.nilMapAsEmpty { + e.ec.NilMapAsEmpty() + } + if e.nilSliceAsEmpty { + e.ec.NilSliceAsEmpty() + } + if e.nilByteSliceAsEmpty { + e.ec.NilByteSliceAsEmpty() + } + if e.omitZeroStruct { + e.ec.OmitZeroStruct() + } + if e.useJSONStructTags { + e.ec.UseJSONStructTags() + } + return encoder.EncodeValue(e.ec, e.vw, reflect.ValueOf(val)) } -// Reset will reset the state of the encoder, using the same *EncodeContext used in +// Reset will reset the state of the Encoder, using the same *EncodeContext used in // the original construction but using vw. func (e *Encoder) Reset(vw bsonrw.ValueWriter) error { + // TODO:(GODRIVER-2719): Remove error return value. e.vw = vw return nil } -// SetRegistry replaces the current registry of the encoder with r. +// SetRegistry replaces the current registry of the Encoder with r. func (e *Encoder) SetRegistry(r *bsoncodec.Registry) error { + // TODO:(GODRIVER-2719): Remove error return value. e.ec.Registry = r return nil } -// SetContext replaces the current EncodeContext of the encoder with er. +// SetContext replaces the current EncodeContext of the encoder with ec. +// +// Deprecated: Use the Encoder configuration methods set the desired marshal behavior instead. func (e *Encoder) SetContext(ec bsoncodec.EncodeContext) error { + // TODO:(GODRIVER-2719): Remove error return value. e.ec = ec return nil } + +// ErrorOnInlineDuplicates causes the Encoder to return an error if there is a duplicate field in +// the marshaled BSON when the "inline" struct tag option is set. +func (e *Encoder) ErrorOnInlineDuplicates() { + e.errorOnInlineDuplicates = true +} + +// IntMinSize causes the Encoder to marshal Go integer values (int, int8, int16, int32, int64, uint, +// uint8, uint16, uint32, or uint64) as the minimum BSON int size (either 32 or 64 bits) that can +// represent the integer value. +func (e *Encoder) IntMinSize() { + e.intMinSize = true +} + +// StringifyMapKeysWithFmt causes the Encoder to convert Go map keys to BSON document field name +// strings using fmt.Sprint instead of the default string conversion logic. +func (e *Encoder) StringifyMapKeysWithFmt() { + e.stringifyMapKeysWithFmt = true +} + +// NilMapAsEmpty causes the Encoder to marshal nil Go maps as empty BSON documents instead of BSON +// null. +func (e *Encoder) NilMapAsEmpty() { + e.nilMapAsEmpty = true +} + +// NilSliceAsEmpty causes the Encoder to marshal nil Go slices as empty BSON arrays instead of BSON +// null. +func (e *Encoder) NilSliceAsEmpty() { + e.nilSliceAsEmpty = true +} + +// NilByteSliceAsEmpty causes the Encoder to marshal nil Go byte slices as empty BSON binary values +// instead of BSON null. +func (e *Encoder) NilByteSliceAsEmpty() { + e.nilByteSliceAsEmpty = true +} + +// TODO(GODRIVER-2820): Update the description to remove the note about only examining exported +// TODO struct fields once the logic is updated to also inspect private struct fields. + +// OmitZeroStruct causes the Encoder to consider the zero value for a struct (e.g. MyStruct{}) +// as empty and omit it from the marshaled BSON when the "omitempty" struct tag option is set. +// +// Note that the Encoder only examines exported struct fields when determining if a struct is the +// zero value. It considers pointers to a zero struct value (e.g. &MyStruct{}) not empty. +func (e *Encoder) OmitZeroStruct() { + e.omitZeroStruct = true +} + +// UseJSONStructTags causes the Encoder to fall back to using the "json" struct tag if a "bson" +// struct tag is not specified. +func (e *Encoder) UseJSONStructTags() { + e.useJSONStructTags = true +} diff --git a/vendor/go.mongodb.org/mongo-driver/bson/marshal.go b/vendor/go.mongodb.org/mongo-driver/bson/marshal.go index db8d8ee92b..f2c48d049e 100644 --- a/vendor/go.mongodb.org/mongo-driver/bson/marshal.go +++ b/vendor/go.mongodb.org/mongo-driver/bson/marshal.go @@ -20,17 +20,23 @@ const defaultDstCap = 256 var bvwPool = bsonrw.NewBSONValueWriterPool() var extjPool = bsonrw.NewExtJSONValueWriterPool() -// Marshaler is an interface implemented by types that can marshal themselves -// into a BSON document represented as bytes. The bytes returned must be a valid -// BSON document if the error is nil. +// Marshaler is the interface implemented by types that can marshal themselves +// into a valid BSON document. +// +// Implementations of Marshaler must return a full BSON document. To create +// custom BSON marshaling behavior for individual values in a BSON document, +// implement the ValueMarshaler interface instead. type Marshaler interface { MarshalBSON() ([]byte, error) } -// ValueMarshaler is an interface implemented by types that can marshal -// themselves into a BSON value as bytes. The type must be the valid type for -// the bytes returned. The bytes and byte type together must be valid if the -// error is nil. +// ValueMarshaler is the interface implemented by types that can marshal +// themselves into a valid BSON value. The format of the returned bytes must +// match the returned type. +// +// Implementations of ValueMarshaler must return an individual BSON value. To +// create custom BSON marshaling behavior for an entire BSON document, implement +// the Marshaler interface instead. type ValueMarshaler interface { MarshalBSONValue() (bsontype.Type, []byte, error) } @@ -48,12 +54,42 @@ func Marshal(val interface{}) ([]byte, error) { // MarshalAppend will encode val as a BSON document and append the bytes to dst. If dst is not large enough to hold the // bytes, it will be grown. If val is not a type that can be transformed into a document, MarshalValueAppend should be // used instead. +// +// Deprecated: Use [NewEncoder] and pass the dst byte slice (wrapped by a bytes.Buffer) into +// [bsonrw.NewBSONValueWriter]: +// +// buf := bytes.NewBuffer(dst) +// vw, err := bsonrw.NewBSONValueWriter(buf) +// if err != nil { +// panic(err) +// } +// enc, err := bson.NewEncoder(vw) +// if err != nil { +// panic(err) +// } +// +// See [Encoder] for more examples. func MarshalAppend(dst []byte, val interface{}) ([]byte, error) { return MarshalAppendWithRegistry(DefaultRegistry, dst, val) } // MarshalWithRegistry returns the BSON encoding of val as a BSON document. If val is not a type that can be transformed // into a document, MarshalValueWithRegistry should be used instead. +// +// Deprecated: Use [NewEncoder] and specify the Registry by calling [Encoder.SetRegistry] instead: +// +// buf := new(bytes.Buffer) +// vw, err := bsonrw.NewBSONValueWriter(buf) +// if err != nil { +// panic(err) +// } +// enc, err := bson.NewEncoder(vw) +// if err != nil { +// panic(err) +// } +// enc.SetRegistry(reg) +// +// See [Encoder] for more examples. func MarshalWithRegistry(r *bsoncodec.Registry, val interface{}) ([]byte, error) { dst := make([]byte, 0) return MarshalAppendWithRegistry(r, dst, val) @@ -61,6 +97,22 @@ func MarshalWithRegistry(r *bsoncodec.Registry, val interface{}) ([]byte, error) // MarshalWithContext returns the BSON encoding of val as a BSON document using EncodeContext ec. If val is not a type // that can be transformed into a document, MarshalValueWithContext should be used instead. +// +// Deprecated: Use [NewEncoder] and use the Encoder configuration methods to set the desired marshal +// behavior instead: +// +// buf := bytes.NewBuffer(dst) +// vw, err := bsonrw.NewBSONValueWriter(buf) +// if err != nil { +// panic(err) +// } +// enc, err := bson.NewEncoder(vw) +// if err != nil { +// panic(err) +// } +// enc.IntMinSize() +// +// See [Encoder] for more examples. func MarshalWithContext(ec bsoncodec.EncodeContext, val interface{}) ([]byte, error) { dst := make([]byte, 0) return MarshalAppendWithContext(ec, dst, val) @@ -69,6 +121,22 @@ func MarshalWithContext(ec bsoncodec.EncodeContext, val interface{}) ([]byte, er // MarshalAppendWithRegistry will encode val as a BSON document using Registry r and append the bytes to dst. If dst is // not large enough to hold the bytes, it will be grown. If val is not a type that can be transformed into a document, // MarshalValueAppendWithRegistry should be used instead. +// +// Deprecated: Use [NewEncoder], and pass the dst byte slice (wrapped by a bytes.Buffer) into +// [bsonrw.NewBSONValueWriter], and specify the Registry by calling [Encoder.SetRegistry] instead: +// +// buf := bytes.NewBuffer(dst) +// vw, err := bsonrw.NewBSONValueWriter(buf) +// if err != nil { +// panic(err) +// } +// enc, err := bson.NewEncoder(vw) +// if err != nil { +// panic(err) +// } +// enc.SetRegistry(reg) +// +// See [Encoder] for more examples. func MarshalAppendWithRegistry(r *bsoncodec.Registry, dst []byte, val interface{}) ([]byte, error) { return MarshalAppendWithContext(bsoncodec.EncodeContext{Registry: r}, dst, val) } @@ -76,6 +144,23 @@ func MarshalAppendWithRegistry(r *bsoncodec.Registry, dst []byte, val interface{ // MarshalAppendWithContext will encode val as a BSON document using Registry r and EncodeContext ec and append the // bytes to dst. If dst is not large enough to hold the bytes, it will be grown. If val is not a type that can be // transformed into a document, MarshalValueAppendWithContext should be used instead. +// +// Deprecated: Use [NewEncoder], pass the dst byte slice (wrapped by a bytes.Buffer) into +// [bsonrw.NewBSONValueWriter], and use the Encoder configuration methods to set the desired marshal +// behavior instead: +// +// buf := bytes.NewBuffer(dst) +// vw, err := bsonrw.NewBSONValueWriter(buf) +// if err != nil { +// panic(err) +// } +// enc, err := bson.NewEncoder(vw) +// if err != nil { +// panic(err) +// } +// enc.IntMinSize() +// +// See [Encoder] for more examples. func MarshalAppendWithContext(ec bsoncodec.EncodeContext, dst []byte, val interface{}) ([]byte, error) { sw := new(bsonrw.SliceWriter) *sw = dst @@ -112,17 +197,26 @@ func MarshalValue(val interface{}) (bsontype.Type, []byte, error) { // MarshalValueAppend will append the BSON encoding of val to dst. If dst is not large enough to hold the BSON encoding // of val, dst will be grown. +// +// Deprecated: Appending individual BSON elements to an existing slice will not be supported in Go +// Driver 2.0. func MarshalValueAppend(dst []byte, val interface{}) (bsontype.Type, []byte, error) { return MarshalValueAppendWithRegistry(DefaultRegistry, dst, val) } // MarshalValueWithRegistry returns the BSON encoding of val using Registry r. +// +// Deprecated: Using a custom registry to marshal individual BSON values will not be supported in Go +// Driver 2.0. func MarshalValueWithRegistry(r *bsoncodec.Registry, val interface{}) (bsontype.Type, []byte, error) { dst := make([]byte, 0) return MarshalValueAppendWithRegistry(r, dst, val) } // MarshalValueWithContext returns the BSON encoding of val using EncodeContext ec. +// +// Deprecated: Using a custom EncodeContext to marshal individual BSON elements will not be +// supported in Go Driver 2.0. func MarshalValueWithContext(ec bsoncodec.EncodeContext, val interface{}) (bsontype.Type, []byte, error) { dst := make([]byte, 0) return MarshalValueAppendWithContext(ec, dst, val) @@ -130,12 +224,18 @@ func MarshalValueWithContext(ec bsoncodec.EncodeContext, val interface{}) (bsont // MarshalValueAppendWithRegistry will append the BSON encoding of val to dst using Registry r. If dst is not large // enough to hold the BSON encoding of val, dst will be grown. +// +// Deprecated: Appending individual BSON elements to an existing slice will not be supported in Go +// Driver 2.0. func MarshalValueAppendWithRegistry(r *bsoncodec.Registry, dst []byte, val interface{}) (bsontype.Type, []byte, error) { return MarshalValueAppendWithContext(bsoncodec.EncodeContext{Registry: r}, dst, val) } // MarshalValueAppendWithContext will append the BSON encoding of val to dst using EncodeContext ec. If dst is not large // enough to hold the BSON encoding of val, dst will be grown. +// +// Deprecated: Appending individual BSON elements to an existing slice will not be supported in Go +// Driver 2.0. func MarshalValueAppendWithContext(ec bsoncodec.EncodeContext, dst []byte, val interface{}) (bsontype.Type, []byte, error) { // get a ValueWriter configured to write to dst sw := new(bsonrw.SliceWriter) @@ -173,17 +273,63 @@ func MarshalExtJSON(val interface{}, canonical, escapeHTML bool) ([]byte, error) // MarshalExtJSONAppend will append the extended JSON encoding of val to dst. // If dst is not large enough to hold the extended JSON encoding of val, dst // will be grown. +// +// Deprecated: Use [NewEncoder] and pass the dst byte slice (wrapped by a bytes.Buffer) into +// [bsonrw.NewExtJSONValueWriter] instead: +// +// buf := bytes.NewBuffer(dst) +// vw, err := bsonrw.NewExtJSONValueWriter(buf, true, false) +// if err != nil { +// panic(err) +// } +// enc, err := bson.NewEncoder(vw) +// if err != nil { +// panic(err) +// } +// +// See [Encoder] for more examples. func MarshalExtJSONAppend(dst []byte, val interface{}, canonical, escapeHTML bool) ([]byte, error) { return MarshalExtJSONAppendWithRegistry(DefaultRegistry, dst, val, canonical, escapeHTML) } // MarshalExtJSONWithRegistry returns the extended JSON encoding of val using Registry r. +// +// Deprecated: Use [NewEncoder] and specify the Registry by calling [Encoder.SetRegistry] instead: +// +// buf := new(bytes.Buffer) +// vw, err := bsonrw.NewBSONValueWriter(buf) +// if err != nil { +// panic(err) +// } +// enc, err := bson.NewEncoder(vw) +// if err != nil { +// panic(err) +// } +// enc.SetRegistry(reg) +// +// See [Encoder] for more examples. func MarshalExtJSONWithRegistry(r *bsoncodec.Registry, val interface{}, canonical, escapeHTML bool) ([]byte, error) { dst := make([]byte, 0, defaultDstCap) return MarshalExtJSONAppendWithContext(bsoncodec.EncodeContext{Registry: r}, dst, val, canonical, escapeHTML) } // MarshalExtJSONWithContext returns the extended JSON encoding of val using Registry r. +// +// Deprecated: Use [NewEncoder] and use the Encoder configuration methods to set the desired marshal +// behavior instead: +// +// buf := new(bytes.Buffer) +// vw, err := bsonrw.NewBSONValueWriter(buf) +// if err != nil { +// panic(err) +// } +// enc, err := bson.NewEncoder(vw) +// if err != nil { +// panic(err) +// } +// enc.IntMinSize() +// +// See [Encoder] for more examples. func MarshalExtJSONWithContext(ec bsoncodec.EncodeContext, val interface{}, canonical, escapeHTML bool) ([]byte, error) { dst := make([]byte, 0, defaultDstCap) return MarshalExtJSONAppendWithContext(ec, dst, val, canonical, escapeHTML) @@ -192,6 +338,22 @@ func MarshalExtJSONWithContext(ec bsoncodec.EncodeContext, val interface{}, cano // MarshalExtJSONAppendWithRegistry will append the extended JSON encoding of // val to dst using Registry r. If dst is not large enough to hold the BSON // encoding of val, dst will be grown. +// +// Deprecated: Use [NewEncoder], pass the dst byte slice (wrapped by a bytes.Buffer) into +// [bsonrw.NewExtJSONValueWriter], and specify the Registry by calling [Encoder.SetRegistry] +// instead: +// +// buf := bytes.NewBuffer(dst) +// vw, err := bsonrw.NewExtJSONValueWriter(buf, true, false) +// if err != nil { +// panic(err) +// } +// enc, err := bson.NewEncoder(vw) +// if err != nil { +// panic(err) +// } +// +// See [Encoder] for more examples. func MarshalExtJSONAppendWithRegistry(r *bsoncodec.Registry, dst []byte, val interface{}, canonical, escapeHTML bool) ([]byte, error) { return MarshalExtJSONAppendWithContext(bsoncodec.EncodeContext{Registry: r}, dst, val, canonical, escapeHTML) } @@ -199,6 +361,23 @@ func MarshalExtJSONAppendWithRegistry(r *bsoncodec.Registry, dst []byte, val int // MarshalExtJSONAppendWithContext will append the extended JSON encoding of // val to dst using Registry r. If dst is not large enough to hold the BSON // encoding of val, dst will be grown. +// +// Deprecated: Use [NewEncoder], pass the dst byte slice (wrapped by a bytes.Buffer) into +// [bsonrw.NewExtJSONValueWriter], and use the Encoder configuration methods to set the desired marshal +// behavior instead: +// +// buf := bytes.NewBuffer(dst) +// vw, err := bsonrw.NewExtJSONValueWriter(buf, true, false) +// if err != nil { +// panic(err) +// } +// enc, err := bson.NewEncoder(vw) +// if err != nil { +// panic(err) +// } +// enc.IntMinSize() +// +// See [Encoder] for more examples. func MarshalExtJSONAppendWithContext(ec bsoncodec.EncodeContext, dst []byte, val interface{}, canonical, escapeHTML bool) ([]byte, error) { sw := new(bsonrw.SliceWriter) *sw = dst diff --git a/vendor/go.mongodb.org/mongo-driver/bson/primitive/objectid.go b/vendor/go.mongodb.org/mongo-driver/bson/primitive/objectid.go index ded3673165..9bbaffac26 100644 --- a/vendor/go.mongodb.org/mongo-driver/bson/primitive/objectid.go +++ b/vendor/go.mongodb.org/mongo-driver/bson/primitive/objectid.go @@ -82,18 +82,18 @@ func ObjectIDFromHex(s string) (ObjectID, error) { return NilObjectID, ErrInvalidHex } - b, err := hex.DecodeString(s) + var oid [12]byte + _, err := hex.Decode(oid[:], []byte(s)) if err != nil { return NilObjectID, err } - var oid [12]byte - copy(oid[:], b) - return oid, nil } // IsValidObjectID returns true if the provided hex string represents a valid ObjectID and false if not. +// +// Deprecated: Use ObjectIDFromHex and check the error instead. func IsValidObjectID(s string) bool { _, err := ObjectIDFromHex(s) return err == nil diff --git a/vendor/go.mongodb.org/mongo-driver/bson/primitive/primitive.go b/vendor/go.mongodb.org/mongo-driver/bson/primitive/primitive.go index c72ccc1c4d..65f4fbb949 100644 --- a/vendor/go.mongodb.org/mongo-driver/bson/primitive/primitive.go +++ b/vendor/go.mongodb.org/mongo-driver/bson/primitive/primitive.go @@ -45,7 +45,7 @@ var _ json.Unmarshaler = (*DateTime)(nil) // MarshalJSON marshal to time type. func (d DateTime) MarshalJSON() ([]byte, error) { - return json.Marshal(d.Time()) + return json.Marshal(d.Time().UTC()) } // UnmarshalJSON creates a primitive.DateTime from a JSON string. @@ -141,6 +141,16 @@ type Timestamp struct { I uint32 } +// After reports whether the time instant tp is after tp2. +func (tp Timestamp) After(tp2 Timestamp) bool { + return tp.T > tp2.T || (tp.T == tp2.T && tp.I > tp2.I) +} + +// Before reports whether the time instant tp is before tp2. +func (tp Timestamp) Before(tp2 Timestamp) bool { + return tp.T < tp2.T || (tp.T == tp2.T && tp.I < tp2.I) +} + // Equal compares tp to tp2 and returns true if they are equal. func (tp Timestamp) Equal(tp2 Timestamp) bool { return tp.T == tp2.T && tp.I == tp2.I @@ -151,24 +161,25 @@ func (tp Timestamp) IsZero() bool { return tp.T == 0 && tp.I == 0 } -// CompareTimestamp returns an integer comparing two Timestamps, where T is compared first, followed by I. -// Returns 0 if tp = tp2, 1 if tp > tp2, -1 if tp < tp2. -func CompareTimestamp(tp, tp2 Timestamp) int { - if tp.Equal(tp2) { +// Compare compares the time instant tp with tp2. If tp is before tp2, it returns -1; if tp is after +// tp2, it returns +1; if they're the same, it returns 0. +func (tp Timestamp) Compare(tp2 Timestamp) int { + switch { + case tp.Equal(tp2): return 0 - } - - if tp.T > tp2.T { - return 1 - } - if tp.T < tp2.T { + case tp.Before(tp2): return -1 + default: + return +1 } - // Compare I values because T values are equal - if tp.I > tp2.I { - return 1 - } - return -1 +} + +// CompareTimestamp compares the time instant tp with tp2. If tp is before tp2, it returns -1; if tp is after +// tp2, it returns +1; if they're the same, it returns 0. +// +// Deprecated: Use Timestamp.Compare instead. +func CompareTimestamp(tp, tp2 Timestamp) int { + return tp.Compare(tp2) } // MinKey represents the BSON minkey value. @@ -186,6 +197,9 @@ type MaxKey struct{} type D []E // Map creates a map from the elements of the D. +// +// Deprecated: Converting directly from a D to an M will not be supported in Go Driver 2.0. Instead, +// users should marshal the D to BSON using bson.Marshal and unmarshal it to M using bson.Unmarshal. func (d D) Map() M { m := make(M, len(d)) for _, e := range d { diff --git a/vendor/go.mongodb.org/mongo-driver/bson/primitive_codecs.go b/vendor/go.mongodb.org/mongo-driver/bson/primitive_codecs.go index 1cbe3884d1..6b9602589c 100644 --- a/vendor/go.mongodb.org/mongo-driver/bson/primitive_codecs.go +++ b/vendor/go.mongodb.org/mongo-driver/bson/primitive_codecs.go @@ -21,10 +21,16 @@ var primitiveCodecs PrimitiveCodecs // PrimitiveCodecs is a namespace for all of the default bsoncodec.Codecs for the primitive types // defined in this package. +// +// Deprecated: Use bson.NewRegistry to get a registry with all primitive encoders and decoders +// registered. type PrimitiveCodecs struct{} // RegisterPrimitiveCodecs will register the encode and decode methods attached to PrimitiveCodecs // with the provided RegistryBuilder. if rb is nil, a new empty RegistryBuilder will be created. +// +// Deprecated: Use bson.NewRegistry to get a registry with all primitive encoders and decoders +// registered. func (pc PrimitiveCodecs) RegisterPrimitiveCodecs(rb *bsoncodec.RegistryBuilder) { if rb == nil { panic(errors.New("argument to RegisterPrimitiveCodecs must not be nil")) @@ -38,7 +44,10 @@ func (pc PrimitiveCodecs) RegisterPrimitiveCodecs(rb *bsoncodec.RegistryBuilder) } // RawValueEncodeValue is the ValueEncoderFunc for RawValue. -func (PrimitiveCodecs) RawValueEncodeValue(ec bsoncodec.EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { +// +// Deprecated: Use bson.NewRegistry to get a registry with all primitive encoders and decoders +// registered. +func (PrimitiveCodecs) RawValueEncodeValue(_ bsoncodec.EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { if !val.IsValid() || val.Type() != tRawValue { return bsoncodec.ValueEncoderError{Name: "RawValueEncodeValue", Types: []reflect.Type{tRawValue}, Received: val} } @@ -49,7 +58,10 @@ func (PrimitiveCodecs) RawValueEncodeValue(ec bsoncodec.EncodeContext, vw bsonrw } // RawValueDecodeValue is the ValueDecoderFunc for RawValue. -func (PrimitiveCodecs) RawValueDecodeValue(dc bsoncodec.DecodeContext, vr bsonrw.ValueReader, val reflect.Value) error { +// +// Deprecated: Use bson.NewRegistry to get a registry with all primitive encoders and decoders +// registered. +func (PrimitiveCodecs) RawValueDecodeValue(_ bsoncodec.DecodeContext, vr bsonrw.ValueReader, val reflect.Value) error { if !val.CanSet() || val.Type() != tRawValue { return bsoncodec.ValueDecoderError{Name: "RawValueDecodeValue", Types: []reflect.Type{tRawValue}, Received: val} } @@ -64,7 +76,10 @@ func (PrimitiveCodecs) RawValueDecodeValue(dc bsoncodec.DecodeContext, vr bsonrw } // RawEncodeValue is the ValueEncoderFunc for Reader. -func (PrimitiveCodecs) RawEncodeValue(ec bsoncodec.EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { +// +// Deprecated: Use bson.NewRegistry to get a registry with all primitive encoders and decoders +// registered. +func (PrimitiveCodecs) RawEncodeValue(_ bsoncodec.EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { if !val.IsValid() || val.Type() != tRaw { return bsoncodec.ValueEncoderError{Name: "RawEncodeValue", Types: []reflect.Type{tRaw}, Received: val} } @@ -75,7 +90,10 @@ func (PrimitiveCodecs) RawEncodeValue(ec bsoncodec.EncodeContext, vw bsonrw.Valu } // RawDecodeValue is the ValueDecoderFunc for Reader. -func (PrimitiveCodecs) RawDecodeValue(dc bsoncodec.DecodeContext, vr bsonrw.ValueReader, val reflect.Value) error { +// +// Deprecated: Use bson.NewRegistry to get a registry with all primitive encoders and decoders +// registered. +func (PrimitiveCodecs) RawDecodeValue(_ bsoncodec.DecodeContext, vr bsonrw.ValueReader, val reflect.Value) error { if !val.CanSet() || val.Type() != tRaw { return bsoncodec.ValueDecoderError{Name: "RawDecodeValue", Types: []reflect.Type{tRaw}, Received: val} } diff --git a/vendor/go.mongodb.org/mongo-driver/bson/raw.go b/vendor/go.mongodb.org/mongo-driver/bson/raw.go index efd705daaa..fe990a1771 100644 --- a/vendor/go.mongodb.org/mongo-driver/bson/raw.go +++ b/vendor/go.mongodb.org/mongo-driver/bson/raw.go @@ -16,18 +16,27 @@ import ( // ErrNilReader indicates that an operation was attempted on a nil bson.Reader. var ErrNilReader = errors.New("nil reader") -// Raw is a wrapper around a byte slice. It will interpret the slice as a -// BSON document. This type is a wrapper around a bsoncore.Document. Errors returned from the -// methods on this type and associated types come from the bsoncore package. +// Raw is a raw encoded BSON document. It can be used to delay BSON document decoding or precompute +// a BSON encoded document. +// +// A Raw must be a full BSON document. Use the RawValue type for individual BSON values. type Raw []byte -// NewFromIOReader reads in a document from the given io.Reader and constructs a Raw from -// it. -func NewFromIOReader(r io.Reader) (Raw, error) { +// ReadDocument reads a BSON document from the io.Reader and returns it as a bson.Raw. If the +// reader contains multiple BSON documents, only the first document is read. +func ReadDocument(r io.Reader) (Raw, error) { doc, err := bsoncore.NewDocumentFromReader(r) return Raw(doc), err } +// NewFromIOReader reads a BSON document from the io.Reader and returns it as a bson.Raw. If the +// reader contains multiple BSON documents, only the first document is read. +// +// Deprecated: Use ReadDocument instead. +func NewFromIOReader(r io.Reader) (Raw, error) { + return ReadDocument(r) +} + // Validate validates the document. This method only validates the first document in // the slice, to validate other documents, the slice must be resliced. func (r Raw) Validate() (err error) { return bsoncore.Document(r).Validate() } @@ -81,5 +90,5 @@ func (r Raw) IndexErr(index uint) (RawElement, error) { return RawElement(elem), err } -// String implements the fmt.Stringer interface. +// String returns the BSON document encoded as Extended JSON. func (r Raw) String() string { return bsoncore.Document(r).String() } diff --git a/vendor/go.mongodb.org/mongo-driver/bson/raw_element.go b/vendor/go.mongodb.org/mongo-driver/bson/raw_element.go index 006f503a30..8ce13c2cc7 100644 --- a/vendor/go.mongodb.org/mongo-driver/bson/raw_element.go +++ b/vendor/go.mongodb.org/mongo-driver/bson/raw_element.go @@ -10,10 +10,7 @@ import ( "go.mongodb.org/mongo-driver/x/bsonx/bsoncore" ) -// RawElement represents a BSON element in byte form. This type provides a simple way to -// transform a slice of bytes into a BSON element and extract information from it. -// -// RawElement is a thin wrapper around a bsoncore.Element. +// RawElement is a raw encoded BSON document or array element. type RawElement []byte // Key returns the key for this element. If the element is not valid, this method returns an empty @@ -36,7 +33,7 @@ func (re RawElement) ValueErr() (RawValue, error) { // Validate ensures re is a valid BSON element. func (re RawElement) Validate() error { return bsoncore.Element(re).Validate() } -// String implements the fmt.Stringer interface. The output will be in extended JSON format. +// String returns the BSON element encoded as Extended JSON. func (re RawElement) String() string { doc := bsoncore.BuildDocument(nil, re) j, err := MarshalExtJSON(Raw(doc), true, false) diff --git a/vendor/go.mongodb.org/mongo-driver/bson/raw_value.go b/vendor/go.mongodb.org/mongo-driver/bson/raw_value.go index 75297f30fe..6627294c4d 100644 --- a/vendor/go.mongodb.org/mongo-driver/bson/raw_value.go +++ b/vendor/go.mongodb.org/mongo-driver/bson/raw_value.go @@ -26,11 +26,10 @@ var ErrNilContext = errors.New("DecodeContext cannot be nil") // ErrNilRegistry is returned when the provided registry is nil. var ErrNilRegistry = errors.New("Registry cannot be nil") -// RawValue represents a BSON value in byte form. It can be used to hold unprocessed BSON or to -// defer processing of BSON. Type is the BSON type of the value and Value are the raw bytes that -// represent the element. +// RawValue is a raw encoded BSON value. It can be used to delay BSON value decoding or precompute +// BSON encoded value. Type is the BSON type of the value and Value is the raw encoded BSON value. // -// This type wraps bsoncore.Value for most of it's functionality. +// A RawValue must be an individual BSON value. Use the Raw type for full BSON documents. type RawValue struct { Type bsontype.Type Value []byte @@ -268,10 +267,16 @@ func (rv RawValue) Int32OK() (int32, bool) { return convertToCoreValue(rv).Int32 // AsInt32 returns a BSON number as an int32. If the BSON type is not a numeric one, this method // will panic. +// +// Deprecated: Use AsInt64 instead. If an int32 is required, convert the returned value to an int32 +// and perform any required overflow/underflow checking. func (rv RawValue) AsInt32() int32 { return convertToCoreValue(rv).AsInt32() } // AsInt32OK is the same as AsInt32, except that it returns a boolean instead of // panicking. +// +// Deprecated: Use AsInt64OK instead. If an int32 is required, convert the returned value to an +// int32 and perform any required overflow/underflow checking. func (rv RawValue) AsInt32OK() (int32, bool) { return convertToCoreValue(rv).AsInt32OK() } // Timestamp returns the BSON timestamp value the Value represents. It panics if the value is a diff --git a/vendor/go.mongodb.org/mongo-driver/bson/registry.go b/vendor/go.mongodb.org/mongo-driver/bson/registry.go index 16d7573e75..b5b0f35687 100644 --- a/vendor/go.mongodb.org/mongo-driver/bson/registry.go +++ b/vendor/go.mongodb.org/mongo-driver/bson/registry.go @@ -6,15 +6,19 @@ package bson -import "go.mongodb.org/mongo-driver/bson/bsoncodec" +import ( + "go.mongodb.org/mongo-driver/bson/bsoncodec" +) // DefaultRegistry is the default bsoncodec.Registry. It contains the default codecs and the // primitive codecs. -var DefaultRegistry = NewRegistryBuilder().Build() +var DefaultRegistry = NewRegistry() // NewRegistryBuilder creates a new RegistryBuilder configured with the default encoders and // decoders from the bsoncodec.DefaultValueEncoders and bsoncodec.DefaultValueDecoders types and the // PrimitiveCodecs type in this package. +// +// Deprecated: Use NewRegistry instead. func NewRegistryBuilder() *bsoncodec.RegistryBuilder { rb := bsoncodec.NewRegistryBuilder() bsoncodec.DefaultValueEncoders{}.RegisterDefaultEncoders(rb) @@ -22,3 +26,10 @@ func NewRegistryBuilder() *bsoncodec.RegistryBuilder { primitiveCodecs.RegisterPrimitiveCodecs(rb) return rb } + +// NewRegistry creates a new Registry configured with the default encoders and decoders from the +// bsoncodec.DefaultValueEncoders and bsoncodec.DefaultValueDecoders types and the PrimitiveCodecs +// type in this package. +func NewRegistry() *bsoncodec.Registry { + return NewRegistryBuilder().Build() +} diff --git a/vendor/go.mongodb.org/mongo-driver/bson/types.go b/vendor/go.mongodb.org/mongo-driver/bson/types.go index 13a1c35cf6..e201ac37eb 100644 --- a/vendor/go.mongodb.org/mongo-driver/bson/types.go +++ b/vendor/go.mongodb.org/mongo-driver/bson/types.go @@ -10,7 +10,7 @@ import ( "go.mongodb.org/mongo-driver/bson/bsontype" ) -// These constants uniquely refer to each BSON type. +// BSON element types as described in https://bsonspec.org/spec.html. const ( TypeDouble = bsontype.Double TypeString = bsontype.String @@ -34,3 +34,16 @@ const ( TypeMinKey = bsontype.MinKey TypeMaxKey = bsontype.MaxKey ) + +// BSON binary element subtypes as described in https://bsonspec.org/spec.html. +const ( + TypeBinaryGeneric = bsontype.BinaryGeneric + TypeBinaryFunction = bsontype.BinaryFunction + TypeBinaryBinaryOld = bsontype.BinaryBinaryOld + TypeBinaryUUIDOld = bsontype.BinaryUUIDOld + TypeBinaryUUID = bsontype.BinaryUUID + TypeBinaryMD5 = bsontype.BinaryMD5 + TypeBinaryEncrypted = bsontype.BinaryEncrypted + TypeBinaryColumn = bsontype.BinaryColumn + TypeBinaryUserDefined = bsontype.BinaryUserDefined +) diff --git a/vendor/go.mongodb.org/mongo-driver/bson/unmarshal.go b/vendor/go.mongodb.org/mongo-driver/bson/unmarshal.go index f936ba1836..66da17ee01 100644 --- a/vendor/go.mongodb.org/mongo-driver/bson/unmarshal.go +++ b/vendor/go.mongodb.org/mongo-driver/bson/unmarshal.go @@ -14,18 +14,26 @@ import ( "go.mongodb.org/mongo-driver/bson/bsontype" ) -// Unmarshaler is an interface implemented by types that can unmarshal a BSON -// document representation of themselves. The BSON bytes can be assumed to be -// valid. UnmarshalBSON must copy the BSON bytes if it wishes to retain the data -// after returning. +// Unmarshaler is the interface implemented by types that can unmarshal a BSON +// document representation of themselves. The input can be assumed to be a valid +// encoding of a BSON document. UnmarshalBSON must copy the JSON data if it +// wishes to retain the data after returning. +// +// Unmarshaler is only used to unmarshal full BSON documents. To create custom +// BSON unmarshaling behavior for individual values in a BSON document, +// implement the ValueUnmarshaler interface instead. type Unmarshaler interface { UnmarshalBSON([]byte) error } -// ValueUnmarshaler is an interface implemented by types that can unmarshal a -// BSON value representation of themselves. The BSON bytes and type can be -// assumed to be valid. UnmarshalBSONValue must copy the BSON value bytes if it -// wishes to retain the data after returning. +// ValueUnmarshaler is the interface implemented by types that can unmarshal a +// BSON value representation of themselves. The input can be assumed to be a +// valid encoding of a BSON value. UnmarshalBSONValue must copy the BSON value +// bytes if it wishes to retain the data after returning. +// +// ValueUnmarshaler is only used to unmarshal individual values in a BSON +// document. To create custom BSON unmarshaling behavior for an entire BSON +// document, implement the Unmarshaler interface instead. type ValueUnmarshaler interface { UnmarshalBSONValue(bsontype.Type, []byte) error } @@ -40,6 +48,16 @@ func Unmarshal(data []byte, val interface{}) error { // UnmarshalWithRegistry parses the BSON-encoded data using Registry r and // stores the result in the value pointed to by val. If val is nil or not // a pointer, UnmarshalWithRegistry returns InvalidUnmarshalError. +// +// Deprecated: Use [NewDecoder] and specify the Registry by calling [Decoder.SetRegistry] instead: +// +// dec, err := bson.NewDecoder(bsonrw.NewBSONDocumentReader(data)) +// if err != nil { +// panic(err) +// } +// dec.SetRegistry(reg) +// +// See [Decoder] for more examples. func UnmarshalWithRegistry(r *bsoncodec.Registry, data []byte, val interface{}) error { vr := bsonrw.NewBSONDocumentReader(data) return unmarshalFromReader(bsoncodec.DecodeContext{Registry: r}, vr, val) @@ -48,11 +66,40 @@ func UnmarshalWithRegistry(r *bsoncodec.Registry, data []byte, val interface{}) // UnmarshalWithContext parses the BSON-encoded data using DecodeContext dc and // stores the result in the value pointed to by val. If val is nil or not // a pointer, UnmarshalWithRegistry returns InvalidUnmarshalError. +// +// Deprecated: Use [NewDecoder] and use the Decoder configuration methods to set the desired unmarshal +// behavior instead: +// +// dec, err := bson.NewDecoder(bsonrw.NewBSONDocumentReader(data)) +// if err != nil { +// panic(err) +// } +// dec.DefaultDocumentM() +// +// See [Decoder] for more examples. func UnmarshalWithContext(dc bsoncodec.DecodeContext, data []byte, val interface{}) error { vr := bsonrw.NewBSONDocumentReader(data) return unmarshalFromReader(dc, vr, val) } +// UnmarshalValue parses the BSON value of type t with bson.DefaultRegistry and +// stores the result in the value pointed to by val. If val is nil or not a pointer, +// UnmarshalValue returns an error. +func UnmarshalValue(t bsontype.Type, data []byte, val interface{}) error { + return UnmarshalValueWithRegistry(DefaultRegistry, t, data, val) +} + +// UnmarshalValueWithRegistry parses the BSON value of type t with registry r and +// stores the result in the value pointed to by val. If val is nil or not a pointer, +// UnmarshalValue returns an error. +// +// Deprecated: Using a custom registry to unmarshal individual BSON values will not be supported in +// Go Driver 2.0. +func UnmarshalValueWithRegistry(r *bsoncodec.Registry, t bsontype.Type, data []byte, val interface{}) error { + vr := bsonrw.NewBSONValueReader(t, data) + return unmarshalFromReader(bsoncodec.DecodeContext{Registry: r}, vr, val) +} + // UnmarshalExtJSON parses the extended JSON-encoded data and stores the result // in the value pointed to by val. If val is nil or not a pointer, Unmarshal // returns InvalidUnmarshalError. @@ -63,6 +110,20 @@ func UnmarshalExtJSON(data []byte, canonical bool, val interface{}) error { // UnmarshalExtJSONWithRegistry parses the extended JSON-encoded data using // Registry r and stores the result in the value pointed to by val. If val is // nil or not a pointer, UnmarshalWithRegistry returns InvalidUnmarshalError. +// +// Deprecated: Use [NewDecoder] and specify the Registry by calling [Decoder.SetRegistry] instead: +// +// vr, err := bsonrw.NewExtJSONValueReader(bytes.NewReader(data), true) +// if err != nil { +// panic(err) +// } +// dec, err := bson.NewDecoder(vr) +// if err != nil { +// panic(err) +// } +// dec.SetRegistry(reg) +// +// See [Decoder] for more examples. func UnmarshalExtJSONWithRegistry(r *bsoncodec.Registry, data []byte, canonical bool, val interface{}) error { ejvr, err := bsonrw.NewExtJSONValueReader(bytes.NewReader(data), canonical) if err != nil { @@ -75,6 +136,21 @@ func UnmarshalExtJSONWithRegistry(r *bsoncodec.Registry, data []byte, canonical // UnmarshalExtJSONWithContext parses the extended JSON-encoded data using // DecodeContext dc and stores the result in the value pointed to by val. If val is // nil or not a pointer, UnmarshalWithRegistry returns InvalidUnmarshalError. +// +// Deprecated: Use [NewDecoder] and use the Decoder configuration methods to set the desired unmarshal +// behavior instead: +// +// vr, err := bsonrw.NewExtJSONValueReader(bytes.NewReader(data), true) +// if err != nil { +// panic(err) +// } +// dec, err := bson.NewDecoder(vr) +// if err != nil { +// panic(err) +// } +// dec.DefaultDocumentM() +// +// See [Decoder] for more examples. func UnmarshalExtJSONWithContext(dc bsoncodec.DecodeContext, data []byte, canonical bool, val interface{}) error { ejvr, err := bsonrw.NewExtJSONValueReader(bytes.NewReader(data), canonical) if err != nil { diff --git a/vendor/go.mongodb.org/mongo-driver/event/monitoring.go b/vendor/go.mongodb.org/mongo-driver/event/monitoring.go index ac05e401cc..195fb6b46c 100644 --- a/vendor/go.mongodb.org/mongo-driver/event/monitoring.go +++ b/vendor/go.mongodb.org/mongo-driver/event/monitoring.go @@ -8,6 +8,7 @@ package event // import "go.mongodb.org/mongo-driver/event" import ( "context" + "time" "go.mongodb.org/mongo-driver/bson" "go.mongodb.org/mongo-driver/bson/primitive" @@ -23,8 +24,14 @@ type CommandStartedEvent struct { RequestID int64 ConnectionID string // ServerConnectionID contains the connection ID from the server of the operation. If the server does not return - // this value (e.g. on MDB < 4.2), it is unset. + // this value (e.g. on MDB < 4.2), it is unset. If the server connection ID would cause an int32 overflow, then + // then this field will be nil. + // + // Deprecated: Use ServerConnectionID64. ServerConnectionID *int32 + // ServerConnectionID64 contains the connection ID from the server of the operation. If the server does not + // return this value (e.g. on MDB < 4.2), it is unset. + ServerConnectionID64 *int64 // ServiceID contains the ID of the server to which the command was sent if it is running behind a load balancer. // Otherwise, it is unset. ServiceID *primitive.ObjectID @@ -32,13 +39,21 @@ type CommandStartedEvent struct { // CommandFinishedEvent represents a generic command finishing. type CommandFinishedEvent struct { + // Deprecated: Use Duration instead. DurationNanos int64 + Duration time.Duration CommandName string RequestID int64 ConnectionID string // ServerConnectionID contains the connection ID from the server of the operation. If the server does not return - // this value (e.g. on MDB < 4.2), it is unset. + // this value (e.g. on MDB < 4.2), it is unset.If the server connection ID would cause an int32 overflow, then + // this field will be nil. + // + // Deprecated: Use ServerConnectionID64. ServerConnectionID *int32 + // ServerConnectionID64 contains the connection ID from the server of the operation. If the server does not + // return this value (e.g. on MDB < 4.2), it is unset. + ServerConnectionID64 *int64 // ServiceID contains the ID of the server to which the command was sent if it is running behind a load balancer. // Otherwise, it is unset. ServiceID *primitive.ObjectID @@ -105,6 +120,7 @@ type PoolEvent struct { // ServiceID is only set if the Type is PoolCleared and the server is deployed behind a load balancer. This field // can be used to distinguish between individual servers in a load balanced deployment. ServiceID *primitive.ObjectID `json:"serviceId"` + Error error `json:"error"` } // PoolMonitor is a function that allows the user to gain access to events occurring in the pool @@ -157,7 +173,9 @@ type ServerHeartbeatStartedEvent struct { // ServerHeartbeatSucceededEvent is an event generated when the heartbeat succeeds. type ServerHeartbeatSucceededEvent struct { + // Deprecated: Use Duration instead. DurationNanos int64 + Duration time.Duration Reply description.Server ConnectionID string // The address this heartbeat was sent to with a unique identifier Awaited bool // If this heartbeat was awaitable @@ -165,7 +183,9 @@ type ServerHeartbeatSucceededEvent struct { // ServerHeartbeatFailedEvent is an event generated when the heartbeat fails. type ServerHeartbeatFailedEvent struct { + // Deprecated: Use Duration instead. DurationNanos int64 + Duration time.Duration Failure error ConnectionID string // The address this heartbeat was sent to with a unique identifier Awaited bool // If this heartbeat was awaitable diff --git a/vendor/go.mongodb.org/mongo-driver/internal/aws/awserr/error.go b/vendor/go.mongodb.org/mongo-driver/internal/aws/awserr/error.go new file mode 100644 index 0000000000..63d06a1769 --- /dev/null +++ b/vendor/go.mongodb.org/mongo-driver/internal/aws/awserr/error.go @@ -0,0 +1,60 @@ +// Copyright (C) MongoDB, Inc. 2023-present. +// +// Licensed under the Apache License, Version 2.0 (the "License"); you may +// not use this file except in compliance with the License. You may obtain +// a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 +// +// Based on github.com/aws/aws-sdk-go by Amazon.com, Inc. with code from: +// - github.com/aws/aws-sdk-go/blob/v1.44.225/aws/awserr/error.go +// See THIRD-PARTY-NOTICES for original license terms + +// Package awserr represents API error interface accessors for the SDK. +package awserr + +// An Error wraps lower level errors with code, message and an original error. +// The underlying concrete error type may also satisfy other interfaces which +// can be to used to obtain more specific information about the error. +type Error interface { + // Satisfy the generic error interface. + error + + // Returns the short phrase depicting the classification of the error. + Code() string + + // Returns the error details message. + Message() string + + // Returns the original error if one was set. Nil is returned if not set. + OrigErr() error +} + +// BatchedErrors is a batch of errors which also wraps lower level errors with +// code, message, and original errors. Calling Error() will include all errors +// that occurred in the batch. +// +// Replaces BatchError +type BatchedErrors interface { + // Satisfy the base Error interface. + Error + + // Returns the original error if one was set. Nil is returned if not set. + OrigErrs() []error +} + +// New returns an Error object described by the code, message, and origErr. +// +// If origErr satisfies the Error interface it will not be wrapped within a new +// Error object and will instead be returned. +func New(code, message string, origErr error) Error { + var errs []error + if origErr != nil { + errs = append(errs, origErr) + } + return newBaseError(code, message, errs) +} + +// NewBatchError returns an BatchedErrors with a collection of errors as an +// array of errors. +func NewBatchError(code, message string, errs []error) BatchedErrors { + return newBaseError(code, message, errs) +} diff --git a/vendor/go.mongodb.org/mongo-driver/internal/aws/awserr/types.go b/vendor/go.mongodb.org/mongo-driver/internal/aws/awserr/types.go new file mode 100644 index 0000000000..18cb4cda28 --- /dev/null +++ b/vendor/go.mongodb.org/mongo-driver/internal/aws/awserr/types.go @@ -0,0 +1,144 @@ +// Copyright (C) MongoDB, Inc. 2023-present. +// +// Licensed under the Apache License, Version 2.0 (the "License"); you may +// not use this file except in compliance with the License. You may obtain +// a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 +// +// Based on github.com/aws/aws-sdk-go by Amazon.com, Inc. with code from: +// - github.com/aws/aws-sdk-go/blob/v1.44.225/aws/awserr/types.go +// See THIRD-PARTY-NOTICES for original license terms + +package awserr + +import ( + "fmt" +) + +// SprintError returns a string of the formatted error code. +// +// Both extra and origErr are optional. If they are included their lines +// will be added, but if they are not included their lines will be ignored. +func SprintError(code, message, extra string, origErr error) string { + msg := fmt.Sprintf("%s: %s", code, message) + if extra != "" { + msg = fmt.Sprintf("%s\n\t%s", msg, extra) + } + if origErr != nil { + msg = fmt.Sprintf("%s\ncaused by: %s", msg, origErr.Error()) + } + return msg +} + +// A baseError wraps the code and message which defines an error. It also +// can be used to wrap an original error object. +// +// Should be used as the root for errors satisfying the awserr.Error. Also +// for any error which does not fit into a specific error wrapper type. +type baseError struct { + // Classification of error + code string + + // Detailed information about error + message string + + // Optional original error this error is based off of. Allows building + // chained errors. + errs []error +} + +// newBaseError returns an error object for the code, message, and errors. +// +// code is a short no whitespace phrase depicting the classification of +// the error that is being created. +// +// message is the free flow string containing detailed information about the +// error. +// +// origErrs is the error objects which will be nested under the new errors to +// be returned. +func newBaseError(code, message string, origErrs []error) *baseError { + b := &baseError{ + code: code, + message: message, + errs: origErrs, + } + + return b +} + +// Error returns the string representation of the error. +// +// See ErrorWithExtra for formatting. +// +// Satisfies the error interface. +func (b baseError) Error() string { + size := len(b.errs) + if size > 0 { + return SprintError(b.code, b.message, "", errorList(b.errs)) + } + + return SprintError(b.code, b.message, "", nil) +} + +// String returns the string representation of the error. +// Alias for Error to satisfy the stringer interface. +func (b baseError) String() string { + return b.Error() +} + +// Code returns the short phrase depicting the classification of the error. +func (b baseError) Code() string { + return b.code +} + +// Message returns the error details message. +func (b baseError) Message() string { + return b.message +} + +// OrigErr returns the original error if one was set. Nil is returned if no +// error was set. This only returns the first element in the list. If the full +// list is needed, use BatchedErrors. +func (b baseError) OrigErr() error { + switch len(b.errs) { + case 0: + return nil + case 1: + return b.errs[0] + default: + if err, ok := b.errs[0].(Error); ok { + return NewBatchError(err.Code(), err.Message(), b.errs[1:]) + } + return NewBatchError("BatchedErrors", + "multiple errors occurred", b.errs) + } +} + +// OrigErrs returns the original errors if one was set. An empty slice is +// returned if no error was set. +func (b baseError) OrigErrs() []error { + return b.errs +} + +// An error list that satisfies the golang interface +type errorList []error + +// Error returns the string representation of the error. +// +// Satisfies the error interface. +func (e errorList) Error() string { + msg := "" + // How do we want to handle the array size being zero + if size := len(e); size > 0 { + for i := 0; i < size; i++ { + msg += e[i].Error() + // We check the next index to see if it is within the slice. + // If it is, then we append a newline. We do this, because unit tests + // could be broken with the additional '\n' + if i+1 < size { + msg += "\n" + } + } + } + return msg +} diff --git a/vendor/go.mongodb.org/mongo-driver/internal/aws/credentials/chain_provider.go b/vendor/go.mongodb.org/mongo-driver/internal/aws/credentials/chain_provider.go new file mode 100644 index 0000000000..6843927153 --- /dev/null +++ b/vendor/go.mongodb.org/mongo-driver/internal/aws/credentials/chain_provider.go @@ -0,0 +1,72 @@ +// Copyright (C) MongoDB, Inc. 2023-present. +// +// Licensed under the Apache License, Version 2.0 (the "License"); you may +// not use this file except in compliance with the License. You may obtain +// a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 +// +// Based on github.com/aws/aws-sdk-go by Amazon.com, Inc. with code from: +// - github.com/aws/aws-sdk-go/blob/v1.44.225/aws/credentials/chain_provider.go +// See THIRD-PARTY-NOTICES for original license terms + +package credentials + +import ( + "go.mongodb.org/mongo-driver/internal/aws/awserr" +) + +// A ChainProvider will search for a provider which returns credentials +// and cache that provider until Retrieve is called again. +// +// The ChainProvider provides a way of chaining multiple providers together +// which will pick the first available using priority order of the Providers +// in the list. +// +// If none of the Providers retrieve valid credentials Value, ChainProvider's +// Retrieve() will return the error ErrNoValidProvidersFoundInChain. +// +// If a Provider is found which returns valid credentials Value ChainProvider +// will cache that Provider for all calls to IsExpired(), until Retrieve is +// called again. +type ChainProvider struct { + Providers []Provider + curr Provider +} + +// NewChainCredentials returns a pointer to a new Credentials object +// wrapping a chain of providers. +func NewChainCredentials(providers []Provider) *Credentials { + return NewCredentials(&ChainProvider{ + Providers: append([]Provider{}, providers...), + }) +} + +// Retrieve returns the credentials value or error if no provider returned +// without error. +// +// If a provider is found it will be cached and any calls to IsExpired() +// will return the expired state of the cached provider. +func (c *ChainProvider) Retrieve() (Value, error) { + var errs = make([]error, 0, len(c.Providers)) + for _, p := range c.Providers { + creds, err := p.Retrieve() + if err == nil { + c.curr = p + return creds, nil + } + errs = append(errs, err) + } + c.curr = nil + + var err = awserr.NewBatchError("NoCredentialProviders", "no valid providers in chain", errs) + return Value{}, err +} + +// IsExpired will returned the expired state of the currently cached provider +// if there is one. If there is no current provider, true will be returned. +func (c *ChainProvider) IsExpired() bool { + if c.curr != nil { + return c.curr.IsExpired() + } + + return true +} diff --git a/vendor/go.mongodb.org/mongo-driver/internal/aws/credentials/credentials.go b/vendor/go.mongodb.org/mongo-driver/internal/aws/credentials/credentials.go new file mode 100644 index 0000000000..53181aa163 --- /dev/null +++ b/vendor/go.mongodb.org/mongo-driver/internal/aws/credentials/credentials.go @@ -0,0 +1,197 @@ +// Copyright (C) MongoDB, Inc. 2023-present. +// +// Licensed under the Apache License, Version 2.0 (the "License"); you may +// not use this file except in compliance with the License. You may obtain +// a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 +// +// Based on github.com/aws/aws-sdk-go by Amazon.com, Inc. with code from: +// - github.com/aws/aws-sdk-go/blob/v1.44.225/aws/credentials/credentials.go +// See THIRD-PARTY-NOTICES for original license terms + +package credentials + +import ( + "context" + "sync" + "time" + + "go.mongodb.org/mongo-driver/internal/aws/awserr" + "golang.org/x/sync/singleflight" +) + +// A Value is the AWS credentials value for individual credential fields. +// +// A Value is also used to represent Azure credentials. +// Azure credentials only consist of an access token, which is stored in the `SessionToken` field. +type Value struct { + // AWS Access key ID + AccessKeyID string + + // AWS Secret Access Key + SecretAccessKey string + + // AWS Session Token + SessionToken string + + // Provider used to get credentials + ProviderName string +} + +// HasKeys returns if the credentials Value has both AccessKeyID and +// SecretAccessKey value set. +func (v Value) HasKeys() bool { + return len(v.AccessKeyID) != 0 && len(v.SecretAccessKey) != 0 +} + +// A Provider is the interface for any component which will provide credentials +// Value. A provider is required to manage its own Expired state, and what to +// be expired means. +// +// The Provider should not need to implement its own mutexes, because +// that will be managed by Credentials. +type Provider interface { + // Retrieve returns nil if it successfully retrieved the value. + // Error is returned if the value were not obtainable, or empty. + Retrieve() (Value, error) + + // IsExpired returns if the credentials are no longer valid, and need + // to be retrieved. + IsExpired() bool +} + +// ProviderWithContext is a Provider that can retrieve credentials with a Context +type ProviderWithContext interface { + Provider + + RetrieveWithContext(context.Context) (Value, error) +} + +// A Credentials provides concurrency safe retrieval of AWS credentials Value. +// +// A Credentials is also used to fetch Azure credentials Value. +// +// Credentials will cache the credentials value until they expire. Once the value +// expires the next Get will attempt to retrieve valid credentials. +// +// Credentials is safe to use across multiple goroutines and will manage the +// synchronous state so the Providers do not need to implement their own +// synchronization. +// +// The first Credentials.Get() will always call Provider.Retrieve() to get the +// first instance of the credentials Value. All calls to Get() after that +// will return the cached credentials Value until IsExpired() returns true. +type Credentials struct { + sf singleflight.Group + + m sync.RWMutex + creds Value + provider Provider +} + +// NewCredentials returns a pointer to a new Credentials with the provider set. +func NewCredentials(provider Provider) *Credentials { + c := &Credentials{ + provider: provider, + } + return c +} + +// GetWithContext returns the credentials value, or error if the credentials +// Value failed to be retrieved. Will return early if the passed in context is +// canceled. +// +// Will return the cached credentials Value if it has not expired. If the +// credentials Value has expired the Provider's Retrieve() will be called +// to refresh the credentials. +// +// If Credentials.Expire() was called the credentials Value will be force +// expired, and the next call to Get() will cause them to be refreshed. +func (c *Credentials) GetWithContext(ctx context.Context) (Value, error) { + // Check if credentials are cached, and not expired. + select { + case curCreds, ok := <-c.asyncIsExpired(): + // ok will only be true, of the credentials were not expired. ok will + // be false and have no value if the credentials are expired. + if ok { + return curCreds, nil + } + case <-ctx.Done(): + return Value{}, awserr.New("RequestCanceled", + "request context canceled", ctx.Err()) + } + + // Cannot pass context down to the actual retrieve, because the first + // context would cancel the whole group when there is not direct + // association of items in the group. + resCh := c.sf.DoChan("", func() (interface{}, error) { + return c.singleRetrieve(&suppressedContext{ctx}) + }) + select { + case res := <-resCh: + return res.Val.(Value), res.Err + case <-ctx.Done(): + return Value{}, awserr.New("RequestCanceled", + "request context canceled", ctx.Err()) + } +} + +func (c *Credentials) singleRetrieve(ctx context.Context) (interface{}, error) { + c.m.Lock() + defer c.m.Unlock() + + if curCreds := c.creds; !c.isExpiredLocked(curCreds) { + return curCreds, nil + } + + var creds Value + var err error + if p, ok := c.provider.(ProviderWithContext); ok { + creds, err = p.RetrieveWithContext(ctx) + } else { + creds, err = c.provider.Retrieve() + } + if err == nil { + c.creds = creds + } + + return creds, err +} + +// asyncIsExpired returns a channel of credentials Value. If the channel is +// closed the credentials are expired and credentials value are not empty. +func (c *Credentials) asyncIsExpired() <-chan Value { + ch := make(chan Value, 1) + go func() { + c.m.RLock() + defer c.m.RUnlock() + + if curCreds := c.creds; !c.isExpiredLocked(curCreds) { + ch <- curCreds + } + + close(ch) + }() + + return ch +} + +// isExpiredLocked helper method wrapping the definition of expired credentials. +func (c *Credentials) isExpiredLocked(creds interface{}) bool { + return creds == nil || creds.(Value) == Value{} || c.provider.IsExpired() +} + +type suppressedContext struct { + context.Context +} + +func (s *suppressedContext) Deadline() (deadline time.Time, ok bool) { + return time.Time{}, false +} + +func (s *suppressedContext) Done() <-chan struct{} { + return nil +} + +func (s *suppressedContext) Err() error { + return nil +} diff --git a/vendor/go.mongodb.org/mongo-driver/internal/aws/signer/v4/header_rules.go b/vendor/go.mongodb.org/mongo-driver/internal/aws/signer/v4/header_rules.go new file mode 100644 index 0000000000..a3726467f3 --- /dev/null +++ b/vendor/go.mongodb.org/mongo-driver/internal/aws/signer/v4/header_rules.go @@ -0,0 +1,51 @@ +// Copyright (C) MongoDB, Inc. 2017-present. +// +// Licensed under the Apache License, Version 2.0 (the "License"); you may +// not use this file except in compliance with the License. You may obtain +// a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 +// +// Based on github.com/aws/aws-sdk-go by Amazon.com, Inc. with code from: +// - github.com/aws/aws-sdk-go/blob/v1.44.225/aws/signer/v4/header_rules.go +// See THIRD-PARTY-NOTICES for original license terms + +package v4 + +// validator houses a set of rule needed for validation of a +// string value +type rules []rule + +// rule interface allows for more flexible rules and just simply +// checks whether or not a value adheres to that rule +type rule interface { + IsValid(value string) bool +} + +// IsValid will iterate through all rules and see if any rules +// apply to the value and supports nested rules +func (r rules) IsValid(value string) bool { + for _, rule := range r { + if rule.IsValid(value) { + return true + } + } + return false +} + +// mapRule generic rule for maps +type mapRule map[string]struct{} + +// IsValid for the map rule satisfies whether it exists in the map +func (m mapRule) IsValid(value string) bool { + _, ok := m[value] + return ok +} + +// excludeList is a generic rule for exclude listing +type excludeList struct { + rule +} + +// IsValid for exclude list checks if the value is within the exclude list +func (b excludeList) IsValid(value string) bool { + return !b.rule.IsValid(value) +} diff --git a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/auth/internal/awsv4/request.go b/vendor/go.mongodb.org/mongo-driver/internal/aws/signer/v4/request.go similarity index 96% rename from vendor/go.mongodb.org/mongo-driver/x/mongo/driver/auth/internal/awsv4/request.go rename to vendor/go.mongodb.org/mongo-driver/internal/aws/signer/v4/request.go index 014ee0833a..7a43bb303b 100644 --- a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/auth/internal/awsv4/request.go +++ b/vendor/go.mongodb.org/mongo-driver/internal/aws/signer/v4/request.go @@ -5,10 +5,10 @@ // a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 // // Based on github.com/aws/aws-sdk-go by Amazon.com, Inc. with code from: -// - github.com/aws/aws-sdk-go/blob/v1.34.28/aws/request/request.go +// - github.com/aws/aws-sdk-go/blob/v1.44.225/aws/request/request.go // See THIRD-PARTY-NOTICES for original license terms -package awsv4 +package v4 import ( "net/http" diff --git a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/auth/internal/awsv4/rest.go b/vendor/go.mongodb.org/mongo-driver/internal/aws/signer/v4/uri_path.go similarity index 72% rename from vendor/go.mongodb.org/mongo-driver/x/mongo/driver/auth/internal/awsv4/rest.go rename to vendor/go.mongodb.org/mongo-driver/internal/aws/signer/v4/uri_path.go index b1f86a0959..69b6005eb5 100644 --- a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/auth/internal/awsv4/rest.go +++ b/vendor/go.mongodb.org/mongo-driver/internal/aws/signer/v4/uri_path.go @@ -5,14 +5,17 @@ // a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 // // Based on github.com/aws/aws-sdk-go by Amazon.com, Inc. with code from: -// - github.com/aws/aws-sdk-go/blob/v1.34.28/private/protocol/rest/build.go +// - github.com/aws/aws-sdk-go/blob/v1.44.225/aws/signer/v4/uri_path.go +// - github.com/aws/aws-sdk-go/blob/v1.44.225/private/protocol/rest/build.go // See THIRD-PARTY-NOTICES for original license terms -package awsv4 +package v4 import ( "bytes" "fmt" + "net/url" + "strings" ) // Whether the byte value can be sent without escaping in AWS URLs @@ -31,6 +34,22 @@ func init() { } } +func getURIPath(u *url.URL) string { + var uri string + + if len(u.Opaque) > 0 { + uri = "/" + strings.Join(strings.Split(u.Opaque, "/")[3:], "/") + } else { + uri = u.EscapedPath() + } + + if len(uri) == 0 { + uri = "/" + } + + return uri +} + // EscapePath escapes part of a URL path in Amazon style func EscapePath(path string, encodeSep bool) string { var buf bytes.Buffer diff --git a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/auth/internal/awsv4/signer.go b/vendor/go.mongodb.org/mongo-driver/internal/aws/signer/v4/v4.go similarity index 80% rename from vendor/go.mongodb.org/mongo-driver/x/mongo/driver/auth/internal/awsv4/signer.go rename to vendor/go.mongodb.org/mongo-driver/internal/aws/signer/v4/v4.go index 23508c1f77..6cf4586bb9 100644 --- a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/auth/internal/awsv4/signer.go +++ b/vendor/go.mongodb.org/mongo-driver/internal/aws/signer/v4/v4.go @@ -5,13 +5,10 @@ // a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 // // Based on github.com/aws/aws-sdk-go by Amazon.com, Inc. with code from: -// - github.com/aws/aws-sdk-go/blob/v1.34.28/aws/request/request.go -// - github.com/aws/aws-sdk-go/blob/v1.34.28/aws/signer/v4/v4.go -// - github.com/aws/aws-sdk-go/blob/v1.34.28/aws/signer/v4/uri_path.go -// - github.com/aws/aws-sdk-go/blob/v1.34.28/aws/types.go +// - github.com/aws/aws-sdk-go/blob/v1.44.225/aws/signer/v4/v4.go // See THIRD-PARTY-NOTICES for original license terms -package awsv4 +package v4 import ( "crypto/hmac" @@ -25,6 +22,9 @@ import ( "sort" "strings" "time" + + "go.mongodb.org/mongo-driver/internal/aws" + "go.mongodb.org/mongo-driver/internal/aws/credentials" ) const ( @@ -41,7 +41,7 @@ const ( ) var ignoredHeaders = rules{ - denylist{ + excludeList{ mapRule{ authorizationHeader: struct{}{}, "User-Agent": struct{}{}, @@ -53,13 +53,13 @@ var ignoredHeaders = rules{ // Signer applies AWS v4 signing to given request. Use this to sign requests // that need to be signed with AWS V4 Signatures. type Signer struct { - Credentials *StaticProvider + // The authentication credentials the request will be signed against. + // This value must be set to sign requests. + Credentials *credentials.Credentials } -// NewSigner returns a Signer pointer configured with the credentials and optional -// option values provided. If not options are provided the Signer will use its -// default configuration. -func NewSigner(credentials *StaticProvider) *Signer { +// NewSigner returns a Signer pointer configured with the credentials provided. +func NewSigner(credentials *credentials.Credentials) *Signer { v4 := &Signer{ Credentials: credentials, } @@ -76,7 +76,7 @@ type signingCtx struct { Time time.Time SignedHeaderVals http.Header - credValues Value + credValues credentials.Value bodyDigest string signedHeaders string @@ -85,7 +85,6 @@ type signingCtx struct { credentialString string stringToSign string signature string - authorization string } // Sign signs AWS v4 requests with the provided body, service name, region the @@ -136,7 +135,7 @@ func (v4 Signer) signWithBody(r *http.Request, body io.ReadSeeker, service, regi } var err error - ctx.credValues, err = v4.Credentials.Retrieve() + ctx.credValues, err = v4.Credentials.GetWithContext(r.Context()) if err != nil { return http.Header{}, err } @@ -200,31 +199,6 @@ func (ctx *signingCtx) build() error { return nil } -// GetSignedRequestSignature attempts to extract the signature of the request. -// Returning an error if the request is unsigned, or unable to extract the -// signature. -func GetSignedRequestSignature(r *http.Request) ([]byte, error) { - - if auth := r.Header.Get(authorizationHeader); len(auth) != 0 { - ps := strings.Split(auth, ", ") - for _, p := range ps { - if idx := strings.Index(p, authHeaderSignatureElem); idx >= 0 { - sig := p[len(authHeaderSignatureElem):] - if len(sig) == 0 { - return nil, fmt.Errorf("invalid request signature authorization header") - } - return hex.DecodeString(sig) - } - } - } - - if sig := r.URL.Query().Get("X-Amz-Signature"); len(sig) != 0 { - return hex.DecodeString(sig) - } - - return nil, fmt.Errorf("request not signed") -} - func (ctx *signingCtx) buildTime() { ctx.Request.Header.Set("X-Amz-Date", formatTime(ctx.Time)) } @@ -234,7 +208,7 @@ func (ctx *signingCtx) buildCredentialString() { } func (ctx *signingCtx) buildCanonicalHeaders(r rule, header http.Header) { - headers := make([]string, 0, len(header)) + headers := make([]string, 0, len(header)+1) headers = append(headers, "host") for k, v := range header { if !r.IsValid(k) { @@ -258,37 +232,25 @@ func (ctx *signingCtx) buildCanonicalHeaders(r rule, header http.Header) { ctx.signedHeaders = strings.Join(headers, ";") - headerValues := make([]string, len(headers)) + headerItems := make([]string, len(headers)) for i, k := range headers { if k == "host" { if ctx.Request.Host != "" { - headerValues[i] = "host:" + ctx.Request.Host + headerItems[i] = "host:" + ctx.Request.Host } else { - headerValues[i] = "host:" + ctx.Request.URL.Host + headerItems[i] = "host:" + ctx.Request.URL.Host } } else { - headerValues[i] = k + ":" + - strings.Join(ctx.SignedHeaderVals[k], ",") + headerValues := make([]string, len(ctx.SignedHeaderVals[k])) + for i, v := range ctx.SignedHeaderVals[k] { + headerValues[i] = strings.TrimSpace(v) + } + headerItems[i] = k + ":" + + strings.Join(headerValues, ",") } } - stripExcessSpaces(headerValues) - ctx.canonicalHeaders = strings.Join(headerValues, "\n") -} - -func getURIPath(u *url.URL) string { - var uri string - - if len(u.Opaque) > 0 { - uri = "/" + strings.Join(strings.Split(u.Opaque, "/")[3:], "/") - } else { - uri = u.EscapedPath() - } - - if len(uri) == 0 { - uri = "/" - } - - return uri + stripExcessSpaces(headerItems) + ctx.canonicalHeaders = strings.Join(headerItems, "\n") } func (ctx *signingCtx) buildCanonicalString() { @@ -329,6 +291,9 @@ func (ctx *signingCtx) buildBodyDigest() error { if ctx.Body == nil { hash = emptyStringSHA256 } else { + if !aws.IsReaderSeekable(ctx.Body) { + return fmt.Errorf("cannot use unseekable request body %T, for signed request with body", ctx.Body) + } hashBytes, err := makeSha256Reader(ctx.Body) if err != nil { return err @@ -358,27 +323,6 @@ func hashSHA256(data []byte) []byte { return hash.Sum(nil) } -// seekerLen attempts to get the number of bytes remaining at the seeker's -// current position. Returns the number of bytes remaining or error. -func seekerLen(s io.Seeker) (int64, error) { - curOffset, err := s.Seek(0, io.SeekCurrent) - if err != nil { - return 0, err - } - - endOffset, err := s.Seek(0, io.SeekEnd) - if err != nil { - return 0, err - } - - _, err = s.Seek(curOffset, io.SeekStart) - if err != nil { - return 0, err - } - - return endOffset - curOffset, nil -} - func makeSha256Reader(reader io.ReadSeeker) (hashBytes []byte, err error) { hash := sha256.New() start, err := reader.Seek(0, io.SeekCurrent) @@ -392,7 +336,7 @@ func makeSha256Reader(reader io.ReadSeeker) (hashBytes []byte, err error) { // Use CopyN to avoid allocating the 32KB buffer in io.Copy for bodies // smaller than 32KB. Fall back to io.Copy if we fail to determine the size. - size, err := seekerLen(reader) + size, err := aws.SeekerLen(reader) if err != nil { _, _ = io.Copy(hash, reader) } else { @@ -409,6 +353,8 @@ const doubleSpace = " " func stripExcessSpaces(vals []string) { var j, k, l, m, spaces int for i, str := range vals { + // revive:disable:empty-block + // Trim trailing spaces for j = len(str) - 1; j >= 0 && str[j] == ' '; j-- { } @@ -416,6 +362,9 @@ func stripExcessSpaces(vals []string) { // Trim leading spaces for k = 0; k < j && str[k] == ' '; k++ { } + + // revive:enable:empty-block + str = str[k : j+1] // Strip multiple spaces. diff --git a/vendor/go.mongodb.org/mongo-driver/internal/aws/types.go b/vendor/go.mongodb.org/mongo-driver/internal/aws/types.go new file mode 100644 index 0000000000..52aecda76b --- /dev/null +++ b/vendor/go.mongodb.org/mongo-driver/internal/aws/types.go @@ -0,0 +1,153 @@ +// Copyright (C) MongoDB, Inc. 2023-present. +// +// Licensed under the Apache License, Version 2.0 (the "License"); you may +// not use this file except in compliance with the License. You may obtain +// a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 +// +// Based on github.com/aws/aws-sdk-go by Amazon.com, Inc. with code from: +// - github.com/aws/aws-sdk-go/blob/v1.44.225/aws/types.go +// See THIRD-PARTY-NOTICES for original license terms + +package aws + +import ( + "io" +) + +// ReadSeekCloser wraps a io.Reader returning a ReaderSeekerCloser. Allows the +// SDK to accept an io.Reader that is not also an io.Seeker for unsigned +// streaming payload API operations. +// +// A ReadSeekCloser wrapping an nonseekable io.Reader used in an API +// operation's input will prevent that operation being retried in the case of +// network errors, and cause operation requests to fail if the operation +// requires payload signing. +// +// Note: If using With S3 PutObject to stream an object upload The SDK's S3 +// Upload manager (s3manager.Uploader) provides support for streaming with the +// ability to retry network errors. +func ReadSeekCloser(r io.Reader) ReaderSeekerCloser { + return ReaderSeekerCloser{r} +} + +// ReaderSeekerCloser represents a reader that can also delegate io.Seeker and +// io.Closer interfaces to the underlying object if they are available. +type ReaderSeekerCloser struct { + r io.Reader +} + +// IsReaderSeekable returns if the underlying reader type can be seeked. A +// io.Reader might not actually be seekable if it is the ReaderSeekerCloser +// type. +func IsReaderSeekable(r io.Reader) bool { + switch v := r.(type) { + case ReaderSeekerCloser: + return v.IsSeeker() + case *ReaderSeekerCloser: + return v.IsSeeker() + case io.ReadSeeker: + return true + default: + return false + } +} + +// Read reads from the reader up to size of p. The number of bytes read, and +// error if it occurred will be returned. +// +// If the reader is not an io.Reader zero bytes read, and nil error will be +// returned. +// +// Performs the same functionality as io.Reader Read +func (r ReaderSeekerCloser) Read(p []byte) (int, error) { + switch t := r.r.(type) { + case io.Reader: + return t.Read(p) + } + return 0, nil +} + +// Seek sets the offset for the next Read to offset, interpreted according to +// whence: 0 means relative to the origin of the file, 1 means relative to the +// current offset, and 2 means relative to the end. Seek returns the new offset +// and an error, if any. +// +// If the ReaderSeekerCloser is not an io.Seeker nothing will be done. +func (r ReaderSeekerCloser) Seek(offset int64, whence int) (int64, error) { + switch t := r.r.(type) { + case io.Seeker: + return t.Seek(offset, whence) + } + return int64(0), nil +} + +// IsSeeker returns if the underlying reader is also a seeker. +func (r ReaderSeekerCloser) IsSeeker() bool { + _, ok := r.r.(io.Seeker) + return ok +} + +// HasLen returns the length of the underlying reader if the value implements +// the Len() int method. +func (r ReaderSeekerCloser) HasLen() (int, bool) { + type lenner interface { + Len() int + } + + if lr, ok := r.r.(lenner); ok { + return lr.Len(), true + } + + return 0, false +} + +// GetLen returns the length of the bytes remaining in the underlying reader. +// Checks first for Len(), then io.Seeker to determine the size of the +// underlying reader. +// +// Will return -1 if the length cannot be determined. +func (r ReaderSeekerCloser) GetLen() (int64, error) { + if l, ok := r.HasLen(); ok { + return int64(l), nil + } + + if s, ok := r.r.(io.Seeker); ok { + return seekerLen(s) + } + + return -1, nil +} + +// SeekerLen attempts to get the number of bytes remaining at the seeker's +// current position. Returns the number of bytes remaining or error. +func SeekerLen(s io.Seeker) (int64, error) { + // Determine if the seeker is actually seekable. ReaderSeekerCloser + // hides the fact that a io.Readers might not actually be seekable. + switch v := s.(type) { + case ReaderSeekerCloser: + return v.GetLen() + case *ReaderSeekerCloser: + return v.GetLen() + } + + return seekerLen(s) +} + +func seekerLen(s io.Seeker) (int64, error) { + curOffset, err := s.Seek(0, io.SeekCurrent) + if err != nil { + return 0, err + } + + endOffset, err := s.Seek(0, io.SeekEnd) + if err != nil { + return 0, err + } + + _, err = s.Seek(curOffset, io.SeekStart) + if err != nil { + return 0, err + } + + return endOffset - curOffset, nil +} diff --git a/vendor/go.mongodb.org/mongo-driver/internal/credproviders/assume_role_provider.go b/vendor/go.mongodb.org/mongo-driver/internal/credproviders/assume_role_provider.go new file mode 100644 index 0000000000..3a95cf401d --- /dev/null +++ b/vendor/go.mongodb.org/mongo-driver/internal/credproviders/assume_role_provider.go @@ -0,0 +1,148 @@ +// Copyright (C) MongoDB, Inc. 2023-present. +// +// Licensed under the Apache License, Version 2.0 (the "License"); you may +// not use this file except in compliance with the License. You may obtain +// a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 + +package credproviders + +import ( + "context" + "encoding/json" + "errors" + "fmt" + "io/ioutil" + "net/http" + "time" + + "go.mongodb.org/mongo-driver/internal/aws/credentials" + "go.mongodb.org/mongo-driver/internal/uuid" +) + +const ( + // assumeRoleProviderName provides a name of assume role provider + assumeRoleProviderName = "AssumeRoleProvider" + + stsURI = `https://sts.amazonaws.com/?Action=AssumeRoleWithWebIdentity&RoleSessionName=%s&RoleArn=%s&WebIdentityToken=%s&Version=2011-06-15` +) + +// An AssumeRoleProvider retrieves credentials for assume role with web identity. +type AssumeRoleProvider struct { + AwsRoleArnEnv EnvVar + AwsWebIdentityTokenFileEnv EnvVar + AwsRoleSessionNameEnv EnvVar + + httpClient *http.Client + expiration time.Time + + // expiryWindow will allow the credentials to trigger refreshing prior to the credentials actually expiring. + // This is beneficial so expiring credentials do not cause request to fail unexpectedly due to exceptions. + // + // So a ExpiryWindow of 10s would cause calls to IsExpired() to return true + // 10 seconds before the credentials are actually expired. + expiryWindow time.Duration +} + +// NewAssumeRoleProvider returns a pointer to an assume role provider. +func NewAssumeRoleProvider(httpClient *http.Client, expiryWindow time.Duration) *AssumeRoleProvider { + return &AssumeRoleProvider{ + // AwsRoleArnEnv is the environment variable for AWS_ROLE_ARN + AwsRoleArnEnv: EnvVar("AWS_ROLE_ARN"), + // AwsWebIdentityTokenFileEnv is the environment variable for AWS_WEB_IDENTITY_TOKEN_FILE + AwsWebIdentityTokenFileEnv: EnvVar("AWS_WEB_IDENTITY_TOKEN_FILE"), + // AwsRoleSessionNameEnv is the environment variable for AWS_ROLE_SESSION_NAME + AwsRoleSessionNameEnv: EnvVar("AWS_ROLE_SESSION_NAME"), + httpClient: httpClient, + expiryWindow: expiryWindow, + } +} + +// RetrieveWithContext retrieves the keys from the AWS service. +func (a *AssumeRoleProvider) RetrieveWithContext(ctx context.Context) (credentials.Value, error) { + const defaultHTTPTimeout = 10 * time.Second + + v := credentials.Value{ProviderName: assumeRoleProviderName} + + roleArn := a.AwsRoleArnEnv.Get() + tokenFile := a.AwsWebIdentityTokenFileEnv.Get() + if tokenFile == "" && roleArn == "" { + return v, errors.New("AWS_WEB_IDENTITY_TOKEN_FILE and AWS_ROLE_ARN are missing") + } + if tokenFile != "" && roleArn == "" { + return v, errors.New("AWS_WEB_IDENTITY_TOKEN_FILE is set, but AWS_ROLE_ARN is missing") + } + if tokenFile == "" && roleArn != "" { + return v, errors.New("AWS_ROLE_ARN is set, but AWS_WEB_IDENTITY_TOKEN_FILE is missing") + } + token, err := ioutil.ReadFile(tokenFile) + if err != nil { + return v, err + } + + sessionName := a.AwsRoleSessionNameEnv.Get() + if sessionName == "" { + // Use a UUID if the RoleSessionName is not given. + id, err := uuid.New() + if err != nil { + return v, err + } + sessionName = id.String() + } + + fullURI := fmt.Sprintf(stsURI, sessionName, roleArn, string(token)) + + req, err := http.NewRequest(http.MethodPost, fullURI, nil) + if err != nil { + return v, err + } + req.Header.Set("Accept", "application/json") + + ctx, cancel := context.WithTimeout(ctx, defaultHTTPTimeout) + defer cancel() + resp, err := a.httpClient.Do(req.WithContext(ctx)) + if err != nil { + return v, err + } + defer resp.Body.Close() + if resp.StatusCode != http.StatusOK { + return v, fmt.Errorf("response failure: %s", resp.Status) + } + + var stsResp struct { + Response struct { + Result struct { + Credentials struct { + AccessKeyID string `json:"AccessKeyId"` + SecretAccessKey string `json:"SecretAccessKey"` + Token string `json:"SessionToken"` + Expiration float64 `json:"Expiration"` + } `json:"Credentials"` + } `json:"AssumeRoleWithWebIdentityResult"` + } `json:"AssumeRoleWithWebIdentityResponse"` + } + + err = json.NewDecoder(resp.Body).Decode(&stsResp) + if err != nil { + return v, err + } + v.AccessKeyID = stsResp.Response.Result.Credentials.AccessKeyID + v.SecretAccessKey = stsResp.Response.Result.Credentials.SecretAccessKey + v.SessionToken = stsResp.Response.Result.Credentials.Token + if !v.HasKeys() { + return v, errors.New("failed to retrieve web identity keys") + } + sec := int64(stsResp.Response.Result.Credentials.Expiration) + a.expiration = time.Unix(sec, 0).Add(-a.expiryWindow) + + return v, nil +} + +// Retrieve retrieves the keys from the AWS service. +func (a *AssumeRoleProvider) Retrieve() (credentials.Value, error) { + return a.RetrieveWithContext(context.Background()) +} + +// IsExpired returns true if the credentials are expired. +func (a *AssumeRoleProvider) IsExpired() bool { + return a.expiration.Before(time.Now()) +} diff --git a/vendor/go.mongodb.org/mongo-driver/internal/credproviders/ec2_provider.go b/vendor/go.mongodb.org/mongo-driver/internal/credproviders/ec2_provider.go new file mode 100644 index 0000000000..771bfca134 --- /dev/null +++ b/vendor/go.mongodb.org/mongo-driver/internal/credproviders/ec2_provider.go @@ -0,0 +1,183 @@ +// Copyright (C) MongoDB, Inc. 2023-present. +// +// Licensed under the Apache License, Version 2.0 (the "License"); you may +// not use this file except in compliance with the License. You may obtain +// a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 + +package credproviders + +import ( + "context" + "encoding/json" + "errors" + "fmt" + "io/ioutil" + "net/http" + "time" + + "go.mongodb.org/mongo-driver/internal/aws/credentials" +) + +const ( + // ec2ProviderName provides a name of EC2 provider + ec2ProviderName = "EC2Provider" + + awsEC2URI = "http://169.254.169.254/" + awsEC2RolePath = "latest/meta-data/iam/security-credentials/" + awsEC2TokenPath = "latest/api/token" + + defaultHTTPTimeout = 10 * time.Second +) + +// An EC2Provider retrieves credentials from EC2 metadata. +type EC2Provider struct { + httpClient *http.Client + expiration time.Time + + // expiryWindow will allow the credentials to trigger refreshing prior to the credentials actually expiring. + // This is beneficial so expiring credentials do not cause request to fail unexpectedly due to exceptions. + // + // So a ExpiryWindow of 10s would cause calls to IsExpired() to return true + // 10 seconds before the credentials are actually expired. + expiryWindow time.Duration +} + +// NewEC2Provider returns a pointer to an EC2 credential provider. +func NewEC2Provider(httpClient *http.Client, expiryWindow time.Duration) *EC2Provider { + return &EC2Provider{ + httpClient: httpClient, + expiryWindow: expiryWindow, + } +} + +func (e *EC2Provider) getToken(ctx context.Context) (string, error) { + req, err := http.NewRequest(http.MethodPut, awsEC2URI+awsEC2TokenPath, nil) + if err != nil { + return "", err + } + const defaultEC2TTLSeconds = "30" + req.Header.Set("X-aws-ec2-metadata-token-ttl-seconds", defaultEC2TTLSeconds) + + ctx, cancel := context.WithTimeout(ctx, defaultHTTPTimeout) + defer cancel() + resp, err := e.httpClient.Do(req.WithContext(ctx)) + if err != nil { + return "", err + } + defer resp.Body.Close() + if resp.StatusCode != http.StatusOK { + return "", fmt.Errorf("%s %s failed: %s", req.Method, req.URL.String(), resp.Status) + } + + token, err := ioutil.ReadAll(resp.Body) + if err != nil { + return "", err + } + if len(token) == 0 { + return "", errors.New("unable to retrieve token from EC2 metadata") + } + return string(token), nil +} + +func (e *EC2Provider) getRoleName(ctx context.Context, token string) (string, error) { + req, err := http.NewRequest(http.MethodGet, awsEC2URI+awsEC2RolePath, nil) + if err != nil { + return "", err + } + req.Header.Set("X-aws-ec2-metadata-token", token) + + ctx, cancel := context.WithTimeout(ctx, defaultHTTPTimeout) + defer cancel() + resp, err := e.httpClient.Do(req.WithContext(ctx)) + if err != nil { + return "", err + } + defer resp.Body.Close() + if resp.StatusCode != http.StatusOK { + return "", fmt.Errorf("%s %s failed: %s", req.Method, req.URL.String(), resp.Status) + } + + role, err := ioutil.ReadAll(resp.Body) + if err != nil { + return "", err + } + if len(role) == 0 { + return "", errors.New("unable to retrieve role_name from EC2 metadata") + } + return string(role), nil +} + +func (e *EC2Provider) getCredentials(ctx context.Context, token string, role string) (credentials.Value, time.Time, error) { + v := credentials.Value{ProviderName: ec2ProviderName} + + pathWithRole := awsEC2URI + awsEC2RolePath + role + req, err := http.NewRequest(http.MethodGet, pathWithRole, nil) + if err != nil { + return v, time.Time{}, err + } + req.Header.Set("X-aws-ec2-metadata-token", token) + ctx, cancel := context.WithTimeout(ctx, defaultHTTPTimeout) + defer cancel() + resp, err := e.httpClient.Do(req.WithContext(ctx)) + if err != nil { + return v, time.Time{}, err + } + defer resp.Body.Close() + if resp.StatusCode != http.StatusOK { + return v, time.Time{}, fmt.Errorf("%s %s failed: %s", req.Method, req.URL.String(), resp.Status) + } + + var ec2Resp struct { + AccessKeyID string `json:"AccessKeyId"` + SecretAccessKey string `json:"SecretAccessKey"` + Token string `json:"Token"` + Expiration time.Time `json:"Expiration"` + } + + err = json.NewDecoder(resp.Body).Decode(&ec2Resp) + if err != nil { + return v, time.Time{}, err + } + + v.AccessKeyID = ec2Resp.AccessKeyID + v.SecretAccessKey = ec2Resp.SecretAccessKey + v.SessionToken = ec2Resp.Token + + return v, ec2Resp.Expiration, nil +} + +// RetrieveWithContext retrieves the keys from the AWS service. +func (e *EC2Provider) RetrieveWithContext(ctx context.Context) (credentials.Value, error) { + v := credentials.Value{ProviderName: ec2ProviderName} + + token, err := e.getToken(ctx) + if err != nil { + return v, err + } + + role, err := e.getRoleName(ctx, token) + if err != nil { + return v, err + } + + v, exp, err := e.getCredentials(ctx, token, role) + if err != nil { + return v, err + } + if !v.HasKeys() { + return v, errors.New("failed to retrieve EC2 keys") + } + e.expiration = exp.Add(-e.expiryWindow) + + return v, nil +} + +// Retrieve retrieves the keys from the AWS service. +func (e *EC2Provider) Retrieve() (credentials.Value, error) { + return e.RetrieveWithContext(context.Background()) +} + +// IsExpired returns true if the credentials are expired. +func (e *EC2Provider) IsExpired() bool { + return e.expiration.Before(time.Now()) +} diff --git a/vendor/go.mongodb.org/mongo-driver/internal/credproviders/ecs_provider.go b/vendor/go.mongodb.org/mongo-driver/internal/credproviders/ecs_provider.go new file mode 100644 index 0000000000..0c3a27e626 --- /dev/null +++ b/vendor/go.mongodb.org/mongo-driver/internal/credproviders/ecs_provider.go @@ -0,0 +1,112 @@ +// Copyright (C) MongoDB, Inc. 2023-present. +// +// Licensed under the Apache License, Version 2.0 (the "License"); you may +// not use this file except in compliance with the License. You may obtain +// a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 + +package credproviders + +import ( + "context" + "encoding/json" + "errors" + "fmt" + "net/http" + "time" + + "go.mongodb.org/mongo-driver/internal/aws/credentials" +) + +const ( + // ecsProviderName provides a name of ECS provider + ecsProviderName = "ECSProvider" + + awsRelativeURI = "http://169.254.170.2/" +) + +// An ECSProvider retrieves credentials from ECS metadata. +type ECSProvider struct { + AwsContainerCredentialsRelativeURIEnv EnvVar + + httpClient *http.Client + expiration time.Time + + // expiryWindow will allow the credentials to trigger refreshing prior to the credentials actually expiring. + // This is beneficial so expiring credentials do not cause request to fail unexpectedly due to exceptions. + // + // So a ExpiryWindow of 10s would cause calls to IsExpired() to return true + // 10 seconds before the credentials are actually expired. + expiryWindow time.Duration +} + +// NewECSProvider returns a pointer to an ECS credential provider. +func NewECSProvider(httpClient *http.Client, expiryWindow time.Duration) *ECSProvider { + return &ECSProvider{ + // AwsContainerCredentialsRelativeURIEnv is the environment variable for AWS_CONTAINER_CREDENTIALS_RELATIVE_URI + AwsContainerCredentialsRelativeURIEnv: EnvVar("AWS_CONTAINER_CREDENTIALS_RELATIVE_URI"), + httpClient: httpClient, + expiryWindow: expiryWindow, + } +} + +// RetrieveWithContext retrieves the keys from the AWS service. +func (e *ECSProvider) RetrieveWithContext(ctx context.Context) (credentials.Value, error) { + const defaultHTTPTimeout = 10 * time.Second + + v := credentials.Value{ProviderName: ecsProviderName} + + relativeEcsURI := e.AwsContainerCredentialsRelativeURIEnv.Get() + if len(relativeEcsURI) == 0 { + return v, errors.New("AWS_CONTAINER_CREDENTIALS_RELATIVE_URI is missing") + } + fullURI := awsRelativeURI + relativeEcsURI + + req, err := http.NewRequest(http.MethodGet, fullURI, nil) + if err != nil { + return v, err + } + req.Header.Set("Accept", "application/json") + + ctx, cancel := context.WithTimeout(ctx, defaultHTTPTimeout) + defer cancel() + resp, err := e.httpClient.Do(req.WithContext(ctx)) + if err != nil { + return v, err + } + defer resp.Body.Close() + if resp.StatusCode != http.StatusOK { + return v, fmt.Errorf("response failure: %s", resp.Status) + } + + var ecsResp struct { + AccessKeyID string `json:"AccessKeyId"` + SecretAccessKey string `json:"SecretAccessKey"` + Token string `json:"Token"` + Expiration time.Time `json:"Expiration"` + } + + err = json.NewDecoder(resp.Body).Decode(&ecsResp) + if err != nil { + return v, err + } + + v.AccessKeyID = ecsResp.AccessKeyID + v.SecretAccessKey = ecsResp.SecretAccessKey + v.SessionToken = ecsResp.Token + if !v.HasKeys() { + return v, errors.New("failed to retrieve ECS keys") + } + e.expiration = ecsResp.Expiration.Add(-e.expiryWindow) + + return v, nil +} + +// Retrieve retrieves the keys from the AWS service. +func (e *ECSProvider) Retrieve() (credentials.Value, error) { + return e.RetrieveWithContext(context.Background()) +} + +// IsExpired returns true if the credentials are expired. +func (e *ECSProvider) IsExpired() bool { + return e.expiration.Before(time.Now()) +} diff --git a/vendor/go.mongodb.org/mongo-driver/internal/credproviders/env_provider.go b/vendor/go.mongodb.org/mongo-driver/internal/credproviders/env_provider.go new file mode 100644 index 0000000000..59ca633635 --- /dev/null +++ b/vendor/go.mongodb.org/mongo-driver/internal/credproviders/env_provider.go @@ -0,0 +1,69 @@ +// Copyright (C) MongoDB, Inc. 2023-present. +// +// Licensed under the Apache License, Version 2.0 (the "License"); you may +// not use this file except in compliance with the License. You may obtain +// a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 + +package credproviders + +import ( + "os" + + "go.mongodb.org/mongo-driver/internal/aws/credentials" +) + +// envProviderName provides a name of Env provider +const envProviderName = "EnvProvider" + +// EnvVar is an environment variable +type EnvVar string + +// Get retrieves the environment variable +func (ev EnvVar) Get() string { + return os.Getenv(string(ev)) +} + +// A EnvProvider retrieves credentials from the environment variables of the +// running process. Environment credentials never expire. +type EnvProvider struct { + AwsAccessKeyIDEnv EnvVar + AwsSecretAccessKeyEnv EnvVar + AwsSessionTokenEnv EnvVar + + retrieved bool +} + +// NewEnvProvider returns a pointer to an ECS credential provider. +func NewEnvProvider() *EnvProvider { + return &EnvProvider{ + // AwsAccessKeyIDEnv is the environment variable for AWS_ACCESS_KEY_ID + AwsAccessKeyIDEnv: EnvVar("AWS_ACCESS_KEY_ID"), + // AwsSecretAccessKeyEnv is the environment variable for AWS_SECRET_ACCESS_KEY + AwsSecretAccessKeyEnv: EnvVar("AWS_SECRET_ACCESS_KEY"), + // AwsSessionTokenEnv is the environment variable for AWS_SESSION_TOKEN + AwsSessionTokenEnv: EnvVar("AWS_SESSION_TOKEN"), + } +} + +// Retrieve retrieves the keys from the environment. +func (e *EnvProvider) Retrieve() (credentials.Value, error) { + e.retrieved = false + + v := credentials.Value{ + AccessKeyID: e.AwsAccessKeyIDEnv.Get(), + SecretAccessKey: e.AwsSecretAccessKeyEnv.Get(), + SessionToken: e.AwsSessionTokenEnv.Get(), + ProviderName: envProviderName, + } + err := verify(v) + if err == nil { + e.retrieved = true + } + + return v, err +} + +// IsExpired returns true if the credentials have not been retrieved. +func (e *EnvProvider) IsExpired() bool { + return !e.retrieved +} diff --git a/vendor/go.mongodb.org/mongo-driver/internal/credproviders/imds_provider.go b/vendor/go.mongodb.org/mongo-driver/internal/credproviders/imds_provider.go new file mode 100644 index 0000000000..4d2a95b2e8 --- /dev/null +++ b/vendor/go.mongodb.org/mongo-driver/internal/credproviders/imds_provider.go @@ -0,0 +1,104 @@ +// Copyright (C) MongoDB, Inc. 2023-present. +// +// Licensed under the Apache License, Version 2.0 (the "License"); you may +// not use this file except in compliance with the License. You may obtain +// a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 + +package credproviders + +import ( + "context" + "encoding/json" + "fmt" + "io/ioutil" + "net/http" + "net/url" + "time" + + "go.mongodb.org/mongo-driver/internal" + "go.mongodb.org/mongo-driver/internal/aws/credentials" +) + +const ( + // AzureProviderName provides a name of Azure provider + AzureProviderName = "AzureProvider" + + azureURI = "http://169.254.169.254/metadata/identity/oauth2/token" +) + +// An AzureProvider retrieves credentials from Azure IMDS. +type AzureProvider struct { + httpClient *http.Client + expiration time.Time + expiryWindow time.Duration +} + +// NewAzureProvider returns a pointer to an Azure credential provider. +func NewAzureProvider(httpClient *http.Client, expiryWindow time.Duration) *AzureProvider { + return &AzureProvider{ + httpClient: httpClient, + expiration: time.Time{}, + expiryWindow: expiryWindow, + } +} + +// RetrieveWithContext retrieves the keys from the Azure service. +func (a *AzureProvider) RetrieveWithContext(ctx context.Context) (credentials.Value, error) { + v := credentials.Value{ProviderName: AzureProviderName} + req, err := http.NewRequest(http.MethodGet, azureURI, nil) + if err != nil { + return v, internal.WrapErrorf(err, "unable to retrieve Azure credentials") + } + q := make(url.Values) + q.Set("api-version", "2018-02-01") + q.Set("resource", "https://vault.azure.net") + req.URL.RawQuery = q.Encode() + req.Header.Set("Metadata", "true") + req.Header.Set("Accept", "application/json") + + resp, err := a.httpClient.Do(req.WithContext(ctx)) + if err != nil { + return v, internal.WrapErrorf(err, "unable to retrieve Azure credentials") + } + defer resp.Body.Close() + body, err := ioutil.ReadAll(resp.Body) + if err != nil { + return v, internal.WrapErrorf(err, "unable to retrieve Azure credentials: error reading response body") + } + if resp.StatusCode != http.StatusOK { + return v, internal.WrapErrorf(err, "unable to retrieve Azure credentials: expected StatusCode 200, got StatusCode: %v. Response body: %s", resp.StatusCode, body) + } + var tokenResponse struct { + AccessToken string `json:"access_token"` + ExpiresIn string `json:"expires_in"` + } + // Attempt to read body as JSON + err = json.Unmarshal(body, &tokenResponse) + if err != nil { + return v, internal.WrapErrorf(err, "unable to retrieve Azure credentials: error reading body JSON. Response body: %s", body) + } + if tokenResponse.AccessToken == "" { + return v, fmt.Errorf("unable to retrieve Azure credentials: got unexpected empty accessToken from Azure Metadata Server. Response body: %s", body) + } + v.SessionToken = tokenResponse.AccessToken + + expiresIn, err := time.ParseDuration(tokenResponse.ExpiresIn + "s") + if err != nil { + return v, err + } + if expiration := expiresIn - a.expiryWindow; expiration > 0 { + a.expiration = time.Now().Add(expiration) + } + + return v, err +} + +// Retrieve retrieves the keys from the Azure service. +func (a *AzureProvider) Retrieve() (credentials.Value, error) { + return a.RetrieveWithContext(context.Background()) +} + +// IsExpired returns if the credentials have been retrieved. +func (a *AzureProvider) IsExpired() bool { + return a.expiration.Before(time.Now()) +} diff --git a/vendor/go.mongodb.org/mongo-driver/internal/credproviders/static_provider.go b/vendor/go.mongodb.org/mongo-driver/internal/credproviders/static_provider.go new file mode 100644 index 0000000000..6b49613941 --- /dev/null +++ b/vendor/go.mongodb.org/mongo-driver/internal/credproviders/static_provider.go @@ -0,0 +1,59 @@ +// Copyright (C) MongoDB, Inc. 2023-present. +// +// Licensed under the Apache License, Version 2.0 (the "License"); you may +// not use this file except in compliance with the License. You may obtain +// a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 + +package credproviders + +import ( + "errors" + + "go.mongodb.org/mongo-driver/internal/aws/credentials" +) + +// staticProviderName provides a name of Static provider +const staticProviderName = "StaticProvider" + +// A StaticProvider is a set of credentials which are set programmatically, +// and will never expire. +type StaticProvider struct { + credentials.Value + + verified bool + err error +} + +func verify(v credentials.Value) error { + if !v.HasKeys() { + return errors.New("failed to retrieve ACCESS_KEY_ID and SECRET_ACCESS_KEY") + } + if v.AccessKeyID != "" && v.SecretAccessKey == "" { + return errors.New("ACCESS_KEY_ID is set, but SECRET_ACCESS_KEY is missing") + } + if v.AccessKeyID == "" && v.SecretAccessKey != "" { + return errors.New("SECRET_ACCESS_KEY is set, but ACCESS_KEY_ID is missing") + } + if v.AccessKeyID == "" && v.SecretAccessKey == "" && v.SessionToken != "" { + return errors.New("AWS_SESSION_TOKEN is set, but ACCESS_KEY_ID and SECRET_ACCESS_KEY are missing") + } + return nil + +} + +// Retrieve returns the credentials or error if the credentials are invalid. +func (s *StaticProvider) Retrieve() (credentials.Value, error) { + if !s.verified { + s.err = verify(s.Value) + s.Value.ProviderName = staticProviderName + s.verified = true + } + return s.Value, s.err +} + +// IsExpired returns if the credentials are expired. +// +// For StaticProvider, the credentials never expired. +func (s *StaticProvider) IsExpired() bool { + return false +} diff --git a/vendor/go.mongodb.org/mongo-driver/internal/http.go b/vendor/go.mongodb.org/mongo-driver/internal/http.go index 13c5fbe9cb..1391ac4ca8 100644 --- a/vendor/go.mongodb.org/mongo-driver/internal/http.go +++ b/vendor/go.mongodb.org/mongo-driver/internal/http.go @@ -8,19 +8,11 @@ package internal // import "go.mongodb.org/mongo-driver/internal" import ( "net/http" - "time" ) // DefaultHTTPClient is the default HTTP client used across the driver. var DefaultHTTPClient = &http.Client{ - // TODO(GODRIVER-2623): Use "http.DefaultTransport.Clone" once we change the minimum supported Go version to 1.13. - Transport: &http.Transport{ - Proxy: http.ProxyFromEnvironment, - MaxIdleConns: 100, - IdleConnTimeout: 90 * time.Second, - TLSHandshakeTimeout: 10 * time.Second, - ExpectContinueTimeout: 1 * time.Second, - }, + Transport: http.DefaultTransport.(*http.Transport).Clone(), } // CloseIdleHTTPConnections closes any connections which were previously diff --git a/vendor/go.mongodb.org/mongo-driver/internal/logger/component.go b/vendor/go.mongodb.org/mongo-driver/internal/logger/component.go new file mode 100644 index 0000000000..da9c43de43 --- /dev/null +++ b/vendor/go.mongodb.org/mongo-driver/internal/logger/component.go @@ -0,0 +1,201 @@ +// Copyright (C) MongoDB, Inc. 2023-present. +// +// Licensed under the Apache License, Version 2.0 (the "License"); you may +// not use this file except in compliance with the License. You may obtain +// a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 + +package logger + +import ( + "os" + "strconv" + + "go.mongodb.org/mongo-driver/bson/primitive" +) + +const ( + CommandFailed = "Command failed" + CommandStarted = "Command started" + CommandSucceeded = "Command succeeded" + ConnectionPoolCreated = "Connection pool created" + ConnectionPoolReady = "Connection pool ready" + ConnectionPoolCleared = "Connection pool cleared" + ConnectionPoolClosed = "Connection pool closed" + ConnectionCreated = "Connection created" + ConnectionReady = "Connection ready" + ConnectionClosed = "Connection closed" + ConnectionCheckoutStarted = "Connection checkout started" + ConnectionCheckoutFailed = "Connection checkout failed" + ConnectionCheckedOut = "Connection checked out" + ConnectionCheckedIn = "Connection checked in" +) + +const ( + KeyCommand = "command" + KeyCommandName = "commandName" + KeyDatabaseName = "databaseName" + KeyDriverConnectionID = "driverConnectionId" + KeyDurationMS = "durationMS" + KeyError = "error" + KeyFailure = "failure" + KeyMaxConnecting = "maxConnecting" + KeyMaxIdleTimeMS = "maxIdleTimeMS" + KeyMaxPoolSize = "maxPoolSize" + KeyMessage = "message" + KeyMinPoolSize = "minPoolSize" + KeyOperationID = "operationId" + KeyReason = "reason" + KeyReply = "reply" + KeyRequestID = "requestId" + KeyServerConnectionID = "serverConnectionId" + KeyServerHost = "serverHost" + KeyServerPort = "serverPort" + KeyServiceID = "serviceId" + KeyTimestamp = "timestamp" +) + +type KeyValues []interface{} + +func (kvs *KeyValues) Add(key string, value interface{}) { + *kvs = append(*kvs, key, value) +} + +const ( + ReasonConnClosedStale = "Connection became stale because the pool was cleared" + ReasonConnClosedIdle = "Connection has been available but unused for longer than the configured max idle time" + ReasonConnClosedError = "An error occurred while using the connection" + ReasonConnClosedPoolClosed = "Connection pool was closed" + ReasonConnCheckoutFailedTimout = "Wait queue timeout elapsed without a connection becoming available" + ReasonConnCheckoutFailedError = "An error occurred while trying to establish a new connection" + ReasonConnCheckoutFailedPoolClosed = "Connection pool was closed" +) + +// Component is an enumeration representing the "components" which can be +// logged against. A LogLevel can be configured on a per-component basis. +type Component int + +const ( + // ComponentAll enables logging for all components. + ComponentAll Component = iota + + // ComponentCommand enables command monitor logging. + ComponentCommand + + // ComponentTopology enables topology logging. + ComponentTopology + + // ComponentServerSelection enables server selection logging. + ComponentServerSelection + + // ComponentConnection enables connection services logging. + ComponentConnection +) + +const ( + mongoDBLogAllEnvVar = "MONGODB_LOG_ALL" + mongoDBLogCommandEnvVar = "MONGODB_LOG_COMMAND" + mongoDBLogTopologyEnvVar = "MONGODB_LOG_TOPOLOGY" + mongoDBLogServerSelectionEnvVar = "MONGODB_LOG_SERVER_SELECTION" + mongoDBLogConnectionEnvVar = "MONGODB_LOG_CONNECTION" +) + +var componentEnvVarMap = map[string]Component{ + mongoDBLogAllEnvVar: ComponentAll, + mongoDBLogCommandEnvVar: ComponentCommand, + mongoDBLogTopologyEnvVar: ComponentTopology, + mongoDBLogServerSelectionEnvVar: ComponentServerSelection, + mongoDBLogConnectionEnvVar: ComponentConnection, +} + +// EnvHasComponentVariables returns true if the environment contains any of the +// component environment variables. +func EnvHasComponentVariables() bool { + for envVar := range componentEnvVarMap { + if os.Getenv(envVar) != "" { + return true + } + } + + return false +} + +// Command is a struct defining common fields that must be included in all +// commands. +type Command struct { + // TODO(GODRIVER-2824): change the DriverConnectionID type to int64. + DriverConnectionID uint64 // Driver's ID for the connection + Name string // Command name + Message string // Message associated with the command + OperationID int32 // Driver-generated operation ID + RequestID int64 // Driver-generated request ID + ServerConnectionID *int64 // Server's ID for the connection used for the command + ServerHost string // Hostname or IP address for the server + ServerPort string // Port for the server + ServiceID *primitive.ObjectID // ID for the command in load balancer mode +} + +// SerializeCommand takes a command and a variable number of key-value pairs and +// returns a slice of interface{} that can be passed to the logger for +// structured logging. +func SerializeCommand(cmd Command, extraKeysAndValues ...interface{}) []interface{} { + // Initialize the boilerplate keys and values. + keysAndValues := KeyValues{ + KeyCommandName, cmd.Name, + KeyDriverConnectionID, cmd.DriverConnectionID, + KeyMessage, cmd.Message, + KeyOperationID, cmd.OperationID, + KeyRequestID, cmd.RequestID, + KeyServerHost, cmd.ServerHost, + } + + // Add the extra keys and values. + for i := 0; i < len(extraKeysAndValues); i += 2 { + keysAndValues.Add(extraKeysAndValues[i].(string), extraKeysAndValues[i+1]) + } + + port, err := strconv.ParseInt(cmd.ServerPort, 0, 32) + if err == nil { + keysAndValues.Add(KeyServerPort, port) + } + + // Add the "serverConnectionId" if it is not nil. + if cmd.ServerConnectionID != nil { + keysAndValues.Add(KeyServerConnectionID, *cmd.ServerConnectionID) + } + + // Add the "serviceId" if it is not nil. + if cmd.ServiceID != nil { + keysAndValues.Add(KeyServiceID, cmd.ServiceID.Hex()) + } + + return keysAndValues +} + +// Connection contains data that all connection log messages MUST contain. +type Connection struct { + Message string // Message associated with the connection + ServerHost string // Hostname or IP address for the server + ServerPort string // Port for the server +} + +// SerializeConnection serializes a ConnectionMessage into a slice of keys +// and values that can be passed to a logger. +func SerializeConnection(conn Connection, extraKeysAndValues ...interface{}) []interface{} { + // Initialize the boilerplate keys and values. + keysAndValues := KeyValues{ + KeyMessage, conn.Message, + KeyServerHost, conn.ServerHost, + } + + // Add the optional keys and values. + for i := 0; i < len(extraKeysAndValues); i += 2 { + keysAndValues.Add(extraKeysAndValues[i].(string), extraKeysAndValues[i+1]) + } + + port, err := strconv.ParseInt(conn.ServerPort, 0, 32) + if err == nil { + keysAndValues.Add(KeyServerPort, port) + } + + return keysAndValues +} diff --git a/vendor/go.mongodb.org/mongo-driver/internal/logger/io_sink.go b/vendor/go.mongodb.org/mongo-driver/internal/logger/io_sink.go new file mode 100644 index 0000000000..c5ff1474b4 --- /dev/null +++ b/vendor/go.mongodb.org/mongo-driver/internal/logger/io_sink.go @@ -0,0 +1,58 @@ +// Copyright (C) MongoDB, Inc. 2023-present. +// +// Licensed under the Apache License, Version 2.0 (the "License"); you may +// not use this file except in compliance with the License. You may obtain +// a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 + +package logger + +import ( + "encoding/json" + "io" + "sync" + "time" +) + +// IOSink writes a JSON-encoded message to the io.Writer. +type IOSink struct { + enc *json.Encoder + + // encMu protects the encoder from concurrent writes. While the logger + // itself does not concurrently write to the sink, the sink may be used + // concurrently within the driver. + encMu sync.Mutex +} + +// Compile-time check to ensure IOSink implements the LogSink interface. +var _ LogSink = &IOSink{} + +// NewIOSink will create an IOSink object that writes JSON messages to the +// provided io.Writer. +func NewIOSink(out io.Writer) *IOSink { + return &IOSink{ + enc: json.NewEncoder(out), + } +} + +// Info will write a JSON-encoded message to the io.Writer. +func (sink *IOSink) Info(_ int, msg string, keysAndValues ...interface{}) { + kvMap := make(map[string]interface{}, len(keysAndValues)/2+2) + + kvMap[KeyTimestamp] = time.Now().UnixNano() + kvMap[KeyMessage] = msg + + for i := 0; i < len(keysAndValues); i += 2 { + kvMap[keysAndValues[i].(string)] = keysAndValues[i+1] + } + + sink.encMu.Lock() + defer sink.encMu.Unlock() + + _ = sink.enc.Encode(kvMap) +} + +// Error will write a JSON-encoded error message to the io.Writer. +func (sink *IOSink) Error(err error, msg string, kv ...interface{}) { + kv = append(kv, KeyError, err.Error()) + sink.Info(0, msg, kv...) +} diff --git a/vendor/go.mongodb.org/mongo-driver/internal/logger/level.go b/vendor/go.mongodb.org/mongo-driver/internal/logger/level.go new file mode 100644 index 0000000000..07f85b35d7 --- /dev/null +++ b/vendor/go.mongodb.org/mongo-driver/internal/logger/level.go @@ -0,0 +1,74 @@ +// Copyright (C) MongoDB, Inc. 2023-present. +// +// Licensed under the Apache License, Version 2.0 (the "License"); you may +// not use this file except in compliance with the License. You may obtain +// a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 + +package logger + +import "strings" + +// DiffToInfo is the number of levels in the Go Driver that come before the +// "Info" level. This should ensure that "Info" is the 0th level passed to the +// sink. +const DiffToInfo = 1 + +// Level is an enumeration representing the log severity levels supported by +// the driver. The order of the logging levels is important. The driver expects +// that a user will likely use the "logr" package to create a LogSink, which +// defaults InfoLevel as 0. Any additions to the Level enumeration before the +// InfoLevel will need to also update the "diffToInfo" constant. +type Level int + +const ( + // LevelOff suppresses logging. + LevelOff Level = iota + + // LevelInfo enables logging of informational messages. These logs are + // high-level information about normal driver behavior. + LevelInfo + + // LevelDebug enables logging of debug messages. These logs can be + // voluminous and are intended for detailed information that may be + // helpful when debugging an application. + LevelDebug +) + +const ( + levelLiteralOff = "off" + levelLiteralEmergency = "emergency" + levelLiteralAlert = "alert" + levelLiteralCritical = "critical" + levelLiteralError = "error" + levelLiteralWarning = "warning" + levelLiteralNotice = "notice" + levelLiteralInfo = "info" + levelLiteralDebug = "debug" + levelLiteralTrace = "trace" +) + +var LevelLiteralMap = map[string]Level{ + levelLiteralOff: LevelOff, + levelLiteralEmergency: LevelInfo, + levelLiteralAlert: LevelInfo, + levelLiteralCritical: LevelInfo, + levelLiteralError: LevelInfo, + levelLiteralWarning: LevelInfo, + levelLiteralNotice: LevelInfo, + levelLiteralInfo: LevelInfo, + levelLiteralDebug: LevelDebug, + levelLiteralTrace: LevelDebug, +} + +// ParseLevel will check if the given string is a valid environment variable +// for a logging severity level. If it is, then it will return the associated +// driver's Level. The default Level is “LevelOff”. +func ParseLevel(str string) Level { + for literal, level := range LevelLiteralMap { + if strings.EqualFold(literal, str) { + return level + } + } + + return LevelOff +} diff --git a/vendor/go.mongodb.org/mongo-driver/internal/logger/logger.go b/vendor/go.mongodb.org/mongo-driver/internal/logger/logger.go new file mode 100644 index 0000000000..c4053ea3df --- /dev/null +++ b/vendor/go.mongodb.org/mongo-driver/internal/logger/logger.go @@ -0,0 +1,250 @@ +// Copyright (C) MongoDB, Inc. 2023-present. +// +// Licensed under the Apache License, Version 2.0 (the "License"); you may +// not use this file except in compliance with the License. You may obtain +// a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 + +package logger + +import ( + "fmt" + "os" + "strconv" + "strings" +) + +// DefaultMaxDocumentLength is the default maximum number of bytes that can be +// logged for a stringified BSON document. +const DefaultMaxDocumentLength = 1000 + +// TruncationSuffix are trailling ellipsis "..." appended to a message to +// indicate to the user that truncation occurred. This constant does not count +// toward the max document length. +const TruncationSuffix = "..." + +const logSinkPathEnvVar = "MONGODB_LOG_PATH" +const maxDocumentLengthEnvVar = "MONGODB_LOG_MAX_DOCUMENT_LENGTH" + +// LogSink represents a logging implementation, this interface should be 1-1 +// with the exported "LogSink" interface in the mongo/options package. +type LogSink interface { + // Info logs a non-error message with the given key/value pairs. The + // level argument is provided for optional logging. + Info(level int, msg string, keysAndValues ...interface{}) + + // Error logs an error, with the given message and key/value pairs. + Error(err error, msg string, keysAndValues ...interface{}) +} + +// Logger represents the configuration for the internal logger. +type Logger struct { + ComponentLevels map[Component]Level // Log levels for each component. + Sink LogSink // LogSink for log printing. + MaxDocumentLength uint // Command truncation width. + logFile *os.File // File to write logs to. +} + +// New will construct a new logger. If any of the given options are the +// zero-value of the argument type, then the constructor will attempt to +// source the data from the environment. If the environment has not been set, +// then the constructor will the respective default values. +func New(sink LogSink, maxDocLen uint, compLevels map[Component]Level) (*Logger, error) { + logger := &Logger{ + ComponentLevels: selectComponentLevels(compLevels), + MaxDocumentLength: selectMaxDocumentLength(maxDocLen), + } + + sink, logFile, err := selectLogSink(sink) + if err != nil { + return nil, err + } + + logger.Sink = sink + logger.logFile = logFile + + return logger, nil +} + +// Close will close the logger's log file, if it exists. +func (logger *Logger) Close() error { + if logger.logFile != nil { + return logger.logFile.Close() + } + + return nil +} + +// LevelComponentEnabled will return true if the given LogLevel is enabled for +// the given LogComponent. +func (logger *Logger) LevelComponentEnabled(level Level, component Component) bool { + return logger.ComponentLevels[component] >= level +} + +// Print will synchronously print the given message to the configured LogSink. +// If the LogSink is nil, then this method will do nothing. Future work could be done to make +// this method asynchronous, see buffer management in libraries such as log4j. +func (logger *Logger) Print(level Level, component Component, msg string, keysAndValues ...interface{}) { + // If the level is not enabled for the component, then + // skip the message. + if !logger.LevelComponentEnabled(level, component) { + return + } + + // If the sink is nil, then skip the message. + if logger.Sink == nil { + return + } + + logger.Sink.Info(int(level)-DiffToInfo, msg, keysAndValues...) +} + +// Error logs an error, with the given message and key/value pairs. +// It functions similarly to Print, but may have unique behavior, and should be +// preferred for logging errors. +func (logger *Logger) Error(err error, msg string, keysAndValues ...interface{}) { + if logger.Sink == nil { + return + } + + logger.Sink.Error(err, msg, keysAndValues...) +} + +// selectMaxDocumentLength will return the integer value of the first non-zero +// function, with the user-defined function taking priority over the environment +// variables. For the environment, the function will attempt to get the value of +// "MONGODB_LOG_MAX_DOCUMENT_LENGTH" and parse it as an unsigned integer. If the +// environment variable is not set or is not an unsigned integer, then this +// function will return the default max document length. +func selectMaxDocumentLength(maxDocLen uint) uint { + if maxDocLen != 0 { + return maxDocLen + } + + maxDocLenEnv := os.Getenv(maxDocumentLengthEnvVar) + if maxDocLenEnv != "" { + maxDocLenEnvInt, err := strconv.ParseUint(maxDocLenEnv, 10, 32) + if err == nil { + return uint(maxDocLenEnvInt) + } + } + + return DefaultMaxDocumentLength +} + +const ( + logSinkPathStdout = "stdout" + logSinkPathStderr = "stderr" +) + +// selectLogSink will return the first non-nil LogSink, with the user-defined +// LogSink taking precedence over the environment-defined LogSink. If no LogSink +// is defined, then this function will return a LogSink that writes to stderr. +func selectLogSink(sink LogSink) (LogSink, *os.File, error) { + if sink != nil { + return sink, nil, nil + } + + path := os.Getenv(logSinkPathEnvVar) + lowerPath := strings.ToLower(path) + + if lowerPath == string(logSinkPathStderr) { + return NewIOSink(os.Stderr), nil, nil + } + + if lowerPath == string(logSinkPathStdout) { + return NewIOSink(os.Stdout), nil, nil + } + + if path != "" { + logFile, err := os.OpenFile(path, os.O_APPEND|os.O_CREATE|os.O_RDWR, 0666) + if err != nil { + return nil, nil, fmt.Errorf("unable to open log file: %v", err) + } + + return NewIOSink(logFile), logFile, nil + } + + return NewIOSink(os.Stderr), nil, nil +} + +// selectComponentLevels returns a new map of LogComponents to LogLevels that is +// the result of merging the user-defined data with the environment, with the +// user-defined data taking priority. +func selectComponentLevels(componentLevels map[Component]Level) map[Component]Level { + selected := make(map[Component]Level) + + // Determine if the "MONGODB_LOG_ALL" environment variable is set. + var globalEnvLevel *Level + if all := os.Getenv(mongoDBLogAllEnvVar); all != "" { + level := ParseLevel(all) + globalEnvLevel = &level + } + + for envVar, component := range componentEnvVarMap { + // If the component already has a level, then skip it. + if _, ok := componentLevels[component]; ok { + selected[component] = componentLevels[component] + + continue + } + + // If the "MONGODB_LOG_ALL" environment variable is set, then + // set the level for the component to the value of the + // environment variable. + if globalEnvLevel != nil { + selected[component] = *globalEnvLevel + + continue + } + + // Otherwise, set the level for the component to the value of + // the environment variable. + selected[component] = ParseLevel(os.Getenv(envVar)) + } + + return selected +} + +// truncate will truncate a string to the given width, appending "..." to the +// end of the string if it is truncated. This routine is safe for multi-byte +// characters. +func truncate(str string, width uint) string { + if width == 0 { + return "" + } + + if len(str) <= int(width) { + return str + } + + // Truncate the byte slice of the string to the given width. + newStr := str[:width] + + // Check if the last byte is at the beginning of a multi-byte character. + // If it is, then remove the last byte. + if newStr[len(newStr)-1]&0xC0 == 0xC0 { + return newStr[:len(newStr)-1] + TruncationSuffix + } + + // Check if the last byte is in the middle of a multi-byte character. If + // it is, then step back until we find the beginning of the character. + if newStr[len(newStr)-1]&0xC0 == 0x80 { + for i := len(newStr) - 1; i >= 0; i-- { + if newStr[i]&0xC0 == 0xC0 { + return newStr[:i] + TruncationSuffix + } + } + } + + return newStr + TruncationSuffix +} + +// FormatMessage formats a BSON document for logging. The document is truncated +// to the given width. +func FormatMessage(msg string, width uint) string { + if len(msg) == 0 { + return "{}" + } + + return truncate(msg, width) +} diff --git a/vendor/go.mongodb.org/mongo-driver/internal/uuid/uuid.go b/vendor/go.mongodb.org/mongo-driver/internal/uuid/uuid.go index 78f16645d7..86c2a33a73 100644 --- a/vendor/go.mongodb.org/mongo-driver/internal/uuid/uuid.go +++ b/vendor/go.mongodb.org/mongo-driver/internal/uuid/uuid.go @@ -7,6 +7,7 @@ package uuid import ( + "encoding/hex" "io" "go.mongodb.org/mongo-driver/internal/randutil" @@ -51,3 +52,17 @@ var globalSource = newSource() func New() (UUID, error) { return globalSource.new() } + +func (uuid UUID) String() string { + var str [36]byte + hex.Encode(str[:], uuid[:4]) + str[8] = '-' + hex.Encode(str[9:13], uuid[4:6]) + str[13] = '-' + hex.Encode(str[14:18], uuid[6:8]) + str[18] = '-' + hex.Encode(str[19:23], uuid[8:10]) + str[23] = '-' + hex.Encode(str[24:], uuid[10:]) + return string(str[:]) +} diff --git a/vendor/go.mongodb.org/mongo-driver/mongo/bulk_write.go b/vendor/go.mongodb.org/mongo-driver/mongo/bulk_write.go index 2c58f22294..58e64f1d9a 100644 --- a/vendor/go.mongodb.org/mongo-driver/mongo/bulk_write.go +++ b/vendor/go.mongodb.org/mongo-driver/mongo/bulk_write.go @@ -10,6 +10,7 @@ import ( "context" "go.mongodb.org/mongo-driver/bson/bsoncodec" + "go.mongodb.org/mongo-driver/bson/primitive" "go.mongodb.org/mongo-driver/mongo/description" "go.mongodb.org/mongo-driver/mongo/options" "go.mongodb.org/mongo-driver/mongo/writeconcern" @@ -165,7 +166,11 @@ func (bw *bulkWrite) runInsert(ctx context.Context, batch bulkWriteBatch) (opera var i int for _, model := range batch.models { converted := model.(*InsertOneModel) - doc, _, err := transformAndEnsureID(bw.collection.registry, converted.Document) + doc, err := marshal(converted.Document, bw.collection.bsonOpts, bw.collection.registry) + if err != nil { + return operation.InsertResult{}, err + } + doc, _, err = ensureID(doc, primitive.NewObjectID(), bw.collection.bsonOpts, bw.collection.registry) if err != nil { return operation.InsertResult{}, err } @@ -179,9 +184,10 @@ func (bw *bulkWrite) runInsert(ctx context.Context, batch bulkWriteBatch) (opera ServerSelector(bw.selector).ClusterClock(bw.collection.client.clock). Database(bw.collection.db.name).Collection(bw.collection.name). Deployment(bw.collection.client.deployment).Crypt(bw.collection.client.cryptFLE). - ServerAPI(bw.collection.client.serverAPI).Timeout(bw.collection.client.timeout) + ServerAPI(bw.collection.client.serverAPI).Timeout(bw.collection.client.timeout). + Logger(bw.collection.client.logger) if bw.comment != nil { - comment, err := transformValue(bw.collection.registry, bw.comment, true, "comment") + comment, err := marshalValue(bw.comment, bw.collection.bsonOpts, bw.collection.registry) if err != nil { return op.Result(), err } @@ -216,10 +222,22 @@ func (bw *bulkWrite) runDelete(ctx context.Context, batch bulkWriteBatch) (opera switch converted := model.(type) { case *DeleteOneModel: - doc, err = createDeleteDoc(converted.Filter, converted.Collation, converted.Hint, true, bw.collection.registry) + doc, err = createDeleteDoc( + converted.Filter, + converted.Collation, + converted.Hint, + true, + bw.collection.bsonOpts, + bw.collection.registry) hasHint = hasHint || (converted.Hint != nil) case *DeleteManyModel: - doc, err = createDeleteDoc(converted.Filter, converted.Collation, converted.Hint, false, bw.collection.registry) + doc, err = createDeleteDoc( + converted.Filter, + converted.Collation, + converted.Hint, + false, + bw.collection.bsonOpts, + bw.collection.registry) hasHint = hasHint || (converted.Hint != nil) } @@ -236,16 +254,17 @@ func (bw *bulkWrite) runDelete(ctx context.Context, batch bulkWriteBatch) (opera ServerSelector(bw.selector).ClusterClock(bw.collection.client.clock). Database(bw.collection.db.name).Collection(bw.collection.name). Deployment(bw.collection.client.deployment).Crypt(bw.collection.client.cryptFLE).Hint(hasHint). - ServerAPI(bw.collection.client.serverAPI).Timeout(bw.collection.client.timeout) + ServerAPI(bw.collection.client.serverAPI).Timeout(bw.collection.client.timeout). + Logger(bw.collection.client.logger) if bw.comment != nil { - comment, err := transformValue(bw.collection.registry, bw.comment, true, "comment") + comment, err := marshalValue(bw.comment, bw.collection.bsonOpts, bw.collection.registry) if err != nil { return op.Result(), err } op.Comment(comment) } if bw.let != nil { - let, err := transformBsoncoreDocument(bw.collection.registry, bw.let, true, "let") + let, err := marshal(bw.let, bw.collection.bsonOpts, bw.collection.registry) if err != nil { return operation.DeleteResult{}, err } @@ -265,10 +284,15 @@ func (bw *bulkWrite) runDelete(ctx context.Context, batch bulkWriteBatch) (opera return op.Result(), err } -func createDeleteDoc(filter interface{}, collation *options.Collation, hint interface{}, deleteOne bool, - registry *bsoncodec.Registry) (bsoncore.Document, error) { - - f, err := transformBsoncoreDocument(registry, filter, true, "filter") +func createDeleteDoc( + filter interface{}, + collation *options.Collation, + hint interface{}, + deleteOne bool, + bsonOpts *options.BSONOptions, + registry *bsoncodec.Registry, +) (bsoncore.Document, error) { + f, err := marshal(filter, bsonOpts, registry) if err != nil { return nil, err } @@ -284,7 +308,10 @@ func createDeleteDoc(filter interface{}, collation *options.Collation, hint inte doc = bsoncore.AppendDocumentElement(doc, "collation", collation.ToDocument()) } if hint != nil { - hintVal, err := transformValue(registry, hint, false, "hint") + if isUnorderedMap(hint) { + return nil, ErrMapForOrderedArgument{"hint"} + } + hintVal, err := marshalValue(hint, bsonOpts, registry) if err != nil { return nil, err } @@ -305,17 +332,44 @@ func (bw *bulkWrite) runUpdate(ctx context.Context, batch bulkWriteBatch) (opera switch converted := model.(type) { case *ReplaceOneModel: - doc, err = createUpdateDoc(converted.Filter, converted.Replacement, converted.Hint, nil, converted.Collation, converted.Upsert, false, - false, bw.collection.registry) + doc, err = createUpdateDoc( + converted.Filter, + converted.Replacement, + converted.Hint, + nil, + converted.Collation, + converted.Upsert, + false, + false, + bw.collection.bsonOpts, + bw.collection.registry) hasHint = hasHint || (converted.Hint != nil) case *UpdateOneModel: - doc, err = createUpdateDoc(converted.Filter, converted.Update, converted.Hint, converted.ArrayFilters, converted.Collation, converted.Upsert, false, - true, bw.collection.registry) + doc, err = createUpdateDoc( + converted.Filter, + converted.Update, + converted.Hint, + converted.ArrayFilters, + converted.Collation, + converted.Upsert, + false, + true, + bw.collection.bsonOpts, + bw.collection.registry) hasHint = hasHint || (converted.Hint != nil) hasArrayFilters = hasArrayFilters || (converted.ArrayFilters != nil) case *UpdateManyModel: - doc, err = createUpdateDoc(converted.Filter, converted.Update, converted.Hint, converted.ArrayFilters, converted.Collation, converted.Upsert, true, - true, bw.collection.registry) + doc, err = createUpdateDoc( + converted.Filter, + converted.Update, + converted.Hint, + converted.ArrayFilters, + converted.Collation, + converted.Upsert, + true, + true, + bw.collection.bsonOpts, + bw.collection.registry) hasHint = hasHint || (converted.Hint != nil) hasArrayFilters = hasArrayFilters || (converted.ArrayFilters != nil) } @@ -331,16 +385,17 @@ func (bw *bulkWrite) runUpdate(ctx context.Context, batch bulkWriteBatch) (opera ServerSelector(bw.selector).ClusterClock(bw.collection.client.clock). Database(bw.collection.db.name).Collection(bw.collection.name). Deployment(bw.collection.client.deployment).Crypt(bw.collection.client.cryptFLE).Hint(hasHint). - ArrayFilters(hasArrayFilters).ServerAPI(bw.collection.client.serverAPI).Timeout(bw.collection.client.timeout) + ArrayFilters(hasArrayFilters).ServerAPI(bw.collection.client.serverAPI). + Timeout(bw.collection.client.timeout).Logger(bw.collection.client.logger) if bw.comment != nil { - comment, err := transformValue(bw.collection.registry, bw.comment, true, "comment") + comment, err := marshalValue(bw.comment, bw.collection.bsonOpts, bw.collection.registry) if err != nil { return op.Result(), err } op.Comment(comment) } if bw.let != nil { - let, err := transformBsoncoreDocument(bw.collection.registry, bw.let, true, "let") + let, err := marshal(bw.let, bw.collection.bsonOpts, bw.collection.registry) if err != nil { return operation.UpdateResult{}, err } @@ -362,6 +417,7 @@ func (bw *bulkWrite) runUpdate(ctx context.Context, batch bulkWriteBatch) (opera return op.Result(), err } + func createUpdateDoc( filter interface{}, update interface{}, @@ -371,9 +427,10 @@ func createUpdateDoc( upsert *bool, multi bool, checkDollarKey bool, + bsonOpts *options.BSONOptions, registry *bsoncodec.Registry, ) (bsoncore.Document, error) { - f, err := transformBsoncoreDocument(registry, filter, true, "filter") + f, err := marshal(filter, bsonOpts, registry) if err != nil { return nil, err } @@ -381,7 +438,7 @@ func createUpdateDoc( uidx, updateDoc := bsoncore.AppendDocumentStart(nil) updateDoc = bsoncore.AppendDocumentElement(updateDoc, "q", f) - u, err := transformUpdateValue(registry, update, checkDollarKey) + u, err := marshalUpdateValue(update, bsonOpts, registry, checkDollarKey) if err != nil { return nil, err } @@ -393,11 +450,15 @@ func createUpdateDoc( } if arrayFilters != nil { - arr, err := arrayFilters.ToArrayDocument() + reg := registry + if arrayFilters.Registry != nil { + reg = arrayFilters.Registry + } + arr, err := marshalValue(arrayFilters.Filters, bsonOpts, reg) if err != nil { return nil, err } - updateDoc = bsoncore.AppendArrayElement(updateDoc, "arrayFilters", arr) + updateDoc = bsoncore.AppendArrayElement(updateDoc, "arrayFilters", arr.Data) } if collation != nil { @@ -409,7 +470,10 @@ func createUpdateDoc( } if hint != nil { - hintVal, err := transformValue(registry, hint, false, "hint") + if isUnorderedMap(hint) { + return nil, ErrMapForOrderedArgument{"hint"} + } + hintVal, err := marshalValue(hint, bsonOpts, registry) if err != nil { return nil, err } diff --git a/vendor/go.mongodb.org/mongo-driver/mongo/change_stream.go b/vendor/go.mongodb.org/mongo-driver/mongo/change_stream.go index 6857e1e3cd..76fe86f000 100644 --- a/vendor/go.mongodb.org/mongo-driver/mongo/change_stream.go +++ b/vendor/go.mongodb.org/mongo-driver/mongo/change_stream.go @@ -80,6 +80,7 @@ type ChangeStream struct { err error sess *session.Client client *Client + bsonOpts *options.BSONOptions registry *bsoncodec.Registry streamType StreamType options *options.ChangeStreamOptions @@ -92,6 +93,7 @@ type changeStreamConfig struct { readConcern *readconcern.ReadConcern readPreference *readpref.ReadPref client *Client + bsonOpts *options.BSONOptions registry *bsoncodec.Registry streamType StreamType collectionName string @@ -107,6 +109,7 @@ func newChangeStream(ctx context.Context, config changeStreamConfig, pipeline in cs := &ChangeStream{ client: config.client, + bsonOpts: config.bsonOpts, registry: config.registry, streamType: config.streamType, options: options.MergeChangeStreamOptions(opts...), @@ -138,7 +141,7 @@ func newChangeStream(ctx context.Context, config changeStreamConfig, pipeline in if comment := cs.options.Comment; comment != nil { cs.aggregate.Comment(*comment) - commentVal, err := transformValue(cs.registry, comment, true, "comment") + commentVal, err := marshalValue(comment, cs.bsonOpts, cs.registry) if err != nil { return nil, err } @@ -389,7 +392,7 @@ func (cs *ChangeStream) storeResumeToken() error { func (cs *ChangeStream) buildPipelineSlice(pipeline interface{}) error { val := reflect.ValueOf(pipeline) if !val.IsValid() || !(val.Kind() == reflect.Slice) { - cs.err = errors.New("can only transform slices and arrays into aggregation pipelines, but got invalid") + cs.err = errors.New("can only marshal slices and arrays into aggregation pipelines, but got invalid") return cs.err } @@ -410,7 +413,7 @@ func (cs *ChangeStream) buildPipelineSlice(pipeline interface{}) error { for i := 0; i < val.Len(); i++ { var elem []byte - elem, cs.err = transformBsoncoreDocument(cs.registry, val.Index(i).Interface(), true, fmt.Sprintf("pipeline stage :%v", i)) + elem, cs.err = marshal(val.Index(i).Interface(), cs.bsonOpts, cs.registry) if cs.err != nil { return cs.err } @@ -438,7 +441,7 @@ func (cs *ChangeStream) createPipelineOptionsDoc() (bsoncore.Document, error) { if cs.options.ResumeAfter != nil { var raDoc bsoncore.Document - raDoc, cs.err = transformBsoncoreDocument(cs.registry, cs.options.ResumeAfter, true, "resumeAfter") + raDoc, cs.err = marshal(cs.options.ResumeAfter, cs.bsonOpts, cs.registry) if cs.err != nil { return nil, cs.err } @@ -452,7 +455,7 @@ func (cs *ChangeStream) createPipelineOptionsDoc() (bsoncore.Document, error) { if cs.options.StartAfter != nil { var saDoc bsoncore.Document - saDoc, cs.err = transformBsoncoreDocument(cs.registry, cs.options.StartAfter, true, "startAfter") + saDoc, cs.err = marshal(cs.options.StartAfter, cs.bsonOpts, cs.registry) if cs.err != nil { return nil, cs.err } @@ -531,7 +534,11 @@ func (cs *ChangeStream) Decode(val interface{}) error { return ErrNilCursor } - return bson.UnmarshalWithRegistry(cs.registry, cs.Current, val) + dec, err := getDecoder(cs.Current, cs.bsonOpts, cs.registry) + if err != nil { + return fmt.Errorf("error configuring BSON decoder: %w", err) + } + return dec.Decode(val) } // Err returns the last error seen by the change stream, or nil if no errors has occurred. diff --git a/vendor/go.mongodb.org/mongo-driver/mongo/client.go b/vendor/go.mongodb.org/mongo-driver/mongo/client.go index b38663747c..588d741fa2 100644 --- a/vendor/go.mongodb.org/mongo-driver/mongo/client.go +++ b/vendor/go.mongodb.org/mongo-driver/mongo/client.go @@ -17,6 +17,7 @@ import ( "go.mongodb.org/mongo-driver/bson/bsoncodec" "go.mongodb.org/mongo-driver/event" "go.mongodb.org/mongo-driver/internal" + "go.mongodb.org/mongo-driver/internal/logger" "go.mongodb.org/mongo-driver/internal/uuid" "go.mongodb.org/mongo-driver/mongo/description" "go.mongodb.org/mongo-driver/mongo/options" @@ -60,6 +61,7 @@ type Client struct { readPreference *readpref.ReadPref readConcern *readconcern.ReadConcern writeConcern *writeconcern.WriteConcern + bsonOpts *options.BSONOptions registry *bsoncodec.Registry monitor *event.CommandMonitor serverAPI *driver.ServerAPIOptions @@ -67,6 +69,7 @@ type Client struct { sessionPool *session.Pool timeout *time.Duration httpClient *http.Client + logger *logger.Logger // client-side encryption fields keyVaultClientFLE *Client @@ -125,6 +128,8 @@ func Connect(ctx context.Context, opts ...*options.ClientOptions) (*Client, erro // option fields of previous options, there is no partial overwriting. For example, if Username is // set in the Auth field for the first option, and Password is set for the second but with no // Username, after the merge the Username field will be empty. +// +// Deprecated: Use [Connect] instead. func NewClient(opts ...*options.ClientOptions) (*Client, error) { clientOpt := options.MergeClientOptions(opts...) @@ -160,6 +165,10 @@ func NewClient(opts ...*options.ClientOptions) (*Client, error) { if clientOpt.ReadPreference != nil { client.readPreference = clientOpt.ReadPreference } + // BSONOptions + if clientOpt.BSONOptions != nil { + client.bsonOpts = clientOpt.BSONOptions + } // Registry client.registry = bson.DefaultRegistry if clientOpt.Registry != nil { @@ -216,6 +225,13 @@ func NewClient(opts ...*options.ClientOptions) (*Client, error) { return nil, replaceErrors(err) } } + + // Create a logger for the client. + client.logger, err = newLogger(clientOpt.LoggerOptions) + if err != nil { + return nil, fmt.Errorf("invalid logger options: %w", err) + } + return client, nil } @@ -224,6 +240,8 @@ func NewClient(opts ...*options.ClientOptions) (*Client, error) { // // Connect starts background goroutines to monitor the state of the deployment and does not do any I/O in the main // goroutine. The Client.Ping method can be used to verify that the connection was created successfully. +// +// Deprecated: Use [mongo.Connect] instead. func (c *Client) Connect(ctx context.Context) error { if connector, ok := c.deployment.(driver.Connector); ok { err := connector.Connect() @@ -277,6 +295,10 @@ func (c *Client) Connect(ctx context.Context) error { // or write operations. If this method returns with no errors, all connections // associated with this Client have been closed. func (c *Client) Disconnect(ctx context.Context) error { + if c.logger != nil { + defer c.logger.Close() + } + if ctx == nil { ctx = context.Background() } @@ -445,14 +467,14 @@ func (c *Client) configureAutoEncryption(clientOpts *options.ClientOptions) erro return err } - // If the crypt_shared library was loaded successfully, signal to the mongocryptd client creator - // that it can bypass spawning mongocryptd. - cryptSharedLibAvailable := mc.CryptSharedLibVersionString() != "" - mongocryptdFLE, err := newMongocryptdClient(cryptSharedLibAvailable, clientOpts.AutoEncryptionOptions) - if err != nil { - return err + // If the crypt_shared library was not loaded, try to spawn and connect to mongocryptd. + if mc.CryptSharedLibVersionString() == "" { + mongocryptdFLE, err := newMongocryptdClient(clientOpts.AutoEncryptionOptions) + if err != nil { + return err + } + c.mongocryptdFLE = mongocryptdFLE } - c.mongocryptdFLE = mongocryptdFLE c.configureCryptFLE(mc, clientOpts.AutoEncryptionOptions) return nil @@ -514,7 +536,7 @@ func (c *Client) newMongoCrypt(opts *options.AutoEncryptionOptions) (*mongocrypt // convert schemas in SchemaMap to bsoncore documents cryptSchemaMap := make(map[string]bsoncore.Document) for k, v := range opts.SchemaMap { - schema, err := transformBsoncoreDocument(c.registry, v, true, "schemaMap") + schema, err := marshal(v, c.bsonOpts, c.registry) if err != nil { return nil, err } @@ -524,14 +546,14 @@ func (c *Client) newMongoCrypt(opts *options.AutoEncryptionOptions) (*mongocrypt // convert schemas in EncryptedFieldsMap to bsoncore documents cryptEncryptedFieldsMap := make(map[string]bsoncore.Document) for k, v := range opts.EncryptedFieldsMap { - encryptedFields, err := transformBsoncoreDocument(c.registry, v, true, "encryptedFieldsMap") + encryptedFields, err := marshal(v, c.bsonOpts, c.registry) if err != nil { return nil, err } cryptEncryptedFieldsMap[k] = encryptedFields } - kmsProviders, err := transformBsoncoreDocument(c.registry, opts.KmsProviders, true, "kmsProviders") + kmsProviders, err := marshal(opts.KmsProviders, c.bsonOpts, c.registry) if err != nil { return nil, fmt.Errorf("error creating KMS providers document: %v", err) } @@ -565,7 +587,8 @@ func (c *Client) newMongoCrypt(opts *options.AutoEncryptionOptions) (*mongocrypt SetBypassQueryAnalysis(bypassQueryAnalysis). SetEncryptedFieldsMap(cryptEncryptedFieldsMap). SetCryptSharedLibDisabled(cryptSharedLibDisabled || bypassAutoEncryption). - SetCryptSharedLibOverridePath(cryptSharedLibPath)) + SetCryptSharedLibOverridePath(cryptSharedLibPath). + SetHTTPClient(opts.HTTPClient)) if err != nil { return nil, err } @@ -609,7 +632,6 @@ func (c *Client) configureCryptFLE(mc *mongocrypt.MongoCrypt, opts *options.Auto KeyFn: kr.cryptKeys, MarkFn: c.mongocryptdFLE.markCommand, TLSConfig: opts.TLSConfig, - HTTPClient: opts.HTTPClient, BypassAutoEncryption: bypass, }) } @@ -657,7 +679,7 @@ func (c *Client) ListDatabases(ctx context.Context, filter interface{}, opts ... return ListDatabasesResult{}, err } - filterDoc, err := transformBsoncoreDocument(c.registry, filter, true, "filter") + filterDoc, err := marshal(filter, c.bsonOpts, c.registry) if err != nil { return ListDatabasesResult{}, err } @@ -788,6 +810,7 @@ func (c *Client) Watch(ctx context.Context, pipeline interface{}, readConcern: c.readConcern, readPreference: c.readPreference, client: c, + bsonOpts: c.bsonOpts, registry: c.registry, streamType: ClientStream, crypt: c.cryptFLE, @@ -817,3 +840,28 @@ func (c *Client) createBaseCursorOptions() driver.CursorOptions { ServerAPI: c.serverAPI, } } + +// newLogger will use the LoggerOptions to create an internal logger and publish +// messages using a LogSink. +func newLogger(opts *options.LoggerOptions) (*logger.Logger, error) { + // If there are no logger options, then create a default logger. + if opts == nil { + opts = options.Logger() + } + + // If there are no component-level options and the environment does not + // contain component variables, then do nothing. + if (opts.ComponentLevels == nil || len(opts.ComponentLevels) == 0) && + !logger.EnvHasComponentVariables() { + + return nil, nil + } + + // Otherwise, collect the component-level options and create a logger. + componentLevels := make(map[logger.Component]logger.Level) + for component, level := range opts.ComponentLevels { + componentLevels[logger.Component(component)] = logger.Level(level) + } + + return logger.New(opts.Sink, opts.MaxDocumentLength, componentLevels) +} diff --git a/vendor/go.mongodb.org/mongo-driver/mongo/client_encryption.go b/vendor/go.mongodb.org/mongo-driver/mongo/client_encryption.go index 59c550b95d..01c2ec3193 100644 --- a/vendor/go.mongodb.org/mongo-driver/mongo/client_encryption.go +++ b/vendor/go.mongodb.org/mongo-driver/mongo/client_encryption.go @@ -8,11 +8,12 @@ package mongo import ( "context" + "errors" "fmt" "strings" - "github.com/pkg/errors" "go.mongodb.org/mongo-driver/bson" + "go.mongodb.org/mongo-driver/bson/bsonrw" "go.mongodb.org/mongo-driver/bson/primitive" "go.mongodb.org/mongo-driver/mongo/options" "go.mongodb.org/mongo-driver/x/bsonx/bsoncore" @@ -43,7 +44,7 @@ func NewClientEncryption(keyVaultClient *Client, opts ...*options.ClientEncrypti db, coll := splitNamespace(ceo.KeyVaultNamespace) ce.keyVaultColl = ce.keyVaultClient.Database(db).Collection(coll, keyVaultCollOpts) - kmsProviders, err := transformBsoncoreDocument(bson.DefaultRegistry, ceo.KmsProviders, true, "kmsProviders") + kmsProviders, err := marshal(ceo.KmsProviders, nil, nil) if err != nil { return nil, fmt.Errorf("error creating KMS providers map: %v", err) } @@ -53,7 +54,8 @@ func NewClientEncryption(keyVaultClient *Client, opts ...*options.ClientEncrypti // Explicitly disable loading the crypt_shared library for the Crypt used for // ClientEncryption because it's only needed for AutoEncryption and we don't expect users to // have the crypt_shared library installed if they're using ClientEncryption. - SetCryptSharedLibDisabled(true)) + SetCryptSharedLibDisabled(true). + SetHTTPClient(ceo.HTTPClient)) if err != nil { return nil, err } @@ -66,12 +68,67 @@ func NewClientEncryption(keyVaultClient *Client, opts ...*options.ClientEncrypti KeyFn: kr.cryptKeys, CollInfoFn: cir.cryptCollInfo, TLSConfig: ceo.TLSConfig, - HTTPClient: ceo.HTTPClient, }) return ce, nil } +// CreateEncryptedCollection creates a new collection for Queryable Encryption with the help of automatic generation of new encryption data keys for null keyIds. +// It returns the created collection and the encrypted fields document used to create it. +func (ce *ClientEncryption) CreateEncryptedCollection(ctx context.Context, + db *Database, coll string, createOpts *options.CreateCollectionOptions, + kmsProvider string, masterKey interface{}) (*Collection, bson.M, error) { + if createOpts == nil { + return nil, nil, errors.New("nil CreateCollectionOptions") + } + ef := createOpts.EncryptedFields + if ef == nil { + return nil, nil, errors.New("no EncryptedFields defined for the collection") + } + + efBSON, err := marshal(ef, db.bsonOpts, db.registry) + if err != nil { + return nil, nil, err + } + r := bsonrw.NewBSONDocumentReader(efBSON) + dec, err := bson.NewDecoder(r) + if err != nil { + return nil, nil, err + } + var m bson.M + err = dec.Decode(&m) + if err != nil { + return nil, nil, err + } + + if v, ok := m["fields"]; ok { + if fields, ok := v.(bson.A); ok { + for _, field := range fields { + if f, ok := field.(bson.M); !ok { + continue + } else if v, ok := f["keyId"]; ok && v == nil { + dkOpts := options.DataKey() + if masterKey != nil { + dkOpts.SetMasterKey(masterKey) + } + keyid, err := ce.CreateDataKey(ctx, kmsProvider, dkOpts) + if err != nil { + createOpts.EncryptedFields = m + return nil, m, err + } + f["keyId"] = keyid + } + } + createOpts.EncryptedFields = m + } + } + err = db.CreateCollection(ctx, coll, createOpts) + if err != nil { + return nil, m, err + } + return db.Collection(coll), m, nil +} + // AddKeyAltName adds a keyAltName to the keyAltNames array of the key document in the key vault collection with the // given UUID (BSON binary subtype 0x04). Returns the previous version of the key document. func (ce *ClientEncryption) AddKeyAltName(ctx context.Context, id primitive.Binary, keyAltName string) *SingleResult { @@ -90,7 +147,10 @@ func (ce *ClientEncryption) CreateDataKey(ctx context.Context, kmsProvider strin dko := options.MergeDataKeyOptions(opts...) co := mcopts.DataKey().SetKeyAltNames(dko.KeyAltNames) if dko.MasterKey != nil { - keyDoc, err := transformBsoncoreDocument(ce.keyVaultClient.registry, dko.MasterKey, true, "masterKey") + keyDoc, err := marshal( + dko.MasterKey, + ce.keyVaultClient.bsonOpts, + ce.keyVaultClient.registry) if err != nil { return primitive.Binary{}, err } @@ -116,10 +176,8 @@ func (ce *ClientEncryption) CreateDataKey(ctx context.Context, kmsProvider strin return primitive.Binary{Subtype: subtype, Data: data}, nil } -// Encrypt encrypts a BSON value with the given key and algorithm. Returns an encrypted value (BSON binary of subtype 6). -func (ce *ClientEncryption) Encrypt(ctx context.Context, val bson.RawValue, - opts ...*options.EncryptOptions) (primitive.Binary, error) { - +// transformExplicitEncryptionOptions creates explicit encryption options to be passed to libmongocrypt. +func transformExplicitEncryptionOptions(opts ...*options.EncryptOptions) *mcopts.ExplicitEncryptionOptions { eo := options.MergeEncryptOptions(opts...) transformed := mcopts.ExplicitEncryption() if eo.KeyID != nil { @@ -135,6 +193,28 @@ func (ce *ClientEncryption) Encrypt(ctx context.Context, val bson.RawValue, transformed.SetContentionFactor(*eo.ContentionFactor) } + if eo.RangeOptions != nil { + var transformedRange mcopts.ExplicitRangeOptions + if eo.RangeOptions.Min != nil { + transformedRange.Min = &bsoncore.Value{Type: eo.RangeOptions.Min.Type, Data: eo.RangeOptions.Min.Value} + } + if eo.RangeOptions.Max != nil { + transformedRange.Max = &bsoncore.Value{Type: eo.RangeOptions.Max.Type, Data: eo.RangeOptions.Max.Value} + } + if eo.RangeOptions.Precision != nil { + transformedRange.Precision = eo.RangeOptions.Precision + } + transformedRange.Sparsity = eo.RangeOptions.Sparsity + transformed.SetRangeOptions(transformedRange) + } + return transformed +} + +// Encrypt encrypts a BSON value with the given key and algorithm. Returns an encrypted value (BSON binary of subtype 6). +func (ce *ClientEncryption) Encrypt(ctx context.Context, val bson.RawValue, + opts ...*options.EncryptOptions) (primitive.Binary, error) { + + transformed := transformExplicitEncryptionOptions(opts...) subtype, data, err := ce.crypt.EncryptExplicit(ctx, bsoncore.Value{Type: val.Type, Data: val.Value}, transformed) if err != nil { return primitive.Binary{}, err @@ -142,6 +222,40 @@ func (ce *ClientEncryption) Encrypt(ctx context.Context, val bson.RawValue, return primitive.Binary{Subtype: subtype, Data: data}, nil } +// EncryptExpression encrypts an expression to query a range index. +// On success, `result` is populated with the resulting BSON document. +// `expr` is expected to be a BSON document of one of the following forms: +// 1. A Match Expression of this form: +// {$and: [{: {$gt: }}, {: {$lt: }}]} +// 2. An Aggregate Expression of this form: +// {$and: [{$gt: [, ]}, {$lt: [, ]}] +// $gt may also be $gte. $lt may also be $lte. +// Only supported for queryType "rangePreview" +// Beta: The Range algorithm is experimental only. It is not intended for public use. It is subject to breaking changes. +func (ce *ClientEncryption) EncryptExpression(ctx context.Context, expr interface{}, result interface{}, opts ...*options.EncryptOptions) error { + transformed := transformExplicitEncryptionOptions(opts...) + + exprDoc, err := marshal(expr, nil, nil) + if err != nil { + return err + } + + encryptedExprDoc, err := ce.crypt.EncryptExplicitExpression(ctx, exprDoc, transformed) + if err != nil { + return err + } + if raw, ok := result.(*bson.Raw); ok { + // Avoid the cost of Unmarshal. + *raw = bson.Raw(encryptedExprDoc) + return nil + } + err = bson.Unmarshal([]byte(encryptedExprDoc), result) + if err != nil { + return err + } + return nil +} + // Decrypt decrypts an encrypted value (BSON binary of subtype 6) and returns the original BSON value. func (ce *ClientEncryption) Decrypt(ctx context.Context, val primitive.Binary) (bson.RawValue, error) { decrypted, err := ce.crypt.DecryptExplicit(ctx, val.Subtype, val.Data) @@ -269,7 +383,10 @@ func (ce *ClientEncryption) RewrapManyDataKey(ctx context.Context, filter interf // Transfer rmdko options to /x/ package options to publish the mongocrypt feed. co := mcopts.RewrapManyDataKey() if rmdko.MasterKey != nil { - keyDoc, err := transformBsoncoreDocument(ce.keyVaultClient.registry, rmdko.MasterKey, true, "masterKey") + keyDoc, err := marshal( + rmdko.MasterKey, + ce.keyVaultClient.bsonOpts, + ce.keyVaultClient.registry) if err != nil { return nil, err } @@ -280,7 +397,7 @@ func (ce *ClientEncryption) RewrapManyDataKey(ctx context.Context, filter interf } // Prepare the filters and rewrap the data key using mongocrypt. - filterdoc, err := transformBsoncoreDocument(ce.keyVaultClient.registry, filter, true, "filter") + filterdoc, err := marshal(filter, ce.keyVaultClient.bsonOpts, ce.keyVaultClient.registry) if err != nil { return nil, err } diff --git a/vendor/go.mongodb.org/mongo-driver/mongo/collection.go b/vendor/go.mongodb.org/mongo-driver/mongo/collection.go index 547110ea2d..1e696ded96 100644 --- a/vendor/go.mongodb.org/mongo-driver/mongo/collection.go +++ b/vendor/go.mongodb.org/mongo-driver/mongo/collection.go @@ -10,12 +10,14 @@ import ( "context" "errors" "fmt" + "reflect" "strings" "time" "go.mongodb.org/mongo-driver/bson" "go.mongodb.org/mongo-driver/bson/bsoncodec" "go.mongodb.org/mongo-driver/bson/bsontype" + "go.mongodb.org/mongo-driver/bson/primitive" "go.mongodb.org/mongo-driver/internal" "go.mongodb.org/mongo-driver/mongo/description" "go.mongodb.org/mongo-driver/mongo/options" @@ -38,6 +40,7 @@ type Collection struct { readPreference *readpref.ReadPref readSelector description.ServerSelector writeSelector description.ServerSelector + bsonOpts *options.BSONOptions registry *bsoncodec.Registry } @@ -46,6 +49,7 @@ type aggregateParams struct { ctx context.Context pipeline interface{} client *Client + bsonOpts *options.BSONOptions registry *bsoncodec.Registry readConcern *readconcern.ReadConcern writeConcern *writeconcern.WriteConcern @@ -82,6 +86,11 @@ func newCollection(db *Database, name string, opts ...*options.CollectionOptions rp = collOpt.ReadPreference } + bsonOpts := db.bsonOpts + if collOpt.BSONOptions != nil { + bsonOpts = collOpt.BSONOptions + } + reg := db.registry if collOpt.Registry != nil { reg = collOpt.Registry @@ -106,6 +115,7 @@ func newCollection(db *Database, name string, opts ...*options.CollectionOptions writeConcern: wc, readSelector: readSelector, writeSelector: writeSelector, + bsonOpts: bsonOpts, registry: reg, } @@ -242,11 +252,17 @@ func (coll *Collection) insert(ctx context.Context, documents []interface{}, docs := make([]bsoncore.Document, len(documents)) for i, doc := range documents { - var err error - docs[i], result[i], err = transformAndEnsureID(coll.registry, doc) + bsoncoreDoc, err := marshal(doc, coll.bsonOpts, coll.registry) if err != nil { return nil, err } + bsoncoreDoc, id, err := ensureID(bsoncoreDoc, primitive.NewObjectID(), coll.bsonOpts, coll.registry) + if err != nil { + return nil, err + } + + docs[i] = bsoncoreDoc + result[i] = id } sess := sessionFromContext(ctx) @@ -275,13 +291,13 @@ func (coll *Collection) insert(ctx context.Context, documents []interface{}, ServerSelector(selector).ClusterClock(coll.client.clock). Database(coll.db.name).Collection(coll.name). Deployment(coll.client.deployment).Crypt(coll.client.cryptFLE).Ordered(true). - ServerAPI(coll.client.serverAPI).Timeout(coll.client.timeout) + ServerAPI(coll.client.serverAPI).Timeout(coll.client.timeout).Logger(coll.client.logger) imo := options.MergeInsertManyOptions(opts...) if imo.BypassDocumentValidation != nil && *imo.BypassDocumentValidation { op = op.BypassDocumentValidation(*imo.BypassDocumentValidation) } if imo.Comment != nil { - comment, err := transformValue(coll.registry, imo.Comment, true, "comment") + comment, err := marshalValue(imo.Comment, coll.bsonOpts, coll.registry) if err != nil { return nil, err } @@ -400,7 +416,7 @@ func (coll *Collection) delete(ctx context.Context, filter interface{}, deleteOn ctx = context.Background() } - f, err := transformBsoncoreDocument(coll.registry, filter, true, "filter") + f, err := marshal(filter, coll.bsonOpts, coll.registry) if err != nil { return nil, err } @@ -438,7 +454,10 @@ func (coll *Collection) delete(ctx context.Context, filter interface{}, deleteOn doc = bsoncore.AppendDocumentElement(doc, "collation", do.Collation.ToDocument()) } if do.Hint != nil { - hint, err := transformValue(coll.registry, do.Hint, false, "hint") + if isUnorderedMap(do.Hint) { + return nil, ErrMapForOrderedArgument{"hint"} + } + hint, err := marshalValue(do.Hint, coll.bsonOpts, coll.registry) if err != nil { return nil, err } @@ -452,9 +471,9 @@ func (coll *Collection) delete(ctx context.Context, filter interface{}, deleteOn ServerSelector(selector).ClusterClock(coll.client.clock). Database(coll.db.name).Collection(coll.name). Deployment(coll.client.deployment).Crypt(coll.client.cryptFLE).Ordered(true). - ServerAPI(coll.client.serverAPI).Timeout(coll.client.timeout) + ServerAPI(coll.client.serverAPI).Timeout(coll.client.timeout).Logger(coll.client.logger) if do.Comment != nil { - comment, err := transformValue(coll.registry, do.Comment, true, "comment") + comment, err := marshalValue(do.Comment, coll.bsonOpts, coll.registry) if err != nil { return nil, err } @@ -464,7 +483,7 @@ func (coll *Collection) delete(ctx context.Context, filter interface{}, deleteOn op = op.Hint(true) } if do.Let != nil { - let, err := transformBsoncoreDocument(coll.registry, do.Let, true, "let") + let, err := marshal(do.Let, coll.bsonOpts, coll.registry) if err != nil { return nil, err } @@ -527,8 +546,17 @@ func (coll *Collection) updateOrReplace(ctx context.Context, filter bsoncore.Doc // collation, arrayFilters, upsert, and hint are included on the individual update documents rather than as part of the // command - updateDoc, err := createUpdateDoc(filter, update, uo.Hint, uo.ArrayFilters, uo.Collation, uo.Upsert, multi, - checkDollarKey, coll.registry) + updateDoc, err := createUpdateDoc( + filter, + update, + uo.Hint, + uo.ArrayFilters, + uo.Collation, + uo.Upsert, + multi, + checkDollarKey, + coll.bsonOpts, + coll.registry) if err != nil { return nil, err } @@ -560,9 +588,9 @@ func (coll *Collection) updateOrReplace(ctx context.Context, filter bsoncore.Doc Database(coll.db.name).Collection(coll.name). Deployment(coll.client.deployment).Crypt(coll.client.cryptFLE).Hint(uo.Hint != nil). ArrayFilters(uo.ArrayFilters != nil).Ordered(true).ServerAPI(coll.client.serverAPI). - Timeout(coll.client.timeout) + Timeout(coll.client.timeout).Logger(coll.client.logger) if uo.Let != nil { - let, err := transformBsoncoreDocument(coll.registry, uo.Let, true, "let") + let, err := marshal(uo.Let, coll.bsonOpts, coll.registry) if err != nil { return nil, err } @@ -573,7 +601,7 @@ func (coll *Collection) updateOrReplace(ctx context.Context, filter bsoncore.Doc op = op.BypassDocumentValidation(*uo.BypassDocumentValidation) } if uo.Comment != nil { - comment, err := transformValue(coll.registry, uo.Comment, true, "comment") + comment, err := marshalValue(uo.Comment, coll.bsonOpts, coll.registry) if err != nil { return nil, err } @@ -648,7 +676,7 @@ func (coll *Collection) UpdateOne(ctx context.Context, filter interface{}, updat ctx = context.Background() } - f, err := transformBsoncoreDocument(coll.registry, filter, true, "filter") + f, err := marshal(filter, coll.bsonOpts, coll.registry) if err != nil { return nil, err } @@ -676,7 +704,7 @@ func (coll *Collection) UpdateMany(ctx context.Context, filter interface{}, upda ctx = context.Background() } - f, err := transformBsoncoreDocument(coll.registry, filter, true, "filter") + f, err := marshal(filter, coll.bsonOpts, coll.registry) if err != nil { return nil, err } @@ -704,12 +732,12 @@ func (coll *Collection) ReplaceOne(ctx context.Context, filter interface{}, ctx = context.Background() } - f, err := transformBsoncoreDocument(coll.registry, filter, true, "filter") + f, err := marshal(filter, coll.bsonOpts, coll.registry) if err != nil { return nil, err } - r, err := transformBsoncoreDocument(coll.registry, replacement, true, "replacement") + r, err := marshal(replacement, coll.bsonOpts, coll.registry) if err != nil { return nil, err } @@ -756,6 +784,7 @@ func (coll *Collection) Aggregate(ctx context.Context, pipeline interface{}, registry: coll.registry, readConcern: coll.readConcern, writeConcern: coll.writeConcern, + bsonOpts: coll.bsonOpts, retryRead: coll.client.retryReads, db: coll.db.name, col: coll.name, @@ -773,7 +802,7 @@ func aggregate(a aggregateParams) (cur *Cursor, err error) { a.ctx = context.Background() } - pipelineArr, hasOutputStage, err := transformAggregatePipeline(a.registry, a.pipeline) + pipelineArr, hasOutputStage, err := marshalAggregatePipeline(a.pipeline, a.bsonOpts, a.registry) if err != nil { return nil, err } @@ -851,21 +880,24 @@ func aggregate(a aggregateParams) (cur *Cursor, err error) { if ao.Comment != nil { op.Comment(*ao.Comment) - commentVal, err := transformValue(a.registry, ao.Comment, true, "comment") + commentVal, err := marshalValue(ao.Comment, a.bsonOpts, a.registry) if err != nil { return nil, err } cursorOpts.Comment = commentVal } if ao.Hint != nil { - hintVal, err := transformValue(a.registry, ao.Hint, false, "hint") + if isUnorderedMap(ao.Hint) { + return nil, ErrMapForOrderedArgument{"hint"} + } + hintVal, err := marshalValue(ao.Hint, a.bsonOpts, a.registry) if err != nil { return nil, err } op.Hint(hintVal) } if ao.Let != nil { - let, err := transformBsoncoreDocument(a.registry, ao.Let, true, "let") + let, err := marshal(ao.Let, a.bsonOpts, a.registry) if err != nil { return nil, err } @@ -904,7 +936,7 @@ func aggregate(a aggregateParams) (cur *Cursor, err error) { if err != nil { return nil, replaceErrors(err) } - cursor, err := newCursorWithSession(bc, a.registry, sess) + cursor, err := newCursorWithSession(bc, a.client.bsonOpts, a.registry, sess) return cursor, replaceErrors(err) } @@ -925,7 +957,7 @@ func (coll *Collection) CountDocuments(ctx context.Context, filter interface{}, countOpts := options.MergeCountOptions(opts...) - pipelineArr, err := countDocumentsAggregatePipeline(coll.registry, filter, countOpts) + pipelineArr, err := countDocumentsAggregatePipeline(filter, coll.bsonOpts, coll.registry, countOpts) if err != nil { return 0, err } @@ -956,7 +988,10 @@ func (coll *Collection) CountDocuments(ctx context.Context, filter interface{}, op.Comment(*countOpts.Comment) } if countOpts.Hint != nil { - hintVal, err := transformValue(coll.registry, countOpts.Hint, false, "hint") + if isUnorderedMap(countOpts.Hint) { + return 0, ErrMapForOrderedArgument{"hint"} + } + hintVal, err := marshalValue(countOpts.Hint, coll.bsonOpts, coll.registry) if err != nil { return 0, err } @@ -1033,7 +1068,7 @@ func (coll *Collection) EstimatedDocumentCount(ctx context.Context, Timeout(coll.client.timeout).MaxTime(co.MaxTime) if co.Comment != nil { - comment, err := transformValue(coll.registry, co.Comment, false, "comment") + comment, err := marshalValue(co.Comment, coll.bsonOpts, coll.registry) if err != nil { return 0, err } @@ -1067,7 +1102,7 @@ func (coll *Collection) Distinct(ctx context.Context, fieldName string, filter i ctx = context.Background() } - f, err := transformBsoncoreDocument(coll.registry, filter, true, "filter") + f, err := marshal(filter, coll.bsonOpts, coll.registry) if err != nil { return nil, err } @@ -1103,7 +1138,7 @@ func (coll *Collection) Distinct(ctx context.Context, fieldName string, filter i op.Collation(bsoncore.Document(option.Collation.ToDocument())) } if option.Comment != nil { - comment, err := transformValue(coll.registry, option.Comment, true, "comment") + comment, err := marshalValue(option.Comment, coll.bsonOpts, coll.registry) if err != nil { return nil, err } @@ -1158,7 +1193,7 @@ func (coll *Collection) Find(ctx context.Context, filter interface{}, ctx = context.Background() } - f, err := transformBsoncoreDocument(coll.registry, filter, true, "filter") + f, err := marshal(filter, coll.bsonOpts, coll.registry) if err != nil { return nil, err } @@ -1192,7 +1227,7 @@ func (coll *Collection) Find(ctx context.Context, filter interface{}, CommandMonitor(coll.client.monitor).ServerSelector(selector). ClusterClock(coll.client.clock).Database(coll.db.name).Collection(coll.name). Deployment(coll.client.deployment).Crypt(coll.client.cryptFLE).ServerAPI(coll.client.serverAPI). - Timeout(coll.client.timeout).MaxTime(fo.MaxTime) + Timeout(coll.client.timeout).MaxTime(fo.MaxTime).Logger(coll.client.logger) cursorOpts := coll.client.createBaseCursorOptions() if fo.AllowDiskUse != nil { @@ -1211,7 +1246,7 @@ func (coll *Collection) Find(ctx context.Context, filter interface{}, if fo.Comment != nil { op.Comment(*fo.Comment) - commentVal, err := transformValue(coll.registry, fo.Comment, true, "comment") + commentVal, err := marshalValue(fo.Comment, coll.bsonOpts, coll.registry) if err != nil { return nil, err } @@ -1227,14 +1262,17 @@ func (coll *Collection) Find(ctx context.Context, filter interface{}, } } if fo.Hint != nil { - hint, err := transformValue(coll.registry, fo.Hint, false, "hint") + if isUnorderedMap(fo.Hint) { + return nil, ErrMapForOrderedArgument{"hint"} + } + hint, err := marshalValue(fo.Hint, coll.bsonOpts, coll.registry) if err != nil { return nil, err } op.Hint(hint) } if fo.Let != nil { - let, err := transformBsoncoreDocument(coll.registry, fo.Let, true, "let") + let, err := marshal(fo.Let, coll.bsonOpts, coll.registry) if err != nil { return nil, err } @@ -1250,7 +1288,7 @@ func (coll *Collection) Find(ctx context.Context, filter interface{}, op.Limit(limit) } if fo.Max != nil { - max, err := transformBsoncoreDocument(coll.registry, fo.Max, true, "max") + max, err := marshal(fo.Max, coll.bsonOpts, coll.registry) if err != nil { return nil, err } @@ -1260,7 +1298,7 @@ func (coll *Collection) Find(ctx context.Context, filter interface{}, cursorOpts.MaxTimeMS = int64(*fo.MaxAwaitTime / time.Millisecond) } if fo.Min != nil { - min, err := transformBsoncoreDocument(coll.registry, fo.Min, true, "min") + min, err := marshal(fo.Min, coll.bsonOpts, coll.registry) if err != nil { return nil, err } @@ -1273,7 +1311,7 @@ func (coll *Collection) Find(ctx context.Context, filter interface{}, op.OplogReplay(*fo.OplogReplay) } if fo.Projection != nil { - proj, err := transformBsoncoreDocument(coll.registry, fo.Projection, true, "projection") + proj, err := marshal(fo.Projection, coll.bsonOpts, coll.registry) if err != nil { return nil, err } @@ -1292,7 +1330,10 @@ func (coll *Collection) Find(ctx context.Context, filter interface{}, op.Snapshot(*fo.Snapshot) } if fo.Sort != nil { - sort, err := transformBsoncoreDocument(coll.registry, fo.Sort, false, "sort") + if isUnorderedMap(fo.Sort) { + return nil, ErrMapForOrderedArgument{"sort"} + } + sort, err := marshal(fo.Sort, coll.bsonOpts, coll.registry) if err != nil { return nil, err } @@ -1312,7 +1353,7 @@ func (coll *Collection) Find(ctx context.Context, filter interface{}, if err != nil { return nil, replaceErrors(err) } - return newCursorWithSession(bc, coll.registry, sess) + return newCursorWithSession(bc, coll.bsonOpts, coll.registry, sess) } // FindOne executes a find command and returns a SingleResult for one document in the collection. @@ -1362,7 +1403,13 @@ func (coll *Collection) FindOne(ctx context.Context, filter interface{}, findOpts = append(findOpts, options.Find().SetLimit(-1)) cursor, err := coll.Find(ctx, filter, findOpts...) - return &SingleResult{cur: cursor, reg: coll.registry, err: replaceErrors(err)} + return &SingleResult{ + ctx: ctx, + cur: cursor, + bsonOpts: coll.bsonOpts, + reg: coll.registry, + err: replaceErrors(err), + } } func (coll *Collection) findAndModify(ctx context.Context, op *operation.FindAndModify) *SingleResult { @@ -1413,7 +1460,12 @@ func (coll *Collection) findAndModify(ctx context.Context, op *operation.FindAnd return &SingleResult{err: err} } - return &SingleResult{rdr: bson.Raw(op.Result().Value), reg: coll.registry} + return &SingleResult{ + ctx: ctx, + rdr: bson.Raw(op.Result().Value), + bsonOpts: coll.bsonOpts, + reg: coll.registry, + } } // FindOneAndDelete executes a findAndModify command to delete at most one document in the collection. and returns the @@ -1430,7 +1482,7 @@ func (coll *Collection) findAndModify(ctx context.Context, op *operation.FindAnd func (coll *Collection) FindOneAndDelete(ctx context.Context, filter interface{}, opts ...*options.FindOneAndDeleteOptions) *SingleResult { - f, err := transformBsoncoreDocument(coll.registry, filter, true, "filter") + f, err := marshal(filter, coll.bsonOpts, coll.registry) if err != nil { return &SingleResult{err: err} } @@ -1441,35 +1493,41 @@ func (coll *Collection) FindOneAndDelete(ctx context.Context, filter interface{} op = op.Collation(bsoncore.Document(fod.Collation.ToDocument())) } if fod.Comment != nil { - comment, err := transformValue(coll.registry, fod.Comment, true, "comment") + comment, err := marshalValue(fod.Comment, coll.bsonOpts, coll.registry) if err != nil { return &SingleResult{err: err} } op = op.Comment(comment) } if fod.Projection != nil { - proj, err := transformBsoncoreDocument(coll.registry, fod.Projection, true, "projection") + proj, err := marshal(fod.Projection, coll.bsonOpts, coll.registry) if err != nil { return &SingleResult{err: err} } op = op.Fields(proj) } if fod.Sort != nil { - sort, err := transformBsoncoreDocument(coll.registry, fod.Sort, false, "sort") + if isUnorderedMap(fod.Sort) { + return &SingleResult{err: ErrMapForOrderedArgument{"sort"}} + } + sort, err := marshal(fod.Sort, coll.bsonOpts, coll.registry) if err != nil { return &SingleResult{err: err} } op = op.Sort(sort) } if fod.Hint != nil { - hint, err := transformValue(coll.registry, fod.Hint, false, "hint") + if isUnorderedMap(fod.Hint) { + return &SingleResult{err: ErrMapForOrderedArgument{"hint"}} + } + hint, err := marshalValue(fod.Hint, coll.bsonOpts, coll.registry) if err != nil { return &SingleResult{err: err} } op = op.Hint(hint) } if fod.Let != nil { - let, err := transformBsoncoreDocument(coll.registry, fod.Let, true, "let") + let, err := marshal(fod.Let, coll.bsonOpts, coll.registry) if err != nil { return &SingleResult{err: err} } @@ -1496,11 +1554,11 @@ func (coll *Collection) FindOneAndDelete(ctx context.Context, filter interface{} func (coll *Collection) FindOneAndReplace(ctx context.Context, filter interface{}, replacement interface{}, opts ...*options.FindOneAndReplaceOptions) *SingleResult { - f, err := transformBsoncoreDocument(coll.registry, filter, true, "filter") + f, err := marshal(filter, coll.bsonOpts, coll.registry) if err != nil { return &SingleResult{err: err} } - r, err := transformBsoncoreDocument(coll.registry, replacement, true, "replacement") + r, err := marshal(replacement, coll.bsonOpts, coll.registry) if err != nil { return &SingleResult{err: err} } @@ -1518,14 +1576,14 @@ func (coll *Collection) FindOneAndReplace(ctx context.Context, filter interface{ op = op.Collation(bsoncore.Document(fo.Collation.ToDocument())) } if fo.Comment != nil { - comment, err := transformValue(coll.registry, fo.Comment, true, "comment") + comment, err := marshalValue(fo.Comment, coll.bsonOpts, coll.registry) if err != nil { return &SingleResult{err: err} } op = op.Comment(comment) } if fo.Projection != nil { - proj, err := transformBsoncoreDocument(coll.registry, fo.Projection, true, "projection") + proj, err := marshal(fo.Projection, coll.bsonOpts, coll.registry) if err != nil { return &SingleResult{err: err} } @@ -1535,7 +1593,10 @@ func (coll *Collection) FindOneAndReplace(ctx context.Context, filter interface{ op = op.NewDocument(*fo.ReturnDocument == options.After) } if fo.Sort != nil { - sort, err := transformBsoncoreDocument(coll.registry, fo.Sort, false, "sort") + if isUnorderedMap(fo.Sort) { + return &SingleResult{err: ErrMapForOrderedArgument{"sort"}} + } + sort, err := marshal(fo.Sort, coll.bsonOpts, coll.registry) if err != nil { return &SingleResult{err: err} } @@ -1545,14 +1606,17 @@ func (coll *Collection) FindOneAndReplace(ctx context.Context, filter interface{ op = op.Upsert(*fo.Upsert) } if fo.Hint != nil { - hint, err := transformValue(coll.registry, fo.Hint, false, "hint") + if isUnorderedMap(fo.Hint) { + return &SingleResult{err: ErrMapForOrderedArgument{"hint"}} + } + hint, err := marshalValue(fo.Hint, coll.bsonOpts, coll.registry) if err != nil { return &SingleResult{err: err} } op = op.Hint(hint) } if fo.Let != nil { - let, err := transformBsoncoreDocument(coll.registry, fo.Let, true, "let") + let, err := marshal(fo.Let, coll.bsonOpts, coll.registry) if err != nil { return &SingleResult{err: err} } @@ -1584,7 +1648,7 @@ func (coll *Collection) FindOneAndUpdate(ctx context.Context, filter interface{} ctx = context.Background() } - f, err := transformBsoncoreDocument(coll.registry, filter, true, "filter") + f, err := marshal(filter, coll.bsonOpts, coll.registry) if err != nil { return &SingleResult{err: err} } @@ -1593,18 +1657,23 @@ func (coll *Collection) FindOneAndUpdate(ctx context.Context, filter interface{} op := operation.NewFindAndModify(f).ServerAPI(coll.client.serverAPI).Timeout(coll.client.timeout). MaxTime(fo.MaxTime) - u, err := transformUpdateValue(coll.registry, update, true) + u, err := marshalUpdateValue(update, coll.bsonOpts, coll.registry, true) if err != nil { return &SingleResult{err: err} } op = op.Update(u) if fo.ArrayFilters != nil { - filtersDoc, err := fo.ArrayFilters.ToArrayDocument() + af := fo.ArrayFilters + reg := coll.registry + if af.Registry != nil { + reg = af.Registry + } + filtersDoc, err := marshalValue(af.Filters, coll.bsonOpts, reg) if err != nil { return &SingleResult{err: err} } - op = op.ArrayFilters(bsoncore.Document(filtersDoc)) + op = op.ArrayFilters(filtersDoc.Data) } if fo.BypassDocumentValidation != nil && *fo.BypassDocumentValidation { op = op.BypassDocumentValidation(*fo.BypassDocumentValidation) @@ -1613,14 +1682,14 @@ func (coll *Collection) FindOneAndUpdate(ctx context.Context, filter interface{} op = op.Collation(bsoncore.Document(fo.Collation.ToDocument())) } if fo.Comment != nil { - comment, err := transformValue(coll.registry, fo.Comment, true, "comment") + comment, err := marshalValue(fo.Comment, coll.bsonOpts, coll.registry) if err != nil { return &SingleResult{err: err} } op = op.Comment(comment) } if fo.Projection != nil { - proj, err := transformBsoncoreDocument(coll.registry, fo.Projection, true, "projection") + proj, err := marshal(fo.Projection, coll.bsonOpts, coll.registry) if err != nil { return &SingleResult{err: err} } @@ -1630,7 +1699,10 @@ func (coll *Collection) FindOneAndUpdate(ctx context.Context, filter interface{} op = op.NewDocument(*fo.ReturnDocument == options.After) } if fo.Sort != nil { - sort, err := transformBsoncoreDocument(coll.registry, fo.Sort, false, "sort") + if isUnorderedMap(fo.Sort) { + return &SingleResult{err: ErrMapForOrderedArgument{"sort"}} + } + sort, err := marshal(fo.Sort, coll.bsonOpts, coll.registry) if err != nil { return &SingleResult{err: err} } @@ -1640,14 +1712,17 @@ func (coll *Collection) FindOneAndUpdate(ctx context.Context, filter interface{} op = op.Upsert(*fo.Upsert) } if fo.Hint != nil { - hint, err := transformValue(coll.registry, fo.Hint, false, "hint") + if isUnorderedMap(fo.Hint) { + return &SingleResult{err: ErrMapForOrderedArgument{"hint"}} + } + hint, err := marshalValue(fo.Hint, coll.bsonOpts, coll.registry) if err != nil { return &SingleResult{err: err} } op = op.Hint(hint) } if fo.Let != nil { - let, err := transformBsoncoreDocument(coll.registry, fo.Let, true, "let") + let, err := marshal(fo.Let, coll.bsonOpts, coll.registry) if err != nil { return &SingleResult{err: err} } @@ -1677,6 +1752,7 @@ func (coll *Collection) Watch(ctx context.Context, pipeline interface{}, readConcern: coll.readConcern, readPreference: coll.readPreference, client: coll.client, + bsonOpts: coll.bsonOpts, registry: coll.registry, streamType: CollectionStream, collectionName: coll.Name(), @@ -1715,12 +1791,12 @@ func (coll *Collection) Drop(ctx context.Context) error { // dropEncryptedCollection drops a collection with EncryptedFields. func (coll *Collection) dropEncryptedCollection(ctx context.Context, ef interface{}) error { - efBSON, err := transformBsoncoreDocument(coll.registry, ef, true /* mapAllowed */, "encryptedFields") + efBSON, err := marshal(ef, coll.bsonOpts, coll.registry) if err != nil { return fmt.Errorf("error transforming document: %v", err) } - // Drop the three encryption-related, associated collections: `escCollection`, `eccCollection` and `ecocCollection`. + // Drop the two encryption-related, associated collections: `escCollection` and `ecocCollection`. // Drop ESCCollection. escCollection, err := internal.GetEncryptedStateCollectionName(efBSON, coll.name, internal.EncryptedStateCollection) if err != nil { @@ -1730,15 +1806,6 @@ func (coll *Collection) dropEncryptedCollection(ctx context.Context, ef interfac return err } - // Drop ECCCollection. - eccCollection, err := internal.GetEncryptedStateCollectionName(efBSON, coll.name, internal.EncryptedCacheCollection) - if err != nil { - return err - } - if err := coll.db.Collection(eccCollection).drop(ctx); err != nil { - return err - } - // Drop ECOCCollection. ecocCollection, err := internal.GetEncryptedStateCollectionName(efBSON, coll.name, internal.EncryptedCompactionCollection) if err != nil { @@ -1749,10 +1816,7 @@ func (coll *Collection) dropEncryptedCollection(ctx context.Context, ef interfac } // Drop the data collection. - if err := coll.drop(ctx); err != nil { - return err - } - return nil + return coll.drop(ctx) } // drop drops a collection without EncryptedFields. @@ -1840,3 +1904,11 @@ func makeOutputAggregateSelector(sess *session.Client, rp *readpref.ReadPref, lo }) return makePinnedSelector(sess, selector) } + +// isUnorderedMap returns true if val is a map with more than 1 element. It is typically used to +// check for unordered Go values that are used in nested command documents where different field +// orders mean different things. Examples are the "sort" and "hint" fields. +func isUnorderedMap(val interface{}) bool { + refValue := reflect.ValueOf(val) + return refValue.Kind() == reflect.Map && refValue.Len() > 1 +} diff --git a/vendor/go.mongodb.org/mongo-driver/mongo/cursor.go b/vendor/go.mongodb.org/mongo-driver/mongo/cursor.go index e2320eade0..9b348cb46a 100644 --- a/vendor/go.mongodb.org/mongo-driver/mongo/cursor.go +++ b/vendor/go.mongodb.org/mongo-driver/mongo/cursor.go @@ -15,7 +15,8 @@ import ( "go.mongodb.org/mongo-driver/bson" "go.mongodb.org/mongo-driver/bson/bsoncodec" - "go.mongodb.org/mongo-driver/x/bsonx" + "go.mongodb.org/mongo-driver/bson/bsonrw" + "go.mongodb.org/mongo-driver/mongo/options" "go.mongodb.org/mongo-driver/x/bsonx/bsoncore" "go.mongodb.org/mongo-driver/x/mongo/driver" "go.mongodb.org/mongo-driver/x/mongo/driver/session" @@ -32,17 +33,27 @@ type Cursor struct { bc batchCursor batch *bsoncore.DocumentSequence batchLength int + bsonOpts *options.BSONOptions registry *bsoncodec.Registry clientSession *session.Client err error } -func newCursor(bc batchCursor, registry *bsoncodec.Registry) (*Cursor, error) { - return newCursorWithSession(bc, registry, nil) +func newCursor( + bc batchCursor, + bsonOpts *options.BSONOptions, + registry *bsoncodec.Registry, +) (*Cursor, error) { + return newCursorWithSession(bc, bsonOpts, registry, nil) } -func newCursorWithSession(bc batchCursor, registry *bsoncodec.Registry, clientSession *session.Client) (*Cursor, error) { +func newCursorWithSession( + bc batchCursor, + bsonOpts *options.BSONOptions, + registry *bsoncodec.Registry, + clientSession *session.Client, +) (*Cursor, error) { if registry == nil { registry = bson.DefaultRegistry } @@ -51,6 +62,7 @@ func newCursorWithSession(bc batchCursor, registry *bsoncodec.Registry, clientSe } c := &Cursor{ bc: bc, + bsonOpts: bsonOpts, registry: registry, clientSession: clientSession, } @@ -83,8 +95,6 @@ func NewCursorFromDocuments(documents []interface{}, err error, registry *bsonco switch t := doc.(type) { case nil: return nil, ErrNilDocument - case bsonx.Doc: - doc = t.Copy() case []byte: // Slight optimization so we'll just use MarshalBSON and not go through the codec machinery. doc = bson.Raw(t) @@ -115,8 +125,8 @@ func (c *Cursor) ID() int64 { return c.bc.ID() } // Next gets the next document for this cursor. It returns true if there were no errors and the cursor has not been // exhausted. // -// Next blocks until a document is available, an error occurs, or ctx expires. If ctx expires, the -// error will be set to ctx.Err(). In an error case, Next will return false. +// Next blocks until a document is available or an error occurs. If the context expires, the cursor's error will +// be set to ctx.Err(). In case of an error, Next will return false. // // If Next returns false, subsequent calls will also return false. func (c *Cursor) Next(ctx context.Context) bool { @@ -128,7 +138,7 @@ func (c *Cursor) Next(ctx context.Context) bool { // Next. See https://www.mongodb.com/docs/manual/core/tailable-cursors/ for more information about tailable cursors. // // TryNext returns false if the cursor is exhausted, an error occurs when getting results from the server, the next -// document is not yet available, or ctx expires. If ctx expires, the error will be set to ctx.Err(). +// document is not yet available, or ctx expires. If the context expires, the cursor's error will be set to ctx.Err(). // // If TryNext returns false and an error occurred or the cursor has been exhausted (i.e. c.Err() != nil || c.ID() == 0), // subsequent attempts will also return false. Otherwise, it is safe to call TryNext again until a document is @@ -206,10 +216,62 @@ func (c *Cursor) next(ctx context.Context, nonBlocking bool) bool { } } +func getDecoder( + data []byte, + opts *options.BSONOptions, + reg *bsoncodec.Registry, +) (*bson.Decoder, error) { + dec, err := bson.NewDecoder(bsonrw.NewBSONDocumentReader(data)) + if err != nil { + return nil, err + } + + if opts != nil { + if opts.AllowTruncatingDoubles { + dec.AllowTruncatingDoubles() + } + if opts.BinaryAsSlice { + dec.BinaryAsSlice() + } + if opts.DefaultDocumentD { + dec.DefaultDocumentD() + } + if opts.DefaultDocumentM { + dec.DefaultDocumentM() + } + if opts.UseJSONStructTags { + dec.UseJSONStructTags() + } + if opts.UseLocalTimeZone { + dec.UseLocalTimeZone() + } + if opts.ZeroMaps { + dec.ZeroMaps() + } + if opts.ZeroStructs { + dec.ZeroStructs() + } + } + + if reg != nil { + // TODO:(GODRIVER-2719): Remove error handling. + if err := dec.SetRegistry(reg); err != nil { + return nil, err + } + } + + return dec, nil +} + // Decode will unmarshal the current document into val and return any errors from the unmarshalling process without any // modification. If val is nil or is a typed nil, an error will be returned. func (c *Cursor) Decode(val interface{}) error { - return bson.UnmarshalWithRegistry(c.registry, c.Current, val) + dec, err := getDecoder(c.Current, c.bsonOpts, c.registry) + if err != nil { + return fmt.Errorf("error configuring BSON decoder: %w", err) + } + + return dec.Decode(val) } // Err returns the last error seen by the Cursor, or nil if no error has occurred. @@ -298,7 +360,12 @@ func (c *Cursor) addFromBatch(sliceVal reflect.Value, elemType reflect.Type, bat } currElem := sliceVal.Index(index).Addr().Interface() - if err = bson.UnmarshalWithRegistry(c.registry, doc, currElem); err != nil { + dec, err := getDecoder(doc, c.bsonOpts, c.registry) + if err != nil { + return sliceVal, index, fmt.Errorf("error configuring BSON decoder: %w", err) + } + err = dec.Decode(currElem) + if err != nil { return sliceVal, index, err } diff --git a/vendor/go.mongodb.org/mongo-driver/mongo/database.go b/vendor/go.mongodb.org/mongo-driver/mongo/database.go index 415537d514..8dd0352aed 100644 --- a/vendor/go.mongodb.org/mongo-driver/mongo/database.go +++ b/vendor/go.mongodb.org/mongo-driver/mongo/database.go @@ -10,6 +10,7 @@ import ( "context" "errors" "fmt" + "time" "go.mongodb.org/mongo-driver/bson" "go.mongodb.org/mongo-driver/bson/bsoncodec" @@ -38,6 +39,7 @@ type Database struct { readPreference *readpref.ReadPref readSelector description.ServerSelector writeSelector description.ServerSelector + bsonOpts *options.BSONOptions registry *bsoncodec.Registry } @@ -59,6 +61,11 @@ func newDatabase(client *Client, name string, opts ...*options.DatabaseOptions) wc = dbOpt.WriteConcern } + bsonOpts := client.bsonOpts + if dbOpt.BSONOptions != nil { + bsonOpts = dbOpt.BSONOptions + } + reg := client.registry if dbOpt.Registry != nil { reg = dbOpt.Registry @@ -70,6 +77,7 @@ func newDatabase(client *Client, name string, opts ...*options.DatabaseOptions) readPreference: rp, readConcern: rc, writeConcern: wc, + bsonOpts: bsonOpts, registry: reg, } @@ -149,7 +157,11 @@ func (db *Database) processRunCommand(ctx context.Context, cmd interface{}, return nil, sess, errors.New("read preference in a transaction must be primary") } - runCmdDoc, err := transformBsoncoreDocument(db.registry, cmd, false, "cmd") + if isUnorderedMap(cmd) { + return nil, sess, ErrMapForOrderedArgument{"cmd"} + } + + runCmdDoc, err := marshal(cmd, db.bsonOpts, db.registry) if err != nil { return nil, sess, err } @@ -169,11 +181,15 @@ func (db *Database) processRunCommand(ctx context.Context, cmd interface{}, default: op = operation.NewCommand(runCmdDoc) } + + // TODO(GODRIVER-2649): ReadConcern(db.readConcern) will not actually pass the database's + // read concern. Remove this note once readConcern is correctly passed to the operation + // level. return op.Session(sess).CommandMonitor(db.client.monitor). ServerSelector(readSelect).ClusterClock(db.client.clock). Database(db.name).Deployment(db.client.deployment).ReadConcern(db.readConcern). Crypt(db.client.cryptFLE).ReadPreference(ro.ReadPreference).ServerAPI(db.client.serverAPI). - Timeout(db.client.timeout), sess, nil + Timeout(db.client.timeout).Logger(db.client.logger), sess, nil } // RunCommand executes the given command against the database. This function does not obey the Database's read @@ -203,9 +219,11 @@ func (db *Database) RunCommand(ctx context.Context, runCommand interface{}, opts // RunCommand can be used to run a write, thus execute may return a write error _, convErr := processWriteError(err) return &SingleResult{ - err: convErr, - rdr: bson.Raw(op.Result()), - reg: db.registry, + ctx: ctx, + err: convErr, + rdr: bson.Raw(op.Result()), + bsonOpts: db.bsonOpts, + reg: db.registry, } } @@ -244,7 +262,7 @@ func (db *Database) RunCommandCursor(ctx context.Context, runCommand interface{} closeImplicitSession(sess) return nil, replaceErrors(err) } - cursor, err := newCursorWithSession(bc, db.registry, sess) + cursor, err := newCursorWithSession(bc, db.bsonOpts, db.registry, sess) return cursor, replaceErrors(err) } @@ -347,7 +365,7 @@ func (db *Database) ListCollections(ctx context.Context, filter interface{}, opt ctx = context.Background() } - filterDoc, err := transformBsoncoreDocument(db.registry, filter, true, "filter") + filterDoc, err := marshal(filter, db.bsonOpts, db.registry) if err != nil { return nil, err } @@ -405,7 +423,7 @@ func (db *Database) ListCollections(ctx context.Context, filter interface{}, opt closeImplicitSession(sess) return nil, replaceErrors(err) } - cursor, err := newCursorWithSession(bc, db.registry, sess) + cursor, err := newCursorWithSession(bc, db.bsonOpts, db.registry, sess) return cursor, replaceErrors(err) } @@ -569,12 +587,32 @@ func (db *Database) getEncryptedFieldsFromMap(collectionName string) interface{} // createCollectionWithEncryptedFields creates a collection with an EncryptedFields. func (db *Database) createCollectionWithEncryptedFields(ctx context.Context, name string, ef interface{}, opts ...*options.CreateCollectionOptions) error { - efBSON, err := transformBsoncoreDocument(db.registry, ef, true /* mapAllowed */, "encryptedFields") + efBSON, err := marshal(ef, db.bsonOpts, db.registry) if err != nil { return fmt.Errorf("error transforming document: %v", err) } - // Create the three encryption-related, associated collections: `escCollection`, `eccCollection` and `ecocCollection`. + // Check the wire version to ensure server is 7.0.0 or newer. + // After the wire version check, and before creating the collections, it is possible the server state changes. + // That is OK. This wire version check is a best effort to inform users earlier if using a QEv2 driver with a QEv1 server. + { + const QEv2WireVersion = 21 + server, err := db.client.deployment.SelectServer(ctx, description.WriteSelector()) + if err != nil { + return fmt.Errorf("error selecting server to check maxWireVersion: %w", err) + } + conn, err := server.Connection(ctx) + if err != nil { + return fmt.Errorf("error getting connection to check maxWireVersion: %w", err) + } + defer conn.Close() + wireVersionRange := conn.Description().WireVersion + if wireVersionRange.Max < QEv2WireVersion { + return fmt.Errorf("Driver support of Queryable Encryption is incompatible with server. Upgrade server to use Queryable Encryption. Got maxWireVersion %v but need maxWireVersion >= %v", wireVersionRange.Max, QEv2WireVersion) + } + } + + // Create the two encryption-related, associated collections: `escCollection` and `ecocCollection`. stateCollectionOpts := options.CreateCollection(). SetClusteredIndex(bson.D{{"key", bson.D{{"_id", 1}}}, {"unique", true}}) @@ -588,16 +626,6 @@ func (db *Database) createCollectionWithEncryptedFields(ctx context.Context, nam return err } - // Create ECCCollection. - eccCollection, err := internal.GetEncryptedStateCollectionName(efBSON, name, internal.EncryptedCacheCollection) - if err != nil { - return err - } - - if err := db.createCollection(ctx, eccCollection, stateCollectionOpts); err != nil { - return err - } - // Create ECOCCollection. ecocCollection, err := internal.GetEncryptedStateCollectionName(efBSON, name, internal.EncryptedCompactionCollection) if err != nil { @@ -647,7 +675,7 @@ func (db *Database) createCollectionOperation(name string, opts ...*options.Crea op.Collation(bsoncore.Document(cco.Collation.ToDocument())) } if cco.ChangeStreamPreAndPostImages != nil { - csppi, err := transformBsoncoreDocument(db.registry, cco.ChangeStreamPreAndPostImages, true, "changeStreamPreAndPostImages") + csppi, err := marshal(cco.ChangeStreamPreAndPostImages, db.bsonOpts, db.registry) if err != nil { return nil, err } @@ -656,7 +684,7 @@ func (db *Database) createCollectionOperation(name string, opts ...*options.Crea if cco.DefaultIndexOptions != nil { idx, doc := bsoncore.AppendDocumentStart(nil) if cco.DefaultIndexOptions.StorageEngine != nil { - storageEngine, err := transformBsoncoreDocument(db.registry, cco.DefaultIndexOptions.StorageEngine, true, "storageEngine") + storageEngine, err := marshal(cco.DefaultIndexOptions.StorageEngine, db.bsonOpts, db.registry) if err != nil { return nil, err } @@ -677,7 +705,7 @@ func (db *Database) createCollectionOperation(name string, opts ...*options.Crea op.Size(*cco.SizeInBytes) } if cco.StorageEngine != nil { - storageEngine, err := transformBsoncoreDocument(db.registry, cco.StorageEngine, true, "storageEngine") + storageEngine, err := marshal(cco.StorageEngine, db.bsonOpts, db.registry) if err != nil { return nil, err } @@ -690,7 +718,7 @@ func (db *Database) createCollectionOperation(name string, opts ...*options.Crea op.ValidationLevel(*cco.ValidationLevel) } if cco.Validator != nil { - validator, err := transformBsoncoreDocument(db.registry, cco.Validator, true, "validator") + validator, err := marshal(cco.Validator, db.bsonOpts, db.registry) if err != nil { return nil, err } @@ -710,6 +738,18 @@ func (db *Database) createCollectionOperation(name string, opts ...*options.Crea doc = bsoncore.AppendStringElement(doc, "granularity", *cco.TimeSeriesOptions.Granularity) } + if cco.TimeSeriesOptions.BucketMaxSpan != nil { + bmss := int64(*cco.TimeSeriesOptions.BucketMaxSpan / time.Second) + + doc = bsoncore.AppendInt64Element(doc, "bucketMaxSpanSeconds", bmss) + } + + if cco.TimeSeriesOptions.BucketRounding != nil { + brs := int64(*cco.TimeSeriesOptions.BucketRounding / time.Second) + + doc = bsoncore.AppendInt64Element(doc, "bucketRoundingSeconds", brs) + } + doc, err := bsoncore.AppendDocumentEnd(doc, idx) if err != nil { return nil, err @@ -718,7 +758,7 @@ func (db *Database) createCollectionOperation(name string, opts ...*options.Crea op.TimeSeries(doc) } if cco.ClusteredIndex != nil { - clusteredIndex, err := transformBsoncoreDocument(db.registry, cco.ClusteredIndex, true, "clusteredIndex") + clusteredIndex, err := marshal(cco.ClusteredIndex, db.bsonOpts, db.registry) if err != nil { return nil, err } @@ -744,7 +784,7 @@ func (db *Database) createCollectionOperation(name string, opts ...*options.Crea func (db *Database) CreateView(ctx context.Context, viewName, viewOn string, pipeline interface{}, opts ...*options.CreateViewOptions) error { - pipelineArray, _, err := transformAggregatePipeline(db.registry, pipeline) + pipelineArray, _, err := marshalAggregatePipeline(pipeline, db.bsonOpts, db.registry) if err != nil { return err } diff --git a/vendor/go.mongodb.org/mongo-driver/mongo/description/server_selector.go b/vendor/go.mongodb.org/mongo-driver/mongo/description/server_selector.go index df5e77a454..2b21a4bd6d 100644 --- a/vendor/go.mongodb.org/mongo-driver/mongo/description/server_selector.go +++ b/vendor/go.mongodb.org/mongo-driver/mongo/description/server_selector.go @@ -96,15 +96,21 @@ func (ls *latencySelector) SelectServer(t Topology, candidates []Server) ([]Serv max := min + ls.latency - var result []Server - for _, candidate := range candidates { + viableIndexes := make([]int, 0, len(candidates)) + for i, candidate := range candidates { if candidate.AverageRTTSet { if candidate.AverageRTT <= max { - result = append(result, candidate) + viableIndexes = append(viableIndexes, i) } } } - + if len(viableIndexes) == len(candidates) { + return candidates, nil + } + result := make([]Server, len(viableIndexes)) + for i, idx := range viableIndexes { + result[i] = candidates[idx] + } return result, nil } } @@ -304,6 +310,9 @@ func selectByKind(candidates []Server, kind ServerKind) []Server { viableIndexes = append(viableIndexes, i) } } + if len(viableIndexes) == len(candidates) { + return candidates + } result := make([]Server, len(viableIndexes)) for i, idx := range viableIndexes { result[i] = candidates[idx] diff --git a/vendor/go.mongodb.org/mongo-driver/mongo/doc.go b/vendor/go.mongodb.org/mongo-driver/mongo/doc.go index 39bb530995..e0a5d66ac2 100644 --- a/vendor/go.mongodb.org/mongo-driver/mongo/doc.go +++ b/vendor/go.mongodb.org/mongo-driver/mongo/doc.go @@ -94,10 +94,13 @@ // // # Potential DNS Issues // -// Building with Go 1.11+ and using connection strings with the "mongodb+srv"[1] scheme is +// Building with Go 1.11+ and using connection strings with the "mongodb+srv"[1] scheme is unfortunately // incompatible with some DNS servers in the wild due to the change introduced in -// https://github.com/golang/go/issues/10622. If you receive an error with the message "cannot -// unmarshal DNS message" while running an operation, we suggest you use a different DNS server. +// https://github.com/golang/go/issues/10622. You may receive an error with the message "cannot unmarshal DNS message" +// while running an operation when using DNS servers that non-compliantly compress SRV records. Old versions of kube-dns +// and the native DNS resolver (systemd-resolver) on Ubuntu 18.04 are known to be non-compliant in this manner. We suggest +// using a different DNS server (8.8.8.8 is the common default), and, if that's not possible, avoiding the "mongodb+srv" +// scheme. // // # Client Side Encryption // @@ -122,6 +125,8 @@ // This bug may result in data corruption. // Please use libmongocrypt 1.5.2 or higher when calling RewrapManyDataKey. // +// - Go Driver v1.12.0 requires libmongocrypt v1.8.0 or higher. +// // To install libmongocrypt, follow the instructions for your // operating system: // diff --git a/vendor/go.mongodb.org/mongo-driver/mongo/errors.go b/vendor/go.mongodb.org/mongo-driver/mongo/errors.go index 5c72a495e3..aff99378da 100644 --- a/vendor/go.mongodb.org/mongo-driver/mongo/errors.go +++ b/vendor/go.mongodb.org/mongo-driver/mongo/errors.go @@ -320,7 +320,7 @@ func (we WriteError) HasErrorCode(code int) bool { // HasErrorLabel returns true if the error contains the specified label. WriteErrors do not contain labels, // so we always return false. -func (we WriteError) HasErrorLabel(label string) bool { +func (we WriteError) HasErrorLabel(string) bool { return false } diff --git a/vendor/go.mongodb.org/mongo-driver/mongo/index_view.go b/vendor/go.mongodb.org/mongo-driver/mongo/index_view.go index 3500b775fb..502de2f2f1 100644 --- a/vendor/go.mongodb.org/mongo-driver/mongo/index_view.go +++ b/vendor/go.mongodb.org/mongo-driver/mongo/index_view.go @@ -122,7 +122,7 @@ func (iv IndexView) List(ctx context.Context, opts ...*options.ListIndexesOption closeImplicitSession(sess) return nil, replaceErrors(err) } - cursor, err := newCursorWithSession(bc, iv.coll.registry, sess) + cursor, err := newCursorWithSession(bc, iv.coll.bsonOpts, iv.coll.registry, sess) return cursor, replaceErrors(err) } @@ -181,7 +181,11 @@ func (iv IndexView) CreateMany(ctx context.Context, models []IndexModel, opts .. return nil, fmt.Errorf("index model keys cannot be nil") } - keys, err := transformBsoncoreDocument(iv.coll.registry, model.Keys, false, "keys") + if isUnorderedMap(model.Keys) { + return nil, ErrMapForOrderedArgument{"keys"} + } + + keys, err := marshal(model.Keys, iv.coll.bsonOpts, iv.coll.registry) if err != nil { return nil, err } @@ -250,7 +254,7 @@ func (iv IndexView) CreateMany(ctx context.Context, models []IndexModel, opts .. Deployment(iv.coll.client.deployment).ServerSelector(selector).ServerAPI(iv.coll.client.serverAPI). Timeout(iv.coll.client.timeout).MaxTime(option.MaxTime) if option.CommitQuorum != nil { - commitQuorum, err := transformValue(iv.coll.registry, option.CommitQuorum, true, "commitQuorum") + commitQuorum, err := marshalValue(option.CommitQuorum, iv.coll.bsonOpts, iv.coll.registry) if err != nil { return nil, err } @@ -282,7 +286,7 @@ func (iv IndexView) createOptionsDoc(opts *options.IndexOptions) (bsoncore.Docum optsDoc = bsoncore.AppendBooleanElement(optsDoc, "sparse", *opts.Sparse) } if opts.StorageEngine != nil { - doc, err := transformBsoncoreDocument(iv.coll.registry, opts.StorageEngine, true, "storageEngine") + doc, err := marshal(opts.StorageEngine, iv.coll.bsonOpts, iv.coll.registry) if err != nil { return nil, err } @@ -305,7 +309,7 @@ func (iv IndexView) createOptionsDoc(opts *options.IndexOptions) (bsoncore.Docum optsDoc = bsoncore.AppendInt32Element(optsDoc, "textIndexVersion", *opts.TextVersion) } if opts.Weights != nil { - doc, err := transformBsoncoreDocument(iv.coll.registry, opts.Weights, true, "weights") + doc, err := marshal(opts.Weights, iv.coll.bsonOpts, iv.coll.registry) if err != nil { return nil, err } @@ -328,7 +332,7 @@ func (iv IndexView) createOptionsDoc(opts *options.IndexOptions) (bsoncore.Docum optsDoc = bsoncore.AppendInt32Element(optsDoc, "bucketSize", *opts.BucketSize) } if opts.PartialFilterExpression != nil { - doc, err := transformBsoncoreDocument(iv.coll.registry, opts.PartialFilterExpression, true, "partialFilterExpression") + doc, err := marshal(opts.PartialFilterExpression, iv.coll.bsonOpts, iv.coll.registry) if err != nil { return nil, err } @@ -339,7 +343,7 @@ func (iv IndexView) createOptionsDoc(opts *options.IndexOptions) (bsoncore.Docum optsDoc = bsoncore.AppendDocumentElement(optsDoc, "collation", bsoncore.Document(opts.Collation.ToDocument())) } if opts.WildcardProjection != nil { - doc, err := transformBsoncoreDocument(iv.coll.registry, opts.WildcardProjection, true, "wildcardProjection") + doc, err := marshal(opts.WildcardProjection, iv.coll.bsonOpts, iv.coll.registry) if err != nil { return nil, err } diff --git a/vendor/go.mongodb.org/mongo-driver/mongo/mongo.go b/vendor/go.mongodb.org/mongo-driver/mongo/mongo.go index 2fa5e54aee..ded99e4e2b 100644 --- a/vendor/go.mongodb.org/mongo-driver/mongo/mongo.go +++ b/vendor/go.mongodb.org/mongo-driver/mongo/mongo.go @@ -7,20 +7,22 @@ package mongo // import "go.mongodb.org/mongo-driver/mongo" import ( + "bytes" "context" "errors" "fmt" + "io" "net" "reflect" "strconv" "strings" "go.mongodb.org/mongo-driver/mongo/options" - "go.mongodb.org/mongo-driver/x/bsonx" "go.mongodb.org/mongo-driver/x/bsonx/bsoncore" "go.mongodb.org/mongo-driver/bson" "go.mongodb.org/mongo-driver/bson/bsoncodec" + "go.mongodb.org/mongo-driver/bson/bsonrw" "go.mongodb.org/mongo-driver/bson/bsontype" "go.mongodb.org/mongo-driver/bson/primitive" ) @@ -34,6 +36,8 @@ type Dialer interface { // provided type into BSON bytes and append those bytes to the provided []byte. // The AppendBSON can return a non-nil error and non-nil []byte. The AppendBSON // method may also write incomplete BSON to the []byte. +// +// Deprecated: BSONAppender is unused and will be removed in Go Driver 2.0. type BSONAppender interface { AppendBSON([]byte, interface{}) ([]byte, error) } @@ -41,14 +45,18 @@ type BSONAppender interface { // BSONAppenderFunc is an adapter function that allows any function that // satisfies the AppendBSON method signature to be used where a BSONAppender is // used. +// +// Deprecated: BSONAppenderFunc is unused and will be removed in Go Driver 2.0. type BSONAppenderFunc func([]byte, interface{}) ([]byte, error) // AppendBSON implements the BSONAppender interface +// +// Deprecated: BSONAppenderFunc is unused and will be removed in Go Driver 2.0. func (baf BSONAppenderFunc) AppendBSON(dst []byte, val interface{}) ([]byte, error) { return baf(dst, val) } -// MarshalError is returned when attempting to transform a value into a document +// MarshalError is returned when attempting to marshal a value into a document // results in an error. type MarshalError struct { Value interface{} @@ -57,7 +65,7 @@ type MarshalError struct { // Error implements the error interface. func (me MarshalError) Error() string { - return fmt.Sprintf("cannot transform type %s to a BSON Document: %v", reflect.TypeOf(me.Value), me.Err) + return fmt.Sprintf("cannot marshal type %s to a BSON Document: %v", reflect.TypeOf(me.Value), me.Err) } // Pipeline is a type that makes creating aggregation pipelines easier. It is a @@ -71,58 +79,69 @@ func (me MarshalError) Error() string { // } type Pipeline []bson.D -// transformAndEnsureID is a hack that makes it easy to get a RawValue as the _id value. -// It will also add an ObjectID _id as the first key if it not already present in the passed-in val. -func transformAndEnsureID(registry *bsoncodec.Registry, val interface{}) (bsoncore.Document, interface{}, error) { - if registry == nil { - registry = bson.NewRegistryBuilder().Build() - } - switch tt := val.(type) { - case nil: - return nil, nil, ErrNilDocument - case bsonx.Doc: - val = tt.Copy() - case []byte: - // Slight optimization so we'll just use MarshalBSON and not go through the codec machinery. - val = bson.Raw(tt) - } - - // TODO(skriptble): Use a pool of these instead. - doc := make(bsoncore.Document, 0, 256) - doc, err := bson.MarshalAppendWithRegistry(registry, doc, val) +// bvwPool is a pool of BSON value writers. BSON value writers +var bvwPool = bsonrw.NewBSONValueWriterPool() + +// getEncoder takes a writer, BSON options, and a BSON registry and returns a properly configured +// bson.Encoder that writes to the given writer. +func getEncoder( + w io.Writer, + opts *options.BSONOptions, + reg *bsoncodec.Registry, +) (*bson.Encoder, error) { + vw := bvwPool.Get(w) + enc, err := bson.NewEncoder(vw) if err != nil { - return nil, nil, MarshalError{Value: val, Err: err} + return nil, err } - var id interface{} - - value := doc.Lookup("_id") - switch value.Type { - case bsontype.Type(0): - value = bsoncore.Value{Type: bsontype.ObjectID, Data: bsoncore.AppendObjectID(nil, primitive.NewObjectID())} - olddoc := doc - doc = make(bsoncore.Document, 0, len(olddoc)+17) // type byte + _id + null byte + object ID - _, doc = bsoncore.ReserveLength(doc) - doc = bsoncore.AppendValueElement(doc, "_id", value) - doc = append(doc, olddoc[4:]...) // remove the length - doc = bsoncore.UpdateLength(doc, 0, int32(len(doc))) - default: - // We copy the bytes here to ensure that any bytes returned to the user aren't modified - // later. - buf := make([]byte, len(value.Data)) - copy(buf, value.Data) - value.Data = buf + if opts != nil { + if opts.ErrorOnInlineDuplicates { + enc.ErrorOnInlineDuplicates() + } + if opts.IntMinSize { + enc.IntMinSize() + } + if opts.NilByteSliceAsEmpty { + enc.NilByteSliceAsEmpty() + } + if opts.NilMapAsEmpty { + enc.NilMapAsEmpty() + } + if opts.NilSliceAsEmpty { + enc.NilSliceAsEmpty() + } + if opts.OmitZeroStruct { + enc.OmitZeroStruct() + } + if opts.StringifyMapKeysWithFmt { + enc.StringifyMapKeysWithFmt() + } + if opts.UseJSONStructTags { + enc.UseJSONStructTags() + } } - err = bson.RawValue{Type: value.Type, Value: value.Data}.UnmarshalWithRegistry(registry, &id) - if err != nil { - return nil, nil, err + if reg != nil { + // TODO:(GODRIVER-2719): Remove error handling. + if err := enc.SetRegistry(reg); err != nil { + return nil, err + } } - return doc, id, nil + return enc, nil } -func transformBsoncoreDocument(registry *bsoncodec.Registry, val interface{}, mapAllowed bool, paramName string) (bsoncore.Document, error) { +// marshal marshals the given value as a BSON document. Byte slices are always converted to a +// bson.Raw before marshaling. +// +// If bsonOpts and registry are specified, the encoder is configured with the requested behaviors. +// If they are nil, the default behaviors are used. +func marshal( + val interface{}, + bsonOpts *options.BSONOptions, + registry *bsoncodec.Registry, +) (bsoncore.Document, error) { if registry == nil { registry = bson.DefaultRegistry } @@ -133,20 +152,72 @@ func transformBsoncoreDocument(registry *bsoncodec.Registry, val interface{}, ma // Slight optimization so we'll just use MarshalBSON and not go through the codec machinery. val = bson.Raw(bs) } - if !mapAllowed { - refValue := reflect.ValueOf(val) - if refValue.Kind() == reflect.Map && refValue.Len() > 1 { - return nil, ErrMapForOrderedArgument{paramName} - } + + buf := new(bytes.Buffer) + enc, err := getEncoder(buf, bsonOpts, registry) + if err != nil { + return nil, fmt.Errorf("error configuring BSON encoder: %w", err) } - // TODO(skriptble): Use a pool of these instead. - buf := make([]byte, 0, 256) - b, err := bson.MarshalAppendWithRegistry(registry, buf[:0], val) + err = enc.Encode(val) if err != nil { return nil, MarshalError{Value: val, Err: err} } - return b, nil + + return buf.Bytes(), nil +} + +// ensureID inserts the given ObjectID as an element named "_id" at the +// beginning of the given BSON document if there is not an "_id" already. If +// there is already an element named "_id", the document is not modified. It +// returns the resulting document and the decoded Go value of the "_id" element. +func ensureID( + doc bsoncore.Document, + oid primitive.ObjectID, + bsonOpts *options.BSONOptions, + reg *bsoncodec.Registry, +) (bsoncore.Document, interface{}, error) { + if reg == nil { + reg = bson.DefaultRegistry + } + + // Try to find the "_id" element. If it exists, try to unmarshal just the + // "_id" field as an interface{} and return it along with the unmodified + // BSON document. + if _, err := doc.LookupErr("_id"); err == nil { + var id struct { + ID interface{} `bson:"_id"` + } + dec, err := getDecoder(doc, bsonOpts, reg) + if err != nil { + return nil, nil, fmt.Errorf("error configuring BSON decoder: %w", err) + } + err = dec.Decode(&id) + if err != nil { + return nil, nil, fmt.Errorf("error unmarshaling BSON document: %w", err) + } + + return doc, id.ID, nil + } + + // We couldn't find an "_id" element, so add one with the value of the + // provided ObjectID. + + olddoc := doc + + // Reserve an extra 17 bytes for the "_id" field we're about to add: + // type (1) + "_id" (3) + terminator (1) + object ID (12) + const extraSpace = 17 + doc = make(bsoncore.Document, 0, len(olddoc)+extraSpace) + _, doc = bsoncore.ReserveLength(doc) + doc = bsoncore.AppendObjectIDElement(doc, "_id", oid) + + // Remove and re-write the BSON document length header. + const int32Len = 4 + doc = append(doc, olddoc[int32Len:]...) + doc = bsoncore.UpdateLength(doc, 0, int32(len(doc))) + + return doc, oid, nil } func ensureDollarKey(doc bsoncore.Document) error { @@ -169,7 +240,11 @@ func ensureNoDollarKey(doc bsoncore.Document) error { return nil } -func transformAggregatePipeline(registry *bsoncodec.Registry, pipeline interface{}) (bsoncore.Document, bool, error) { +func marshalAggregatePipeline( + pipeline interface{}, + bsonOpts *options.BSONOptions, + registry *bsoncodec.Registry, +) (bsoncore.Document, bool, error) { switch t := pipeline.(type) { case bsoncodec.ValueMarshaler: btype, val, err := t.MarshalBSONValue() @@ -195,7 +270,7 @@ func transformAggregatePipeline(registry *bsoncodec.Registry, pipeline interface default: val := reflect.ValueOf(t) if !val.IsValid() || (val.Kind() != reflect.Slice && val.Kind() != reflect.Array) { - return nil, false, fmt.Errorf("can only transform slices and arrays into aggregation pipelines, but got %v", val.Kind()) + return nil, false, fmt.Errorf("can only marshal slices and arrays into aggregation pipelines, but got %v", val.Kind()) } var hasOutputStage bool @@ -209,7 +284,7 @@ func transformAggregatePipeline(registry *bsoncodec.Registry, pipeline interface return nil, false, fmt.Errorf("%T is not an allowed pipeline type as it represents a single document. Use bson.A or mongo.Pipeline instead", t) } - // bsoncore.Arrays do not need to be transformed. Only check validity and presence of output stage. + // bsoncore.Arrays do not need to be marshaled. Only check validity and presence of output stage. case bsoncore.Array: if err := t.Validate(); err != nil { return nil, false, err @@ -236,7 +311,7 @@ func transformAggregatePipeline(registry *bsoncodec.Registry, pipeline interface aidx, arr := bsoncore.AppendArrayStart(nil) for idx := 0; idx < valLen; idx++ { - doc, err := transformBsoncoreDocument(registry, val.Index(idx).Interface(), true, fmt.Sprintf("pipeline stage :%v", idx)) + doc, err := marshal(val.Index(idx).Interface(), bsonOpts, registry) if err != nil { return nil, false, err } @@ -253,7 +328,12 @@ func transformAggregatePipeline(registry *bsoncodec.Registry, pipeline interface } } -func transformUpdateValue(registry *bsoncodec.Registry, update interface{}, dollarKeysAllowed bool) (bsoncore.Value, error) { +func marshalUpdateValue( + update interface{}, + bsonOpts *options.BSONOptions, + registry *bsoncodec.Registry, + dollarKeysAllowed bool, +) (bsoncore.Value, error) { documentCheckerFunc := ensureDollarKey if !dollarKeysAllowed { documentCheckerFunc = ensureNoDollarKey @@ -264,9 +344,9 @@ func transformUpdateValue(registry *bsoncodec.Registry, update interface{}, doll switch t := update.(type) { case nil: return u, ErrNilDocument - case primitive.D, bsonx.Doc: + case primitive.D: u.Type = bsontype.EmbeddedDocument - u.Data, err = transformBsoncoreDocument(registry, update, true, "update") + u.Data, err = marshal(update, bsonOpts, registry) if err != nil { return u, err } @@ -304,11 +384,11 @@ func transformUpdateValue(registry *bsoncodec.Registry, update interface{}, doll default: val := reflect.ValueOf(t) if !val.IsValid() { - return u, fmt.Errorf("can only transform slices and arrays into update pipelines, but got %v", val.Kind()) + return u, fmt.Errorf("can only marshal slices and arrays into update pipelines, but got %v", val.Kind()) } if val.Kind() != reflect.Slice && val.Kind() != reflect.Array { u.Type = bsontype.EmbeddedDocument - u.Data, err = transformBsoncoreDocument(registry, update, true, "update") + u.Data, err = marshal(update, bsonOpts, registry) if err != nil { return u, err } @@ -320,7 +400,7 @@ func transformUpdateValue(registry *bsoncodec.Registry, update interface{}, doll aidx, arr := bsoncore.AppendArrayStart(nil) valLen := val.Len() for idx := 0; idx < valLen; idx++ { - doc, err := transformBsoncoreDocument(registry, val.Index(idx).Interface(), true, "update") + doc, err := marshal(val.Index(idx).Interface(), bsonOpts, registry) if err != nil { return u, err } @@ -336,7 +416,11 @@ func transformUpdateValue(registry *bsoncodec.Registry, update interface{}, doll } } -func transformValue(registry *bsoncodec.Registry, val interface{}, mapAllowed bool, paramName string) (bsoncore.Value, error) { +func marshalValue( + val interface{}, + bsonOpts *options.BSONOptions, + registry *bsoncodec.Registry, +) (bsoncore.Value, error) { if registry == nil { registry = bson.DefaultRegistry } @@ -344,25 +428,29 @@ func transformValue(registry *bsoncodec.Registry, val interface{}, mapAllowed bo return bsoncore.Value{}, ErrNilValue } - if !mapAllowed { - refValue := reflect.ValueOf(val) - if refValue.Kind() == reflect.Map && refValue.Len() > 1 { - return bsoncore.Value{}, ErrMapForOrderedArgument{paramName} - } + buf := new(bytes.Buffer) + enc, err := getEncoder(buf, bsonOpts, registry) + if err != nil { + return bsoncore.Value{}, fmt.Errorf("error configuring BSON encoder: %w", err) } - buf := make([]byte, 0, 256) - bsonType, bsonValue, err := bson.MarshalValueAppendWithRegistry(registry, buf[:0], val) + // Encode the value in a single-element document with an empty key. Use bsoncore to extract the + // first element and return the BSON value. + err = enc.Encode(bson.D{{Key: "", Value: val}}) if err != nil { return bsoncore.Value{}, MarshalError{Value: val, Err: err} } - - return bsoncore.Value{Type: bsonType, Data: bsonValue}, nil + return bsoncore.Document(buf.Bytes()).Index(0).Value(), nil } // Build the aggregation pipeline for the CountDocument command. -func countDocumentsAggregatePipeline(registry *bsoncodec.Registry, filter interface{}, opts *options.CountOptions) (bsoncore.Document, error) { - filterDoc, err := transformBsoncoreDocument(registry, filter, true, "filter") +func countDocumentsAggregatePipeline( + filter interface{}, + encOpts *options.BSONOptions, + registry *bsoncodec.Registry, + opts *options.CountOptions, +) (bsoncore.Document, error) { + filterDoc, err := marshal(filter, encOpts, registry) if err != nil { return nil, err } diff --git a/vendor/go.mongodb.org/mongo-driver/mongo/mongocryptd.go b/vendor/go.mongodb.org/mongo-driver/mongo/mongocryptd.go index 016ccef62c..41aebc76c1 100644 --- a/vendor/go.mongodb.org/mongo-driver/mongo/mongocryptd.go +++ b/vendor/go.mongodb.org/mongo-driver/mongo/mongocryptd.go @@ -35,7 +35,10 @@ type mongocryptdClient struct { spawnArgs []string } -func newMongocryptdClient(cryptSharedLibAvailable bool, opts *options.AutoEncryptionOptions) (*mongocryptdClient, error) { +// newMongocryptdClient creates a client to mongocryptd. +// newMongocryptdClient is expected to not be called if the crypt shared library is available. +// The crypt shared library replaces all mongocryptd functionality. +func newMongocryptdClient(opts *options.AutoEncryptionOptions) (*mongocryptdClient, error) { // create mcryptClient instance and spawn process if necessary var bypassSpawn bool var bypassAutoEncryption bool @@ -54,8 +57,7 @@ func newMongocryptdClient(cryptSharedLibAvailable bool, opts *options.AutoEncryp // - mongocryptdBypassSpawn is passed // - bypassAutoEncryption is true because mongocryptd is not used during decryption // - bypassQueryAnalysis is true because mongocryptd is not used during decryption - // - the crypt_shared library is available because it replaces all mongocryptd functionality. - bypassSpawn: bypassSpawn || bypassAutoEncryption || bypassQueryAnalysis || cryptSharedLibAvailable, + bypassSpawn: bypassSpawn || bypassAutoEncryption || bypassQueryAnalysis, } if !mc.bypassSpawn { diff --git a/vendor/go.mongodb.org/mongo-driver/mongo/options/aggregateoptions.go b/vendor/go.mongodb.org/mongo-driver/mongo/options/aggregateoptions.go index 38ed249085..20e1c70439 100644 --- a/vendor/go.mongodb.org/mongo-driver/mongo/options/aggregateoptions.go +++ b/vendor/go.mongodb.org/mongo-driver/mongo/options/aggregateoptions.go @@ -139,6 +139,9 @@ func (ao *AggregateOptions) SetCustom(c bson.M) *AggregateOptions { // MergeAggregateOptions combines the given AggregateOptions instances into a single AggregateOptions in a last-one-wins // fashion. +// +// Deprecated: Merging options structs will not be supported in Go Driver 2.0. Users should create a +// single options struct instead. func MergeAggregateOptions(opts ...*AggregateOptions) *AggregateOptions { aggOpts := Aggregate() for _, ao := range opts { diff --git a/vendor/go.mongodb.org/mongo-driver/mongo/options/autoencryptionoptions.go b/vendor/go.mongodb.org/mongo-driver/mongo/options/autoencryptionoptions.go index f42714b3d0..d561d5ef11 100644 --- a/vendor/go.mongodb.org/mongo-driver/mongo/options/autoencryptionoptions.go +++ b/vendor/go.mongodb.org/mongo-driver/mongo/options/autoencryptionoptions.go @@ -151,7 +151,6 @@ func (a *AutoEncryptionOptions) SetTLSConfig(tlsOpts map[string]*tls.Config) *Au // SetEncryptedFieldsMap specifies a map from namespace to local EncryptedFieldsMap document. // EncryptedFieldsMap is used for Queryable Encryption. -// Queryable Encryption is in Public Technical Preview. Queryable Encryption should not be used in production and is subject to backwards breaking changes. func (a *AutoEncryptionOptions) SetEncryptedFieldsMap(ef map[string]interface{}) *AutoEncryptionOptions { a.EncryptedFieldsMap = ef return a @@ -159,13 +158,15 @@ func (a *AutoEncryptionOptions) SetEncryptedFieldsMap(ef map[string]interface{}) // SetBypassQueryAnalysis specifies whether or not query analysis should be used for automatic encryption. // Use this option when using explicit encryption with Queryable Encryption. -// Queryable Encryption is in Public Technical Preview. Queryable Encryption should not be used in production and is subject to backwards breaking changes. func (a *AutoEncryptionOptions) SetBypassQueryAnalysis(bypass bool) *AutoEncryptionOptions { a.BypassQueryAnalysis = &bypass return a } // MergeAutoEncryptionOptions combines the argued AutoEncryptionOptions in a last-one wins fashion. +// +// Deprecated: Merging options structs will not be supported in Go Driver 2.0. Users should create a +// single options struct instead. func MergeAutoEncryptionOptions(opts ...*AutoEncryptionOptions) *AutoEncryptionOptions { aeo := AutoEncryption() for _, opt := range opts { diff --git a/vendor/go.mongodb.org/mongo-driver/mongo/options/bulkwriteoptions.go b/vendor/go.mongodb.org/mongo-driver/mongo/options/bulkwriteoptions.go index 0c36d0b7b0..153de0c735 100644 --- a/vendor/go.mongodb.org/mongo-driver/mongo/options/bulkwriteoptions.go +++ b/vendor/go.mongodb.org/mongo-driver/mongo/options/bulkwriteoptions.go @@ -67,6 +67,9 @@ func (b *BulkWriteOptions) SetLet(let interface{}) *BulkWriteOptions { // MergeBulkWriteOptions combines the given BulkWriteOptions instances into a single BulkWriteOptions in a last-one-wins // fashion. +// +// Deprecated: Merging options structs will not be supported in Go Driver 2.0. Users should create a +// single options struct instead. func MergeBulkWriteOptions(opts ...*BulkWriteOptions) *BulkWriteOptions { b := BulkWrite() for _, opt := range opts { diff --git a/vendor/go.mongodb.org/mongo-driver/mongo/options/changestreamoptions.go b/vendor/go.mongodb.org/mongo-driver/mongo/options/changestreamoptions.go index 54d3a782e2..3d06a668e5 100644 --- a/vendor/go.mongodb.org/mongo-driver/mongo/options/changestreamoptions.go +++ b/vendor/go.mongodb.org/mongo-driver/mongo/options/changestreamoptions.go @@ -156,6 +156,9 @@ func (cso *ChangeStreamOptions) SetCustomPipeline(cp bson.M) *ChangeStreamOption // MergeChangeStreamOptions combines the given ChangeStreamOptions instances into a single ChangeStreamOptions in a // last-one-wins fashion. +// +// Deprecated: Merging options structs will not be supported in Go Driver 2.0. Users should create a +// single options struct instead. func MergeChangeStreamOptions(opts ...*ChangeStreamOptions) *ChangeStreamOptions { csOpts := ChangeStream() for _, cso := range opts { diff --git a/vendor/go.mongodb.org/mongo-driver/mongo/options/clientencryptionoptions.go b/vendor/go.mongodb.org/mongo-driver/mongo/options/clientencryptionoptions.go index 81ea42d42a..7eef3fe6a5 100644 --- a/vendor/go.mongodb.org/mongo-driver/mongo/options/clientencryptionoptions.go +++ b/vendor/go.mongodb.org/mongo-driver/mongo/options/clientencryptionoptions.go @@ -122,6 +122,9 @@ func BuildTLSConfig(tlsOpts map[string]interface{}) (*tls.Config, error) { } // MergeClientEncryptionOptions combines the argued ClientEncryptionOptions in a last-one wins fashion. +// +// Deprecated: Merging options structs will not be supported in Go Driver 2.0. Users should create a +// single options struct instead. func MergeClientEncryptionOptions(opts ...*ClientEncryptionOptions) *ClientEncryptionOptions { ceo := ClientEncryption() for _, opt := range opts { diff --git a/vendor/go.mongodb.org/mongo-driver/mongo/options/clientoptions.go b/vendor/go.mongodb.org/mongo-driver/mongo/options/clientoptions.go index 4355b2f303..1c2e5bed51 100644 --- a/vendor/go.mongodb.org/mongo-driver/mongo/options/clientoptions.go +++ b/vendor/go.mongodb.org/mongo-driver/mongo/options/clientoptions.go @@ -92,6 +92,88 @@ type Credential struct { PasswordSet bool } +// BSONOptions are optional BSON marshaling and unmarshaling behaviors. +type BSONOptions struct { + // UseJSONStructTags causes the driver to fall back to using the "json" + // struct tag if a "bson" struct tag is not specified. + UseJSONStructTags bool + + // ErrorOnInlineDuplicates causes the driver to return an error if there is + // a duplicate field in the marshaled BSON when the "inline" struct tag + // option is set. + ErrorOnInlineDuplicates bool + + // IntMinSize causes the driver to marshal Go integer values (int, int8, + // int16, int32, int64, uint, uint8, uint16, uint32, or uint64) as the + // minimum BSON int size (either 32 or 64 bits) that can represent the + // integer value. + IntMinSize bool + + // NilMapAsEmpty causes the driver to marshal nil Go maps as empty BSON + // documents instead of BSON null. + // + // Empty BSON documents take up slightly more space than BSON null, but + // preserve the ability to use document update operations like "$set" that + // do not work on BSON null. + NilMapAsEmpty bool + + // NilSliceAsEmpty causes the driver to marshal nil Go slices as empty BSON + // arrays instead of BSON null. + // + // Empty BSON arrays take up slightly more space than BSON null, but + // preserve the ability to use array update operations like "$push" or + // "$addToSet" that do not work on BSON null. + NilSliceAsEmpty bool + + // NilByteSliceAsEmpty causes the driver to marshal nil Go byte slices as + // empty BSON binary values instead of BSON null. + NilByteSliceAsEmpty bool + + // OmitZeroStruct causes the driver to consider the zero value for a struct + // (e.g. MyStruct{}) as empty and omit it from the marshaled BSON when the + // "omitempty" struct tag option is set. + OmitZeroStruct bool + + // StringifyMapKeysWithFmt causes the driver to convert Go map keys to BSON + // document field name strings using fmt.Sprint instead of the default + // string conversion logic. + StringifyMapKeysWithFmt bool + + // AllowTruncatingDoubles causes the driver to truncate the fractional part + // of BSON "double" values when attempting to unmarshal them into a Go + // integer (int, int8, int16, int32, or int64) struct field. The truncation + // logic does not apply to BSON "decimal128" values. + AllowTruncatingDoubles bool + + // BinaryAsSlice causes the driver to unmarshal BSON binary field values + // that are the "Generic" or "Old" BSON binary subtype as a Go byte slice + // instead of a primitive.Binary. + BinaryAsSlice bool + + // DefaultDocumentD causes the driver to always unmarshal documents into the + // primitive.D type. This behavior is restricted to data typed as + // "interface{}" or "map[string]interface{}". + DefaultDocumentD bool + + // DefaultDocumentM causes the driver to always unmarshal documents into the + // primitive.M type. This behavior is restricted to data typed as + // "interface{}" or "map[string]interface{}". + DefaultDocumentM bool + + // UseLocalTimeZone causes the driver to unmarshal time.Time values in the + // local timezone instead of the UTC timezone. + UseLocalTimeZone bool + + // ZeroMaps causes the driver to delete any existing values from Go maps in + // the destination value before unmarshaling BSON documents into them. + ZeroMaps bool + + // ZeroStructs causes the driver to delete any existing values from Go + // structs in the destination value before unmarshaling BSON documents into + // them. + ZeroStructs bool +} + // ClientOptions contains options to configure a Client instance. Each option can be set through setter functions. See // documentation for each setter function for an explanation of the option. type ClientOptions struct { @@ -108,6 +190,7 @@ type ClientOptions struct { HTTPClient *http.Client LoadBalanced *bool LocalThreshold *time.Duration + LoggerOptions *LoggerOptions MaxConnIdleTime *time.Duration MaxPoolSize *uint64 MinPoolSize *uint64 @@ -117,6 +200,7 @@ type ClientOptions struct { ServerMonitor *event.ServerMonitor ReadConcern *readconcern.ReadConcern ReadPreference *readpref.ReadPref + BSONOptions *BSONOptions Registry *bsoncodec.Registry ReplicaSet *string RetryReads *bool @@ -580,6 +664,14 @@ func (c *ClientOptions) SetLocalThreshold(d time.Duration) *ClientOptions { return c } +// SetLoggerOptions specifies a LoggerOptions containing options for +// configuring a logger. +func (c *ClientOptions) SetLoggerOptions(opts *LoggerOptions) *ClientOptions { + c.LoggerOptions = opts + + return c +} + // SetMaxConnIdleTime specifies the maximum amount of time that a connection will remain idle in a connection pool // before it is removed from the pool and closed. This can also be set through the "maxIdleTimeMS" URI option (e.g. // "maxIdleTimeMS=10000"). The default is 0, meaning a connection can remain unused indefinitely. @@ -660,6 +752,12 @@ func (c *ClientOptions) SetReadPreference(rp *readpref.ReadPref) *ClientOptions return c } +// SetBSONOptions configures optional BSON marshaling and unmarshaling behavior. +func (c *ClientOptions) SetBSONOptions(opts *BSONOptions) *ClientOptions { + c.BSONOptions = opts + return c +} + // SetRegistry specifies the BSON registry to use for BSON marshalling/unmarshalling operations. The default is // bson.DefaultRegistry. func (c *ClientOptions) SetRegistry(registry *bsoncodec.Registry) *ClientOptions { @@ -752,7 +850,8 @@ func (c *ClientOptions) SetTimeout(d time.Duration) *ClientOptions { // "tlsPrivateKeyFile". The "tlsCertificateKeyFile" option specifies a path to the client certificate and private key, // which must be concatenated into one file. The "tlsCertificateFile" and "tlsPrivateKey" combination specifies separate // paths to the client certificate and private key, respectively. Note that if "tlsCertificateKeyFile" is used, the -// other two options must not be specified. +// other two options must not be specified. Only the subject name of the first certificate is honored as the username +// for X509 auth in a file with multiple certs. // // 3. "tlsCertificateKeyFilePassword" (or "sslClientCertificateKeyPassword"): Specify the password to decrypt the client // private key file (e.g. "tlsCertificateKeyFilePassword=password"). @@ -866,6 +965,9 @@ func (c *ClientOptions) SetSRVServiceName(srvName string) *ClientOptions { // MergeClientOptions combines the given *ClientOptions into a single *ClientOptions in a last one wins fashion. // The specified options are merged with the existing options on the client, with the specified options taking // precedence. +// +// Deprecated: Merging options structs will not be supported in Go Driver 2.0. Users should create a +// single options struct instead. func MergeClientOptions(opts ...*ClientOptions) *ClientOptions { c := Client() @@ -940,6 +1042,9 @@ func MergeClientOptions(opts ...*ClientOptions) *ClientOptions { if opt.ReadPreference != nil { c.ReadPreference = opt.ReadPreference } + if opt.BSONOptions != nil { + c.BSONOptions = opt.BSONOptions + } if opt.Registry != nil { c.Registry = opt.Registry } @@ -1000,6 +1105,9 @@ func MergeClientOptions(opts ...*ClientOptions) *ClientOptions { if opt.cs != nil { c.cs = opt.cs } + if opt.LoggerOptions != nil { + c.LoggerOptions = opt.LoggerOptions + } } return c @@ -1049,8 +1157,8 @@ func addClientCertFromConcatenatedFile(cfg *tls.Config, certKeyFile, keyPassword return addClientCertFromBytes(cfg, data, keyPassword) } -// addClientCertFromBytes adds a client certificate to the configuration given a path to the -// containing file and returns the certificate's subject name. +// addClientCertFromBytes adds client certificates to the configuration given a path to the +// containing file and returns the subject name in the first certificate. func addClientCertFromBytes(cfg *tls.Config, data []byte, keyPasswd string) (string, error) { var currentBlock *pem.Block var certDecodedBlock []byte @@ -1067,7 +1175,11 @@ func addClientCertFromBytes(cfg *tls.Config, data []byte, keyPasswd string) (str if currentBlock.Type == "CERTIFICATE" { certBlock := data[start : len(data)-len(remaining)] certBlocks = append(certBlocks, certBlock) - certDecodedBlock = currentBlock.Bytes + // Assign the certDecodedBlock when it is never set, + // so only the first certificate is honored in a file with multiple certs. + if certDecodedBlock == nil { + certDecodedBlock = currentBlock.Bytes + } start += len(certBlock) } else if strings.HasSuffix(currentBlock.Type, "PRIVATE KEY") { isEncrypted := x509.IsEncryptedPEMBlock(currentBlock) || strings.Contains(currentBlock.Type, "ENCRYPTED PRIVATE KEY") diff --git a/vendor/go.mongodb.org/mongo-driver/mongo/options/collectionoptions.go b/vendor/go.mongodb.org/mongo-driver/mongo/options/collectionoptions.go index e8b68a2706..04fda6d779 100644 --- a/vendor/go.mongodb.org/mongo-driver/mongo/options/collectionoptions.go +++ b/vendor/go.mongodb.org/mongo-driver/mongo/options/collectionoptions.go @@ -27,6 +27,10 @@ type CollectionOptions struct { // the read preference of the Database used to configure the Collection will be used. ReadPreference *readpref.ReadPref + // BSONOptions configures optional BSON marshaling and unmarshaling + // behavior. + BSONOptions *BSONOptions + // Registry is the BSON registry to marshal and unmarshal documents for operations executed on the Collection. The default value // is nil, which means that the registry of the Database used to configure the Collection will be used. Registry *bsoncodec.Registry @@ -55,6 +59,12 @@ func (c *CollectionOptions) SetReadPreference(rp *readpref.ReadPref) *Collection return c } +// SetBSONOptions configures optional BSON marshaling and unmarshaling behavior. +func (c *CollectionOptions) SetBSONOptions(opts *BSONOptions) *CollectionOptions { + c.BSONOptions = opts + return c +} + // SetRegistry sets the value for the Registry field. func (c *CollectionOptions) SetRegistry(r *bsoncodec.Registry) *CollectionOptions { c.Registry = r @@ -63,6 +73,9 @@ func (c *CollectionOptions) SetRegistry(r *bsoncodec.Registry) *CollectionOption // MergeCollectionOptions combines the given CollectionOptions instances into a single *CollectionOptions in a // last-one-wins fashion. +// +// Deprecated: Merging options structs will not be supported in Go Driver 2.0. Users should create a +// single options struct instead. func MergeCollectionOptions(opts ...*CollectionOptions) *CollectionOptions { c := Collection() diff --git a/vendor/go.mongodb.org/mongo-driver/mongo/options/countoptions.go b/vendor/go.mongodb.org/mongo-driver/mongo/options/countoptions.go index f772ec4a3b..bb765d950d 100644 --- a/vendor/go.mongodb.org/mongo-driver/mongo/options/countoptions.go +++ b/vendor/go.mongodb.org/mongo-driver/mongo/options/countoptions.go @@ -89,6 +89,9 @@ func (co *CountOptions) SetSkip(i int64) *CountOptions { } // MergeCountOptions combines the given CountOptions instances into a single CountOptions in a last-one-wins fashion. +// +// Deprecated: Merging options structs will not be supported in Go Driver 2.0. Users should create a +// single options struct instead. func MergeCountOptions(opts ...*CountOptions) *CountOptions { countOpts := Count() for _, co := range opts { diff --git a/vendor/go.mongodb.org/mongo-driver/mongo/options/createcollectionoptions.go b/vendor/go.mongodb.org/mongo-driver/mongo/options/createcollectionoptions.go index 6fc7d066a2..d8ffaaf337 100644 --- a/vendor/go.mongodb.org/mongo-driver/mongo/options/createcollectionoptions.go +++ b/vendor/go.mongodb.org/mongo-driver/mongo/options/createcollectionoptions.go @@ -6,6 +6,8 @@ package options +import "time" + // DefaultIndexOptions represents the default options for a collection to apply on new indexes. This type can be used // when creating a new collection through the CreateCollectionOptions.SetDefaultIndexOptions method. type DefaultIndexOptions struct { @@ -28,18 +30,30 @@ func (d *DefaultIndexOptions) SetStorageEngine(storageEngine interface{}) *Defau // TimeSeriesOptions specifies options on a time-series collection. type TimeSeriesOptions struct { - // Name of the top-level field to be used for time. Inserted documents must have this field, + // TimeField is the top-level field to be used for time. Inserted documents must have this field, // and the field must be of the BSON UTC datetime type (0x9). TimeField string - // Optional name of the top-level field describing the series. This field is used to group + // MetaField is the name of the top-level field describing the series. This field is used to group // related data and may be of any BSON type, except for array. This name may not be the same - // as the TimeField or _id. + // as the TimeField or _id. This field is optional. MetaField *string - // Optional string specifying granularity of time-series data. Allowed granularity options are - // "seconds", "minutes" and "hours". + // Granularity is the granularity of time-series data. Allowed granularity options are + // "seconds", "minutes" and "hours". This field is optional. Granularity *string + + // BucketMaxSpan is the maximum range of time values for a bucket. The + // time.Duration is rounded down to the nearest second and applied as + // the command option: "bucketRoundingSeconds". This field is optional. + BucketMaxSpan *time.Duration + + // BucketRounding is used to determine the minimum time boundary when + // opening a new bucket by rounding the first timestamp down to the next + // multiple of this value. The time.Duration is rounded down to the + // nearest second and applied as the command option: + // "bucketRoundingSeconds". This field is optional. + BucketRounding *time.Duration } // TimeSeries creates a new TimeSeriesOptions instance. @@ -65,6 +79,20 @@ func (tso *TimeSeriesOptions) SetGranularity(granularity string) *TimeSeriesOpti return tso } +// SetBucketMaxSpan sets the value for BucketMaxSpan. +func (tso *TimeSeriesOptions) SetBucketMaxSpan(dur time.Duration) *TimeSeriesOptions { + tso.BucketMaxSpan = &dur + + return tso +} + +// SetBucketRounding sets the value for BucketRounding. +func (tso *TimeSeriesOptions) SetBucketRounding(dur time.Duration) *TimeSeriesOptions { + tso.BucketRounding = &dur + + return tso +} + // CreateCollectionOptions represents options that can be used to configure a CreateCollection operation. type CreateCollectionOptions struct { // Specifies if the collection is capped (see https://www.mongodb.com/docs/manual/core/capped-collections/). If true, @@ -234,6 +262,9 @@ func (c *CreateCollectionOptions) SetClusteredIndex(clusteredIndex interface{}) // MergeCreateCollectionOptions combines the given CreateCollectionOptions instances into a single // CreateCollectionOptions in a last-one-wins fashion. +// +// Deprecated: Merging options structs will not be supported in Go Driver 2.0. Users should create a +// single options struct instead. func MergeCreateCollectionOptions(opts ...*CreateCollectionOptions) *CreateCollectionOptions { cc := CreateCollection() @@ -309,6 +340,9 @@ func (c *CreateViewOptions) SetCollation(collation *Collation) *CreateViewOption // MergeCreateViewOptions combines the given CreateViewOptions instances into a single CreateViewOptions in a // last-one-wins fashion. +// +// Deprecated: Merging options structs will not be supported in Go Driver 2.0. Users should create a +// single options struct instead. func MergeCreateViewOptions(opts ...*CreateViewOptions) *CreateViewOptions { cv := CreateView() diff --git a/vendor/go.mongodb.org/mongo-driver/mongo/options/datakeyoptions.go b/vendor/go.mongodb.org/mongo-driver/mongo/options/datakeyoptions.go index 059805a6a0..5afe8a2480 100644 --- a/vendor/go.mongodb.org/mongo-driver/mongo/options/datakeyoptions.go +++ b/vendor/go.mongodb.org/mongo-driver/mongo/options/datakeyoptions.go @@ -79,6 +79,9 @@ func (dk *DataKeyOptions) SetKeyMaterial(keyMaterial []byte) *DataKeyOptions { } // MergeDataKeyOptions combines the argued DataKeyOptions in a last-one wins fashion. +// +// Deprecated: Merging options structs will not be supported in Go Driver 2.0. Users should create a +// single options struct instead. func MergeDataKeyOptions(opts ...*DataKeyOptions) *DataKeyOptions { dko := DataKey() for _, opt := range opts { diff --git a/vendor/go.mongodb.org/mongo-driver/mongo/options/dboptions.go b/vendor/go.mongodb.org/mongo-driver/mongo/options/dboptions.go index 86e5cc80cc..8a380d2168 100644 --- a/vendor/go.mongodb.org/mongo-driver/mongo/options/dboptions.go +++ b/vendor/go.mongodb.org/mongo-driver/mongo/options/dboptions.go @@ -27,6 +27,10 @@ type DatabaseOptions struct { // the read preference of the Client used to configure the Database will be used. ReadPreference *readpref.ReadPref + // BSONOptions configures optional BSON marshaling and unmarshaling + // behavior. + BSONOptions *BSONOptions + // Registry is the BSON registry to marshal and unmarshal documents for operations executed on the Database. The default value // is nil, which means that the registry of the Client used to configure the Database will be used. Registry *bsoncodec.Registry @@ -55,6 +59,12 @@ func (d *DatabaseOptions) SetReadPreference(rp *readpref.ReadPref) *DatabaseOpti return d } +// SetBSONOptions configures optional BSON marshaling and unmarshaling behavior. +func (d *DatabaseOptions) SetBSONOptions(opts *BSONOptions) *DatabaseOptions { + d.BSONOptions = opts + return d +} + // SetRegistry sets the value for the Registry field. func (d *DatabaseOptions) SetRegistry(r *bsoncodec.Registry) *DatabaseOptions { d.Registry = r @@ -63,6 +73,9 @@ func (d *DatabaseOptions) SetRegistry(r *bsoncodec.Registry) *DatabaseOptions { // MergeDatabaseOptions combines the given DatabaseOptions instances into a single DatabaseOptions in a last-one-wins // fashion. +// +// Deprecated: Merging options structs will not be supported in Go Driver 2.0. Users should create a +// single options struct instead. func MergeDatabaseOptions(opts ...*DatabaseOptions) *DatabaseOptions { d := Database() diff --git a/vendor/go.mongodb.org/mongo-driver/mongo/options/deleteoptions.go b/vendor/go.mongodb.org/mongo-driver/mongo/options/deleteoptions.go index 77e5d45cdc..59aaef9153 100644 --- a/vendor/go.mongodb.org/mongo-driver/mongo/options/deleteoptions.go +++ b/vendor/go.mongodb.org/mongo-driver/mongo/options/deleteoptions.go @@ -62,6 +62,9 @@ func (do *DeleteOptions) SetLet(let interface{}) *DeleteOptions { } // MergeDeleteOptions combines the given DeleteOptions instances into a single DeleteOptions in a last-one-wins fashion. +// +// Deprecated: Merging options structs will not be supported in Go Driver 2.0. Users should create a +// single options struct instead. func MergeDeleteOptions(opts ...*DeleteOptions) *DeleteOptions { dOpts := Delete() for _, do := range opts { diff --git a/vendor/go.mongodb.org/mongo-driver/mongo/options/distinctoptions.go b/vendor/go.mongodb.org/mongo-driver/mongo/options/distinctoptions.go index fdd005c14a..819f2a9a8f 100644 --- a/vendor/go.mongodb.org/mongo-driver/mongo/options/distinctoptions.go +++ b/vendor/go.mongodb.org/mongo-driver/mongo/options/distinctoptions.go @@ -57,6 +57,9 @@ func (do *DistinctOptions) SetMaxTime(d time.Duration) *DistinctOptions { // MergeDistinctOptions combines the given DistinctOptions instances into a single DistinctOptions in a last-one-wins // fashion. +// +// Deprecated: Merging options structs will not be supported in Go Driver 2.0. Users should create a +// single options struct instead. func MergeDistinctOptions(opts ...*DistinctOptions) *DistinctOptions { distinctOpts := Distinct() for _, do := range opts { diff --git a/vendor/go.mongodb.org/mongo-driver/mongo/options/encryptoptions.go b/vendor/go.mongodb.org/mongo-driver/mongo/options/encryptoptions.go index 31528b38ef..88517d0c8d 100644 --- a/vendor/go.mongodb.org/mongo-driver/mongo/options/encryptoptions.go +++ b/vendor/go.mongodb.org/mongo-driver/mongo/options/encryptoptions.go @@ -7,16 +7,25 @@ package options import ( + "go.mongodb.org/mongo-driver/bson" "go.mongodb.org/mongo-driver/bson/primitive" ) // These constants specify valid values for QueryType // QueryType is used for Queryable Encryption. -// Queryable Encryption is in Public Technical Preview. Queryable Encryption should not be used in production and is subject to backwards breaking changes. const ( QueryTypeEquality string = "equality" ) +// RangeOptions specifies index options for a Queryable Encryption field supporting "rangePreview" queries. +// Beta: The Range algorithm is experimental only. It is not intended for public use. It is subject to breaking changes. +type RangeOptions struct { + Min *bson.RawValue + Max *bson.RawValue + Sparsity int64 + Precision *int32 +} + // EncryptOptions represents options to explicitly encrypt a value. type EncryptOptions struct { KeyID *primitive.Binary @@ -24,6 +33,7 @@ type EncryptOptions struct { Algorithm string QueryType string ContentionFactor *int64 + RangeOptions *RangeOptions } // Encrypt creates a new EncryptOptions instance. @@ -50,7 +60,6 @@ func (e *EncryptOptions) SetKeyAltName(keyAltName string) *EncryptOptions { // - Unindexed // This is required. // Indexed and Unindexed are used for Queryable Encryption. -// Queryable Encryption is in Public Technical Preview. Queryable Encryption should not be used in production and is subject to backwards breaking changes. func (e *EncryptOptions) SetAlgorithm(algorithm string) *EncryptOptions { e.Algorithm = algorithm return e @@ -60,7 +69,6 @@ func (e *EncryptOptions) SetAlgorithm(algorithm string) *EncryptOptions { // This should be one of the following: // - equality // QueryType is used for Queryable Encryption. -// Queryable Encryption is in Public Technical Preview. Queryable Encryption should not be used in production and is subject to backwards breaking changes. func (e *EncryptOptions) SetQueryType(queryType string) *EncryptOptions { e.QueryType = queryType return e @@ -68,13 +76,50 @@ func (e *EncryptOptions) SetQueryType(queryType string) *EncryptOptions { // SetContentionFactor specifies the contention factor. It is only valid to set if algorithm is "Indexed". // ContentionFactor is used for Queryable Encryption. -// Queryable Encryption is in Public Technical Preview. Queryable Encryption should not be used in production and is subject to backwards breaking changes. func (e *EncryptOptions) SetContentionFactor(contentionFactor int64) *EncryptOptions { e.ContentionFactor = &contentionFactor return e } +// SetRangeOptions specifies the options to use for explicit encryption with range. It is only valid to set if algorithm is "rangePreview". +// Beta: The Range algorithm is experimental only. It is not intended for public use. It is subject to breaking changes. +func (e *EncryptOptions) SetRangeOptions(ro RangeOptions) *EncryptOptions { + e.RangeOptions = &ro + return e +} + +// SetMin sets the range index minimum value. +// Beta: The Range algorithm is experimental only. It is not intended for public use. It is subject to breaking changes. +func (ro *RangeOptions) SetMin(min bson.RawValue) *RangeOptions { + ro.Min = &min + return ro +} + +// SetMax sets the range index maximum value. +// Beta: The Range algorithm is experimental only. It is not intended for public use. It is subject to breaking changes. +func (ro *RangeOptions) SetMax(max bson.RawValue) *RangeOptions { + ro.Max = &max + return ro +} + +// SetSparsity sets the range index sparsity. +// Beta: The Range algorithm is experimental only. It is not intended for public use. It is subject to breaking changes. +func (ro *RangeOptions) SetSparsity(sparsity int64) *RangeOptions { + ro.Sparsity = sparsity + return ro +} + +// SetPrecision sets the range index precision. +// Beta: The Range algorithm is experimental only. It is not intended for public use. It is subject to breaking changes. +func (ro *RangeOptions) SetPrecision(precision int32) *RangeOptions { + ro.Precision = &precision + return ro +} + // MergeEncryptOptions combines the argued EncryptOptions in a last-one wins fashion. +// +// Deprecated: Merging options structs will not be supported in Go Driver 2.0. Users should create a +// single options struct instead. func MergeEncryptOptions(opts ...*EncryptOptions) *EncryptOptions { eo := Encrypt() for _, opt := range opts { @@ -97,6 +142,9 @@ func MergeEncryptOptions(opts ...*EncryptOptions) *EncryptOptions { if opt.ContentionFactor != nil { eo.ContentionFactor = opt.ContentionFactor } + if opt.RangeOptions != nil { + eo.RangeOptions = opt.RangeOptions + } } return eo diff --git a/vendor/go.mongodb.org/mongo-driver/mongo/options/estimatedcountoptions.go b/vendor/go.mongodb.org/mongo-driver/mongo/options/estimatedcountoptions.go index 6ac53809a4..d088af9c9a 100644 --- a/vendor/go.mongodb.org/mongo-driver/mongo/options/estimatedcountoptions.go +++ b/vendor/go.mongodb.org/mongo-driver/mongo/options/estimatedcountoptions.go @@ -46,6 +46,9 @@ func (eco *EstimatedDocumentCountOptions) SetMaxTime(d time.Duration) *Estimated // MergeEstimatedDocumentCountOptions combines the given EstimatedDocumentCountOptions instances into a single // EstimatedDocumentCountOptions in a last-one-wins fashion. +// +// Deprecated: Merging options structs will not be supported in Go Driver 2.0. Users should create a +// single options struct instead. func MergeEstimatedDocumentCountOptions(opts ...*EstimatedDocumentCountOptions) *EstimatedDocumentCountOptions { e := EstimatedDocumentCount() for _, opt := range opts { diff --git a/vendor/go.mongodb.org/mongo-driver/mongo/options/findoptions.go b/vendor/go.mongodb.org/mongo-driver/mongo/options/findoptions.go index 219a95940e..fa3bf1197a 100644 --- a/vendor/go.mongodb.org/mongo-driver/mongo/options/findoptions.go +++ b/vendor/go.mongodb.org/mongo-driver/mongo/options/findoptions.go @@ -251,6 +251,9 @@ func (f *FindOptions) SetSort(sort interface{}) *FindOptions { } // MergeFindOptions combines the given FindOptions instances into a single FindOptions in a last-one-wins fashion. +// +// Deprecated: Merging options structs will not be supported in Go Driver 2.0. Users should create a +// single options struct instead. func MergeFindOptions(opts ...*FindOptions) *FindOptions { fo := Find() for _, opt := range opts { @@ -549,6 +552,9 @@ func (f *FindOneOptions) SetSort(sort interface{}) *FindOneOptions { // MergeFindOneOptions combines the given FindOneOptions instances into a single FindOneOptions in a last-one-wins // fashion. +// +// Deprecated: Merging options structs will not be supported in Go Driver 2.0. Users should create a +// single options struct instead. func MergeFindOneOptions(opts ...*FindOneOptions) *FindOneOptions { fo := FindOne() for _, opt := range opts { @@ -742,6 +748,9 @@ func (f *FindOneAndReplaceOptions) SetLet(let interface{}) *FindOneAndReplaceOpt // MergeFindOneAndReplaceOptions combines the given FindOneAndReplaceOptions instances into a single // FindOneAndReplaceOptions in a last-one-wins fashion. +// +// Deprecated: Merging options structs will not be supported in Go Driver 2.0. Users should create a +// single options struct instead. func MergeFindOneAndReplaceOptions(opts ...*FindOneAndReplaceOptions) *FindOneAndReplaceOptions { fo := FindOneAndReplace() for _, opt := range opts { @@ -922,6 +931,9 @@ func (f *FindOneAndUpdateOptions) SetLet(let interface{}) *FindOneAndUpdateOptio // MergeFindOneAndUpdateOptions combines the given FindOneAndUpdateOptions instances into a single // FindOneAndUpdateOptions in a last-one-wins fashion. +// +// Deprecated: Merging options structs will not be supported in Go Driver 2.0. Users should create a +// single options struct instead. func MergeFindOneAndUpdateOptions(opts ...*FindOneAndUpdateOptions) *FindOneAndUpdateOptions { fo := FindOneAndUpdate() for _, opt := range opts { @@ -1062,6 +1074,9 @@ func (f *FindOneAndDeleteOptions) SetLet(let interface{}) *FindOneAndDeleteOptio // MergeFindOneAndDeleteOptions combines the given FindOneAndDeleteOptions instances into a single // FindOneAndDeleteOptions in a last-one-wins fashion. +// +// Deprecated: Merging options structs will not be supported in Go Driver 2.0. Users should create a +// single options struct instead. func MergeFindOneAndDeleteOptions(opts ...*FindOneAndDeleteOptions) *FindOneAndDeleteOptions { fo := FindOneAndDelete() for _, opt := range opts { diff --git a/vendor/go.mongodb.org/mongo-driver/mongo/options/gridfsoptions.go b/vendor/go.mongodb.org/mongo-driver/mongo/options/gridfsoptions.go index 9221585baa..c8d347f4e7 100644 --- a/vendor/go.mongodb.org/mongo-driver/mongo/options/gridfsoptions.go +++ b/vendor/go.mongodb.org/mongo-driver/mongo/options/gridfsoptions.go @@ -85,6 +85,9 @@ func (b *BucketOptions) SetReadPreference(rp *readpref.ReadPref) *BucketOptions } // MergeBucketOptions combines the given BucketOptions instances into a single BucketOptions in a last-one-wins fashion. +// +// Deprecated: Merging options structs will not be supported in Go Driver 2.0. Users should create a +// single options struct instead. func MergeBucketOptions(opts ...*BucketOptions) *BucketOptions { b := GridFSBucket() @@ -144,6 +147,9 @@ func (u *UploadOptions) SetMetadata(doc interface{}) *UploadOptions { } // MergeUploadOptions combines the given UploadOptions instances into a single UploadOptions in a last-one-wins fashion. +// +// Deprecated: Merging options structs will not be supported in Go Driver 2.0. Users should create a +// single options struct instead. func MergeUploadOptions(opts ...*UploadOptions) *UploadOptions { u := GridFSUpload() @@ -192,6 +198,9 @@ func (n *NameOptions) SetRevision(r int32) *NameOptions { } // MergeNameOptions combines the given NameOptions instances into a single *NameOptions in a last-one-wins fashion. +// +// Deprecated: Merging options structs will not be supported in Go Driver 2.0. Users should create a +// single options struct instead. func MergeNameOptions(opts ...*NameOptions) *NameOptions { n := GridFSName() n.Revision = &DefaultRevision @@ -296,6 +305,9 @@ func (f *GridFSFindOptions) SetSort(sort interface{}) *GridFSFindOptions { // MergeGridFSFindOptions combines the given GridFSFindOptions instances into a single GridFSFindOptions in a // last-one-wins fashion. +// +// Deprecated: Merging options structs will not be supported in Go Driver 2.0. Users should create a +// single options struct instead. func MergeGridFSFindOptions(opts ...*GridFSFindOptions) *GridFSFindOptions { fo := GridFSFind() for _, opt := range opts { diff --git a/vendor/go.mongodb.org/mongo-driver/mongo/options/indexoptions.go b/vendor/go.mongodb.org/mongo-driver/mongo/options/indexoptions.go index 4c2d6920ab..ab7e2b3f6b 100644 --- a/vendor/go.mongodb.org/mongo-driver/mongo/options/indexoptions.go +++ b/vendor/go.mongodb.org/mongo-driver/mongo/options/indexoptions.go @@ -77,6 +77,9 @@ func (c *CreateIndexesOptions) SetCommitQuorumVotingMembers() *CreateIndexesOpti // MergeCreateIndexesOptions combines the given CreateIndexesOptions into a single CreateIndexesOptions in a last one // wins fashion. +// +// Deprecated: Merging options structs will not be supported in Go Driver 2.0. Users should create a +// single options struct instead. func MergeCreateIndexesOptions(opts ...*CreateIndexesOptions) *CreateIndexesOptions { c := CreateIndexes() for _, opt := range opts { @@ -123,6 +126,9 @@ func (d *DropIndexesOptions) SetMaxTime(duration time.Duration) *DropIndexesOpti // MergeDropIndexesOptions combines the given DropIndexesOptions into a single DropIndexesOptions in a last-one-wins // fashion. +// +// Deprecated: Merging options structs will not be supported in Go Driver 2.0. Users should create a +// single options struct instead. func MergeDropIndexesOptions(opts ...*DropIndexesOptions) *DropIndexesOptions { c := DropIndexes() for _, opt := range opts { @@ -174,6 +180,9 @@ func (l *ListIndexesOptions) SetMaxTime(d time.Duration) *ListIndexesOptions { // MergeListIndexesOptions combines the given ListIndexesOptions instances into a single *ListIndexesOptions in a // last-one-wins fashion. +// +// Deprecated: Merging options structs will not be supported in Go Driver 2.0. Users should create a +// single options struct instead. func MergeListIndexesOptions(opts ...*ListIndexesOptions) *ListIndexesOptions { c := ListIndexes() for _, opt := range opts { @@ -409,6 +418,9 @@ func (i *IndexOptions) SetHidden(hidden bool) *IndexOptions { } // MergeIndexOptions combines the given IndexOptions into a single IndexOptions in a last-one-wins fashion. +// +// Deprecated: Merging options structs will not be supported in Go Driver 2.0. Users should create a +// single options struct instead. func MergeIndexOptions(opts ...*IndexOptions) *IndexOptions { i := Index() diff --git a/vendor/go.mongodb.org/mongo-driver/mongo/options/insertoptions.go b/vendor/go.mongodb.org/mongo-driver/mongo/options/insertoptions.go index 08c46b2818..82137c60a3 100644 --- a/vendor/go.mongodb.org/mongo-driver/mongo/options/insertoptions.go +++ b/vendor/go.mongodb.org/mongo-driver/mongo/options/insertoptions.go @@ -38,6 +38,9 @@ func (ioo *InsertOneOptions) SetComment(comment interface{}) *InsertOneOptions { // MergeInsertOneOptions combines the given InsertOneOptions instances into a single InsertOneOptions in a last-one-wins // fashion. +// +// Deprecated: Merging options structs will not be supported in Go Driver 2.0. Users should create a +// single options struct instead. func MergeInsertOneOptions(opts ...*InsertOneOptions) *InsertOneOptions { ioOpts := InsertOne() for _, ioo := range opts { @@ -98,6 +101,9 @@ func (imo *InsertManyOptions) SetOrdered(b bool) *InsertManyOptions { // MergeInsertManyOptions combines the given InsertManyOptions instances into a single InsertManyOptions in a last one // wins fashion. +// +// Deprecated: Merging options structs will not be supported in Go Driver 2.0. Users should create a +// single options struct instead. func MergeInsertManyOptions(opts ...*InsertManyOptions) *InsertManyOptions { imOpts := InsertMany() for _, imo := range opts { diff --git a/vendor/go.mongodb.org/mongo-driver/mongo/options/listcollectionsoptions.go b/vendor/go.mongodb.org/mongo-driver/mongo/options/listcollectionsoptions.go index 6f4b1cca6d..69b8c997e9 100644 --- a/vendor/go.mongodb.org/mongo-driver/mongo/options/listcollectionsoptions.go +++ b/vendor/go.mongodb.org/mongo-driver/mongo/options/listcollectionsoptions.go @@ -45,6 +45,9 @@ func (lc *ListCollectionsOptions) SetAuthorizedCollections(b bool) *ListCollecti // MergeListCollectionsOptions combines the given ListCollectionsOptions instances into a single *ListCollectionsOptions // in a last-one-wins fashion. +// +// Deprecated: Merging options structs will not be supported in Go Driver 2.0. Users should create a +// single options struct instead. func MergeListCollectionsOptions(opts ...*ListCollectionsOptions) *ListCollectionsOptions { lc := ListCollections() for _, opt := range opts { diff --git a/vendor/go.mongodb.org/mongo-driver/mongo/options/listdatabasesoptions.go b/vendor/go.mongodb.org/mongo-driver/mongo/options/listdatabasesoptions.go index 496763667e..fbd3df60d8 100644 --- a/vendor/go.mongodb.org/mongo-driver/mongo/options/listdatabasesoptions.go +++ b/vendor/go.mongodb.org/mongo-driver/mongo/options/listdatabasesoptions.go @@ -37,6 +37,9 @@ func (ld *ListDatabasesOptions) SetAuthorizedDatabases(b bool) *ListDatabasesOpt // MergeListDatabasesOptions combines the given ListDatabasesOptions instances into a single *ListDatabasesOptions in a // last-one-wins fashion. +// +// Deprecated: Merging options structs will not be supported in Go Driver 2.0. Users should create a +// single options struct instead. func MergeListDatabasesOptions(opts ...*ListDatabasesOptions) *ListDatabasesOptions { ld := ListDatabases() for _, opt := range opts { diff --git a/vendor/go.mongodb.org/mongo-driver/mongo/options/loggeroptions.go b/vendor/go.mongodb.org/mongo-driver/mongo/options/loggeroptions.go new file mode 100644 index 0000000000..4a33e449a5 --- /dev/null +++ b/vendor/go.mongodb.org/mongo-driver/mongo/options/loggeroptions.go @@ -0,0 +1,103 @@ +// Copyright (C) MongoDB, Inc. 2023-present. +// +// Licensed under the Apache License, Version 2.0 (the "License"); you may +// not use this file except in compliance with the License. You may obtain +// a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 + +package options + +import ( + "go.mongodb.org/mongo-driver/internal/logger" +) + +// LogLevel is an enumeration representing the supported log severity levels. +type LogLevel int + +const ( + // LogLevelInfo enables logging of informational messages. These logs + // are high-level information about normal driver behavior. + LogLevelInfo LogLevel = LogLevel(logger.LevelInfo) + + // LogLevelDebug enables logging of debug messages. These logs can be + // voluminous and are intended for detailed information that may be + // helpful when debugging an application. + LogLevelDebug LogLevel = LogLevel(logger.LevelDebug) +) + +// LogComponent is an enumeration representing the "components" which can be +// logged against. A LogLevel can be configured on a per-component basis. +type LogComponent int + +const ( + // LogComponentAll enables logging for all components. + LogComponentAll LogComponent = LogComponent(logger.ComponentAll) + + // LogComponentCommand enables command monitor logging. + LogComponentCommand LogComponent = LogComponent(logger.ComponentCommand) + + // LogComponentTopology enables topology logging. + LogComponentTopology LogComponent = LogComponent(logger.ComponentTopology) + + // LogComponentServerSelection enables server selection logging. + LogComponentServerSelection LogComponent = LogComponent(logger.ComponentServerSelection) + + // LogComponentConnection enables connection services logging. + LogComponentConnection LogComponent = LogComponent(logger.ComponentConnection) +) + +// LogSink is an interface that can be implemented to provide a custom sink for +// the driver's logs. +type LogSink interface { + // Info logs a non-error message with the given key/value pairs. This + // method will only be called if the provided level has been defined + // for a component in the LoggerOptions. + Info(level int, message string, keysAndValues ...interface{}) + + // Error logs an error message with the given key/value pairs + Error(err error, message string, keysAndValues ...interface{}) +} + +// LoggerOptions represent options used to configure Logging in the Go Driver. +type LoggerOptions struct { + // ComponentLevels is a map of LogComponent to LogLevel. The LogLevel + // for a given LogComponent will be used to determine if a log message + // should be logged. + ComponentLevels map[LogComponent]LogLevel + + // Sink is the LogSink that will be used to log messages. If this is + // nil, the driver will use the standard logging library. + Sink LogSink + + // MaxDocumentLength is the maximum length of a document to be logged. + // If the underlying document is larger than this value, it will be + // truncated and appended with an ellipses "...". + MaxDocumentLength uint +} + +// Logger creates a new LoggerOptions instance. +func Logger() *LoggerOptions { + return &LoggerOptions{ + ComponentLevels: map[LogComponent]LogLevel{}, + } +} + +// SetComponentLevel sets the LogLevel value for a LogComponent. +func (opts *LoggerOptions) SetComponentLevel(component LogComponent, level LogLevel) *LoggerOptions { + opts.ComponentLevels[component] = level + + return opts +} + +// SetMaxDocumentLength sets the maximum length of a document to be logged. +func (opts *LoggerOptions) SetMaxDocumentLength(maxDocumentLength uint) *LoggerOptions { + opts.MaxDocumentLength = maxDocumentLength + + return opts +} + +// SetSink sets the LogSink to use for logging. +func (opts *LoggerOptions) SetSink(sink LogSink) *LoggerOptions { + opts.Sink = sink + + return opts +} diff --git a/vendor/go.mongodb.org/mongo-driver/mongo/options/mongooptions.go b/vendor/go.mongodb.org/mongo-driver/mongo/options/mongooptions.go index 25689f521c..fd17ce44e1 100644 --- a/vendor/go.mongodb.org/mongo-driver/mongo/options/mongooptions.go +++ b/vendor/go.mongodb.org/mongo-driver/mongo/options/mongooptions.go @@ -31,6 +31,8 @@ type Collation struct { } // ToDocument converts the Collation to a bson.Raw. +// +// Deprecated: Marshaling a Collation to BSON will not be supported in Go Driver 2.0. func (co *Collation) ToDocument() bson.Raw { idx, doc := bsoncore.AppendDocumentStart(nil) if co.Locale != "" { @@ -107,14 +109,24 @@ const ( WhenAvailable FullDocument = "whenAvailable" ) +// TODO(GODRIVER-2617): Once Registry is removed, ArrayFilters doesn't need to +// TODO be a separate type. Remove the type and update all ArrayFilters fields +// TODO to be type []interface{}. + // ArrayFilters is used to hold filters for the array filters CRUD option. If a registry is nil, bson.DefaultRegistry // will be used when converting the filter interfaces to BSON. type ArrayFilters struct { - Registry *bsoncodec.Registry // The registry to use for converting filters. Defaults to bson.DefaultRegistry. - Filters []interface{} // The filters to apply + // Registry is the registry to use for converting filters. Defaults to bson.DefaultRegistry. + // + // Deprecated: Marshaling ArrayFilters to BSON will not be supported in Go Driver 2.0. + Registry *bsoncodec.Registry + + Filters []interface{} // The filters to apply } // ToArray builds a []bson.Raw from the provided ArrayFilters. +// +// Deprecated: Marshaling ArrayFilters to BSON will not be supported in Go Driver 2.0. func (af *ArrayFilters) ToArray() ([]bson.Raw, error) { registry := af.Registry if registry == nil { @@ -133,6 +145,8 @@ func (af *ArrayFilters) ToArray() ([]bson.Raw, error) { // ToArrayDocument builds a BSON array for the array filters CRUD option. If the registry for af is nil, // bson.DefaultRegistry will be used when converting the filter interfaces to BSON. +// +// Deprecated: Marshaling ArrayFilters to BSON will not be supported in Go Driver 2.0. func (af *ArrayFilters) ToArrayDocument() (bson.Raw, error) { registry := af.Registry if registry == nil { @@ -154,12 +168,16 @@ func (af *ArrayFilters) ToArrayDocument() (bson.Raw, error) { // MarshalError is returned when attempting to transform a value into a document // results in an error. +// +// Deprecated: MarshalError is unused and will be removed in Go Driver 2.0. type MarshalError struct { Value interface{} Err error } // Error implements the error interface. +// +// Deprecated: MarshalError is unused and will be removed in Go Driver 2.0. func (me MarshalError) Error() string { return fmt.Sprintf("cannot transform type %s to a bson.Raw", reflect.TypeOf(me.Value)) } diff --git a/vendor/go.mongodb.org/mongo-driver/mongo/options/replaceoptions.go b/vendor/go.mongodb.org/mongo-driver/mongo/options/replaceoptions.go index f5bc6b98ef..f7d3960194 100644 --- a/vendor/go.mongodb.org/mongo-driver/mongo/options/replaceoptions.go +++ b/vendor/go.mongodb.org/mongo-driver/mongo/options/replaceoptions.go @@ -85,6 +85,9 @@ func (ro *ReplaceOptions) SetLet(l interface{}) *ReplaceOptions { // MergeReplaceOptions combines the given ReplaceOptions instances into a single ReplaceOptions in a last-one-wins // fashion. +// +// Deprecated: Merging options structs will not be supported in Go Driver 2.0. Users should create a +// single options struct instead. func MergeReplaceOptions(opts ...*ReplaceOptions) *ReplaceOptions { rOpts := Replace() for _, ro := range opts { diff --git a/vendor/go.mongodb.org/mongo-driver/mongo/options/rewrapdatakeyoptions.go b/vendor/go.mongodb.org/mongo-driver/mongo/options/rewrapdatakeyoptions.go index 2ab1b3c5b7..22ba586042 100644 --- a/vendor/go.mongodb.org/mongo-driver/mongo/options/rewrapdatakeyoptions.go +++ b/vendor/go.mongodb.org/mongo-driver/mongo/options/rewrapdatakeyoptions.go @@ -35,6 +35,9 @@ func (rmdko *RewrapManyDataKeyOptions) SetMasterKey(masterKey interface{}) *Rewr // MergeRewrapManyDataKeyOptions combines the given RewrapManyDataKeyOptions instances into a single // RewrapManyDataKeyOptions in a last one wins fashion. +// +// Deprecated: Merging options structs will not be supported in Go Driver 2.0. Users should create a +// single options struct instead. func MergeRewrapManyDataKeyOptions(opts ...*RewrapManyDataKeyOptions) *RewrapManyDataKeyOptions { rmdkOpts := RewrapManyDataKey() for _, rmdko := range opts { diff --git a/vendor/go.mongodb.org/mongo-driver/mongo/options/runcmdoptions.go b/vendor/go.mongodb.org/mongo-driver/mongo/options/runcmdoptions.go index ce2ec728d4..8c3899e78f 100644 --- a/vendor/go.mongodb.org/mongo-driver/mongo/options/runcmdoptions.go +++ b/vendor/go.mongodb.org/mongo-driver/mongo/options/runcmdoptions.go @@ -27,6 +27,9 @@ func (rc *RunCmdOptions) SetReadPreference(rp *readpref.ReadPref) *RunCmdOptions } // MergeRunCmdOptions combines the given RunCmdOptions instances into one *RunCmdOptions in a last-one-wins fashion. +// +// Deprecated: Merging options structs will not be supported in Go Driver 2.0. Users should create a +// single options struct instead. func MergeRunCmdOptions(opts ...*RunCmdOptions) *RunCmdOptions { rc := RunCmd() for _, opt := range opts { diff --git a/vendor/go.mongodb.org/mongo-driver/mongo/options/sessionoptions.go b/vendor/go.mongodb.org/mongo-driver/mongo/options/sessionoptions.go index ab5ecb5a46..e1eab098be 100644 --- a/vendor/go.mongodb.org/mongo-driver/mongo/options/sessionoptions.go +++ b/vendor/go.mongodb.org/mongo-driver/mongo/options/sessionoptions.go @@ -98,6 +98,9 @@ func (s *SessionOptions) SetSnapshot(b bool) *SessionOptions { // MergeSessionOptions combines the given SessionOptions instances into a single SessionOptions in a last-one-wins // fashion. +// +// Deprecated: Merging options structs will not be supported in Go Driver 2.0. Users should create a +// single options struct instead. func MergeSessionOptions(opts ...*SessionOptions) *SessionOptions { s := Session() for _, opt := range opts { diff --git a/vendor/go.mongodb.org/mongo-driver/mongo/options/transactionoptions.go b/vendor/go.mongodb.org/mongo-driver/mongo/options/transactionoptions.go index 0b9d1081bb..9270cd20d4 100644 --- a/vendor/go.mongodb.org/mongo-driver/mongo/options/transactionoptions.go +++ b/vendor/go.mongodb.org/mongo-driver/mongo/options/transactionoptions.go @@ -76,6 +76,9 @@ func (t *TransactionOptions) SetMaxCommitTime(mct *time.Duration) *TransactionOp // MergeTransactionOptions combines the given TransactionOptions instances into a single TransactionOptions in a // last-one-wins fashion. +// +// Deprecated: Merging options structs will not be supported in Go Driver 2.0. Users should create a +// single options struct instead. func MergeTransactionOptions(opts ...*TransactionOptions) *TransactionOptions { t := Transaction() for _, opt := range opts { diff --git a/vendor/go.mongodb.org/mongo-driver/mongo/options/updateoptions.go b/vendor/go.mongodb.org/mongo-driver/mongo/options/updateoptions.go index 768d243ca1..5206f9f01b 100644 --- a/vendor/go.mongodb.org/mongo-driver/mongo/options/updateoptions.go +++ b/vendor/go.mongodb.org/mongo-driver/mongo/options/updateoptions.go @@ -95,6 +95,9 @@ func (uo *UpdateOptions) SetLet(l interface{}) *UpdateOptions { } // MergeUpdateOptions combines the given UpdateOptions instances into a single UpdateOptions in a last-one-wins fashion. +// +// Deprecated: Merging options structs will not be supported in Go Driver 2.0. Users should create a +// single options struct instead. func MergeUpdateOptions(opts ...*UpdateOptions) *UpdateOptions { uOpts := Update() for _, uo := range opts { diff --git a/vendor/go.mongodb.org/mongo-driver/mongo/readconcern/readconcern.go b/vendor/go.mongodb.org/mongo-driver/mongo/readconcern/readconcern.go index 92429007ff..987f416055 100644 --- a/vendor/go.mongodb.org/mongo-driver/mongo/readconcern/readconcern.go +++ b/vendor/go.mongodb.org/mongo-driver/mongo/readconcern/readconcern.go @@ -5,6 +5,9 @@ // a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 // Package readconcern defines read concerns for MongoDB operations. +// +// For more information about MongoDB read concerns, see +// https://www.mongodb.com/docs/manual/reference/read-concern/ package readconcern // import "go.mongodb.org/mongo-driver/mongo/readconcern" import ( @@ -12,50 +15,83 @@ import ( "go.mongodb.org/mongo-driver/x/bsonx/bsoncore" ) -// ReadConcern for replica sets and replica set shards determines which data to return from a query. +// A ReadConcern defines a MongoDB read concern, which allows you to control the consistency and +// isolation properties of the data read from replica sets and replica set shards. +// +// For more information about MongoDB read concerns, see +// https://www.mongodb.com/docs/manual/reference/read-concern/ type ReadConcern struct { - level string + Level string } // Option is an option to provide when creating a ReadConcern. +// +// Deprecated: Use the ReadConcern literal declaration instead. For example: +// +// &readconcern.ReadConcern{Level: "local"} type Option func(concern *ReadConcern) // Level creates an option that sets the level of a ReadConcern. +// +// Deprecated: Use the ReadConcern literal declaration instead. For example: +// +// &readconcern.ReadConcern{Level: "local"} func Level(level string) Option { return func(concern *ReadConcern) { - concern.level = level + concern.Level = level } } -// Local specifies that the query should return the instance’s most recent data. +// Local returns a ReadConcern that requests data from the instance with no guarantee that the data +// has been written to a majority of the replica set members (i.e. may be rolled back). +// +// For more information about read concern "local", see +// https://www.mongodb.com/docs/manual/reference/read-concern-local/ func Local() *ReadConcern { return New(Level("local")) } -// Majority specifies that the query should return the instance’s most recent data acknowledged as -// having been written to a majority of members in the replica set. +// Majority returns a ReadConcern that requests data that has been acknowledged by a majority of the +// replica set members (i.e. the documents read are durable and guaranteed not to roll back). +// +// For more information about read concern "majority", see +// https://www.mongodb.com/docs/manual/reference/read-concern-majority/ func Majority() *ReadConcern { return New(Level("majority")) } -// Linearizable specifies that the query should return data that reflects all successful writes -// issued with a write concern of "majority" and acknowledged prior to the start of the read operation. +// Linearizable returns a ReadConcern that requests data that reflects all successful +// majority-acknowledged writes that completed prior to the start of the read operation. +// +// For more information about read concern "linearizable", see +// https://www.mongodb.com/docs/manual/reference/read-concern-linearizable/ func Linearizable() *ReadConcern { return New(Level("linearizable")) } -// Available specifies that the query should return data from the instance with no guarantee -// that the data has been written to a majority of the replica set members (i.e. may be rolled back). +// Available returns a ReadConcern that requests data from an instance with no guarantee that the +// data has been written to a majority of the replica set members (i.e. may be rolled back). +// +// For more information about read concern "available", see +// https://www.mongodb.com/docs/manual/reference/read-concern-available/ func Available() *ReadConcern { return New(Level("available")) } -// Snapshot is only available for operations within multi-document transactions. +// Snapshot returns a ReadConcern that requests majority-committed data as it appears across shards +// from a specific single point in time in the recent past. +// +// For more information about read concern "snapshot", see +// https://www.mongodb.com/docs/manual/reference/read-concern-snapshot/ func Snapshot() *ReadConcern { return New(Level("snapshot")) } // New constructs a new read concern from the given string. +// +// Deprecated: Use the ReadConcern literal declaration instead. For example: +// +// &readconcern.ReadConcern{Level: "local"} func New(options ...Option) *ReadConcern { concern := &ReadConcern{} @@ -67,17 +103,21 @@ func New(options ...Option) *ReadConcern { } // MarshalBSONValue implements the bson.ValueMarshaler interface. +// +// Deprecated: Marshaling a ReadConcern to BSON will not be supported in Go Driver 2.0. func (rc *ReadConcern) MarshalBSONValue() (bsontype.Type, []byte, error) { var elems []byte - if len(rc.level) > 0 { - elems = bsoncore.AppendStringElement(elems, "level", rc.level) + if len(rc.Level) > 0 { + elems = bsoncore.AppendStringElement(elems, "level", rc.Level) } return bsontype.EmbeddedDocument, bsoncore.BuildDocument(nil, elems), nil } // GetLevel returns the read concern level. +// +// Deprecated: Use the ReadConcern.Level field instead. func (rc *ReadConcern) GetLevel() string { - return rc.level + return rc.Level } diff --git a/vendor/go.mongodb.org/mongo-driver/mongo/readpref/options.go b/vendor/go.mongodb.org/mongo-driver/mongo/readpref/options.go index 8154198456..c59b0705f1 100644 --- a/vendor/go.mongodb.org/mongo-driver/mongo/readpref/options.go +++ b/vendor/go.mongodb.org/mongo-driver/mongo/readpref/options.go @@ -29,9 +29,14 @@ func WithMaxStaleness(ms time.Duration) Option { } } -// WithTags sets a single tag set used to match -// a server. The last call to WithTags or WithTagSets -// overrides all previous calls to either method. +// WithTags specifies a single tag set used to match replica set members. If no members match the +// tag set, read operations will return an error. To avoid errors if no members match the tag set, use +// [WithTagSets] and include an empty tag set as the last tag set in the list. +// +// The last call to [WithTags] or [WithTagSets] overrides all previous calls to either method. +// +// For more information about read preference tags, see +// https://www.mongodb.com/docs/manual/core/read-preference-tags/ func WithTags(tags ...string) Option { return func(rp *ReadPref) error { length := len(tags) @@ -49,9 +54,16 @@ func WithTags(tags ...string) Option { } } -// WithTagSets sets the tag sets used to match -// a server. The last call to WithTags or WithTagSets -// overrides all previous calls to either method. +// WithTagSets specifies a list of tag sets used to match replica set members. If the list contains +// multiple tag sets, members are matched against each tag set in succession until a match is found. +// Once a match is found, the remaining tag sets are ignored. If no members match any of the tag +// sets, the read operation returns with an error. To avoid an error if no members match any of the +// tag sets, include an empty tag set as the last tag set in the list. +// +// The last call to [WithTags] or [WithTagSets] overrides all previous calls to either method. +// +// For more information about read preference tags, see +// https://www.mongodb.com/docs/manual/core/read-preference-tags/ func WithTagSets(tagSets ...tag.Set) Option { return func(rp *ReadPref) error { rp.tagSets = tagSets diff --git a/vendor/go.mongodb.org/mongo-driver/mongo/readpref/readpref.go b/vendor/go.mongodb.org/mongo-driver/mongo/readpref/readpref.go index a07e2f8bc6..e2a1d7f340 100644 --- a/vendor/go.mongodb.org/mongo-driver/mongo/readpref/readpref.go +++ b/vendor/go.mongodb.org/mongo-driver/mongo/readpref/readpref.go @@ -20,11 +20,9 @@ var ( errInvalidReadPreference = errors.New("can not specify tags, max staleness, or hedge with mode primary") ) -var primary = ReadPref{mode: PrimaryMode} - // Primary constructs a read preference with a PrimaryMode. func Primary() *ReadPref { - return &primary + return &ReadPref{mode: PrimaryMode} } // PrimaryPreferred constructs a read preference with a PrimaryPreferredMode. diff --git a/vendor/go.mongodb.org/mongo-driver/mongo/results.go b/vendor/go.mongodb.org/mongo-driver/mongo/results.go index 0258238157..8408e8ba1b 100644 --- a/vendor/go.mongodb.org/mongo-driver/mongo/results.go +++ b/vendor/go.mongodb.org/mongo-driver/mongo/results.go @@ -201,6 +201,8 @@ type unmarshalIndexSpecification struct { } // UnmarshalBSON implements the bson.Unmarshaler interface. +// +// Deprecated: Unmarshaling an IndexSpecification from BSON will not be supported in Go Driver 2.0. func (i *IndexSpecification) UnmarshalBSON(data []byte) error { var temp unmarshalIndexSpecification if err := bson.Unmarshal(data, &temp); err != nil { @@ -258,6 +260,9 @@ type unmarshalCollectionSpecification struct { } // UnmarshalBSON implements the bson.Unmarshaler interface. +// +// Deprecated: Unmarshaling a CollectionSpecification from BSON will not be supported in Go Driver +// 2.0. func (cs *CollectionSpecification) UnmarshalBSON(data []byte) error { var temp unmarshalCollectionSpecification if err := bson.Unmarshal(data, &temp); err != nil { diff --git a/vendor/go.mongodb.org/mongo-driver/mongo/session.go b/vendor/go.mongodb.org/mongo-driver/mongo/session.go index 37d5b75761..766e07f394 100644 --- a/vendor/go.mongodb.org/mongo-driver/mongo/session.go +++ b/vendor/go.mongodb.org/mongo-driver/mongo/session.go @@ -84,53 +84,58 @@ func SessionFromContext(ctx context.Context) Session { // https://www.mongodb.com/docs/manual/core/transactions/. // // Implementations of Session are not safe for concurrent use by multiple goroutines. -// -// StartTransaction starts a new transaction, configured with the given options, on this session. This method will -// return an error if there is already a transaction in-progress for this session. -// -// CommitTransaction commits the active transaction for this session. This method will return an error if there is no -// active transaction for this session or the transaction has been aborted. -// -// AbortTransaction aborts the active transaction for this session. This method will return an error if there is no -// active transaction for this session or the transaction has been committed or aborted. -// -// WithTransaction starts a transaction on this session and runs the fn callback. Errors with the -// TransientTransactionError and UnknownTransactionCommitResult labels are retried for up to 120 seconds. Inside the -// callback, sessCtx must be used as the Context parameter for any operations that should be part of the transaction. If -// the ctx parameter already has a Session attached to it, it will be replaced by this session. The fn callback may be -// run multiple times during WithTransaction due to retry attempts, so it must be idempotent. Non-retryable operation -// errors or any operation errors that occur after the timeout expires will be returned without retrying. If the -// callback fails, the driver will call AbortTransaction. Because this method must succeed to ensure that server-side -// resources are properly cleaned up, context deadlines and cancellations will not be respected during this call. For a -// usage example, see the Client.StartSession method documentation. -// -// ClusterTime, OperationTime, Client, and ID return the session's current cluster time, the session's current operation -// time, the Client associated with the session, and the ID document associated with the session, respectively. The ID -// document for a session is in the form {"id": }. -// -// EndSession method should abort any existing transactions and close the session. -// -// AdvanceClusterTime advances the cluster time for a session. This method will return an error if the session has ended. -// -// AdvanceOperationTime advances the operation time for a session. This method will return an error if the session has -// ended. type Session interface { - // Functions to modify session state. + // StartTransaction starts a new transaction, configured with the given options, on this + // session. This method returns an error if there is already a transaction in-progress for this + // session. StartTransaction(...*options.TransactionOptions) error + + // AbortTransaction aborts the active transaction for this session. This method returns an error + // if there is no active transaction for this session or if the transaction has been committed + // or aborted. AbortTransaction(context.Context) error + + // CommitTransaction commits the active transaction for this session. This method returns an + // error if there is no active transaction for this session or if the transaction has been + // aborted. CommitTransaction(context.Context) error - WithTransaction(ctx context.Context, fn func(sessCtx SessionContext) (interface{}, error), + + // WithTransaction starts a transaction on this session and runs the fn callback. Errors with + // the TransientTransactionError and UnknownTransactionCommitResult labels are retried for up to + // 120 seconds. Inside the callback, the SessionContext must be used as the Context parameter + // for any operations that should be part of the transaction. If the ctx parameter already has a + // Session attached to it, it will be replaced by this session. The fn callback may be run + // multiple times during WithTransaction due to retry attempts, so it must be idempotent. + // Non-retryable operation errors or any operation errors that occur after the timeout expires + // will be returned without retrying. If the callback fails, the driver will call + // AbortTransaction. Because this method must succeed to ensure that server-side resources are + // properly cleaned up, context deadlines and cancellations will not be respected during this + // call. For a usage example, see the Client.StartSession method documentation. + WithTransaction(ctx context.Context, fn func(ctx SessionContext) (interface{}, error), opts ...*options.TransactionOptions) (interface{}, error) + + // EndSession aborts any existing transactions and close the session. EndSession(context.Context) - // Functions to retrieve session properties. + // ClusterTime returns the current cluster time document associated with the session. ClusterTime() bson.Raw + + // OperationTime returns the current operation time document associated with the session. OperationTime() *primitive.Timestamp + + // Client the Client associated with the session. Client() *Client + + // ID returns the current ID document associated with the session. The ID document is in the + // form {"id": }. ID() bson.Raw - // Functions to modify mutable session properties. + // AdvanceClusterTime advances the cluster time for a session. This method returns an error if + // the session has ended. AdvanceClusterTime(bson.Raw) error + + // AdvanceOperationTime advances the operation time for a session. This method returns an error + // if the session has ended. AdvanceOperationTime(*primitive.Timestamp) error session() @@ -175,7 +180,7 @@ func (s *sessionImpl) EndSession(ctx context.Context) { } // WithTransaction implements the Session interface. -func (s *sessionImpl) WithTransaction(ctx context.Context, fn func(sessCtx SessionContext) (interface{}, error), +func (s *sessionImpl) WithTransaction(ctx context.Context, fn func(ctx SessionContext) (interface{}, error), opts ...*options.TransactionOptions) (interface{}, error) { timeout := time.NewTimer(withTransactionTimeout) defer timeout.Stop() diff --git a/vendor/go.mongodb.org/mongo-driver/mongo/single_result.go b/vendor/go.mongodb.org/mongo-driver/mongo/single_result.go index 4760250217..9c9b4f4fc6 100644 --- a/vendor/go.mongodb.org/mongo-driver/mongo/single_result.go +++ b/vendor/go.mongodb.org/mongo-driver/mongo/single_result.go @@ -9,9 +9,11 @@ package mongo import ( "context" "errors" + "fmt" "go.mongodb.org/mongo-driver/bson" "go.mongodb.org/mongo-driver/bson/bsoncodec" + "go.mongodb.org/mongo-driver/mongo/options" ) // ErrNoDocuments is returned by SingleResult methods when the operation that created the SingleResult did not return @@ -22,10 +24,12 @@ var ErrNoDocuments = errors.New("mongo: no documents in result") // SingleResult methods will return that error. If the operation did not return any documents, all SingleResult methods // will return ErrNoDocuments. type SingleResult struct { - err error - cur *Cursor - rdr bson.Raw - reg *bsoncodec.Registry + ctx context.Context + err error + cur *Cursor + rdr bson.Raw + bsonOpts *options.BSONOptions + reg *bsoncodec.Registry } // NewSingleResultFromDocument creates a SingleResult with the provided error, registry, and an underlying Cursor pre-loaded with @@ -70,7 +74,13 @@ func (sr *SingleResult) Decode(v interface{}) error { if sr.err = sr.setRdrContents(); sr.err != nil { return sr.err } - return bson.UnmarshalWithRegistry(sr.reg, sr.rdr, v) + + dec, err := getDecoder(sr.rdr, sr.bsonOpts, sr.reg) + if err != nil { + return fmt.Errorf("error configuring BSON decoder: %w", err) + } + + return dec.Decode(v) } // DecodeBytes will return the document represented by this SingleResult as a bson.Raw. If there was an error from the @@ -95,9 +105,9 @@ func (sr *SingleResult) setRdrContents() error { case sr.rdr != nil: return nil case sr.cur != nil: - defer sr.cur.Close(context.TODO()) + defer sr.cur.Close(sr.ctx) - if !sr.cur.Next(context.TODO()) { + if !sr.cur.Next(sr.ctx) { if err := sr.cur.Err(); err != nil { return err } @@ -111,9 +121,10 @@ func (sr *SingleResult) setRdrContents() error { return ErrNoDocuments } -// Err returns the error from the operation that created this SingleResult. If the operation was successful but did not -// return any documents, Err will return ErrNoDocuments. If the operation was successful and returned a document, Err -// will return nil. +// Err provides a way to check for query errors without calling Decode. Err returns the error, if +// any, that was encountered while running the operation. If the operation was successful but did +// not return any documents, Err returns ErrNoDocuments. If this error is not nil, this error will +// also be returned from Decode. func (sr *SingleResult) Err() error { sr.err = sr.setRdrContents() diff --git a/vendor/go.mongodb.org/mongo-driver/mongo/writeconcern/writeconcern.go b/vendor/go.mongodb.org/mongo-driver/mongo/writeconcern/writeconcern.go index 29c667e330..8e288d10b7 100644 --- a/vendor/go.mongodb.org/mongo-driver/mongo/writeconcern/writeconcern.go +++ b/vendor/go.mongodb.org/mongo-driver/mongo/writeconcern/writeconcern.go @@ -5,10 +5,14 @@ // a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 // Package writeconcern defines write concerns for MongoDB operations. +// +// For more information about MongoDB write concerns, see +// https://www.mongodb.com/docs/manual/reference/write-concern/ package writeconcern // import "go.mongodb.org/mongo-driver/mongo/writeconcern" import ( "errors" + "fmt" "time" "go.mongodb.org/mongo-driver/bson" @@ -16,35 +20,160 @@ import ( "go.mongodb.org/mongo-driver/x/bsonx/bsoncore" ) +const majority = "majority" + // ErrInconsistent indicates that an inconsistent write concern was specified. +// +// Deprecated: ErrInconsistent will be removed in Go Driver 2.0. var ErrInconsistent = errors.New("a write concern cannot have both w=0 and j=true") // ErrEmptyWriteConcern indicates that a write concern has no fields set. +// +// Deprecated: ErrEmptyWriteConcern will be removed in Go Driver 2.0. var ErrEmptyWriteConcern = errors.New("a write concern must have at least one field set") // ErrNegativeW indicates that a negative integer `w` field was specified. +// +// Deprecated: ErrNegativeW will be removed in Go Driver 2.0. var ErrNegativeW = errors.New("write concern `w` field cannot be a negative number") // ErrNegativeWTimeout indicates that a negative WTimeout was specified. +// +// Deprecated: ErrNegativeWTimeout will be removed in Go Driver 2.0. var ErrNegativeWTimeout = errors.New("write concern `wtimeout` field cannot be negative") -// WriteConcern describes the level of acknowledgement requested from MongoDB for write operations -// to a standalone mongod or to replica sets or to sharded clusters. +// A WriteConcern defines a MongoDB read concern, which describes the level of acknowledgment +// requested from MongoDB for write operations to a standalone mongod, to replica sets, or to +// sharded clusters. +// +// For more information about MongoDB write concerns, see +// https://www.mongodb.com/docs/manual/reference/write-concern/ type WriteConcern struct { - w interface{} - j bool + // W requests acknowledgment that the write operation has propagated to a + // specified number of mongod instances or to mongod instances with + // specified tags. It sets the the "w" option in a MongoDB write concern. + // + // W values must be a string or an int. + // + // Common values are: + // - "majority": requests acknowledgment that write operations have been + // durably committed to the calculated majority of the data-bearing + // voting members. + // - 1: requests acknowledgment that write operations have been written + // to 1 node. + // - 0: requests no acknowledgment of write operations + // + // For more information about the "w" option, see + // https://www.mongodb.com/docs/manual/reference/write-concern/#w-option + W interface{} + + // Journal requests acknowledgment from MongoDB that the write operation has + // been written to the on-disk journal. It sets the "j" option in a MongoDB + // write concern. + // + // For more information about the "j" option, see + // https://www.mongodb.com/docs/manual/reference/write-concern/#j-option + Journal *bool + + // WTimeout specifies a time limit for the write concern. It sets the + // "wtimeout" option in a MongoDB write concern. + // + // It is only applicable for "w" values greater than 1. Using a WTimeout and + // setting Timeout on the Client at the same time will result in undefined + // behavior. + // + // For more information about the "wtimeout" option, see + // https://www.mongodb.com/docs/manual/reference/write-concern/#wtimeout + WTimeout time.Duration +} + +// Unacknowledged returns a WriteConcern that requests no acknowledgment of +// write operations. +// +// For more information about write concern "w: 0", see +// https://www.mongodb.com/docs/manual/reference/write-concern/#mongodb-writeconcern-writeconcern.-number- +func Unacknowledged() *WriteConcern { + return &WriteConcern{W: 0} +} + +// W1 returns a WriteConcern that requests acknowledgment that write operations +// have been written to memory on one node (e.g. the standalone mongod or the +// primary in a replica set). +// +// For more information about write concern "w: 1", see +// https://www.mongodb.com/docs/manual/reference/write-concern/#mongodb-writeconcern-writeconcern.-number- +func W1() *WriteConcern { + return &WriteConcern{W: 1} +} + +// Journaled returns a WriteConcern that requests acknowledgment that write +// operations have been written to the on-disk journal on MongoDB. +// +// The database's default value for "w" determines how many nodes must write to +// their on-disk journal before the write operation is acknowledged. +// +// For more information about write concern "j: true", see +// https://www.mongodb.com/docs/manual/reference/write-concern/#mongodb-writeconcern-ournal +func Journaled() *WriteConcern { + journal := true + return &WriteConcern{Journal: &journal} +} - // NOTE(benjirewis): wTimeout will be deprecated in a future release. The more general Timeout - // option may be used in its place to control the amount of time that a single operation can run - // before returning an error. Using wTimeout and setting Timeout on the client will result in - // undefined behavior. - wTimeout time.Duration +// Majority returns a WriteConcern that requests acknowledgment that write +// operations have been durably committed to the calculated majority of the +// data-bearing voting members. +// +// Write concern "w: majority" typically requires write operations to be written +// to the on-disk journal before they are acknowledged, unless journaling is +// disabled on MongoDB or the "writeConcernMajorityJournalDefault" replica set +// configuration is set to false. +// +// For more information about write concern "w: majority", see +// https://www.mongodb.com/docs/manual/reference/write-concern/#mongodb-writeconcern-writeconcern.-majority- +func Majority() *WriteConcern { + return &WriteConcern{W: majority} +} + +// Custom returns a WriteConcern that requests acknowledgment that write +// operations have propagated to tagged members that satisfy the custom write +// concern defined in "settings.getLastErrorModes". +// +// For more information about custom write concern names, see +// https://www.mongodb.com/docs/manual/reference/write-concern/#mongodb-writeconcern-writeconcern.-custom-write-concern-name- +func Custom(tag string) *WriteConcern { + return &WriteConcern{W: tag} } // Option is an option to provide when creating a WriteConcern. +// +// Deprecated: Use the WriteConcern convenience functions or define a struct literal instead. +// For example: +// +// writeconcern.Majority() +// +// or +// +// journal := true +// &writeconcern.WriteConcern{ +// W: 2, +// Journal: &journal, +// } type Option func(concern *WriteConcern) // New constructs a new WriteConcern. +// +// Deprecated: Use the WriteConcern convenience functions or define a struct literal instead. +// For example: +// +// writeconcern.Majority() +// +// or +// +// journal := true +// &writeconcern.WriteConcern{ +// W: 2, +// Journal: &journal, +// } func New(options ...Option) *WriteConcern { concern := &WriteConcern{} @@ -57,89 +186,153 @@ func New(options ...Option) *WriteConcern { // W requests acknowledgement that write operations propagate to the specified number of mongod // instances. +// +// Deprecated: Use the Unacknowledged or W1 functions or define a struct literal instead. +// For example: +// +// writeconcern.Unacknowledged() +// +// or +// +// journal := true +// &writeconcern.WriteConcern{ +// W: 2, +// Journal: &journal, +// } func W(w int) Option { return func(concern *WriteConcern) { - concern.w = w + concern.W = w } } // WMajority requests acknowledgement that write operations propagate to the majority of mongod // instances. +// +// Deprecated: Use [Majority] instead. func WMajority() Option { return func(concern *WriteConcern) { - concern.w = "majority" + concern.W = majority } } // WTagSet requests acknowledgement that write operations propagate to the specified mongod // instance. +// +// Deprecated: Use [Custom] instead. func WTagSet(tag string) Option { return func(concern *WriteConcern) { - concern.w = tag + concern.W = tag } } // J requests acknowledgement from MongoDB that write operations are written to // the journal. +// +// Deprecated: Use the Journaled function or define a struct literal instead. +// For example: +// +// writeconcern.Journaled() +// +// or +// +// journal := true +// &writeconcern.WriteConcern{ +// W: 2, +// Journal: &journal, +// } func J(j bool) Option { return func(concern *WriteConcern) { - concern.j = j + // To maintain backward compatible behavior (now that the J field is a + // bool pointer), only set a value for J if the input is true. If the + // input is false, do not set a value, which omits "j" from the + // marshaled write concern. + if j { + concern.Journal = &j + } } } -// WTimeout specifies specifies a time limit for the write concern. +// WTimeout specifies a time limit for the write concern. +// +// It is only applicable for "w" values greater than 1. Using a WTimeout and setting Timeout on the +// Client at the same time will result in undefined behavior. +// +// Deprecated: Use the WriteConcern convenience functions or define a struct literal instead. +// For example: +// +// wc := writeconcern.W1() +// wc.WTimeout = 30 * time.Second // -// NOTE(benjirewis): wTimeout will be deprecated in a future release. The more general Timeout -// option may be used in its place to control the amount of time that a single operation can run -// before returning an error. Using wTimeout and setting Timeout on the client will result in -// undefined behavior. +// or +// +// journal := true +// &writeconcern.WriteConcern{ +// W: "majority", +// WTimeout: 30 * time.Second, +// } func WTimeout(d time.Duration) Option { return func(concern *WriteConcern) { - concern.wTimeout = d + concern.WTimeout = d } } // MarshalBSONValue implements the bson.ValueMarshaler interface. +// +// Deprecated: Marshaling a WriteConcern to BSON will not be supported in Go +// Driver 2.0. func (wc *WriteConcern) MarshalBSONValue() (bsontype.Type, []byte, error) { - if !wc.IsValid() { - return bsontype.Type(0), nil, ErrInconsistent + if wc == nil { + return 0, nil, ErrEmptyWriteConcern } var elems []byte - - if wc.w != nil { - switch t := wc.w.(type) { + if wc.W != nil { + // Only support string or int values for W. That aligns with the + // documentation and the behavior of other functions, like Acknowledged. + switch w := wc.W.(type) { case int: - if t < 0 { - return bsontype.Type(0), nil, ErrNegativeW + if w < 0 { + return 0, nil, ErrNegativeW } - elems = bsoncore.AppendInt32Element(elems, "w", int32(t)) + // If Journal=true and W=0, return an error because that write + // concern is ambiguous. + if wc.Journal != nil && *wc.Journal && w == 0 { + return 0, nil, ErrInconsistent + } + + elems = bsoncore.AppendInt32Element(elems, "w", int32(w)) case string: - elems = bsoncore.AppendStringElement(elems, "w", t) + elems = bsoncore.AppendStringElement(elems, "w", w) + default: + return 0, + nil, + fmt.Errorf("WriteConcern.W must be a string or int, but is a %T", wc.W) } } - if wc.j { - elems = bsoncore.AppendBooleanElement(elems, "j", wc.j) + if wc.Journal != nil { + elems = bsoncore.AppendBooleanElement(elems, "j", *wc.Journal) } - if wc.wTimeout < 0 { - return bsontype.Type(0), nil, ErrNegativeWTimeout + if wc.WTimeout < 0 { + return 0, nil, ErrNegativeWTimeout } - if wc.wTimeout != 0 { - elems = bsoncore.AppendInt64Element(elems, "wtimeout", int64(wc.wTimeout/time.Millisecond)) + if wc.WTimeout != 0 { + elems = bsoncore.AppendInt64Element(elems, "wtimeout", int64(wc.WTimeout/time.Millisecond)) } if len(elems) == 0 { - return bsontype.Type(0), nil, ErrEmptyWriteConcern + return 0, nil, ErrEmptyWriteConcern } - return bsontype.EmbeddedDocument, bsoncore.BuildDocument(nil, elems), nil + return bson.TypeEmbeddedDocument, bsoncore.BuildDocument(nil, elems), nil } // AcknowledgedValue returns true if a BSON RawValue for a write concern represents an acknowledged write concern. // The element's value must be a document representing a write concern. +// +// Deprecated: AcknowledgedValue will not be supported in Go Driver 2.0. func AcknowledgedValue(rawv bson.RawValue) bool { doc, ok := bsoncore.Value{Type: rawv.Type, Data: rawv.Value}.DocumentOK() if !ok { @@ -161,52 +354,69 @@ func AcknowledgedValue(rawv bson.RawValue) bool { // Acknowledged indicates whether or not a write with the given write concern will be acknowledged. func (wc *WriteConcern) Acknowledged() bool { - if wc == nil || wc.j { - return true - } - - switch v := wc.w.(type) { - case int: - if v == 0 { - return false - } - } - - return true + // Only {w: 0} or {w: 0, j: false} are an unacknowledged write concerns. All other values are + // acknowledged. + return wc == nil || wc.W != 0 || (wc.Journal != nil && *wc.Journal) } -// IsValid checks whether the write concern is invalid. +// IsValid returns true if the WriteConcern is valid. func (wc *WriteConcern) IsValid() bool { - if !wc.j { + if wc == nil { return true } - switch v := wc.w.(type) { + switch w := wc.W.(type) { case int: - if v == 0 { - return false - } + // A write concern with {w: int} must have a non-negative value and + // cannot have the combination {w: 0, j: true}. + return w >= 0 && (w > 0 || wc.Journal == nil || !*wc.Journal) + case string, nil: + // A write concern with {w: string} or no w specified is always valid. + return true + default: + // A write concern with an unsupported w type is not valid. + return false } - - return true } // GetW returns the write concern w level. +// +// Deprecated: Use the WriteConcern.W field instead. func (wc *WriteConcern) GetW() interface{} { - return wc.w + return wc.W } // GetJ returns the write concern journaling level. +// +// Deprecated: Use the WriteConcern.Journal field instead. func (wc *WriteConcern) GetJ() bool { - return wc.j + // Treat a nil Journal as false. That maintains backward compatibility with the existing + // behavior of GetJ where unset is false. If users want the real value of Journal, they can + // access the Journal field. + return wc.Journal != nil && *wc.Journal } // GetWTimeout returns the write concern timeout. +// +// Deprecated: Use the WriteConcern.WTimeout field instead. func (wc *WriteConcern) GetWTimeout() time.Duration { - return wc.wTimeout + return wc.WTimeout } // WithOptions returns a copy of this WriteConcern with the options set. +// +// Deprecated: Use the WriteConcern convenience functions or define a struct literal instead. +// For example: +// +// writeconcern.Majority() +// +// or +// +// journal := true +// &writeconcern.WriteConcern{ +// W: 2, +// Journal: &journal, +// } func (wc *WriteConcern) WithOptions(options ...Option) *WriteConcern { if wc == nil { return New(options...) @@ -222,6 +432,8 @@ func (wc *WriteConcern) WithOptions(options ...Option) *WriteConcern { } // AckWrite returns true if a write concern represents an acknowledged write +// +// Deprecated: Use [WriteConcern.Acknowledged] instead. func AckWrite(wc *WriteConcern) bool { return wc == nil || wc.Acknowledged() } diff --git a/vendor/go.mongodb.org/mongo-driver/tag/tag.go b/vendor/go.mongodb.org/mongo-driver/tag/tag.go index dc45f1e476..4faff52549 100644 --- a/vendor/go.mongodb.org/mongo-driver/tag/tag.go +++ b/vendor/go.mongodb.org/mongo-driver/tag/tag.go @@ -4,7 +4,10 @@ // not use this file except in compliance with the License. You may obtain // a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 -// Package tag provides a way to define filters for tagged servers. +// Package tag provides types for filtering replica set members using tags in a read preference. +// +// For more information about read preference tags, see +// https://www.mongodb.com/docs/manual/core/read-preference-tags/ package tag // import "go.mongodb.org/mongo-driver/tag" import ( @@ -12,7 +15,7 @@ import ( "fmt" ) -// Tag is a name/vlaue pair. +// Tag is a name/value pair. type Tag struct { Name string Value string @@ -23,7 +26,10 @@ func (tag Tag) String() string { return fmt.Sprintf("%s=%s", tag.Name, tag.Value) } -// NewTagSetFromMap creates a new tag set from a map. +// NewTagSetFromMap creates a tag set from a map. +// +// For more information about read preference tags, see +// https://www.mongodb.com/docs/manual/core/read-preference-tags/ func NewTagSetFromMap(m map[string]string) Set { var set Set for k, v := range m { @@ -33,7 +39,10 @@ func NewTagSetFromMap(m map[string]string) Set { return set } -// NewTagSetsFromMaps creates new tag sets from maps. +// NewTagSetsFromMaps creates a list of tag sets from a slice of maps. +// +// For more information about read preference tags, see +// https://www.mongodb.com/docs/manual/core/read-preference-tags/ func NewTagSetsFromMaps(maps []map[string]string) []Set { sets := make([]Set, 0, len(maps)) for _, m := range maps { diff --git a/vendor/go.mongodb.org/mongo-driver/version/version.go b/vendor/go.mongodb.org/mongo-driver/version/version.go index d5f74e6057..354548fe7a 100644 --- a/vendor/go.mongodb.org/mongo-driver/version/version.go +++ b/vendor/go.mongodb.org/mongo-driver/version/version.go @@ -8,4 +8,4 @@ package version // import "go.mongodb.org/mongo-driver/version" // Driver is the current version of the driver. -var Driver = "v1.11.7" +var Driver = "v1.12.0" diff --git a/vendor/go.mongodb.org/mongo-driver/x/bsonx/array.go b/vendor/go.mongodb.org/mongo-driver/x/bsonx/array.go deleted file mode 100644 index 80359e8c70..0000000000 --- a/vendor/go.mongodb.org/mongo-driver/x/bsonx/array.go +++ /dev/null @@ -1,97 +0,0 @@ -// Copyright (C) MongoDB, Inc. 2017-present. -// -// Licensed under the Apache License, Version 2.0 (the "License"); you may -// not use this file except in compliance with the License. You may obtain -// a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 - -package bsonx // import "go.mongodb.org/mongo-driver/x/bsonx" - -import ( - "bytes" - "errors" - "fmt" - "strconv" - - "go.mongodb.org/mongo-driver/bson/bsontype" - "go.mongodb.org/mongo-driver/x/bsonx/bsoncore" -) - -// ErrNilArray indicates that an operation was attempted on a nil *Array. -var ErrNilArray = errors.New("array is nil") - -// Arr represents an array in BSON. -type Arr []Val - -// String implements the fmt.Stringer interface. -func (a Arr) String() string { - var buf bytes.Buffer - buf.Write([]byte("bson.Array[")) - for idx, val := range a { - if idx > 0 { - buf.Write([]byte(", ")) - } - fmt.Fprintf(&buf, "%s", val) - } - buf.WriteByte(']') - - return buf.String() -} - -// MarshalBSONValue implements the bsoncodec.ValueMarshaler interface. -func (a Arr) MarshalBSONValue() (bsontype.Type, []byte, error) { - if a == nil { - // TODO: Should we do this? - return bsontype.Null, nil, nil - } - - idx, dst := bsoncore.ReserveLength(nil) - for idx, value := range a { - t, data, _ := value.MarshalBSONValue() // marshalBSONValue never returns an error. - dst = append(dst, byte(t)) - dst = append(dst, strconv.Itoa(idx)...) - dst = append(dst, 0x00) - dst = append(dst, data...) - } - dst = append(dst, 0x00) - dst = bsoncore.UpdateLength(dst, idx, int32(len(dst[idx:]))) - return bsontype.Array, dst, nil -} - -// UnmarshalBSONValue implements the bsoncodec.ValueUnmarshaler interface. -func (a *Arr) UnmarshalBSONValue(t bsontype.Type, data []byte) error { - if a == nil { - return ErrNilArray - } - *a = (*a)[:0] - - elements, err := bsoncore.Document(data).Elements() - if err != nil { - return err - } - - for _, elem := range elements { - var val Val - rawval := elem.Value() - err = val.UnmarshalBSONValue(rawval.Type, rawval.Data) - if err != nil { - return err - } - *a = append(*a, val) - } - return nil -} - -// Equal compares this document to another, returning true if they are equal. -func (a Arr) Equal(a2 Arr) bool { - if len(a) != len(a2) { - return false - } - for idx := range a { - if !a[idx].Equal(a2[idx]) { - return false - } - } - return true -} - -func (Arr) idoc() {} diff --git a/vendor/go.mongodb.org/mongo-driver/x/bsonx/bsoncore/array.go b/vendor/go.mongodb.org/mongo-driver/x/bsonx/bsoncore/array.go index 8ea60ba3c6..6bc0afa700 100644 --- a/vendor/go.mongodb.org/mongo-driver/x/bsonx/bsoncore/array.go +++ b/vendor/go.mongodb.org/mongo-driver/x/bsonx/bsoncore/array.go @@ -7,10 +7,10 @@ package bsoncore import ( - "bytes" "fmt" "io" "strconv" + "strings" ) // NewArrayLengthError creates and returns an error for when the length of an array exceeds the @@ -53,7 +53,7 @@ func (a Array) DebugString() string { if len(a) < 5 { return "" } - var buf bytes.Buffer + var buf strings.Builder buf.WriteString("Array") length, rem, _ := ReadLength(a) // We know we have enough bytes to read the length buf.WriteByte('(') @@ -69,7 +69,7 @@ func (a Array) DebugString() string { buf.WriteString(fmt.Sprintf("", length)) break } - fmt.Fprintf(&buf, "%s", elem.Value().DebugString()) + buf.WriteString(elem.Value().DebugString()) if length != 1 { buf.WriteByte(',') } @@ -85,7 +85,7 @@ func (a Array) String() string { if len(a) < 5 { return "" } - var buf bytes.Buffer + var buf strings.Builder buf.WriteByte('[') length, rem, _ := ReadLength(a) // We know we have enough bytes to read the length @@ -100,7 +100,7 @@ func (a Array) String() string { if !ok { return "" } - fmt.Fprintf(&buf, "%s", elem.Value().String()) + buf.WriteString(elem.Value().String()) if length > 1 { buf.WriteByte(',') } diff --git a/vendor/go.mongodb.org/mongo-driver/x/bsonx/bsoncore/bsoncore.go b/vendor/go.mongodb.org/mongo-driver/x/bsonx/bsoncore/bsoncore.go index 17aad6d71e..94d479428f 100644 --- a/vendor/go.mongodb.org/mongo-driver/x/bsonx/bsoncore/bsoncore.go +++ b/vendor/go.mongodb.org/mongo-driver/x/bsonx/bsoncore/bsoncore.go @@ -4,25 +4,6 @@ // not use this file except in compliance with the License. You may obtain // a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 -// Package bsoncore contains functions that can be used to encode and decode BSON -// elements and values to or from a slice of bytes. These functions are aimed at -// allowing low level manipulation of BSON and can be used to build a higher -// level BSON library. -// -// The Read* functions within this package return the values of the element and -// a boolean indicating if the values are valid. A boolean was used instead of -// an error because any error that would be returned would be the same: not -// enough bytes. This library attempts to do no validation, it will only return -// false if there are not enough bytes for an item to be read. For example, the -// ReadDocument function checks the length, if that length is larger than the -// number of bytes available, it will return false, if there are enough bytes, it -// will return those bytes and true. It is the consumers responsibility to -// validate those bytes. -// -// The Append* functions within this package will append the type value to the -// given dst slice. If the slice has enough capacity, it will not grow the -// slice. The Append*Element functions within this package operate in the same -// way, but additionally append the BSON type and the key before the value. package bsoncore // import "go.mongodb.org/mongo-driver/x/bsonx/bsoncore" import ( diff --git a/vendor/go.mongodb.org/mongo-driver/x/bsonx/bsoncore/doc.go b/vendor/go.mongodb.org/mongo-driver/x/bsonx/bsoncore/doc.go new file mode 100644 index 0000000000..6837b53fc5 --- /dev/null +++ b/vendor/go.mongodb.org/mongo-driver/x/bsonx/bsoncore/doc.go @@ -0,0 +1,29 @@ +// Copyright (C) MongoDB, Inc. 2022-present. +// +// Licensed under the Apache License, Version 2.0 (the "License"); you may +// not use this file except in compliance with the License. You may obtain +// a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 + +// Package bsoncore contains functions that can be used to encode and decode BSON +// elements and values to or from a slice of bytes. These functions are aimed at +// allowing low level manipulation of BSON and can be used to build a higher +// level BSON library. +// +// The Read* functions within this package return the values of the element and +// a boolean indicating if the values are valid. A boolean was used instead of +// an error because any error that would be returned would be the same: not +// enough bytes. This library attempts to do no validation, it will only return +// false if there are not enough bytes for an item to be read. For example, the +// ReadDocument function checks the length, if that length is larger than the +// number of bytes available, it will return false, if there are enough bytes, it +// will return those bytes and true. It is the consumers responsibility to +// validate those bytes. +// +// The Append* functions within this package will append the type value to the +// given dst slice. If the slice has enough capacity, it will not grow the +// slice. The Append*Element functions within this package operate in the same +// way, but additionally append the BSON type and the key before the value. +// +// Warning: Package bsoncore is unstable and there is no backward compatibility +// guarantee. It is experimental and subject to change. +package bsoncore diff --git a/vendor/go.mongodb.org/mongo-driver/x/bsonx/bsoncore/document.go b/vendor/go.mongodb.org/mongo-driver/x/bsonx/bsoncore/document.go index d6e4bb069f..3f360f1ae1 100644 --- a/vendor/go.mongodb.org/mongo-driver/x/bsonx/bsoncore/document.go +++ b/vendor/go.mongodb.org/mongo-driver/x/bsonx/bsoncore/document.go @@ -7,11 +7,11 @@ package bsoncore import ( - "bytes" "errors" "fmt" "io" "strconv" + "strings" "go.mongodb.org/mongo-driver/bson/bsontype" ) @@ -237,7 +237,7 @@ func (d Document) DebugString() string { if len(d) < 5 { return "" } - var buf bytes.Buffer + var buf strings.Builder buf.WriteString("Document") length, rem, _ := ReadLength(d) // We know we have enough bytes to read the length buf.WriteByte('(') @@ -253,7 +253,7 @@ func (d Document) DebugString() string { buf.WriteString(fmt.Sprintf("", length)) break } - fmt.Fprintf(&buf, "%s ", elem.DebugString()) + buf.WriteString(elem.DebugString()) } buf.WriteByte('}') @@ -266,7 +266,7 @@ func (d Document) String() string { if len(d) < 5 { return "" } - var buf bytes.Buffer + var buf strings.Builder buf.WriteByte('{') length, rem, _ := ReadLength(d) // We know we have enough bytes to read the length @@ -285,7 +285,7 @@ func (d Document) String() string { if !ok { return "" } - fmt.Fprintf(&buf, "%s", elem.String()) + buf.WriteString(elem.String()) first = false } buf.WriteByte('}') diff --git a/vendor/go.mongodb.org/mongo-driver/x/bsonx/bsoncore/element.go b/vendor/go.mongodb.org/mongo-driver/x/bsonx/bsoncore/element.go index 3acb4222b2..1fe0897c91 100644 --- a/vendor/go.mongodb.org/mongo-driver/x/bsonx/bsoncore/element.go +++ b/vendor/go.mongodb.org/mongo-driver/x/bsonx/bsoncore/element.go @@ -129,7 +129,7 @@ func (e Element) String() string { if !valid { return "" } - return fmt.Sprintf(`"%s": %v`, key, val) + return "\"" + string(key) + "\": " + val.String() } // DebugString outputs a human readable version of RawElement. It will attempt to stringify the diff --git a/vendor/go.mongodb.org/mongo-driver/x/bsonx/bsoncore/value.go b/vendor/go.mongodb.org/mongo-driver/x/bsonx/bsoncore/value.go index 9cf87d6d77..69c1f9edbb 100644 --- a/vendor/go.mongodb.org/mongo-driver/x/bsonx/bsoncore/value.go +++ b/vendor/go.mongodb.org/mongo-driver/x/bsonx/bsoncore/value.go @@ -190,21 +190,14 @@ func (v Value) AsInt64OK() (int64, bool) { // AsFloat64 returns a BSON number as an float64. If the BSON type is not a numeric one, this method // will panic. // -// TODO(skriptble): Add support for Decimal128. -func (v Value) AsFloat64() float64 { return 0 } +// TODO(GODRIVER-2751): Implement AsFloat64. +// func (v Value) AsFloat64() float64 // AsFloat64OK functions the same as AsFloat64 but returns a boolean instead of panicking. False // indicates an error. // -// TODO(skriptble): Add support for Decimal128. -func (v Value) AsFloat64OK() (float64, bool) { return 0, false } - -// Add will add this value to another. This is currently only implemented for strings and numbers. -// If either value is a string, the other type is coerced into a string and added to the other. -// -// This method will alter v and will attempt to reuse the []byte of v. If the []byte is too small, -// it will be expanded. -func (v *Value) Add(v2 Value) error { return nil } +// TODO(GODRIVER-2751): Implement AsFloat64OK. +// func (v Value) AsFloat64OK() (float64, bool) // Equal compaes v to v2 and returns true if they are equal. func (v Value) Equal(v2 Value) bool { diff --git a/vendor/go.mongodb.org/mongo-driver/x/bsonx/constructor.go b/vendor/go.mongodb.org/mongo-driver/x/bsonx/constructor.go deleted file mode 100644 index a8be859ddf..0000000000 --- a/vendor/go.mongodb.org/mongo-driver/x/bsonx/constructor.go +++ /dev/null @@ -1,166 +0,0 @@ -// Copyright (C) MongoDB, Inc. 2017-present. -// -// Licensed under the Apache License, Version 2.0 (the "License"); you may -// not use this file except in compliance with the License. You may obtain -// a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 - -package bsonx - -import ( - "encoding/binary" - "math" - "time" - - "go.mongodb.org/mongo-driver/bson/bsontype" - "go.mongodb.org/mongo-driver/bson/primitive" -) - -// IDoc is the interface implemented by Doc and MDoc. It allows either of these types to be provided -// to the Document function to create a Value. -type IDoc interface { - idoc() -} - -// Double constructs a BSON double Value. -func Double(f64 float64) Val { - v := Val{t: bsontype.Double} - binary.LittleEndian.PutUint64(v.bootstrap[0:8], math.Float64bits(f64)) - return v -} - -// String constructs a BSON string Value. -func String(str string) Val { return Val{t: bsontype.String}.writestring(str) } - -// Document constructs a Value from the given IDoc. If nil is provided, a BSON Null value will be -// returned. -func Document(doc IDoc) Val { - var v Val - switch tt := doc.(type) { - case Doc: - if tt == nil { - v.t = bsontype.Null - break - } - v.t = bsontype.EmbeddedDocument - v.primitive = tt - case MDoc: - if tt == nil { - v.t = bsontype.Null - break - } - v.t = bsontype.EmbeddedDocument - v.primitive = tt - default: - v.t = bsontype.Null - } - return v -} - -// Array constructs a Value from arr. If arr is nil, a BSON Null value is returned. -func Array(arr Arr) Val { - if arr == nil { - return Val{t: bsontype.Null} - } - return Val{t: bsontype.Array, primitive: arr} -} - -// Binary constructs a BSON binary Value. -func Binary(subtype byte, data []byte) Val { - return Val{t: bsontype.Binary, primitive: primitive.Binary{Subtype: subtype, Data: data}} -} - -// Undefined constructs a BSON binary Value. -func Undefined() Val { return Val{t: bsontype.Undefined} } - -// ObjectID constructs a BSON objectid Value. -func ObjectID(oid primitive.ObjectID) Val { - v := Val{t: bsontype.ObjectID} - copy(v.bootstrap[0:12], oid[:]) - return v -} - -// Boolean constructs a BSON boolean Value. -func Boolean(b bool) Val { - v := Val{t: bsontype.Boolean} - if b { - v.bootstrap[0] = 0x01 - } - return v -} - -// DateTime constructs a BSON datetime Value. -func DateTime(dt int64) Val { return Val{t: bsontype.DateTime}.writei64(dt) } - -// Time constructs a BSON datetime Value. -func Time(t time.Time) Val { - return Val{t: bsontype.DateTime}.writei64(t.Unix()*1e3 + int64(t.Nanosecond()/1e6)) -} - -// Null constructs a BSON binary Value. -func Null() Val { return Val{t: bsontype.Null} } - -// Regex constructs a BSON regex Value. -func Regex(pattern, options string) Val { - regex := primitive.Regex{Pattern: pattern, Options: options} - return Val{t: bsontype.Regex, primitive: regex} -} - -// DBPointer constructs a BSON dbpointer Value. -func DBPointer(ns string, ptr primitive.ObjectID) Val { - dbptr := primitive.DBPointer{DB: ns, Pointer: ptr} - return Val{t: bsontype.DBPointer, primitive: dbptr} -} - -// JavaScript constructs a BSON javascript Value. -func JavaScript(js string) Val { - return Val{t: bsontype.JavaScript}.writestring(js) -} - -// Symbol constructs a BSON symbol Value. -func Symbol(symbol string) Val { - return Val{t: bsontype.Symbol}.writestring(symbol) -} - -// CodeWithScope constructs a BSON code with scope Value. -func CodeWithScope(code string, scope IDoc) Val { - cws := primitive.CodeWithScope{Code: primitive.JavaScript(code), Scope: scope} - return Val{t: bsontype.CodeWithScope, primitive: cws} -} - -// Int32 constructs a BSON int32 Value. -func Int32(i32 int32) Val { - v := Val{t: bsontype.Int32} - v.bootstrap[0] = byte(i32) - v.bootstrap[1] = byte(i32 >> 8) - v.bootstrap[2] = byte(i32 >> 16) - v.bootstrap[3] = byte(i32 >> 24) - return v -} - -// Timestamp constructs a BSON timestamp Value. -func Timestamp(t, i uint32) Val { - v := Val{t: bsontype.Timestamp} - v.bootstrap[0] = byte(i) - v.bootstrap[1] = byte(i >> 8) - v.bootstrap[2] = byte(i >> 16) - v.bootstrap[3] = byte(i >> 24) - v.bootstrap[4] = byte(t) - v.bootstrap[5] = byte(t >> 8) - v.bootstrap[6] = byte(t >> 16) - v.bootstrap[7] = byte(t >> 24) - return v -} - -// Int64 constructs a BSON int64 Value. -func Int64(i64 int64) Val { return Val{t: bsontype.Int64}.writei64(i64) } - -// Decimal128 constructs a BSON decimal128 Value. -func Decimal128(d128 primitive.Decimal128) Val { - return Val{t: bsontype.Decimal128, primitive: d128} -} - -// MinKey constructs a BSON minkey Value. -func MinKey() Val { return Val{t: bsontype.MinKey} } - -// MaxKey constructs a BSON maxkey Value. -func MaxKey() Val { return Val{t: bsontype.MaxKey} } diff --git a/vendor/go.mongodb.org/mongo-driver/x/bsonx/document.go b/vendor/go.mongodb.org/mongo-driver/x/bsonx/document.go deleted file mode 100644 index 2d53bc18b8..0000000000 --- a/vendor/go.mongodb.org/mongo-driver/x/bsonx/document.go +++ /dev/null @@ -1,305 +0,0 @@ -// Copyright (C) MongoDB, Inc. 2017-present. -// -// Licensed under the Apache License, Version 2.0 (the "License"); you may -// not use this file except in compliance with the License. You may obtain -// a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 - -package bsonx - -import ( - "bytes" - "errors" - "fmt" - - "go.mongodb.org/mongo-driver/bson/bsontype" - "go.mongodb.org/mongo-driver/x/bsonx/bsoncore" -) - -// ErrNilDocument indicates that an operation was attempted on a nil *bson.Document. -var ErrNilDocument = errors.New("document is nil") - -// KeyNotFound is an error type returned from the Lookup methods on Document. This type contains -// information about which key was not found and if it was actually not found or if a component of -// the key except the last was not a document nor array. -type KeyNotFound struct { - Key []string // The keys that were searched for. - Depth uint // Which key either was not found or was an incorrect type. - Type bsontype.Type // The type of the key that was found but was an incorrect type. -} - -func (knf KeyNotFound) Error() string { - depth := knf.Depth - if depth >= uint(len(knf.Key)) { - depth = uint(len(knf.Key)) - 1 - } - - if len(knf.Key) == 0 { - return "no keys were provided for lookup" - } - - if knf.Type != bsontype.Type(0) { - return fmt.Sprintf(`key "%s" was found but was not valid to traverse BSON type %s`, knf.Key[depth], knf.Type) - } - - return fmt.Sprintf(`key "%s" was not found`, knf.Key[depth]) -} - -// Doc is a type safe, concise BSON document representation. -type Doc []Elem - -// ReadDoc will create a Document using the provided slice of bytes. If the -// slice of bytes is not a valid BSON document, this method will return an error. -func ReadDoc(b []byte) (Doc, error) { - doc := make(Doc, 0) - err := doc.UnmarshalBSON(b) - if err != nil { - return nil, err - } - return doc, nil -} - -// Copy makes a shallow copy of this document. -func (d Doc) Copy() Doc { - d2 := make(Doc, len(d)) - copy(d2, d) - return d2 -} - -// Append adds an element to the end of the document, creating it from the key and value provided. -func (d Doc) Append(key string, val Val) Doc { - return append(d, Elem{Key: key, Value: val}) -} - -// Prepend adds an element to the beginning of the document, creating it from the key and value provided. -func (d Doc) Prepend(key string, val Val) Doc { - // TODO: should we just modify d itself instead of doing an alloc here? - return append(Doc{{Key: key, Value: val}}, d...) -} - -// Set replaces an element of a document. If an element with a matching key is -// found, the element will be replaced with the one provided. If the document -// does not have an element with that key, the element is appended to the -// document instead. -func (d Doc) Set(key string, val Val) Doc { - idx := d.IndexOf(key) - if idx == -1 { - return append(d, Elem{Key: key, Value: val}) - } - d[idx] = Elem{Key: key, Value: val} - return d -} - -// IndexOf returns the index of the first element with a key of key, or -1 if no element with a key -// was found. -func (d Doc) IndexOf(key string) int { - for i, e := range d { - if e.Key == key { - return i - } - } - return -1 -} - -// Delete removes the element with key if it exists and returns the updated Doc. -func (d Doc) Delete(key string) Doc { - idx := d.IndexOf(key) - if idx == -1 { - return d - } - return append(d[:idx], d[idx+1:]...) -} - -// Lookup searches the document and potentially subdocuments or arrays for the -// provided key. Each key provided to this method represents a layer of depth. -// -// This method will return an empty Value if they key does not exist. To know if they key actually -// exists, use LookupErr. -func (d Doc) Lookup(key ...string) Val { - val, _ := d.LookupErr(key...) - return val -} - -// LookupErr searches the document and potentially subdocuments or arrays for the -// provided key. Each key provided to this method represents a layer of depth. -func (d Doc) LookupErr(key ...string) (Val, error) { - elem, err := d.LookupElementErr(key...) - return elem.Value, err -} - -// LookupElement searches the document and potentially subdocuments or arrays for the -// provided key. Each key provided to this method represents a layer of depth. -// -// This method will return an empty Element if they key does not exist. To know if they key actually -// exists, use LookupElementErr. -func (d Doc) LookupElement(key ...string) Elem { - elem, _ := d.LookupElementErr(key...) - return elem -} - -// LookupElementErr searches the document and potentially subdocuments for the -// provided key. Each key provided to this method represents a layer of depth. -func (d Doc) LookupElementErr(key ...string) (Elem, error) { - // KeyNotFound operates by being created where the error happens and then the depth is - // incremented by 1 as each function unwinds. Whenever this function returns, it also assigns - // the Key slice to the key slice it has. This ensures that the proper depth is identified and - // the proper keys. - if len(key) == 0 { - return Elem{}, KeyNotFound{Key: key} - } - - var elem Elem - var err error - idx := d.IndexOf(key[0]) - if idx == -1 { - return Elem{}, KeyNotFound{Key: key} - } - - elem = d[idx] - if len(key) == 1 { - return elem, nil - } - - switch elem.Value.Type() { - case bsontype.EmbeddedDocument: - switch tt := elem.Value.primitive.(type) { - case Doc: - elem, err = tt.LookupElementErr(key[1:]...) - case MDoc: - elem, err = tt.LookupElementErr(key[1:]...) - } - default: - return Elem{}, KeyNotFound{Type: elem.Value.Type()} - } - switch tt := err.(type) { - case KeyNotFound: - tt.Depth++ - tt.Key = key - return Elem{}, tt - case nil: - return elem, nil - default: - return Elem{}, err // We can't actually hit this. - } -} - -// MarshalBSONValue implements the bsoncodec.ValueMarshaler interface. -// -// This method will never return an error. -func (d Doc) MarshalBSONValue() (bsontype.Type, []byte, error) { - if d == nil { - // TODO: Should we do this? - return bsontype.Null, nil, nil - } - data, _ := d.MarshalBSON() - return bsontype.EmbeddedDocument, data, nil -} - -// MarshalBSON implements the Marshaler interface. -// -// This method will never return an error. -func (d Doc) MarshalBSON() ([]byte, error) { return d.AppendMarshalBSON(nil) } - -// AppendMarshalBSON marshals Doc to BSON bytes, appending to dst. -// -// This method will never return an error. -func (d Doc) AppendMarshalBSON(dst []byte) ([]byte, error) { - idx, dst := bsoncore.ReserveLength(dst) - for _, elem := range d { - t, data, _ := elem.Value.MarshalBSONValue() // Value.MarshalBSONValue never returns an error. - dst = append(dst, byte(t)) - dst = append(dst, elem.Key...) - dst = append(dst, 0x00) - dst = append(dst, data...) - } - dst = append(dst, 0x00) - dst = bsoncore.UpdateLength(dst, idx, int32(len(dst[idx:]))) - return dst, nil -} - -// UnmarshalBSON implements the Unmarshaler interface. -func (d *Doc) UnmarshalBSON(b []byte) error { - if d == nil { - return ErrNilDocument - } - - if err := bsoncore.Document(b).Validate(); err != nil { - return err - } - - elems, err := bsoncore.Document(b).Elements() - if err != nil { - return err - } - var val Val - for _, elem := range elems { - rawv := elem.Value() - err = val.UnmarshalBSONValue(rawv.Type, rawv.Data) - if err != nil { - return err - } - *d = d.Append(elem.Key(), val) - } - return nil -} - -// UnmarshalBSONValue implements the bson.ValueUnmarshaler interface. -func (d *Doc) UnmarshalBSONValue(t bsontype.Type, data []byte) error { - if t != bsontype.EmbeddedDocument { - return fmt.Errorf("cannot unmarshal %s into a bsonx.Doc", t) - } - return d.UnmarshalBSON(data) -} - -// Equal compares this document to another, returning true if they are equal. -func (d Doc) Equal(id IDoc) bool { - switch tt := id.(type) { - case Doc: - d2 := tt - if len(d) != len(d2) { - return false - } - for idx := range d { - if !d[idx].Equal(d2[idx]) { - return false - } - } - case MDoc: - unique := make(map[string]struct{}) - for _, elem := range d { - unique[elem.Key] = struct{}{} - val, ok := tt[elem.Key] - if !ok { - return false - } - if !val.Equal(elem.Value) { - return false - } - } - if len(unique) != len(tt) { - return false - } - case nil: - return d == nil - default: - return false - } - - return true -} - -// String implements the fmt.Stringer interface. -func (d Doc) String() string { - var buf bytes.Buffer - buf.Write([]byte("bson.Document{")) - for idx, elem := range d { - if idx > 0 { - buf.Write([]byte(", ")) - } - fmt.Fprintf(&buf, "%v", elem) - } - buf.WriteByte('}') - - return buf.String() -} - -func (Doc) idoc() {} diff --git a/vendor/go.mongodb.org/mongo-driver/x/bsonx/element.go b/vendor/go.mongodb.org/mongo-driver/x/bsonx/element.go deleted file mode 100644 index 00d1ba377f..0000000000 --- a/vendor/go.mongodb.org/mongo-driver/x/bsonx/element.go +++ /dev/null @@ -1,51 +0,0 @@ -// Copyright (C) MongoDB, Inc. 2017-present. -// -// Licensed under the Apache License, Version 2.0 (the "License"); you may -// not use this file except in compliance with the License. You may obtain -// a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 - -package bsonx - -import ( - "fmt" - - "go.mongodb.org/mongo-driver/bson/bsontype" -) - -// ElementTypeError specifies that a method to obtain a BSON value an incorrect type was called on a bson.Value. -// -// TODO: rename this ValueTypeError. -type ElementTypeError struct { - Method string - Type bsontype.Type -} - -// Error implements the error interface. -func (ete ElementTypeError) Error() string { - return "Call of " + ete.Method + " on " + ete.Type.String() + " type" -} - -// Elem represents a BSON element. -// -// NOTE: Element cannot be the value of a map nor a property of a struct without special handling. -// The default encoders and decoders will not process Element correctly. To do so would require -// information loss since an Element contains a key, but the keys used when encoding a struct are -// the struct field names. Instead of using an Element, use a Value as a value in a map or a -// property of a struct. -type Elem struct { - Key string - Value Val -} - -// Equal compares e and e2 and returns true if they are equal. -func (e Elem) Equal(e2 Elem) bool { - if e.Key != e2.Key { - return false - } - return e.Value.Equal(e2.Value) -} - -func (e Elem) String() string { - // TODO(GODRIVER-612): When bsoncore has appenders for extended JSON use that here. - return fmt.Sprintf(`bson.Element{"%s": %v}`, e.Key, e.Value) -} diff --git a/vendor/go.mongodb.org/mongo-driver/x/bsonx/mdocument.go b/vendor/go.mongodb.org/mongo-driver/x/bsonx/mdocument.go deleted file mode 100644 index 7877f22401..0000000000 --- a/vendor/go.mongodb.org/mongo-driver/x/bsonx/mdocument.go +++ /dev/null @@ -1,231 +0,0 @@ -// Copyright (C) MongoDB, Inc. 2017-present. -// -// Licensed under the Apache License, Version 2.0 (the "License"); you may -// not use this file except in compliance with the License. You may obtain -// a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 - -package bsonx - -import ( - "bytes" - "fmt" - - "go.mongodb.org/mongo-driver/bson/bsontype" - "go.mongodb.org/mongo-driver/x/bsonx/bsoncore" -) - -// MDoc is an unordered, type safe, concise BSON document representation. This type should not be -// used if you require ordering of values or duplicate keys. -type MDoc map[string]Val - -// ReadMDoc will create a Doc using the provided slice of bytes. If the -// slice of bytes is not a valid BSON document, this method will return an error. -func ReadMDoc(b []byte) (MDoc, error) { - doc := make(MDoc) - err := doc.UnmarshalBSON(b) - if err != nil { - return nil, err - } - return doc, nil -} - -// Copy makes a shallow copy of this document. -func (d MDoc) Copy() MDoc { - d2 := make(MDoc, len(d)) - for k, v := range d { - d2[k] = v - } - return d2 -} - -// Lookup searches the document and potentially subdocuments or arrays for the -// provided key. Each key provided to this method represents a layer of depth. -// -// This method will return an empty Value if they key does not exist. To know if they key actually -// exists, use LookupErr. -func (d MDoc) Lookup(key ...string) Val { - val, _ := d.LookupErr(key...) - return val -} - -// LookupErr searches the document and potentially subdocuments or arrays for the -// provided key. Each key provided to this method represents a layer of depth. -func (d MDoc) LookupErr(key ...string) (Val, error) { - elem, err := d.LookupElementErr(key...) - return elem.Value, err -} - -// LookupElement searches the document and potentially subdocuments or arrays for the -// provided key. Each key provided to this method represents a layer of depth. -// -// This method will return an empty Element if they key does not exist. To know if they key actually -// exists, use LookupElementErr. -func (d MDoc) LookupElement(key ...string) Elem { - elem, _ := d.LookupElementErr(key...) - return elem -} - -// LookupElementErr searches the document and potentially subdocuments for the -// provided key. Each key provided to this method represents a layer of depth. -func (d MDoc) LookupElementErr(key ...string) (Elem, error) { - // KeyNotFound operates by being created where the error happens and then the depth is - // incremented by 1 as each function unwinds. Whenever this function returns, it also assigns - // the Key slice to the key slice it has. This ensures that the proper depth is identified and - // the proper keys. - if len(key) == 0 { - return Elem{}, KeyNotFound{Key: key} - } - - var elem Elem - var err error - val, ok := d[key[0]] - if !ok { - return Elem{}, KeyNotFound{Key: key} - } - - if len(key) == 1 { - return Elem{Key: key[0], Value: val}, nil - } - - switch val.Type() { - case bsontype.EmbeddedDocument: - switch tt := val.primitive.(type) { - case Doc: - elem, err = tt.LookupElementErr(key[1:]...) - case MDoc: - elem, err = tt.LookupElementErr(key[1:]...) - } - default: - return Elem{}, KeyNotFound{Type: val.Type()} - } - switch tt := err.(type) { - case KeyNotFound: - tt.Depth++ - tt.Key = key - return Elem{}, tt - case nil: - return elem, nil - default: - return Elem{}, err // We can't actually hit this. - } -} - -// MarshalBSONValue implements the bsoncodec.ValueMarshaler interface. -// -// This method will never return an error. -func (d MDoc) MarshalBSONValue() (bsontype.Type, []byte, error) { - if d == nil { - // TODO: Should we do this? - return bsontype.Null, nil, nil - } - data, _ := d.MarshalBSON() - return bsontype.EmbeddedDocument, data, nil -} - -// MarshalBSON implements the Marshaler interface. -// -// This method will never return an error. -func (d MDoc) MarshalBSON() ([]byte, error) { return d.AppendMarshalBSON(nil) } - -// AppendMarshalBSON marshals Doc to BSON bytes, appending to dst. -// -// This method will never return an error. -func (d MDoc) AppendMarshalBSON(dst []byte) ([]byte, error) { - idx, dst := bsoncore.ReserveLength(dst) - for k, v := range d { - t, data, _ := v.MarshalBSONValue() // Value.MarshalBSONValue never returns an error. - dst = append(dst, byte(t)) - dst = append(dst, k...) - dst = append(dst, 0x00) - dst = append(dst, data...) - } - dst = append(dst, 0x00) - dst = bsoncore.UpdateLength(dst, idx, int32(len(dst[idx:]))) - return dst, nil -} - -// UnmarshalBSON implements the Unmarshaler interface. -func (d *MDoc) UnmarshalBSON(b []byte) error { - if d == nil { - return ErrNilDocument - } - - if err := bsoncore.Document(b).Validate(); err != nil { - return err - } - - elems, err := bsoncore.Document(b).Elements() - if err != nil { - return err - } - var val Val - for _, elem := range elems { - rawv := elem.Value() - err = val.UnmarshalBSONValue(rawv.Type, rawv.Data) - if err != nil { - return err - } - (*d)[elem.Key()] = val - } - return nil -} - -// Equal compares this document to another, returning true if they are equal. -func (d MDoc) Equal(id IDoc) bool { - switch tt := id.(type) { - case MDoc: - d2 := tt - if len(d) != len(d2) { - return false - } - for key, value := range d { - value2, ok := d2[key] - if !ok { - return false - } - if !value.Equal(value2) { - return false - } - } - case Doc: - unique := make(map[string]struct{}) - for _, elem := range tt { - unique[elem.Key] = struct{}{} - val, ok := d[elem.Key] - if !ok { - return false - } - if !val.Equal(elem.Value) { - return false - } - } - if len(unique) != len(d) { - return false - } - case nil: - return d == nil - default: - return false - } - - return true -} - -// String implements the fmt.Stringer interface. -func (d MDoc) String() string { - var buf bytes.Buffer - buf.Write([]byte("bson.Document{")) - first := true - for key, value := range d { - if !first { - buf.Write([]byte(", ")) - } - fmt.Fprintf(&buf, "%v", Elem{Key: key, Value: value}) - first = false - } - buf.WriteByte('}') - - return buf.String() -} - -func (MDoc) idoc() {} diff --git a/vendor/go.mongodb.org/mongo-driver/x/bsonx/primitive_codecs.go b/vendor/go.mongodb.org/mongo-driver/x/bsonx/primitive_codecs.go deleted file mode 100644 index 01bd182678..0000000000 --- a/vendor/go.mongodb.org/mongo-driver/x/bsonx/primitive_codecs.go +++ /dev/null @@ -1,637 +0,0 @@ -// Copyright (C) MongoDB, Inc. 2017-present. -// -// Licensed under the Apache License, Version 2.0 (the "License"); you may -// not use this file except in compliance with the License. You may obtain -// a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 - -package bsonx - -import ( - "errors" - "fmt" - "reflect" - - "go.mongodb.org/mongo-driver/bson/bsoncodec" - "go.mongodb.org/mongo-driver/bson/bsonrw" - "go.mongodb.org/mongo-driver/bson/bsontype" -) - -var primitiveCodecs PrimitiveCodecs - -var tDocument = reflect.TypeOf((Doc)(nil)) -var tArray = reflect.TypeOf((Arr)(nil)) -var tValue = reflect.TypeOf(Val{}) -var tElementSlice = reflect.TypeOf(([]Elem)(nil)) - -// PrimitiveCodecs is a namespace for all of the default bsoncodec.Codecs for the primitive types -// defined in this package. -type PrimitiveCodecs struct{} - -// RegisterPrimitiveCodecs will register the encode and decode methods attached to PrimitiveCodecs -// with the provided RegistryBuilder. if rb is nil, a new empty RegistryBuilder will be created. -func (pc PrimitiveCodecs) RegisterPrimitiveCodecs(rb *bsoncodec.RegistryBuilder) { - if rb == nil { - panic(errors.New("argument to RegisterPrimitiveCodecs must not be nil")) - } - - rb. - RegisterTypeEncoder(tDocument, bsoncodec.ValueEncoderFunc(pc.DocumentEncodeValue)). - RegisterTypeEncoder(tArray, bsoncodec.ValueEncoderFunc(pc.ArrayEncodeValue)). - RegisterTypeEncoder(tValue, bsoncodec.ValueEncoderFunc(pc.ValueEncodeValue)). - RegisterTypeEncoder(tElementSlice, bsoncodec.ValueEncoderFunc(pc.ElementSliceEncodeValue)). - RegisterTypeDecoder(tDocument, bsoncodec.ValueDecoderFunc(pc.DocumentDecodeValue)). - RegisterTypeDecoder(tArray, bsoncodec.ValueDecoderFunc(pc.ArrayDecodeValue)). - RegisterTypeDecoder(tValue, bsoncodec.ValueDecoderFunc(pc.ValueDecodeValue)). - RegisterTypeDecoder(tElementSlice, bsoncodec.ValueDecoderFunc(pc.ElementSliceDecodeValue)) -} - -// DocumentEncodeValue is the ValueEncoderFunc for *Document. -func (pc PrimitiveCodecs) DocumentEncodeValue(ec bsoncodec.EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { - if !val.IsValid() || val.Type() != tDocument { - return bsoncodec.ValueEncoderError{Name: "DocumentEncodeValue", Types: []reflect.Type{tDocument}, Received: val} - } - - if val.IsNil() { - return vw.WriteNull() - } - - doc := val.Interface().(Doc) - - dw, err := vw.WriteDocument() - if err != nil { - return err - } - - return pc.encodeDocument(ec, dw, doc) -} - -// DocumentDecodeValue is the ValueDecoderFunc for *Document. -func (pc PrimitiveCodecs) DocumentDecodeValue(dctx bsoncodec.DecodeContext, vr bsonrw.ValueReader, val reflect.Value) error { - if !val.CanSet() || val.Type() != tDocument { - return bsoncodec.ValueDecoderError{Name: "DocumentDecodeValue", Types: []reflect.Type{tDocument}, Received: val} - } - - return pc.documentDecodeValue(dctx, vr, val.Addr().Interface().(*Doc)) -} - -func (pc PrimitiveCodecs) documentDecodeValue(dctx bsoncodec.DecodeContext, vr bsonrw.ValueReader, doc *Doc) error { - - dr, err := vr.ReadDocument() - if err != nil { - return err - } - - return pc.decodeDocument(dctx, dr, doc) -} - -// ArrayEncodeValue is the ValueEncoderFunc for *Array. -func (pc PrimitiveCodecs) ArrayEncodeValue(ec bsoncodec.EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { - if !val.IsValid() || val.Type() != tArray { - return bsoncodec.ValueEncoderError{Name: "ArrayEncodeValue", Types: []reflect.Type{tArray}, Received: val} - } - - if val.IsNil() { - return vw.WriteNull() - } - - arr := val.Interface().(Arr) - - aw, err := vw.WriteArray() - if err != nil { - return err - } - - for _, val := range arr { - dvw, err := aw.WriteArrayElement() - if err != nil { - return err - } - - err = pc.encodeValue(ec, dvw, val) - - if err != nil { - return err - } - } - - return aw.WriteArrayEnd() -} - -// ArrayDecodeValue is the ValueDecoderFunc for *Array. -func (pc PrimitiveCodecs) ArrayDecodeValue(dc bsoncodec.DecodeContext, vr bsonrw.ValueReader, val reflect.Value) error { - if !val.CanSet() || val.Type() != tArray { - return bsoncodec.ValueDecoderError{Name: "ArrayDecodeValue", Types: []reflect.Type{tArray}, Received: val} - } - - ar, err := vr.ReadArray() - if err != nil { - return err - } - - if val.IsNil() { - val.Set(reflect.MakeSlice(tArray, 0, 0)) - } - val.SetLen(0) - - for { - vr, err := ar.ReadValue() - if err == bsonrw.ErrEOA { - break - } - if err != nil { - return err - } - - var elem Val - err = pc.valueDecodeValue(dc, vr, &elem) - if err != nil { - return err - } - - val.Set(reflect.Append(val, reflect.ValueOf(elem))) - } - - return nil -} - -// ElementSliceEncodeValue is the ValueEncoderFunc for []*Element. -func (pc PrimitiveCodecs) ElementSliceEncodeValue(ec bsoncodec.EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { - if !val.IsValid() || val.Type() != tElementSlice { - return bsoncodec.ValueEncoderError{Name: "ElementSliceEncodeValue", Types: []reflect.Type{tElementSlice}, Received: val} - } - - if val.IsNil() { - return vw.WriteNull() - } - - return pc.DocumentEncodeValue(ec, vw, val.Convert(tDocument)) -} - -// ElementSliceDecodeValue is the ValueDecoderFunc for []*Element. -func (pc PrimitiveCodecs) ElementSliceDecodeValue(dc bsoncodec.DecodeContext, vr bsonrw.ValueReader, val reflect.Value) error { - if !val.CanSet() || val.Type() != tElementSlice { - return bsoncodec.ValueDecoderError{Name: "ElementSliceDecodeValue", Types: []reflect.Type{tElementSlice}, Received: val} - } - - if val.IsNil() { - val.Set(reflect.MakeSlice(val.Type(), 0, 0)) - } - - val.SetLen(0) - - dr, err := vr.ReadDocument() - if err != nil { - return err - } - elems := make([]reflect.Value, 0) - for { - key, vr, err := dr.ReadElement() - if err == bsonrw.ErrEOD { - break - } - if err != nil { - return err - } - - var elem Elem - err = pc.elementDecodeValue(dc, vr, key, &elem) - if err != nil { - return err - } - - elems = append(elems, reflect.ValueOf(elem)) - } - - val.Set(reflect.Append(val, elems...)) - return nil -} - -// ValueEncodeValue is the ValueEncoderFunc for *Value. -func (pc PrimitiveCodecs) ValueEncodeValue(ec bsoncodec.EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { - if !val.IsValid() || val.Type() != tValue { - return bsoncodec.ValueEncoderError{Name: "ValueEncodeValue", Types: []reflect.Type{tValue}, Received: val} - } - - v := val.Interface().(Val) - - return pc.encodeValue(ec, vw, v) -} - -// ValueDecodeValue is the ValueDecoderFunc for *Value. -func (pc PrimitiveCodecs) ValueDecodeValue(dc bsoncodec.DecodeContext, vr bsonrw.ValueReader, val reflect.Value) error { - if !val.CanSet() || val.Type() != tValue { - return bsoncodec.ValueDecoderError{Name: "ValueDecodeValue", Types: []reflect.Type{tValue}, Received: val} - } - - return pc.valueDecodeValue(dc, vr, val.Addr().Interface().(*Val)) -} - -// encodeDocument is a separate function that we use because CodeWithScope -// returns us a DocumentWriter and we need to do the same logic that we would do -// for a document but cannot use a Codec. -func (pc PrimitiveCodecs) encodeDocument(ec bsoncodec.EncodeContext, dw bsonrw.DocumentWriter, doc Doc) error { - for _, elem := range doc { - dvw, err := dw.WriteDocumentElement(elem.Key) - if err != nil { - return err - } - - err = pc.encodeValue(ec, dvw, elem.Value) - - if err != nil { - return err - } - } - - return dw.WriteDocumentEnd() -} - -// DecodeDocument haves decoding into a Doc from a bsonrw.DocumentReader. -func (pc PrimitiveCodecs) DecodeDocument(dctx bsoncodec.DecodeContext, dr bsonrw.DocumentReader, pdoc *Doc) error { - return pc.decodeDocument(dctx, dr, pdoc) -} - -func (pc PrimitiveCodecs) decodeDocument(dctx bsoncodec.DecodeContext, dr bsonrw.DocumentReader, pdoc *Doc) error { - if *pdoc == nil { - *pdoc = make(Doc, 0) - } - *pdoc = (*pdoc)[:0] - for { - key, vr, err := dr.ReadElement() - if err == bsonrw.ErrEOD { - break - } - if err != nil { - return err - } - - var elem Elem - err = pc.elementDecodeValue(dctx, vr, key, &elem) - if err != nil { - return err - } - - *pdoc = append(*pdoc, elem) - } - return nil -} - -func (pc PrimitiveCodecs) elementDecodeValue(dc bsoncodec.DecodeContext, vr bsonrw.ValueReader, key string, elem *Elem) error { - var val Val - switch vr.Type() { - case bsontype.Double: - f64, err := vr.ReadDouble() - if err != nil { - return err - } - val = Double(f64) - case bsontype.String: - str, err := vr.ReadString() - if err != nil { - return err - } - val = String(str) - case bsontype.EmbeddedDocument: - var embeddedDoc Doc - err := pc.documentDecodeValue(dc, vr, &embeddedDoc) - if err != nil { - return err - } - val = Document(embeddedDoc) - case bsontype.Array: - arr := reflect.New(tArray).Elem() - err := pc.ArrayDecodeValue(dc, vr, arr) - if err != nil { - return err - } - val = Array(arr.Interface().(Arr)) - case bsontype.Binary: - data, subtype, err := vr.ReadBinary() - if err != nil { - return err - } - val = Binary(subtype, data) - case bsontype.Undefined: - err := vr.ReadUndefined() - if err != nil { - return err - } - val = Undefined() - case bsontype.ObjectID: - oid, err := vr.ReadObjectID() - if err != nil { - return err - } - val = ObjectID(oid) - case bsontype.Boolean: - b, err := vr.ReadBoolean() - if err != nil { - return err - } - val = Boolean(b) - case bsontype.DateTime: - dt, err := vr.ReadDateTime() - if err != nil { - return err - } - val = DateTime(dt) - case bsontype.Null: - err := vr.ReadNull() - if err != nil { - return err - } - val = Null() - case bsontype.Regex: - pattern, options, err := vr.ReadRegex() - if err != nil { - return err - } - val = Regex(pattern, options) - case bsontype.DBPointer: - ns, pointer, err := vr.ReadDBPointer() - if err != nil { - return err - } - val = DBPointer(ns, pointer) - case bsontype.JavaScript: - js, err := vr.ReadJavascript() - if err != nil { - return err - } - val = JavaScript(js) - case bsontype.Symbol: - symbol, err := vr.ReadSymbol() - if err != nil { - return err - } - val = Symbol(symbol) - case bsontype.CodeWithScope: - code, scope, err := vr.ReadCodeWithScope() - if err != nil { - return err - } - var doc Doc - err = pc.decodeDocument(dc, scope, &doc) - if err != nil { - return err - } - val = CodeWithScope(code, doc) - case bsontype.Int32: - i32, err := vr.ReadInt32() - if err != nil { - return err - } - val = Int32(i32) - case bsontype.Timestamp: - t, i, err := vr.ReadTimestamp() - if err != nil { - return err - } - val = Timestamp(t, i) - case bsontype.Int64: - i64, err := vr.ReadInt64() - if err != nil { - return err - } - val = Int64(i64) - case bsontype.Decimal128: - d128, err := vr.ReadDecimal128() - if err != nil { - return err - } - val = Decimal128(d128) - case bsontype.MinKey: - err := vr.ReadMinKey() - if err != nil { - return err - } - val = MinKey() - case bsontype.MaxKey: - err := vr.ReadMaxKey() - if err != nil { - return err - } - val = MaxKey() - default: - return fmt.Errorf("Cannot read unknown BSON type %s", vr.Type()) - } - - *elem = Elem{Key: key, Value: val} - return nil -} - -// encodeValue does not validation, and the callers must perform validation on val before calling -// this method. -func (pc PrimitiveCodecs) encodeValue(ec bsoncodec.EncodeContext, vw bsonrw.ValueWriter, val Val) error { - var err error - switch val.Type() { - case bsontype.Double: - err = vw.WriteDouble(val.Double()) - case bsontype.String: - err = vw.WriteString(val.StringValue()) - case bsontype.EmbeddedDocument: - var encoder bsoncodec.ValueEncoder - encoder, err = ec.LookupEncoder(tDocument) - if err != nil { - break - } - err = encoder.EncodeValue(ec, vw, reflect.ValueOf(val.Document())) - case bsontype.Array: - var encoder bsoncodec.ValueEncoder - encoder, err = ec.LookupEncoder(tArray) - if err != nil { - break - } - err = encoder.EncodeValue(ec, vw, reflect.ValueOf(val.Array())) - case bsontype.Binary: - // TODO: FIX THIS (╯°□°）╯︵ ┻━┻ - subtype, data := val.Binary() - err = vw.WriteBinaryWithSubtype(data, subtype) - case bsontype.Undefined: - err = vw.WriteUndefined() - case bsontype.ObjectID: - err = vw.WriteObjectID(val.ObjectID()) - case bsontype.Boolean: - err = vw.WriteBoolean(val.Boolean()) - case bsontype.DateTime: - err = vw.WriteDateTime(val.DateTime()) - case bsontype.Null: - err = vw.WriteNull() - case bsontype.Regex: - err = vw.WriteRegex(val.Regex()) - case bsontype.DBPointer: - err = vw.WriteDBPointer(val.DBPointer()) - case bsontype.JavaScript: - err = vw.WriteJavascript(val.JavaScript()) - case bsontype.Symbol: - err = vw.WriteSymbol(val.Symbol()) - case bsontype.CodeWithScope: - code, scope := val.CodeWithScope() - - var cwsw bsonrw.DocumentWriter - cwsw, err = vw.WriteCodeWithScope(code) - if err != nil { - break - } - - err = pc.encodeDocument(ec, cwsw, scope) - case bsontype.Int32: - err = vw.WriteInt32(val.Int32()) - case bsontype.Timestamp: - err = vw.WriteTimestamp(val.Timestamp()) - case bsontype.Int64: - err = vw.WriteInt64(val.Int64()) - case bsontype.Decimal128: - err = vw.WriteDecimal128(val.Decimal128()) - case bsontype.MinKey: - err = vw.WriteMinKey() - case bsontype.MaxKey: - err = vw.WriteMaxKey() - default: - err = fmt.Errorf("%T is not a valid BSON type to encode", val.Type()) - } - - return err -} - -func (pc PrimitiveCodecs) valueDecodeValue(dc bsoncodec.DecodeContext, vr bsonrw.ValueReader, val *Val) error { - switch vr.Type() { - case bsontype.Double: - f64, err := vr.ReadDouble() - if err != nil { - return err - } - *val = Double(f64) - case bsontype.String: - str, err := vr.ReadString() - if err != nil { - return err - } - *val = String(str) - case bsontype.EmbeddedDocument: - var embeddedDoc Doc - err := pc.documentDecodeValue(dc, vr, &embeddedDoc) - if err != nil { - return err - } - *val = Document(embeddedDoc) - case bsontype.Array: - arr := reflect.New(tArray).Elem() - err := pc.ArrayDecodeValue(dc, vr, arr) - if err != nil { - return err - } - *val = Array(arr.Interface().(Arr)) - case bsontype.Binary: - data, subtype, err := vr.ReadBinary() - if err != nil { - return err - } - *val = Binary(subtype, data) - case bsontype.Undefined: - err := vr.ReadUndefined() - if err != nil { - return err - } - *val = Undefined() - case bsontype.ObjectID: - oid, err := vr.ReadObjectID() - if err != nil { - return err - } - *val = ObjectID(oid) - case bsontype.Boolean: - b, err := vr.ReadBoolean() - if err != nil { - return err - } - *val = Boolean(b) - case bsontype.DateTime: - dt, err := vr.ReadDateTime() - if err != nil { - return err - } - *val = DateTime(dt) - case bsontype.Null: - err := vr.ReadNull() - if err != nil { - return err - } - *val = Null() - case bsontype.Regex: - pattern, options, err := vr.ReadRegex() - if err != nil { - return err - } - *val = Regex(pattern, options) - case bsontype.DBPointer: - ns, pointer, err := vr.ReadDBPointer() - if err != nil { - return err - } - *val = DBPointer(ns, pointer) - case bsontype.JavaScript: - js, err := vr.ReadJavascript() - if err != nil { - return err - } - *val = JavaScript(js) - case bsontype.Symbol: - symbol, err := vr.ReadSymbol() - if err != nil { - return err - } - *val = Symbol(symbol) - case bsontype.CodeWithScope: - code, scope, err := vr.ReadCodeWithScope() - if err != nil { - return err - } - var scopeDoc Doc - err = pc.decodeDocument(dc, scope, &scopeDoc) - if err != nil { - return err - } - *val = CodeWithScope(code, scopeDoc) - case bsontype.Int32: - i32, err := vr.ReadInt32() - if err != nil { - return err - } - *val = Int32(i32) - case bsontype.Timestamp: - t, i, err := vr.ReadTimestamp() - if err != nil { - return err - } - *val = Timestamp(t, i) - case bsontype.Int64: - i64, err := vr.ReadInt64() - if err != nil { - return err - } - *val = Int64(i64) - case bsontype.Decimal128: - d128, err := vr.ReadDecimal128() - if err != nil { - return err - } - *val = Decimal128(d128) - case bsontype.MinKey: - err := vr.ReadMinKey() - if err != nil { - return err - } - *val = MinKey() - case bsontype.MaxKey: - err := vr.ReadMaxKey() - if err != nil { - return err - } - *val = MaxKey() - default: - return fmt.Errorf("Cannot read unknown BSON type %s", vr.Type()) - } - - return nil -} diff --git a/vendor/go.mongodb.org/mongo-driver/x/bsonx/reflectionfree_d_codec.go b/vendor/go.mongodb.org/mongo-driver/x/bsonx/reflectionfree_d_codec.go deleted file mode 100644 index 7e68e55c1e..0000000000 --- a/vendor/go.mongodb.org/mongo-driver/x/bsonx/reflectionfree_d_codec.go +++ /dev/null @@ -1,1025 +0,0 @@ -// Copyright (C) MongoDB, Inc. 2017-present. -// -// Licensed under the Apache License, Version 2.0 (the "License"); you may -// not use this file except in compliance with the License. You may obtain -// a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 - -package bsonx - -import ( - "fmt" - "math" - "reflect" - "time" - - "go.mongodb.org/mongo-driver/bson/bsoncodec" - "go.mongodb.org/mongo-driver/bson/bsonrw" - "go.mongodb.org/mongo-driver/bson/bsontype" - "go.mongodb.org/mongo-driver/bson/primitive" -) - -var ( - tPrimitiveD = reflect.TypeOf(primitive.D{}) - tPrimitiveCWS = reflect.TypeOf(primitive.CodeWithScope{}) - defaultValueEncoders = bsoncodec.DefaultValueEncoders{} - defaultValueDecoders = bsoncodec.DefaultValueDecoders{} -) - -type reflectionFreeDCodec struct{} - -// ReflectionFreeDCodec is a ValueEncoder for the primitive.D type that does not use reflection. -var ReflectionFreeDCodec bsoncodec.ValueCodec = &reflectionFreeDCodec{} - -func (r *reflectionFreeDCodec) EncodeValue(ec bsoncodec.EncodeContext, vw bsonrw.ValueWriter, val reflect.Value) error { - if !val.IsValid() || val.Type() != tPrimitiveD { - return bsoncodec.ValueEncoderError{Name: "DEncodeValue", Types: []reflect.Type{tPrimitiveD}, Received: val} - } - - if val.IsNil() { - return vw.WriteNull() - } - - doc := val.Interface().(primitive.D) - return r.encodeDocument(ec, vw, doc) -} - -func (r *reflectionFreeDCodec) DecodeValue(dc bsoncodec.DecodeContext, vr bsonrw.ValueReader, val reflect.Value) error { - if !val.IsValid() || !val.CanSet() || val.Type() != tPrimitiveD { - return bsoncodec.ValueDecoderError{Name: "DDecodeValue", Kinds: []reflect.Kind{reflect.Slice}, Received: val} - } - - switch vrType := vr.Type(); vrType { - case bsontype.Type(0), bsontype.EmbeddedDocument: - case bsontype.Null: - val.Set(reflect.Zero(val.Type())) - return vr.ReadNull() - default: - return fmt.Errorf("cannot decode %v into a primitive.D", vrType) - } - - doc, err := r.decodeDocument(dc, vr) - if err != nil { - return err - } - - val.Set(reflect.ValueOf(doc)) - return nil -} - -func (r *reflectionFreeDCodec) decodeDocument(dc bsoncodec.DecodeContext, vr bsonrw.ValueReader) (primitive.D, error) { - dr, err := vr.ReadDocument() - if err != nil { - return nil, err - } - - doc := primitive.D{} - for { - key, elemVr, err := dr.ReadElement() - if err == bsonrw.ErrEOD { - break - } - if err != nil { - return nil, err - } - - val, err := r.decodeValue(dc, elemVr) - if err != nil { - return nil, err - } - doc = append(doc, primitive.E{Key: key, Value: val}) - } - - return doc, nil -} - -func (r *reflectionFreeDCodec) decodeArray(dc bsoncodec.DecodeContext, vr bsonrw.ValueReader) (primitive.A, error) { - ar, err := vr.ReadArray() - if err != nil { - return nil, err - } - - array := primitive.A{} - for { - arrayValReader, err := ar.ReadValue() - if err == bsonrw.ErrEOA { - break - } - if err != nil { - return nil, err - } - - val, err := r.decodeValue(dc, arrayValReader) - if err != nil { - return nil, err - } - array = append(array, val) - } - - return array, nil -} - -func (r *reflectionFreeDCodec) decodeValue(dc bsoncodec.DecodeContext, vr bsonrw.ValueReader) (interface{}, error) { - switch vrType := vr.Type(); vrType { - case bsontype.Null: - return nil, vr.ReadNull() - case bsontype.Double: - return vr.ReadDouble() - case bsontype.String: - return vr.ReadString() - case bsontype.Binary: - data, subtype, err := vr.ReadBinary() - if err != nil { - return nil, err - } - - return primitive.Binary{ - Data: data, - Subtype: subtype, - }, nil - case bsontype.Undefined: - return primitive.Undefined{}, vr.ReadUndefined() - case bsontype.ObjectID: - return vr.ReadObjectID() - case bsontype.Boolean: - return vr.ReadBoolean() - case bsontype.DateTime: - dt, err := vr.ReadDateTime() - if err != nil { - return nil, err - } - - return primitive.DateTime(dt), nil - case bsontype.Regex: - pattern, options, err := vr.ReadRegex() - if err != nil { - return nil, err - } - - return primitive.Regex{ - Pattern: pattern, - Options: options, - }, nil - case bsontype.DBPointer: - ns, oid, err := vr.ReadDBPointer() - if err != nil { - return nil, err - } - - return primitive.DBPointer{ - DB: ns, - Pointer: oid, - }, nil - case bsontype.JavaScript: - js, err := vr.ReadJavascript() - if err != nil { - return nil, err - } - - return primitive.JavaScript(js), nil - case bsontype.Symbol: - sym, err := vr.ReadSymbol() - if err != nil { - return nil, err - } - - return primitive.Symbol(sym), nil - case bsontype.CodeWithScope: - cws := reflect.New(tPrimitiveCWS).Elem() - err := defaultValueDecoders.CodeWithScopeDecodeValue(dc, vr, cws) - if err != nil { - return nil, err - } - - return cws.Interface().(primitive.CodeWithScope), nil - case bsontype.Int32: - return vr.ReadInt32() - case bsontype.Int64: - return vr.ReadInt64() - case bsontype.Timestamp: - t, i, err := vr.ReadTimestamp() - if err != nil { - return nil, err - } - - return primitive.Timestamp{ - T: t, - I: i, - }, nil - case bsontype.Decimal128: - return vr.ReadDecimal128() - case bsontype.MinKey: - return primitive.MinKey{}, vr.ReadMinKey() - case bsontype.MaxKey: - return primitive.MaxKey{}, vr.ReadMaxKey() - case bsontype.Type(0), bsontype.EmbeddedDocument: - return r.decodeDocument(dc, vr) - case bsontype.Array: - return r.decodeArray(dc, vr) - default: - return nil, fmt.Errorf("cannot decode invalid BSON type %s", vrType) - } -} - -func (r *reflectionFreeDCodec) encodeDocumentValue(ec bsoncodec.EncodeContext, vw bsonrw.ValueWriter, v interface{}) error { - switch val := v.(type) { - case int: - return r.encodeInt(vw, val) - case int8: - return vw.WriteInt32(int32(val)) - case int16: - return vw.WriteInt32(int32(val)) - case int32: - return vw.WriteInt32(val) - case int64: - return r.encodeInt64(ec, vw, val) - case uint: - return r.encodeUint64(ec, vw, uint64(val)) - case uint8: - return vw.WriteInt32(int32(val)) - case uint16: - return vw.WriteInt32(int32(val)) - case uint32: - return r.encodeUint64(ec, vw, uint64(val)) - case uint64: - return r.encodeUint64(ec, vw, val) - case float32: - return vw.WriteDouble(float64(val)) - case float64: - return vw.WriteDouble(val) - case []byte: - return vw.WriteBinary(val) - case primitive.Binary: - return vw.WriteBinaryWithSubtype(val.Data, val.Subtype) - case bool: - return vw.WriteBoolean(val) - case primitive.CodeWithScope: - return defaultValueEncoders.CodeWithScopeEncodeValue(ec, vw, reflect.ValueOf(val)) - case primitive.DBPointer: - return vw.WriteDBPointer(val.DB, val.Pointer) - case primitive.DateTime: - return vw.WriteDateTime(int64(val)) - case time.Time: - dt := primitive.NewDateTimeFromTime(val) - return vw.WriteDateTime(int64(dt)) - case primitive.Decimal128: - return vw.WriteDecimal128(val) - case primitive.JavaScript: - return vw.WriteJavascript(string(val)) - case primitive.MinKey: - return vw.WriteMinKey() - case primitive.MaxKey: - return vw.WriteMaxKey() - case primitive.Null, nil: - return vw.WriteNull() - case primitive.ObjectID: - return vw.WriteObjectID(val) - case primitive.Regex: - return vw.WriteRegex(val.Pattern, val.Options) - case string: - return vw.WriteString(val) - case primitive.Symbol: - return vw.WriteSymbol(string(val)) - case primitive.Timestamp: - return vw.WriteTimestamp(val.T, val.I) - case primitive.Undefined: - return vw.WriteUndefined() - case primitive.D: - return r.encodeDocument(ec, vw, val) - case primitive.A: - return r.encodePrimitiveA(ec, vw, val) - case []interface{}: - return r.encodePrimitiveA(ec, vw, val) - case []primitive.D: - return r.encodeSliceD(ec, vw, val) - case []int: - return r.encodeSliceInt(vw, val) - case []int8: - return r.encodeSliceInt8(vw, val) - case []int16: - return r.encodeSliceInt16(vw, val) - case []int32: - return r.encodeSliceInt32(vw, val) - case []int64: - return r.encodeSliceInt64(ec, vw, val) - case []uint: - return r.encodeSliceUint(ec, vw, val) - case []uint16: - return r.encodeSliceUint16(vw, val) - case []uint32: - return r.encodeSliceUint32(ec, vw, val) - case []uint64: - return r.encodeSliceUint64(ec, vw, val) - case [][]byte: - return r.encodeSliceByteSlice(vw, val) - case []primitive.Binary: - return r.encodeSliceBinary(vw, val) - case []bool: - return r.encodeSliceBoolean(vw, val) - case []primitive.CodeWithScope: - return r.encodeSliceCWS(ec, vw, val) - case []primitive.DBPointer: - return r.encodeSliceDBPointer(vw, val) - case []primitive.DateTime: - return r.encodeSliceDateTime(vw, val) - case []time.Time: - return r.encodeSliceTimeTime(vw, val) - case []primitive.Decimal128: - return r.encodeSliceDecimal128(vw, val) - case []float32: - return r.encodeSliceFloat32(vw, val) - case []float64: - return r.encodeSliceFloat64(vw, val) - case []primitive.JavaScript: - return r.encodeSliceJavaScript(vw, val) - case []primitive.MinKey: - return r.encodeSliceMinKey(vw, val) - case []primitive.MaxKey: - return r.encodeSliceMaxKey(vw, val) - case []primitive.Null: - return r.encodeSliceNull(vw, val) - case []primitive.ObjectID: - return r.encodeSliceObjectID(vw, val) - case []primitive.Regex: - return r.encodeSliceRegex(vw, val) - case []string: - return r.encodeSliceString(vw, val) - case []primitive.Symbol: - return r.encodeSliceSymbol(vw, val) - case []primitive.Timestamp: - return r.encodeSliceTimestamp(vw, val) - case []primitive.Undefined: - return r.encodeSliceUndefined(vw, val) - default: - return fmt.Errorf("value of type %T not supported", v) - } -} - -func (r *reflectionFreeDCodec) encodeInt(vw bsonrw.ValueWriter, val int) error { - if fitsIn32Bits(int64(val)) { - return vw.WriteInt32(int32(val)) - } - return vw.WriteInt64(int64(val)) -} - -func (r *reflectionFreeDCodec) encodeInt64(ec bsoncodec.EncodeContext, vw bsonrw.ValueWriter, val int64) error { - if ec.MinSize && fitsIn32Bits(val) { - return vw.WriteInt32(int32(val)) - } - return vw.WriteInt64(val) -} - -func (r *reflectionFreeDCodec) encodeUint64(ec bsoncodec.EncodeContext, vw bsonrw.ValueWriter, val uint64) error { - if ec.MinSize && val <= math.MaxInt32 { - return vw.WriteInt32(int32(val)) - } - if val > math.MaxInt64 { - return fmt.Errorf("%d overflows int64", val) - } - - return vw.WriteInt64(int64(val)) -} - -func (r *reflectionFreeDCodec) encodeDocument(ec bsoncodec.EncodeContext, vw bsonrw.ValueWriter, doc primitive.D) error { - dw, err := vw.WriteDocument() - if err != nil { - return err - } - - for _, elem := range doc { - docValWriter, err := dw.WriteDocumentElement(elem.Key) - if err != nil { - return err - } - - if err := r.encodeDocumentValue(ec, docValWriter, elem.Value); err != nil { - return err - } - } - - return dw.WriteDocumentEnd() -} - -func (r *reflectionFreeDCodec) encodeSliceByteSlice(vw bsonrw.ValueWriter, arr [][]byte) error { - aw, err := vw.WriteArray() - if err != nil { - return err - } - - for _, val := range arr { - arrayValWriter, err := aw.WriteArrayElement() - if err != nil { - return err - } - - if err := arrayValWriter.WriteBinary(val); err != nil { - return err - } - } - - return aw.WriteArrayEnd() -} - -func (r *reflectionFreeDCodec) encodeSliceBinary(vw bsonrw.ValueWriter, arr []primitive.Binary) error { - aw, err := vw.WriteArray() - if err != nil { - return err - } - - for _, val := range arr { - arrayValWriter, err := aw.WriteArrayElement() - if err != nil { - return err - } - - if err := arrayValWriter.WriteBinaryWithSubtype(val.Data, val.Subtype); err != nil { - return err - } - } - - return aw.WriteArrayEnd() -} - -func (r *reflectionFreeDCodec) encodeSliceBoolean(vw bsonrw.ValueWriter, arr []bool) error { - aw, err := vw.WriteArray() - if err != nil { - return err - } - - for _, val := range arr { - arrayValWriter, err := aw.WriteArrayElement() - if err != nil { - return err - } - - if err := arrayValWriter.WriteBoolean(val); err != nil { - return err - } - } - - return aw.WriteArrayEnd() -} - -func (r *reflectionFreeDCodec) encodeSliceCWS(ec bsoncodec.EncodeContext, vw bsonrw.ValueWriter, arr []primitive.CodeWithScope) error { - aw, err := vw.WriteArray() - if err != nil { - return err - } - - for _, val := range arr { - arrayValWriter, err := aw.WriteArrayElement() - if err != nil { - return err - } - - if err := defaultValueEncoders.CodeWithScopeEncodeValue(ec, arrayValWriter, reflect.ValueOf(val)); err != nil { - return err - } - } - - return aw.WriteArrayEnd() -} - -func (r *reflectionFreeDCodec) encodeSliceDBPointer(vw bsonrw.ValueWriter, arr []primitive.DBPointer) error { - aw, err := vw.WriteArray() - if err != nil { - return err - } - - for _, val := range arr { - arrayValWriter, err := aw.WriteArrayElement() - if err != nil { - return err - } - - if err := arrayValWriter.WriteDBPointer(val.DB, val.Pointer); err != nil { - return err - } - } - - return aw.WriteArrayEnd() -} - -func (r *reflectionFreeDCodec) encodeSliceDateTime(vw bsonrw.ValueWriter, arr []primitive.DateTime) error { - aw, err := vw.WriteArray() - if err != nil { - return err - } - - for _, val := range arr { - arrayValWriter, err := aw.WriteArrayElement() - if err != nil { - return err - } - - if err := arrayValWriter.WriteDateTime(int64(val)); err != nil { - return err - } - } - - return aw.WriteArrayEnd() -} - -func (r *reflectionFreeDCodec) encodeSliceTimeTime(vw bsonrw.ValueWriter, arr []time.Time) error { - aw, err := vw.WriteArray() - if err != nil { - return err - } - - for _, val := range arr { - arrayValWriter, err := aw.WriteArrayElement() - if err != nil { - return err - } - - dt := primitive.NewDateTimeFromTime(val) - if err := arrayValWriter.WriteDateTime(int64(dt)); err != nil { - return err - } - } - - return aw.WriteArrayEnd() -} - -func (r *reflectionFreeDCodec) encodeSliceDecimal128(vw bsonrw.ValueWriter, arr []primitive.Decimal128) error { - aw, err := vw.WriteArray() - if err != nil { - return err - } - - for _, val := range arr { - arrayValWriter, err := aw.WriteArrayElement() - if err != nil { - return err - } - - if err := arrayValWriter.WriteDecimal128(val); err != nil { - return err - } - } - - return aw.WriteArrayEnd() -} - -func (r *reflectionFreeDCodec) encodeSliceFloat32(vw bsonrw.ValueWriter, arr []float32) error { - aw, err := vw.WriteArray() - if err != nil { - return err - } - - for _, val := range arr { - arrayValWriter, err := aw.WriteArrayElement() - if err != nil { - return err - } - - if err := arrayValWriter.WriteDouble(float64(val)); err != nil { - return err - } - } - - return aw.WriteArrayEnd() -} - -func (r *reflectionFreeDCodec) encodeSliceFloat64(vw bsonrw.ValueWriter, arr []float64) error { - aw, err := vw.WriteArray() - if err != nil { - return err - } - - for _, val := range arr { - arrayValWriter, err := aw.WriteArrayElement() - if err != nil { - return err - } - - if err := arrayValWriter.WriteDouble(val); err != nil { - return err - } - } - - return aw.WriteArrayEnd() -} - -func (r *reflectionFreeDCodec) encodeSliceJavaScript(vw bsonrw.ValueWriter, arr []primitive.JavaScript) error { - aw, err := vw.WriteArray() - if err != nil { - return err - } - - for _, val := range arr { - arrayValWriter, err := aw.WriteArrayElement() - if err != nil { - return err - } - - if err := arrayValWriter.WriteJavascript(string(val)); err != nil { - return err - } - } - - return aw.WriteArrayEnd() -} - -func (r *reflectionFreeDCodec) encodeSliceMinKey(vw bsonrw.ValueWriter, arr []primitive.MinKey) error { - aw, err := vw.WriteArray() - if err != nil { - return err - } - - for range arr { - arrayValWriter, err := aw.WriteArrayElement() - if err != nil { - return err - } - - if err := arrayValWriter.WriteMinKey(); err != nil { - return err - } - } - - return aw.WriteArrayEnd() -} - -func (r *reflectionFreeDCodec) encodeSliceMaxKey(vw bsonrw.ValueWriter, arr []primitive.MaxKey) error { - aw, err := vw.WriteArray() - if err != nil { - return err - } - - for range arr { - arrayValWriter, err := aw.WriteArrayElement() - if err != nil { - return err - } - - if err := arrayValWriter.WriteMaxKey(); err != nil { - return err - } - } - - return aw.WriteArrayEnd() -} - -func (r *reflectionFreeDCodec) encodeSliceNull(vw bsonrw.ValueWriter, arr []primitive.Null) error { - aw, err := vw.WriteArray() - if err != nil { - return err - } - - for range arr { - arrayValWriter, err := aw.WriteArrayElement() - if err != nil { - return err - } - - if err := arrayValWriter.WriteNull(); err != nil { - return err - } - } - - return aw.WriteArrayEnd() -} - -func (r *reflectionFreeDCodec) encodeSliceObjectID(vw bsonrw.ValueWriter, arr []primitive.ObjectID) error { - aw, err := vw.WriteArray() - if err != nil { - return err - } - - for _, val := range arr { - arrayValWriter, err := aw.WriteArrayElement() - if err != nil { - return err - } - - if err := arrayValWriter.WriteObjectID(val); err != nil { - return err - } - } - - return aw.WriteArrayEnd() -} - -func (r *reflectionFreeDCodec) encodeSliceRegex(vw bsonrw.ValueWriter, arr []primitive.Regex) error { - aw, err := vw.WriteArray() - if err != nil { - return err - } - - for _, val := range arr { - arrayValWriter, err := aw.WriteArrayElement() - if err != nil { - return err - } - - if err := arrayValWriter.WriteRegex(val.Pattern, val.Options); err != nil { - return err - } - } - - return aw.WriteArrayEnd() -} - -func (r *reflectionFreeDCodec) encodeSliceString(vw bsonrw.ValueWriter, arr []string) error { - aw, err := vw.WriteArray() - if err != nil { - return err - } - - for _, val := range arr { - arrayValWriter, err := aw.WriteArrayElement() - if err != nil { - return err - } - - if err := arrayValWriter.WriteString(val); err != nil { - return err - } - } - - return aw.WriteArrayEnd() -} - -func (r *reflectionFreeDCodec) encodeSliceSymbol(vw bsonrw.ValueWriter, arr []primitive.Symbol) error { - aw, err := vw.WriteArray() - if err != nil { - return err - } - - for _, val := range arr { - arrayValWriter, err := aw.WriteArrayElement() - if err != nil { - return err - } - - if err := arrayValWriter.WriteSymbol(string(val)); err != nil { - return err - } - } - - return aw.WriteArrayEnd() -} - -func (r *reflectionFreeDCodec) encodeSliceTimestamp(vw bsonrw.ValueWriter, arr []primitive.Timestamp) error { - aw, err := vw.WriteArray() - if err != nil { - return err - } - - for _, val := range arr { - arrayValWriter, err := aw.WriteArrayElement() - if err != nil { - return err - } - - if err := arrayValWriter.WriteTimestamp(val.T, val.I); err != nil { - return err - } - } - - return aw.WriteArrayEnd() -} - -func (r *reflectionFreeDCodec) encodeSliceUndefined(vw bsonrw.ValueWriter, arr []primitive.Undefined) error { - aw, err := vw.WriteArray() - if err != nil { - return err - } - - for range arr { - arrayValWriter, err := aw.WriteArrayElement() - if err != nil { - return err - } - - if err := arrayValWriter.WriteUndefined(); err != nil { - return err - } - } - - return aw.WriteArrayEnd() -} - -func (r *reflectionFreeDCodec) encodePrimitiveA(ec bsoncodec.EncodeContext, vw bsonrw.ValueWriter, arr primitive.A) error { - aw, err := vw.WriteArray() - if err != nil { - return err - } - - for _, val := range arr { - arrayValWriter, err := aw.WriteArrayElement() - if err != nil { - return err - } - - if err := r.encodeDocumentValue(ec, arrayValWriter, val); err != nil { - return err - } - } - - return aw.WriteArrayEnd() -} - -func (r *reflectionFreeDCodec) encodeSliceD(ec bsoncodec.EncodeContext, vw bsonrw.ValueWriter, arr []primitive.D) error { - aw, err := vw.WriteArray() - if err != nil { - return err - } - - for _, val := range arr { - arrayValWriter, err := aw.WriteArrayElement() - if err != nil { - return err - } - - if err := r.encodeDocument(ec, arrayValWriter, val); err != nil { - return err - } - } - - return aw.WriteArrayEnd() -} - -func (r *reflectionFreeDCodec) encodeSliceInt(vw bsonrw.ValueWriter, arr []int) error { - aw, err := vw.WriteArray() - if err != nil { - return err - } - - for _, val := range arr { - arrayValWriter, err := aw.WriteArrayElement() - if err != nil { - return err - } - - if err := r.encodeInt(arrayValWriter, val); err != nil { - return err - } - } - - return aw.WriteArrayEnd() -} - -func (r *reflectionFreeDCodec) encodeSliceInt8(vw bsonrw.ValueWriter, arr []int8) error { - aw, err := vw.WriteArray() - if err != nil { - return err - } - - for _, val := range arr { - arrayValWriter, err := aw.WriteArrayElement() - if err != nil { - return err - } - - if err := arrayValWriter.WriteInt32(int32(val)); err != nil { - return err - } - } - - return aw.WriteArrayEnd() -} - -func (r *reflectionFreeDCodec) encodeSliceInt16(vw bsonrw.ValueWriter, arr []int16) error { - aw, err := vw.WriteArray() - if err != nil { - return err - } - - for _, val := range arr { - arrayValWriter, err := aw.WriteArrayElement() - if err != nil { - return err - } - - if err := arrayValWriter.WriteInt32(int32(val)); err != nil { - return err - } - } - - return aw.WriteArrayEnd() -} - -func (r *reflectionFreeDCodec) encodeSliceInt32(vw bsonrw.ValueWriter, arr []int32) error { - aw, err := vw.WriteArray() - if err != nil { - return err - } - - for _, val := range arr { - arrayValWriter, err := aw.WriteArrayElement() - if err != nil { - return err - } - - if err := arrayValWriter.WriteInt32(val); err != nil { - return err - } - } - - return aw.WriteArrayEnd() -} - -func (r *reflectionFreeDCodec) encodeSliceInt64(ec bsoncodec.EncodeContext, vw bsonrw.ValueWriter, arr []int64) error { - aw, err := vw.WriteArray() - if err != nil { - return err - } - - for _, val := range arr { - arrayValWriter, err := aw.WriteArrayElement() - if err != nil { - return err - } - - if err := r.encodeInt64(ec, arrayValWriter, val); err != nil { - return err - } - } - - return aw.WriteArrayEnd() -} - -func (r *reflectionFreeDCodec) encodeSliceUint(ec bsoncodec.EncodeContext, vw bsonrw.ValueWriter, arr []uint) error { - aw, err := vw.WriteArray() - if err != nil { - return err - } - - for _, val := range arr { - arrayValWriter, err := aw.WriteArrayElement() - if err != nil { - return err - } - - if err := r.encodeUint64(ec, arrayValWriter, uint64(val)); err != nil { - return err - } - } - - return aw.WriteArrayEnd() -} - -func (r *reflectionFreeDCodec) encodeSliceUint16(vw bsonrw.ValueWriter, arr []uint16) error { - aw, err := vw.WriteArray() - if err != nil { - return err - } - - for _, val := range arr { - arrayValWriter, err := aw.WriteArrayElement() - if err != nil { - return err - } - - if err := arrayValWriter.WriteInt32(int32(val)); err != nil { - return err - } - } - - return aw.WriteArrayEnd() -} - -func (r *reflectionFreeDCodec) encodeSliceUint32(ec bsoncodec.EncodeContext, vw bsonrw.ValueWriter, arr []uint32) error { - aw, err := vw.WriteArray() - if err != nil { - return err - } - - for _, val := range arr { - arrayValWriter, err := aw.WriteArrayElement() - if err != nil { - return err - } - - if err := r.encodeUint64(ec, arrayValWriter, uint64(val)); err != nil { - return err - } - } - - return aw.WriteArrayEnd() -} - -func (r *reflectionFreeDCodec) encodeSliceUint64(ec bsoncodec.EncodeContext, vw bsonrw.ValueWriter, arr []uint64) error { - aw, err := vw.WriteArray() - if err != nil { - return err - } - - for _, val := range arr { - arrayValWriter, err := aw.WriteArrayElement() - if err != nil { - return err - } - - if err := r.encodeUint64(ec, arrayValWriter, val); err != nil { - return err - } - } - - return aw.WriteArrayEnd() -} - -func fitsIn32Bits(i int64) bool { - return math.MinInt32 <= i && i <= math.MaxInt32 -} diff --git a/vendor/go.mongodb.org/mongo-driver/x/bsonx/registry.go b/vendor/go.mongodb.org/mongo-driver/x/bsonx/registry.go deleted file mode 100644 index 3ca1c326c8..0000000000 --- a/vendor/go.mongodb.org/mongo-driver/x/bsonx/registry.go +++ /dev/null @@ -1,28 +0,0 @@ -// Copyright (C) MongoDB, Inc. 2022-present. -// -// Licensed under the Apache License, Version 2.0 (the "License"); you may -// not use this file except in compliance with the License. You may obtain -// a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 - -package bsonx - -import ( - "go.mongodb.org/mongo-driver/bson" - "go.mongodb.org/mongo-driver/bson/bsoncodec" -) - -// DefaultRegistry is the default bsoncodec.Registry. It contains the default codecs and the -// primitive codecs. -var DefaultRegistry = NewRegistryBuilder().Build() - -// NewRegistryBuilder creates a new RegistryBuilder configured with the default encoders and -// decoders from the bsoncodec.DefaultValueEncoders and bsoncodec.DefaultValueDecoders types and the -// PrimitiveCodecs type in this package. -func NewRegistryBuilder() *bsoncodec.RegistryBuilder { - rb := bsoncodec.NewRegistryBuilder() - bsoncodec.DefaultValueEncoders{}.RegisterDefaultEncoders(rb) - bsoncodec.DefaultValueDecoders{}.RegisterDefaultDecoders(rb) - bson.PrimitiveCodecs{}.RegisterPrimitiveCodecs(rb) - primitiveCodecs.RegisterPrimitiveCodecs(rb) - return rb -} diff --git a/vendor/go.mongodb.org/mongo-driver/x/bsonx/value.go b/vendor/go.mongodb.org/mongo-driver/x/bsonx/value.go deleted file mode 100644 index f66f6b240f..0000000000 --- a/vendor/go.mongodb.org/mongo-driver/x/bsonx/value.go +++ /dev/null @@ -1,866 +0,0 @@ -// Copyright (C) MongoDB, Inc. 2017-present. -// -// Licensed under the Apache License, Version 2.0 (the "License"); you may -// not use this file except in compliance with the License. You may obtain -// a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 - -package bsonx - -import ( - "bytes" - "encoding/binary" - "errors" - "fmt" - "math" - "time" - - "go.mongodb.org/mongo-driver/bson/bsontype" - "go.mongodb.org/mongo-driver/bson/primitive" - "go.mongodb.org/mongo-driver/x/bsonx/bsoncore" -) - -// Val represents a BSON value. -type Val struct { - // NOTE: The bootstrap is a small amount of space that'll be on the stack. At 15 bytes this - // doesn't make this type any larger, since there are 7 bytes of padding and we want an int64 to - // store small values (e.g. boolean, double, int64, etc...). The primitive property is where all - // of the larger values go. They will use either Go primitives or the primitive.* types. - t bsontype.Type - bootstrap [15]byte - primitive interface{} -} - -func (v Val) string() string { - if v.primitive != nil { - return v.primitive.(string) - } - // The string will either end with a null byte or it fills the entire bootstrap space. - length := v.bootstrap[0] - return string(v.bootstrap[1 : length+1]) -} - -func (v Val) writestring(str string) Val { - switch { - case len(str) < 15: - v.bootstrap[0] = uint8(len(str)) - copy(v.bootstrap[1:], str) - default: - v.primitive = str - } - return v -} - -func (v Val) i64() int64 { - return int64(v.bootstrap[0]) | int64(v.bootstrap[1])<<8 | int64(v.bootstrap[2])<<16 | - int64(v.bootstrap[3])<<24 | int64(v.bootstrap[4])<<32 | int64(v.bootstrap[5])<<40 | - int64(v.bootstrap[6])<<48 | int64(v.bootstrap[7])<<56 -} - -func (v Val) writei64(i64 int64) Val { - v.bootstrap[0] = byte(i64) - v.bootstrap[1] = byte(i64 >> 8) - v.bootstrap[2] = byte(i64 >> 16) - v.bootstrap[3] = byte(i64 >> 24) - v.bootstrap[4] = byte(i64 >> 32) - v.bootstrap[5] = byte(i64 >> 40) - v.bootstrap[6] = byte(i64 >> 48) - v.bootstrap[7] = byte(i64 >> 56) - return v -} - -// IsZero returns true if this value is zero or a BSON null. -func (v Val) IsZero() bool { return v.t == bsontype.Type(0) || v.t == bsontype.Null } - -func (v Val) String() string { - // TODO(GODRIVER-612): When bsoncore has appenders for extended JSON use that here. - return fmt.Sprintf("%v", v.Interface()) -} - -// Interface returns the Go value of this Value as an empty interface. -// -// This method will return nil if it is empty, otherwise it will return a Go primitive or a -// primitive.* instance. -func (v Val) Interface() interface{} { - switch v.Type() { - case bsontype.Double: - return v.Double() - case bsontype.String: - return v.StringValue() - case bsontype.EmbeddedDocument: - switch v.primitive.(type) { - case Doc: - return v.primitive.(Doc) - case MDoc: - return v.primitive.(MDoc) - default: - return primitive.Null{} - } - case bsontype.Array: - return v.Array() - case bsontype.Binary: - return v.primitive.(primitive.Binary) - case bsontype.Undefined: - return primitive.Undefined{} - case bsontype.ObjectID: - return v.ObjectID() - case bsontype.Boolean: - return v.Boolean() - case bsontype.DateTime: - return v.DateTime() - case bsontype.Null: - return primitive.Null{} - case bsontype.Regex: - return v.primitive.(primitive.Regex) - case bsontype.DBPointer: - return v.primitive.(primitive.DBPointer) - case bsontype.JavaScript: - return v.JavaScript() - case bsontype.Symbol: - return v.Symbol() - case bsontype.CodeWithScope: - return v.primitive.(primitive.CodeWithScope) - case bsontype.Int32: - return v.Int32() - case bsontype.Timestamp: - t, i := v.Timestamp() - return primitive.Timestamp{T: t, I: i} - case bsontype.Int64: - return v.Int64() - case bsontype.Decimal128: - return v.Decimal128() - case bsontype.MinKey: - return primitive.MinKey{} - case bsontype.MaxKey: - return primitive.MaxKey{} - default: - return primitive.Null{} - } -} - -// MarshalBSONValue implements the bsoncodec.ValueMarshaler interface. -func (v Val) MarshalBSONValue() (bsontype.Type, []byte, error) { - return v.MarshalAppendBSONValue(nil) -} - -// MarshalAppendBSONValue is similar to MarshalBSONValue, but allows the caller to specify a slice -// to add the bytes to. -func (v Val) MarshalAppendBSONValue(dst []byte) (bsontype.Type, []byte, error) { - t := v.Type() - switch v.Type() { - case bsontype.Double: - dst = bsoncore.AppendDouble(dst, v.Double()) - case bsontype.String: - dst = bsoncore.AppendString(dst, v.String()) - case bsontype.EmbeddedDocument: - switch v.primitive.(type) { - case Doc: - t, dst, _ = v.primitive.(Doc).MarshalBSONValue() // Doc.MarshalBSONValue never returns an error. - case MDoc: - t, dst, _ = v.primitive.(MDoc).MarshalBSONValue() // MDoc.MarshalBSONValue never returns an error. - } - case bsontype.Array: - t, dst, _ = v.Array().MarshalBSONValue() // Arr.MarshalBSON never returns an error. - case bsontype.Binary: - subtype, bindata := v.Binary() - dst = bsoncore.AppendBinary(dst, subtype, bindata) - case bsontype.Undefined: - case bsontype.ObjectID: - dst = bsoncore.AppendObjectID(dst, v.ObjectID()) - case bsontype.Boolean: - dst = bsoncore.AppendBoolean(dst, v.Boolean()) - case bsontype.DateTime: - dst = bsoncore.AppendDateTime(dst, v.DateTime()) - case bsontype.Null: - case bsontype.Regex: - pattern, options := v.Regex() - dst = bsoncore.AppendRegex(dst, pattern, options) - case bsontype.DBPointer: - ns, ptr := v.DBPointer() - dst = bsoncore.AppendDBPointer(dst, ns, ptr) - case bsontype.JavaScript: - dst = bsoncore.AppendJavaScript(dst, v.JavaScript()) - case bsontype.Symbol: - dst = bsoncore.AppendSymbol(dst, v.Symbol()) - case bsontype.CodeWithScope: - code, doc := v.CodeWithScope() - var scope []byte - scope, _ = doc.MarshalBSON() // Doc.MarshalBSON never returns an error. - dst = bsoncore.AppendCodeWithScope(dst, code, scope) - case bsontype.Int32: - dst = bsoncore.AppendInt32(dst, v.Int32()) - case bsontype.Timestamp: - t, i := v.Timestamp() - dst = bsoncore.AppendTimestamp(dst, t, i) - case bsontype.Int64: - dst = bsoncore.AppendInt64(dst, v.Int64()) - case bsontype.Decimal128: - dst = bsoncore.AppendDecimal128(dst, v.Decimal128()) - case bsontype.MinKey: - case bsontype.MaxKey: - default: - panic(fmt.Errorf("invalid BSON type %v", t)) - } - - return t, dst, nil -} - -// UnmarshalBSONValue implements the bsoncodec.ValueUnmarshaler interface. -func (v *Val) UnmarshalBSONValue(t bsontype.Type, data []byte) error { - if v == nil { - return errors.New("cannot unmarshal into nil Value") - } - var err error - var ok = true - var rem []byte - switch t { - case bsontype.Double: - var f64 float64 - f64, rem, ok = bsoncore.ReadDouble(data) - *v = Double(f64) - case bsontype.String: - var str string - str, rem, ok = bsoncore.ReadString(data) - *v = String(str) - case bsontype.EmbeddedDocument: - var raw []byte - var doc Doc - raw, rem, ok = bsoncore.ReadDocument(data) - doc, err = ReadDoc(raw) - *v = Document(doc) - case bsontype.Array: - var raw []byte - arr := make(Arr, 0) - raw, rem, ok = bsoncore.ReadArray(data) - err = arr.UnmarshalBSONValue(t, raw) - *v = Array(arr) - case bsontype.Binary: - var subtype byte - var bindata []byte - subtype, bindata, rem, ok = bsoncore.ReadBinary(data) - *v = Binary(subtype, bindata) - case bsontype.Undefined: - *v = Undefined() - case bsontype.ObjectID: - var oid primitive.ObjectID - oid, rem, ok = bsoncore.ReadObjectID(data) - *v = ObjectID(oid) - case bsontype.Boolean: - var b bool - b, rem, ok = bsoncore.ReadBoolean(data) - *v = Boolean(b) - case bsontype.DateTime: - var dt int64 - dt, rem, ok = bsoncore.ReadDateTime(data) - *v = DateTime(dt) - case bsontype.Null: - *v = Null() - case bsontype.Regex: - var pattern, options string - pattern, options, rem, ok = bsoncore.ReadRegex(data) - *v = Regex(pattern, options) - case bsontype.DBPointer: - var ns string - var ptr primitive.ObjectID - ns, ptr, rem, ok = bsoncore.ReadDBPointer(data) - *v = DBPointer(ns, ptr) - case bsontype.JavaScript: - var js string - js, rem, ok = bsoncore.ReadJavaScript(data) - *v = JavaScript(js) - case bsontype.Symbol: - var symbol string - symbol, rem, ok = bsoncore.ReadSymbol(data) - *v = Symbol(symbol) - case bsontype.CodeWithScope: - var raw []byte - var code string - var scope Doc - code, raw, rem, ok = bsoncore.ReadCodeWithScope(data) - scope, err = ReadDoc(raw) - *v = CodeWithScope(code, scope) - case bsontype.Int32: - var i32 int32 - i32, rem, ok = bsoncore.ReadInt32(data) - *v = Int32(i32) - case bsontype.Timestamp: - var i, t uint32 - t, i, rem, ok = bsoncore.ReadTimestamp(data) - *v = Timestamp(t, i) - case bsontype.Int64: - var i64 int64 - i64, rem, ok = bsoncore.ReadInt64(data) - *v = Int64(i64) - case bsontype.Decimal128: - var d128 primitive.Decimal128 - d128, rem, ok = bsoncore.ReadDecimal128(data) - *v = Decimal128(d128) - case bsontype.MinKey: - *v = MinKey() - case bsontype.MaxKey: - *v = MaxKey() - default: - err = fmt.Errorf("invalid BSON type %v", t) - } - - if !ok && err == nil { - err = bsoncore.NewInsufficientBytesError(data, rem) - } - - return err -} - -// Type returns the BSON type of this value. -func (v Val) Type() bsontype.Type { - if v.t == bsontype.Type(0) { - return bsontype.Null - } - return v.t -} - -// IsNumber returns true if the type of v is a numberic BSON type. -func (v Val) IsNumber() bool { - switch v.Type() { - case bsontype.Double, bsontype.Int32, bsontype.Int64, bsontype.Decimal128: - return true - default: - return false - } -} - -// Double returns the BSON double value the Value represents. It panics if the value is a BSON type -// other than double. -func (v Val) Double() float64 { - if v.t != bsontype.Double { - panic(ElementTypeError{"bson.Value.Double", v.t}) - } - return math.Float64frombits(binary.LittleEndian.Uint64(v.bootstrap[0:8])) -} - -// DoubleOK is the same as Double, but returns a boolean instead of panicking. -func (v Val) DoubleOK() (float64, bool) { - if v.t != bsontype.Double { - return 0, false - } - return math.Float64frombits(binary.LittleEndian.Uint64(v.bootstrap[0:8])), true -} - -// StringValue returns the BSON string the Value represents. It panics if the value is a BSON type -// other than string. -// -// NOTE: This method is called StringValue to avoid it implementing the -// fmt.Stringer interface. -func (v Val) StringValue() string { - if v.t != bsontype.String { - panic(ElementTypeError{"bson.Value.StringValue", v.t}) - } - return v.string() -} - -// StringValueOK is the same as StringValue, but returns a boolean instead of -// panicking. -func (v Val) StringValueOK() (string, bool) { - if v.t != bsontype.String { - return "", false - } - return v.string(), true -} - -func (v Val) asDoc() Doc { - doc, ok := v.primitive.(Doc) - if ok { - return doc - } - mdoc := v.primitive.(MDoc) - for k, v := range mdoc { - doc = append(doc, Elem{k, v}) - } - return doc -} - -func (v Val) asMDoc() MDoc { - mdoc, ok := v.primitive.(MDoc) - if ok { - return mdoc - } - mdoc = make(MDoc) - doc := v.primitive.(Doc) - for _, elem := range doc { - mdoc[elem.Key] = elem.Value - } - return mdoc -} - -// Document returns the BSON embedded document value the Value represents. It panics if the value -// is a BSON type other than embedded document. -func (v Val) Document() Doc { - if v.t != bsontype.EmbeddedDocument { - panic(ElementTypeError{"bson.Value.Document", v.t}) - } - return v.asDoc() -} - -// DocumentOK is the same as Document, except it returns a boolean -// instead of panicking. -func (v Val) DocumentOK() (Doc, bool) { - if v.t != bsontype.EmbeddedDocument { - return nil, false - } - return v.asDoc(), true -} - -// MDocument returns the BSON embedded document value the Value represents. It panics if the value -// is a BSON type other than embedded document. -func (v Val) MDocument() MDoc { - if v.t != bsontype.EmbeddedDocument { - panic(ElementTypeError{"bson.Value.MDocument", v.t}) - } - return v.asMDoc() -} - -// MDocumentOK is the same as Document, except it returns a boolean -// instead of panicking. -func (v Val) MDocumentOK() (MDoc, bool) { - if v.t != bsontype.EmbeddedDocument { - return nil, false - } - return v.asMDoc(), true -} - -// Array returns the BSON array value the Value represents. It panics if the value is a BSON type -// other than array. -func (v Val) Array() Arr { - if v.t != bsontype.Array { - panic(ElementTypeError{"bson.Value.Array", v.t}) - } - return v.primitive.(Arr) -} - -// ArrayOK is the same as Array, except it returns a boolean -// instead of panicking. -func (v Val) ArrayOK() (Arr, bool) { - if v.t != bsontype.Array { - return nil, false - } - return v.primitive.(Arr), true -} - -// Binary returns the BSON binary value the Value represents. It panics if the value is a BSON type -// other than binary. -func (v Val) Binary() (byte, []byte) { - if v.t != bsontype.Binary { - panic(ElementTypeError{"bson.Value.Binary", v.t}) - } - bin := v.primitive.(primitive.Binary) - return bin.Subtype, bin.Data -} - -// BinaryOK is the same as Binary, except it returns a boolean instead of -// panicking. -func (v Val) BinaryOK() (byte, []byte, bool) { - if v.t != bsontype.Binary { - return 0x00, nil, false - } - bin := v.primitive.(primitive.Binary) - return bin.Subtype, bin.Data, true -} - -// Undefined returns the BSON undefined the Value represents. It panics if the value is a BSON type -// other than binary. -func (v Val) Undefined() { - if v.t != bsontype.Undefined { - panic(ElementTypeError{"bson.Value.Undefined", v.t}) - } -} - -// UndefinedOK is the same as Undefined, except it returns a boolean instead of -// panicking. -func (v Val) UndefinedOK() bool { - return v.t == bsontype.Undefined -} - -// ObjectID returns the BSON ObjectID the Value represents. It panics if the value is a BSON type -// other than ObjectID. -func (v Val) ObjectID() primitive.ObjectID { - if v.t != bsontype.ObjectID { - panic(ElementTypeError{"bson.Value.ObjectID", v.t}) - } - var oid primitive.ObjectID - copy(oid[:], v.bootstrap[:12]) - return oid -} - -// ObjectIDOK is the same as ObjectID, except it returns a boolean instead of -// panicking. -func (v Val) ObjectIDOK() (primitive.ObjectID, bool) { - if v.t != bsontype.ObjectID { - return primitive.ObjectID{}, false - } - var oid primitive.ObjectID - copy(oid[:], v.bootstrap[:12]) - return oid, true -} - -// Boolean returns the BSON boolean the Value represents. It panics if the value is a BSON type -// other than boolean. -func (v Val) Boolean() bool { - if v.t != bsontype.Boolean { - panic(ElementTypeError{"bson.Value.Boolean", v.t}) - } - return v.bootstrap[0] == 0x01 -} - -// BooleanOK is the same as Boolean, except it returns a boolean instead of -// panicking. -func (v Val) BooleanOK() (bool, bool) { - if v.t != bsontype.Boolean { - return false, false - } - return v.bootstrap[0] == 0x01, true -} - -// DateTime returns the BSON datetime the Value represents. It panics if the value is a BSON type -// other than datetime. -func (v Val) DateTime() int64 { - if v.t != bsontype.DateTime { - panic(ElementTypeError{"bson.Value.DateTime", v.t}) - } - return v.i64() -} - -// DateTimeOK is the same as DateTime, except it returns a boolean instead of -// panicking. -func (v Val) DateTimeOK() (int64, bool) { - if v.t != bsontype.DateTime { - return 0, false - } - return v.i64(), true -} - -// Time returns the BSON datetime the Value represents as time.Time. It panics if the value is a BSON -// type other than datetime. -func (v Val) Time() time.Time { - if v.t != bsontype.DateTime { - panic(ElementTypeError{"bson.Value.Time", v.t}) - } - i := v.i64() - return time.Unix(i/1000, i%1000*1000000) -} - -// TimeOK is the same as Time, except it returns a boolean instead of -// panicking. -func (v Val) TimeOK() (time.Time, bool) { - if v.t != bsontype.DateTime { - return time.Time{}, false - } - i := v.i64() - return time.Unix(i/1000, i%1000*1000000), true -} - -// Null returns the BSON undefined the Value represents. It panics if the value is a BSON type -// other than binary. -func (v Val) Null() { - if v.t != bsontype.Null && v.t != bsontype.Type(0) { - panic(ElementTypeError{"bson.Value.Null", v.t}) - } -} - -// NullOK is the same as Null, except it returns a boolean instead of -// panicking. -func (v Val) NullOK() bool { - if v.t != bsontype.Null && v.t != bsontype.Type(0) { - return false - } - return true -} - -// Regex returns the BSON regex the Value represents. It panics if the value is a BSON type -// other than regex. -func (v Val) Regex() (pattern, options string) { - if v.t != bsontype.Regex { - panic(ElementTypeError{"bson.Value.Regex", v.t}) - } - regex := v.primitive.(primitive.Regex) - return regex.Pattern, regex.Options -} - -// RegexOK is the same as Regex, except that it returns a boolean -// instead of panicking. -func (v Val) RegexOK() (pattern, options string, ok bool) { - if v.t != bsontype.Regex { - return "", "", false - } - regex := v.primitive.(primitive.Regex) - return regex.Pattern, regex.Options, true -} - -// DBPointer returns the BSON dbpointer the Value represents. It panics if the value is a BSON type -// other than dbpointer. -func (v Val) DBPointer() (string, primitive.ObjectID) { - if v.t != bsontype.DBPointer { - panic(ElementTypeError{"bson.Value.DBPointer", v.t}) - } - dbptr := v.primitive.(primitive.DBPointer) - return dbptr.DB, dbptr.Pointer -} - -// DBPointerOK is the same as DBPoitner, except that it returns a boolean -// instead of panicking. -func (v Val) DBPointerOK() (string, primitive.ObjectID, bool) { - if v.t != bsontype.DBPointer { - return "", primitive.ObjectID{}, false - } - dbptr := v.primitive.(primitive.DBPointer) - return dbptr.DB, dbptr.Pointer, true -} - -// JavaScript returns the BSON JavaScript the Value represents. It panics if the value is a BSON type -// other than JavaScript. -func (v Val) JavaScript() string { - if v.t != bsontype.JavaScript { - panic(ElementTypeError{"bson.Value.JavaScript", v.t}) - } - return v.string() -} - -// JavaScriptOK is the same as Javascript, except that it returns a boolean -// instead of panicking. -func (v Val) JavaScriptOK() (string, bool) { - if v.t != bsontype.JavaScript { - return "", false - } - return v.string(), true -} - -// Symbol returns the BSON symbol the Value represents. It panics if the value is a BSON type -// other than symbol. -func (v Val) Symbol() string { - if v.t != bsontype.Symbol { - panic(ElementTypeError{"bson.Value.Symbol", v.t}) - } - return v.string() -} - -// SymbolOK is the same as Javascript, except that it returns a boolean -// instead of panicking. -func (v Val) SymbolOK() (string, bool) { - if v.t != bsontype.Symbol { - return "", false - } - return v.string(), true -} - -// CodeWithScope returns the BSON code with scope value the Value represents. It panics if the -// value is a BSON type other than code with scope. -func (v Val) CodeWithScope() (string, Doc) { - if v.t != bsontype.CodeWithScope { - panic(ElementTypeError{"bson.Value.CodeWithScope", v.t}) - } - cws := v.primitive.(primitive.CodeWithScope) - return string(cws.Code), cws.Scope.(Doc) -} - -// CodeWithScopeOK is the same as JavascriptWithScope, -// except that it returns a boolean instead of panicking. -func (v Val) CodeWithScopeOK() (string, Doc, bool) { - if v.t != bsontype.CodeWithScope { - return "", nil, false - } - cws := v.primitive.(primitive.CodeWithScope) - return string(cws.Code), cws.Scope.(Doc), true -} - -// Int32 returns the BSON int32 the Value represents. It panics if the value is a BSON type -// other than int32. -func (v Val) Int32() int32 { - if v.t != bsontype.Int32 { - panic(ElementTypeError{"bson.Value.Int32", v.t}) - } - return int32(v.bootstrap[0]) | int32(v.bootstrap[1])<<8 | - int32(v.bootstrap[2])<<16 | int32(v.bootstrap[3])<<24 -} - -// Int32OK is the same as Int32, except that it returns a boolean instead of -// panicking. -func (v Val) Int32OK() (int32, bool) { - if v.t != bsontype.Int32 { - return 0, false - } - return int32(v.bootstrap[0]) | int32(v.bootstrap[1])<<8 | - int32(v.bootstrap[2])<<16 | int32(v.bootstrap[3])<<24, - true -} - -// Timestamp returns the BSON timestamp the Value represents. It panics if the value is a -// BSON type other than timestamp. -func (v Val) Timestamp() (t, i uint32) { - if v.t != bsontype.Timestamp { - panic(ElementTypeError{"bson.Value.Timestamp", v.t}) - } - return uint32(v.bootstrap[4]) | uint32(v.bootstrap[5])<<8 | - uint32(v.bootstrap[6])<<16 | uint32(v.bootstrap[7])<<24, - uint32(v.bootstrap[0]) | uint32(v.bootstrap[1])<<8 | - uint32(v.bootstrap[2])<<16 | uint32(v.bootstrap[3])<<24 -} - -// TimestampOK is the same as Timestamp, except that it returns a boolean -// instead of panicking. -func (v Val) TimestampOK() (t uint32, i uint32, ok bool) { - if v.t != bsontype.Timestamp { - return 0, 0, false - } - return uint32(v.bootstrap[4]) | uint32(v.bootstrap[5])<<8 | - uint32(v.bootstrap[6])<<16 | uint32(v.bootstrap[7])<<24, - uint32(v.bootstrap[0]) | uint32(v.bootstrap[1])<<8 | - uint32(v.bootstrap[2])<<16 | uint32(v.bootstrap[3])<<24, - true -} - -// Int64 returns the BSON int64 the Value represents. It panics if the value is a BSON type -// other than int64. -func (v Val) Int64() int64 { - if v.t != bsontype.Int64 { - panic(ElementTypeError{"bson.Value.Int64", v.t}) - } - return v.i64() -} - -// Int64OK is the same as Int64, except that it returns a boolean instead of -// panicking. -func (v Val) Int64OK() (int64, bool) { - if v.t != bsontype.Int64 { - return 0, false - } - return v.i64(), true -} - -// Decimal128 returns the BSON decimal128 value the Value represents. It panics if the value is a -// BSON type other than decimal128. -func (v Val) Decimal128() primitive.Decimal128 { - if v.t != bsontype.Decimal128 { - panic(ElementTypeError{"bson.Value.Decimal128", v.t}) - } - return v.primitive.(primitive.Decimal128) -} - -// Decimal128OK is the same as Decimal128, except that it returns a boolean -// instead of panicking. -func (v Val) Decimal128OK() (primitive.Decimal128, bool) { - if v.t != bsontype.Decimal128 { - return primitive.Decimal128{}, false - } - return v.primitive.(primitive.Decimal128), true -} - -// MinKey returns the BSON minkey the Value represents. It panics if the value is a BSON type -// other than binary. -func (v Val) MinKey() { - if v.t != bsontype.MinKey { - panic(ElementTypeError{"bson.Value.MinKey", v.t}) - } -} - -// MinKeyOK is the same as MinKey, except it returns a boolean instead of -// panicking. -func (v Val) MinKeyOK() bool { - return v.t == bsontype.MinKey -} - -// MaxKey returns the BSON maxkey the Value represents. It panics if the value is a BSON type -// other than binary. -func (v Val) MaxKey() { - if v.t != bsontype.MaxKey { - panic(ElementTypeError{"bson.Value.MaxKey", v.t}) - } -} - -// MaxKeyOK is the same as MaxKey, except it returns a boolean instead of -// panicking. -func (v Val) MaxKeyOK() bool { - return v.t == bsontype.MaxKey -} - -// Equal compares v to v2 and returns true if they are equal. Unknown BSON types are -// never equal. Two empty values are equal. -func (v Val) Equal(v2 Val) bool { - if v.Type() != v2.Type() { - return false - } - if v.IsZero() && v2.IsZero() { - return true - } - - switch v.Type() { - case bsontype.Double, bsontype.DateTime, bsontype.Timestamp, bsontype.Int64: - return bytes.Equal(v.bootstrap[0:8], v2.bootstrap[0:8]) - case bsontype.String: - return v.string() == v2.string() - case bsontype.EmbeddedDocument: - return v.equalDocs(v2) - case bsontype.Array: - return v.Array().Equal(v2.Array()) - case bsontype.Binary: - return v.primitive.(primitive.Binary).Equal(v2.primitive.(primitive.Binary)) - case bsontype.Undefined: - return true - case bsontype.ObjectID: - return bytes.Equal(v.bootstrap[0:12], v2.bootstrap[0:12]) - case bsontype.Boolean: - return v.bootstrap[0] == v2.bootstrap[0] - case bsontype.Null: - return true - case bsontype.Regex: - return v.primitive.(primitive.Regex).Equal(v2.primitive.(primitive.Regex)) - case bsontype.DBPointer: - return v.primitive.(primitive.DBPointer).Equal(v2.primitive.(primitive.DBPointer)) - case bsontype.JavaScript: - return v.JavaScript() == v2.JavaScript() - case bsontype.Symbol: - return v.Symbol() == v2.Symbol() - case bsontype.CodeWithScope: - code1, scope1 := v.primitive.(primitive.CodeWithScope).Code, v.primitive.(primitive.CodeWithScope).Scope - code2, scope2 := v2.primitive.(primitive.CodeWithScope).Code, v2.primitive.(primitive.CodeWithScope).Scope - return code1 == code2 && v.equalInterfaceDocs(scope1, scope2) - case bsontype.Int32: - return v.Int32() == v2.Int32() - case bsontype.Decimal128: - h, l := v.Decimal128().GetBytes() - h2, l2 := v2.Decimal128().GetBytes() - return h == h2 && l == l2 - case bsontype.MinKey: - return true - case bsontype.MaxKey: - return true - default: - return false - } -} - -func (v Val) equalDocs(v2 Val) bool { - _, ok1 := v.primitive.(MDoc) - _, ok2 := v2.primitive.(MDoc) - if ok1 || ok2 { - return v.asMDoc().Equal(v2.asMDoc()) - } - return v.asDoc().Equal(v2.asDoc()) -} - -func (Val) equalInterfaceDocs(i, i2 interface{}) bool { - switch d := i.(type) { - case MDoc: - d2, ok := i2.(IDoc) - if !ok { - return false - } - return d.Equal(d2) - case Doc: - d2, ok := i2.(IDoc) - if !ok { - return false - } - return d.Equal(d2) - case nil: - return i2 == nil - default: - return false - } -} diff --git a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/auth/aws_conv.go b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/auth/aws_conv.go index 8509abfbde..616182d9cf 100644 --- a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/auth/aws_conv.go +++ b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/auth/aws_conv.go @@ -11,19 +11,17 @@ import ( "context" "crypto/rand" "encoding/base64" - "encoding/json" "errors" "fmt" - "io/ioutil" "net/http" - "os" "strings" "time" "go.mongodb.org/mongo-driver/bson" "go.mongodb.org/mongo-driver/bson/primitive" + "go.mongodb.org/mongo-driver/internal/aws/credentials" + v4signer "go.mongodb.org/mongo-driver/internal/aws/signer/v4" "go.mongodb.org/mongo-driver/x/bsonx/bsoncore" - "go.mongodb.org/mongo-driver/x/mongo/driver/auth/internal/awsv4" ) type clientState int @@ -36,13 +34,10 @@ const ( ) type awsConversation struct { - state clientState - valid bool - nonce []byte - username string - password string - token string - httpClient *http.Client + state clientState + valid bool + nonce []byte + credentials *credentials.Credentials } type serverMessage struct { @@ -50,21 +45,10 @@ type serverMessage struct { Host string `bson:"h"` } -type ecsResponse struct { - AccessKeyID string `json:"AccessKeyId"` - SecretAccessKey string `json:"SecretAccessKey"` - Token string `json:"Token"` -} - const ( amzDateFormat = "20060102T150405Z" - awsRelativeURI = "http://169.254.170.2/" - awsEC2URI = "http://169.254.169.254/" - awsEC2RolePath = "latest/meta-data/iam/security-credentials/" - awsEC2TokenPath = "latest/api/token" defaultRegion = "us-east-1" maxHostLength = 255 - defaultHTTPTimeout = 10 * time.Second responceNonceLength = 64 ) @@ -128,149 +112,6 @@ func getRegion(host string) (string, error) { return region, nil } -func (ac *awsConversation) validateAndMakeCredentials() (*awsv4.StaticProvider, error) { - if ac.username != "" && ac.password == "" { - return nil, errors.New("ACCESS_KEY_ID is set, but SECRET_ACCESS_KEY is missing") - } - if ac.username == "" && ac.password != "" { - return nil, errors.New("SECRET_ACCESS_KEY is set, but ACCESS_KEY_ID is missing") - } - if ac.username == "" && ac.password == "" && ac.token != "" { - return nil, errors.New("AWS_SESSION_TOKEN is set, but ACCESS_KEY_ID and SECRET_ACCESS_KEY are missing") - } - if ac.username != "" || ac.password != "" || ac.token != "" { - return &awsv4.StaticProvider{Value: awsv4.Value{ - AccessKeyID: ac.username, - SecretAccessKey: ac.password, - SessionToken: ac.token, - }}, nil - } - return nil, nil -} - -func executeAWSHTTPRequest(httpClient *http.Client, req *http.Request) ([]byte, error) { - ctx, cancel := context.WithTimeout(context.Background(), defaultHTTPTimeout) - defer cancel() - resp, err := httpClient.Do(req.WithContext(ctx)) - if err != nil { - return nil, err - } - defer resp.Body.Close() - - return ioutil.ReadAll(resp.Body) -} - -func (ac *awsConversation) getEC2Credentials() (*awsv4.StaticProvider, error) { - // get token - req, err := http.NewRequest("PUT", awsEC2URI+awsEC2TokenPath, nil) - if err != nil { - return nil, err - } - req.Header.Set("X-aws-ec2-metadata-token-ttl-seconds", "30") - - token, err := executeAWSHTTPRequest(ac.httpClient, req) - if err != nil { - return nil, err - } - if len(token) == 0 { - return nil, errors.New("unable to retrieve token from EC2 metadata") - } - tokenStr := string(token) - - // get role name - req, err = http.NewRequest("GET", awsEC2URI+awsEC2RolePath, nil) - if err != nil { - return nil, err - } - req.Header.Set("X-aws-ec2-metadata-token", tokenStr) - - role, err := executeAWSHTTPRequest(ac.httpClient, req) - if err != nil { - return nil, err - } - if len(role) == 0 { - return nil, errors.New("unable to retrieve role_name from EC2 metadata") - } - - // get credentials - pathWithRole := awsEC2URI + awsEC2RolePath + string(role) - req, err = http.NewRequest("GET", pathWithRole, nil) - if err != nil { - return nil, err - } - req.Header.Set("X-aws-ec2-metadata-token", tokenStr) - creds, err := executeAWSHTTPRequest(ac.httpClient, req) - if err != nil { - return nil, err - } - - var es2Resp ecsResponse - err = json.Unmarshal(creds, &es2Resp) - if err != nil { - return nil, err - } - ac.username = es2Resp.AccessKeyID - ac.password = es2Resp.SecretAccessKey - ac.token = es2Resp.Token - - return ac.validateAndMakeCredentials() -} - -func (ac *awsConversation) getCredentials() (*awsv4.StaticProvider, error) { - // Credentials passed through URI - creds, err := ac.validateAndMakeCredentials() - if creds != nil || err != nil { - return creds, err - } - - // Credentials from environment variables - ac.username = os.Getenv("AWS_ACCESS_KEY_ID") - ac.password = os.Getenv("AWS_SECRET_ACCESS_KEY") - ac.token = os.Getenv("AWS_SESSION_TOKEN") - - creds, err = ac.validateAndMakeCredentials() - if creds != nil || err != nil { - return creds, err - } - - // Credentials from ECS metadata - relativeEcsURI := os.Getenv("AWS_CONTAINER_CREDENTIALS_RELATIVE_URI") - if len(relativeEcsURI) > 0 { - fullURI := awsRelativeURI + relativeEcsURI - - req, err := http.NewRequest("GET", fullURI, nil) - if err != nil { - return nil, err - } - - body, err := executeAWSHTTPRequest(ac.httpClient, req) - if err != nil { - return nil, err - } - - var espResp ecsResponse - err = json.Unmarshal(body, &espResp) - if err != nil { - return nil, err - } - ac.username = espResp.AccessKeyID - ac.password = espResp.SecretAccessKey - ac.token = espResp.Token - - creds, err = ac.validateAndMakeCredentials() - if creds != nil || err != nil { - return creds, err - } - } - - // Credentials from EC2 metadata - creds, err = ac.getEC2Credentials() - if creds == nil && err == nil { - return nil, errors.New("unable to get credentials") - } - return creds, err -} - func (ac *awsConversation) firstMsg() []byte { // Values are cached for use in final message parameters ac.nonce = make([]byte, 32) @@ -306,7 +147,7 @@ func (ac *awsConversation) finalMsg(s1 []byte) ([]byte, error) { return nil, err } - creds, err := ac.getCredentials() + creds, err := ac.credentials.GetWithContext(context.Background()) if err != nil { return nil, err } @@ -320,14 +161,14 @@ func (ac *awsConversation) finalMsg(s1 []byte) ([]byte, error) { req.Header.Set("Content-Length", "43") req.Host = sm.Host req.Header.Set("X-Amz-Date", currentTime.Format(amzDateFormat)) - if len(ac.token) > 0 { - req.Header.Set("X-Amz-Security-Token", ac.token) + if len(creds.SessionToken) > 0 { + req.Header.Set("X-Amz-Security-Token", creds.SessionToken) } req.Header.Set("X-MongoDB-Server-Nonce", base64.StdEncoding.EncodeToString(sm.Nonce.Data)) req.Header.Set("X-MongoDB-GS2-CB-Flag", "n") // Create signer with credentials - signer := awsv4.NewSigner(creds) + signer := v4signer.NewSigner(ac.credentials) // Get signed header _, err = signer.Sign(req, strings.NewReader(body), "sts", region, currentTime) @@ -339,8 +180,8 @@ func (ac *awsConversation) finalMsg(s1 []byte) ([]byte, error) { idx, msg := bsoncore.AppendDocumentStart(nil) msg = bsoncore.AppendStringElement(msg, "a", req.Header.Get("Authorization")) msg = bsoncore.AppendStringElement(msg, "d", req.Header.Get("X-Amz-Date")) - if len(ac.token) > 0 { - msg = bsoncore.AppendStringElement(msg, "t", ac.token) + if len(creds.SessionToken) > 0 { + msg = bsoncore.AppendStringElement(msg, "t", creds.SessionToken) } msg, _ = bsoncore.AppendDocumentEnd(msg, idx) diff --git a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/auth/creds/awscreds.go b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/auth/creds/awscreds.go new file mode 100644 index 0000000000..06bba45343 --- /dev/null +++ b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/auth/creds/awscreds.go @@ -0,0 +1,58 @@ +// Copyright (C) MongoDB, Inc. 2022-present. +// +// Licensed under the Apache License, Version 2.0 (the "License"); you may +// not use this file except in compliance with the License. You may obtain +// a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 + +package creds + +import ( + "context" + "net/http" + "time" + + "go.mongodb.org/mongo-driver/internal/aws/credentials" + "go.mongodb.org/mongo-driver/internal/credproviders" + "go.mongodb.org/mongo-driver/x/bsonx/bsoncore" +) + +const ( + // expiryWindow will allow the credentials to trigger refreshing prior to the credentials actually expiring. + // This is beneficial so expiring credentials do not cause request to fail unexpectedly due to exceptions. + // + // Set an early expiration of 5 minutes before the credentials are actually expired. + expiryWindow = 5 * time.Minute +) + +// AWSCredentialProvider wraps AWS credentials. +type AWSCredentialProvider struct { + Cred *credentials.Credentials +} + +// NewAWSCredentialProvider generates new AWSCredentialProvider +func NewAWSCredentialProvider(httpClient *http.Client, providers ...credentials.Provider) AWSCredentialProvider { + providers = append( + providers, + credproviders.NewEnvProvider(), + credproviders.NewAssumeRoleProvider(httpClient, expiryWindow), + credproviders.NewECSProvider(httpClient, expiryWindow), + credproviders.NewEC2Provider(httpClient, expiryWindow), + ) + + return AWSCredentialProvider{credentials.NewChainCredentials(providers)} +} + +// GetCredentialsDoc generates AWS credentials. +func (p AWSCredentialProvider) GetCredentialsDoc(ctx context.Context) (bsoncore.Document, error) { + creds, err := p.Cred.GetWithContext(ctx) + if err != nil { + return nil, err + } + builder := bsoncore.NewDocumentBuilder(). + AppendString("accessKeyId", creds.AccessKeyID). + AppendString("secretAccessKey", creds.SecretAccessKey) + if token := creds.SessionToken; len(token) > 0 { + builder.AppendString("sessionToken", token) + } + return builder.Build(), nil +} diff --git a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/auth/creds/azurecreds.go b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/auth/creds/azurecreds.go new file mode 100644 index 0000000000..d8f105a9d9 --- /dev/null +++ b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/auth/creds/azurecreds.go @@ -0,0 +1,40 @@ +// Copyright (C) MongoDB, Inc. 2023-present. +// +// Licensed under the Apache License, Version 2.0 (the "License"); you may +// not use this file except in compliance with the License. You may obtain +// a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 + +package creds + +import ( + "context" + "net/http" + "time" + + "go.mongodb.org/mongo-driver/internal/aws/credentials" + "go.mongodb.org/mongo-driver/internal/credproviders" + "go.mongodb.org/mongo-driver/x/bsonx/bsoncore" +) + +// AzureCredentialProvider provides Azure credentials. +type AzureCredentialProvider struct { + cred *credentials.Credentials +} + +// NewAzureCredentialProvider generates new AzureCredentialProvider +func NewAzureCredentialProvider(httpClient *http.Client) AzureCredentialProvider { + return AzureCredentialProvider{ + credentials.NewCredentials(credproviders.NewAzureProvider(httpClient, 1*time.Minute)), + } +} + +// GetCredentialsDoc generates Azure credentials. +func (p AzureCredentialProvider) GetCredentialsDoc(ctx context.Context) (bsoncore.Document, error) { + creds, err := p.cred.GetWithContext(ctx) + if err != nil { + return nil, err + } + builder := bsoncore.NewDocumentBuilder(). + AppendString("accessToken", creds.SessionToken) + return builder.Build(), nil +} diff --git a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/auth/creds/gcpcreds.go b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/auth/creds/gcpcreds.go new file mode 100644 index 0000000000..f5b06ff970 --- /dev/null +++ b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/auth/creds/gcpcreds.go @@ -0,0 +1,69 @@ +// Copyright (C) MongoDB, Inc. 2022-present. +// +// Licensed under the Apache License, Version 2.0 (the "License"); you may +// not use this file except in compliance with the License. You may obtain +// a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 + +package creds + +import ( + "context" + "encoding/json" + "fmt" + "io/ioutil" + "net/http" + "os" + + "go.mongodb.org/mongo-driver/internal" + "go.mongodb.org/mongo-driver/x/bsonx/bsoncore" +) + +// GCPCredentialProvider provides GCP credentials. +type GCPCredentialProvider struct { + httpClient *http.Client +} + +// NewGCPCredentialProvider generates new GCPCredentialProvider +func NewGCPCredentialProvider(httpClient *http.Client) GCPCredentialProvider { + return GCPCredentialProvider{httpClient} +} + +// GetCredentialsDoc generates GCP credentials. +func (p GCPCredentialProvider) GetCredentialsDoc(ctx context.Context) (bsoncore.Document, error) { + metadataHost := "metadata.google.internal" + if envhost := os.Getenv("GCE_METADATA_HOST"); envhost != "" { + metadataHost = envhost + } + url := fmt.Sprintf("http://%s/computeMetadata/v1/instance/service-accounts/default/token", metadataHost) + req, err := http.NewRequest(http.MethodGet, url, nil) + if err != nil { + return nil, internal.WrapErrorf(err, "unable to retrieve GCP credentials") + } + req.Header.Set("Metadata-Flavor", "Google") + resp, err := p.httpClient.Do(req.WithContext(ctx)) + if err != nil { + return nil, internal.WrapErrorf(err, "unable to retrieve GCP credentials") + } + defer resp.Body.Close() + body, err := ioutil.ReadAll(resp.Body) + if err != nil { + return nil, internal.WrapErrorf(err, "unable to retrieve GCP credentials: error reading response body") + } + if resp.StatusCode != http.StatusOK { + return nil, internal.WrapErrorf(err, "unable to retrieve GCP credentials: expected StatusCode 200, got StatusCode: %v. Response body: %s", resp.StatusCode, body) + } + var tokenResponse struct { + AccessToken string `json:"access_token"` + } + // Attempt to read body as JSON + err = json.Unmarshal(body, &tokenResponse) + if err != nil { + return nil, internal.WrapErrorf(err, "unable to retrieve GCP credentials: error reading body JSON. Response body: %s", body) + } + if tokenResponse.AccessToken == "" { + return nil, fmt.Errorf("unable to retrieve GCP credentials: got unexpected empty accessToken from GCP Metadata Server. Response body: %s", body) + } + + builder := bsoncore.NewDocumentBuilder().AppendString("accessToken", tokenResponse.AccessToken) + return builder.Build(), nil +} diff --git a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/auth/gssapi_not_enabled.go b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/auth/gssapi_not_enabled.go index 50522cbb6c..7ba5fe860c 100644 --- a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/auth/gssapi_not_enabled.go +++ b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/auth/gssapi_not_enabled.go @@ -12,6 +12,6 @@ package auth // GSSAPI is the mechanism name for GSSAPI. const GSSAPI = "GSSAPI" -func newGSSAPIAuthenticator(cred *Cred) (Authenticator, error) { +func newGSSAPIAuthenticator(*Cred) (Authenticator, error) { return nil, newAuthError("GSSAPI support not enabled during build (-tags gssapi)", nil) } diff --git a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/auth/internal/awsv4/credentials.go b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/auth/internal/awsv4/credentials.go deleted file mode 100644 index 95225a4715..0000000000 --- a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/auth/internal/awsv4/credentials.go +++ /dev/null @@ -1,63 +0,0 @@ -// Copyright (C) MongoDB, Inc. 2017-present. -// -// Licensed under the Apache License, Version 2.0 (the "License"); you may -// not use this file except in compliance with the License. You may obtain -// a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 -// -// Based on github.com/aws/aws-sdk-go by Amazon.com, Inc. with code from: -// - github.com/aws/aws-sdk-go/blob/v1.34.28/aws/credentials/static_provider.go -// - github.com/aws/aws-sdk-go/blob/v1.34.28/aws/credentials/credentials.go -// See THIRD-PARTY-NOTICES for original license terms - -package awsv4 - -import ( - "errors" -) - -// StaticProviderName provides a name of Static provider -const StaticProviderName = "StaticProvider" - -var ( - // ErrStaticCredentialsEmpty is emitted when static credentials are empty. - ErrStaticCredentialsEmpty = errors.New("EmptyStaticCreds: static credentials are empty") -) - -// A Value is the AWS credentials value for individual credential fields. -type Value struct { - // AWS Access key ID - AccessKeyID string - - // AWS Secret Access Key - SecretAccessKey string - - // AWS Session Token - SessionToken string - - // Provider used to get credentials - ProviderName string -} - -// HasKeys returns if the credentials Value has both AccessKeyID and -// SecretAccessKey value set. -func (v Value) HasKeys() bool { - return len(v.AccessKeyID) != 0 && len(v.SecretAccessKey) != 0 -} - -// A StaticProvider is a set of credentials which are set programmatically, -// and will never expire. -type StaticProvider struct { - Value -} - -// Retrieve returns the credentials or error if the credentials are invalid. -func (s *StaticProvider) Retrieve() (Value, error) { - if s.AccessKeyID == "" || s.SecretAccessKey == "" { - return Value{ProviderName: StaticProviderName}, ErrStaticCredentialsEmpty - } - - if len(s.Value.ProviderName) == 0 { - s.Value.ProviderName = StaticProviderName - } - return s.Value, nil -} diff --git a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/auth/internal/awsv4/doc.go b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/auth/internal/awsv4/doc.go deleted file mode 100644 index 6a29293d8a..0000000000 --- a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/auth/internal/awsv4/doc.go +++ /dev/null @@ -1,15 +0,0 @@ -// Copyright (C) MongoDB, Inc. 2017-present. -// -// Licensed under the Apache License, Version 2.0 (the "License"); you may -// not use this file except in compliance with the License. You may obtain -// a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 -// -// Based on github.com/aws/aws-sdk-go v1.34.28 by Amazon.com, Inc. -// See THIRD-PARTY-NOTICES for original license terms - -// Package awsv4 implements signing for AWS V4 signer with static credentials, -// and is based on and modified from code in the package aws-sdk-go. The -// modifications remove non-static credentials, support for non-sts services, -// and the options for v4.Signer. They also reduce the number of non-Go -// library dependencies. -package awsv4 diff --git a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/auth/internal/awsv4/rules.go b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/auth/internal/awsv4/rules.go deleted file mode 100644 index ad820d8e94..0000000000 --- a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/auth/internal/awsv4/rules.go +++ /dev/null @@ -1,98 +0,0 @@ -// Copyright (C) MongoDB, Inc. 2017-present. -// -// Licensed under the Apache License, Version 2.0 (the "License"); you may -// not use this file except in compliance with the License. You may obtain -// a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 -// -// Based on github.com/aws/aws-sdk-go by Amazon.com, Inc. with code from: -// - github.com/aws/aws-sdk-go/blob/v1.34.28/aws/signer/v4/header_rules.go -// - github.com/aws/aws-sdk-go/blob/v1.34.28/internal/strings/strings.go -// See THIRD-PARTY-NOTICES for original license terms - -package awsv4 - -import ( - "strings" -) - -// validator houses a set of rule needed for validation of a -// string value -type rules []rule - -// rule interface allows for more flexible rules and just simply -// checks whether or not a value adheres to that rule -type rule interface { - IsValid(value string) bool -} - -// IsValid will iterate through all rules and see if any rules -// apply to the value and supports nested rules -func (r rules) IsValid(value string) bool { - for _, rule := range r { - if rule.IsValid(value) { - return true - } - } - return false -} - -// mapRule generic rule for maps -type mapRule map[string]struct{} - -// IsValid for the map rule satisfies whether it exists in the map -func (m mapRule) IsValid(value string) bool { - _, ok := m[value] - return ok -} - -// allowlist is a generic rule for allowlisting -type allowlist struct { - rule -} - -// IsValid for allowlist checks if the value is within the allowlist -func (a allowlist) IsValid(value string) bool { - return a.rule.IsValid(value) -} - -// denylist is a generic rule for denylisting -type denylist struct { - rule -} - -// IsValid for allowlist checks if the value is within the allowlist -func (d denylist) IsValid(value string) bool { - return !d.rule.IsValid(value) -} - -type patterns []string - -// hasPrefixFold tests whether the string s begins with prefix, interpreted as UTF-8 strings, -// under Unicode case-folding. -func hasPrefixFold(s, prefix string) bool { - return len(s) >= len(prefix) && strings.EqualFold(s[0:len(prefix)], prefix) -} - -// IsValid for patterns checks each pattern and returns if a match has -// been found -func (p patterns) IsValid(value string) bool { - for _, pattern := range p { - if hasPrefixFold(value, pattern) { - return true - } - } - return false -} - -// inclusiveRules rules allow for rules to depend on one another -type inclusiveRules []rule - -// IsValid will return true if all rules are true -func (r inclusiveRules) IsValid(value string) bool { - for _, rule := range r { - if !rule.IsValid(value) { - return false - } - } - return true -} diff --git a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/auth/mongodbaws.go b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/auth/mongodbaws.go index 8982f04da6..7ae4b08998 100644 --- a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/auth/mongodbaws.go +++ b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/auth/mongodbaws.go @@ -9,6 +9,10 @@ package auth import ( "context" "errors" + + "go.mongodb.org/mongo-driver/internal/aws/credentials" + "go.mongodb.org/mongo-driver/internal/credproviders" + "go.mongodb.org/mongo-driver/x/mongo/driver/auth/creds" ) // MongoDBAWS is the mechanism name for MongoDBAWS. @@ -19,19 +23,22 @@ func newMongoDBAWSAuthenticator(cred *Cred) (Authenticator, error) { return nil, newAuthError("MONGODB-AWS source must be empty or $external", nil) } return &MongoDBAWSAuthenticator{ - source: cred.Source, - username: cred.Username, - password: cred.Password, - sessionToken: cred.Props["AWS_SESSION_TOKEN"], + source: cred.Source, + credentials: &credproviders.StaticProvider{ + Value: credentials.Value{ + ProviderName: cred.Source, + AccessKeyID: cred.Username, + SecretAccessKey: cred.Password, + SessionToken: cred.Props["AWS_SESSION_TOKEN"], + }, + }, }, nil } // MongoDBAWSAuthenticator uses AWS-IAM credentials over SASL to authenticate a connection. type MongoDBAWSAuthenticator struct { - source string - username string - password string - sessionToken string + source string + credentials *credproviders.StaticProvider } // Auth authenticates the connection. @@ -40,12 +47,10 @@ func (a *MongoDBAWSAuthenticator) Auth(ctx context.Context, cfg *Config) error { if httpClient == nil { return errors.New("cfg.HTTPClient must not be nil") } + providers := creds.NewAWSCredentialProvider(httpClient, a.credentials) adapter := &awsSaslAdapter{ conversation: &awsConversation{ - username: a.username, - password: a.password, - token: a.sessionToken, - httpClient: httpClient, + credentials: providers.Cred, }, } err := ConductSaslConversation(ctx, cfg, a.source, adapter) diff --git a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/auth/plain.go b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/auth/plain.go index f881003508..532d43e39f 100644 --- a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/auth/plain.go +++ b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/auth/plain.go @@ -46,7 +46,7 @@ func (c *plainSaslClient) Start() (string, []byte, error) { return PLAIN, b, nil } -func (c *plainSaslClient) Next(challenge []byte) ([]byte, error) { +func (c *plainSaslClient) Next([]byte) ([]byte, error) { return nil, newAuthError("unexpected server challenge", nil) } diff --git a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/crypt.go b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/crypt.go index cd918fc46c..4c254c03cf 100644 --- a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/crypt.go +++ b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/crypt.go @@ -9,17 +9,12 @@ package driver import ( "context" "crypto/tls" - "encoding/json" "fmt" "io" - "io/ioutil" - "net/http" - "os" "strings" "time" "go.mongodb.org/mongo-driver/bson/bsontype" - "go.mongodb.org/mongo-driver/internal" "go.mongodb.org/mongo-driver/x/bsonx/bsoncore" "go.mongodb.org/mongo-driver/x/mongo/driver/mongocrypt" "go.mongodb.org/mongo-driver/x/mongo/driver/mongocrypt/options" @@ -46,7 +41,6 @@ type CryptOptions struct { KeyFn KeyRetrieverFn MarkFn MarkCommandFn TLSConfig map[string]*tls.Config - HTTPClient *http.Client BypassAutoEncryption bool BypassQueryAnalysis bool } @@ -65,6 +59,8 @@ type Crypt interface { CreateDataKey(ctx context.Context, kmsProvider string, opts *options.DataKeyOptions) (bsoncore.Document, error) // EncryptExplicit encrypts the given value with the given options. EncryptExplicit(ctx context.Context, val bsoncore.Value, opts *options.ExplicitEncryptionOptions) (byte, []byte, error) + // EncryptExplicitExpression encrypts the given expression with the given options. + EncryptExplicitExpression(ctx context.Context, val bsoncore.Document, opts *options.ExplicitEncryptionOptions) (bsoncore.Document, error) // DecryptExplicit decrypts the given encrypted value. DecryptExplicit(ctx context.Context, subtype byte, data []byte) (bsoncore.Value, error) // Close cleans up any resources associated with the Crypt instance. @@ -84,7 +80,6 @@ type crypt struct { keyFn KeyRetrieverFn markFn MarkCommandFn tlsConfig map[string]*tls.Config - httpClient *http.Client bypassAutoEncryption bool } @@ -97,12 +92,8 @@ func NewCrypt(opts *CryptOptions) Crypt { keyFn: opts.KeyFn, markFn: opts.MarkFn, tlsConfig: opts.TLSConfig, - httpClient: opts.HTTPClient, bypassAutoEncryption: opts.BypassAutoEncryption, } - if c.httpClient == nil { - c.httpClient = internal.DefaultHTTPClient - } return c } @@ -215,6 +206,27 @@ func (c *crypt) EncryptExplicit(ctx context.Context, val bsoncore.Value, opts *o return sub, data, nil } +// EncryptExplicitExpression encrypts the given expression with the given options. +func (c *crypt) EncryptExplicitExpression(ctx context.Context, expr bsoncore.Document, opts *options.ExplicitEncryptionOptions) (bsoncore.Document, error) { + idx, doc := bsoncore.AppendDocumentStart(nil) + doc = bsoncore.AppendDocumentElement(doc, "v", expr) + doc, _ = bsoncore.AppendDocumentEnd(doc, idx) + + cryptCtx, err := c.mongoCrypt.CreateExplicitEncryptionExpressionContext(doc, opts) + if err != nil { + return nil, err + } + defer cryptCtx.Close() + + res, err := c.executeStateMachine(ctx, cryptCtx, "") + if err != nil { + return nil, err + } + + encryptedExpr := res.Lookup("v").Document() + return encryptedExpr, nil +} + // DecryptExplicit decrypts the given encrypted value. func (c *crypt) DecryptExplicit(ctx context.Context, subtype byte, data []byte) (bsoncore.Value, error) { idx, doc := bsoncore.AppendDocumentStart(nil) @@ -238,9 +250,6 @@ func (c *crypt) DecryptExplicit(ctx context.Context, subtype byte, data []byte) // Close cleans up any resources associated with the Crypt instance. func (c *crypt) Close() { c.mongoCrypt.Close() - if c.httpClient == internal.DefaultHTTPClient { - internal.CloseIdleHTTPConnections(c.httpClient) - } } func (c *crypt) BypassAutoEncryption() bool { @@ -400,74 +409,10 @@ func (c *crypt) decryptKey(kmsCtx *mongocrypt.KmsContext) error { } } -// needsKmsProvider returns true if provider was initially set to an empty document. -// An empty document signals the driver to fetch credentials. -func needsKmsProvider(kmsProviders bsoncore.Document, provider string) bool { - val, err := kmsProviders.LookupErr(provider) - if err != nil { - // KMS provider is not configured. - return false - } - doc, ok := val.DocumentOK() - // KMS provider is an empty document. - return ok && len(doc) == 5 -} - -func getGCPAccessToken(ctx context.Context, httpClient *http.Client) (string, error) { - metadataHost := "metadata.google.internal" - if envhost := os.Getenv("GCE_METADATA_HOST"); envhost != "" { - metadataHost = envhost - } - url := fmt.Sprintf("http://%s/computeMetadata/v1/instance/service-accounts/default/token", metadataHost) - req, err := http.NewRequest("GET", url, nil) - if err != nil { - return "", internal.WrapErrorf(err, "unable to retrieve GCP credentials") - } - req.Header.Set("Metadata-Flavor", "Google") - resp, err := httpClient.Do(req.WithContext(ctx)) - if err != nil { - return "", internal.WrapErrorf(err, "unable to retrieve GCP credentials") - } - defer resp.Body.Close() - body, err := ioutil.ReadAll(resp.Body) - if err != nil { - return "", internal.WrapErrorf(err, "unable to retrieve GCP credentials: error reading response body") - } - if resp.StatusCode != http.StatusOK { - return "", internal.WrapErrorf(err, "unable to retrieve GCP credentials: expected StatusCode 200, got StatusCode: %v. Response body: %s", resp.StatusCode, body) - } - var tokenResponse struct { - AccessToken string `json:"access_token"` - } - // Attempt to read body as JSON - err = json.Unmarshal(body, &tokenResponse) - if err != nil { - return "", internal.WrapErrorf(err, "unable to retrieve GCP credentials: error reading body JSON. Response body: %s", body) - } - if tokenResponse.AccessToken == "" { - return "", fmt.Errorf("unable to retrieve GCP credentials: got unexpected empty accessToken from GCP Metadata Server. Response body: %s", body) - } - return tokenResponse.AccessToken, nil -} - func (c *crypt) provideKmsProviders(ctx context.Context, cryptCtx *mongocrypt.Context) error { - kmsProviders := c.mongoCrypt.GetKmsProviders() - builder := bsoncore.NewDocumentBuilder() - - if needsKmsProvider(kmsProviders, "gcp") { - // "gcp" KMS provider is an empty document. - // Attempt to fetch from GCP Instance Metadata server. - { - token, err := getGCPAccessToken(ctx, c.httpClient) - if err != nil { - return err - } - builder.StartDocument("gcp"). - AppendString("accessToken", token). - FinishDocument() - - } + kmsProviders, err := c.mongoCrypt.GetKmsProviders(ctx) + if err != nil { + return err } - - return cryptCtx.ProvideKmsProviders(builder.Build()) + return cryptCtx.ProvideKmsProviders(kmsProviders) } diff --git a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/dns/dns.go b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/dns/dns.go index 16268b593e..848554d3a1 100644 --- a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/dns/dns.go +++ b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/dns/dns.go @@ -80,7 +80,9 @@ func (r *Resolver) fetchSeedlistFromSRV(host string, srvName string, stopOnErr b srvName = "mongodb" } _, addresses, err := r.LookupSRV(srvName, "tcp", host) - if err != nil { + if err != nil && strings.Contains(err.Error(), "cannot unmarshal DNS message") { + return nil, fmt.Errorf("see https://pkg.go.dev/go.mongodb.org/mongo-driver/mongo#hdr-Potential_DNS_Issues: %w", err) + } else if err != nil { return nil, err } diff --git a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/mongocrypt/mongocrypt.go b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/mongocrypt/mongocrypt.go index fb96a82190..64e2265083 100644 --- a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/mongocrypt/mongocrypt.go +++ b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/mongocrypt/mongocrypt.go @@ -16,18 +16,27 @@ package mongocrypt // #include import "C" import ( + "context" "errors" "fmt" + "net/http" "unsafe" "go.mongodb.org/mongo-driver/bson" + "go.mongodb.org/mongo-driver/internal" "go.mongodb.org/mongo-driver/x/bsonx/bsoncore" + "go.mongodb.org/mongo-driver/x/mongo/driver/auth/creds" "go.mongodb.org/mongo-driver/x/mongo/driver/mongocrypt/options" ) +type kmsProvider interface { + GetCredentialsDoc(context.Context) (bsoncore.Document, error) +} + type MongoCrypt struct { wrapped *C.mongocrypt_t - kmsProviders bsoncore.Document + kmsProviders map[string]kmsProvider + httpClient *http.Client } // Version returns the version string for the loaded libmongocrypt, or an empty string @@ -44,9 +53,24 @@ func NewMongoCrypt(opts *options.MongoCryptOptions) (*MongoCrypt, error) { if wrapped == nil { return nil, errors.New("could not create new mongocrypt object") } + httpClient := opts.HTTPClient + if httpClient == nil { + httpClient = internal.DefaultHTTPClient + } + kmsProviders := make(map[string]kmsProvider) + if needsKmsProvider(opts.KmsProviders, "gcp") { + kmsProviders["gcp"] = creds.NewGCPCredentialProvider(httpClient) + } + if needsKmsProvider(opts.KmsProviders, "aws") { + kmsProviders["aws"] = creds.NewAWSCredentialProvider(httpClient) + } + if needsKmsProvider(opts.KmsProviders, "azure") { + kmsProviders["azure"] = creds.NewAzureCredentialProvider(httpClient) + } crypt := &MongoCrypt{ wrapped: wrapped, - kmsProviders: opts.KmsProviders, + kmsProviders: kmsProviders, + httpClient: httpClient, } // set options in mongocrypt @@ -222,9 +246,8 @@ const ( IndexTypeIndexed = 2 ) -// CreateExplicitEncryptionContext creates a Context to use for explicit encryption. -func (m *MongoCrypt) CreateExplicitEncryptionContext(doc bsoncore.Document, opts *options.ExplicitEncryptionOptions) (*Context, error) { - +// createExplicitEncryptionContext creates an explicit encryption context. +func (m *MongoCrypt) createExplicitEncryptionContext(opts *options.ExplicitEncryptionOptions) (*Context, error) { ctx := newContext(C.mongocrypt_ctx_new(m.wrapped)) if ctx.wrapped == nil { return nil, m.createErrorFromStatus() @@ -244,6 +267,32 @@ func (m *MongoCrypt) CreateExplicitEncryptionContext(doc bsoncore.Document, opts } } + if opts.RangeOptions != nil { + idx, mongocryptDoc := bsoncore.AppendDocumentStart(nil) + if opts.RangeOptions.Min != nil { + mongocryptDoc = bsoncore.AppendValueElement(mongocryptDoc, "min", *opts.RangeOptions.Min) + } + if opts.RangeOptions.Max != nil { + mongocryptDoc = bsoncore.AppendValueElement(mongocryptDoc, "max", *opts.RangeOptions.Max) + } + if opts.RangeOptions.Precision != nil { + mongocryptDoc = bsoncore.AppendInt32Element(mongocryptDoc, "precision", *opts.RangeOptions.Precision) + } + mongocryptDoc = bsoncore.AppendInt64Element(mongocryptDoc, "sparsity", opts.RangeOptions.Sparsity) + + mongocryptDoc, err := bsoncore.AppendDocumentEnd(mongocryptDoc, idx) + if err != nil { + return nil, err + } + + mongocryptBinary := newBinaryFromBytes(mongocryptDoc) + defer mongocryptBinary.close() + + if ok := C.mongocrypt_ctx_setopt_algorithm_range(ctx.wrapped, mongocryptBinary.wrapped); !ok { + return nil, ctx.createErrorFromStatus() + } + } + algoStr := C.CString(opts.Algorithm) defer C.free(unsafe.Pointer(algoStr)) @@ -264,7 +313,15 @@ func (m *MongoCrypt) CreateExplicitEncryptionContext(doc bsoncore.Document, opts return nil, ctx.createErrorFromStatus() } } + return ctx, nil +} +// CreateExplicitEncryptionContext creates a Context to use for explicit encryption. +func (m *MongoCrypt) CreateExplicitEncryptionContext(doc bsoncore.Document, opts *options.ExplicitEncryptionOptions) (*Context, error) { + ctx, err := m.createExplicitEncryptionContext(opts) + if err != nil { + return ctx, err + } docBinary := newBinaryFromBytes(doc) defer docBinary.close() if ok := C.mongocrypt_ctx_explicit_encrypt_init(ctx.wrapped, docBinary.wrapped); !ok { @@ -274,6 +331,21 @@ func (m *MongoCrypt) CreateExplicitEncryptionContext(doc bsoncore.Document, opts return ctx, nil } +// CreateExplicitEncryptionExpressionContext creates a Context to use for explicit encryption of an expression. +func (m *MongoCrypt) CreateExplicitEncryptionExpressionContext(doc bsoncore.Document, opts *options.ExplicitEncryptionOptions) (*Context, error) { + ctx, err := m.createExplicitEncryptionContext(opts) + if err != nil { + return ctx, err + } + docBinary := newBinaryFromBytes(doc) + defer docBinary.close() + if ok := C.mongocrypt_ctx_explicit_encrypt_expression_init(ctx.wrapped, docBinary.wrapped); !ok { + return nil, ctx.createErrorFromStatus() + } + + return ctx, nil +} + // CreateExplicitDecryptionContext creates a Context to use for explicit decryption. func (m *MongoCrypt) CreateExplicitDecryptionContext(doc bsoncore.Document) (*Context, error) { ctx := newContext(C.mongocrypt_ctx_new(m.wrapped)) @@ -309,6 +381,9 @@ func (m *MongoCrypt) CryptSharedLibVersionString() string { // Close cleans up any resources associated with the given MongoCrypt instance. func (m *MongoCrypt) Close() { C.mongocrypt_destroy(m.wrapped) + if m.httpClient == internal.DefaultHTTPClient { + internal.CloseIdleHTTPConnections(m.httpClient) + } } // RewrapDataKeyContext create a Context to use for rewrapping a data key. @@ -415,7 +490,30 @@ func (m *MongoCrypt) createErrorFromStatus() error { return errorFromStatus(status) } -// GetKmsProviders returns the originally configured KMS providers. -func (m *MongoCrypt) GetKmsProviders() bsoncore.Document { - return m.kmsProviders +// needsKmsProvider returns true if provider was initially set to an empty document. +// An empty document signals the driver to fetch credentials. +func needsKmsProvider(kmsProviders bsoncore.Document, provider string) bool { + val, err := kmsProviders.LookupErr(provider) + if err != nil { + // KMS provider is not configured. + return false + } + doc, ok := val.DocumentOK() + // KMS provider is an empty document if the length is 5. + // An empty document contains 4 bytes of "\x00" and a null byte. + return ok && len(doc) == 5 +} + +// GetKmsProviders attempts to obtain credentials from environment. +// It is expected to be called when a libmongocrypt context is in the mongocrypt.NeedKmsCredentials state. +func (m *MongoCrypt) GetKmsProviders(ctx context.Context) (bsoncore.Document, error) { + builder := bsoncore.NewDocumentBuilder() + for k, p := range m.kmsProviders { + doc, err := p.GetCredentialsDoc(ctx) + if err != nil { + return nil, internal.WrapErrorf(err, "unable to retrieve %s credentials", k) + } + builder.AppendDocument(k, doc) + } + return builder.Build(), nil } diff --git a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/mongocrypt/mongocrypt_context_not_enabled.go b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/mongocrypt/mongocrypt_context_not_enabled.go index 2e2776914a..734662e715 100644 --- a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/mongocrypt/mongocrypt_context_not_enabled.go +++ b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/mongocrypt/mongocrypt_context_not_enabled.go @@ -27,7 +27,7 @@ func (c *Context) NextOperation() (bsoncore.Document, error) { } // AddOperationResult feeds the result of a database operation to mongocrypt. -func (c *Context) AddOperationResult(result bsoncore.Document) error { +func (c *Context) AddOperationResult(bsoncore.Document) error { panic(cseNotSupportedMsg) } @@ -57,6 +57,6 @@ func (c *Context) Close() { } // ProvideKmsProviders provides the KMS providers when in the NeedKmsCredentials state. -func (c *Context) ProvideKmsProviders(kmsProviders bsoncore.Document) error { +func (c *Context) ProvideKmsProviders(bsoncore.Document) error { panic(cseNotSupportedMsg) } diff --git a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/mongocrypt/mongocrypt_kms_context_not_enabled.go b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/mongocrypt/mongocrypt_kms_context_not_enabled.go index 272367ea55..6bce2f0299 100644 --- a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/mongocrypt/mongocrypt_kms_context_not_enabled.go +++ b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/mongocrypt/mongocrypt_kms_context_not_enabled.go @@ -34,6 +34,6 @@ func (kc *KmsContext) BytesNeeded() int32 { } // FeedResponse feeds the bytes received from the KMS to mongocrypt. -func (kc *KmsContext) FeedResponse(response []byte) error { +func (kc *KmsContext) FeedResponse([]byte) error { panic(cseNotSupportedMsg) } diff --git a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/mongocrypt/mongocrypt_not_enabled.go b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/mongocrypt/mongocrypt_not_enabled.go index a333dc536f..24f9f9b0ec 100644 --- a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/mongocrypt/mongocrypt_not_enabled.go +++ b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/mongocrypt/mongocrypt_not_enabled.go @@ -10,6 +10,8 @@ package mongocrypt import ( + "context" + "go.mongodb.org/mongo-driver/x/bsonx/bsoncore" "go.mongodb.org/mongo-driver/x/mongo/driver/mongocrypt/options" ) @@ -26,37 +28,42 @@ func Version() string { } // NewMongoCrypt constructs a new MongoCrypt instance configured using the provided MongoCryptOptions. -func NewMongoCrypt(opts *options.MongoCryptOptions) (*MongoCrypt, error) { +func NewMongoCrypt(*options.MongoCryptOptions) (*MongoCrypt, error) { panic(cseNotSupportedMsg) } // CreateEncryptionContext creates a Context to use for encryption. -func (m *MongoCrypt) CreateEncryptionContext(db string, cmd bsoncore.Document) (*Context, error) { +func (m *MongoCrypt) CreateEncryptionContext(string, bsoncore.Document) (*Context, error) { + panic(cseNotSupportedMsg) +} + +// CreateExplicitEncryptionExpressionContext creates a Context to use for explicit encryption of an expression. +func (m *MongoCrypt) CreateExplicitEncryptionExpressionContext(bsoncore.Document, *options.ExplicitEncryptionOptions) (*Context, error) { panic(cseNotSupportedMsg) } // CreateDecryptionContext creates a Context to use for decryption. -func (m *MongoCrypt) CreateDecryptionContext(cmd bsoncore.Document) (*Context, error) { +func (m *MongoCrypt) CreateDecryptionContext(bsoncore.Document) (*Context, error) { panic(cseNotSupportedMsg) } // CreateDataKeyContext creates a Context to use for creating a data key. -func (m *MongoCrypt) CreateDataKeyContext(kmsProvider string, opts *options.DataKeyOptions) (*Context, error) { +func (m *MongoCrypt) CreateDataKeyContext(string, *options.DataKeyOptions) (*Context, error) { panic(cseNotSupportedMsg) } // CreateExplicitEncryptionContext creates a Context to use for explicit encryption. -func (m *MongoCrypt) CreateExplicitEncryptionContext(doc bsoncore.Document, opts *options.ExplicitEncryptionOptions) (*Context, error) { +func (m *MongoCrypt) CreateExplicitEncryptionContext(bsoncore.Document, *options.ExplicitEncryptionOptions) (*Context, error) { panic(cseNotSupportedMsg) } // RewrapDataKeyContext creates a Context to use for rewrapping a data key. -func (m *MongoCrypt) RewrapDataKeyContext(filter []byte, opts *options.RewrapManyDataKeyOptions) (*Context, error) { +func (m *MongoCrypt) RewrapDataKeyContext([]byte, *options.RewrapManyDataKeyOptions) (*Context, error) { panic(cseNotSupportedMsg) } // CreateExplicitDecryptionContext creates a Context to use for explicit decryption. -func (m *MongoCrypt) CreateExplicitDecryptionContext(doc bsoncore.Document) (*Context, error) { +func (m *MongoCrypt) CreateExplicitDecryptionContext(bsoncore.Document) (*Context, error) { panic(cseNotSupportedMsg) } @@ -78,6 +85,6 @@ func (m *MongoCrypt) Close() { } // GetKmsProviders returns the originally configured KMS providers. -func (m *MongoCrypt) GetKmsProviders() bsoncore.Document { +func (m *MongoCrypt) GetKmsProviders(context.Context) (bsoncore.Document, error) { panic(cseNotSupportedMsg) } diff --git a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/mongocrypt/options/mongocrypt_context_options.go b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/mongocrypt/options/mongocrypt_context_options.go index fdf704ffa0..325777eb2b 100644 --- a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/mongocrypt/options/mongocrypt_context_options.go +++ b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/mongocrypt/options/mongocrypt_context_options.go @@ -56,6 +56,15 @@ type ExplicitEncryptionOptions struct { Algorithm string QueryType string ContentionFactor *int64 + RangeOptions *ExplicitRangeOptions +} + +// ExplicitRangeOptions specifies options for the range index. +type ExplicitRangeOptions struct { + Min *bsoncore.Value + Max *bsoncore.Value + Sparsity int64 + Precision *int32 } // ExplicitEncryption creates a new ExplicitEncryptionOptions instance. @@ -93,6 +102,12 @@ func (eeo *ExplicitEncryptionOptions) SetContentionFactor(contentionFactor int64 return eeo } +// SetRangeOptions specifies the range options. +func (eeo *ExplicitEncryptionOptions) SetRangeOptions(ro ExplicitRangeOptions) *ExplicitEncryptionOptions { + eeo.RangeOptions = &ro + return eeo +} + // RewrapManyDataKeyOptions represents all possible options used to decrypt and encrypt all matching data keys with a // possibly new masterKey. type RewrapManyDataKeyOptions struct { @@ -122,6 +137,9 @@ func (rmdko *RewrapManyDataKeyOptions) SetMasterKey(masterKey bsoncore.Document) // MergeRewrapManyDataKeyOptions combines the given RewrapManyDataKeyOptions instances into a single // RewrapManyDataKeyOptions in a last one wins fashion. +// +// Deprecated: Merging options structs will not be supported in Go Driver 2.0. Users should create a +// single options struct instead. func MergeRewrapManyDataKeyOptions(opts ...*RewrapManyDataKeyOptions) *RewrapManyDataKeyOptions { rmdkOpts := RewrapManyDataKey() for _, rmdko := range opts { diff --git a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/mongocrypt/options/mongocrypt_options.go b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/mongocrypt/options/mongocrypt_options.go index 7e90a0ecd3..d800bc8db7 100644 --- a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/mongocrypt/options/mongocrypt_options.go +++ b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/mongocrypt/options/mongocrypt_options.go @@ -7,6 +7,8 @@ package options import ( + "net/http" + "go.mongodb.org/mongo-driver/x/bsonx/bsoncore" ) @@ -18,6 +20,7 @@ type MongoCryptOptions struct { EncryptedFieldsMap map[string]bsoncore.Document CryptSharedLibDisabled bool CryptSharedLibOverridePath string + HTTPClient *http.Client } // MongoCrypt creates a new MongoCryptOptions instance. @@ -61,3 +64,9 @@ func (mo *MongoCryptOptions) SetCryptSharedLibOverridePath(path string) *MongoCr mo.CryptSharedLibOverridePath = path return mo } + +// SetHTTPClient sets the http client. +func (mo *MongoCryptOptions) SetHTTPClient(httpClient *http.Client) *MongoCryptOptions { + mo.HTTPClient = httpClient + return mo +} diff --git a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation.go b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation.go index fa51ba9c63..beb8651cff 100644 --- a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation.go +++ b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation.go @@ -12,6 +12,7 @@ import ( "errors" "fmt" "math" + "net" "strconv" "strings" "sync" @@ -22,6 +23,8 @@ import ( "go.mongodb.org/mongo-driver/bson/primitive" "go.mongodb.org/mongo-driver/event" "go.mongodb.org/mongo-driver/internal" + "go.mongodb.org/mongo-driver/internal/logger" + "go.mongodb.org/mongo-driver/mongo/address" "go.mongodb.org/mongo-driver/mongo/description" "go.mongodb.org/mongo-driver/mongo/readconcern" "go.mongodb.org/mongo-driver/mongo/readpref" @@ -44,6 +47,8 @@ var ( ErrReplyDocumentMismatch = errors.New("number of documents returned does not match numberReturned field") // ErrNonPrimaryReadPref is returned when a read is attempted in a transaction with a non-primary read preference. ErrNonPrimaryReadPref = errors.New("read preference in a transaction must be primary") + // errDatabaseNameEmpty occurs when a database name is not provided. + errDatabaseNameEmpty = errors.New("database name cannot be empty") ) const ( @@ -96,6 +101,7 @@ type startedInformation struct { serverConnID *int64 redacted bool serviceID *primitive.ObjectID + serverAddress address.Address } // finishedInformation keeps track of all of the information necessary for monitoring success and failure events. @@ -107,9 +113,10 @@ type finishedInformation struct { connID string driverConnectionID uint64 // TODO(GODRIVER-2824): change type to int64. serverConnID *int64 - startTime time.Time redacted bool serviceID *primitive.ObjectID + serverAddress address.Address + duration time.Duration } // convertInt64PtrToInt32Ptr will convert an int64 pointer reference to an int32 pointer @@ -128,6 +135,20 @@ func convertInt64PtrToInt32Ptr(i64 *int64) *int32 { return &i32 } +// success returns true if there was no command error or the command error is a +// "WriteCommandError". Commands that executed on the server and return a status +// of { ok: 1.0 } are considered successful commands and MUST generate a +// CommandSucceededEvent and "command succeeded" log message. Commands that have +// write errors are included since the actual command did succeed, only writes +// failed. +func (info finishedInformation) success() bool { + if _, ok := info.cmdErr.(WriteCommandError); ok { + return true + } + + return info.cmdErr == nil +} + // ResponseInfo contains the context required to parse a server response. type ResponseInfo struct { ServerResponse bsoncore.Document @@ -137,6 +158,37 @@ type ResponseInfo struct { CurrentIndex int } +func redactStartedInformationCmd(op Operation, info startedInformation) bson.Raw { + var cmdCopy bson.Raw + + // Make a copy of the command. Redact if the command is security + // sensitive and cannot be monitored. If there was a type 1 payload for + // the current batch, convert it to a BSON array + if !info.redacted { + cmdCopy = make([]byte, len(info.cmd)) + copy(cmdCopy, info.cmd) + + if info.documentSequenceIncluded { + // remove 0 byte at end + cmdCopy = cmdCopy[:len(info.cmd)-1] + cmdCopy = op.addBatchArray(cmdCopy) + + // add back 0 byte and update length + cmdCopy, _ = bsoncore.AppendDocumentEnd(cmdCopy, 0) + } + } + + return cmdCopy +} + +func redactFinishedInformationResponse(info finishedInformation) bson.Raw { + if !info.redacted { + return bson.Raw(info.response) + } + + return bson.Raw{} +} + // Operation is used to execute an operation. It contains all of the common code required to // select a server, transform an operation into a command, write the command to a connection from // the selected server, read a response from that connection, process the response, and potentially @@ -252,6 +304,8 @@ type Operation struct { // nil, which means that the timeout of the operation's caller will be used. Timeout *time.Duration + Logger *logger.Logger + // cmdName is only set when serializing OP_MSG and is used internally in readWireMessage. cmdName string } @@ -337,7 +391,7 @@ func (op Operation) Validate() error { return InvalidOperationError{MissingField: "Deployment"} } if op.Database == "" { - return InvalidOperationError{MissingField: "Database"} + return errDatabaseNameEmpty } if op.Client != nil && !writeconcern.AckWrite(op.WriteConcern) { return errors.New("session provided for an unacknowledged write") @@ -577,6 +631,8 @@ func (op Operation) Execute(ctx context.Context) error { startedInfo.redacted = op.redactCommand(startedInfo.cmdName, startedInfo.cmd) startedInfo.serviceID = conn.Description().ServiceID startedInfo.serverConnID = conn.ServerConnectionID() + startedInfo.serverAddress = conn.Description().Addr + op.publishStartedEvent(ctx, startedInfo) // get the moreToCome flag information before we compress @@ -595,15 +651,17 @@ func (op Operation) Execute(ctx context.Context) error { finishedInfo := finishedInformation{ cmdName: startedInfo.cmdName, + driverConnectionID: startedInfo.driverConnectionID, requestID: startedInfo.requestID, - startTime: time.Now(), connID: startedInfo.connID, - driverConnectionID: startedInfo.driverConnectionID, serverConnID: startedInfo.serverConnID, redacted: startedInfo.redacted, serviceID: startedInfo.serviceID, + serverAddress: desc.Server.Addr, } + startedTime := time.Now() + // Check for possible context error. If no context error, check if there's enough time to perform a // round trip before the Context deadline. If ctx is a Timeout Context, use the 90th percentile RTT // as a threshold. Otherwise, use the minimum observed RTT. @@ -621,7 +679,7 @@ func (op Operation) Execute(ctx context.Context) error { if err == nil { // roundtrip using either the full roundTripper or a special one for when the moreToCome // flag is set - var roundTrip = op.roundTrip + roundTrip := op.roundTrip if moreToCome { roundTrip = op.moreToComeRoundTrip } @@ -634,6 +692,8 @@ func (op Operation) Execute(ctx context.Context) error { finishedInfo.response = res finishedInfo.cmdErr = err + finishedInfo.duration = time.Since(startedTime) + op.publishFinishedEvent(ctx, finishedInfo) // prevIndefiniteErrorIsSet is "true" if the "err" variable has been set to the "prevIndefiniteErr" in @@ -1016,8 +1076,8 @@ func (op Operation) createWireMessage( dst []byte, desc description.SelectedServer, maxTimeMS uint64, - conn Connection) ([]byte, startedInformation, error) { - + conn Connection, +) ([]byte, startedInformation, error) { // If topology is not LoadBalanced, API version is not declared, and wire version is unknown // or less than 6, use OP_QUERY. Otherwise, use OP_MSG. if desc.Kind != description.LoadBalanced && op.ServerAPI == nil && @@ -1109,8 +1169,8 @@ func (op Operation) createQueryWireMessage(maxTimeMS uint64, dst []byte, desc de } func (op Operation) createMsgWireMessage(ctx context.Context, maxTimeMS uint64, dst []byte, desc description.SelectedServer, - conn Connection) ([]byte, startedInformation, error) { - + conn Connection, +) ([]byte, startedInformation, error) { var info startedInformation var flags wiremessage.MsgFlag var wmindex int32 @@ -1698,76 +1758,141 @@ func (op *Operation) redactCommand(cmd string, doc bsoncore.Document) bool { return err == nil } +// canLogCommandMessage returns true if the command can be logged. +func (op Operation) canLogCommandMessage() bool { + return op.Logger != nil && op.Logger.LevelComponentEnabled(logger.LevelDebug, logger.ComponentCommand) +} + +func (op Operation) canPublishStartedEvent() bool { + return op.CommandMonitor != nil && op.CommandMonitor.Started != nil +} + // publishStartedEvent publishes a CommandStartedEvent to the operation's command monitor if possible. If the command is // an unacknowledged write, a CommandSucceededEvent will be published as well. If started events are not being monitored, // no events are published. func (op Operation) publishStartedEvent(ctx context.Context, info startedInformation) { - if op.CommandMonitor == nil || op.CommandMonitor.Started == nil { - return - } - - // Make a copy of the command. Redact if the command is security sensitive and cannot be monitored. - // If there was a type 1 payload for the current batch, convert it to a BSON array. - cmdCopy := bson.Raw{} - if !info.redacted { - cmdCopy = make([]byte, len(info.cmd)) - copy(cmdCopy, info.cmd) - if info.documentSequenceIncluded { - cmdCopy = cmdCopy[:len(info.cmd)-1] // remove 0 byte at end - cmdCopy = op.addBatchArray(cmdCopy) - cmdCopy, _ = bsoncore.AppendDocumentEnd(cmdCopy, 0) // add back 0 byte and update length + // If logging is enabled for the command component at the debug level, log the command response. + if op.canLogCommandMessage() { + host, port, _ := net.SplitHostPort(info.serverAddress.String()) + + redactedCmd := redactStartedInformationCmd(op, info).String() + formattedCmd := logger.FormatMessage(redactedCmd, op.Logger.MaxDocumentLength) + + op.Logger.Print(logger.LevelDebug, + logger.ComponentCommand, + logger.CommandStarted, + logger.SerializeCommand(logger.Command{ + DriverConnectionID: info.driverConnectionID, + Message: logger.CommandStarted, + Name: info.cmdName, + RequestID: int64(info.requestID), + ServerConnectionID: info.serverConnID, + ServerHost: host, + ServerPort: port, + ServiceID: info.serviceID, + }, + logger.KeyCommand, formattedCmd, + logger.KeyDatabaseName, op.Database)...) + + } + + if op.canPublishStartedEvent() { + started := &event.CommandStartedEvent{ + Command: redactStartedInformationCmd(op, info), + DatabaseName: op.Database, + CommandName: info.cmdName, + RequestID: int64(info.requestID), + ConnectionID: info.connID, + ServerConnectionID: convertInt64PtrToInt32Ptr(info.serverConnID), + ServerConnectionID64: info.serverConnID, + ServiceID: info.serviceID, } + op.CommandMonitor.Started(ctx, started) } +} - started := &event.CommandStartedEvent{ - Command: cmdCopy, - DatabaseName: op.Database, - CommandName: info.cmdName, - RequestID: int64(info.requestID), - ConnectionID: info.connID, - ServerConnectionID: convertInt64PtrToInt32Ptr(info.serverConnID), - ServiceID: info.serviceID, - } - op.CommandMonitor.Started(ctx, started) +// canPublishSucceededEvent returns true if a CommandSucceededEvent can be +// published for the given command. This is true if the command is not an +// unacknowledged write and the command monitor is monitoring succeeded events. +func (op Operation) canPublishFinishedEvent(info finishedInformation) bool { + success := info.success() + + return op.CommandMonitor != nil && + (!success || op.CommandMonitor.Succeeded != nil) && + (success || op.CommandMonitor.Failed != nil) } // publishFinishedEvent publishes either a CommandSucceededEvent or a CommandFailedEvent to the operation's command // monitor if possible. If success/failure events aren't being monitored, no events are published. func (op Operation) publishFinishedEvent(ctx context.Context, info finishedInformation) { - success := info.cmdErr == nil - if _, ok := info.cmdErr.(WriteCommandError); ok { - success = true - } - if op.CommandMonitor == nil || (success && op.CommandMonitor.Succeeded == nil) || (!success && op.CommandMonitor.Failed == nil) { + if op.canLogCommandMessage() && info.success() { + host, port, _ := net.SplitHostPort(info.serverAddress.String()) + + redactedReply := redactFinishedInformationResponse(info).String() + formattedReply := logger.FormatMessage(redactedReply, op.Logger.MaxDocumentLength) + + op.Logger.Print(logger.LevelDebug, + logger.ComponentCommand, + logger.CommandSucceeded, + logger.SerializeCommand(logger.Command{ + DriverConnectionID: info.driverConnectionID, + Message: logger.CommandSucceeded, + Name: info.cmdName, + RequestID: int64(info.requestID), + ServerConnectionID: info.serverConnID, + ServerHost: host, + ServerPort: port, + ServiceID: info.serviceID, + }, + logger.KeyDurationMS, info.duration.Milliseconds(), + logger.KeyReply, formattedReply)...) + } + + if op.canLogCommandMessage() && !info.success() { + host, port, _ := net.SplitHostPort(info.serverAddress.String()) + + formattedReply := logger.FormatMessage(info.cmdErr.Error(), op.Logger.MaxDocumentLength) + + op.Logger.Print(logger.LevelDebug, + logger.ComponentCommand, + logger.CommandFailed, + logger.SerializeCommand(logger.Command{ + DriverConnectionID: info.driverConnectionID, + Message: logger.CommandFailed, + Name: info.cmdName, + RequestID: int64(info.requestID), + ServerConnectionID: info.serverConnID, + ServerHost: host, + ServerPort: port, + ServiceID: info.serviceID, + }, + logger.KeyDurationMS, info.duration.Milliseconds(), + logger.KeyFailure, formattedReply)...) + } + + // If the finished event cannot be published, return early. + if !op.canPublishFinishedEvent(info) { return } - var durationNanos int64 - var emptyTime time.Time - if info.startTime != emptyTime { - durationNanos = time.Since(info.startTime).Nanoseconds() + finished := event.CommandFinishedEvent{ + CommandName: info.cmdName, + RequestID: int64(info.requestID), + ConnectionID: info.connID, + Duration: info.duration, + DurationNanos: info.duration.Nanoseconds(), + ServerConnectionID: convertInt64PtrToInt32Ptr(info.serverConnID), + ServerConnectionID64: info.serverConnID, + ServiceID: info.serviceID, } - finished := event.CommandFinishedEvent{ - CommandName: info.cmdName, - RequestID: int64(info.requestID), - ConnectionID: info.connID, - DurationNanos: durationNanos, - ServerConnectionID: convertInt64PtrToInt32Ptr(info.serverConnID), - ServiceID: info.serviceID, - } - - if success { - res := bson.Raw{} - // Only copy the reply for commands that are not security sensitive - if !info.redacted { - res = bson.Raw(info.response) - } + if info.success() { successEvent := &event.CommandSucceededEvent{ - Reply: res, + Reply: redactFinishedInformationResponse(info), CommandFinishedEvent: finished, } op.CommandMonitor.Succeeded(ctx, successEvent) + return } diff --git a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/abort_transaction.go b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/abort_transaction.go index 2bf0ec052e..42ff5e6fc5 100644 --- a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/abort_transaction.go +++ b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/abort_transaction.go @@ -68,7 +68,7 @@ func (at *AbortTransaction) Execute(ctx context.Context) error { } -func (at *AbortTransaction) command(dst []byte, desc description.SelectedServer) ([]byte, error) { +func (at *AbortTransaction) command(dst []byte, _ description.SelectedServer) ([]byte, error) { dst = bsoncore.AppendInt32Element(dst, "abortTransaction", 1) if at.recoveryToken != nil { diff --git a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/command.go b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/command.go index 574cb03144..5aad3f72e6 100644 --- a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/command.go +++ b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/command.go @@ -12,6 +12,7 @@ import ( "time" "go.mongodb.org/mongo-driver/event" + "go.mongodb.org/mongo-driver/internal/logger" "go.mongodb.org/mongo-driver/mongo/description" "go.mongodb.org/mongo-driver/mongo/readconcern" "go.mongodb.org/mongo-driver/mongo/readpref" @@ -38,6 +39,7 @@ type Command struct { createCursor bool cursorOpts driver.CursorOptions timeout *time.Duration + logger *logger.Logger } // NewCommand constructs and returns a new Command. Once the operation is executed, the result may only be accessed via @@ -77,6 +79,7 @@ func (c *Command) Execute(ctx context.Context) error { return errors.New("the Command operation must have a Deployment set before Execute can be called") } + // TODO(GODRIVER-2649): Actually pass readConcern to underlying driver.Operation. return driver.Operation{ CommandFn: func(dst []byte, desc description.SelectedServer) ([]byte, error) { return append(dst, c.command[4:len(c.command)-1]...), nil @@ -106,6 +109,7 @@ func (c *Command) Execute(ctx context.Context) error { Crypt: c.crypt, ServerAPI: c.serverAPI, Timeout: c.timeout, + Logger: c.logger, }.Execute(ctx) } @@ -218,3 +222,13 @@ func (c *Command) Timeout(timeout *time.Duration) *Command { c.timeout = timeout return c } + +// Logger sets the logger for this operation. +func (c *Command) Logger(logger *logger.Logger) *Command { + if c == nil { + c = new(Command) + } + + c.logger = logger + return c +} diff --git a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/commit_transaction.go b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/commit_transaction.go index ff2794a1f1..2eecc5163b 100644 --- a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/commit_transaction.go +++ b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/commit_transaction.go @@ -70,7 +70,7 @@ func (ct *CommitTransaction) Execute(ctx context.Context) error { } -func (ct *CommitTransaction) command(dst []byte, desc description.SelectedServer) ([]byte, error) { +func (ct *CommitTransaction) command(dst []byte, _ description.SelectedServer) ([]byte, error) { dst = bsoncore.AppendInt32Element(dst, "commitTransaction", 1) if ct.recoveryToken != nil { diff --git a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/count.go b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/count.go index 7e605572db..0e4d0ec1fd 100644 --- a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/count.go +++ b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/count.go @@ -138,7 +138,7 @@ func (c *Count) Execute(ctx context.Context) error { return err } -func (c *Count) command(dst []byte, desc description.SelectedServer) ([]byte, error) { +func (c *Count) command(dst []byte, _ description.SelectedServer) ([]byte, error) { dst = bsoncore.AppendStringElement(dst, "count", c.collection) if c.query != nil { dst = bsoncore.AppendDocumentElement(dst, "query", c.query) diff --git a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/delete.go b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/delete.go index bb83594255..ee2823342d 100644 --- a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/delete.go +++ b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/delete.go @@ -14,6 +14,7 @@ import ( "go.mongodb.org/mongo-driver/bson/bsontype" "go.mongodb.org/mongo-driver/event" + "go.mongodb.org/mongo-driver/internal/logger" "go.mongodb.org/mongo-driver/mongo/description" "go.mongodb.org/mongo-driver/mongo/writeconcern" "go.mongodb.org/mongo-driver/x/bsonx/bsoncore" @@ -41,6 +42,7 @@ type Delete struct { serverAPI *driver.ServerAPIOptions let bsoncore.Document timeout *time.Duration + logger *logger.Logger } // DeleteResult represents a delete result returned by the server. @@ -111,6 +113,7 @@ func (d *Delete) Execute(ctx context.Context) error { WriteConcern: d.writeConcern, ServerAPI: d.serverAPI, Timeout: d.timeout, + Logger: d.logger, }.Execute(ctx) } @@ -312,3 +315,14 @@ func (d *Delete) Timeout(timeout *time.Duration) *Delete { d.timeout = timeout return d } + +// Logger sets the logger for this operation. +func (d *Delete) Logger(logger *logger.Logger) *Delete { + if d == nil { + d = new(Delete) + } + + d.logger = logger + + return d +} diff --git a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/drop_collection.go b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/drop_collection.go index 2b65d48444..5d9a03d386 100644 --- a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/drop_collection.go +++ b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/drop_collection.go @@ -106,7 +106,7 @@ func (dc *DropCollection) Execute(ctx context.Context) error { } -func (dc *DropCollection) command(dst []byte, desc description.SelectedServer) ([]byte, error) { +func (dc *DropCollection) command(dst []byte, _ description.SelectedServer) ([]byte, error) { dst = bsoncore.AppendStringElement(dst, "drop", dc.collection) return dst, nil } diff --git a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/drop_database.go b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/drop_database.go index ae011e2ba4..74c8db446d 100644 --- a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/drop_database.go +++ b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/drop_database.go @@ -57,7 +57,7 @@ func (dd *DropDatabase) Execute(ctx context.Context) error { } -func (dd *DropDatabase) command(dst []byte, desc description.SelectedServer) ([]byte, error) { +func (dd *DropDatabase) command(dst []byte, _ description.SelectedServer) ([]byte, error) { dst = bsoncore.AppendInt32Element(dst, "dropDatabase", 1) return dst, nil diff --git a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/drop_indexes.go b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/drop_indexes.go index 2e8569021b..5b2a56dde4 100644 --- a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/drop_indexes.go +++ b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/drop_indexes.go @@ -103,7 +103,7 @@ func (di *DropIndexes) Execute(ctx context.Context) error { } -func (di *DropIndexes) command(dst []byte, desc description.SelectedServer) ([]byte, error) { +func (di *DropIndexes) command(dst []byte, _ description.SelectedServer) ([]byte, error) { dst = bsoncore.AppendStringElement(dst, "dropIndexes", di.collection) if di.index != nil { dst = bsoncore.AppendStringElement(dst, "index", *di.index) diff --git a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/end_sessions.go b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/end_sessions.go index 644d19555a..26e215fbef 100644 --- a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/end_sessions.go +++ b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/end_sessions.go @@ -63,7 +63,7 @@ func (es *EndSessions) Execute(ctx context.Context) error { } -func (es *EndSessions) command(dst []byte, desc description.SelectedServer) ([]byte, error) { +func (es *EndSessions) command(dst []byte, _ description.SelectedServer) ([]byte, error) { if es.sessionIDs != nil { dst = bsoncore.AppendArrayElement(dst, "endSessions", es.sessionIDs) } diff --git a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/find.go b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/find.go index 6ccdfcae85..ab8a8d80df 100644 --- a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/find.go +++ b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/find.go @@ -13,6 +13,7 @@ import ( "go.mongodb.org/mongo-driver/bson/bsontype" "go.mongodb.org/mongo-driver/event" + "go.mongodb.org/mongo-driver/internal/logger" "go.mongodb.org/mongo-driver/mongo/description" "go.mongodb.org/mongo-driver/mongo/readconcern" "go.mongodb.org/mongo-driver/mongo/readpref" @@ -60,6 +61,7 @@ type Find struct { result driver.CursorResponse serverAPI *driver.ServerAPIOptions timeout *time.Duration + logger *logger.Logger } // NewFind constructs and returns a new Find. @@ -105,6 +107,7 @@ func (f *Find) Execute(ctx context.Context) error { Legacy: driver.LegacyFind, ServerAPI: f.serverAPI, Timeout: f.timeout, + Logger: f.logger, }.Execute(ctx) } @@ -546,3 +549,13 @@ func (f *Find) Timeout(timeout *time.Duration) *Find { f.timeout = timeout return f } + +// Logger sets the logger for this operation. +func (f *Find) Logger(logger *logger.Logger) *Find { + if f == nil { + f = new(Find) + } + + f.logger = logger + return f +} diff --git a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/find_and_modify.go b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/find_and_modify.go index 7c4cb527bf..38d001c716 100644 --- a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/find_and_modify.go +++ b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/find_and_modify.go @@ -24,7 +24,7 @@ import ( // FindAndModify performs a findAndModify operation. type FindAndModify struct { - arrayFilters bsoncore.Document + arrayFilters bsoncore.Array bypassDocumentValidation *bool collation bsoncore.Document comment bsoncore.Value @@ -215,7 +215,7 @@ func (fam *FindAndModify) command(dst []byte, desc description.SelectedServer) ( } // ArrayFilters specifies an array of filter documents that determines which array elements to modify for an update operation on an array field. -func (fam *FindAndModify) ArrayFilters(arrayFilters bsoncore.Document) *FindAndModify { +func (fam *FindAndModify) ArrayFilters(arrayFilters bsoncore.Array) *FindAndModify { if fam == nil { fam = new(FindAndModify) } diff --git a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/hello.go b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/hello.go index b2f657715f..f0d98ee703 100644 --- a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/hello.go +++ b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/hello.go @@ -9,8 +9,10 @@ package operation import ( "context" "errors" + "os" "runtime" "strconv" + "strings" "go.mongodb.org/mongo-driver/bson" "go.mongodb.org/mongo-driver/internal" @@ -22,6 +24,15 @@ import ( "go.mongodb.org/mongo-driver/x/mongo/driver/session" ) +// maxClientMetadataSize is the maximum size of the client metadata document +// that can be sent to the server. Note that the maximum document size on +// standalone and replica servers is 1024, but the maximum document size on +// sharded clusters is 512. +const maxClientMetadataSize = 512 + +const awsLambdaPrefix = "AWS_Lambda_" +const driverName = "mongo-go-driver" + // Hello is used to run the handshake operation. type Hello struct { appname string @@ -113,6 +124,343 @@ func (h *Hello) Result(addr address.Address) description.Server { return description.NewServer(addr, bson.Raw(h.res)) } +const ( + // FaaS environment variable names + envVarAWSExecutionEnv = "AWS_EXECUTION_ENV" + envVarAWSLambdaRuntimeAPI = "AWS_LAMBDA_RUNTIME_API" + envVarFunctionsWorkerRuntime = "FUNCTIONS_WORKER_RUNTIME" + envVarKService = "K_SERVICE" + envVarFunctionName = "FUNCTION_NAME" + envVarVercel = "VERCEL" +) + +const ( + // FaaS environment variable names + envVarAWSRegion = "AWS_REGION" + envVarAWSLambdaFunctionMemorySize = "AWS_LAMBDA_FUNCTION_MEMORY_SIZE" + envVarFunctionMemoryMB = "FUNCTION_MEMORY_MB" + envVarFunctionTimeoutSec = "FUNCTION_TIMEOUT_SEC" + envVarFunctionRegion = "FUNCTION_REGION" + envVarVercelRegion = "VERCEL_REGION" +) + +const ( + // FaaS environment names used by the client + envNameAWSLambda = "aws.lambda" + envNameAzureFunc = "azure.func" + envNameGCPFunc = "gcp.func" + envNameVercel = "vercel" +) + +// getFaasEnvName parses the FaaS environment variable name and returns the +// corresponding name used by the client. If none of the variables or variables +// for multiple names are populated the client.env value MUST be entirely +// omitted. When variables for multiple "client.env.name" values are present, +// "vercel" takes precedence over "aws.lambda"; any other combination MUST cause +// "client.env" to be entirely omitted. +func getFaasEnvName() string { + envVars := []string{ + envVarAWSExecutionEnv, + envVarAWSLambdaRuntimeAPI, + envVarFunctionsWorkerRuntime, + envVarKService, + envVarFunctionName, + envVarVercel, + } + + // If none of the variables are populated the client.env value MUST be + // entirely omitted. + names := make(map[string]struct{}) + + for _, envVar := range envVars { + val := os.Getenv(envVar) + if val == "" { + continue + } + + var name string + + switch envVar { + case envVarAWSExecutionEnv: + if !strings.HasPrefix(val, awsLambdaPrefix) { + continue + } + + name = envNameAWSLambda + case envVarAWSLambdaRuntimeAPI: + name = envNameAWSLambda + case envVarFunctionsWorkerRuntime: + name = envNameAzureFunc + case envVarKService, envVarFunctionName: + name = envNameGCPFunc + case envVarVercel: + // "vercel" takes precedence over "aws.lambda". + delete(names, envNameAWSLambda) + + name = envNameVercel + } + + names[name] = struct{}{} + if len(names) > 1 { + // If multiple names are populated the client.env value + // MUST be entirely omitted. + names = nil + + break + } + } + + for name := range names { + return name + } + + return "" +} + +// appendClientAppName appends the application metadata to the dst. It is the +// responsibility of the caller to check that this appending does not cause dst +// to exceed any size limitations. +func appendClientAppName(dst []byte, name string) ([]byte, error) { + if name == "" { + return dst, nil + } + + var idx int32 + idx, dst = bsoncore.AppendDocumentElementStart(dst, "application") + + dst = bsoncore.AppendStringElement(dst, "name", name) + + return bsoncore.AppendDocumentEnd(dst, idx) +} + +// appendClientDriver appends the driver metadata to dst. It is the +// responsibility of the caller to check that this appending does not cause dst +// to exceed any size limitations. +func appendClientDriver(dst []byte) ([]byte, error) { + var idx int32 + idx, dst = bsoncore.AppendDocumentElementStart(dst, "driver") + + dst = bsoncore.AppendStringElement(dst, "name", driverName) + dst = bsoncore.AppendStringElement(dst, "version", version.Driver) + + return bsoncore.AppendDocumentEnd(dst, idx) +} + +// appendClientEnv appends the environment metadata to dst. It is the +// responsibility of the caller to check that this appending does not cause dst +// to exceed any size limitations. +func appendClientEnv(dst []byte, omitNonName, omitDoc bool) ([]byte, error) { + if omitDoc { + return dst, nil + } + + name := getFaasEnvName() + if name == "" { + return dst, nil + } + + var idx int32 + + idx, dst = bsoncore.AppendDocumentElementStart(dst, "env") + dst = bsoncore.AppendStringElement(dst, "name", name) + + addMem := func(envVar string) []byte { + mem := os.Getenv(envVar) + if mem == "" { + return dst + } + + memInt64, err := strconv.ParseInt(mem, 10, 32) + if err != nil { + return dst + } + + memInt32 := int32(memInt64) + + return bsoncore.AppendInt32Element(dst, "memory_mb", memInt32) + } + + addRegion := func(envVar string) []byte { + region := os.Getenv(envVar) + if region == "" { + return dst + } + + return bsoncore.AppendStringElement(dst, "region", region) + } + + addTimeout := func(envVar string) []byte { + timeout := os.Getenv(envVar) + if timeout == "" { + return dst + } + + timeoutInt64, err := strconv.ParseInt(timeout, 10, 32) + if err != nil { + return dst + } + + timeoutInt32 := int32(timeoutInt64) + return bsoncore.AppendInt32Element(dst, "timeout_sec", timeoutInt32) + } + + if !omitNonName { + switch name { + case envNameAWSLambda: + dst = addMem(envVarAWSLambdaFunctionMemorySize) + dst = addRegion(envVarAWSRegion) + case envNameGCPFunc: + dst = addMem(envVarFunctionMemoryMB) + dst = addRegion(envVarFunctionRegion) + dst = addTimeout(envVarFunctionTimeoutSec) + case envNameVercel: + dst = addRegion(envVarVercelRegion) + } + } + + return bsoncore.AppendDocumentEnd(dst, idx) +} + +// appendClientOS appends the OS metadata to dst. It is the responsibility of the +// caller to check that this appending does not cause dst to exceed any size +// limitations. +func appendClientOS(dst []byte, omitNonType bool) ([]byte, error) { + var idx int32 + + idx, dst = bsoncore.AppendDocumentElementStart(dst, "os") + + dst = bsoncore.AppendStringElement(dst, "type", runtime.GOOS) + if !omitNonType { + dst = bsoncore.AppendStringElement(dst, "architecture", runtime.GOARCH) + } + + return bsoncore.AppendDocumentEnd(dst, idx) +} + +// appendClientPlatform appends the platform metadata to dst. It is the +// responsibility of the caller to check that this appending does not cause dst +// to exceed any size limitations. +func appendClientPlatform(dst []byte) []byte { + return bsoncore.AppendStringElement(dst, "platform", runtime.Version()) +} + +// encodeClientMetadata encodes the client metadata into a BSON document. maxLen +// is the maximum length the document can be. If the document exceeds maxLen, +// then an empty byte slice is returned. If there is not enough space to encode +// a document, the document is truncated and returned. +// +// This function attempts to build the following document. Fields are omitted to +// save space following the MongoDB Handshake. +// +// { +// application: { +// name: "" +// }, +// driver: { +// name: "", +// version: "" +// }, +// platform: "", +// os: { +// type: "", +// name: "", +// architecture: "", +// version: "" +// }, +// env: { +// name: "", +// timeout_sec: 42, +// memory_mb: 1024, +// region: "", +// } +// } +func encodeClientMetadata(appname string, maxLen int) ([]byte, error) { + dst := make([]byte, 0, maxLen) + + omitEnvDoc := false + omitEnvNonName := false + omitOSNonType := false + omitEnvDocument := false + truncatePlatform := false + +retry: + var idx int32 + idx, dst = bsoncore.AppendDocumentStart(dst) + + var err error + dst, err = appendClientAppName(dst, appname) + if err != nil { + return nil, err + } + + dst, err = appendClientDriver(dst) + if err != nil { + return nil, err + } + + dst, err = appendClientOS(dst, omitOSNonType) + if err != nil { + return nil, err + } + + if !truncatePlatform { + dst = appendClientPlatform(dst) + } + + if !omitEnvDocument { + dst, err = appendClientEnv(dst, omitEnvNonName, omitEnvDoc) + if err != nil { + return nil, err + } + } + + dst, err = bsoncore.AppendDocumentEnd(dst, idx) + if err != nil { + return nil, err + } + + if len(dst) > maxLen { + // Implementors SHOULD cumulatively update fields in the + // following order until the document is under the size limit + // + // 1. Omit fields from ``env`` except ``env.name`` + // 2. Omit fields from ``os`` except ``os.type`` + // 3. Omit the ``env`` document entirely + // 4. Truncate ``platform`` + dst = dst[:0] + + if !omitEnvNonName { + omitEnvNonName = true + + goto retry + } + + if !omitOSNonType { + omitOSNonType = true + + goto retry + } + + if !omitEnvDoc { + omitEnvDoc = true + + goto retry + } + + if !truncatePlatform { + truncatePlatform = true + + goto retry + } + + // There is nothing left to update. Return an empty slice to + // tell caller not to append a `client` document. + return nil, nil + } + + return dst, nil +} + // handshakeCommand appends all necessary command fields as well as client metadata, SASL supported mechs, and compression. func (h *Hello) handshakeCommand(dst []byte, desc description.SelectedServer) ([]byte, error) { dst, err := h.command(dst, desc) @@ -133,26 +481,12 @@ func (h *Hello) handshakeCommand(dst []byte, desc description.SelectedServer) ([ } dst, _ = bsoncore.AppendArrayEnd(dst, idx) - // append client metadata - idx, dst = bsoncore.AppendDocumentElementStart(dst, "client") - - didx, dst := bsoncore.AppendDocumentElementStart(dst, "driver") - dst = bsoncore.AppendStringElement(dst, "name", "mongo-go-driver") - dst = bsoncore.AppendStringElement(dst, "version", version.Driver) - dst, _ = bsoncore.AppendDocumentEnd(dst, didx) - - didx, dst = bsoncore.AppendDocumentElementStart(dst, "os") - dst = bsoncore.AppendStringElement(dst, "type", runtime.GOOS) - dst = bsoncore.AppendStringElement(dst, "architecture", runtime.GOARCH) - dst, _ = bsoncore.AppendDocumentEnd(dst, didx) + clientMetadata, _ := encodeClientMetadata(h.appname, maxClientMetadataSize) - dst = bsoncore.AppendStringElement(dst, "platform", runtime.Version()) - if h.appname != "" { - didx, dst = bsoncore.AppendDocumentElementStart(dst, "application") - dst = bsoncore.AppendStringElement(dst, "name", h.appname) - dst, _ = bsoncore.AppendDocumentEnd(dst, didx) + // If the client metadata is empty, do not append it to the command. + if len(clientMetadata) > 0 { + dst = bsoncore.AppendDocumentElement(dst, "client", clientMetadata) } - dst, _ = bsoncore.AppendDocumentEnd(dst, idx) return dst, nil } @@ -222,7 +556,7 @@ func (h *Hello) GetHandshakeInformation(ctx context.Context, _ address.Address, err := driver.Operation{ Clock: h.clock, CommandFn: h.handshakeCommand, - Deployment: driver.SingleConnectionDeployment{c}, + Deployment: driver.SingleConnectionDeployment{C: c}, Database: "admin", ProcessResponseFn: func(info driver.ResponseInfo) error { h.res = info.ServerResponse diff --git a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/insert.go b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/insert.go index 83ba5e6e13..601e47eac9 100644 --- a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/insert.go +++ b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/insert.go @@ -14,6 +14,7 @@ import ( "go.mongodb.org/mongo-driver/bson/bsontype" "go.mongodb.org/mongo-driver/event" + "go.mongodb.org/mongo-driver/internal/logger" "go.mongodb.org/mongo-driver/mongo/description" "go.mongodb.org/mongo-driver/mongo/writeconcern" "go.mongodb.org/mongo-driver/x/bsonx/bsoncore" @@ -40,6 +41,7 @@ type Insert struct { result InsertResult serverAPI *driver.ServerAPIOptions timeout *time.Duration + logger *logger.Logger } // InsertResult represents an insert result returned by the server. @@ -110,6 +112,7 @@ func (i *Insert) Execute(ctx context.Context) error { WriteConcern: i.writeConcern, ServerAPI: i.serverAPI, Timeout: i.timeout, + Logger: i.logger, }.Execute(ctx) } @@ -291,3 +294,13 @@ func (i *Insert) Timeout(timeout *time.Duration) *Insert { i.timeout = timeout return i } + +// Logger sets the logger for this operation. +func (i *Insert) Logger(logger *logger.Logger) *Insert { + if i == nil { + i = new(Insert) + } + + i.logger = logger + return i +} diff --git a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/listDatabases.go b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/listDatabases.go index 28f72dd121..514d1dc3ef 100644 --- a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/listDatabases.go +++ b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/listDatabases.go @@ -167,7 +167,7 @@ func (ld *ListDatabases) Execute(ctx context.Context) error { } -func (ld *ListDatabases) command(dst []byte, desc description.SelectedServer) ([]byte, error) { +func (ld *ListDatabases) command(dst []byte, _ description.SelectedServer) ([]byte, error) { dst = bsoncore.AppendInt32Element(dst, "listDatabases", 1) if ld.filter != nil { diff --git a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/list_collections.go b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/list_collections.go index 7118417f7e..6f15bbeece 100644 --- a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/list_collections.go +++ b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/list_collections.go @@ -92,7 +92,7 @@ func (lc *ListCollections) Execute(ctx context.Context) error { } -func (lc *ListCollections) command(dst []byte, desc description.SelectedServer) ([]byte, error) { +func (lc *ListCollections) command(dst []byte, _ description.SelectedServer) ([]byte, error) { dst = bsoncore.AppendInt32Element(dst, "listCollections", 1) if lc.filter != nil { dst = bsoncore.AppendDocumentElement(dst, "filter", lc.filter) diff --git a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/list_indexes.go b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/list_indexes.go index 9e5901b997..e9485cf638 100644 --- a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/list_indexes.go +++ b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/list_indexes.go @@ -87,7 +87,7 @@ func (li *ListIndexes) Execute(ctx context.Context) error { } -func (li *ListIndexes) command(dst []byte, desc description.SelectedServer) ([]byte, error) { +func (li *ListIndexes) command(dst []byte, _ description.SelectedServer) ([]byte, error) { dst = bsoncore.AppendStringElement(dst, "listIndexes", li.collection) cursorIdx, cursorDoc := bsoncore.AppendDocumentStart(nil) diff --git a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/update.go b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/update.go index 816b3709b9..474ccca31a 100644 --- a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/update.go +++ b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/operation/update.go @@ -15,6 +15,7 @@ import ( "go.mongodb.org/mongo-driver/bson" "go.mongodb.org/mongo-driver/bson/bsontype" "go.mongodb.org/mongo-driver/event" + "go.mongodb.org/mongo-driver/internal/logger" "go.mongodb.org/mongo-driver/mongo/description" "go.mongodb.org/mongo-driver/mongo/writeconcern" "go.mongodb.org/mongo-driver/x/bsonx/bsoncore" @@ -44,6 +45,7 @@ type Update struct { serverAPI *driver.ServerAPIOptions let bsoncore.Document timeout *time.Duration + logger *logger.Logger } // Upsert contains the information for an upsert in an Update operation. @@ -162,6 +164,7 @@ func (u *Update) Execute(ctx context.Context) error { Crypt: u.crypt, ServerAPI: u.serverAPI, Timeout: u.timeout, + Logger: u.logger, }.Execute(ctx) } @@ -399,3 +402,13 @@ func (u *Update) Timeout(timeout *time.Duration) *Update { u.timeout = timeout return u } + +// Logger sets the logger for this operation. +func (u *Update) Logger(logger *logger.Logger) *Update { + if u == nil { + u = new(Update) + } + + u.logger = logger + return u +} diff --git a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/topology/fsm.go b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/topology/fsm.go index 1ee8dce496..1251456c6d 100644 --- a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/topology/fsm.go +++ b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/topology/fsm.go @@ -21,7 +21,7 @@ var ( MinSupportedMongoDBVersion = "3.6" // SupportedWireVersions is the range of wire versions supported by the driver. - SupportedWireVersions = description.NewVersionRange(6, 17) + SupportedWireVersions = description.NewVersionRange(6, 21) ) type fsm struct { diff --git a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/topology/pool.go b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/topology/pool.go index b7a15e4ecf..da40fd6a80 100644 --- a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/topology/pool.go +++ b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/topology/pool.go @@ -9,12 +9,14 @@ package topology import ( "context" "fmt" + "net" "sync" "sync/atomic" "time" "go.mongodb.org/mongo-driver/bson/primitive" "go.mongodb.org/mongo-driver/event" + "go.mongodb.org/mongo-driver/internal/logger" "go.mongodb.org/mongo-driver/mongo/address" "go.mongodb.org/mongo-driver/x/mongo/driver" ) @@ -73,6 +75,7 @@ type poolConfig struct { MaxIdleTime time.Duration MaintainInterval time.Duration PoolMonitor *event.PoolMonitor + Logger *logger.Logger handshakeErrFn func(error, uint64, *primitive.ObjectID) } @@ -91,6 +94,7 @@ type pool struct { maxSize uint64 maxConnecting uint64 monitor *event.PoolMonitor + logger *logger.Logger // handshakeErrFn is used to handle any errors that happen during connection establishment and // handshaking. @@ -129,18 +133,56 @@ func (p *pool) getState() int { return p.state } +func mustLogPoolMessage(pool *pool) bool { + return pool.logger != nil && pool.logger.LevelComponentEnabled( + logger.LevelDebug, logger.ComponentConnection) +} + +func logPoolMessage(pool *pool, msg string, keysAndValues ...interface{}) { + host, port, err := net.SplitHostPort(pool.address.String()) + if err != nil { + host = pool.address.String() + port = "" + } + + pool.logger.Print(logger.LevelDebug, + logger.ComponentConnection, + msg, + logger.SerializeConnection(logger.Connection{ + Message: msg, + ServerHost: host, + ServerPort: port, + }, keysAndValues...)...) + +} + +type reason struct { + loggerConn string + event string +} + // connectionPerished checks if a given connection is perished and should be removed from the pool. -func connectionPerished(conn *connection) (string, bool) { +func connectionPerished(conn *connection) (reason, bool) { switch { case conn.closed(): // A connection would only be closed if it encountered a network error during an operation and closed itself. - return event.ReasonError, true + return reason{ + loggerConn: logger.ReasonConnClosedError, + event: event.ReasonError, + }, true case conn.idleTimeoutExpired(): - return event.ReasonIdle, true + return reason{ + loggerConn: logger.ReasonConnClosedIdle, + event: event.ReasonIdle, + }, true case conn.pool.stale(conn): - return event.ReasonStale, true + return reason{ + loggerConn: logger.ReasonConnClosedStale, + event: event.ReasonStale, + }, true } - return "", false + + return reason{}, false } // newPool creates a new pool. It will use the provided options when creating connections. @@ -165,6 +207,7 @@ func newPool(config poolConfig, connOpts ...ConnectionOption) *pool { maxSize: config.MaxPoolSize, maxConnecting: maxConnecting, monitor: config.PoolMonitor, + logger: config.Logger, handshakeErrFn: config.handshakeErrFn, connOpts: connOpts, generation: newPoolGenerationMap(), @@ -202,6 +245,17 @@ func newPool(config poolConfig, connOpts ...ConnectionOption) *pool { go pool.maintain(ctx, pool.backgroundDone) } + if mustLogPoolMessage(pool) { + keysAndValues := logger.KeyValues{ + logger.KeyMaxIdleTimeMS, config.MaxIdleTime.Milliseconds(), + logger.KeyMinPoolSize, config.MinPoolSize, + logger.KeyMaxPoolSize, config.MaxPoolSize, + logger.KeyMaxConnecting, config.MaxConnecting, + } + + logPoolMessage(pool, logger.ConnectionPoolCreated, keysAndValues...) + } + if pool.monitor != nil { pool.monitor.Event(&event.PoolEvent{ Type: event.PoolCreated, @@ -239,12 +293,12 @@ func (p *pool) ready() error { p.state = poolReady p.stateMu.Unlock() - // Signal maintain() to wake up immediately when marking the pool "ready". - select { - case p.maintainReady <- struct{}{}: - default: + if mustLogPoolMessage(p) { + logPoolMessage(p, logger.ConnectionPoolReady) } + // Send event.PoolReady before resuming the maintain() goroutine to guarantee that the + // "pool ready" event is always sent before maintain() starts creating connections. if p.monitor != nil { p.monitor.Event(&event.PoolEvent{ Type: event.PoolReady, @@ -252,6 +306,12 @@ func (p *pool) ready() error { }) } + // Signal maintain() to wake up immediately when marking the pool "ready". + select { + case p.maintainReady <- struct{}{}: + default: + } + return nil } @@ -342,10 +402,17 @@ func (p *pool) close(ctx context.Context) { // Now that we're not holding any locks, remove all of the connections we collected from the // pool. for _, conn := range conns { - _ = p.removeConnection(conn, event.ReasonPoolClosed) + _ = p.removeConnection(conn, reason{ + loggerConn: logger.ReasonConnClosedPoolClosed, + event: event.ReasonPoolClosed, + }, nil) _ = p.closeConnection(conn) // We don't care about errors while closing the connection. } + if mustLogPoolMessage(p) { + logPoolMessage(p, logger.ConnectionPoolClosed) + } + if p.monitor != nil { p.monitor.Event(&event.PoolEvent{ Type: event.PoolClosedEvent, @@ -377,6 +444,10 @@ func (p *pool) unpinConnectionFromTransaction() { // ready, checkOut returns an error. // Based partially on https://cs.opensource.google/go/go/+/refs/tags/go1.16.6:src/net/http/transport.go;l=1324 func (p *pool) checkOut(ctx context.Context) (conn *connection, err error) { + if mustLogPoolMessage(p) { + logPoolMessage(p, logger.ConnectionCheckoutStarted) + } + // TODO(CSOT): If a Timeout was specified at any level, respect the Timeout is server selection, connection // TODO checkout. if p.monitor != nil { @@ -395,6 +466,15 @@ func (p *pool) checkOut(ctx context.Context) (conn *connection, err error) { switch p.state { case poolClosed: p.stateMu.RUnlock() + + if mustLogPoolMessage(p) { + keysAndValues := logger.KeyValues{ + logger.KeyReason, logger.ReasonConnCheckoutFailedPoolClosed, + } + + logPoolMessage(p, logger.ConnectionCheckoutFailed, keysAndValues...) + } + if p.monitor != nil { p.monitor.Event(&event.PoolEvent{ Type: event.GetFailed, @@ -406,6 +486,15 @@ func (p *pool) checkOut(ctx context.Context) (conn *connection, err error) { case poolPaused: err := poolClearedError{err: p.lastClearErr, address: p.address} p.stateMu.RUnlock() + + if mustLogPoolMessage(p) { + keysAndValues := logger.KeyValues{ + logger.KeyReason, logger.ReasonConnCheckoutFailedError, + } + + logPoolMessage(p, logger.ConnectionCheckoutFailed, keysAndValues...) + } + if p.monitor != nil { p.monitor.Event(&event.PoolEvent{ Type: event.GetFailed, @@ -440,6 +529,14 @@ func (p *pool) checkOut(ctx context.Context) (conn *connection, err error) { p.stateMu.RUnlock() if w.err != nil { + if mustLogPoolMessage(p) { + keysAndValues := logger.KeyValues{ + logger.KeyReason, logger.ReasonConnCheckoutFailedError, + } + + logPoolMessage(p, logger.ConnectionCheckoutFailed, keysAndValues...) + } + if p.monitor != nil { p.monitor.Event(&event.PoolEvent{ Type: event.GetFailed, @@ -450,6 +547,14 @@ func (p *pool) checkOut(ctx context.Context) (conn *connection, err error) { return nil, w.err } + if mustLogPoolMessage(p) { + keysAndValues := logger.KeyValues{ + logger.KeyDriverConnectionID, w.conn.driverConnectionID, + } + + logPoolMessage(p, logger.ConnectionCheckedOut, keysAndValues...) + } + if p.monitor != nil { p.monitor.Event(&event.PoolEvent{ Type: event.GetSucceeded, @@ -457,6 +562,7 @@ func (p *pool) checkOut(ctx context.Context) (conn *connection, err error) { ConnectionID: w.conn.driverConnectionID, }) } + return w.conn, nil } @@ -469,6 +575,15 @@ func (p *pool) checkOut(ctx context.Context) (conn *connection, err error) { select { case <-w.ready: if w.err != nil { + if mustLogPoolMessage(p) { + keysAndValues := logger.KeyValues{ + logger.KeyReason, logger.ReasonConnCheckoutFailedError, + logger.KeyError, w.err.Error(), + } + + logPoolMessage(p, logger.ConnectionCheckoutFailed, keysAndValues...) + } + if p.monitor != nil { p.monitor.Event(&event.PoolEvent{ Type: event.GetFailed, @@ -476,9 +591,18 @@ func (p *pool) checkOut(ctx context.Context) (conn *connection, err error) { Reason: event.ReasonConnectionErrored, }) } + return nil, w.err } + if mustLogPoolMessage(p) { + keysAndValues := logger.KeyValues{ + logger.KeyDriverConnectionID, w.conn.driverConnectionID, + } + + logPoolMessage(p, logger.ConnectionCheckedOut, keysAndValues...) + } + if p.monitor != nil { p.monitor.Event(&event.PoolEvent{ Type: event.GetSucceeded, @@ -488,6 +612,14 @@ func (p *pool) checkOut(ctx context.Context) (conn *connection, err error) { } return w.conn, nil case <-ctx.Done(): + if mustLogPoolMessage(p) { + keysAndValues := logger.KeyValues{ + logger.KeyReason, logger.ReasonConnCheckoutFailedTimout, + } + + logPoolMessage(p, logger.ConnectionCheckoutFailed, keysAndValues...) + } + if p.monitor != nil { p.monitor.Event(&event.PoolEvent{ Type: event.GetFailed, @@ -495,6 +627,7 @@ func (p *pool) checkOut(ctx context.Context) (conn *connection, err error) { Reason: event.ReasonTimedOut, }) } + return nil, WaitQueueTimeoutError{ Wrapped: ctx.Err(), PinnedCursorConnections: atomic.LoadUint64(&p.pinnedCursorConnections), @@ -529,7 +662,7 @@ func (p *pool) getGenerationForNewConnection(serviceID *primitive.ObjectID) uint } // removeConnection removes a connection from the pool and emits a "ConnectionClosed" event. -func (p *pool) removeConnection(conn *connection, reason string) error { +func (p *pool) removeConnection(conn *connection, reason reason, err error) error { if conn == nil { return nil } @@ -559,12 +692,26 @@ func (p *pool) removeConnection(conn *connection, reason string) error { p.generation.removeConnection(conn.desc.ServiceID) } + if mustLogPoolMessage(p) { + keysAndValues := logger.KeyValues{ + logger.KeyDriverConnectionID, conn.driverConnectionID, + logger.KeyReason, reason.loggerConn, + } + + if err != nil { + keysAndValues.Add(logger.KeyError, err.Error()) + } + + logPoolMessage(p, logger.ConnectionClosed, keysAndValues...) + } + if p.monitor != nil { p.monitor.Event(&event.PoolEvent{ Type: event.ConnectionClosed, Address: p.address.String(), ConnectionID: conn.driverConnectionID, - Reason: reason, + Reason: reason.event, + Error: err, }) } @@ -581,6 +728,14 @@ func (p *pool) checkIn(conn *connection) error { return ErrWrongPool } + if mustLogPoolMessage(p) { + keysAndValues := logger.KeyValues{ + logger.KeyDriverConnectionID, conn.driverConnectionID, + } + + logPoolMessage(p, logger.ConnectionCheckedIn, keysAndValues...) + } + if p.monitor != nil { p.monitor.Event(&event.PoolEvent{ Type: event.ConnectionReturned, @@ -611,7 +766,7 @@ func (p *pool) checkInNoEvent(conn *connection) error { conn.bumpIdleDeadline() if reason, perished := connectionPerished(conn); perished { - _ = p.removeConnection(conn, reason) + _ = p.removeConnection(conn, reason, nil) go func() { _ = p.closeConnection(conn) }() @@ -619,7 +774,11 @@ func (p *pool) checkInNoEvent(conn *connection) error { } if conn.pool.getState() == poolClosed { - _ = p.removeConnection(conn, event.ReasonPoolClosed) + _ = p.removeConnection(conn, reason{ + loggerConn: logger.ReasonConnClosedPoolClosed, + event: event.ReasonPoolClosed, + }, nil) + go func() { _ = p.closeConnection(conn) }() @@ -706,6 +865,14 @@ func (p *pool) clear(err error, serviceID *primitive.ObjectID) { p.createConnectionsCond.L.Unlock() } + if mustLogPoolMessage(p) { + keysAndValues := logger.KeyValues{ + logger.KeyServiceID, serviceID, + } + + logPoolMessage(p, logger.ConnectionPoolCleared, keysAndValues...) + } + if sendEvent && p.monitor != nil { p.monitor.Event(&event.PoolEvent{ Type: event.PoolCleared, @@ -733,7 +900,7 @@ func (p *pool) getOrQueueForIdleConn(w *wantConn) bool { } if reason, perished := connectionPerished(conn); perished { - _ = conn.pool.removeConnection(conn, reason) + _ = conn.pool.removeConnection(conn, reason, nil) go func() { _ = conn.pool.closeConnection(conn) }() @@ -829,6 +996,14 @@ func (p *pool) createConnections(ctx context.Context, wg *sync.WaitGroup) { continue } + if mustLogPoolMessage(p) { + keysAndValues := logger.KeyValues{ + logger.KeyDriverConnectionID, conn.driverConnectionID, + } + + logPoolMessage(p, logger.ConnectionCreated, keysAndValues...) + } + if p.monitor != nil { p.monitor.Event(&event.PoolEvent{ Type: event.ConnectionCreated, @@ -853,11 +1028,24 @@ func (p *pool) createConnections(ctx context.Context, wg *sync.WaitGroup) { p.handshakeErrFn(err, conn.generation, conn.desc.ServiceID) } - _ = p.removeConnection(conn, event.ReasonError) + _ = p.removeConnection(conn, reason{ + loggerConn: logger.ReasonConnClosedError, + event: event.ReasonError, + }, err) + _ = p.closeConnection(conn) + continue } + if mustLogPoolMessage(p) { + keysAndValues := logger.KeyValues{ + logger.KeyDriverConnectionID, conn.driverConnectionID, + } + + logPoolMessage(p, logger.ConnectionReady, keysAndValues...) + } + if p.monitor != nil { p.monitor.Event(&event.PoolEvent{ Type: event.ConnectionReady, @@ -976,7 +1164,7 @@ func (p *pool) removePerishedConns() { if reason, perished := connectionPerished(conn); perished { p.idleConns[i] = nil - _ = p.removeConnection(conn, reason) + _ = p.removeConnection(conn, reason, nil) go func() { _ = p.closeConnection(conn) }() @@ -1043,7 +1231,9 @@ func (w *wantConn) tryDeliver(conn *connection, err error) bool { if w.conn == nil && w.err == nil { panic("x/mongo/driver/topology: internal error: misuse of tryDeliver") } + close(w.ready) + return true } diff --git a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/topology/server.go b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/topology/server.go index 95ca8e85ba..f0a1c5b05c 100644 --- a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/topology/server.go +++ b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/topology/server.go @@ -177,6 +177,7 @@ func NewServer(addr address.Address, topologyID primitive.ObjectID, opts ...Serv MaxIdleTime: cfg.poolMaxIdleTime, MaintainInterval: cfg.poolMaintainInterval, PoolMonitor: cfg.poolMonitor, + Logger: cfg.logger, handshakeErrFn: s.ProcessHandshakeError, } @@ -756,30 +757,29 @@ func (s *Server) createBaseOperation(conn driver.Connection) *operation.Hello { func (s *Server) check() (description.Server, error) { var descPtr *description.Server var err error - var durationNanos int64 + var duration time.Duration start := time.Now() if s.conn == nil || s.conn.closed() || s.checkWasCancelled() { // Create a new connection if this is the first check, the connection was closed after an error during the previous // check, or the previous check was cancelled. - isNilConn := s.conn == nil - if !isNilConn { + if s.conn != nil { s.publishServerHeartbeatStartedEvent(s.conn.ID(), false) } // Create a new connection and add it's handshake RTT as a sample. err = s.setupHeartbeatConnection() - durationNanos = time.Since(start).Nanoseconds() + duration = time.Since(start) if err == nil { // Use the description from the connection handshake as the value for this check. s.rttMonitor.addSample(s.conn.helloRTT) descPtr = &s.conn.desc - if !isNilConn { - s.publishServerHeartbeatSucceededEvent(s.conn.ID(), durationNanos, s.conn.desc, false) + if s.conn != nil { + s.publishServerHeartbeatSucceededEvent(s.conn.ID(), duration, s.conn.desc, false) } } else { err = unwrapConnectionError(err) - if !isNilConn { - s.publishServerHeartbeatFailedEvent(s.conn.ID(), durationNanos, err, false) + if s.conn != nil { + s.publishServerHeartbeatFailedEvent(s.conn.ID(), duration, err, false) } } } else { @@ -822,19 +822,19 @@ func (s *Server) check() (description.Server, error) { s.conn.setSocketTimeout(s.cfg.heartbeatTimeout) err = baseOperation.Execute(s.heartbeatCtx) } - durationNanos = time.Since(start).Nanoseconds() + duration = time.Since(start) if err == nil { tempDesc := baseOperation.Result(s.address) descPtr = &tempDesc - s.publishServerHeartbeatSucceededEvent(s.conn.ID(), durationNanos, tempDesc, s.conn.getCurrentlyStreaming() || streamable) + s.publishServerHeartbeatSucceededEvent(s.conn.ID(), duration, tempDesc, s.conn.getCurrentlyStreaming() || streamable) } else { // Close the connection here rather than below so we ensure we're not closing a connection that wasn't // successfully created. if s.conn != nil { _ = s.conn.close() } - s.publishServerHeartbeatFailedEvent(s.conn.ID(), durationNanos, err, s.conn.getCurrentlyStreaming() || streamable) + s.publishServerHeartbeatFailedEvent(s.conn.ID(), duration, err, s.conn.getCurrentlyStreaming() || streamable) } } @@ -963,11 +963,13 @@ func (s *Server) publishServerHeartbeatStartedEvent(connectionID string, await b // publishes a ServerHeartbeatSucceededEvent to indicate hello has succeeded func (s *Server) publishServerHeartbeatSucceededEvent(connectionID string, - durationNanos int64, + duration time.Duration, desc description.Server, - await bool) { + await bool, +) { serverHeartbeatSucceeded := &event.ServerHeartbeatSucceededEvent{ - DurationNanos: durationNanos, + DurationNanos: duration.Nanoseconds(), + Duration: duration, Reply: desc, ConnectionID: connectionID, Awaited: await, @@ -980,11 +982,13 @@ func (s *Server) publishServerHeartbeatSucceededEvent(connectionID string, // publishes a ServerHeartbeatFailedEvent to indicate hello has failed func (s *Server) publishServerHeartbeatFailedEvent(connectionID string, - durationNanos int64, + duration time.Duration, err error, - await bool) { + await bool, +) { serverHeartbeatFailed := &event.ServerHeartbeatFailedEvent{ - DurationNanos: durationNanos, + DurationNanos: duration.Nanoseconds(), + Duration: duration, Failure: err, ConnectionID: connectionID, Awaited: await, diff --git a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/topology/server_options.go b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/topology/server_options.go index 73819f9fc3..4272b3f751 100644 --- a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/topology/server_options.go +++ b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/topology/server_options.go @@ -12,6 +12,7 @@ import ( "go.mongodb.org/mongo-driver/bson" "go.mongodb.org/mongo-driver/bson/bsoncodec" "go.mongodb.org/mongo-driver/event" + "go.mongodb.org/mongo-driver/internal/logger" "go.mongodb.org/mongo-driver/x/mongo/driver" "go.mongodb.org/mongo-driver/x/mongo/driver/session" ) @@ -36,6 +37,7 @@ type serverConfig struct { minConns uint64 maxConnecting uint64 poolMonitor *event.PoolMonitor + logger *logger.Logger poolMaxIdleTime time.Duration poolMaintainInterval time.Duration } @@ -193,3 +195,10 @@ func WithServerLoadBalanced(fn func(bool) bool) ServerOption { cfg.loadBalanced = fn(cfg.loadBalanced) } } + +// withLogger configures the logger for the server to use. +func withLogger(fn func() *logger.Logger) ServerOption { + return func(cfg *serverConfig) { + cfg.logger = fn() + } +} diff --git a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/topology/topology.go b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/topology/topology.go index eb0ac425a1..d5a27cbb3a 100644 --- a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/topology/topology.go +++ b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/topology/topology.go @@ -558,13 +558,18 @@ func (t *Topology) selectServerFromDescription(desc description.Topology, return desc.Servers, nil } - var allowed []description.Server - for _, s := range desc.Servers { + allowedIndexes := make([]int, 0, len(desc.Servers)) + for i, s := range desc.Servers { if s.Kind != description.Unknown { - allowed = append(allowed, s) + allowedIndexes = append(allowedIndexes, i) } } + allowed := make([]description.Server, len(allowedIndexes)) + for i, idx := range allowedIndexes { + allowed[i] = desc.Servers[idx] + } + suitable, err := selectionState.selector.SelectServer(desc, allowed) if err != nil { return nil, ServerSelectionError{Wrapped: err, Desc: desc} diff --git a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/topology/topology_options.go b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/topology/topology_options.go index 98b71ea383..67e6cbf9fd 100644 --- a/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/topology/topology_options.go +++ b/vendor/go.mongodb.org/mongo-driver/x/mongo/driver/topology/topology_options.go @@ -8,11 +8,13 @@ package topology import ( "crypto/tls" + "fmt" "net/http" "strings" "time" "go.mongodb.org/mongo-driver/event" + "go.mongodb.org/mongo-driver/internal/logger" "go.mongodb.org/mongo-driver/mongo/description" "go.mongodb.org/mongo-driver/mongo/options" "go.mongodb.org/mongo-driver/x/mongo/driver" @@ -62,7 +64,7 @@ func NewConfig(co *options.ClientOptions, clock *session.ClusterClock) (*Config, var connOpts []ConnectionOption var serverOpts []ServerOption - cfgp := new(Config) + cfgp := &Config{} // Set the default "ServerSelectionTimeout" to 30 seconds. cfgp.ServerSelectionTimeout = defaultServerSelectionTimeout @@ -224,7 +226,7 @@ func NewConfig(co *options.ClientOptions, clock *session.ClusterClock) (*Config, // MaxConIdleTime if co.MaxConnIdleTime != nil { - connOpts = append(connOpts, WithIdleTimeout( + serverOpts = append(serverOpts, WithConnectionPoolMaxIdleTime( func(time.Duration) time.Duration { return *co.MaxConnIdleTime }, )) } @@ -333,6 +335,24 @@ func NewConfig(co *options.ClientOptions, clock *session.ClusterClock) (*Config, ) } + if opts := co.LoggerOptions; opts != nil { + // Build an internal component-level mapping. + componentLevels := make(map[logger.Component]logger.Level) + for component, level := range opts.ComponentLevels { + componentLevels[logger.Component(component)] = logger.Level(level) + } + + log, err := logger.New(opts.Sink, opts.MaxDocumentLength, componentLevels) + if err != nil { + return nil, fmt.Errorf("error creating logger: %w", err) + } + + serverOpts = append( + serverOpts, + withLogger(func() *logger.Logger { return log }), + ) + } + serverOpts = append( serverOpts, WithClock(func(*session.ClusterClock) *session.ClusterClock { return clock }), diff --git a/vendor/gocloud.dev/internal/useragent/useragent.go b/vendor/gocloud.dev/internal/useragent/useragent.go index 5d273d72cd..74f9879b87 100644 --- a/vendor/gocloud.dev/internal/useragent/useragent.go +++ b/vendor/gocloud.dev/internal/useragent/useragent.go @@ -26,7 +26,7 @@ import ( const ( prefix = "go-cloud" - version = "0.32.0" + version = "0.33.0" ) // ClientOption returns an option.ClientOption that sets a Go CDK User-Agent. diff --git a/vendor/golang.org/x/net/html/render.go b/vendor/golang.org/x/net/html/render.go index 8b28031905..e8c1233455 100644 --- a/vendor/golang.org/x/net/html/render.go +++ b/vendor/golang.org/x/net/html/render.go @@ -194,9 +194,8 @@ func render1(w writer, n *Node) error { } } - // Render any child nodes. - switch n.Data { - case "iframe", "noembed", "noframes", "noscript", "plaintext", "script", "style", "xmp": + // Render any child nodes + if childTextNodesAreLiteral(n) { for c := n.FirstChild; c != nil; c = c.NextSibling { if c.Type == TextNode { if _, err := w.WriteString(c.Data); err != nil { @@ -213,7 +212,7 @@ func render1(w writer, n *Node) error { // last element in the file, with no closing tag. return plaintextAbort } - default: + } else { for c := n.FirstChild; c != nil; c = c.NextSibling { if err := render1(w, c); err != nil { return err @@ -231,6 +230,27 @@ func render1(w writer, n *Node) error { return w.WriteByte('>') } +func childTextNodesAreLiteral(n *Node) bool { + // Per WHATWG HTML 13.3, if the parent of the current node is a style, + // script, xmp, iframe, noembed, noframes, or plaintext element, and the + // current node is a text node, append the value of the node's data + // literally. The specification is not explicit about it, but we only + // enforce this if we are in the HTML namespace (i.e. when the namespace is + // ""). + // NOTE: we also always include noscript elements, although the + // specification states that they should only be rendered as such if + // scripting is enabled for the node (which is not something we track). + if n.Namespace != "" { + return false + } + switch n.Data { + case "iframe", "noembed", "noframes", "noscript", "plaintext", "script", "style", "xmp": + return true + default: + return false + } +} + // writeQuoted writes s to w surrounded by quotes. Normally it will use double // quotes, but if s contains a double quote, it will use single quotes. // It is used for writing the identifiers in a doctype declaration. diff --git a/vendor/golang.org/x/net/http2/transport.go b/vendor/golang.org/x/net/http2/transport.go index b9632380e7..b20c749171 100644 --- a/vendor/golang.org/x/net/http2/transport.go +++ b/vendor/golang.org/x/net/http2/transport.go @@ -518,11 +518,14 @@ func (t *Transport) RoundTrip(req *http.Request) (*http.Response, error) { func authorityAddr(scheme string, authority string) (addr string) { host, port, err := net.SplitHostPort(authority) if err != nil { // authority didn't have a port + host = authority + port = "" + } + if port == "" { // authority's port was empty port = "443" if scheme == "http" { port = "80" } - host = authority } if a, err := idna.ToASCII(host); err == nil { host = a diff --git a/vendor/google.golang.org/api/internal/version.go b/vendor/google.golang.org/api/internal/version.go index 7a7266777b..6fdda3b791 100644 --- a/vendor/google.golang.org/api/internal/version.go +++ b/vendor/google.golang.org/api/internal/version.go @@ -5,4 +5,4 @@ package internal // Version is the current tagged release of the library. -const Version = "0.132.0" +const Version = "0.134.0" diff --git a/vendor/google.golang.org/grpc/attributes/attributes.go b/vendor/google.golang.org/grpc/attributes/attributes.go index 3efca45914..49712aca33 100644 --- a/vendor/google.golang.org/grpc/attributes/attributes.go +++ b/vendor/google.golang.org/grpc/attributes/attributes.go @@ -112,19 +112,31 @@ func (a *Attributes) String() string { sb.WriteString("{") first := true for k, v := range a.m { - var key, val string - if str, ok := k.(interface{ String() string }); ok { - key = str.String() - } - if str, ok := v.(interface{ String() string }); ok { - val = str.String() - } if !first { sb.WriteString(", ") } - sb.WriteString(fmt.Sprintf("%q: %q, ", key, val)) + sb.WriteString(fmt.Sprintf("%q: %q ", str(k), str(v))) first = false } sb.WriteString("}") return sb.String() } + +func str(x interface{}) string { + if v, ok := x.(fmt.Stringer); ok { + return v.String() + } else if v, ok := x.(string); ok { + return v + } + return fmt.Sprintf("<%p>", x) +} + +// MarshalJSON helps implement the json.Marshaler interface, thereby rendering +// the Attributes correctly when printing (via pretty.JSON) structs containing +// Attributes as fields. +// +// Is it impossible to unmarshal attributes from a JSON representation and this +// method is meant only for debugging purposes. +func (a *Attributes) MarshalJSON() ([]byte, error) { + return []byte(a.String()), nil +} diff --git a/vendor/google.golang.org/grpc/clientconn.go b/vendor/google.golang.org/grpc/clientconn.go index 95a7459b02..bfd7555a8b 100644 --- a/vendor/google.golang.org/grpc/clientconn.go +++ b/vendor/google.golang.org/grpc/clientconn.go @@ -37,6 +37,7 @@ import ( "google.golang.org/grpc/internal/backoff" "google.golang.org/grpc/internal/channelz" "google.golang.org/grpc/internal/grpcsync" + "google.golang.org/grpc/internal/pretty" iresolver "google.golang.org/grpc/internal/resolver" "google.golang.org/grpc/internal/transport" "google.golang.org/grpc/keepalive" @@ -867,6 +868,20 @@ func (cc *ClientConn) handleSubConnStateChange(sc balancer.SubConn, s connectivi cc.balancerWrapper.updateSubConnState(sc, s, err) } +// Makes a copy of the input addresses slice and clears out the balancer +// attributes field. Addresses are passed during subconn creation and address +// update operations. In both cases, we will clear the balancer attributes by +// calling this function, and therefore we will be able to use the Equal method +// provided by the resolver.Address type for comparison. +func copyAddressesWithoutBalancerAttributes(in []resolver.Address) []resolver.Address { + out := make([]resolver.Address, len(in)) + for i := range in { + out[i] = in[i] + out[i].BalancerAttributes = nil + } + return out +} + // newAddrConn creates an addrConn for addrs and adds it to cc.conns. // // Caller needs to make sure len(addrs) > 0. @@ -874,7 +889,7 @@ func (cc *ClientConn) newAddrConn(addrs []resolver.Address, opts balancer.NewSub ac := &addrConn{ state: connectivity.Idle, cc: cc, - addrs: addrs, + addrs: copyAddressesWithoutBalancerAttributes(addrs), scopts: opts, dopts: cc.dopts, czData: new(channelzData), @@ -995,8 +1010,9 @@ func equalAddresses(a, b []resolver.Address) bool { // connections or connection attempts. func (ac *addrConn) updateAddrs(addrs []resolver.Address) { ac.mu.Lock() - channelz.Infof(logger, ac.channelzID, "addrConn: updateAddrs curAddr: %v, addrs: %v", ac.curAddr, addrs) + channelz.Infof(logger, ac.channelzID, "addrConn: updateAddrs curAddr: %v, addrs: %v", pretty.ToJSON(ac.curAddr), pretty.ToJSON(addrs)) + addrs = copyAddressesWithoutBalancerAttributes(addrs) if equalAddresses(ac.addrs, addrs) { ac.mu.Unlock() return @@ -1807,19 +1823,70 @@ func (cc *ClientConn) parseTargetAndFindResolver() error { } // parseTarget uses RFC 3986 semantics to parse the given target into a -// resolver.Target struct containing scheme, authority and url. Query -// params are stripped from the endpoint. +// resolver.Target struct containing url. Query params are stripped from the +// endpoint. func parseTarget(target string) (resolver.Target, error) { u, err := url.Parse(target) if err != nil { return resolver.Target{}, err } - return resolver.Target{ - Scheme: u.Scheme, - Authority: u.Host, - URL: *u, - }, nil + return resolver.Target{URL: *u}, nil +} + +func encodeAuthority(authority string) string { + const upperhex = "0123456789ABCDEF" + + // Return for characters that must be escaped as per + // Valid chars are mentioned here: + // https://datatracker.ietf.org/doc/html/rfc3986#section-3.2 + shouldEscape := func(c byte) bool { + // Alphanum are always allowed. + if 'a' <= c && c <= 'z' || 'A' <= c && c <= 'Z' || '0' <= c && c <= '9' { + return false + } + switch c { + case '-', '_', '.', '~': // Unreserved characters + return false + case '!', '$', '&', '\'', '(', ')', '*', '+', ',', ';', '=': // Subdelim characters + return false + case ':', '[', ']', '@': // Authority related delimeters + return false + } + // Everything else must be escaped. + return true + } + + hexCount := 0 + for i := 0; i < len(authority); i++ { + c := authority[i] + if shouldEscape(c) { + hexCount++ + } + } + + if hexCount == 0 { + return authority + } + + required := len(authority) + 2*hexCount + t := make([]byte, required) + + j := 0 + // This logic is a barebones version of escape in the go net/url library. + for i := 0; i < len(authority); i++ { + switch c := authority[i]; { + case shouldEscape(c): + t[j] = '%' + t[j+1] = upperhex[c>>4] + t[j+2] = upperhex[c&15] + j += 3 + default: + t[j] = authority[i] + j++ + } + } + return string(t) } // Determine channel authority. The order of precedence is as follows: @@ -1872,7 +1939,11 @@ func (cc *ClientConn) determineAuthority() error { // the channel authority given the user's dial target. For resolvers // which don't implement this interface, we will use the endpoint from // "scheme://authority/endpoint" as the default authority. - cc.authority = endpoint + // Escape the endpoint to handle use cases where the endpoint + // might not be a valid authority by default. + // For example an endpoint which has multiple paths like + // 'a/b/c', which is not a valid authority by default. + cc.authority = encodeAuthority(endpoint) } channelz.Infof(logger, cc.channelzID, "Channel authority set to %q", cc.authority) return nil diff --git a/vendor/google.golang.org/grpc/credentials/alts/internal/handshaker/handshaker.go b/vendor/google.golang.org/grpc/credentials/alts/internal/handshaker/handshaker.go index 150ae55767..0854e7af65 100644 --- a/vendor/google.golang.org/grpc/credentials/alts/internal/handshaker/handshaker.go +++ b/vendor/google.golang.org/grpc/credentials/alts/internal/handshaker/handshaker.go @@ -25,8 +25,8 @@ import ( "fmt" "io" "net" - "sync" + "golang.org/x/sync/semaphore" grpc "google.golang.org/grpc" "google.golang.org/grpc/codes" "google.golang.org/grpc/credentials" @@ -35,15 +35,13 @@ import ( "google.golang.org/grpc/credentials/alts/internal/conn" altsgrpc "google.golang.org/grpc/credentials/alts/internal/proto/grpc_gcp" altspb "google.golang.org/grpc/credentials/alts/internal/proto/grpc_gcp" + "google.golang.org/grpc/internal/envconfig" ) const ( // The maximum byte size of receive frames. frameLimit = 64 * 1024 // 64 KB rekeyRecordProtocolName = "ALTSRP_GCM_AES128_REKEY" - // maxPendingHandshakes represents the maximum number of concurrent - // handshakes. - maxPendingHandshakes = 100 ) var ( @@ -59,9 +57,9 @@ var ( return conn.NewAES128GCMRekey(s, keyData) }, } - // control number of concurrent created (but not closed) handshakers. - mu sync.Mutex - concurrentHandshakes = int64(0) + // control number of concurrent created (but not closed) handshakes. + clientHandshakes = semaphore.NewWeighted(int64(envconfig.ALTSMaxConcurrentHandshakes)) + serverHandshakes = semaphore.NewWeighted(int64(envconfig.ALTSMaxConcurrentHandshakes)) // errDropped occurs when maxPendingHandshakes is reached. errDropped = errors.New("maximum number of concurrent ALTS handshakes is reached") // errOutOfBound occurs when the handshake service returns a consumed @@ -77,30 +75,6 @@ func init() { } } -func acquire() bool { - mu.Lock() - // If we need n to be configurable, we can pass it as an argument. - n := int64(1) - success := maxPendingHandshakes-concurrentHandshakes >= n - if success { - concurrentHandshakes += n - } - mu.Unlock() - return success -} - -func release() { - mu.Lock() - // If we need n to be configurable, we can pass it as an argument. - n := int64(1) - concurrentHandshakes -= n - if concurrentHandshakes < 0 { - mu.Unlock() - panic("bad release") - } - mu.Unlock() -} - // ClientHandshakerOptions contains the client handshaker options that can // provided by the caller. type ClientHandshakerOptions struct { @@ -134,10 +108,6 @@ func DefaultServerHandshakerOptions() *ServerHandshakerOptions { return &ServerHandshakerOptions{} } -// TODO: add support for future local and remote endpoint in both client options -// and server options (server options struct does not exist now. When -// caller can provide endpoints, it should be created. - // altsHandshaker is used to complete an ALTS handshake between client and // server. This handshaker talks to the ALTS handshaker service in the metadata // server. @@ -185,10 +155,10 @@ func NewServerHandshaker(ctx context.Context, conn *grpc.ClientConn, c net.Conn, // ClientHandshake starts and completes a client ALTS handshake for GCP. Once // done, ClientHandshake returns a secure connection. func (h *altsHandshaker) ClientHandshake(ctx context.Context) (net.Conn, credentials.AuthInfo, error) { - if !acquire() { + if !clientHandshakes.TryAcquire(1) { return nil, nil, errDropped } - defer release() + defer clientHandshakes.Release(1) if h.side != core.ClientSide { return nil, nil, errors.New("only handshakers created using NewClientHandshaker can perform a client handshaker") @@ -238,10 +208,10 @@ func (h *altsHandshaker) ClientHandshake(ctx context.Context) (net.Conn, credent // ServerHandshake starts and completes a server ALTS handshake for GCP. Once // done, ServerHandshake returns a secure connection. func (h *altsHandshaker) ServerHandshake(ctx context.Context) (net.Conn, credentials.AuthInfo, error) { - if !acquire() { + if !serverHandshakes.TryAcquire(1) { return nil, nil, errDropped } - defer release() + defer serverHandshakes.Release(1) if h.side != core.ServerSide { return nil, nil, errors.New("only handshakers created using NewServerHandshaker can perform a server handshaker") @@ -264,8 +234,6 @@ func (h *altsHandshaker) ServerHandshake(ctx context.Context) (net.Conn, credent } // Prepare server parameters. - // TODO: currently only ALTS parameters are provided. Might need to use - // more options in the future. params := make(map[int32]*altspb.ServerHandshakeParameters) params[int32(altspb.HandshakeProtocol_ALTS)] = &altspb.ServerHandshakeParameters{ RecordProtocols: recordProtocols, @@ -391,3 +359,10 @@ func (h *altsHandshaker) Close() { h.stream.CloseSend() } } + +// ResetConcurrentHandshakeSemaphoreForTesting resets the handshake semaphores +// to allow numberOfAllowedHandshakes concurrent handshakes each. +func ResetConcurrentHandshakeSemaphoreForTesting(numberOfAllowedHandshakes int64) { + clientHandshakes = semaphore.NewWeighted(numberOfAllowedHandshakes) + serverHandshakes = semaphore.NewWeighted(numberOfAllowedHandshakes) +} diff --git a/vendor/google.golang.org/grpc/dialoptions.go b/vendor/google.golang.org/grpc/dialoptions.go index 15a3d5102a..23ea95237e 100644 --- a/vendor/google.golang.org/grpc/dialoptions.go +++ b/vendor/google.golang.org/grpc/dialoptions.go @@ -78,6 +78,7 @@ type dialOptions struct { defaultServiceConfigRawJSON *string resolvers []resolver.Builder idleTimeout time.Duration + recvBufferPool SharedBufferPool } // DialOption configures how we set up the connection. @@ -628,6 +629,7 @@ func defaultDialOptions() dialOptions { ReadBufferSize: defaultReadBufSize, UseProxy: true, }, + recvBufferPool: nopBufferPool{}, } } @@ -676,3 +678,24 @@ func WithIdleTimeout(d time.Duration) DialOption { o.idleTimeout = d }) } + +// WithRecvBufferPool returns a DialOption that configures the ClientConn +// to use the provided shared buffer pool for parsing incoming messages. Depending +// on the application's workload, this could result in reduced memory allocation. +// +// If you are unsure about how to implement a memory pool but want to utilize one, +// begin with grpc.NewSharedBufferPool. +// +// Note: The shared buffer pool feature will not be active if any of the following +// options are used: WithStatsHandler, EnableTracing, or binary logging. In such +// cases, the shared buffer pool will be ignored. +// +// # Experimental +// +// Notice: This API is EXPERIMENTAL and may be changed or removed in a +// later release. +func WithRecvBufferPool(bufferPool SharedBufferPool) DialOption { + return newFuncDialOption(func(o *dialOptions) { + o.recvBufferPool = bufferPool + }) +} diff --git a/vendor/google.golang.org/grpc/internal/envconfig/envconfig.go b/vendor/google.golang.org/grpc/internal/envconfig/envconfig.go index 80fd5c7d2a..77c2c0b89f 100644 --- a/vendor/google.golang.org/grpc/internal/envconfig/envconfig.go +++ b/vendor/google.golang.org/grpc/internal/envconfig/envconfig.go @@ -40,6 +40,9 @@ var ( // pick_first LB policy, which can be enabled by setting the environment // variable "GRPC_EXPERIMENTAL_PICKFIRST_LB_CONFIG" to "true". PickFirstLBConfig = boolFromEnv("GRPC_EXPERIMENTAL_PICKFIRST_LB_CONFIG", false) + // ALTSMaxConcurrentHandshakes is the maximum number of concurrent ALTS + // handshakes that can be performed. + ALTSMaxConcurrentHandshakes = uint64FromEnv("GRPC_ALTS_MAX_CONCURRENT_HANDSHAKES", 100, 1, 100) ) func boolFromEnv(envVar string, def bool) bool { diff --git a/vendor/google.golang.org/grpc/internal/grpcrand/grpcrand.go b/vendor/google.golang.org/grpc/internal/grpcrand/grpcrand.go index d08e3e9076..aa97273e7d 100644 --- a/vendor/google.golang.org/grpc/internal/grpcrand/grpcrand.go +++ b/vendor/google.golang.org/grpc/internal/grpcrand/grpcrand.go @@ -80,6 +80,13 @@ func Uint32() uint32 { return r.Uint32() } +// ExpFloat64 implements rand.ExpFloat64 on the grpcrand global source. +func ExpFloat64() float64 { + mu.Lock() + defer mu.Unlock() + return r.ExpFloat64() +} + // Shuffle implements rand.Shuffle on the grpcrand global source. var Shuffle = func(n int, f func(int, int)) { mu.Lock() diff --git a/vendor/google.golang.org/grpc/internal/grpcsync/pubsub.go b/vendor/google.golang.org/grpc/internal/grpcsync/pubsub.go new file mode 100644 index 0000000000..f58b5ffa6b --- /dev/null +++ b/vendor/google.golang.org/grpc/internal/grpcsync/pubsub.go @@ -0,0 +1,136 @@ +/* + * + * Copyright 2023 gRPC authors. + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + */ + +package grpcsync + +import ( + "context" + "sync" +) + +// Subscriber represents an entity that is subscribed to messages published on +// a PubSub. It wraps the callback to be invoked by the PubSub when a new +// message is published. +type Subscriber interface { + // OnMessage is invoked when a new message is published. Implementations + // must not block in this method. + OnMessage(msg interface{}) +} + +// PubSub is a simple one-to-many publish-subscribe system that supports +// messages of arbitrary type. It guarantees that messages are delivered in +// the same order in which they were published. +// +// Publisher invokes the Publish() method to publish new messages, while +// subscribers interested in receiving these messages register a callback +// via the Subscribe() method. +// +// Once a PubSub is stopped, no more messages can be published, and +// it is guaranteed that no more subscriber callback will be invoked. +type PubSub struct { + cs *CallbackSerializer + cancel context.CancelFunc + + // Access to the below fields are guarded by this mutex. + mu sync.Mutex + msg interface{} + subscribers map[Subscriber]bool + stopped bool +} + +// NewPubSub returns a new PubSub instance. +func NewPubSub() *PubSub { + ctx, cancel := context.WithCancel(context.Background()) + return &PubSub{ + cs: NewCallbackSerializer(ctx), + cancel: cancel, + subscribers: map[Subscriber]bool{}, + } +} + +// Subscribe registers the provided Subscriber to the PubSub. +// +// If the PubSub contains a previously published message, the Subscriber's +// OnMessage() callback will be invoked asynchronously with the existing +// message to begin with, and subsequently for every newly published message. +// +// The caller is responsible for invoking the returned cancel function to +// unsubscribe itself from the PubSub. +func (ps *PubSub) Subscribe(sub Subscriber) (cancel func()) { + ps.mu.Lock() + defer ps.mu.Unlock() + + if ps.stopped { + return func() {} + } + + ps.subscribers[sub] = true + + if ps.msg != nil { + msg := ps.msg + ps.cs.Schedule(func(context.Context) { + ps.mu.Lock() + defer ps.mu.Unlock() + if !ps.subscribers[sub] { + return + } + sub.OnMessage(msg) + }) + } + + return func() { + ps.mu.Lock() + defer ps.mu.Unlock() + delete(ps.subscribers, sub) + } +} + +// Publish publishes the provided message to the PubSub, and invokes +// callbacks registered by subscribers asynchronously. +func (ps *PubSub) Publish(msg interface{}) { + ps.mu.Lock() + defer ps.mu.Unlock() + + if ps.stopped { + return + } + + ps.msg = msg + for sub := range ps.subscribers { + s := sub + ps.cs.Schedule(func(context.Context) { + ps.mu.Lock() + defer ps.mu.Unlock() + if !ps.subscribers[s] { + return + } + s.OnMessage(msg) + }) + } +} + +// Stop shuts down the PubSub and releases any resources allocated by it. +// It is guaranteed that no subscriber callbacks would be invoked once this +// method returns. +func (ps *PubSub) Stop() { + ps.mu.Lock() + defer ps.mu.Unlock() + ps.stopped = true + + ps.cancel() +} diff --git a/vendor/google.golang.org/grpc/internal/resolver/dns/dns_resolver.go b/vendor/google.golang.org/grpc/internal/resolver/dns/dns_resolver.go index 09a667f33c..99e1e5b36c 100644 --- a/vendor/google.golang.org/grpc/internal/resolver/dns/dns_resolver.go +++ b/vendor/google.golang.org/grpc/internal/resolver/dns/dns_resolver.go @@ -62,7 +62,8 @@ const ( defaultPort = "443" defaultDNSSvrPort = "53" golang = "GO" - // txtPrefix is the prefix string to be prepended to the host name for txt record lookup. + // txtPrefix is the prefix string to be prepended to the host name for txt + // record lookup. txtPrefix = "_grpc_config." // In DNS, service config is encoded in a TXT record via the mechanism // described in RFC-1464 using the attribute name grpc_config. @@ -86,14 +87,14 @@ var ( minDNSResRate = 30 * time.Second ) -var customAuthorityDialler = func(authority string) func(ctx context.Context, network, address string) (net.Conn, error) { - return func(ctx context.Context, network, address string) (net.Conn, error) { +var addressDialer = func(address string) func(context.Context, string, string) (net.Conn, error) { + return func(ctx context.Context, network, _ string) (net.Conn, error) { var dialer net.Dialer - return dialer.DialContext(ctx, network, authority) + return dialer.DialContext(ctx, network, address) } } -var customAuthorityResolver = func(authority string) (netResolver, error) { +var newNetResolver = func(authority string) (netResolver, error) { host, port, err := parseTarget(authority, defaultDNSSvrPort) if err != nil { return nil, err @@ -103,7 +104,7 @@ var customAuthorityResolver = func(authority string) (netResolver, error) { return &net.Resolver{ PreferGo: true, - Dial: customAuthorityDialler(authorityWithPort), + Dial: addressDialer(authorityWithPort), }, nil } @@ -114,7 +115,8 @@ func NewBuilder() resolver.Builder { type dnsBuilder struct{} -// Build creates and starts a DNS resolver that watches the name resolution of the target. +// Build creates and starts a DNS resolver that watches the name resolution of +// the target. func (b *dnsBuilder) Build(target resolver.Target, cc resolver.ClientConn, opts resolver.BuildOptions) (resolver.Resolver, error) { host, port, err := parseTarget(target.Endpoint(), defaultPort) if err != nil { @@ -143,7 +145,7 @@ func (b *dnsBuilder) Build(target resolver.Target, cc resolver.ClientConn, opts if target.URL.Host == "" { d.resolver = defaultResolver } else { - d.resolver, err = customAuthorityResolver(target.URL.Host) + d.resolver, err = newNetResolver(target.URL.Host) if err != nil { return nil, err } @@ -180,19 +182,22 @@ type dnsResolver struct { ctx context.Context cancel context.CancelFunc cc resolver.ClientConn - // rn channel is used by ResolveNow() to force an immediate resolution of the target. + // rn channel is used by ResolveNow() to force an immediate resolution of the + // target. rn chan struct{} - // wg is used to enforce Close() to return after the watcher() goroutine has finished. - // Otherwise, data race will be possible. [Race Example] in dns_resolver_test we - // replace the real lookup functions with mocked ones to facilitate testing. - // If Close() doesn't wait for watcher() goroutine finishes, race detector sometimes - // will warns lookup (READ the lookup function pointers) inside watcher() goroutine - // has data race with replaceNetFunc (WRITE the lookup function pointers). + // wg is used to enforce Close() to return after the watcher() goroutine has + // finished. Otherwise, data race will be possible. [Race Example] in + // dns_resolver_test we replace the real lookup functions with mocked ones to + // facilitate testing. If Close() doesn't wait for watcher() goroutine + // finishes, race detector sometimes will warns lookup (READ the lookup + // function pointers) inside watcher() goroutine has data race with + // replaceNetFunc (WRITE the lookup function pointers). wg sync.WaitGroup disableServiceConfig bool } -// ResolveNow invoke an immediate resolution of the target that this dnsResolver watches. +// ResolveNow invoke an immediate resolution of the target that this +// dnsResolver watches. func (d *dnsResolver) ResolveNow(resolver.ResolveNowOptions) { select { case d.rn <- struct{}{}: @@ -220,8 +225,8 @@ func (d *dnsResolver) watcher() { var timer *time.Timer if err == nil { - // Success resolving, wait for the next ResolveNow. However, also wait 30 seconds at the very least - // to prevent constantly re-resolving. + // Success resolving, wait for the next ResolveNow. However, also wait 30 + // seconds at the very least to prevent constantly re-resolving. backoffIndex = 1 timer = newTimerDNSResRate(minDNSResRate) select { @@ -231,7 +236,8 @@ func (d *dnsResolver) watcher() { case <-d.rn: } } else { - // Poll on an error found in DNS Resolver or an error received from ClientConn. + // Poll on an error found in DNS Resolver or an error received from + // ClientConn. timer = newTimer(backoff.DefaultExponential.Backoff(backoffIndex)) backoffIndex++ } @@ -278,7 +284,8 @@ func (d *dnsResolver) lookupSRV() ([]resolver.Address, error) { } func handleDNSError(err error, lookupType string) error { - if dnsErr, ok := err.(*net.DNSError); ok && !dnsErr.IsTimeout && !dnsErr.IsTemporary { + dnsErr, ok := err.(*net.DNSError) + if ok && !dnsErr.IsTimeout && !dnsErr.IsTemporary { // Timeouts and temporary errors should be communicated to gRPC to // attempt another DNS query (with backoff). Other errors should be // suppressed (they may represent the absence of a TXT record). @@ -307,10 +314,12 @@ func (d *dnsResolver) lookupTXT() *serviceconfig.ParseResult { res += s } - // TXT record must have "grpc_config=" attribute in order to be used as service config. + // TXT record must have "grpc_config=" attribute in order to be used as + // service config. if !strings.HasPrefix(res, txtAttribute) { logger.Warningf("dns: TXT record %v missing %v attribute", res, txtAttribute) - // This is not an error; it is the equivalent of not having a service config. + // This is not an error; it is the equivalent of not having a service + // config. return nil } sc := canaryingSC(strings.TrimPrefix(res, txtAttribute)) @@ -352,9 +361,10 @@ func (d *dnsResolver) lookup() (*resolver.State, error) { return &state, nil } -// formatIP returns ok = false if addr is not a valid textual representation of an IP address. -// If addr is an IPv4 address, return the addr and ok = true. -// If addr is an IPv6 address, return the addr enclosed in square brackets and ok = true. +// formatIP returns ok = false if addr is not a valid textual representation of +// an IP address. If addr is an IPv4 address, return the addr and ok = true. +// If addr is an IPv6 address, return the addr enclosed in square brackets and +// ok = true. func formatIP(addr string) (addrIP string, ok bool) { ip := net.ParseIP(addr) if ip == nil { @@ -366,10 +376,10 @@ func formatIP(addr string) (addrIP string, ok bool) { return "[" + addr + "]", true } -// parseTarget takes the user input target string and default port, returns formatted host and port info. -// If target doesn't specify a port, set the port to be the defaultPort. -// If target is in IPv6 format and host-name is enclosed in square brackets, brackets -// are stripped when setting the host. +// parseTarget takes the user input target string and default port, returns +// formatted host and port info. If target doesn't specify a port, set the port +// to be the defaultPort. If target is in IPv6 format and host-name is enclosed +// in square brackets, brackets are stripped when setting the host. // examples: // target: "www.google.com" defaultPort: "443" returns host: "www.google.com", port: "443" // target: "ipv4-host:80" defaultPort: "443" returns host: "ipv4-host", port: "80" @@ -385,12 +395,14 @@ func parseTarget(target, defaultPort string) (host, port string, err error) { } if host, port, err = net.SplitHostPort(target); err == nil { if port == "" { - // If the port field is empty (target ends with colon), e.g. "[::1]:", this is an error. + // If the port field is empty (target ends with colon), e.g. "[::1]:", + // this is an error. return "", "", errEndsWithColon } // target has port, i.e ipv4-host:port, [ipv6-host]:port, host-name:port if host == "" { - // Keep consistent with net.Dial(): If the host is empty, as in ":80", the local system is assumed. + // Keep consistent with net.Dial(): If the host is empty, as in ":80", + // the local system is assumed. host = "localhost" } return host, port, nil diff --git a/vendor/google.golang.org/grpc/internal/transport/http2_server.go b/vendor/google.golang.org/grpc/internal/transport/http2_server.go index 79e86ba088..f960640128 100644 --- a/vendor/google.golang.org/grpc/internal/transport/http2_server.go +++ b/vendor/google.golang.org/grpc/internal/transport/http2_server.go @@ -238,7 +238,7 @@ func NewServerTransport(conn net.Conn, config *ServerConfig) (_ ServerTransport, kp.Timeout = defaultServerKeepaliveTimeout } if kp.Time != infinity { - if err = syscall.SetTCPUserTimeout(conn, kp.Timeout); err != nil { + if err = syscall.SetTCPUserTimeout(rawConn, kp.Timeout); err != nil { return nil, connectionErrorf(false, err, "transport: failed to set TCP_USER_TIMEOUT: %v", err) } } diff --git a/vendor/google.golang.org/grpc/resolver/resolver.go b/vendor/google.golang.org/grpc/resolver/resolver.go index 353c10b69a..d8db6f5d34 100644 --- a/vendor/google.golang.org/grpc/resolver/resolver.go +++ b/vendor/google.golang.org/grpc/resolver/resolver.go @@ -142,6 +142,10 @@ type Address struct { // Equal returns whether a and o are identical. Metadata is compared directly, // not with any recursive introspection. +// +// This method compares all fields of the address. When used to tell apart +// addresses during subchannel creation or connection establishment, it might be +// more appropriate for the caller to implement custom equality logic. func (a Address) Equal(o Address) bool { return a.Addr == o.Addr && a.ServerName == o.ServerName && a.Attributes.Equal(o.Attributes) && @@ -264,10 +268,6 @@ type ClientConn interface { // - "unknown_scheme://authority/endpoint" // Target{Scheme: resolver.GetDefaultScheme(), Endpoint: "unknown_scheme://authority/endpoint"} type Target struct { - // Deprecated: use URL.Scheme instead. - Scheme string - // Deprecated: use URL.Host instead. - Authority string // URL contains the parsed dial target with an optional default scheme added // to it if the original dial target contained no scheme or contained an // unregistered scheme. Any query params specified in the original dial diff --git a/vendor/google.golang.org/grpc/rpc_util.go b/vendor/google.golang.org/grpc/rpc_util.go index 2030736a30..a844d28f49 100644 --- a/vendor/google.golang.org/grpc/rpc_util.go +++ b/vendor/google.golang.org/grpc/rpc_util.go @@ -577,6 +577,9 @@ type parser struct { // The header of a gRPC message. Find more detail at // https://github.com/grpc/grpc/blob/master/doc/PROTOCOL-HTTP2.md header [5]byte + + // recvBufferPool is the pool of shared receive buffers. + recvBufferPool SharedBufferPool } // recvMsg reads a complete gRPC message from the stream. @@ -610,9 +613,7 @@ func (p *parser) recvMsg(maxReceiveMessageSize int) (pf payloadFormat, msg []byt if int(length) > maxReceiveMessageSize { return 0, nil, status.Errorf(codes.ResourceExhausted, "grpc: received message larger than max (%d vs. %d)", length, maxReceiveMessageSize) } - // TODO(bradfitz,zhaoq): garbage. reuse buffer after proto decoding instead - // of making it for each message: - msg = make([]byte, int(length)) + msg = p.recvBufferPool.Get(int(length)) if _, err := p.r.Read(msg); err != nil { if err == io.EOF { err = io.ErrUnexpectedEOF @@ -726,12 +727,12 @@ type payloadInfo struct { } func recvAndDecompress(p *parser, s *transport.Stream, dc Decompressor, maxReceiveMessageSize int, payInfo *payloadInfo, compressor encoding.Compressor) ([]byte, error) { - pf, d, err := p.recvMsg(maxReceiveMessageSize) + pf, buf, err := p.recvMsg(maxReceiveMessageSize) if err != nil { return nil, err } if payInfo != nil { - payInfo.compressedLength = len(d) + payInfo.compressedLength = len(buf) } if st := checkRecvPayload(pf, s.RecvCompress(), compressor != nil || dc != nil); st != nil { @@ -743,10 +744,10 @@ func recvAndDecompress(p *parser, s *transport.Stream, dc Decompressor, maxRecei // To match legacy behavior, if the decompressor is set by WithDecompressor or RPCDecompressor, // use this decompressor as the default. if dc != nil { - d, err = dc.Do(bytes.NewReader(d)) - size = len(d) + buf, err = dc.Do(bytes.NewReader(buf)) + size = len(buf) } else { - d, size, err = decompress(compressor, d, maxReceiveMessageSize) + buf, size, err = decompress(compressor, buf, maxReceiveMessageSize) } if err != nil { return nil, status.Errorf(codes.Internal, "grpc: failed to decompress the received message: %v", err) @@ -757,7 +758,7 @@ func recvAndDecompress(p *parser, s *transport.Stream, dc Decompressor, maxRecei return nil, status.Errorf(codes.ResourceExhausted, "grpc: received message after decompression larger than max (%d vs. %d)", size, maxReceiveMessageSize) } } - return d, nil + return buf, nil } // Using compressor, decompress d, returning data and size. @@ -792,15 +793,17 @@ func decompress(compressor encoding.Compressor, d []byte, maxReceiveMessageSize // dc takes precedence over compressor. // TODO(dfawley): wrap the old compressor/decompressor using the new API? func recv(p *parser, c baseCodec, s *transport.Stream, dc Decompressor, m interface{}, maxReceiveMessageSize int, payInfo *payloadInfo, compressor encoding.Compressor) error { - d, err := recvAndDecompress(p, s, dc, maxReceiveMessageSize, payInfo, compressor) + buf, err := recvAndDecompress(p, s, dc, maxReceiveMessageSize, payInfo, compressor) if err != nil { return err } - if err := c.Unmarshal(d, m); err != nil { + if err := c.Unmarshal(buf, m); err != nil { return status.Errorf(codes.Internal, "grpc: failed to unmarshal the received message: %v", err) } if payInfo != nil { - payInfo.uncompressedBytes = d + payInfo.uncompressedBytes = buf + } else { + p.recvBufferPool.Put(&buf) } return nil } diff --git a/vendor/google.golang.org/grpc/server.go b/vendor/google.golang.org/grpc/server.go index 81969e7c15..e076ec7143 100644 --- a/vendor/google.golang.org/grpc/server.go +++ b/vendor/google.golang.org/grpc/server.go @@ -174,6 +174,7 @@ type serverOptions struct { maxHeaderListSize *uint32 headerTableSize *uint32 numServerWorkers uint32 + recvBufferPool SharedBufferPool } var defaultServerOptions = serverOptions{ @@ -182,6 +183,7 @@ var defaultServerOptions = serverOptions{ connectionTimeout: 120 * time.Second, writeBufferSize: defaultWriteBufSize, readBufferSize: defaultReadBufSize, + recvBufferPool: nopBufferPool{}, } var globalServerOptions []ServerOption @@ -552,6 +554,27 @@ func NumStreamWorkers(numServerWorkers uint32) ServerOption { }) } +// RecvBufferPool returns a ServerOption that configures the server +// to use the provided shared buffer pool for parsing incoming messages. Depending +// on the application's workload, this could result in reduced memory allocation. +// +// If you are unsure about how to implement a memory pool but want to utilize one, +// begin with grpc.NewSharedBufferPool. +// +// Note: The shared buffer pool feature will not be active if any of the following +// options are used: StatsHandler, EnableTracing, or binary logging. In such +// cases, the shared buffer pool will be ignored. +// +// # Experimental +// +// Notice: This API is EXPERIMENTAL and may be changed or removed in a +// later release. +func RecvBufferPool(bufferPool SharedBufferPool) ServerOption { + return newFuncServerOption(func(o *serverOptions) { + o.recvBufferPool = bufferPool + }) +} + // serverWorkerResetThreshold defines how often the stack must be reset. Every // N requests, by spawning a new goroutine in its place, a worker can reset its // stack so that large stacks don't live in memory forever. 2^16 should allow @@ -1296,7 +1319,7 @@ func (s *Server) processUnaryRPC(t transport.ServerTransport, stream *transport. if len(shs) != 0 || len(binlogs) != 0 { payInfo = &payloadInfo{} } - d, err := recvAndDecompress(&parser{r: stream}, stream, dc, s.opts.maxReceiveMessageSize, payInfo, decomp) + d, err := recvAndDecompress(&parser{r: stream, recvBufferPool: s.opts.recvBufferPool}, stream, dc, s.opts.maxReceiveMessageSize, payInfo, decomp) if err != nil { if e := t.WriteStatus(stream, status.Convert(err)); e != nil { channelz.Warningf(logger, s.channelzID, "grpc: Server.processUnaryRPC failed to write status: %v", e) @@ -1506,7 +1529,7 @@ func (s *Server) processStreamingRPC(t transport.ServerTransport, stream *transp ctx: ctx, t: t, s: stream, - p: &parser{r: stream}, + p: &parser{r: stream, recvBufferPool: s.opts.recvBufferPool}, codec: s.getCodec(stream.ContentSubtype()), maxReceiveMessageSize: s.opts.maxReceiveMessageSize, maxSendMessageSize: s.opts.maxSendMessageSize, diff --git a/vendor/google.golang.org/grpc/shared_buffer_pool.go b/vendor/google.golang.org/grpc/shared_buffer_pool.go new file mode 100644 index 0000000000..c3a5a9ac1f --- /dev/null +++ b/vendor/google.golang.org/grpc/shared_buffer_pool.go @@ -0,0 +1,154 @@ +/* + * + * Copyright 2023 gRPC authors. + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + */ + +package grpc + +import "sync" + +// SharedBufferPool is a pool of buffers that can be shared, resulting in +// decreased memory allocation. Currently, in gRPC-go, it is only utilized +// for parsing incoming messages. +// +// # Experimental +// +// Notice: This API is EXPERIMENTAL and may be changed or removed in a +// later release. +type SharedBufferPool interface { + // Get returns a buffer with specified length from the pool. + // + // The returned byte slice may be not zero initialized. + Get(length int) []byte + + // Put returns a buffer to the pool. + Put(*[]byte) +} + +// NewSharedBufferPool creates a simple SharedBufferPool with buckets +// of different sizes to optimize memory usage. This prevents the pool from +// wasting large amounts of memory, even when handling messages of varying sizes. +// +// # Experimental +// +// Notice: This API is EXPERIMENTAL and may be changed or removed in a +// later release. +func NewSharedBufferPool() SharedBufferPool { + return &simpleSharedBufferPool{ + pools: [poolArraySize]simpleSharedBufferChildPool{ + newBytesPool(level0PoolMaxSize), + newBytesPool(level1PoolMaxSize), + newBytesPool(level2PoolMaxSize), + newBytesPool(level3PoolMaxSize), + newBytesPool(level4PoolMaxSize), + newBytesPool(0), + }, + } +} + +// simpleSharedBufferPool is a simple implementation of SharedBufferPool. +type simpleSharedBufferPool struct { + pools [poolArraySize]simpleSharedBufferChildPool +} + +func (p *simpleSharedBufferPool) Get(size int) []byte { + return p.pools[p.poolIdx(size)].Get(size) +} + +func (p *simpleSharedBufferPool) Put(bs *[]byte) { + p.pools[p.poolIdx(cap(*bs))].Put(bs) +} + +func (p *simpleSharedBufferPool) poolIdx(size int) int { + switch { + case size <= level0PoolMaxSize: + return level0PoolIdx + case size <= level1PoolMaxSize: + return level1PoolIdx + case size <= level2PoolMaxSize: + return level2PoolIdx + case size <= level3PoolMaxSize: + return level3PoolIdx + case size <= level4PoolMaxSize: + return level4PoolIdx + default: + return levelMaxPoolIdx + } +} + +const ( + level0PoolMaxSize = 16 // 16 B + level1PoolMaxSize = level0PoolMaxSize * 16 // 256 B + level2PoolMaxSize = level1PoolMaxSize * 16 // 4 KB + level3PoolMaxSize = level2PoolMaxSize * 16 // 64 KB + level4PoolMaxSize = level3PoolMaxSize * 16 // 1 MB +) + +const ( + level0PoolIdx = iota + level1PoolIdx + level2PoolIdx + level3PoolIdx + level4PoolIdx + levelMaxPoolIdx + poolArraySize +) + +type simpleSharedBufferChildPool interface { + Get(size int) []byte + Put(interface{}) +} + +type bufferPool struct { + sync.Pool + + defaultSize int +} + +func (p *bufferPool) Get(size int) []byte { + bs := p.Pool.Get().(*[]byte) + + if cap(*bs) < size { + p.Pool.Put(bs) + + return make([]byte, size) + } + + return (*bs)[:size] +} + +func newBytesPool(size int) simpleSharedBufferChildPool { + return &bufferPool{ + Pool: sync.Pool{ + New: func() interface{} { + bs := make([]byte, size) + return &bs + }, + }, + defaultSize: size, + } +} + +// nopBufferPool is a buffer pool just makes new buffer without pooling. +type nopBufferPool struct { +} + +func (nopBufferPool) Get(length int) []byte { + return make([]byte, length) +} + +func (nopBufferPool) Put(*[]byte) { +} diff --git a/vendor/google.golang.org/grpc/stream.go b/vendor/google.golang.org/grpc/stream.go index 10092685b2..de32a75971 100644 --- a/vendor/google.golang.org/grpc/stream.go +++ b/vendor/google.golang.org/grpc/stream.go @@ -507,7 +507,7 @@ func (a *csAttempt) newStream() error { return toRPCErr(nse.Err) } a.s = s - a.p = &parser{r: s} + a.p = &parser{r: s, recvBufferPool: a.cs.cc.dopts.recvBufferPool} return nil } @@ -1270,7 +1270,7 @@ func newNonRetryClientStream(ctx context.Context, desc *StreamDesc, method strin return nil, err } as.s = s - as.p = &parser{r: s} + as.p = &parser{r: s, recvBufferPool: ac.dopts.recvBufferPool} ac.incrCallsStarted() if desc != unaryStreamDesc { // Listen on stream context to cleanup when the stream context is diff --git a/vendor/google.golang.org/grpc/version.go b/vendor/google.golang.org/grpc/version.go index 59b513585a..353cfd5286 100644 --- a/vendor/google.golang.org/grpc/version.go +++ b/vendor/google.golang.org/grpc/version.go @@ -19,4 +19,4 @@ package grpc // Version is the current grpc version. -const Version = "1.56.2" +const Version = "1.57.0" diff --git a/vendor/modules.txt b/vendor/modules.txt index e8c4e43430..586d03b80c 100644 --- a/vendor/modules.txt +++ b/vendor/modules.txt @@ -4,19 +4,19 @@ # 4d63.com/gochecknoglobals v0.2.1 ## explicit; go 1.15 4d63.com/gochecknoglobals/checknoglobals -# cloud.google.com/go v0.110.6 +# cloud.google.com/go v0.110.7 ## explicit; go 1.19 cloud.google.com/go/internal cloud.google.com/go/internal/optional cloud.google.com/go/internal/trace cloud.google.com/go/internal/version -# cloud.google.com/go/compute v1.22.0 +# cloud.google.com/go/compute v1.23.0 ## explicit; go 1.19 cloud.google.com/go/compute/internal # cloud.google.com/go/compute/metadata v0.2.3 ## explicit; go 1.19 cloud.google.com/go/compute/metadata -# cloud.google.com/go/firestore v1.11.0 +# cloud.google.com/go/firestore v1.12.0 ## explicit; go 1.19 cloud.google.com/go/firestore/apiv1 cloud.google.com/go/firestore/apiv1/firestorepb @@ -25,7 +25,7 @@ cloud.google.com/go/firestore/internal ## explicit; go 1.19 cloud.google.com/go/iam cloud.google.com/go/iam/apiv1/iampb -# cloud.google.com/go/kms v1.14.0 +# cloud.google.com/go/kms v1.15.0 ## explicit; go 1.19 cloud.google.com/go/kms/apiv1 cloud.google.com/go/kms/apiv1/kmspb @@ -257,7 +257,7 @@ github.com/ashanbrown/forbidigo/forbidigo # github.com/ashanbrown/makezero v1.1.1 ## explicit; go 1.12 github.com/ashanbrown/makezero/makezero -# github.com/aws/aws-sdk-go v1.44.303 +# github.com/aws/aws-sdk-go v1.44.314 ## explicit; go 1.11 github.com/aws/aws-sdk-go/aws github.com/aws/aws-sdk-go/aws/auth/bearer @@ -305,7 +305,7 @@ github.com/aws/aws-sdk-go/service/sso/ssoiface github.com/aws/aws-sdk-go/service/ssooidc github.com/aws/aws-sdk-go/service/sts github.com/aws/aws-sdk-go/service/sts/stsiface -# github.com/aws/aws-sdk-go-v2 v1.19.0 +# github.com/aws/aws-sdk-go-v2 v1.20.0 ## explicit; go 1.15 github.com/aws/aws-sdk-go-v2 github.com/aws/aws-sdk-go-v2/aws @@ -319,6 +319,8 @@ github.com/aws/aws-sdk-go-v2/aws/retry github.com/aws/aws-sdk-go-v2/aws/signer/internal/v4 github.com/aws/aws-sdk-go-v2/aws/signer/v4 github.com/aws/aws-sdk-go-v2/aws/transport/http +github.com/aws/aws-sdk-go-v2/internal/auth +github.com/aws/aws-sdk-go-v2/internal/endpoints/awsrulesfn github.com/aws/aws-sdk-go-v2/internal/rand github.com/aws/aws-sdk-go-v2/internal/sdk github.com/aws/aws-sdk-go-v2/internal/sdkio @@ -326,10 +328,10 @@ github.com/aws/aws-sdk-go-v2/internal/shareddefaults github.com/aws/aws-sdk-go-v2/internal/strings github.com/aws/aws-sdk-go-v2/internal/sync/singleflight github.com/aws/aws-sdk-go-v2/internal/timeconv -# github.com/aws/aws-sdk-go-v2/config v1.18.28 +# github.com/aws/aws-sdk-go-v2/config v1.18.32 ## explicit; go 1.15 github.com/aws/aws-sdk-go-v2/config -# github.com/aws/aws-sdk-go-v2/credentials v1.13.27 +# github.com/aws/aws-sdk-go-v2/credentials v1.13.31 ## explicit; go 1.15 github.com/aws/aws-sdk-go-v2/credentials github.com/aws/aws-sdk-go-v2/credentials/ec2rolecreds @@ -338,17 +340,17 @@ github.com/aws/aws-sdk-go-v2/credentials/endpointcreds/internal/client github.com/aws/aws-sdk-go-v2/credentials/processcreds github.com/aws/aws-sdk-go-v2/credentials/ssocreds github.com/aws/aws-sdk-go-v2/credentials/stscreds -# github.com/aws/aws-sdk-go-v2/feature/ec2/imds v1.13.5 +# github.com/aws/aws-sdk-go-v2/feature/ec2/imds v1.13.7 ## explicit; go 1.15 github.com/aws/aws-sdk-go-v2/feature/ec2/imds github.com/aws/aws-sdk-go-v2/feature/ec2/imds/internal/config -# github.com/aws/aws-sdk-go-v2/internal/configsources v1.1.35 +# github.com/aws/aws-sdk-go-v2/internal/configsources v1.1.37 ## explicit; go 1.15 github.com/aws/aws-sdk-go-v2/internal/configsources -# github.com/aws/aws-sdk-go-v2/internal/endpoints/v2 v2.4.29 +# github.com/aws/aws-sdk-go-v2/internal/endpoints/v2 v2.4.31 ## explicit; go 1.15 github.com/aws/aws-sdk-go-v2/internal/endpoints/v2 -# github.com/aws/aws-sdk-go-v2/internal/ini v1.3.36 +# github.com/aws/aws-sdk-go-v2/internal/ini v1.3.38 ## explicit; go 1.15 github.com/aws/aws-sdk-go-v2/internal/ini # github.com/aws/aws-sdk-go-v2/service/ecr v1.18.11 @@ -361,30 +363,30 @@ github.com/aws/aws-sdk-go-v2/service/ecr/types github.com/aws/aws-sdk-go-v2/service/ecrpublic github.com/aws/aws-sdk-go-v2/service/ecrpublic/internal/endpoints github.com/aws/aws-sdk-go-v2/service/ecrpublic/types -# github.com/aws/aws-sdk-go-v2/service/internal/presigned-url v1.9.29 +# github.com/aws/aws-sdk-go-v2/service/internal/presigned-url v1.9.31 ## explicit; go 1.15 github.com/aws/aws-sdk-go-v2/service/internal/presigned-url -# github.com/aws/aws-sdk-go-v2/service/kms v1.23.1 +# github.com/aws/aws-sdk-go-v2/service/kms v1.24.1 ## explicit; go 1.15 github.com/aws/aws-sdk-go-v2/service/kms github.com/aws/aws-sdk-go-v2/service/kms/internal/endpoints github.com/aws/aws-sdk-go-v2/service/kms/types -# github.com/aws/aws-sdk-go-v2/service/sso v1.12.13 +# github.com/aws/aws-sdk-go-v2/service/sso v1.13.1 ## explicit; go 1.15 github.com/aws/aws-sdk-go-v2/service/sso github.com/aws/aws-sdk-go-v2/service/sso/internal/endpoints github.com/aws/aws-sdk-go-v2/service/sso/types -# github.com/aws/aws-sdk-go-v2/service/ssooidc v1.14.13 +# github.com/aws/aws-sdk-go-v2/service/ssooidc v1.15.1 ## explicit; go 1.15 github.com/aws/aws-sdk-go-v2/service/ssooidc github.com/aws/aws-sdk-go-v2/service/ssooidc/internal/endpoints github.com/aws/aws-sdk-go-v2/service/ssooidc/types -# github.com/aws/aws-sdk-go-v2/service/sts v1.19.3 +# github.com/aws/aws-sdk-go-v2/service/sts v1.21.1 ## explicit; go 1.15 github.com/aws/aws-sdk-go-v2/service/sts github.com/aws/aws-sdk-go-v2/service/sts/internal/endpoints github.com/aws/aws-sdk-go-v2/service/sts/types -# github.com/aws/smithy-go v1.13.5 +# github.com/aws/smithy-go v1.14.0 ## explicit; go 1.15 github.com/aws/smithy-go github.com/aws/smithy-go/auth/bearer @@ -394,6 +396,7 @@ github.com/aws/smithy-go/encoding github.com/aws/smithy-go/encoding/httpbinding github.com/aws/smithy-go/encoding/json github.com/aws/smithy-go/encoding/xml +github.com/aws/smithy-go/endpoints github.com/aws/smithy-go/internal/sync/singleflight github.com/aws/smithy-go/io github.com/aws/smithy-go/logging @@ -1864,7 +1867,7 @@ github.com/zeebo/errs # gitlab.com/bosi/decorder v0.2.3 ## explicit; go 1.17 gitlab.com/bosi/decorder -# go.mongodb.org/mongo-driver v1.11.7 +# go.mongodb.org/mongo-driver v1.12.0 ## explicit; go 1.13 go.mongodb.org/mongo-driver/bson go.mongodb.org/mongo-driver/bson/bsoncodec @@ -1874,6 +1877,12 @@ go.mongodb.org/mongo-driver/bson/bsontype go.mongodb.org/mongo-driver/bson/primitive go.mongodb.org/mongo-driver/event go.mongodb.org/mongo-driver/internal +go.mongodb.org/mongo-driver/internal/aws +go.mongodb.org/mongo-driver/internal/aws/awserr +go.mongodb.org/mongo-driver/internal/aws/credentials +go.mongodb.org/mongo-driver/internal/aws/signer/v4 +go.mongodb.org/mongo-driver/internal/credproviders +go.mongodb.org/mongo-driver/internal/logger go.mongodb.org/mongo-driver/internal/randutil go.mongodb.org/mongo-driver/internal/randutil/rand go.mongodb.org/mongo-driver/internal/uuid @@ -1886,11 +1895,10 @@ go.mongodb.org/mongo-driver/mongo/readpref go.mongodb.org/mongo-driver/mongo/writeconcern go.mongodb.org/mongo-driver/tag go.mongodb.org/mongo-driver/version -go.mongodb.org/mongo-driver/x/bsonx go.mongodb.org/mongo-driver/x/bsonx/bsoncore go.mongodb.org/mongo-driver/x/mongo/driver go.mongodb.org/mongo-driver/x/mongo/driver/auth -go.mongodb.org/mongo-driver/x/mongo/driver/auth/internal/awsv4 +go.mongodb.org/mongo-driver/x/mongo/driver/auth/creds go.mongodb.org/mongo-driver/x/mongo/driver/auth/internal/gssapi go.mongodb.org/mongo-driver/x/mongo/driver/connstring go.mongodb.org/mongo-driver/x/mongo/driver/dns @@ -1978,7 +1986,7 @@ go.uber.org/zap/internal/exit go.uber.org/zap/internal/ztest go.uber.org/zap/zapcore go.uber.org/zap/zaptest -# gocloud.dev v0.32.0 +# gocloud.dev v0.33.0 ## explicit; go 1.19 gocloud.dev/aws gocloud.dev/docstore @@ -1998,8 +2006,8 @@ gocloud.dev/pubsub gocloud.dev/pubsub/batcher gocloud.dev/pubsub/driver gocloud.dev/pubsub/mempubsub -# gocloud.dev/docstore/mongodocstore v0.30.0 -## explicit; go 1.12 +# gocloud.dev/docstore/mongodocstore v0.33.0 +## explicit; go 1.19 gocloud.dev/docstore/mongodocstore # gocloud.dev/pubsub/kafkapubsub v0.32.0 ## explicit; go 1.19 @@ -2056,7 +2064,7 @@ golang.org/x/mod/modfile golang.org/x/mod/module golang.org/x/mod/semver golang.org/x/mod/sumdb/note -# golang.org/x/net v0.12.0 +# golang.org/x/net v0.13.0 ## explicit; go 1.17 golang.org/x/net/context golang.org/x/net/context/ctxhttp @@ -2193,7 +2201,7 @@ golang.org/x/xerrors/internal # gomodules.xyz/jsonpatch/v2 v2.2.0 ## explicit; go 1.12 gomodules.xyz/jsonpatch/v2 -# google.golang.org/api v0.132.0 +# google.golang.org/api v0.134.0 ## explicit; go 1.19 google.golang.org/api/googleapi google.golang.org/api/googleapi/transport @@ -2228,7 +2236,7 @@ google.golang.org/appengine/internal/socket google.golang.org/appengine/internal/urlfetch google.golang.org/appengine/socket google.golang.org/appengine/urlfetch -# google.golang.org/genproto v0.0.0-20230717213848-3f92550aa753 +# google.golang.org/genproto v0.0.0-20230731193218-e0aa005b6bdf ## explicit; go 1.19 google.golang.org/genproto/googleapis/cloud/location google.golang.org/genproto/googleapis/type/date @@ -2236,17 +2244,17 @@ google.golang.org/genproto/googleapis/type/expr google.golang.org/genproto/googleapis/type/latlng google.golang.org/genproto/internal google.golang.org/genproto/protobuf/field_mask -# google.golang.org/genproto/googleapis/api v0.0.0-20230717213848-3f92550aa753 +# google.golang.org/genproto/googleapis/api v0.0.0-20230731193218-e0aa005b6bdf ## explicit; go 1.19 google.golang.org/genproto/googleapis/api google.golang.org/genproto/googleapis/api/annotations google.golang.org/genproto/googleapis/api/httpbody -# google.golang.org/genproto/googleapis/rpc v0.0.0-20230717213848-3f92550aa753 +# google.golang.org/genproto/googleapis/rpc v0.0.0-20230731193218-e0aa005b6bdf ## explicit; go 1.19 google.golang.org/genproto/googleapis/rpc/code google.golang.org/genproto/googleapis/rpc/errdetails google.golang.org/genproto/googleapis/rpc/status -# google.golang.org/grpc v1.56.2 +# google.golang.org/grpc v1.57.0 ## explicit; go 1.17 google.golang.org/grpc google.golang.org/grpc/attributes